diff --git a/early_access/coi-serviceworker.js b/early_access/coi-serviceworker.js
new file mode 100644
index 000000000000..9901474cc317
--- /dev/null
+++ b/early_access/coi-serviceworker.js
@@ -0,0 +1,146 @@
+/*! coi-serviceworker v0.1.7 - Guido Zuidhof and contributors, licensed under MIT */
+let coepCredentialless = false;
+if (typeof window === 'undefined') {
+ self.addEventListener("install", () => self.skipWaiting());
+ self.addEventListener("activate", (event) => event.waitUntil(self.clients.claim()));
+
+ self.addEventListener("message", (ev) => {
+ if (!ev.data) {
+ return;
+ } else if (ev.data.type === "deregister") {
+ self.registration
+ .unregister()
+ .then(() => {
+ return self.clients.matchAll();
+ })
+ .then(clients => {
+ clients.forEach((client) => client.navigate(client.url));
+ });
+ } else if (ev.data.type === "coepCredentialless") {
+ coepCredentialless = ev.data.value;
+ }
+ });
+
+ self.addEventListener("fetch", function (event) {
+ const r = event.request;
+ if (r.cache === "only-if-cached" && r.mode !== "same-origin") {
+ return;
+ }
+
+ const request = (coepCredentialless && r.mode === "no-cors")
+ ? new Request(r, {
+ credentials: "omit",
+ })
+ : r;
+ event.respondWith(
+ fetch(request)
+ .then((response) => {
+ if (response.status === 0) {
+ return response;
+ }
+
+ const newHeaders = new Headers(response.headers);
+ newHeaders.set("Cross-Origin-Embedder-Policy",
+ coepCredentialless ? "credentialless" : "require-corp"
+ );
+ if (!coepCredentialless) {
+ newHeaders.set("Cross-Origin-Resource-Policy", "cross-origin");
+ }
+ newHeaders.set("Cross-Origin-Opener-Policy", "same-origin");
+
+ return new Response(response.body, {
+ status: response.status,
+ statusText: response.statusText,
+ headers: newHeaders,
+ });
+ })
+ .catch((e) => console.error(e))
+ );
+ });
+
+} else {
+ (() => {
+ const reloadedBySelf = window.sessionStorage.getItem("coiReloadedBySelf");
+ window.sessionStorage.removeItem("coiReloadedBySelf");
+ const coepDegrading = (reloadedBySelf == "coepdegrade");
+
+ // You can customize the behavior of this script through a global `coi` variable.
+ const coi = {
+ shouldRegister: () => !reloadedBySelf,
+ shouldDeregister: () => false,
+ coepCredentialless: () => true,
+ coepDegrade: () => true,
+ doReload: () => window.location.reload(),
+ quiet: false,
+ ...window.coi
+ };
+
+ const n = navigator;
+ const controlling = n.serviceWorker && n.serviceWorker.controller;
+
+ // Record the failure if the page is served by serviceWorker.
+ if (controlling && !window.crossOriginIsolated) {
+ window.sessionStorage.setItem("coiCoepHasFailed", "true");
+ }
+ const coepHasFailed = window.sessionStorage.getItem("coiCoepHasFailed");
+
+ if (controlling) {
+ // Reload only on the first failure.
+ const reloadToDegrade = coi.coepDegrade() && !(
+ coepDegrading || window.crossOriginIsolated
+ );
+ n.serviceWorker.controller.postMessage({
+ type: "coepCredentialless",
+ value: (reloadToDegrade || coepHasFailed && coi.coepDegrade())
+ ? false
+ : coi.coepCredentialless(),
+ });
+ if (reloadToDegrade) {
+ !coi.quiet && console.log("Reloading page to degrade COEP.");
+ window.sessionStorage.setItem("coiReloadedBySelf", "coepdegrade");
+ coi.doReload("coepdegrade");
+ }
+
+ if (coi.shouldDeregister()) {
+ n.serviceWorker.controller.postMessage({ type: "deregister" });
+ }
+ }
+
+ // If we're already coi: do nothing. Perhaps it's due to this script doing its job, or COOP/COEP are
+ // already set from the origin server. Also if the browser has no notion of crossOriginIsolated, just give up here.
+ if (window.crossOriginIsolated !== false || !coi.shouldRegister()) return;
+
+ if (!window.isSecureContext) {
+ !coi.quiet && console.log("COOP/COEP Service Worker not registered, a secure context is required.");
+ return;
+ }
+
+ // In some environments (e.g. Firefox private mode) this won't be available
+ if (!n.serviceWorker) {
+ !coi.quiet && console.error("COOP/COEP Service Worker not registered, perhaps due to private mode.");
+ return;
+ }
+
+ n.serviceWorker.register(window.document.currentScript.src).then(
+ (registration) => {
+ !coi.quiet && console.log("COOP/COEP Service Worker registered", registration.scope);
+
+ registration.addEventListener("updatefound", () => {
+ !coi.quiet && console.log("Reloading page to make use of updated COOP/COEP Service Worker.");
+ window.sessionStorage.setItem("coiReloadedBySelf", "updatefound");
+ coi.doReload();
+ });
+
+ // If the registration is active, but it's not controlling the page
+ if (registration.active && !n.serviceWorker.controller) {
+ !coi.quiet && console.log("Reloading page to make use of COOP/COEP Service Worker.");
+ window.sessionStorage.setItem("coiReloadedBySelf", "notcontrolling");
+ coi.doReload();
+ }
+ },
+ (err) => {
+ !coi.quiet && console.error("COOP/COEP Service Worker failed to register:", err);
+ }
+ );
+ })();
+}
diff --git a/early_access/index.144x144.png b/early_access/index.144x144.png
new file mode 100644
index 000000000000..5e65f72f81ca
Binary files /dev/null and b/early_access/index.144x144.png differ
diff --git a/early_access/index.180x180.png b/early_access/index.180x180.png
new file mode 100644
index 000000000000..87c545ffe8f9
Binary files /dev/null and b/early_access/index.180x180.png differ
diff --git a/early_access/index.512x512.png b/early_access/index.512x512.png
new file mode 100644
index 000000000000..20749934e558
Binary files /dev/null and b/early_access/index.512x512.png differ
diff --git a/early_access/index.apple-touch-icon.png b/early_access/index.apple-touch-icon.png
new file mode 100644
index 000000000000..87c545ffe8f9
Binary files /dev/null and b/early_access/index.apple-touch-icon.png differ
diff --git a/early_access/index.audio.worklet.js b/early_access/index.audio.worklet.js
new file mode 100644
index 000000000000..89b581b3d6fa
--- /dev/null
+++ b/early_access/index.audio.worklet.js
@@ -0,0 +1,213 @@
+/**************************************************************************/
+/* audio.worklet.js */
+/**************************************************************************/
+/* This file is part of: */
+/* GODOT ENGINE */
+/* https://godotengine.org */
+/**************************************************************************/
+/* Copyright (c) 2014-present Godot Engine contributors (see AUTHORS.md). */
+/* Copyright (c) 2007-2014 Juan Linietsky, Ariel Manzur. */
+/* */
+/* Permission is hereby granted, free of charge, to any person obtaining */
+/* a copy of this software and associated documentation files (the */
+/* "Software"), to deal in the Software without restriction, including */
+/* without limitation the rights to use, copy, modify, merge, publish, */
+/* distribute, sublicense, and/or sell copies of the Software, and to */
+/* permit persons to whom the Software is furnished to do so, subject to */
+/* the following conditions: */
+/* */
+/* The above copyright notice and this permission notice shall be */
+/* included in all copies or substantial portions of the Software. */
+/* */
+/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */
+/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */
+/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. */
+/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */
+/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */
+/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */
+/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */
+/**************************************************************************/
+
+class RingBuffer {
+ constructor(p_buffer, p_state, p_threads) {
+ this.buffer = p_buffer;
+ this.avail = p_state;
+ this.threads = p_threads;
+ this.rpos = 0;
+ this.wpos = 0;
+ }
+
+ data_left() {
+ return this.threads ? Atomics.load(this.avail, 0) : this.avail;
+ }
+
+ space_left() {
+ return this.buffer.length - this.data_left();
+ }
+
+ read(output) {
+ const size = this.buffer.length;
+ let from = 0;
+ let to_write = output.length;
+ if (this.rpos + to_write > size) {
+ const high = size - this.rpos;
+ output.set(this.buffer.subarray(this.rpos, size));
+ from = high;
+ to_write -= high;
+ this.rpos = 0;
+ }
+ if (to_write) {
+ output.set(this.buffer.subarray(this.rpos, this.rpos + to_write), from);
+ }
+ this.rpos += to_write;
+ if (this.threads) {
+ Atomics.add(this.avail, 0, -output.length);
+ Atomics.notify(this.avail, 0);
+ } else {
+ this.avail -= output.length;
+ }
+ }
+
+ write(p_buffer) {
+ const to_write = p_buffer.length;
+ const mw = this.buffer.length - this.wpos;
+ if (mw >= to_write) {
+ this.buffer.set(p_buffer, this.wpos);
+ this.wpos += to_write;
+ if (mw === to_write) {
+ this.wpos = 0;
+ }
+ } else {
+ const high = p_buffer.subarray(0, mw);
+ const low = p_buffer.subarray(mw);
+ this.buffer.set(high, this.wpos);
+ this.buffer.set(low);
+ this.wpos = low.length;
+ }
+ if (this.threads) {
+ Atomics.add(this.avail, 0, to_write);
+ Atomics.notify(this.avail, 0);
+ } else {
+ this.avail += to_write;
+ }
+ }
+}
+
+class GodotProcessor extends AudioWorkletProcessor {
+ constructor() {
+ super();
+ this.threads = false;
+ this.running = true;
+ this.lock = null;
+ this.notifier = null;
+ this.output = null;
+ this.output_buffer = new Float32Array();
+ this.input = null;
+ this.input_buffer = new Float32Array();
+ this.port.onmessage = (event) => {
+ const cmd = event.data['cmd'];
+ const data = event.data['data'];
+ this.parse_message(cmd, data);
+ };
+ }
+
+ process_notify() {
+ if (this.notifier) {
+ Atomics.add(this.notifier, 0, 1);
+ Atomics.notify(this.notifier, 0);
+ }
+ }
+
+ parse_message(p_cmd, p_data) {
+ if (p_cmd === 'start' && p_data) {
+ const state = p_data[0];
+ let idx = 0;
+ this.threads = true;
+ this.lock = state.subarray(idx, ++idx);
+ this.notifier = state.subarray(idx, ++idx);
+ const avail_in = state.subarray(idx, ++idx);
+ const avail_out = state.subarray(idx, ++idx);
+ this.input = new RingBuffer(p_data[1], avail_in, true);
+ this.output = new RingBuffer(p_data[2], avail_out, true);
+ } else if (p_cmd === 'stop') {
+ this.running = false;
+ this.output = null;
+ this.input = null;
+ this.lock = null;
+ this.notifier = null;
+ } else if (p_cmd === 'start_nothreads') {
+ this.output = new RingBuffer(p_data[0], p_data[0].length, false);
+ } else if (p_cmd === 'chunk') {
+ this.output.write(p_data);
+ }
+ }
+
+ static array_has_data(arr) {
+ return arr.length && arr[0].length && arr[0][0].length;
+ }
+
+ process(inputs, outputs, parameters) {
+ if (!this.running) {
+ return false; // Stop processing.
+ }
+ if (this.output === null) {
+ return true; // Not ready yet, keep processing.
+ }
+ const process_input = GodotProcessor.array_has_data(inputs);
+ if (process_input) {
+ const input = inputs[0];
+ const chunk = input[0].length * input.length;
+ if (this.input_buffer.length !== chunk) {
+ this.input_buffer = new Float32Array(chunk);
+ }
+ if (!this.threads) {
+ GodotProcessor.write_input(this.input_buffer, input);
+ this.port.postMessage({ 'cmd': 'input', 'data': this.input_buffer });
+ } else if (this.input.space_left() >= chunk) {
+ GodotProcessor.write_input(this.input_buffer, input);
+ this.input.write(this.input_buffer);
+ } else {
+ this.port.postMessage('Input buffer is full! Skipping input frame.');
+ }
+ }
+ const process_output = GodotProcessor.array_has_data(outputs);
+ if (process_output) {
+ const output = outputs[0];
+ const chunk = output[0].length * output.length;
+ if (this.output_buffer.length !== chunk) {
+ this.output_buffer = new Float32Array(chunk);
+ }
+ if (this.output.data_left() >= chunk) {
+ this.output.read(this.output_buffer);
+ GodotProcessor.write_output(output, this.output_buffer);
+ if (!this.threads) {
+ this.port.postMessage({ 'cmd': 'read', 'data': chunk });
+ }
+ } else {
+ this.port.postMessage('Output buffer has not enough frames! Skipping output frame.');
+ }
+ }
+ this.process_notify();
+ return true;
+ }
+
+ static write_output(dest, source) {
+ const channels = dest.length;
+ for (let ch = 0; ch < channels; ch++) {
+ for (let sample = 0; sample < dest[ch].length; sample++) {
+ dest[ch][sample] = source[sample * channels + ch];
+ }
+ }
+ }
+
+ static write_input(dest, source) {
+ const channels = source.length;
+ for (let ch = 0; ch < channels; ch++) {
+ for (let sample = 0; sample < source[ch].length; sample++) {
+ dest[sample * channels + ch] = source[ch][sample];
+ }
+ }
+ }
+}
+
+registerProcessor('godot-processor', GodotProcessor);
diff --git a/early_access/index.html b/early_access/index.html
new file mode 100644
index 000000000000..13af3bff6183
--- /dev/null
+++ b/early_access/index.html
@@ -0,0 +1,250 @@
+
+
+
+
+
+ Pixelorama
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/early_access/index.icon.png b/early_access/index.icon.png
new file mode 100644
index 000000000000..b249a953af19
Binary files /dev/null and b/early_access/index.icon.png differ
diff --git a/early_access/index.js b/early_access/index.js
new file mode 100644
index 000000000000..fad00d18f5f9
--- /dev/null
+++ b/early_access/index.js
@@ -0,0 +1,14477 @@
+
+var Godot = (() => {
+ var _scriptDir = typeof document !== 'undefined' && document.currentScript ? document.currentScript.src : undefined;
+
+ return (
+function(Godot = {}) {
+
+// Support for growable heap + pthreads, where the buffer may change, so JS views
+// must be updated.
+function GROWABLE_HEAP_I8() {
+ if (wasmMemory.buffer != HEAP8.buffer) {
+ updateMemoryViews();
+ }
+ return HEAP8;
+}
+function GROWABLE_HEAP_U8() {
+ if (wasmMemory.buffer != HEAP8.buffer) {
+ updateMemoryViews();
+ }
+ return HEAPU8;
+}
+function GROWABLE_HEAP_I16() {
+ if (wasmMemory.buffer != HEAP8.buffer) {
+ updateMemoryViews();
+ }
+ return HEAP16;
+}
+function GROWABLE_HEAP_U16() {
+ if (wasmMemory.buffer != HEAP8.buffer) {
+ updateMemoryViews();
+ }
+ return HEAPU16;
+}
+function GROWABLE_HEAP_I32() {
+ if (wasmMemory.buffer != HEAP8.buffer) {
+ updateMemoryViews();
+ }
+ return HEAP32;
+}
+function GROWABLE_HEAP_U32() {
+ if (wasmMemory.buffer != HEAP8.buffer) {
+ updateMemoryViews();
+ }
+ return HEAPU32;
+}
+function GROWABLE_HEAP_F32() {
+ if (wasmMemory.buffer != HEAP8.buffer) {
+ updateMemoryViews();
+ }
+ return HEAPF32;
+}
+function GROWABLE_HEAP_F64() {
+ if (wasmMemory.buffer != HEAP8.buffer) {
+ updateMemoryViews();
+ }
+ return HEAPF64;
+}
+
+var Module = typeof Godot != "undefined" ? Godot : {};
+
+var readyPromiseResolve, readyPromiseReject;
+
+Module["ready"] = new Promise((resolve, reject) => {
+ readyPromiseResolve = resolve;
+ readyPromiseReject = reject;
+});
+
+[ "_main", "__emscripten_thread_init", "__emscripten_thread_exit", "__emscripten_thread_crashed", "__emscripten_thread_mailbox_await", "__emscripten_tls_init", "_pthread_self", "checkMailbox", "establishStackSpace", "invokeEntryPoint", "PThread", "__Z14godot_web_mainiPPc", "_fflush", "__emwebxr_on_input_event", "__emwebxr_on_simple_event", "__emscripten_check_mailbox", "onRuntimeInitialized" ].forEach(prop => {
+ if (!Object.getOwnPropertyDescriptor(Module["ready"], prop)) {
+ Object.defineProperty(Module["ready"], prop, {
+ get: () => abort("You are getting " + prop + " on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js"),
+ set: () => abort("You are setting " + prop + " on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js")
+ });
+ }
+});
+
+var moduleOverrides = Object.assign({}, Module);
+
+var arguments_ = [];
+
+var thisProgram = "./this.program";
+
+var quit_ = (status, toThrow) => {
+ throw toThrow;
+};
+
+var ENVIRONMENT_IS_WEB = typeof window == "object";
+
+var ENVIRONMENT_IS_WORKER = typeof importScripts == "function";
+
+var ENVIRONMENT_IS_NODE = typeof process == "object" && typeof process.versions == "object" && typeof process.versions.node == "string";
+
+var ENVIRONMENT_IS_SHELL = !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_NODE && !ENVIRONMENT_IS_WORKER;
+
+if (Module["ENVIRONMENT"]) {
+ throw new Error("Module.ENVIRONMENT has been deprecated. To force the environment, use the ENVIRONMENT compile-time option (for example, -sENVIRONMENT=web or -sENVIRONMENT=node)");
+}
+
+var ENVIRONMENT_IS_PTHREAD = Module["ENVIRONMENT_IS_PTHREAD"] || false;
+
+var scriptDirectory = "";
+
+function locateFile(path) {
+ if (Module["locateFile"]) {
+ return Module["locateFile"](path, scriptDirectory);
+ }
+ return scriptDirectory + path;
+}
+
+var read_, readAsync, readBinary, setWindowTitle;
+
+if (ENVIRONMENT_IS_SHELL) {
+ if (typeof process == "object" && typeof require === "function" || typeof window == "object" || typeof importScripts == "function") throw new Error("not compiled for this environment (did you build to HTML and try to run it not on the web, or set ENVIRONMENT to something - like node - and run it someplace else - like on the web?)");
+ if (typeof read != "undefined") {
+ read_ = f => {
+ return read(f);
+ };
+ }
+ readBinary = f => {
+ let data;
+ if (typeof readbuffer == "function") {
+ return new Uint8Array(readbuffer(f));
+ }
+ data = read(f, "binary");
+ assert(typeof data == "object");
+ return data;
+ };
+ readAsync = (f, onload, onerror) => {
+ setTimeout(() => onload(readBinary(f)), 0);
+ };
+ if (typeof clearTimeout == "undefined") {
+ globalThis.clearTimeout = id => {};
+ }
+ if (typeof scriptArgs != "undefined") {
+ arguments_ = scriptArgs;
+ } else if (typeof arguments != "undefined") {
+ arguments_ = arguments;
+ }
+ if (typeof quit == "function") {
+ quit_ = (status, toThrow) => {
+ setTimeout(() => {
+ if (!(toThrow instanceof ExitStatus)) {
+ let toLog = toThrow;
+ if (toThrow && typeof toThrow == "object" && toThrow.stack) {
+ toLog = [ toThrow, toThrow.stack ];
+ }
+ err(`exiting due to exception: ${toLog}`);
+ }
+ quit(status);
+ });
+ throw toThrow;
+ };
+ }
+ if (typeof print != "undefined") {
+ if (typeof console == "undefined") console = {};
+ console.log = print;
+ console.warn = console.error = typeof printErr != "undefined" ? printErr : print;
+ }
+} else if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) {
+ if (ENVIRONMENT_IS_WORKER) {
+ scriptDirectory = self.location.href;
+ } else if (typeof document != "undefined" && document.currentScript) {
+ scriptDirectory = document.currentScript.src;
+ }
+ if (_scriptDir) {
+ scriptDirectory = _scriptDir;
+ }
+ if (scriptDirectory.indexOf("blob:") !== 0) {
+ scriptDirectory = scriptDirectory.substr(0, scriptDirectory.replace(/[?#].*/, "").lastIndexOf("/") + 1);
+ } else {
+ scriptDirectory = "";
+ }
+ if (!(typeof window == "object" || typeof importScripts == "function")) throw new Error("not compiled for this environment (did you build to HTML and try to run it not on the web, or set ENVIRONMENT to something - like node - and run it someplace else - like on the web?)");
+ {
+ read_ = url => {
+ var xhr = new XMLHttpRequest();
+ xhr.open("GET", url, false);
+ xhr.send(null);
+ return xhr.responseText;
+ };
+ if (ENVIRONMENT_IS_WORKER) {
+ readBinary = url => {
+ var xhr = new XMLHttpRequest();
+ xhr.open("GET", url, false);
+ xhr.responseType = "arraybuffer";
+ xhr.send(null);
+ return new Uint8Array(xhr.response);
+ };
+ }
+ readAsync = (url, onload, onerror) => {
+ var xhr = new XMLHttpRequest();
+ xhr.open("GET", url, true);
+ xhr.responseType = "arraybuffer";
+ xhr.onload = () => {
+ if (xhr.status == 200 || xhr.status == 0 && xhr.response) {
+ onload(xhr.response);
+ return;
+ }
+ onerror();
+ };
+ xhr.onerror = onerror;
+ xhr.send(null);
+ };
+ }
+ setWindowTitle = title => document.title = title;
+} else {
+ throw new Error("environment detection error");
+}
+
+var out = Module["print"] || console.log.bind(console);
+
+var err = Module["printErr"] || console.error.bind(console);
+
+Object.assign(Module, moduleOverrides);
+
+moduleOverrides = null;
+
+checkIncomingModuleAPI();
+
+if (Module["arguments"]) arguments_ = Module["arguments"];
+
+legacyModuleProp("arguments", "arguments_");
+
+if (Module["thisProgram"]) thisProgram = Module["thisProgram"];
+
+legacyModuleProp("thisProgram", "thisProgram");
+
+if (Module["quit"]) quit_ = Module["quit"];
+
+legacyModuleProp("quit", "quit_");
+
+assert(typeof Module["memoryInitializerPrefixURL"] == "undefined", "Module.memoryInitializerPrefixURL option was removed, use Module.locateFile instead");
+
+assert(typeof Module["pthreadMainPrefixURL"] == "undefined", "Module.pthreadMainPrefixURL option was removed, use Module.locateFile instead");
+
+assert(typeof Module["cdInitializerPrefixURL"] == "undefined", "Module.cdInitializerPrefixURL option was removed, use Module.locateFile instead");
+
+assert(typeof Module["filePackagePrefixURL"] == "undefined", "Module.filePackagePrefixURL option was removed, use Module.locateFile instead");
+
+assert(typeof Module["read"] == "undefined", "Module.read option was removed (modify read_ in JS)");
+
+assert(typeof Module["readAsync"] == "undefined", "Module.readAsync option was removed (modify readAsync in JS)");
+
+assert(typeof Module["readBinary"] == "undefined", "Module.readBinary option was removed (modify readBinary in JS)");
+
+assert(typeof Module["setWindowTitle"] == "undefined", "Module.setWindowTitle option was removed (modify setWindowTitle in JS)");
+
+assert(typeof Module["TOTAL_MEMORY"] == "undefined", "Module.TOTAL_MEMORY has been renamed Module.INITIAL_MEMORY");
+
+legacyModuleProp("read", "read_");
+
+legacyModuleProp("readAsync", "readAsync");
+
+legacyModuleProp("readBinary", "readBinary");
+
+legacyModuleProp("setWindowTitle", "setWindowTitle");
+
+var PROXYFS = "PROXYFS is no longer included by default; build with -lproxyfs.js";
+
+var WORKERFS = "WORKERFS is no longer included by default; build with -lworkerfs.js";
+
+var NODEFS = "NODEFS is no longer included by default; build with -lnodefs.js";
+
+assert(ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER || ENVIRONMENT_IS_NODE, "Pthreads do not work in this environment yet (need Web Workers, or an alternative to them)");
+
+assert(!ENVIRONMENT_IS_NODE, "node environment detected but not enabled at build time. Add 'node' to `-sENVIRONMENT` to enable.");
+
+assert(!ENVIRONMENT_IS_SHELL, "shell environment detected but not enabled at build time. Add 'shell' to `-sENVIRONMENT` to enable.");
+
+var wasmBinary;
+
+if (Module["wasmBinary"]) wasmBinary = Module["wasmBinary"];
+
+legacyModuleProp("wasmBinary", "wasmBinary");
+
+var noExitRuntime = Module["noExitRuntime"] || false;
+
+legacyModuleProp("noExitRuntime", "noExitRuntime");
+
+if (typeof WebAssembly != "object") {
+ abort("no native wasm support detected");
+}
+
+var wasmMemory;
+
+var wasmModule;
+
+var ABORT = false;
+
+var EXITSTATUS;
+
+function assert(condition, text) {
+ if (!condition) {
+ abort("Assertion failed" + (text ? ": " + text : ""));
+ }
+}
+
+var HEAP, HEAP8, HEAPU8, HEAP16, HEAPU16, HEAP32, HEAPU32, HEAPF32, HEAPF64;
+
+function updateMemoryViews() {
+ var b = wasmMemory.buffer;
+ Module["HEAP8"] = HEAP8 = new Int8Array(b);
+ Module["HEAP16"] = HEAP16 = new Int16Array(b);
+ Module["HEAP32"] = HEAP32 = new Int32Array(b);
+ Module["HEAPU8"] = HEAPU8 = new Uint8Array(b);
+ Module["HEAPU16"] = HEAPU16 = new Uint16Array(b);
+ Module["HEAPU32"] = HEAPU32 = new Uint32Array(b);
+ Module["HEAPF32"] = HEAPF32 = new Float32Array(b);
+ Module["HEAPF64"] = HEAPF64 = new Float64Array(b);
+}
+
+assert(!Module["STACK_SIZE"], "STACK_SIZE can no longer be set at runtime. Use -sSTACK_SIZE at link time");
+
+assert(typeof Int32Array != "undefined" && typeof Float64Array !== "undefined" && Int32Array.prototype.subarray != undefined && Int32Array.prototype.set != undefined, "JS engine does not provide full typed array support");
+
+var INITIAL_MEMORY = Module["INITIAL_MEMORY"] || 33554432;
+
+legacyModuleProp("INITIAL_MEMORY", "INITIAL_MEMORY");
+
+assert(INITIAL_MEMORY >= 5242880, "INITIAL_MEMORY should be larger than STACK_SIZE, was " + INITIAL_MEMORY + "! (STACK_SIZE=" + 5242880 + ")");
+
+if (ENVIRONMENT_IS_PTHREAD) {
+ wasmMemory = Module["wasmMemory"];
+} else {
+ if (Module["wasmMemory"]) {
+ wasmMemory = Module["wasmMemory"];
+ } else {
+ wasmMemory = new WebAssembly.Memory({
+ "initial": INITIAL_MEMORY / 65536,
+ "maximum": 2147483648 / 65536,
+ "shared": true
+ });
+ if (!(wasmMemory.buffer instanceof SharedArrayBuffer)) {
+ err("requested a shared WebAssembly.Memory but the returned buffer is not a SharedArrayBuffer, indicating that while the browser has SharedArrayBuffer it does not have WebAssembly threads support - you may need to set a flag");
+ if (ENVIRONMENT_IS_NODE) {
+ err("(on node you may need: --experimental-wasm-threads --experimental-wasm-bulk-memory and/or recent version)");
+ }
+ throw Error("bad memory");
+ }
+ }
+}
+
+updateMemoryViews();
+
+INITIAL_MEMORY = wasmMemory.buffer.byteLength;
+
+assert(INITIAL_MEMORY % 65536 === 0);
+
+var wasmTable;
+
+function writeStackCookie() {
+ var max = _emscripten_stack_get_end();
+ assert((max & 3) == 0);
+ if (max == 0) {
+ max += 4;
+ }
+ GROWABLE_HEAP_U32()[max >> 2] = 34821223;
+ GROWABLE_HEAP_U32()[max + 4 >> 2] = 2310721022;
+ GROWABLE_HEAP_U32()[0] = 1668509029;
+}
+
+function checkStackCookie() {
+ if (ABORT) return;
+ var max = _emscripten_stack_get_end();
+ if (max == 0) {
+ max += 4;
+ }
+ var cookie1 = GROWABLE_HEAP_U32()[max >> 2];
+ var cookie2 = GROWABLE_HEAP_U32()[max + 4 >> 2];
+ if (cookie1 != 34821223 || cookie2 != 2310721022) {
+ abort("Stack overflow! Stack cookie has been overwritten at " + ptrToString(max) + ", expected hex dwords 0x89BACDFE and 0x2135467, but received " + ptrToString(cookie2) + " " + ptrToString(cookie1));
+ }
+ if (GROWABLE_HEAP_U32()[0] !== 1668509029) {
+ abort("Runtime error: The application has corrupted its heap memory area (address zero)!");
+ }
+}
+
+(function() {
+ var h16 = new Int16Array(1);
+ var h8 = new Int8Array(h16.buffer);
+ h16[0] = 25459;
+ if (h8[0] !== 115 || h8[1] !== 99) throw "Runtime error: expected the system to be little-endian! (Run with -sSUPPORT_BIG_ENDIAN to bypass)";
+})();
+
+var __ATPRERUN__ = [];
+
+var __ATINIT__ = [];
+
+var __ATMAIN__ = [];
+
+var __ATEXIT__ = [];
+
+var __ATPOSTRUN__ = [];
+
+var runtimeInitialized = false;
+
+var runtimeExited = false;
+
+var runtimeKeepaliveCounter = 0;
+
+function keepRuntimeAlive() {
+ return noExitRuntime || runtimeKeepaliveCounter > 0;
+}
+
+function preRun() {
+ assert(!ENVIRONMENT_IS_PTHREAD);
+ if (Module["preRun"]) {
+ if (typeof Module["preRun"] == "function") Module["preRun"] = [ Module["preRun"] ];
+ while (Module["preRun"].length) {
+ addOnPreRun(Module["preRun"].shift());
+ }
+ }
+ callRuntimeCallbacks(__ATPRERUN__);
+}
+
+function initRuntime() {
+ assert(!runtimeInitialized);
+ runtimeInitialized = true;
+ if (ENVIRONMENT_IS_PTHREAD) return;
+ checkStackCookie();
+ if (!Module["noFSInit"] && !FS.init.initialized) FS.init();
+ FS.ignorePermissions = false;
+ TTY.init();
+ SOCKFS.root = FS.mount(SOCKFS, {}, null);
+ callRuntimeCallbacks(__ATINIT__);
+}
+
+function preMain() {
+ checkStackCookie();
+ if (ENVIRONMENT_IS_PTHREAD) return;
+ callRuntimeCallbacks(__ATMAIN__);
+}
+
+function exitRuntime() {
+ assert(!runtimeExited);
+ checkStackCookie();
+ if (ENVIRONMENT_IS_PTHREAD) return;
+ ___funcs_on_exit();
+ callRuntimeCallbacks(__ATEXIT__);
+ FS.quit();
+ TTY.shutdown();
+ IDBFS.quit();
+ PThread.terminateAllThreads();
+ runtimeExited = true;
+}
+
+function postRun() {
+ checkStackCookie();
+ if (ENVIRONMENT_IS_PTHREAD) return;
+ if (Module["postRun"]) {
+ if (typeof Module["postRun"] == "function") Module["postRun"] = [ Module["postRun"] ];
+ while (Module["postRun"].length) {
+ addOnPostRun(Module["postRun"].shift());
+ }
+ }
+ callRuntimeCallbacks(__ATPOSTRUN__);
+}
+
+function addOnPreRun(cb) {
+ __ATPRERUN__.unshift(cb);
+}
+
+function addOnInit(cb) {
+ __ATINIT__.unshift(cb);
+}
+
+function addOnPreMain(cb) {
+ __ATMAIN__.unshift(cb);
+}
+
+function addOnExit(cb) {
+ __ATEXIT__.unshift(cb);
+}
+
+function addOnPostRun(cb) {
+ __ATPOSTRUN__.unshift(cb);
+}
+
+assert(Math.imul, "This browser does not support Math.imul(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill");
+
+assert(Math.fround, "This browser does not support Math.fround(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill");
+
+assert(Math.clz32, "This browser does not support Math.clz32(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill");
+
+assert(Math.trunc, "This browser does not support Math.trunc(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill");
+
+var runDependencies = 0;
+
+var runDependencyWatcher = null;
+
+var dependenciesFulfilled = null;
+
+var runDependencyTracking = {};
+
+function getUniqueRunDependency(id) {
+ var orig = id;
+ while (1) {
+ if (!runDependencyTracking[id]) return id;
+ id = orig + Math.random();
+ }
+}
+
+function addRunDependency(id) {
+ runDependencies++;
+ if (Module["monitorRunDependencies"]) {
+ Module["monitorRunDependencies"](runDependencies);
+ }
+ if (id) {
+ assert(!runDependencyTracking[id]);
+ runDependencyTracking[id] = 1;
+ if (runDependencyWatcher === null && typeof setInterval != "undefined") {
+ runDependencyWatcher = setInterval(() => {
+ if (ABORT) {
+ clearInterval(runDependencyWatcher);
+ runDependencyWatcher = null;
+ return;
+ }
+ var shown = false;
+ for (var dep in runDependencyTracking) {
+ if (!shown) {
+ shown = true;
+ err("still waiting on run dependencies:");
+ }
+ err("dependency: " + dep);
+ }
+ if (shown) {
+ err("(end of list)");
+ }
+ }, 1e4);
+ }
+ } else {
+ err("warning: run dependency added without ID");
+ }
+}
+
+function removeRunDependency(id) {
+ runDependencies--;
+ if (Module["monitorRunDependencies"]) {
+ Module["monitorRunDependencies"](runDependencies);
+ }
+ if (id) {
+ assert(runDependencyTracking[id]);
+ delete runDependencyTracking[id];
+ } else {
+ err("warning: run dependency removed without ID");
+ }
+ if (runDependencies == 0) {
+ if (runDependencyWatcher !== null) {
+ clearInterval(runDependencyWatcher);
+ runDependencyWatcher = null;
+ }
+ if (dependenciesFulfilled) {
+ var callback = dependenciesFulfilled;
+ dependenciesFulfilled = null;
+ callback();
+ }
+ }
+}
+
+function abort(what) {
+ if (Module["onAbort"]) {
+ Module["onAbort"](what);
+ }
+ what = "Aborted(" + what + ")";
+ err(what);
+ ABORT = true;
+ EXITSTATUS = 1;
+ var e = new WebAssembly.RuntimeError(what);
+ readyPromiseReject(e);
+ throw e;
+}
+
+var dataURIPrefix = "data:application/octet-stream;base64,";
+
+function isDataURI(filename) {
+ return filename.startsWith(dataURIPrefix);
+}
+
+function isFileURI(filename) {
+ return filename.startsWith("file://");
+}
+
+function createExportWrapper(name, fixedasm) {
+ return function() {
+ var displayName = name;
+ var asm = fixedasm;
+ if (!fixedasm) {
+ asm = Module["asm"];
+ }
+ assert(runtimeInitialized, "native function `" + displayName + "` called before runtime initialization");
+ assert(!runtimeExited, "native function `" + displayName + "` called after runtime exit (use NO_EXIT_RUNTIME to keep it alive after main() exits)");
+ if (!asm[name]) {
+ assert(asm[name], "exported native function `" + displayName + "` not found");
+ }
+ return asm[name].apply(null, arguments);
+ };
+}
+
+var wasmBinaryFile;
+
+wasmBinaryFile = "godot.web.template_release.wasm32.wasm";
+
+if (!isDataURI(wasmBinaryFile)) {
+ wasmBinaryFile = locateFile(wasmBinaryFile);
+}
+
+function getBinary(file) {
+ try {
+ if (file == wasmBinaryFile && wasmBinary) {
+ return new Uint8Array(wasmBinary);
+ }
+ if (readBinary) {
+ return readBinary(file);
+ }
+ throw "both async and sync fetching of the wasm failed";
+ } catch (err) {
+ abort(err);
+ }
+}
+
+function getBinaryPromise(binaryFile) {
+ if (!wasmBinary && (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER)) {
+ if (typeof fetch == "function") {
+ return fetch(binaryFile, {
+ credentials: "same-origin"
+ }).then(response => {
+ if (!response["ok"]) {
+ throw "failed to load wasm binary file at '" + binaryFile + "'";
+ }
+ return response["arrayBuffer"]();
+ }).catch(() => getBinary(binaryFile));
+ }
+ }
+ return Promise.resolve().then(() => getBinary(binaryFile));
+}
+
+function instantiateArrayBuffer(binaryFile, imports, receiver) {
+ return getBinaryPromise(binaryFile).then(binary => {
+ return WebAssembly.instantiate(binary, imports);
+ }).then(instance => {
+ return instance;
+ }).then(receiver, reason => {
+ err("failed to asynchronously prepare wasm: " + reason);
+ if (isFileURI(wasmBinaryFile)) {
+ err("warning: Loading from a file URI (" + wasmBinaryFile + ") is not supported in most browsers. See https://emscripten.org/docs/getting_started/FAQ.html#how-do-i-run-a-local-webserver-for-testing-why-does-my-program-stall-in-downloading-or-preparing");
+ }
+ abort(reason);
+ });
+}
+
+function instantiateAsync(binary, binaryFile, imports, callback) {
+ if (!binary && typeof WebAssembly.instantiateStreaming == "function" && !isDataURI(binaryFile) && typeof fetch == "function") {
+ return fetch(binaryFile, {
+ credentials: "same-origin"
+ }).then(response => {
+ var result = WebAssembly.instantiateStreaming(response, imports);
+ return result.then(callback, function(reason) {
+ err("wasm streaming compile failed: " + reason);
+ err("falling back to ArrayBuffer instantiation");
+ return instantiateArrayBuffer(binaryFile, imports, callback);
+ });
+ });
+ } else {
+ return instantiateArrayBuffer(binaryFile, imports, callback);
+ }
+}
+
+function createWasm() {
+ var info = {
+ "env": wasmImports,
+ "wasi_snapshot_preview1": wasmImports
+ };
+ function receiveInstance(instance, module) {
+ var exports = instance.exports;
+ Module["asm"] = exports;
+ registerTLSInit(Module["asm"]["_emscripten_tls_init"]);
+ wasmTable = Module["asm"]["__indirect_function_table"];
+ assert(wasmTable, "table not found in wasm exports");
+ addOnInit(Module["asm"]["__wasm_call_ctors"]);
+ wasmModule = module;
+ PThread.loadWasmModuleToAllWorkers(() => removeRunDependency("wasm-instantiate"));
+ return exports;
+ }
+ addRunDependency("wasm-instantiate");
+ var trueModule = Module;
+ function receiveInstantiationResult(result) {
+ assert(Module === trueModule, "the Module object should not be replaced during async compilation - perhaps the order of HTML elements is wrong?");
+ trueModule = null;
+ receiveInstance(result["instance"], result["module"]);
+ }
+ if (Module["instantiateWasm"]) {
+ try {
+ return Module["instantiateWasm"](info, receiveInstance);
+ } catch (e) {
+ err("Module.instantiateWasm callback failed with error: " + e);
+ readyPromiseReject(e);
+ }
+ }
+ instantiateAsync(wasmBinary, wasmBinaryFile, info, receiveInstantiationResult).catch(readyPromiseReject);
+ return {};
+}
+
+var tempDouble;
+
+var tempI64;
+
+function legacyModuleProp(prop, newName) {
+ if (!Object.getOwnPropertyDescriptor(Module, prop)) {
+ Object.defineProperty(Module, prop, {
+ configurable: true,
+ get: function() {
+ abort("Module." + prop + " has been replaced with plain " + newName + " (the initial value can be provided on Module, but after startup the value is only looked for on a local variable of that name)");
+ }
+ });
+ }
+}
+
+function ignoredModuleProp(prop) {
+ if (Object.getOwnPropertyDescriptor(Module, prop)) {
+ abort("`Module." + prop + "` was supplied but `" + prop + "` not included in INCOMING_MODULE_JS_API");
+ }
+}
+
+function isExportedByForceFilesystem(name) {
+ return name === "FS_createPath" || name === "FS_createDataFile" || name === "FS_createPreloadedFile" || name === "FS_unlink" || name === "addRunDependency" || name === "FS_createLazyFile" || name === "FS_createDevice" || name === "removeRunDependency";
+}
+
+function missingGlobal(sym, msg) {
+ if (typeof globalThis !== "undefined") {
+ Object.defineProperty(globalThis, sym, {
+ configurable: true,
+ get: function() {
+ warnOnce("`" + sym + "` is not longer defined by emscripten. " + msg);
+ return undefined;
+ }
+ });
+ }
+}
+
+missingGlobal("buffer", "Please use HEAP8.buffer or wasmMemory.buffer");
+
+function missingLibrarySymbol(sym) {
+ if (typeof globalThis !== "undefined" && !Object.getOwnPropertyDescriptor(globalThis, sym)) {
+ Object.defineProperty(globalThis, sym, {
+ configurable: true,
+ get: function() {
+ var msg = "`" + sym + "` is a library symbol and not included by default; add it to your library.js __deps or to DEFAULT_LIBRARY_FUNCS_TO_INCLUDE on the command line";
+ var librarySymbol = sym;
+ if (!librarySymbol.startsWith("_")) {
+ librarySymbol = "$" + sym;
+ }
+ msg += " (e.g. -sDEFAULT_LIBRARY_FUNCS_TO_INCLUDE=" + librarySymbol + ")";
+ if (isExportedByForceFilesystem(sym)) {
+ msg += ". Alternatively, forcing filesystem support (-sFORCE_FILESYSTEM) can export this for you";
+ }
+ warnOnce(msg);
+ return undefined;
+ }
+ });
+ }
+ unexportedRuntimeSymbol(sym);
+}
+
+function unexportedRuntimeSymbol(sym) {
+ if (!Object.getOwnPropertyDescriptor(Module, sym)) {
+ Object.defineProperty(Module, sym, {
+ configurable: true,
+ get: function() {
+ var msg = "'" + sym + "' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)";
+ if (isExportedByForceFilesystem(sym)) {
+ msg += ". Alternatively, forcing filesystem support (-sFORCE_FILESYSTEM) can export this for you";
+ }
+ abort(msg);
+ }
+ });
+ }
+}
+
+function dbg(text) {
+ console.warn.apply(console, arguments);
+}
+
+function ExitStatus(status) {
+ this.name = "ExitStatus";
+ this.message = "Program terminated with exit(" + status + ")";
+ this.status = status;
+}
+
+function terminateWorker(worker) {
+ worker.terminate();
+ worker.onmessage = e => {
+ var cmd = e["data"]["cmd"];
+ err('received "' + cmd + '" command from terminated worker: ' + worker.workerID);
+ };
+}
+
+function killThread(pthread_ptr) {
+ assert(!ENVIRONMENT_IS_PTHREAD, "Internal Error! killThread() can only ever be called from main application thread!");
+ assert(pthread_ptr, "Internal Error! Null pthread_ptr in killThread!");
+ var worker = PThread.pthreads[pthread_ptr];
+ delete PThread.pthreads[pthread_ptr];
+ terminateWorker(worker);
+ __emscripten_thread_free_data(pthread_ptr);
+ PThread.runningWorkers.splice(PThread.runningWorkers.indexOf(worker), 1);
+ worker.pthread_ptr = 0;
+}
+
+function cancelThread(pthread_ptr) {
+ assert(!ENVIRONMENT_IS_PTHREAD, "Internal Error! cancelThread() can only ever be called from main application thread!");
+ assert(pthread_ptr, "Internal Error! Null pthread_ptr in cancelThread!");
+ var worker = PThread.pthreads[pthread_ptr];
+ worker.postMessage({
+ "cmd": "cancel"
+ });
+}
+
+function cleanupThread(pthread_ptr) {
+ assert(!ENVIRONMENT_IS_PTHREAD, "Internal Error! cleanupThread() can only ever be called from main application thread!");
+ assert(pthread_ptr, "Internal Error! Null pthread_ptr in cleanupThread!");
+ var worker = PThread.pthreads[pthread_ptr];
+ assert(worker);
+ PThread.returnWorkerToPool(worker);
+}
+
+function zeroMemory(address, size) {
+ GROWABLE_HEAP_U8().fill(0, address, address + size);
+ return address;
+}
+
+function spawnThread(threadParams) {
+ assert(!ENVIRONMENT_IS_PTHREAD, "Internal Error! spawnThread() can only ever be called from main application thread!");
+ assert(threadParams.pthread_ptr, "Internal error, no pthread ptr!");
+ var worker = PThread.getNewWorker();
+ if (!worker) {
+ return 6;
+ }
+ assert(!worker.pthread_ptr, "Internal error!");
+ PThread.runningWorkers.push(worker);
+ PThread.pthreads[threadParams.pthread_ptr] = worker;
+ worker.pthread_ptr = threadParams.pthread_ptr;
+ var msg = {
+ "cmd": "run",
+ "start_routine": threadParams.startRoutine,
+ "arg": threadParams.arg,
+ "pthread_ptr": threadParams.pthread_ptr
+ };
+ worker.postMessage(msg, threadParams.transferList);
+ return 0;
+}
+
+var PATH = {
+ isAbs: path => path.charAt(0) === "/",
+ splitPath: filename => {
+ var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/;
+ return splitPathRe.exec(filename).slice(1);
+ },
+ normalizeArray: (parts, allowAboveRoot) => {
+ var up = 0;
+ for (var i = parts.length - 1; i >= 0; i--) {
+ var last = parts[i];
+ if (last === ".") {
+ parts.splice(i, 1);
+ } else if (last === "..") {
+ parts.splice(i, 1);
+ up++;
+ } else if (up) {
+ parts.splice(i, 1);
+ up--;
+ }
+ }
+ if (allowAboveRoot) {
+ for (;up; up--) {
+ parts.unshift("..");
+ }
+ }
+ return parts;
+ },
+ normalize: path => {
+ var isAbsolute = PATH.isAbs(path), trailingSlash = path.substr(-1) === "/";
+ path = PATH.normalizeArray(path.split("/").filter(p => !!p), !isAbsolute).join("/");
+ if (!path && !isAbsolute) {
+ path = ".";
+ }
+ if (path && trailingSlash) {
+ path += "/";
+ }
+ return (isAbsolute ? "/" : "") + path;
+ },
+ dirname: path => {
+ var result = PATH.splitPath(path), root = result[0], dir = result[1];
+ if (!root && !dir) {
+ return ".";
+ }
+ if (dir) {
+ dir = dir.substr(0, dir.length - 1);
+ }
+ return root + dir;
+ },
+ basename: path => {
+ if (path === "/") return "/";
+ path = PATH.normalize(path);
+ path = path.replace(/\/$/, "");
+ var lastSlash = path.lastIndexOf("/");
+ if (lastSlash === -1) return path;
+ return path.substr(lastSlash + 1);
+ },
+ join: function() {
+ var paths = Array.prototype.slice.call(arguments);
+ return PATH.normalize(paths.join("/"));
+ },
+ join2: (l, r) => {
+ return PATH.normalize(l + "/" + r);
+ }
+};
+
+function initRandomFill() {
+ if (typeof crypto == "object" && typeof crypto["getRandomValues"] == "function") {
+ return view => (view.set(crypto.getRandomValues(new Uint8Array(view.byteLength))),
+ view);
+ } else abort("no cryptographic support found for randomDevice. consider polyfilling it if you want to use something insecure like Math.random(), e.g. put this in a --pre-js: var crypto = { getRandomValues: function(array) { for (var i = 0; i < array.length; i++) array[i] = (Math.random()*256)|0 } };");
+}
+
+function randomFill(view) {
+ return (randomFill = initRandomFill())(view);
+}
+
+var PATH_FS = {
+ resolve: function() {
+ var resolvedPath = "", resolvedAbsolute = false;
+ for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) {
+ var path = i >= 0 ? arguments[i] : FS.cwd();
+ if (typeof path != "string") {
+ throw new TypeError("Arguments to path.resolve must be strings");
+ } else if (!path) {
+ return "";
+ }
+ resolvedPath = path + "/" + resolvedPath;
+ resolvedAbsolute = PATH.isAbs(path);
+ }
+ resolvedPath = PATH.normalizeArray(resolvedPath.split("/").filter(p => !!p), !resolvedAbsolute).join("/");
+ return (resolvedAbsolute ? "/" : "") + resolvedPath || ".";
+ },
+ relative: (from, to) => {
+ from = PATH_FS.resolve(from).substr(1);
+ to = PATH_FS.resolve(to).substr(1);
+ function trim(arr) {
+ var start = 0;
+ for (;start < arr.length; start++) {
+ if (arr[start] !== "") break;
+ }
+ var end = arr.length - 1;
+ for (;end >= 0; end--) {
+ if (arr[end] !== "") break;
+ }
+ if (start > end) return [];
+ return arr.slice(start, end - start + 1);
+ }
+ var fromParts = trim(from.split("/"));
+ var toParts = trim(to.split("/"));
+ var length = Math.min(fromParts.length, toParts.length);
+ var samePartsLength = length;
+ for (var i = 0; i < length; i++) {
+ if (fromParts[i] !== toParts[i]) {
+ samePartsLength = i;
+ break;
+ }
+ }
+ var outputParts = [];
+ for (var i = samePartsLength; i < fromParts.length; i++) {
+ outputParts.push("..");
+ }
+ outputParts = outputParts.concat(toParts.slice(samePartsLength));
+ return outputParts.join("/");
+ }
+};
+
+function lengthBytesUTF8(str) {
+ var len = 0;
+ for (var i = 0; i < str.length; ++i) {
+ var c = str.charCodeAt(i);
+ if (c <= 127) {
+ len++;
+ } else if (c <= 2047) {
+ len += 2;
+ } else if (c >= 55296 && c <= 57343) {
+ len += 4;
+ ++i;
+ } else {
+ len += 3;
+ }
+ }
+ return len;
+}
+
+function stringToUTF8Array(str, heap, outIdx, maxBytesToWrite) {
+ assert(typeof str === "string");
+ if (!(maxBytesToWrite > 0)) return 0;
+ var startIdx = outIdx;
+ var endIdx = outIdx + maxBytesToWrite - 1;
+ for (var i = 0; i < str.length; ++i) {
+ var u = str.charCodeAt(i);
+ if (u >= 55296 && u <= 57343) {
+ var u1 = str.charCodeAt(++i);
+ u = 65536 + ((u & 1023) << 10) | u1 & 1023;
+ }
+ if (u <= 127) {
+ if (outIdx >= endIdx) break;
+ heap[outIdx++] = u;
+ } else if (u <= 2047) {
+ if (outIdx + 1 >= endIdx) break;
+ heap[outIdx++] = 192 | u >> 6;
+ heap[outIdx++] = 128 | u & 63;
+ } else if (u <= 65535) {
+ if (outIdx + 2 >= endIdx) break;
+ heap[outIdx++] = 224 | u >> 12;
+ heap[outIdx++] = 128 | u >> 6 & 63;
+ heap[outIdx++] = 128 | u & 63;
+ } else {
+ if (outIdx + 3 >= endIdx) break;
+ if (u > 1114111) warnOnce("Invalid Unicode code point " + ptrToString(u) + " encountered when serializing a JS string to a UTF-8 string in wasm memory! (Valid unicode code points should be in range 0-0x10FFFF).");
+ heap[outIdx++] = 240 | u >> 18;
+ heap[outIdx++] = 128 | u >> 12 & 63;
+ heap[outIdx++] = 128 | u >> 6 & 63;
+ heap[outIdx++] = 128 | u & 63;
+ }
+ }
+ heap[outIdx] = 0;
+ return outIdx - startIdx;
+}
+
+function intArrayFromString(stringy, dontAddNull, length) {
+ var len = length > 0 ? length : lengthBytesUTF8(stringy) + 1;
+ var u8array = new Array(len);
+ var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length);
+ if (dontAddNull) u8array.length = numBytesWritten;
+ return u8array;
+}
+
+var UTF8Decoder = typeof TextDecoder != "undefined" ? new TextDecoder("utf8") : undefined;
+
+function UTF8ArrayToString(heapOrArray, idx, maxBytesToRead) {
+ var endIdx = idx + maxBytesToRead;
+ var endPtr = idx;
+ while (heapOrArray[endPtr] && !(endPtr >= endIdx)) ++endPtr;
+ if (endPtr - idx > 16 && heapOrArray.buffer && UTF8Decoder) {
+ return UTF8Decoder.decode(heapOrArray.buffer instanceof SharedArrayBuffer ? heapOrArray.slice(idx, endPtr) : heapOrArray.subarray(idx, endPtr));
+ }
+ var str = "";
+ while (idx < endPtr) {
+ var u0 = heapOrArray[idx++];
+ if (!(u0 & 128)) {
+ str += String.fromCharCode(u0);
+ continue;
+ }
+ var u1 = heapOrArray[idx++] & 63;
+ if ((u0 & 224) == 192) {
+ str += String.fromCharCode((u0 & 31) << 6 | u1);
+ continue;
+ }
+ var u2 = heapOrArray[idx++] & 63;
+ if ((u0 & 240) == 224) {
+ u0 = (u0 & 15) << 12 | u1 << 6 | u2;
+ } else {
+ if ((u0 & 248) != 240) warnOnce("Invalid UTF-8 leading byte " + ptrToString(u0) + " encountered when deserializing a UTF-8 string in wasm memory to a JS string!");
+ u0 = (u0 & 7) << 18 | u1 << 12 | u2 << 6 | heapOrArray[idx++] & 63;
+ }
+ if (u0 < 65536) {
+ str += String.fromCharCode(u0);
+ } else {
+ var ch = u0 - 65536;
+ str += String.fromCharCode(55296 | ch >> 10, 56320 | ch & 1023);
+ }
+ }
+ return str;
+}
+
+var TTY = {
+ ttys: [],
+ init: function() {},
+ shutdown: function() {},
+ register: function(dev, ops) {
+ TTY.ttys[dev] = {
+ input: [],
+ output: [],
+ ops: ops
+ };
+ FS.registerDevice(dev, TTY.stream_ops);
+ },
+ stream_ops: {
+ open: function(stream) {
+ var tty = TTY.ttys[stream.node.rdev];
+ if (!tty) {
+ throw new FS.ErrnoError(43);
+ }
+ stream.tty = tty;
+ stream.seekable = false;
+ },
+ close: function(stream) {
+ stream.tty.ops.fsync(stream.tty);
+ },
+ fsync: function(stream) {
+ stream.tty.ops.fsync(stream.tty);
+ },
+ read: function(stream, buffer, offset, length, pos) {
+ if (!stream.tty || !stream.tty.ops.get_char) {
+ throw new FS.ErrnoError(60);
+ }
+ var bytesRead = 0;
+ for (var i = 0; i < length; i++) {
+ var result;
+ try {
+ result = stream.tty.ops.get_char(stream.tty);
+ } catch (e) {
+ throw new FS.ErrnoError(29);
+ }
+ if (result === undefined && bytesRead === 0) {
+ throw new FS.ErrnoError(6);
+ }
+ if (result === null || result === undefined) break;
+ bytesRead++;
+ buffer[offset + i] = result;
+ }
+ if (bytesRead) {
+ stream.node.timestamp = Date.now();
+ }
+ return bytesRead;
+ },
+ write: function(stream, buffer, offset, length, pos) {
+ if (!stream.tty || !stream.tty.ops.put_char) {
+ throw new FS.ErrnoError(60);
+ }
+ try {
+ for (var i = 0; i < length; i++) {
+ stream.tty.ops.put_char(stream.tty, buffer[offset + i]);
+ }
+ } catch (e) {
+ throw new FS.ErrnoError(29);
+ }
+ if (length) {
+ stream.node.timestamp = Date.now();
+ }
+ return i;
+ }
+ },
+ default_tty_ops: {
+ get_char: function(tty) {
+ if (!tty.input.length) {
+ var result = null;
+ if (typeof window != "undefined" && typeof window.prompt == "function") {
+ result = window.prompt("Input: ");
+ if (result !== null) {
+ result += "\n";
+ }
+ } else if (typeof readline == "function") {
+ result = readline();
+ if (result !== null) {
+ result += "\n";
+ }
+ }
+ if (!result) {
+ return null;
+ }
+ tty.input = intArrayFromString(result, true);
+ }
+ return tty.input.shift();
+ },
+ put_char: function(tty, val) {
+ if (val === null || val === 10) {
+ out(UTF8ArrayToString(tty.output, 0));
+ tty.output = [];
+ } else {
+ if (val != 0) tty.output.push(val);
+ }
+ },
+ fsync: function(tty) {
+ if (tty.output && tty.output.length > 0) {
+ out(UTF8ArrayToString(tty.output, 0));
+ tty.output = [];
+ }
+ }
+ },
+ default_tty1_ops: {
+ put_char: function(tty, val) {
+ if (val === null || val === 10) {
+ err(UTF8ArrayToString(tty.output, 0));
+ tty.output = [];
+ } else {
+ if (val != 0) tty.output.push(val);
+ }
+ },
+ fsync: function(tty) {
+ if (tty.output && tty.output.length > 0) {
+ err(UTF8ArrayToString(tty.output, 0));
+ tty.output = [];
+ }
+ }
+ }
+};
+
+function alignMemory(size, alignment) {
+ assert(alignment, "alignment argument is required");
+ return Math.ceil(size / alignment) * alignment;
+}
+
+function mmapAlloc(size) {
+ abort("internal error: mmapAlloc called but `emscripten_builtin_memalign` native symbol not exported");
+}
+
+var MEMFS = {
+ ops_table: null,
+ mount: function(mount) {
+ return MEMFS.createNode(null, "/", 16384 | 511, 0);
+ },
+ createNode: function(parent, name, mode, dev) {
+ if (FS.isBlkdev(mode) || FS.isFIFO(mode)) {
+ throw new FS.ErrnoError(63);
+ }
+ if (!MEMFS.ops_table) {
+ MEMFS.ops_table = {
+ dir: {
+ node: {
+ getattr: MEMFS.node_ops.getattr,
+ setattr: MEMFS.node_ops.setattr,
+ lookup: MEMFS.node_ops.lookup,
+ mknod: MEMFS.node_ops.mknod,
+ rename: MEMFS.node_ops.rename,
+ unlink: MEMFS.node_ops.unlink,
+ rmdir: MEMFS.node_ops.rmdir,
+ readdir: MEMFS.node_ops.readdir,
+ symlink: MEMFS.node_ops.symlink
+ },
+ stream: {
+ llseek: MEMFS.stream_ops.llseek
+ }
+ },
+ file: {
+ node: {
+ getattr: MEMFS.node_ops.getattr,
+ setattr: MEMFS.node_ops.setattr
+ },
+ stream: {
+ llseek: MEMFS.stream_ops.llseek,
+ read: MEMFS.stream_ops.read,
+ write: MEMFS.stream_ops.write,
+ allocate: MEMFS.stream_ops.allocate,
+ mmap: MEMFS.stream_ops.mmap,
+ msync: MEMFS.stream_ops.msync
+ }
+ },
+ link: {
+ node: {
+ getattr: MEMFS.node_ops.getattr,
+ setattr: MEMFS.node_ops.setattr,
+ readlink: MEMFS.node_ops.readlink
+ },
+ stream: {}
+ },
+ chrdev: {
+ node: {
+ getattr: MEMFS.node_ops.getattr,
+ setattr: MEMFS.node_ops.setattr
+ },
+ stream: FS.chrdev_stream_ops
+ }
+ };
+ }
+ var node = FS.createNode(parent, name, mode, dev);
+ if (FS.isDir(node.mode)) {
+ node.node_ops = MEMFS.ops_table.dir.node;
+ node.stream_ops = MEMFS.ops_table.dir.stream;
+ node.contents = {};
+ } else if (FS.isFile(node.mode)) {
+ node.node_ops = MEMFS.ops_table.file.node;
+ node.stream_ops = MEMFS.ops_table.file.stream;
+ node.usedBytes = 0;
+ node.contents = null;
+ } else if (FS.isLink(node.mode)) {
+ node.node_ops = MEMFS.ops_table.link.node;
+ node.stream_ops = MEMFS.ops_table.link.stream;
+ } else if (FS.isChrdev(node.mode)) {
+ node.node_ops = MEMFS.ops_table.chrdev.node;
+ node.stream_ops = MEMFS.ops_table.chrdev.stream;
+ }
+ node.timestamp = Date.now();
+ if (parent) {
+ parent.contents[name] = node;
+ parent.timestamp = node.timestamp;
+ }
+ return node;
+ },
+ getFileDataAsTypedArray: function(node) {
+ if (!node.contents) return new Uint8Array(0);
+ if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes);
+ return new Uint8Array(node.contents);
+ },
+ expandFileStorage: function(node, newCapacity) {
+ var prevCapacity = node.contents ? node.contents.length : 0;
+ if (prevCapacity >= newCapacity) return;
+ var CAPACITY_DOUBLING_MAX = 1024 * 1024;
+ newCapacity = Math.max(newCapacity, prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2 : 1.125) >>> 0);
+ if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256);
+ var oldContents = node.contents;
+ node.contents = new Uint8Array(newCapacity);
+ if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0);
+ },
+ resizeFileStorage: function(node, newSize) {
+ if (node.usedBytes == newSize) return;
+ if (newSize == 0) {
+ node.contents = null;
+ node.usedBytes = 0;
+ } else {
+ var oldContents = node.contents;
+ node.contents = new Uint8Array(newSize);
+ if (oldContents) {
+ node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes)));
+ }
+ node.usedBytes = newSize;
+ }
+ },
+ node_ops: {
+ getattr: function(node) {
+ var attr = {};
+ attr.dev = FS.isChrdev(node.mode) ? node.id : 1;
+ attr.ino = node.id;
+ attr.mode = node.mode;
+ attr.nlink = 1;
+ attr.uid = 0;
+ attr.gid = 0;
+ attr.rdev = node.rdev;
+ if (FS.isDir(node.mode)) {
+ attr.size = 4096;
+ } else if (FS.isFile(node.mode)) {
+ attr.size = node.usedBytes;
+ } else if (FS.isLink(node.mode)) {
+ attr.size = node.link.length;
+ } else {
+ attr.size = 0;
+ }
+ attr.atime = new Date(node.timestamp);
+ attr.mtime = new Date(node.timestamp);
+ attr.ctime = new Date(node.timestamp);
+ attr.blksize = 4096;
+ attr.blocks = Math.ceil(attr.size / attr.blksize);
+ return attr;
+ },
+ setattr: function(node, attr) {
+ if (attr.mode !== undefined) {
+ node.mode = attr.mode;
+ }
+ if (attr.timestamp !== undefined) {
+ node.timestamp = attr.timestamp;
+ }
+ if (attr.size !== undefined) {
+ MEMFS.resizeFileStorage(node, attr.size);
+ }
+ },
+ lookup: function(parent, name) {
+ throw FS.genericErrors[44];
+ },
+ mknod: function(parent, name, mode, dev) {
+ return MEMFS.createNode(parent, name, mode, dev);
+ },
+ rename: function(old_node, new_dir, new_name) {
+ if (FS.isDir(old_node.mode)) {
+ var new_node;
+ try {
+ new_node = FS.lookupNode(new_dir, new_name);
+ } catch (e) {}
+ if (new_node) {
+ for (var i in new_node.contents) {
+ throw new FS.ErrnoError(55);
+ }
+ }
+ }
+ delete old_node.parent.contents[old_node.name];
+ old_node.parent.timestamp = Date.now();
+ old_node.name = new_name;
+ new_dir.contents[new_name] = old_node;
+ new_dir.timestamp = old_node.parent.timestamp;
+ old_node.parent = new_dir;
+ },
+ unlink: function(parent, name) {
+ delete parent.contents[name];
+ parent.timestamp = Date.now();
+ },
+ rmdir: function(parent, name) {
+ var node = FS.lookupNode(parent, name);
+ for (var i in node.contents) {
+ throw new FS.ErrnoError(55);
+ }
+ delete parent.contents[name];
+ parent.timestamp = Date.now();
+ },
+ readdir: function(node) {
+ var entries = [ ".", ".." ];
+ for (var key in node.contents) {
+ if (!node.contents.hasOwnProperty(key)) {
+ continue;
+ }
+ entries.push(key);
+ }
+ return entries;
+ },
+ symlink: function(parent, newname, oldpath) {
+ var node = MEMFS.createNode(parent, newname, 511 | 40960, 0);
+ node.link = oldpath;
+ return node;
+ },
+ readlink: function(node) {
+ if (!FS.isLink(node.mode)) {
+ throw new FS.ErrnoError(28);
+ }
+ return node.link;
+ }
+ },
+ stream_ops: {
+ read: function(stream, buffer, offset, length, position) {
+ var contents = stream.node.contents;
+ if (position >= stream.node.usedBytes) return 0;
+ var size = Math.min(stream.node.usedBytes - position, length);
+ assert(size >= 0);
+ if (size > 8 && contents.subarray) {
+ buffer.set(contents.subarray(position, position + size), offset);
+ } else {
+ for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i];
+ }
+ return size;
+ },
+ write: function(stream, buffer, offset, length, position, canOwn) {
+ assert(!(buffer instanceof ArrayBuffer));
+ if (buffer.buffer === GROWABLE_HEAP_I8().buffer) {
+ canOwn = false;
+ }
+ if (!length) return 0;
+ var node = stream.node;
+ node.timestamp = Date.now();
+ if (buffer.subarray && (!node.contents || node.contents.subarray)) {
+ if (canOwn) {
+ assert(position === 0, "canOwn must imply no weird position inside the file");
+ node.contents = buffer.subarray(offset, offset + length);
+ node.usedBytes = length;
+ return length;
+ } else if (node.usedBytes === 0 && position === 0) {
+ node.contents = buffer.slice(offset, offset + length);
+ node.usedBytes = length;
+ return length;
+ } else if (position + length <= node.usedBytes) {
+ node.contents.set(buffer.subarray(offset, offset + length), position);
+ return length;
+ }
+ }
+ MEMFS.expandFileStorage(node, position + length);
+ if (node.contents.subarray && buffer.subarray) {
+ node.contents.set(buffer.subarray(offset, offset + length), position);
+ } else {
+ for (var i = 0; i < length; i++) {
+ node.contents[position + i] = buffer[offset + i];
+ }
+ }
+ node.usedBytes = Math.max(node.usedBytes, position + length);
+ return length;
+ },
+ llseek: function(stream, offset, whence) {
+ var position = offset;
+ if (whence === 1) {
+ position += stream.position;
+ } else if (whence === 2) {
+ if (FS.isFile(stream.node.mode)) {
+ position += stream.node.usedBytes;
+ }
+ }
+ if (position < 0) {
+ throw new FS.ErrnoError(28);
+ }
+ return position;
+ },
+ allocate: function(stream, offset, length) {
+ MEMFS.expandFileStorage(stream.node, offset + length);
+ stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length);
+ },
+ mmap: function(stream, length, position, prot, flags) {
+ if (!FS.isFile(stream.node.mode)) {
+ throw new FS.ErrnoError(43);
+ }
+ var ptr;
+ var allocated;
+ var contents = stream.node.contents;
+ if (!(flags & 2) && contents.buffer === GROWABLE_HEAP_I8().buffer) {
+ allocated = false;
+ ptr = contents.byteOffset;
+ } else {
+ if (position > 0 || position + length < contents.length) {
+ if (contents.subarray) {
+ contents = contents.subarray(position, position + length);
+ } else {
+ contents = Array.prototype.slice.call(contents, position, position + length);
+ }
+ }
+ allocated = true;
+ ptr = mmapAlloc(length);
+ if (!ptr) {
+ throw new FS.ErrnoError(48);
+ }
+ GROWABLE_HEAP_I8().set(contents, ptr);
+ }
+ return {
+ ptr: ptr,
+ allocated: allocated
+ };
+ },
+ msync: function(stream, buffer, offset, length, mmapFlags) {
+ MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false);
+ return 0;
+ }
+ }
+};
+
+function asyncLoad(url, onload, onerror, noRunDep) {
+ var dep = !noRunDep ? getUniqueRunDependency(`al ${url}`) : "";
+ readAsync(url, arrayBuffer => {
+ assert(arrayBuffer, `Loading data file "${url}" failed (no arrayBuffer).`);
+ onload(new Uint8Array(arrayBuffer));
+ if (dep) removeRunDependency(dep);
+ }, event => {
+ if (onerror) {
+ onerror();
+ } else {
+ throw `Loading data file "${url}" failed.`;
+ }
+ });
+ if (dep) addRunDependency(dep);
+}
+
+var preloadPlugins = Module["preloadPlugins"] || [];
+
+function FS_handledByPreloadPlugin(byteArray, fullname, finish, onerror) {
+ if (typeof Browser != "undefined") Browser.init();
+ var handled = false;
+ preloadPlugins.forEach(function(plugin) {
+ if (handled) return;
+ if (plugin["canHandle"](fullname)) {
+ plugin["handle"](byteArray, fullname, finish, onerror);
+ handled = true;
+ }
+ });
+ return handled;
+}
+
+function FS_createPreloadedFile(parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) {
+ var fullname = name ? PATH_FS.resolve(PATH.join2(parent, name)) : parent;
+ var dep = getUniqueRunDependency(`cp ${fullname}`);
+ function processData(byteArray) {
+ function finish(byteArray) {
+ if (preFinish) preFinish();
+ if (!dontCreateFile) {
+ FS.createDataFile(parent, name, byteArray, canRead, canWrite, canOwn);
+ }
+ if (onload) onload();
+ removeRunDependency(dep);
+ }
+ if (FS_handledByPreloadPlugin(byteArray, fullname, finish, () => {
+ if (onerror) onerror();
+ removeRunDependency(dep);
+ })) {
+ return;
+ }
+ finish(byteArray);
+ }
+ addRunDependency(dep);
+ if (typeof url == "string") {
+ asyncLoad(url, byteArray => processData(byteArray), onerror);
+ } else {
+ processData(url);
+ }
+}
+
+function FS_modeStringToFlags(str) {
+ var flagModes = {
+ "r": 0,
+ "r+": 2,
+ "w": 512 | 64 | 1,
+ "w+": 512 | 64 | 2,
+ "a": 1024 | 64 | 1,
+ "a+": 1024 | 64 | 2
+ };
+ var flags = flagModes[str];
+ if (typeof flags == "undefined") {
+ throw new Error(`Unknown file open mode: ${str}`);
+ }
+ return flags;
+}
+
+function FS_getMode(canRead, canWrite) {
+ var mode = 0;
+ if (canRead) mode |= 292 | 73;
+ if (canWrite) mode |= 146;
+ return mode;
+}
+
+var IDBFS = {
+ dbs: {},
+ indexedDB: () => {
+ if (typeof indexedDB != "undefined") return indexedDB;
+ var ret = null;
+ if (typeof window == "object") ret = window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB;
+ assert(ret, "IDBFS used, but indexedDB not supported");
+ return ret;
+ },
+ DB_VERSION: 21,
+ DB_STORE_NAME: "FILE_DATA",
+ mount: function(mount) {
+ return MEMFS.mount.apply(null, arguments);
+ },
+ syncfs: (mount, populate, callback) => {
+ IDBFS.getLocalSet(mount, (err, local) => {
+ if (err) return callback(err);
+ IDBFS.getRemoteSet(mount, (err, remote) => {
+ if (err) return callback(err);
+ var src = populate ? remote : local;
+ var dst = populate ? local : remote;
+ IDBFS.reconcile(src, dst, callback);
+ });
+ });
+ },
+ quit: () => {
+ Object.values(IDBFS.dbs).forEach(value => value.close());
+ IDBFS.dbs = {};
+ },
+ getDB: (name, callback) => {
+ var db = IDBFS.dbs[name];
+ if (db) {
+ return callback(null, db);
+ }
+ var req;
+ try {
+ req = IDBFS.indexedDB().open(name, IDBFS.DB_VERSION);
+ } catch (e) {
+ return callback(e);
+ }
+ if (!req) {
+ return callback("Unable to connect to IndexedDB");
+ }
+ req.onupgradeneeded = e => {
+ var db = e.target.result;
+ var transaction = e.target.transaction;
+ var fileStore;
+ if (db.objectStoreNames.contains(IDBFS.DB_STORE_NAME)) {
+ fileStore = transaction.objectStore(IDBFS.DB_STORE_NAME);
+ } else {
+ fileStore = db.createObjectStore(IDBFS.DB_STORE_NAME);
+ }
+ if (!fileStore.indexNames.contains("timestamp")) {
+ fileStore.createIndex("timestamp", "timestamp", {
+ unique: false
+ });
+ }
+ };
+ req.onsuccess = () => {
+ db = req.result;
+ IDBFS.dbs[name] = db;
+ callback(null, db);
+ };
+ req.onerror = e => {
+ callback(this.error);
+ e.preventDefault();
+ };
+ },
+ getLocalSet: (mount, callback) => {
+ var entries = {};
+ function isRealDir(p) {
+ return p !== "." && p !== "..";
+ }
+ function toAbsolute(root) {
+ return p => {
+ return PATH.join2(root, p);
+ };
+ }
+ var check = FS.readdir(mount.mountpoint).filter(isRealDir).map(toAbsolute(mount.mountpoint));
+ while (check.length) {
+ var path = check.pop();
+ var stat;
+ try {
+ stat = FS.stat(path);
+ } catch (e) {
+ return callback(e);
+ }
+ if (FS.isDir(stat.mode)) {
+ check.push.apply(check, FS.readdir(path).filter(isRealDir).map(toAbsolute(path)));
+ }
+ entries[path] = {
+ "timestamp": stat.mtime
+ };
+ }
+ return callback(null, {
+ type: "local",
+ entries: entries
+ });
+ },
+ getRemoteSet: (mount, callback) => {
+ var entries = {};
+ IDBFS.getDB(mount.mountpoint, (err, db) => {
+ if (err) return callback(err);
+ try {
+ var transaction = db.transaction([ IDBFS.DB_STORE_NAME ], "readonly");
+ transaction.onerror = e => {
+ callback(this.error);
+ e.preventDefault();
+ };
+ var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
+ var index = store.index("timestamp");
+ index.openKeyCursor().onsuccess = event => {
+ var cursor = event.target.result;
+ if (!cursor) {
+ return callback(null, {
+ type: "remote",
+ db: db,
+ entries: entries
+ });
+ }
+ entries[cursor.primaryKey] = {
+ "timestamp": cursor.key
+ };
+ cursor.continue();
+ };
+ } catch (e) {
+ return callback(e);
+ }
+ });
+ },
+ loadLocalEntry: (path, callback) => {
+ var stat, node;
+ try {
+ var lookup = FS.lookupPath(path);
+ node = lookup.node;
+ stat = FS.stat(path);
+ } catch (e) {
+ return callback(e);
+ }
+ if (FS.isDir(stat.mode)) {
+ return callback(null, {
+ "timestamp": stat.mtime,
+ "mode": stat.mode
+ });
+ } else if (FS.isFile(stat.mode)) {
+ node.contents = MEMFS.getFileDataAsTypedArray(node);
+ return callback(null, {
+ "timestamp": stat.mtime,
+ "mode": stat.mode,
+ "contents": node.contents
+ });
+ } else {
+ return callback(new Error("node type not supported"));
+ }
+ },
+ storeLocalEntry: (path, entry, callback) => {
+ try {
+ if (FS.isDir(entry["mode"])) {
+ FS.mkdirTree(path, entry["mode"]);
+ } else if (FS.isFile(entry["mode"])) {
+ FS.writeFile(path, entry["contents"], {
+ canOwn: true
+ });
+ } else {
+ return callback(new Error("node type not supported"));
+ }
+ FS.chmod(path, entry["mode"]);
+ FS.utime(path, entry["timestamp"], entry["timestamp"]);
+ } catch (e) {
+ return callback(e);
+ }
+ callback(null);
+ },
+ removeLocalEntry: (path, callback) => {
+ try {
+ var stat = FS.stat(path);
+ if (FS.isDir(stat.mode)) {
+ FS.rmdir(path);
+ } else if (FS.isFile(stat.mode)) {
+ FS.unlink(path);
+ }
+ } catch (e) {
+ return callback(e);
+ }
+ callback(null);
+ },
+ loadRemoteEntry: (store, path, callback) => {
+ var req = store.get(path);
+ req.onsuccess = event => {
+ callback(null, event.target.result);
+ };
+ req.onerror = e => {
+ callback(this.error);
+ e.preventDefault();
+ };
+ },
+ storeRemoteEntry: (store, path, entry, callback) => {
+ try {
+ var req = store.put(entry, path);
+ } catch (e) {
+ callback(e);
+ return;
+ }
+ req.onsuccess = () => {
+ callback(null);
+ };
+ req.onerror = e => {
+ callback(this.error);
+ e.preventDefault();
+ };
+ },
+ removeRemoteEntry: (store, path, callback) => {
+ var req = store.delete(path);
+ req.onsuccess = () => {
+ callback(null);
+ };
+ req.onerror = e => {
+ callback(this.error);
+ e.preventDefault();
+ };
+ },
+ reconcile: (src, dst, callback) => {
+ var total = 0;
+ var create = [];
+ Object.keys(src.entries).forEach(function(key) {
+ var e = src.entries[key];
+ var e2 = dst.entries[key];
+ if (!e2 || e["timestamp"].getTime() != e2["timestamp"].getTime()) {
+ create.push(key);
+ total++;
+ }
+ });
+ var remove = [];
+ Object.keys(dst.entries).forEach(function(key) {
+ if (!src.entries[key]) {
+ remove.push(key);
+ total++;
+ }
+ });
+ if (!total) {
+ return callback(null);
+ }
+ var errored = false;
+ var db = src.type === "remote" ? src.db : dst.db;
+ var transaction = db.transaction([ IDBFS.DB_STORE_NAME ], "readwrite");
+ var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
+ function done(err) {
+ if (err && !errored) {
+ errored = true;
+ return callback(err);
+ }
+ }
+ transaction.onerror = e => {
+ done(this.error);
+ e.preventDefault();
+ };
+ transaction.oncomplete = e => {
+ if (!errored) {
+ callback(null);
+ }
+ };
+ create.sort().forEach(path => {
+ if (dst.type === "local") {
+ IDBFS.loadRemoteEntry(store, path, (err, entry) => {
+ if (err) return done(err);
+ IDBFS.storeLocalEntry(path, entry, done);
+ });
+ } else {
+ IDBFS.loadLocalEntry(path, (err, entry) => {
+ if (err) return done(err);
+ IDBFS.storeRemoteEntry(store, path, entry, done);
+ });
+ }
+ });
+ remove.sort().reverse().forEach(path => {
+ if (dst.type === "local") {
+ IDBFS.removeLocalEntry(path, done);
+ } else {
+ IDBFS.removeRemoteEntry(store, path, done);
+ }
+ });
+ }
+};
+
+var ERRNO_MESSAGES = {
+ 0: "Success",
+ 1: "Arg list too long",
+ 2: "Permission denied",
+ 3: "Address already in use",
+ 4: "Address not available",
+ 5: "Address family not supported by protocol family",
+ 6: "No more processes",
+ 7: "Socket already connected",
+ 8: "Bad file number",
+ 9: "Trying to read unreadable message",
+ 10: "Mount device busy",
+ 11: "Operation canceled",
+ 12: "No children",
+ 13: "Connection aborted",
+ 14: "Connection refused",
+ 15: "Connection reset by peer",
+ 16: "File locking deadlock error",
+ 17: "Destination address required",
+ 18: "Math arg out of domain of func",
+ 19: "Quota exceeded",
+ 20: "File exists",
+ 21: "Bad address",
+ 22: "File too large",
+ 23: "Host is unreachable",
+ 24: "Identifier removed",
+ 25: "Illegal byte sequence",
+ 26: "Connection already in progress",
+ 27: "Interrupted system call",
+ 28: "Invalid argument",
+ 29: "I/O error",
+ 30: "Socket is already connected",
+ 31: "Is a directory",
+ 32: "Too many symbolic links",
+ 33: "Too many open files",
+ 34: "Too many links",
+ 35: "Message too long",
+ 36: "Multihop attempted",
+ 37: "File or path name too long",
+ 38: "Network interface is not configured",
+ 39: "Connection reset by network",
+ 40: "Network is unreachable",
+ 41: "Too many open files in system",
+ 42: "No buffer space available",
+ 43: "No such device",
+ 44: "No such file or directory",
+ 45: "Exec format error",
+ 46: "No record locks available",
+ 47: "The link has been severed",
+ 48: "Not enough core",
+ 49: "No message of desired type",
+ 50: "Protocol not available",
+ 51: "No space left on device",
+ 52: "Function not implemented",
+ 53: "Socket is not connected",
+ 54: "Not a directory",
+ 55: "Directory not empty",
+ 56: "State not recoverable",
+ 57: "Socket operation on non-socket",
+ 59: "Not a typewriter",
+ 60: "No such device or address",
+ 61: "Value too large for defined data type",
+ 62: "Previous owner died",
+ 63: "Not super-user",
+ 64: "Broken pipe",
+ 65: "Protocol error",
+ 66: "Unknown protocol",
+ 67: "Protocol wrong type for socket",
+ 68: "Math result not representable",
+ 69: "Read only file system",
+ 70: "Illegal seek",
+ 71: "No such process",
+ 72: "Stale file handle",
+ 73: "Connection timed out",
+ 74: "Text file busy",
+ 75: "Cross-device link",
+ 100: "Device not a stream",
+ 101: "Bad font file fmt",
+ 102: "Invalid slot",
+ 103: "Invalid request code",
+ 104: "No anode",
+ 105: "Block device required",
+ 106: "Channel number out of range",
+ 107: "Level 3 halted",
+ 108: "Level 3 reset",
+ 109: "Link number out of range",
+ 110: "Protocol driver not attached",
+ 111: "No CSI structure available",
+ 112: "Level 2 halted",
+ 113: "Invalid exchange",
+ 114: "Invalid request descriptor",
+ 115: "Exchange full",
+ 116: "No data (for no delay io)",
+ 117: "Timer expired",
+ 118: "Out of streams resources",
+ 119: "Machine is not on the network",
+ 120: "Package not installed",
+ 121: "The object is remote",
+ 122: "Advertise error",
+ 123: "Srmount error",
+ 124: "Communication error on send",
+ 125: "Cross mount point (not really error)",
+ 126: "Given log. name not unique",
+ 127: "f.d. invalid for this operation",
+ 128: "Remote address changed",
+ 129: "Can access a needed shared lib",
+ 130: "Accessing a corrupted shared lib",
+ 131: ".lib section in a.out corrupted",
+ 132: "Attempting to link in too many libs",
+ 133: "Attempting to exec a shared library",
+ 135: "Streams pipe error",
+ 136: "Too many users",
+ 137: "Socket type not supported",
+ 138: "Not supported",
+ 139: "Protocol family not supported",
+ 140: "Can't send after socket shutdown",
+ 141: "Too many references",
+ 142: "Host is down",
+ 148: "No medium (in tape drive)",
+ 156: "Level 2 not synchronized"
+};
+
+var ERRNO_CODES = {};
+
+function demangle(func) {
+ warnOnce("warning: build with -sDEMANGLE_SUPPORT to link in libcxxabi demangling");
+ return func;
+}
+
+function demangleAll(text) {
+ var regex = /\b_Z[\w\d_]+/g;
+ return text.replace(regex, function(x) {
+ var y = demangle(x);
+ return x === y ? x : y + " [" + x + "]";
+ });
+}
+
+var FS = {
+ root: null,
+ mounts: [],
+ devices: {},
+ streams: [],
+ nextInode: 1,
+ nameTable: null,
+ currentPath: "/",
+ initialized: false,
+ ignorePermissions: true,
+ ErrnoError: null,
+ genericErrors: {},
+ filesystems: null,
+ syncFSRequests: 0,
+ lookupPath: (path, opts = {}) => {
+ path = PATH_FS.resolve(path);
+ if (!path) return {
+ path: "",
+ node: null
+ };
+ var defaults = {
+ follow_mount: true,
+ recurse_count: 0
+ };
+ opts = Object.assign(defaults, opts);
+ if (opts.recurse_count > 8) {
+ throw new FS.ErrnoError(32);
+ }
+ var parts = path.split("/").filter(p => !!p);
+ var current = FS.root;
+ var current_path = "/";
+ for (var i = 0; i < parts.length; i++) {
+ var islast = i === parts.length - 1;
+ if (islast && opts.parent) {
+ break;
+ }
+ current = FS.lookupNode(current, parts[i]);
+ current_path = PATH.join2(current_path, parts[i]);
+ if (FS.isMountpoint(current)) {
+ if (!islast || islast && opts.follow_mount) {
+ current = current.mounted.root;
+ }
+ }
+ if (!islast || opts.follow) {
+ var count = 0;
+ while (FS.isLink(current.mode)) {
+ var link = FS.readlink(current_path);
+ current_path = PATH_FS.resolve(PATH.dirname(current_path), link);
+ var lookup = FS.lookupPath(current_path, {
+ recurse_count: opts.recurse_count + 1
+ });
+ current = lookup.node;
+ if (count++ > 40) {
+ throw new FS.ErrnoError(32);
+ }
+ }
+ }
+ }
+ return {
+ path: current_path,
+ node: current
+ };
+ },
+ getPath: node => {
+ var path;
+ while (true) {
+ if (FS.isRoot(node)) {
+ var mount = node.mount.mountpoint;
+ if (!path) return mount;
+ return mount[mount.length - 1] !== "/" ? `${mount}/${path}` : mount + path;
+ }
+ path = path ? `${node.name}/${path}` : node.name;
+ node = node.parent;
+ }
+ },
+ hashName: (parentid, name) => {
+ var hash = 0;
+ for (var i = 0; i < name.length; i++) {
+ hash = (hash << 5) - hash + name.charCodeAt(i) | 0;
+ }
+ return (parentid + hash >>> 0) % FS.nameTable.length;
+ },
+ hashAddNode: node => {
+ var hash = FS.hashName(node.parent.id, node.name);
+ node.name_next = FS.nameTable[hash];
+ FS.nameTable[hash] = node;
+ },
+ hashRemoveNode: node => {
+ var hash = FS.hashName(node.parent.id, node.name);
+ if (FS.nameTable[hash] === node) {
+ FS.nameTable[hash] = node.name_next;
+ } else {
+ var current = FS.nameTable[hash];
+ while (current) {
+ if (current.name_next === node) {
+ current.name_next = node.name_next;
+ break;
+ }
+ current = current.name_next;
+ }
+ }
+ },
+ lookupNode: (parent, name) => {
+ var errCode = FS.mayLookup(parent);
+ if (errCode) {
+ throw new FS.ErrnoError(errCode, parent);
+ }
+ var hash = FS.hashName(parent.id, name);
+ for (var node = FS.nameTable[hash]; node; node = node.name_next) {
+ var nodeName = node.name;
+ if (node.parent.id === parent.id && nodeName === name) {
+ return node;
+ }
+ }
+ return FS.lookup(parent, name);
+ },
+ createNode: (parent, name, mode, rdev) => {
+ assert(typeof parent == "object");
+ var node = new FS.FSNode(parent, name, mode, rdev);
+ FS.hashAddNode(node);
+ return node;
+ },
+ destroyNode: node => {
+ FS.hashRemoveNode(node);
+ },
+ isRoot: node => {
+ return node === node.parent;
+ },
+ isMountpoint: node => {
+ return !!node.mounted;
+ },
+ isFile: mode => {
+ return (mode & 61440) === 32768;
+ },
+ isDir: mode => {
+ return (mode & 61440) === 16384;
+ },
+ isLink: mode => {
+ return (mode & 61440) === 40960;
+ },
+ isChrdev: mode => {
+ return (mode & 61440) === 8192;
+ },
+ isBlkdev: mode => {
+ return (mode & 61440) === 24576;
+ },
+ isFIFO: mode => {
+ return (mode & 61440) === 4096;
+ },
+ isSocket: mode => {
+ return (mode & 49152) === 49152;
+ },
+ flagsToPermissionString: flag => {
+ var perms = [ "r", "w", "rw" ][flag & 3];
+ if (flag & 512) {
+ perms += "w";
+ }
+ return perms;
+ },
+ nodePermissions: (node, perms) => {
+ if (FS.ignorePermissions) {
+ return 0;
+ }
+ if (perms.includes("r") && !(node.mode & 292)) {
+ return 2;
+ } else if (perms.includes("w") && !(node.mode & 146)) {
+ return 2;
+ } else if (perms.includes("x") && !(node.mode & 73)) {
+ return 2;
+ }
+ return 0;
+ },
+ mayLookup: dir => {
+ var errCode = FS.nodePermissions(dir, "x");
+ if (errCode) return errCode;
+ if (!dir.node_ops.lookup) return 2;
+ return 0;
+ },
+ mayCreate: (dir, name) => {
+ try {
+ var node = FS.lookupNode(dir, name);
+ return 20;
+ } catch (e) {}
+ return FS.nodePermissions(dir, "wx");
+ },
+ mayDelete: (dir, name, isdir) => {
+ var node;
+ try {
+ node = FS.lookupNode(dir, name);
+ } catch (e) {
+ return e.errno;
+ }
+ var errCode = FS.nodePermissions(dir, "wx");
+ if (errCode) {
+ return errCode;
+ }
+ if (isdir) {
+ if (!FS.isDir(node.mode)) {
+ return 54;
+ }
+ if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) {
+ return 10;
+ }
+ } else {
+ if (FS.isDir(node.mode)) {
+ return 31;
+ }
+ }
+ return 0;
+ },
+ mayOpen: (node, flags) => {
+ if (!node) {
+ return 44;
+ }
+ if (FS.isLink(node.mode)) {
+ return 32;
+ } else if (FS.isDir(node.mode)) {
+ if (FS.flagsToPermissionString(flags) !== "r" || flags & 512) {
+ return 31;
+ }
+ }
+ return FS.nodePermissions(node, FS.flagsToPermissionString(flags));
+ },
+ MAX_OPEN_FDS: 4096,
+ nextfd: (fd_start = 0, fd_end = FS.MAX_OPEN_FDS) => {
+ for (var fd = fd_start; fd <= fd_end; fd++) {
+ if (!FS.streams[fd]) {
+ return fd;
+ }
+ }
+ throw new FS.ErrnoError(33);
+ },
+ getStream: fd => FS.streams[fd],
+ createStream: (stream, fd_start, fd_end) => {
+ if (!FS.FSStream) {
+ FS.FSStream = function() {
+ this.shared = {};
+ };
+ FS.FSStream.prototype = {};
+ Object.defineProperties(FS.FSStream.prototype, {
+ object: {
+ get: function() {
+ return this.node;
+ },
+ set: function(val) {
+ this.node = val;
+ }
+ },
+ isRead: {
+ get: function() {
+ return (this.flags & 2097155) !== 1;
+ }
+ },
+ isWrite: {
+ get: function() {
+ return (this.flags & 2097155) !== 0;
+ }
+ },
+ isAppend: {
+ get: function() {
+ return this.flags & 1024;
+ }
+ },
+ flags: {
+ get: function() {
+ return this.shared.flags;
+ },
+ set: function(val) {
+ this.shared.flags = val;
+ }
+ },
+ position: {
+ get: function() {
+ return this.shared.position;
+ },
+ set: function(val) {
+ this.shared.position = val;
+ }
+ }
+ });
+ }
+ stream = Object.assign(new FS.FSStream(), stream);
+ var fd = FS.nextfd(fd_start, fd_end);
+ stream.fd = fd;
+ FS.streams[fd] = stream;
+ return stream;
+ },
+ closeStream: fd => {
+ FS.streams[fd] = null;
+ },
+ chrdev_stream_ops: {
+ open: stream => {
+ var device = FS.getDevice(stream.node.rdev);
+ stream.stream_ops = device.stream_ops;
+ if (stream.stream_ops.open) {
+ stream.stream_ops.open(stream);
+ }
+ },
+ llseek: () => {
+ throw new FS.ErrnoError(70);
+ }
+ },
+ major: dev => dev >> 8,
+ minor: dev => dev & 255,
+ makedev: (ma, mi) => ma << 8 | mi,
+ registerDevice: (dev, ops) => {
+ FS.devices[dev] = {
+ stream_ops: ops
+ };
+ },
+ getDevice: dev => FS.devices[dev],
+ getMounts: mount => {
+ var mounts = [];
+ var check = [ mount ];
+ while (check.length) {
+ var m = check.pop();
+ mounts.push(m);
+ check.push.apply(check, m.mounts);
+ }
+ return mounts;
+ },
+ syncfs: (populate, callback) => {
+ if (typeof populate == "function") {
+ callback = populate;
+ populate = false;
+ }
+ FS.syncFSRequests++;
+ if (FS.syncFSRequests > 1) {
+ err(`warning: ${FS.syncFSRequests} FS.syncfs operations in flight at once, probably just doing extra work`);
+ }
+ var mounts = FS.getMounts(FS.root.mount);
+ var completed = 0;
+ function doCallback(errCode) {
+ assert(FS.syncFSRequests > 0);
+ FS.syncFSRequests--;
+ return callback(errCode);
+ }
+ function done(errCode) {
+ if (errCode) {
+ if (!done.errored) {
+ done.errored = true;
+ return doCallback(errCode);
+ }
+ return;
+ }
+ if (++completed >= mounts.length) {
+ doCallback(null);
+ }
+ }
+ mounts.forEach(mount => {
+ if (!mount.type.syncfs) {
+ return done(null);
+ }
+ mount.type.syncfs(mount, populate, done);
+ });
+ },
+ mount: (type, opts, mountpoint) => {
+ if (typeof type == "string") {
+ throw type;
+ }
+ var root = mountpoint === "/";
+ var pseudo = !mountpoint;
+ var node;
+ if (root && FS.root) {
+ throw new FS.ErrnoError(10);
+ } else if (!root && !pseudo) {
+ var lookup = FS.lookupPath(mountpoint, {
+ follow_mount: false
+ });
+ mountpoint = lookup.path;
+ node = lookup.node;
+ if (FS.isMountpoint(node)) {
+ throw new FS.ErrnoError(10);
+ }
+ if (!FS.isDir(node.mode)) {
+ throw new FS.ErrnoError(54);
+ }
+ }
+ var mount = {
+ type: type,
+ opts: opts,
+ mountpoint: mountpoint,
+ mounts: []
+ };
+ var mountRoot = type.mount(mount);
+ mountRoot.mount = mount;
+ mount.root = mountRoot;
+ if (root) {
+ FS.root = mountRoot;
+ } else if (node) {
+ node.mounted = mount;
+ if (node.mount) {
+ node.mount.mounts.push(mount);
+ }
+ }
+ return mountRoot;
+ },
+ unmount: mountpoint => {
+ var lookup = FS.lookupPath(mountpoint, {
+ follow_mount: false
+ });
+ if (!FS.isMountpoint(lookup.node)) {
+ throw new FS.ErrnoError(28);
+ }
+ var node = lookup.node;
+ var mount = node.mounted;
+ var mounts = FS.getMounts(mount);
+ Object.keys(FS.nameTable).forEach(hash => {
+ var current = FS.nameTable[hash];
+ while (current) {
+ var next = current.name_next;
+ if (mounts.includes(current.mount)) {
+ FS.destroyNode(current);
+ }
+ current = next;
+ }
+ });
+ node.mounted = null;
+ var idx = node.mount.mounts.indexOf(mount);
+ assert(idx !== -1);
+ node.mount.mounts.splice(idx, 1);
+ },
+ lookup: (parent, name) => {
+ return parent.node_ops.lookup(parent, name);
+ },
+ mknod: (path, mode, dev) => {
+ var lookup = FS.lookupPath(path, {
+ parent: true
+ });
+ var parent = lookup.node;
+ var name = PATH.basename(path);
+ if (!name || name === "." || name === "..") {
+ throw new FS.ErrnoError(28);
+ }
+ var errCode = FS.mayCreate(parent, name);
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ if (!parent.node_ops.mknod) {
+ throw new FS.ErrnoError(63);
+ }
+ return parent.node_ops.mknod(parent, name, mode, dev);
+ },
+ create: (path, mode) => {
+ mode = mode !== undefined ? mode : 438;
+ mode &= 4095;
+ mode |= 32768;
+ return FS.mknod(path, mode, 0);
+ },
+ mkdir: (path, mode) => {
+ mode = mode !== undefined ? mode : 511;
+ mode &= 511 | 512;
+ mode |= 16384;
+ return FS.mknod(path, mode, 0);
+ },
+ mkdirTree: (path, mode) => {
+ var dirs = path.split("/");
+ var d = "";
+ for (var i = 0; i < dirs.length; ++i) {
+ if (!dirs[i]) continue;
+ d += "/" + dirs[i];
+ try {
+ FS.mkdir(d, mode);
+ } catch (e) {
+ if (e.errno != 20) throw e;
+ }
+ }
+ },
+ mkdev: (path, mode, dev) => {
+ if (typeof dev == "undefined") {
+ dev = mode;
+ mode = 438;
+ }
+ mode |= 8192;
+ return FS.mknod(path, mode, dev);
+ },
+ symlink: (oldpath, newpath) => {
+ if (!PATH_FS.resolve(oldpath)) {
+ throw new FS.ErrnoError(44);
+ }
+ var lookup = FS.lookupPath(newpath, {
+ parent: true
+ });
+ var parent = lookup.node;
+ if (!parent) {
+ throw new FS.ErrnoError(44);
+ }
+ var newname = PATH.basename(newpath);
+ var errCode = FS.mayCreate(parent, newname);
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ if (!parent.node_ops.symlink) {
+ throw new FS.ErrnoError(63);
+ }
+ return parent.node_ops.symlink(parent, newname, oldpath);
+ },
+ rename: (old_path, new_path) => {
+ var old_dirname = PATH.dirname(old_path);
+ var new_dirname = PATH.dirname(new_path);
+ var old_name = PATH.basename(old_path);
+ var new_name = PATH.basename(new_path);
+ var lookup, old_dir, new_dir;
+ lookup = FS.lookupPath(old_path, {
+ parent: true
+ });
+ old_dir = lookup.node;
+ lookup = FS.lookupPath(new_path, {
+ parent: true
+ });
+ new_dir = lookup.node;
+ if (!old_dir || !new_dir) throw new FS.ErrnoError(44);
+ if (old_dir.mount !== new_dir.mount) {
+ throw new FS.ErrnoError(75);
+ }
+ var old_node = FS.lookupNode(old_dir, old_name);
+ var relative = PATH_FS.relative(old_path, new_dirname);
+ if (relative.charAt(0) !== ".") {
+ throw new FS.ErrnoError(28);
+ }
+ relative = PATH_FS.relative(new_path, old_dirname);
+ if (relative.charAt(0) !== ".") {
+ throw new FS.ErrnoError(55);
+ }
+ var new_node;
+ try {
+ new_node = FS.lookupNode(new_dir, new_name);
+ } catch (e) {}
+ if (old_node === new_node) {
+ return;
+ }
+ var isdir = FS.isDir(old_node.mode);
+ var errCode = FS.mayDelete(old_dir, old_name, isdir);
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ errCode = new_node ? FS.mayDelete(new_dir, new_name, isdir) : FS.mayCreate(new_dir, new_name);
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ if (!old_dir.node_ops.rename) {
+ throw new FS.ErrnoError(63);
+ }
+ if (FS.isMountpoint(old_node) || new_node && FS.isMountpoint(new_node)) {
+ throw new FS.ErrnoError(10);
+ }
+ if (new_dir !== old_dir) {
+ errCode = FS.nodePermissions(old_dir, "w");
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ }
+ FS.hashRemoveNode(old_node);
+ try {
+ old_dir.node_ops.rename(old_node, new_dir, new_name);
+ } catch (e) {
+ throw e;
+ } finally {
+ FS.hashAddNode(old_node);
+ }
+ },
+ rmdir: path => {
+ var lookup = FS.lookupPath(path, {
+ parent: true
+ });
+ var parent = lookup.node;
+ var name = PATH.basename(path);
+ var node = FS.lookupNode(parent, name);
+ var errCode = FS.mayDelete(parent, name, true);
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ if (!parent.node_ops.rmdir) {
+ throw new FS.ErrnoError(63);
+ }
+ if (FS.isMountpoint(node)) {
+ throw new FS.ErrnoError(10);
+ }
+ parent.node_ops.rmdir(parent, name);
+ FS.destroyNode(node);
+ },
+ readdir: path => {
+ var lookup = FS.lookupPath(path, {
+ follow: true
+ });
+ var node = lookup.node;
+ if (!node.node_ops.readdir) {
+ throw new FS.ErrnoError(54);
+ }
+ return node.node_ops.readdir(node);
+ },
+ unlink: path => {
+ var lookup = FS.lookupPath(path, {
+ parent: true
+ });
+ var parent = lookup.node;
+ if (!parent) {
+ throw new FS.ErrnoError(44);
+ }
+ var name = PATH.basename(path);
+ var node = FS.lookupNode(parent, name);
+ var errCode = FS.mayDelete(parent, name, false);
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ if (!parent.node_ops.unlink) {
+ throw new FS.ErrnoError(63);
+ }
+ if (FS.isMountpoint(node)) {
+ throw new FS.ErrnoError(10);
+ }
+ parent.node_ops.unlink(parent, name);
+ FS.destroyNode(node);
+ },
+ readlink: path => {
+ var lookup = FS.lookupPath(path);
+ var link = lookup.node;
+ if (!link) {
+ throw new FS.ErrnoError(44);
+ }
+ if (!link.node_ops.readlink) {
+ throw new FS.ErrnoError(28);
+ }
+ return PATH_FS.resolve(FS.getPath(link.parent), link.node_ops.readlink(link));
+ },
+ stat: (path, dontFollow) => {
+ var lookup = FS.lookupPath(path, {
+ follow: !dontFollow
+ });
+ var node = lookup.node;
+ if (!node) {
+ throw new FS.ErrnoError(44);
+ }
+ if (!node.node_ops.getattr) {
+ throw new FS.ErrnoError(63);
+ }
+ return node.node_ops.getattr(node);
+ },
+ lstat: path => {
+ return FS.stat(path, true);
+ },
+ chmod: (path, mode, dontFollow) => {
+ var node;
+ if (typeof path == "string") {
+ var lookup = FS.lookupPath(path, {
+ follow: !dontFollow
+ });
+ node = lookup.node;
+ } else {
+ node = path;
+ }
+ if (!node.node_ops.setattr) {
+ throw new FS.ErrnoError(63);
+ }
+ node.node_ops.setattr(node, {
+ mode: mode & 4095 | node.mode & ~4095,
+ timestamp: Date.now()
+ });
+ },
+ lchmod: (path, mode) => {
+ FS.chmod(path, mode, true);
+ },
+ fchmod: (fd, mode) => {
+ var stream = FS.getStream(fd);
+ if (!stream) {
+ throw new FS.ErrnoError(8);
+ }
+ FS.chmod(stream.node, mode);
+ },
+ chown: (path, uid, gid, dontFollow) => {
+ var node;
+ if (typeof path == "string") {
+ var lookup = FS.lookupPath(path, {
+ follow: !dontFollow
+ });
+ node = lookup.node;
+ } else {
+ node = path;
+ }
+ if (!node.node_ops.setattr) {
+ throw new FS.ErrnoError(63);
+ }
+ node.node_ops.setattr(node, {
+ timestamp: Date.now()
+ });
+ },
+ lchown: (path, uid, gid) => {
+ FS.chown(path, uid, gid, true);
+ },
+ fchown: (fd, uid, gid) => {
+ var stream = FS.getStream(fd);
+ if (!stream) {
+ throw new FS.ErrnoError(8);
+ }
+ FS.chown(stream.node, uid, gid);
+ },
+ truncate: (path, len) => {
+ if (len < 0) {
+ throw new FS.ErrnoError(28);
+ }
+ var node;
+ if (typeof path == "string") {
+ var lookup = FS.lookupPath(path, {
+ follow: true
+ });
+ node = lookup.node;
+ } else {
+ node = path;
+ }
+ if (!node.node_ops.setattr) {
+ throw new FS.ErrnoError(63);
+ }
+ if (FS.isDir(node.mode)) {
+ throw new FS.ErrnoError(31);
+ }
+ if (!FS.isFile(node.mode)) {
+ throw new FS.ErrnoError(28);
+ }
+ var errCode = FS.nodePermissions(node, "w");
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ node.node_ops.setattr(node, {
+ size: len,
+ timestamp: Date.now()
+ });
+ },
+ ftruncate: (fd, len) => {
+ var stream = FS.getStream(fd);
+ if (!stream) {
+ throw new FS.ErrnoError(8);
+ }
+ if ((stream.flags & 2097155) === 0) {
+ throw new FS.ErrnoError(28);
+ }
+ FS.truncate(stream.node, len);
+ },
+ utime: (path, atime, mtime) => {
+ var lookup = FS.lookupPath(path, {
+ follow: true
+ });
+ var node = lookup.node;
+ node.node_ops.setattr(node, {
+ timestamp: Math.max(atime, mtime)
+ });
+ },
+ open: (path, flags, mode) => {
+ if (path === "") {
+ throw new FS.ErrnoError(44);
+ }
+ flags = typeof flags == "string" ? FS_modeStringToFlags(flags) : flags;
+ mode = typeof mode == "undefined" ? 438 : mode;
+ if (flags & 64) {
+ mode = mode & 4095 | 32768;
+ } else {
+ mode = 0;
+ }
+ var node;
+ if (typeof path == "object") {
+ node = path;
+ } else {
+ path = PATH.normalize(path);
+ try {
+ var lookup = FS.lookupPath(path, {
+ follow: !(flags & 131072)
+ });
+ node = lookup.node;
+ } catch (e) {}
+ }
+ var created = false;
+ if (flags & 64) {
+ if (node) {
+ if (flags & 128) {
+ throw new FS.ErrnoError(20);
+ }
+ } else {
+ node = FS.mknod(path, mode, 0);
+ created = true;
+ }
+ }
+ if (!node) {
+ throw new FS.ErrnoError(44);
+ }
+ if (FS.isChrdev(node.mode)) {
+ flags &= ~512;
+ }
+ if (flags & 65536 && !FS.isDir(node.mode)) {
+ throw new FS.ErrnoError(54);
+ }
+ if (!created) {
+ var errCode = FS.mayOpen(node, flags);
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ }
+ if (flags & 512 && !created) {
+ FS.truncate(node, 0);
+ }
+ flags &= ~(128 | 512 | 131072);
+ var stream = FS.createStream({
+ node: node,
+ path: FS.getPath(node),
+ flags: flags,
+ seekable: true,
+ position: 0,
+ stream_ops: node.stream_ops,
+ ungotten: [],
+ error: false
+ });
+ if (stream.stream_ops.open) {
+ stream.stream_ops.open(stream);
+ }
+ if (Module["logReadFiles"] && !(flags & 1)) {
+ if (!FS.readFiles) FS.readFiles = {};
+ if (!(path in FS.readFiles)) {
+ FS.readFiles[path] = 1;
+ }
+ }
+ return stream;
+ },
+ close: stream => {
+ if (FS.isClosed(stream)) {
+ throw new FS.ErrnoError(8);
+ }
+ if (stream.getdents) stream.getdents = null;
+ try {
+ if (stream.stream_ops.close) {
+ stream.stream_ops.close(stream);
+ }
+ } catch (e) {
+ throw e;
+ } finally {
+ FS.closeStream(stream.fd);
+ }
+ stream.fd = null;
+ },
+ isClosed: stream => {
+ return stream.fd === null;
+ },
+ llseek: (stream, offset, whence) => {
+ if (FS.isClosed(stream)) {
+ throw new FS.ErrnoError(8);
+ }
+ if (!stream.seekable || !stream.stream_ops.llseek) {
+ throw new FS.ErrnoError(70);
+ }
+ if (whence != 0 && whence != 1 && whence != 2) {
+ throw new FS.ErrnoError(28);
+ }
+ stream.position = stream.stream_ops.llseek(stream, offset, whence);
+ stream.ungotten = [];
+ return stream.position;
+ },
+ read: (stream, buffer, offset, length, position) => {
+ if (length < 0 || position < 0) {
+ throw new FS.ErrnoError(28);
+ }
+ if (FS.isClosed(stream)) {
+ throw new FS.ErrnoError(8);
+ }
+ if ((stream.flags & 2097155) === 1) {
+ throw new FS.ErrnoError(8);
+ }
+ if (FS.isDir(stream.node.mode)) {
+ throw new FS.ErrnoError(31);
+ }
+ if (!stream.stream_ops.read) {
+ throw new FS.ErrnoError(28);
+ }
+ var seeking = typeof position != "undefined";
+ if (!seeking) {
+ position = stream.position;
+ } else if (!stream.seekable) {
+ throw new FS.ErrnoError(70);
+ }
+ var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position);
+ if (!seeking) stream.position += bytesRead;
+ return bytesRead;
+ },
+ write: (stream, buffer, offset, length, position, canOwn) => {
+ if (length < 0 || position < 0) {
+ throw new FS.ErrnoError(28);
+ }
+ if (FS.isClosed(stream)) {
+ throw new FS.ErrnoError(8);
+ }
+ if ((stream.flags & 2097155) === 0) {
+ throw new FS.ErrnoError(8);
+ }
+ if (FS.isDir(stream.node.mode)) {
+ throw new FS.ErrnoError(31);
+ }
+ if (!stream.stream_ops.write) {
+ throw new FS.ErrnoError(28);
+ }
+ if (stream.seekable && stream.flags & 1024) {
+ FS.llseek(stream, 0, 2);
+ }
+ var seeking = typeof position != "undefined";
+ if (!seeking) {
+ position = stream.position;
+ } else if (!stream.seekable) {
+ throw new FS.ErrnoError(70);
+ }
+ var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn);
+ if (!seeking) stream.position += bytesWritten;
+ return bytesWritten;
+ },
+ allocate: (stream, offset, length) => {
+ if (FS.isClosed(stream)) {
+ throw new FS.ErrnoError(8);
+ }
+ if (offset < 0 || length <= 0) {
+ throw new FS.ErrnoError(28);
+ }
+ if ((stream.flags & 2097155) === 0) {
+ throw new FS.ErrnoError(8);
+ }
+ if (!FS.isFile(stream.node.mode) && !FS.isDir(stream.node.mode)) {
+ throw new FS.ErrnoError(43);
+ }
+ if (!stream.stream_ops.allocate) {
+ throw new FS.ErrnoError(138);
+ }
+ stream.stream_ops.allocate(stream, offset, length);
+ },
+ mmap: (stream, length, position, prot, flags) => {
+ if ((prot & 2) !== 0 && (flags & 2) === 0 && (stream.flags & 2097155) !== 2) {
+ throw new FS.ErrnoError(2);
+ }
+ if ((stream.flags & 2097155) === 1) {
+ throw new FS.ErrnoError(2);
+ }
+ if (!stream.stream_ops.mmap) {
+ throw new FS.ErrnoError(43);
+ }
+ return stream.stream_ops.mmap(stream, length, position, prot, flags);
+ },
+ msync: (stream, buffer, offset, length, mmapFlags) => {
+ if (!stream.stream_ops.msync) {
+ return 0;
+ }
+ return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags);
+ },
+ munmap: stream => 0,
+ ioctl: (stream, cmd, arg) => {
+ if (!stream.stream_ops.ioctl) {
+ throw new FS.ErrnoError(59);
+ }
+ return stream.stream_ops.ioctl(stream, cmd, arg);
+ },
+ readFile: (path, opts = {}) => {
+ opts.flags = opts.flags || 0;
+ opts.encoding = opts.encoding || "binary";
+ if (opts.encoding !== "utf8" && opts.encoding !== "binary") {
+ throw new Error(`Invalid encoding type "${opts.encoding}"`);
+ }
+ var ret;
+ var stream = FS.open(path, opts.flags);
+ var stat = FS.stat(path);
+ var length = stat.size;
+ var buf = new Uint8Array(length);
+ FS.read(stream, buf, 0, length, 0);
+ if (opts.encoding === "utf8") {
+ ret = UTF8ArrayToString(buf, 0);
+ } else if (opts.encoding === "binary") {
+ ret = buf;
+ }
+ FS.close(stream);
+ return ret;
+ },
+ writeFile: (path, data, opts = {}) => {
+ opts.flags = opts.flags || 577;
+ var stream = FS.open(path, opts.flags, opts.mode);
+ if (typeof data == "string") {
+ var buf = new Uint8Array(lengthBytesUTF8(data) + 1);
+ var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length);
+ FS.write(stream, buf, 0, actualNumBytes, undefined, opts.canOwn);
+ } else if (ArrayBuffer.isView(data)) {
+ FS.write(stream, data, 0, data.byteLength, undefined, opts.canOwn);
+ } else {
+ throw new Error("Unsupported data type");
+ }
+ FS.close(stream);
+ },
+ cwd: () => FS.currentPath,
+ chdir: path => {
+ var lookup = FS.lookupPath(path, {
+ follow: true
+ });
+ if (lookup.node === null) {
+ throw new FS.ErrnoError(44);
+ }
+ if (!FS.isDir(lookup.node.mode)) {
+ throw new FS.ErrnoError(54);
+ }
+ var errCode = FS.nodePermissions(lookup.node, "x");
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ FS.currentPath = lookup.path;
+ },
+ createDefaultDirectories: () => {
+ FS.mkdir("/tmp");
+ FS.mkdir("/home");
+ FS.mkdir("/home/web_user");
+ },
+ createDefaultDevices: () => {
+ FS.mkdir("/dev");
+ FS.registerDevice(FS.makedev(1, 3), {
+ read: () => 0,
+ write: (stream, buffer, offset, length, pos) => length
+ });
+ FS.mkdev("/dev/null", FS.makedev(1, 3));
+ TTY.register(FS.makedev(5, 0), TTY.default_tty_ops);
+ TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops);
+ FS.mkdev("/dev/tty", FS.makedev(5, 0));
+ FS.mkdev("/dev/tty1", FS.makedev(6, 0));
+ var randomBuffer = new Uint8Array(1024), randomLeft = 0;
+ var randomByte = () => {
+ if (randomLeft === 0) {
+ randomLeft = randomFill(randomBuffer).byteLength;
+ }
+ return randomBuffer[--randomLeft];
+ };
+ FS.createDevice("/dev", "random", randomByte);
+ FS.createDevice("/dev", "urandom", randomByte);
+ FS.mkdir("/dev/shm");
+ FS.mkdir("/dev/shm/tmp");
+ },
+ createSpecialDirectories: () => {
+ FS.mkdir("/proc");
+ var proc_self = FS.mkdir("/proc/self");
+ FS.mkdir("/proc/self/fd");
+ FS.mount({
+ mount: () => {
+ var node = FS.createNode(proc_self, "fd", 16384 | 511, 73);
+ node.node_ops = {
+ lookup: (parent, name) => {
+ var fd = +name;
+ var stream = FS.getStream(fd);
+ if (!stream) throw new FS.ErrnoError(8);
+ var ret = {
+ parent: null,
+ mount: {
+ mountpoint: "fake"
+ },
+ node_ops: {
+ readlink: () => stream.path
+ }
+ };
+ ret.parent = ret;
+ return ret;
+ }
+ };
+ return node;
+ }
+ }, {}, "/proc/self/fd");
+ },
+ createStandardStreams: () => {
+ if (Module["stdin"]) {
+ FS.createDevice("/dev", "stdin", Module["stdin"]);
+ } else {
+ FS.symlink("/dev/tty", "/dev/stdin");
+ }
+ if (Module["stdout"]) {
+ FS.createDevice("/dev", "stdout", null, Module["stdout"]);
+ } else {
+ FS.symlink("/dev/tty", "/dev/stdout");
+ }
+ if (Module["stderr"]) {
+ FS.createDevice("/dev", "stderr", null, Module["stderr"]);
+ } else {
+ FS.symlink("/dev/tty1", "/dev/stderr");
+ }
+ var stdin = FS.open("/dev/stdin", 0);
+ var stdout = FS.open("/dev/stdout", 1);
+ var stderr = FS.open("/dev/stderr", 1);
+ assert(stdin.fd === 0, `invalid handle for stdin (${stdin.fd})`);
+ assert(stdout.fd === 1, `invalid handle for stdout (${stdout.fd})`);
+ assert(stderr.fd === 2, `invalid handle for stderr (${stderr.fd})`);
+ },
+ ensureErrnoError: () => {
+ if (FS.ErrnoError) return;
+ FS.ErrnoError = function ErrnoError(errno, node) {
+ this.name = "ErrnoError";
+ this.node = node;
+ this.setErrno = function(errno) {
+ this.errno = errno;
+ for (var key in ERRNO_CODES) {
+ if (ERRNO_CODES[key] === errno) {
+ this.code = key;
+ break;
+ }
+ }
+ };
+ this.setErrno(errno);
+ this.message = ERRNO_MESSAGES[errno];
+ if (this.stack) {
+ Object.defineProperty(this, "stack", {
+ value: new Error().stack,
+ writable: true
+ });
+ this.stack = demangleAll(this.stack);
+ }
+ };
+ FS.ErrnoError.prototype = new Error();
+ FS.ErrnoError.prototype.constructor = FS.ErrnoError;
+ [ 44 ].forEach(code => {
+ FS.genericErrors[code] = new FS.ErrnoError(code);
+ FS.genericErrors[code].stack = "";
+ });
+ },
+ staticInit: () => {
+ FS.ensureErrnoError();
+ FS.nameTable = new Array(4096);
+ FS.mount(MEMFS, {}, "/");
+ FS.createDefaultDirectories();
+ FS.createDefaultDevices();
+ FS.createSpecialDirectories();
+ FS.filesystems = {
+ "MEMFS": MEMFS,
+ "IDBFS": IDBFS
+ };
+ },
+ init: (input, output, error) => {
+ assert(!FS.init.initialized, "FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)");
+ FS.init.initialized = true;
+ FS.ensureErrnoError();
+ Module["stdin"] = input || Module["stdin"];
+ Module["stdout"] = output || Module["stdout"];
+ Module["stderr"] = error || Module["stderr"];
+ FS.createStandardStreams();
+ },
+ quit: () => {
+ FS.init.initialized = false;
+ _fflush(0);
+ for (var i = 0; i < FS.streams.length; i++) {
+ var stream = FS.streams[i];
+ if (!stream) {
+ continue;
+ }
+ FS.close(stream);
+ }
+ },
+ findObject: (path, dontResolveLastLink) => {
+ var ret = FS.analyzePath(path, dontResolveLastLink);
+ if (!ret.exists) {
+ return null;
+ }
+ return ret.object;
+ },
+ analyzePath: (path, dontResolveLastLink) => {
+ try {
+ var lookup = FS.lookupPath(path, {
+ follow: !dontResolveLastLink
+ });
+ path = lookup.path;
+ } catch (e) {}
+ var ret = {
+ isRoot: false,
+ exists: false,
+ error: 0,
+ name: null,
+ path: null,
+ object: null,
+ parentExists: false,
+ parentPath: null,
+ parentObject: null
+ };
+ try {
+ var lookup = FS.lookupPath(path, {
+ parent: true
+ });
+ ret.parentExists = true;
+ ret.parentPath = lookup.path;
+ ret.parentObject = lookup.node;
+ ret.name = PATH.basename(path);
+ lookup = FS.lookupPath(path, {
+ follow: !dontResolveLastLink
+ });
+ ret.exists = true;
+ ret.path = lookup.path;
+ ret.object = lookup.node;
+ ret.name = lookup.node.name;
+ ret.isRoot = lookup.path === "/";
+ } catch (e) {
+ ret.error = e.errno;
+ }
+ return ret;
+ },
+ createPath: (parent, path, canRead, canWrite) => {
+ parent = typeof parent == "string" ? parent : FS.getPath(parent);
+ var parts = path.split("/").reverse();
+ while (parts.length) {
+ var part = parts.pop();
+ if (!part) continue;
+ var current = PATH.join2(parent, part);
+ try {
+ FS.mkdir(current);
+ } catch (e) {}
+ parent = current;
+ }
+ return current;
+ },
+ createFile: (parent, name, properties, canRead, canWrite) => {
+ var path = PATH.join2(typeof parent == "string" ? parent : FS.getPath(parent), name);
+ var mode = FS_getMode(canRead, canWrite);
+ return FS.create(path, mode);
+ },
+ createDataFile: (parent, name, data, canRead, canWrite, canOwn) => {
+ var path = name;
+ if (parent) {
+ parent = typeof parent == "string" ? parent : FS.getPath(parent);
+ path = name ? PATH.join2(parent, name) : parent;
+ }
+ var mode = FS_getMode(canRead, canWrite);
+ var node = FS.create(path, mode);
+ if (data) {
+ if (typeof data == "string") {
+ var arr = new Array(data.length);
+ for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i);
+ data = arr;
+ }
+ FS.chmod(node, mode | 146);
+ var stream = FS.open(node, 577);
+ FS.write(stream, data, 0, data.length, 0, canOwn);
+ FS.close(stream);
+ FS.chmod(node, mode);
+ }
+ return node;
+ },
+ createDevice: (parent, name, input, output) => {
+ var path = PATH.join2(typeof parent == "string" ? parent : FS.getPath(parent), name);
+ var mode = FS_getMode(!!input, !!output);
+ if (!FS.createDevice.major) FS.createDevice.major = 64;
+ var dev = FS.makedev(FS.createDevice.major++, 0);
+ FS.registerDevice(dev, {
+ open: stream => {
+ stream.seekable = false;
+ },
+ close: stream => {
+ if (output && output.buffer && output.buffer.length) {
+ output(10);
+ }
+ },
+ read: (stream, buffer, offset, length, pos) => {
+ var bytesRead = 0;
+ for (var i = 0; i < length; i++) {
+ var result;
+ try {
+ result = input();
+ } catch (e) {
+ throw new FS.ErrnoError(29);
+ }
+ if (result === undefined && bytesRead === 0) {
+ throw new FS.ErrnoError(6);
+ }
+ if (result === null || result === undefined) break;
+ bytesRead++;
+ buffer[offset + i] = result;
+ }
+ if (bytesRead) {
+ stream.node.timestamp = Date.now();
+ }
+ return bytesRead;
+ },
+ write: (stream, buffer, offset, length, pos) => {
+ for (var i = 0; i < length; i++) {
+ try {
+ output(buffer[offset + i]);
+ } catch (e) {
+ throw new FS.ErrnoError(29);
+ }
+ }
+ if (length) {
+ stream.node.timestamp = Date.now();
+ }
+ return i;
+ }
+ });
+ return FS.mkdev(path, mode, dev);
+ },
+ forceLoadFile: obj => {
+ if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true;
+ if (typeof XMLHttpRequest != "undefined") {
+ throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread.");
+ } else if (read_) {
+ try {
+ obj.contents = intArrayFromString(read_(obj.url), true);
+ obj.usedBytes = obj.contents.length;
+ } catch (e) {
+ throw new FS.ErrnoError(29);
+ }
+ } else {
+ throw new Error("Cannot load without read() or XMLHttpRequest.");
+ }
+ },
+ createLazyFile: (parent, name, url, canRead, canWrite) => {
+ function LazyUint8Array() {
+ this.lengthKnown = false;
+ this.chunks = [];
+ }
+ LazyUint8Array.prototype.get = function LazyUint8Array_get(idx) {
+ if (idx > this.length - 1 || idx < 0) {
+ return undefined;
+ }
+ var chunkOffset = idx % this.chunkSize;
+ var chunkNum = idx / this.chunkSize | 0;
+ return this.getter(chunkNum)[chunkOffset];
+ };
+ LazyUint8Array.prototype.setDataGetter = function LazyUint8Array_setDataGetter(getter) {
+ this.getter = getter;
+ };
+ LazyUint8Array.prototype.cacheLength = function LazyUint8Array_cacheLength() {
+ var xhr = new XMLHttpRequest();
+ xhr.open("HEAD", url, false);
+ xhr.send(null);
+ if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
+ var datalength = Number(xhr.getResponseHeader("Content-length"));
+ var header;
+ var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes";
+ var usesGzip = (header = xhr.getResponseHeader("Content-Encoding")) && header === "gzip";
+ var chunkSize = 1024 * 1024;
+ if (!hasByteServing) chunkSize = datalength;
+ var doXHR = (from, to) => {
+ if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!");
+ if (to > datalength - 1) throw new Error("only " + datalength + " bytes available! programmer error!");
+ var xhr = new XMLHttpRequest();
+ xhr.open("GET", url, false);
+ if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to);
+ xhr.responseType = "arraybuffer";
+ if (xhr.overrideMimeType) {
+ xhr.overrideMimeType("text/plain; charset=x-user-defined");
+ }
+ xhr.send(null);
+ if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
+ if (xhr.response !== undefined) {
+ return new Uint8Array(xhr.response || []);
+ }
+ return intArrayFromString(xhr.responseText || "", true);
+ };
+ var lazyArray = this;
+ lazyArray.setDataGetter(chunkNum => {
+ var start = chunkNum * chunkSize;
+ var end = (chunkNum + 1) * chunkSize - 1;
+ end = Math.min(end, datalength - 1);
+ if (typeof lazyArray.chunks[chunkNum] == "undefined") {
+ lazyArray.chunks[chunkNum] = doXHR(start, end);
+ }
+ if (typeof lazyArray.chunks[chunkNum] == "undefined") throw new Error("doXHR failed!");
+ return lazyArray.chunks[chunkNum];
+ });
+ if (usesGzip || !datalength) {
+ chunkSize = datalength = 1;
+ datalength = this.getter(0).length;
+ chunkSize = datalength;
+ out("LazyFiles on gzip forces download of the whole file when length is accessed");
+ }
+ this._length = datalength;
+ this._chunkSize = chunkSize;
+ this.lengthKnown = true;
+ };
+ if (typeof XMLHttpRequest != "undefined") {
+ if (!ENVIRONMENT_IS_WORKER) throw "Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc";
+ var lazyArray = new LazyUint8Array();
+ Object.defineProperties(lazyArray, {
+ length: {
+ get: function() {
+ if (!this.lengthKnown) {
+ this.cacheLength();
+ }
+ return this._length;
+ }
+ },
+ chunkSize: {
+ get: function() {
+ if (!this.lengthKnown) {
+ this.cacheLength();
+ }
+ return this._chunkSize;
+ }
+ }
+ });
+ var properties = {
+ isDevice: false,
+ contents: lazyArray
+ };
+ } else {
+ var properties = {
+ isDevice: false,
+ url: url
+ };
+ }
+ var node = FS.createFile(parent, name, properties, canRead, canWrite);
+ if (properties.contents) {
+ node.contents = properties.contents;
+ } else if (properties.url) {
+ node.contents = null;
+ node.url = properties.url;
+ }
+ Object.defineProperties(node, {
+ usedBytes: {
+ get: function() {
+ return this.contents.length;
+ }
+ }
+ });
+ var stream_ops = {};
+ var keys = Object.keys(node.stream_ops);
+ keys.forEach(key => {
+ var fn = node.stream_ops[key];
+ stream_ops[key] = function forceLoadLazyFile() {
+ FS.forceLoadFile(node);
+ return fn.apply(null, arguments);
+ };
+ });
+ function writeChunks(stream, buffer, offset, length, position) {
+ var contents = stream.node.contents;
+ if (position >= contents.length) return 0;
+ var size = Math.min(contents.length - position, length);
+ assert(size >= 0);
+ if (contents.slice) {
+ for (var i = 0; i < size; i++) {
+ buffer[offset + i] = contents[position + i];
+ }
+ } else {
+ for (var i = 0; i < size; i++) {
+ buffer[offset + i] = contents.get(position + i);
+ }
+ }
+ return size;
+ }
+ stream_ops.read = (stream, buffer, offset, length, position) => {
+ FS.forceLoadFile(node);
+ return writeChunks(stream, buffer, offset, length, position);
+ };
+ stream_ops.mmap = (stream, length, position, prot, flags) => {
+ FS.forceLoadFile(node);
+ var ptr = mmapAlloc(length);
+ if (!ptr) {
+ throw new FS.ErrnoError(48);
+ }
+ writeChunks(stream, GROWABLE_HEAP_I8(), ptr, length, position);
+ return {
+ ptr: ptr,
+ allocated: true
+ };
+ };
+ node.stream_ops = stream_ops;
+ return node;
+ },
+ absolutePath: () => {
+ abort("FS.absolutePath has been removed; use PATH_FS.resolve instead");
+ },
+ createFolder: () => {
+ abort("FS.createFolder has been removed; use FS.mkdir instead");
+ },
+ createLink: () => {
+ abort("FS.createLink has been removed; use FS.symlink instead");
+ },
+ joinPath: () => {
+ abort("FS.joinPath has been removed; use PATH.join instead");
+ },
+ mmapAlloc: () => {
+ abort("FS.mmapAlloc has been replaced by the top level function mmapAlloc");
+ },
+ standardizePath: () => {
+ abort("FS.standardizePath has been removed; use PATH.normalize instead");
+ }
+};
+
+function UTF8ToString(ptr, maxBytesToRead) {
+ assert(typeof ptr == "number");
+ return ptr ? UTF8ArrayToString(GROWABLE_HEAP_U8(), ptr, maxBytesToRead) : "";
+}
+
+var SYSCALLS = {
+ DEFAULT_POLLMASK: 5,
+ calculateAt: function(dirfd, path, allowEmpty) {
+ if (PATH.isAbs(path)) {
+ return path;
+ }
+ var dir;
+ if (dirfd === -100) {
+ dir = FS.cwd();
+ } else {
+ var dirstream = SYSCALLS.getStreamFromFD(dirfd);
+ dir = dirstream.path;
+ }
+ if (path.length == 0) {
+ if (!allowEmpty) {
+ throw new FS.ErrnoError(44);
+ }
+ return dir;
+ }
+ return PATH.join2(dir, path);
+ },
+ doStat: function(func, path, buf) {
+ try {
+ var stat = func(path);
+ } catch (e) {
+ if (e && e.node && PATH.normalize(path) !== PATH.normalize(FS.getPath(e.node))) {
+ return -54;
+ }
+ throw e;
+ }
+ GROWABLE_HEAP_I32()[buf >> 2] = stat.dev;
+ GROWABLE_HEAP_I32()[buf + 8 >> 2] = stat.ino;
+ GROWABLE_HEAP_I32()[buf + 12 >> 2] = stat.mode;
+ GROWABLE_HEAP_U32()[buf + 16 >> 2] = stat.nlink;
+ GROWABLE_HEAP_I32()[buf + 20 >> 2] = stat.uid;
+ GROWABLE_HEAP_I32()[buf + 24 >> 2] = stat.gid;
+ GROWABLE_HEAP_I32()[buf + 28 >> 2] = stat.rdev;
+ tempI64 = [ stat.size >>> 0, (tempDouble = stat.size, +Math.abs(tempDouble) >= 1 ? tempDouble > 0 ? +Math.floor(tempDouble / 4294967296) >>> 0 : ~~+Math.ceil((tempDouble - +(~~tempDouble >>> 0)) / 4294967296) >>> 0 : 0) ],
+ GROWABLE_HEAP_I32()[buf + 40 >> 2] = tempI64[0], GROWABLE_HEAP_I32()[buf + 44 >> 2] = tempI64[1];
+ GROWABLE_HEAP_I32()[buf + 48 >> 2] = 4096;
+ GROWABLE_HEAP_I32()[buf + 52 >> 2] = stat.blocks;
+ var atime = stat.atime.getTime();
+ var mtime = stat.mtime.getTime();
+ var ctime = stat.ctime.getTime();
+ tempI64 = [ Math.floor(atime / 1e3) >>> 0, (tempDouble = Math.floor(atime / 1e3),
+ +Math.abs(tempDouble) >= 1 ? tempDouble > 0 ? +Math.floor(tempDouble / 4294967296) >>> 0 : ~~+Math.ceil((tempDouble - +(~~tempDouble >>> 0)) / 4294967296) >>> 0 : 0) ],
+ GROWABLE_HEAP_I32()[buf + 56 >> 2] = tempI64[0], GROWABLE_HEAP_I32()[buf + 60 >> 2] = tempI64[1];
+ GROWABLE_HEAP_U32()[buf + 64 >> 2] = atime % 1e3 * 1e3;
+ tempI64 = [ Math.floor(mtime / 1e3) >>> 0, (tempDouble = Math.floor(mtime / 1e3),
+ +Math.abs(tempDouble) >= 1 ? tempDouble > 0 ? +Math.floor(tempDouble / 4294967296) >>> 0 : ~~+Math.ceil((tempDouble - +(~~tempDouble >>> 0)) / 4294967296) >>> 0 : 0) ],
+ GROWABLE_HEAP_I32()[buf + 72 >> 2] = tempI64[0], GROWABLE_HEAP_I32()[buf + 76 >> 2] = tempI64[1];
+ GROWABLE_HEAP_U32()[buf + 80 >> 2] = mtime % 1e3 * 1e3;
+ tempI64 = [ Math.floor(ctime / 1e3) >>> 0, (tempDouble = Math.floor(ctime / 1e3),
+ +Math.abs(tempDouble) >= 1 ? tempDouble > 0 ? +Math.floor(tempDouble / 4294967296) >>> 0 : ~~+Math.ceil((tempDouble - +(~~tempDouble >>> 0)) / 4294967296) >>> 0 : 0) ],
+ GROWABLE_HEAP_I32()[buf + 88 >> 2] = tempI64[0], GROWABLE_HEAP_I32()[buf + 92 >> 2] = tempI64[1];
+ GROWABLE_HEAP_U32()[buf + 96 >> 2] = ctime % 1e3 * 1e3;
+ tempI64 = [ stat.ino >>> 0, (tempDouble = stat.ino, +Math.abs(tempDouble) >= 1 ? tempDouble > 0 ? +Math.floor(tempDouble / 4294967296) >>> 0 : ~~+Math.ceil((tempDouble - +(~~tempDouble >>> 0)) / 4294967296) >>> 0 : 0) ],
+ GROWABLE_HEAP_I32()[buf + 104 >> 2] = tempI64[0], GROWABLE_HEAP_I32()[buf + 108 >> 2] = tempI64[1];
+ return 0;
+ },
+ doMsync: function(addr, stream, len, flags, offset) {
+ if (!FS.isFile(stream.node.mode)) {
+ throw new FS.ErrnoError(43);
+ }
+ if (flags & 2) {
+ return 0;
+ }
+ var buffer = GROWABLE_HEAP_U8().slice(addr, addr + len);
+ FS.msync(stream, buffer, offset, len, flags);
+ },
+ varargs: undefined,
+ get: function() {
+ assert(SYSCALLS.varargs != undefined);
+ SYSCALLS.varargs += 4;
+ var ret = GROWABLE_HEAP_I32()[SYSCALLS.varargs - 4 >> 2];
+ return ret;
+ },
+ getStr: function(ptr) {
+ var ret = UTF8ToString(ptr);
+ return ret;
+ },
+ getStreamFromFD: function(fd) {
+ var stream = FS.getStream(fd);
+ if (!stream) throw new FS.ErrnoError(8);
+ return stream;
+ }
+};
+
+function _proc_exit(code) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(1, 1, code);
+ EXITSTATUS = code;
+ if (!keepRuntimeAlive()) {
+ PThread.terminateAllThreads();
+ if (Module["onExit"]) Module["onExit"](code);
+ ABORT = true;
+ }
+ quit_(code, new ExitStatus(code));
+}
+
+function exitJS(status, implicit) {
+ EXITSTATUS = status;
+ if (ENVIRONMENT_IS_PTHREAD) {
+ assert(!implicit);
+ exitOnMainThread(status);
+ throw "unwind";
+ }
+ if (!keepRuntimeAlive()) {
+ exitRuntime();
+ }
+ if (keepRuntimeAlive() && !implicit) {
+ var msg = `program exited (with status: ${status}), but keepRuntimeAlive() is set (counter=${runtimeKeepaliveCounter}) due to an async operation, so halting execution but not exiting the runtime or preventing further async execution (you can use emscripten_force_exit, if you want to force a true shutdown)`;
+ readyPromiseReject(msg);
+ err(msg);
+ }
+ _proc_exit(status);
+}
+
+var _exit = exitJS;
+
+function ptrToString(ptr) {
+ assert(typeof ptr === "number");
+ return "0x" + ptr.toString(16).padStart(8, "0");
+}
+
+function handleException(e) {
+ if (e instanceof ExitStatus || e == "unwind") {
+ return EXITSTATUS;
+ }
+ checkStackCookie();
+ if (e instanceof WebAssembly.RuntimeError) {
+ if (_emscripten_stack_get_current() <= 0) {
+ err("Stack overflow detected. You can try increasing -sSTACK_SIZE (currently set to 5242880)");
+ }
+ }
+ quit_(1, e);
+}
+
+var PThread = {
+ unusedWorkers: [],
+ runningWorkers: [],
+ tlsInitFunctions: [],
+ pthreads: {},
+ nextWorkerID: 1,
+ debugInit: function() {
+ function pthreadLogPrefix() {
+ var t = 0;
+ if (runtimeInitialized && typeof _pthread_self != "undefined" && !runtimeExited) {
+ t = _pthread_self();
+ }
+ return "w:" + (Module["workerID"] || 0) + ",t:" + ptrToString(t) + ": ";
+ }
+ var origDbg = dbg;
+ dbg = message => origDbg(pthreadLogPrefix() + message);
+ },
+ init: function() {
+ PThread.debugInit();
+ if (ENVIRONMENT_IS_PTHREAD) {
+ PThread.initWorker();
+ } else {
+ PThread.initMainThread();
+ }
+ },
+ initMainThread: function() {
+ var pthreadPoolSize = 8;
+ while (pthreadPoolSize--) {
+ PThread.allocateUnusedWorker();
+ }
+ },
+ initWorker: function() {
+ noExitRuntime = false;
+ },
+ setExitStatus: function(status) {
+ EXITSTATUS = status;
+ },
+ terminateAllThreads__deps: [ "$terminateWorker" ],
+ terminateAllThreads: function() {
+ assert(!ENVIRONMENT_IS_PTHREAD, "Internal Error! terminateAllThreads() can only ever be called from main application thread!");
+ for (var worker of PThread.runningWorkers) {
+ terminateWorker(worker);
+ }
+ for (var worker of PThread.unusedWorkers) {
+ terminateWorker(worker);
+ }
+ PThread.unusedWorkers = [];
+ PThread.runningWorkers = [];
+ PThread.pthreads = [];
+ },
+ returnWorkerToPool: function(worker) {
+ var pthread_ptr = worker.pthread_ptr;
+ delete PThread.pthreads[pthread_ptr];
+ PThread.unusedWorkers.push(worker);
+ PThread.runningWorkers.splice(PThread.runningWorkers.indexOf(worker), 1);
+ worker.pthread_ptr = 0;
+ __emscripten_thread_free_data(pthread_ptr);
+ },
+ receiveObjectTransfer: function(data) {},
+ threadInitTLS: function() {
+ PThread.tlsInitFunctions.forEach(f => f());
+ },
+ loadWasmModuleToWorker: worker => new Promise(onFinishedLoading => {
+ worker.onmessage = e => {
+ var d = e["data"];
+ var cmd = d["cmd"];
+ if (worker.pthread_ptr) PThread.currentProxiedOperationCallerThread = worker.pthread_ptr;
+ if (d["targetThread"] && d["targetThread"] != _pthread_self()) {
+ var targetWorker = PThread.pthreads[d.targetThread];
+ if (targetWorker) {
+ targetWorker.postMessage(d, d["transferList"]);
+ } else {
+ err('Internal error! Worker sent a message "' + cmd + '" to target pthread ' + d["targetThread"] + ", but that thread no longer exists!");
+ }
+ PThread.currentProxiedOperationCallerThread = undefined;
+ return;
+ }
+ if (cmd === "checkMailbox") {
+ checkMailbox();
+ } else if (cmd === "spawnThread") {
+ spawnThread(d);
+ } else if (cmd === "cleanupThread") {
+ cleanupThread(d["thread"]);
+ } else if (cmd === "killThread") {
+ killThread(d["thread"]);
+ } else if (cmd === "cancelThread") {
+ cancelThread(d["thread"]);
+ } else if (cmd === "loaded") {
+ worker.loaded = true;
+ onFinishedLoading(worker);
+ } else if (cmd === "print") {
+ out("Thread " + d["threadId"] + ": " + d["text"]);
+ } else if (cmd === "printErr") {
+ err("Thread " + d["threadId"] + ": " + d["text"]);
+ } else if (cmd === "alert") {
+ alert("Thread " + d["threadId"] + ": " + d["text"]);
+ } else if (d.target === "setimmediate") {
+ worker.postMessage(d);
+ } else if (cmd === "callHandler") {
+ Module[d["handler"]](...d["args"]);
+ } else if (cmd) {
+ err("worker sent an unknown command " + cmd);
+ }
+ PThread.currentProxiedOperationCallerThread = undefined;
+ };
+ worker.onerror = e => {
+ var message = "worker sent an error!";
+ if (worker.pthread_ptr) {
+ message = "Pthread " + ptrToString(worker.pthread_ptr) + " sent an error!";
+ }
+ err(message + " " + e.filename + ":" + e.lineno + ": " + e.message);
+ throw e;
+ };
+ assert(wasmMemory instanceof WebAssembly.Memory, "WebAssembly memory should have been loaded by now!");
+ assert(wasmModule instanceof WebAssembly.Module, "WebAssembly Module should have been loaded by now!");
+ var handlers = [];
+ var knownHandlers = [ "onExit", "onAbort", "print", "printErr" ];
+ for (var handler of knownHandlers) {
+ if (Module.hasOwnProperty(handler)) {
+ handlers.push(handler);
+ }
+ }
+ worker.workerID = PThread.nextWorkerID++;
+ worker.postMessage({
+ "cmd": "load",
+ "handlers": handlers,
+ "urlOrBlob": Module["mainScriptUrlOrBlob"] || _scriptDir,
+ "wasmMemory": wasmMemory,
+ "wasmModule": wasmModule,
+ "workerID": worker.workerID
+ });
+ }),
+ loadWasmModuleToAllWorkers: function(onMaybeReady) {
+ if (ENVIRONMENT_IS_PTHREAD) {
+ return onMaybeReady();
+ }
+ let pthreadPoolReady = Promise.all(PThread.unusedWorkers.map(PThread.loadWasmModuleToWorker));
+ pthreadPoolReady.then(onMaybeReady);
+ },
+ allocateUnusedWorker: function() {
+ var worker;
+ var pthreadMainJs = locateFile("godot.web.template_release.wasm32.worker.js");
+ worker = new Worker(pthreadMainJs);
+ PThread.unusedWorkers.push(worker);
+ },
+ getNewWorker: function() {
+ if (PThread.unusedWorkers.length == 0) {
+ err("Tried to spawn a new thread, but the thread pool is exhausted.\n" + "This might result in a deadlock unless some threads eventually exit or the code explicitly breaks out to the event loop.\n" + "If you want to increase the pool size, use setting `-sPTHREAD_POOL_SIZE=...`." + "\nIf you want to throw an explicit error instead of the risk of deadlocking in those cases, use setting `-sPTHREAD_POOL_SIZE_STRICT=2`.");
+ PThread.allocateUnusedWorker();
+ PThread.loadWasmModuleToWorker(PThread.unusedWorkers[0]);
+ }
+ return PThread.unusedWorkers.pop();
+ }
+};
+
+Module["PThread"] = PThread;
+
+function callRuntimeCallbacks(callbacks) {
+ while (callbacks.length > 0) {
+ callbacks.shift()(Module);
+ }
+}
+
+function establishStackSpace() {
+ var pthread_ptr = _pthread_self();
+ var stackTop = GROWABLE_HEAP_I32()[pthread_ptr + 52 >> 2];
+ var stackSize = GROWABLE_HEAP_I32()[pthread_ptr + 56 >> 2];
+ var stackMax = stackTop - stackSize;
+ assert(stackTop != 0);
+ assert(stackMax != 0);
+ assert(stackTop > stackMax, "stackTop must be higher then stackMax");
+ _emscripten_stack_set_limits(stackTop, stackMax);
+ stackRestore(stackTop);
+ writeStackCookie();
+}
+
+Module["establishStackSpace"] = establishStackSpace;
+
+function exitOnMainThread(returnCode) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(2, 0, returnCode);
+ _exit(returnCode);
+}
+
+function getValue(ptr, type = "i8") {
+ if (type.endsWith("*")) type = "*";
+ switch (type) {
+ case "i1":
+ return GROWABLE_HEAP_I8()[ptr >> 0];
+
+ case "i8":
+ return GROWABLE_HEAP_I8()[ptr >> 0];
+
+ case "i16":
+ return GROWABLE_HEAP_I16()[ptr >> 1];
+
+ case "i32":
+ return GROWABLE_HEAP_I32()[ptr >> 2];
+
+ case "i64":
+ return GROWABLE_HEAP_I32()[ptr >> 2];
+
+ case "float":
+ return GROWABLE_HEAP_F32()[ptr >> 2];
+
+ case "double":
+ return GROWABLE_HEAP_F64()[ptr >> 3];
+
+ case "*":
+ return GROWABLE_HEAP_U32()[ptr >> 2];
+
+ default:
+ abort(`invalid type for getValue: ${type}`);
+ }
+}
+
+var wasmTableMirror = [];
+
+function getWasmTableEntry(funcPtr) {
+ var func = wasmTableMirror[funcPtr];
+ if (!func) {
+ if (funcPtr >= wasmTableMirror.length) wasmTableMirror.length = funcPtr + 1;
+ wasmTableMirror[funcPtr] = func = wasmTable.get(funcPtr);
+ }
+ assert(wasmTable.get(funcPtr) == func, "JavaScript-side Wasm function table mirror is out of date!");
+ return func;
+}
+
+function invokeEntryPoint(ptr, arg) {
+ runtimeKeepaliveCounter = 0;
+ var result = getWasmTableEntry(ptr)(arg);
+ checkStackCookie();
+ if (keepRuntimeAlive()) {
+ PThread.setExitStatus(result);
+ } else {
+ __emscripten_thread_exit(result);
+ }
+}
+
+Module["invokeEntryPoint"] = invokeEntryPoint;
+
+function registerTLSInit(tlsInitFunc) {
+ PThread.tlsInitFunctions.push(tlsInitFunc);
+}
+
+function setValue(ptr, value, type = "i8") {
+ if (type.endsWith("*")) type = "*";
+ switch (type) {
+ case "i1":
+ GROWABLE_HEAP_I8()[ptr >> 0] = value;
+ break;
+
+ case "i8":
+ GROWABLE_HEAP_I8()[ptr >> 0] = value;
+ break;
+
+ case "i16":
+ GROWABLE_HEAP_I16()[ptr >> 1] = value;
+ break;
+
+ case "i32":
+ GROWABLE_HEAP_I32()[ptr >> 2] = value;
+ break;
+
+ case "i64":
+ tempI64 = [ value >>> 0, (tempDouble = value, +Math.abs(tempDouble) >= 1 ? tempDouble > 0 ? +Math.floor(tempDouble / 4294967296) >>> 0 : ~~+Math.ceil((tempDouble - +(~~tempDouble >>> 0)) / 4294967296) >>> 0 : 0) ],
+ GROWABLE_HEAP_I32()[ptr >> 2] = tempI64[0], GROWABLE_HEAP_I32()[ptr + 4 >> 2] = tempI64[1];
+ break;
+
+ case "float":
+ GROWABLE_HEAP_F32()[ptr >> 2] = value;
+ break;
+
+ case "double":
+ GROWABLE_HEAP_F64()[ptr >> 3] = value;
+ break;
+
+ case "*":
+ GROWABLE_HEAP_U32()[ptr >> 2] = value;
+ break;
+
+ default:
+ abort(`invalid type for setValue: ${type}`);
+ }
+}
+
+function warnOnce(text) {
+ if (!warnOnce.shown) warnOnce.shown = {};
+ if (!warnOnce.shown[text]) {
+ warnOnce.shown[text] = 1;
+ err(text);
+ }
+}
+
+function ___assert_fail(condition, filename, line, func) {
+ abort(`Assertion failed: ${UTF8ToString(condition)}, at: ` + [ filename ? UTF8ToString(filename) : "unknown filename", line, func ? UTF8ToString(func) : "unknown function" ]);
+}
+
+function ___call_sighandler(fp, sig) {
+ getWasmTableEntry(fp)(sig);
+}
+
+var dlopenMissingError = "To use dlopen, you need enable dynamic linking, see https://emscripten.org/docs/compiling/Dynamic-Linking.html";
+
+function ___dlsym(handle, symbol) {
+ abort(dlopenMissingError);
+}
+
+function ___emscripten_init_main_thread_js(tb) {
+ __emscripten_thread_init(tb, !ENVIRONMENT_IS_WORKER, 1, !ENVIRONMENT_IS_WEB, 2097152);
+ PThread.threadInitTLS();
+}
+
+function ___emscripten_thread_cleanup(thread) {
+ if (!ENVIRONMENT_IS_PTHREAD) cleanupThread(thread); else postMessage({
+ "cmd": "cleanupThread",
+ "thread": thread
+ });
+}
+
+function pthreadCreateProxied(pthread_ptr, attr, startRoutine, arg) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(3, 1, pthread_ptr, attr, startRoutine, arg);
+ return ___pthread_create_js(pthread_ptr, attr, startRoutine, arg);
+}
+
+function ___pthread_create_js(pthread_ptr, attr, startRoutine, arg) {
+ if (typeof SharedArrayBuffer == "undefined") {
+ err("Current environment does not support SharedArrayBuffer, pthreads are not available!");
+ return 6;
+ }
+ var transferList = [];
+ var error = 0;
+ if (ENVIRONMENT_IS_PTHREAD && (transferList.length === 0 || error)) {
+ return pthreadCreateProxied(pthread_ptr, attr, startRoutine, arg);
+ }
+ if (error) return error;
+ var threadParams = {
+ startRoutine: startRoutine,
+ pthread_ptr: pthread_ptr,
+ arg: arg,
+ transferList: transferList
+ };
+ if (ENVIRONMENT_IS_PTHREAD) {
+ threadParams.cmd = "spawnThread";
+ postMessage(threadParams, transferList);
+ return 0;
+ }
+ return spawnThread(threadParams);
+}
+
+function ___syscall__newselect(nfds, readfds, writefds, exceptfds, timeout) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(4, 1, nfds, readfds, writefds, exceptfds, timeout);
+ try {
+ assert(nfds <= 64, "nfds must be less than or equal to 64");
+ assert(!exceptfds, "exceptfds not supported");
+ var total = 0;
+ var srcReadLow = readfds ? GROWABLE_HEAP_I32()[readfds >> 2] : 0, srcReadHigh = readfds ? GROWABLE_HEAP_I32()[readfds + 4 >> 2] : 0;
+ var srcWriteLow = writefds ? GROWABLE_HEAP_I32()[writefds >> 2] : 0, srcWriteHigh = writefds ? GROWABLE_HEAP_I32()[writefds + 4 >> 2] : 0;
+ var srcExceptLow = exceptfds ? GROWABLE_HEAP_I32()[exceptfds >> 2] : 0, srcExceptHigh = exceptfds ? GROWABLE_HEAP_I32()[exceptfds + 4 >> 2] : 0;
+ var dstReadLow = 0, dstReadHigh = 0;
+ var dstWriteLow = 0, dstWriteHigh = 0;
+ var dstExceptLow = 0, dstExceptHigh = 0;
+ var allLow = (readfds ? GROWABLE_HEAP_I32()[readfds >> 2] : 0) | (writefds ? GROWABLE_HEAP_I32()[writefds >> 2] : 0) | (exceptfds ? GROWABLE_HEAP_I32()[exceptfds >> 2] : 0);
+ var allHigh = (readfds ? GROWABLE_HEAP_I32()[readfds + 4 >> 2] : 0) | (writefds ? GROWABLE_HEAP_I32()[writefds + 4 >> 2] : 0) | (exceptfds ? GROWABLE_HEAP_I32()[exceptfds + 4 >> 2] : 0);
+ var check = function(fd, low, high, val) {
+ return fd < 32 ? low & val : high & val;
+ };
+ for (var fd = 0; fd < nfds; fd++) {
+ var mask = 1 << fd % 32;
+ if (!check(fd, allLow, allHigh, mask)) {
+ continue;
+ }
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ var flags = SYSCALLS.DEFAULT_POLLMASK;
+ if (stream.stream_ops.poll) {
+ flags = stream.stream_ops.poll(stream);
+ }
+ if (flags & 1 && check(fd, srcReadLow, srcReadHigh, mask)) {
+ fd < 32 ? dstReadLow = dstReadLow | mask : dstReadHigh = dstReadHigh | mask;
+ total++;
+ }
+ if (flags & 4 && check(fd, srcWriteLow, srcWriteHigh, mask)) {
+ fd < 32 ? dstWriteLow = dstWriteLow | mask : dstWriteHigh = dstWriteHigh | mask;
+ total++;
+ }
+ if (flags & 2 && check(fd, srcExceptLow, srcExceptHigh, mask)) {
+ fd < 32 ? dstExceptLow = dstExceptLow | mask : dstExceptHigh = dstExceptHigh | mask;
+ total++;
+ }
+ }
+ if (readfds) {
+ GROWABLE_HEAP_I32()[readfds >> 2] = dstReadLow;
+ GROWABLE_HEAP_I32()[readfds + 4 >> 2] = dstReadHigh;
+ }
+ if (writefds) {
+ GROWABLE_HEAP_I32()[writefds >> 2] = dstWriteLow;
+ GROWABLE_HEAP_I32()[writefds + 4 >> 2] = dstWriteHigh;
+ }
+ if (exceptfds) {
+ GROWABLE_HEAP_I32()[exceptfds >> 2] = dstExceptLow;
+ GROWABLE_HEAP_I32()[exceptfds + 4 >> 2] = dstExceptHigh;
+ }
+ return total;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+var SOCKFS = {
+ mount: function(mount) {
+ Module["websocket"] = Module["websocket"] && "object" === typeof Module["websocket"] ? Module["websocket"] : {};
+ Module["websocket"]._callbacks = {};
+ Module["websocket"]["on"] = function(event, callback) {
+ if ("function" === typeof callback) {
+ this._callbacks[event] = callback;
+ }
+ return this;
+ };
+ Module["websocket"].emit = function(event, param) {
+ if ("function" === typeof this._callbacks[event]) {
+ this._callbacks[event].call(this, param);
+ }
+ };
+ return FS.createNode(null, "/", 16384 | 511, 0);
+ },
+ createSocket: function(family, type, protocol) {
+ type &= ~526336;
+ var streaming = type == 1;
+ if (streaming && protocol && protocol != 6) {
+ throw new FS.ErrnoError(66);
+ }
+ var sock = {
+ family: family,
+ type: type,
+ protocol: protocol,
+ server: null,
+ error: null,
+ peers: {},
+ pending: [],
+ recv_queue: [],
+ sock_ops: SOCKFS.websocket_sock_ops
+ };
+ var name = SOCKFS.nextname();
+ var node = FS.createNode(SOCKFS.root, name, 49152, 0);
+ node.sock = sock;
+ var stream = FS.createStream({
+ path: name,
+ node: node,
+ flags: 2,
+ seekable: false,
+ stream_ops: SOCKFS.stream_ops
+ });
+ sock.stream = stream;
+ return sock;
+ },
+ getSocket: function(fd) {
+ var stream = FS.getStream(fd);
+ if (!stream || !FS.isSocket(stream.node.mode)) {
+ return null;
+ }
+ return stream.node.sock;
+ },
+ stream_ops: {
+ poll: function(stream) {
+ var sock = stream.node.sock;
+ return sock.sock_ops.poll(sock);
+ },
+ ioctl: function(stream, request, varargs) {
+ var sock = stream.node.sock;
+ return sock.sock_ops.ioctl(sock, request, varargs);
+ },
+ read: function(stream, buffer, offset, length, position) {
+ var sock = stream.node.sock;
+ var msg = sock.sock_ops.recvmsg(sock, length);
+ if (!msg) {
+ return 0;
+ }
+ buffer.set(msg.buffer, offset);
+ return msg.buffer.length;
+ },
+ write: function(stream, buffer, offset, length, position) {
+ var sock = stream.node.sock;
+ return sock.sock_ops.sendmsg(sock, buffer, offset, length);
+ },
+ close: function(stream) {
+ var sock = stream.node.sock;
+ sock.sock_ops.close(sock);
+ }
+ },
+ nextname: function() {
+ if (!SOCKFS.nextname.current) {
+ SOCKFS.nextname.current = 0;
+ }
+ return "socket[" + SOCKFS.nextname.current++ + "]";
+ },
+ websocket_sock_ops: {
+ createPeer: function(sock, addr, port) {
+ var ws;
+ if (typeof addr == "object") {
+ ws = addr;
+ addr = null;
+ port = null;
+ }
+ if (ws) {
+ if (ws._socket) {
+ addr = ws._socket.remoteAddress;
+ port = ws._socket.remotePort;
+ } else {
+ var result = /ws[s]?:\/\/([^:]+):(\d+)/.exec(ws.url);
+ if (!result) {
+ throw new Error("WebSocket URL must be in the format ws(s)://address:port");
+ }
+ addr = result[1];
+ port = parseInt(result[2], 10);
+ }
+ } else {
+ try {
+ var runtimeConfig = Module["websocket"] && "object" === typeof Module["websocket"];
+ var url = "ws:#".replace("#", "//");
+ if (runtimeConfig) {
+ if ("string" === typeof Module["websocket"]["url"]) {
+ url = Module["websocket"]["url"];
+ }
+ }
+ if (url === "ws://" || url === "wss://") {
+ var parts = addr.split("/");
+ url = url + parts[0] + ":" + port + "/" + parts.slice(1).join("/");
+ }
+ var subProtocols = "binary";
+ if (runtimeConfig) {
+ if ("string" === typeof Module["websocket"]["subprotocol"]) {
+ subProtocols = Module["websocket"]["subprotocol"];
+ }
+ }
+ var opts = undefined;
+ if (subProtocols !== "null") {
+ subProtocols = subProtocols.replace(/^ +| +$/g, "").split(/ *, */);
+ opts = subProtocols;
+ }
+ if (runtimeConfig && null === Module["websocket"]["subprotocol"]) {
+ subProtocols = "null";
+ opts = undefined;
+ }
+ var WebSocketConstructor;
+ {
+ WebSocketConstructor = WebSocket;
+ }
+ ws = new WebSocketConstructor(url, opts);
+ ws.binaryType = "arraybuffer";
+ } catch (e) {
+ throw new FS.ErrnoError(23);
+ }
+ }
+ var peer = {
+ addr: addr,
+ port: port,
+ socket: ws,
+ dgram_send_queue: []
+ };
+ SOCKFS.websocket_sock_ops.addPeer(sock, peer);
+ SOCKFS.websocket_sock_ops.handlePeerEvents(sock, peer);
+ if (sock.type === 2 && typeof sock.sport != "undefined") {
+ peer.dgram_send_queue.push(new Uint8Array([ 255, 255, 255, 255, "p".charCodeAt(0), "o".charCodeAt(0), "r".charCodeAt(0), "t".charCodeAt(0), (sock.sport & 65280) >> 8, sock.sport & 255 ]));
+ }
+ return peer;
+ },
+ getPeer: function(sock, addr, port) {
+ return sock.peers[addr + ":" + port];
+ },
+ addPeer: function(sock, peer) {
+ sock.peers[peer.addr + ":" + peer.port] = peer;
+ },
+ removePeer: function(sock, peer) {
+ delete sock.peers[peer.addr + ":" + peer.port];
+ },
+ handlePeerEvents: function(sock, peer) {
+ var first = true;
+ var handleOpen = function() {
+ Module["websocket"].emit("open", sock.stream.fd);
+ try {
+ var queued = peer.dgram_send_queue.shift();
+ while (queued) {
+ peer.socket.send(queued);
+ queued = peer.dgram_send_queue.shift();
+ }
+ } catch (e) {
+ peer.socket.close();
+ }
+ };
+ function handleMessage(data) {
+ if (typeof data == "string") {
+ var encoder = new TextEncoder();
+ data = encoder.encode(data);
+ } else {
+ assert(data.byteLength !== undefined);
+ if (data.byteLength == 0) {
+ return;
+ }
+ data = new Uint8Array(data);
+ }
+ var wasfirst = first;
+ first = false;
+ if (wasfirst && data.length === 10 && data[0] === 255 && data[1] === 255 && data[2] === 255 && data[3] === 255 && data[4] === "p".charCodeAt(0) && data[5] === "o".charCodeAt(0) && data[6] === "r".charCodeAt(0) && data[7] === "t".charCodeAt(0)) {
+ var newport = data[8] << 8 | data[9];
+ SOCKFS.websocket_sock_ops.removePeer(sock, peer);
+ peer.port = newport;
+ SOCKFS.websocket_sock_ops.addPeer(sock, peer);
+ return;
+ }
+ sock.recv_queue.push({
+ addr: peer.addr,
+ port: peer.port,
+ data: data
+ });
+ Module["websocket"].emit("message", sock.stream.fd);
+ }
+ if (ENVIRONMENT_IS_NODE) {
+ peer.socket.on("open", handleOpen);
+ peer.socket.on("message", function(data, isBinary) {
+ if (!isBinary) {
+ return;
+ }
+ handleMessage(new Uint8Array(data).buffer);
+ });
+ peer.socket.on("close", function() {
+ Module["websocket"].emit("close", sock.stream.fd);
+ });
+ peer.socket.on("error", function(error) {
+ sock.error = 14;
+ Module["websocket"].emit("error", [ sock.stream.fd, sock.error, "ECONNREFUSED: Connection refused" ]);
+ });
+ } else {
+ peer.socket.onopen = handleOpen;
+ peer.socket.onclose = function() {
+ Module["websocket"].emit("close", sock.stream.fd);
+ };
+ peer.socket.onmessage = function peer_socket_onmessage(event) {
+ handleMessage(event.data);
+ };
+ peer.socket.onerror = function(error) {
+ sock.error = 14;
+ Module["websocket"].emit("error", [ sock.stream.fd, sock.error, "ECONNREFUSED: Connection refused" ]);
+ };
+ }
+ },
+ poll: function(sock) {
+ if (sock.type === 1 && sock.server) {
+ return sock.pending.length ? 64 | 1 : 0;
+ }
+ var mask = 0;
+ var dest = sock.type === 1 ? SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport) : null;
+ if (sock.recv_queue.length || !dest || dest && dest.socket.readyState === dest.socket.CLOSING || dest && dest.socket.readyState === dest.socket.CLOSED) {
+ mask |= 64 | 1;
+ }
+ if (!dest || dest && dest.socket.readyState === dest.socket.OPEN) {
+ mask |= 4;
+ }
+ if (dest && dest.socket.readyState === dest.socket.CLOSING || dest && dest.socket.readyState === dest.socket.CLOSED) {
+ mask |= 16;
+ }
+ return mask;
+ },
+ ioctl: function(sock, request, arg) {
+ switch (request) {
+ case 21531:
+ var bytes = 0;
+ if (sock.recv_queue.length) {
+ bytes = sock.recv_queue[0].data.length;
+ }
+ GROWABLE_HEAP_I32()[arg >> 2] = bytes;
+ return 0;
+
+ default:
+ return 28;
+ }
+ },
+ close: function(sock) {
+ if (sock.server) {
+ try {
+ sock.server.close();
+ } catch (e) {}
+ sock.server = null;
+ }
+ var peers = Object.keys(sock.peers);
+ for (var i = 0; i < peers.length; i++) {
+ var peer = sock.peers[peers[i]];
+ try {
+ peer.socket.close();
+ } catch (e) {}
+ SOCKFS.websocket_sock_ops.removePeer(sock, peer);
+ }
+ return 0;
+ },
+ bind: function(sock, addr, port) {
+ if (typeof sock.saddr != "undefined" || typeof sock.sport != "undefined") {
+ throw new FS.ErrnoError(28);
+ }
+ sock.saddr = addr;
+ sock.sport = port;
+ if (sock.type === 2) {
+ if (sock.server) {
+ sock.server.close();
+ sock.server = null;
+ }
+ try {
+ sock.sock_ops.listen(sock, 0);
+ } catch (e) {
+ if (!(e.name === "ErrnoError")) throw e;
+ if (e.errno !== 138) throw e;
+ }
+ }
+ },
+ connect: function(sock, addr, port) {
+ if (sock.server) {
+ throw new FS.ErrnoError(138);
+ }
+ if (typeof sock.daddr != "undefined" && typeof sock.dport != "undefined") {
+ var dest = SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport);
+ if (dest) {
+ if (dest.socket.readyState === dest.socket.CONNECTING) {
+ throw new FS.ErrnoError(7);
+ } else {
+ throw new FS.ErrnoError(30);
+ }
+ }
+ }
+ var peer = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port);
+ sock.daddr = peer.addr;
+ sock.dport = peer.port;
+ throw new FS.ErrnoError(26);
+ },
+ listen: function(sock, backlog) {
+ if (!ENVIRONMENT_IS_NODE) {
+ throw new FS.ErrnoError(138);
+ }
+ },
+ accept: function(listensock) {
+ if (!listensock.server || !listensock.pending.length) {
+ throw new FS.ErrnoError(28);
+ }
+ var newsock = listensock.pending.shift();
+ newsock.stream.flags = listensock.stream.flags;
+ return newsock;
+ },
+ getname: function(sock, peer) {
+ var addr, port;
+ if (peer) {
+ if (sock.daddr === undefined || sock.dport === undefined) {
+ throw new FS.ErrnoError(53);
+ }
+ addr = sock.daddr;
+ port = sock.dport;
+ } else {
+ addr = sock.saddr || 0;
+ port = sock.sport || 0;
+ }
+ return {
+ addr: addr,
+ port: port
+ };
+ },
+ sendmsg: function(sock, buffer, offset, length, addr, port) {
+ if (sock.type === 2) {
+ if (addr === undefined || port === undefined) {
+ addr = sock.daddr;
+ port = sock.dport;
+ }
+ if (addr === undefined || port === undefined) {
+ throw new FS.ErrnoError(17);
+ }
+ } else {
+ addr = sock.daddr;
+ port = sock.dport;
+ }
+ var dest = SOCKFS.websocket_sock_ops.getPeer(sock, addr, port);
+ if (sock.type === 1) {
+ if (!dest || dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) {
+ throw new FS.ErrnoError(53);
+ } else if (dest.socket.readyState === dest.socket.CONNECTING) {
+ throw new FS.ErrnoError(6);
+ }
+ }
+ if (ArrayBuffer.isView(buffer)) {
+ offset += buffer.byteOffset;
+ buffer = buffer.buffer;
+ }
+ var data;
+ if (buffer instanceof SharedArrayBuffer) {
+ data = new Uint8Array(new Uint8Array(buffer.slice(offset, offset + length))).buffer;
+ } else {
+ data = buffer.slice(offset, offset + length);
+ }
+ if (sock.type === 2) {
+ if (!dest || dest.socket.readyState !== dest.socket.OPEN) {
+ if (!dest || dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) {
+ dest = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port);
+ }
+ dest.dgram_send_queue.push(data);
+ return length;
+ }
+ }
+ try {
+ dest.socket.send(data);
+ return length;
+ } catch (e) {
+ throw new FS.ErrnoError(28);
+ }
+ },
+ recvmsg: function(sock, length) {
+ if (sock.type === 1 && sock.server) {
+ throw new FS.ErrnoError(53);
+ }
+ var queued = sock.recv_queue.shift();
+ if (!queued) {
+ if (sock.type === 1) {
+ var dest = SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport);
+ if (!dest) {
+ throw new FS.ErrnoError(53);
+ }
+ if (dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) {
+ return null;
+ }
+ throw new FS.ErrnoError(6);
+ }
+ throw new FS.ErrnoError(6);
+ }
+ var queuedLength = queued.data.byteLength || queued.data.length;
+ var queuedOffset = queued.data.byteOffset || 0;
+ var queuedBuffer = queued.data.buffer || queued.data;
+ var bytesRead = Math.min(length, queuedLength);
+ var res = {
+ buffer: new Uint8Array(queuedBuffer, queuedOffset, bytesRead),
+ addr: queued.addr,
+ port: queued.port
+ };
+ if (sock.type === 1 && bytesRead < queuedLength) {
+ var bytesRemaining = queuedLength - bytesRead;
+ queued.data = new Uint8Array(queuedBuffer, queuedOffset + bytesRead, bytesRemaining);
+ sock.recv_queue.unshift(queued);
+ }
+ return res;
+ }
+ }
+};
+
+function getSocketFromFD(fd) {
+ var socket = SOCKFS.getSocket(fd);
+ if (!socket) throw new FS.ErrnoError(8);
+ return socket;
+}
+
+function setErrNo(value) {
+ GROWABLE_HEAP_I32()[___errno_location() >> 2] = value;
+ return value;
+}
+
+var Sockets = {
+ BUFFER_SIZE: 10240,
+ MAX_BUFFER_SIZE: 10485760,
+ nextFd: 1,
+ fds: {},
+ nextport: 1,
+ maxport: 65535,
+ peer: null,
+ connections: {},
+ portmap: {},
+ localAddr: 4261412874,
+ addrPool: [ 33554442, 50331658, 67108874, 83886090, 100663306, 117440522, 134217738, 150994954, 167772170, 184549386, 201326602, 218103818, 234881034 ]
+};
+
+function inetPton4(str) {
+ var b = str.split(".");
+ for (var i = 0; i < 4; i++) {
+ var tmp = Number(b[i]);
+ if (isNaN(tmp)) return null;
+ b[i] = tmp;
+ }
+ return (b[0] | b[1] << 8 | b[2] << 16 | b[3] << 24) >>> 0;
+}
+
+function jstoi_q(str) {
+ return parseInt(str);
+}
+
+function inetPton6(str) {
+ var words;
+ var w, offset, z, i;
+ var valid6regx = /^((?=.*::)(?!.*::.+::)(::)?([\dA-F]{1,4}:(:|\b)|){5}|([\dA-F]{1,4}:){6})((([\dA-F]{1,4}((?!\3)::|:\b|$))|(?!\2\3)){2}|(((2[0-4]|1\d|[1-9])?\d|25[0-5])\.?\b){4})$/i;
+ var parts = [];
+ if (!valid6regx.test(str)) {
+ return null;
+ }
+ if (str === "::") {
+ return [ 0, 0, 0, 0, 0, 0, 0, 0 ];
+ }
+ if (str.startsWith("::")) {
+ str = str.replace("::", "Z:");
+ } else {
+ str = str.replace("::", ":Z:");
+ }
+ if (str.indexOf(".") > 0) {
+ str = str.replace(new RegExp("[.]", "g"), ":");
+ words = str.split(":");
+ words[words.length - 4] = jstoi_q(words[words.length - 4]) + jstoi_q(words[words.length - 3]) * 256;
+ words[words.length - 3] = jstoi_q(words[words.length - 2]) + jstoi_q(words[words.length - 1]) * 256;
+ words = words.slice(0, words.length - 2);
+ } else {
+ words = str.split(":");
+ }
+ offset = 0;
+ z = 0;
+ for (w = 0; w < words.length; w++) {
+ if (typeof words[w] == "string") {
+ if (words[w] === "Z") {
+ for (z = 0; z < 8 - words.length + 1; z++) {
+ parts[w + z] = 0;
+ }
+ offset = z - 1;
+ } else {
+ parts[w + offset] = _htons(parseInt(words[w], 16));
+ }
+ } else {
+ parts[w + offset] = words[w];
+ }
+ }
+ return [ parts[1] << 16 | parts[0], parts[3] << 16 | parts[2], parts[5] << 16 | parts[4], parts[7] << 16 | parts[6] ];
+}
+
+function writeSockaddr(sa, family, addr, port, addrlen) {
+ switch (family) {
+ case 2:
+ addr = inetPton4(addr);
+ zeroMemory(sa, 16);
+ if (addrlen) {
+ GROWABLE_HEAP_I32()[addrlen >> 2] = 16;
+ }
+ GROWABLE_HEAP_I16()[sa >> 1] = family;
+ GROWABLE_HEAP_I32()[sa + 4 >> 2] = addr;
+ GROWABLE_HEAP_I16()[sa + 2 >> 1] = _htons(port);
+ break;
+
+ case 10:
+ addr = inetPton6(addr);
+ zeroMemory(sa, 28);
+ if (addrlen) {
+ GROWABLE_HEAP_I32()[addrlen >> 2] = 28;
+ }
+ GROWABLE_HEAP_I32()[sa >> 2] = family;
+ GROWABLE_HEAP_I32()[sa + 8 >> 2] = addr[0];
+ GROWABLE_HEAP_I32()[sa + 12 >> 2] = addr[1];
+ GROWABLE_HEAP_I32()[sa + 16 >> 2] = addr[2];
+ GROWABLE_HEAP_I32()[sa + 20 >> 2] = addr[3];
+ GROWABLE_HEAP_I16()[sa + 2 >> 1] = _htons(port);
+ break;
+
+ default:
+ return 5;
+ }
+ return 0;
+}
+
+var DNS = {
+ address_map: {
+ id: 1,
+ addrs: {},
+ names: {}
+ },
+ lookup_name: function(name) {
+ var res = inetPton4(name);
+ if (res !== null) {
+ return name;
+ }
+ res = inetPton6(name);
+ if (res !== null) {
+ return name;
+ }
+ var addr;
+ if (DNS.address_map.addrs[name]) {
+ addr = DNS.address_map.addrs[name];
+ } else {
+ var id = DNS.address_map.id++;
+ assert(id < 65535, "exceeded max address mappings of 65535");
+ addr = "172.29." + (id & 255) + "." + (id & 65280);
+ DNS.address_map.names[addr] = name;
+ DNS.address_map.addrs[name] = addr;
+ }
+ return addr;
+ },
+ lookup_addr: function(addr) {
+ if (DNS.address_map.names[addr]) {
+ return DNS.address_map.names[addr];
+ }
+ return null;
+ }
+};
+
+function ___syscall_accept4(fd, addr, addrlen, flags, d1, d2) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(5, 1, fd, addr, addrlen, flags, d1, d2);
+ try {
+ var sock = getSocketFromFD(fd);
+ var newsock = sock.sock_ops.accept(sock);
+ if (addr) {
+ var errno = writeSockaddr(addr, newsock.family, DNS.lookup_name(newsock.daddr), newsock.dport, addrlen);
+ assert(!errno);
+ }
+ return newsock.stream.fd;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function inetNtop4(addr) {
+ return (addr & 255) + "." + (addr >> 8 & 255) + "." + (addr >> 16 & 255) + "." + (addr >> 24 & 255);
+}
+
+function inetNtop6(ints) {
+ var str = "";
+ var word = 0;
+ var longest = 0;
+ var lastzero = 0;
+ var zstart = 0;
+ var len = 0;
+ var i = 0;
+ var parts = [ ints[0] & 65535, ints[0] >> 16, ints[1] & 65535, ints[1] >> 16, ints[2] & 65535, ints[2] >> 16, ints[3] & 65535, ints[3] >> 16 ];
+ var hasipv4 = true;
+ var v4part = "";
+ for (i = 0; i < 5; i++) {
+ if (parts[i] !== 0) {
+ hasipv4 = false;
+ break;
+ }
+ }
+ if (hasipv4) {
+ v4part = inetNtop4(parts[6] | parts[7] << 16);
+ if (parts[5] === -1) {
+ str = "::ffff:";
+ str += v4part;
+ return str;
+ }
+ if (parts[5] === 0) {
+ str = "::";
+ if (v4part === "0.0.0.0") v4part = "";
+ if (v4part === "0.0.0.1") v4part = "1";
+ str += v4part;
+ return str;
+ }
+ }
+ for (word = 0; word < 8; word++) {
+ if (parts[word] === 0) {
+ if (word - lastzero > 1) {
+ len = 0;
+ }
+ lastzero = word;
+ len++;
+ }
+ if (len > longest) {
+ longest = len;
+ zstart = word - longest + 1;
+ }
+ }
+ for (word = 0; word < 8; word++) {
+ if (longest > 1) {
+ if (parts[word] === 0 && word >= zstart && word < zstart + longest) {
+ if (word === zstart) {
+ str += ":";
+ if (zstart === 0) str += ":";
+ }
+ continue;
+ }
+ }
+ str += Number(_ntohs(parts[word] & 65535)).toString(16);
+ str += word < 7 ? ":" : "";
+ }
+ return str;
+}
+
+function readSockaddr(sa, salen) {
+ var family = GROWABLE_HEAP_I16()[sa >> 1];
+ var port = _ntohs(GROWABLE_HEAP_U16()[sa + 2 >> 1]);
+ var addr;
+ switch (family) {
+ case 2:
+ if (salen !== 16) {
+ return {
+ errno: 28
+ };
+ }
+ addr = GROWABLE_HEAP_I32()[sa + 4 >> 2];
+ addr = inetNtop4(addr);
+ break;
+
+ case 10:
+ if (salen !== 28) {
+ return {
+ errno: 28
+ };
+ }
+ addr = [ GROWABLE_HEAP_I32()[sa + 8 >> 2], GROWABLE_HEAP_I32()[sa + 12 >> 2], GROWABLE_HEAP_I32()[sa + 16 >> 2], GROWABLE_HEAP_I32()[sa + 20 >> 2] ];
+ addr = inetNtop6(addr);
+ break;
+
+ default:
+ return {
+ errno: 5
+ };
+ }
+ return {
+ family: family,
+ addr: addr,
+ port: port
+ };
+}
+
+function getSocketAddress(addrp, addrlen, allowNull) {
+ if (allowNull && addrp === 0) return null;
+ var info = readSockaddr(addrp, addrlen);
+ if (info.errno) throw new FS.ErrnoError(info.errno);
+ info.addr = DNS.lookup_addr(info.addr) || info.addr;
+ return info;
+}
+
+function ___syscall_bind(fd, addr, addrlen, d1, d2, d3) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(6, 1, fd, addr, addrlen, d1, d2, d3);
+ try {
+ var sock = getSocketFromFD(fd);
+ var info = getSocketAddress(addr, addrlen);
+ sock.sock_ops.bind(sock, info.addr, info.port);
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function ___syscall_chdir(path) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(7, 1, path);
+ try {
+ path = SYSCALLS.getStr(path);
+ FS.chdir(path);
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function ___syscall_chmod(path, mode) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(8, 1, path, mode);
+ try {
+ path = SYSCALLS.getStr(path);
+ FS.chmod(path, mode);
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function ___syscall_connect(fd, addr, addrlen, d1, d2, d3) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(9, 1, fd, addr, addrlen, d1, d2, d3);
+ try {
+ var sock = getSocketFromFD(fd);
+ var info = getSocketAddress(addr, addrlen);
+ sock.sock_ops.connect(sock, info.addr, info.port);
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function ___syscall_faccessat(dirfd, path, amode, flags) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(10, 1, dirfd, path, amode, flags);
+ try {
+ path = SYSCALLS.getStr(path);
+ assert(flags === 0);
+ path = SYSCALLS.calculateAt(dirfd, path);
+ if (amode & ~7) {
+ return -28;
+ }
+ var lookup = FS.lookupPath(path, {
+ follow: true
+ });
+ var node = lookup.node;
+ if (!node) {
+ return -44;
+ }
+ var perms = "";
+ if (amode & 4) perms += "r";
+ if (amode & 2) perms += "w";
+ if (amode & 1) perms += "x";
+ if (perms && FS.nodePermissions(node, perms)) {
+ return -2;
+ }
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function ___syscall_fchmod(fd, mode) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(11, 1, fd, mode);
+ try {
+ FS.fchmod(fd, mode);
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function ___syscall_fcntl64(fd, cmd, varargs) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(12, 1, fd, cmd, varargs);
+ SYSCALLS.varargs = varargs;
+ try {
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ switch (cmd) {
+ case 0:
+ {
+ var arg = SYSCALLS.get();
+ if (arg < 0) {
+ return -28;
+ }
+ var newStream;
+ newStream = FS.createStream(stream, arg);
+ return newStream.fd;
+ }
+
+ case 1:
+ case 2:
+ return 0;
+
+ case 3:
+ return stream.flags;
+
+ case 4:
+ {
+ var arg = SYSCALLS.get();
+ stream.flags |= arg;
+ return 0;
+ }
+
+ case 5:
+ {
+ var arg = SYSCALLS.get();
+ var offset = 0;
+ GROWABLE_HEAP_I16()[arg + offset >> 1] = 2;
+ return 0;
+ }
+
+ case 6:
+ case 7:
+ return 0;
+
+ case 16:
+ case 8:
+ return -28;
+
+ case 9:
+ setErrNo(28);
+ return -1;
+
+ default:
+ {
+ return -28;
+ }
+ }
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function stringToUTF8(str, outPtr, maxBytesToWrite) {
+ assert(typeof maxBytesToWrite == "number", "stringToUTF8(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!");
+ return stringToUTF8Array(str, GROWABLE_HEAP_U8(), outPtr, maxBytesToWrite);
+}
+
+function ___syscall_getcwd(buf, size) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(13, 1, buf, size);
+ try {
+ if (size === 0) return -28;
+ var cwd = FS.cwd();
+ var cwdLengthInBytes = lengthBytesUTF8(cwd) + 1;
+ if (size < cwdLengthInBytes) return -68;
+ stringToUTF8(cwd, buf, size);
+ return cwdLengthInBytes;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function ___syscall_getdents64(fd, dirp, count) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(14, 1, fd, dirp, count);
+ try {
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ if (!stream.getdents) {
+ stream.getdents = FS.readdir(stream.path);
+ }
+ var struct_size = 280;
+ var pos = 0;
+ var off = FS.llseek(stream, 0, 1);
+ var idx = Math.floor(off / struct_size);
+ while (idx < stream.getdents.length && pos + struct_size <= count) {
+ var id;
+ var type;
+ var name = stream.getdents[idx];
+ if (name === ".") {
+ id = stream.node.id;
+ type = 4;
+ } else if (name === "..") {
+ var lookup = FS.lookupPath(stream.path, {
+ parent: true
+ });
+ id = lookup.node.id;
+ type = 4;
+ } else {
+ var child = FS.lookupNode(stream.node, name);
+ id = child.id;
+ type = FS.isChrdev(child.mode) ? 2 : FS.isDir(child.mode) ? 4 : FS.isLink(child.mode) ? 10 : 8;
+ }
+ assert(id);
+ tempI64 = [ id >>> 0, (tempDouble = id, +Math.abs(tempDouble) >= 1 ? tempDouble > 0 ? +Math.floor(tempDouble / 4294967296) >>> 0 : ~~+Math.ceil((tempDouble - +(~~tempDouble >>> 0)) / 4294967296) >>> 0 : 0) ],
+ GROWABLE_HEAP_I32()[dirp + pos >> 2] = tempI64[0], GROWABLE_HEAP_I32()[dirp + pos + 4 >> 2] = tempI64[1];
+ tempI64 = [ (idx + 1) * struct_size >>> 0, (tempDouble = (idx + 1) * struct_size,
+ +Math.abs(tempDouble) >= 1 ? tempDouble > 0 ? +Math.floor(tempDouble / 4294967296) >>> 0 : ~~+Math.ceil((tempDouble - +(~~tempDouble >>> 0)) / 4294967296) >>> 0 : 0) ],
+ GROWABLE_HEAP_I32()[dirp + pos + 8 >> 2] = tempI64[0], GROWABLE_HEAP_I32()[dirp + pos + 12 >> 2] = tempI64[1];
+ GROWABLE_HEAP_I16()[dirp + pos + 16 >> 1] = 280;
+ GROWABLE_HEAP_I8()[dirp + pos + 18 >> 0] = type;
+ stringToUTF8(name, dirp + pos + 19, 256);
+ pos += struct_size;
+ idx += 1;
+ }
+ FS.llseek(stream, idx * struct_size, 0);
+ return pos;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function ___syscall_getsockname(fd, addr, addrlen, d1, d2, d3) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(15, 1, fd, addr, addrlen, d1, d2, d3);
+ try {
+ var sock = getSocketFromFD(fd);
+ var errno = writeSockaddr(addr, sock.family, DNS.lookup_name(sock.saddr || "0.0.0.0"), sock.sport, addrlen);
+ assert(!errno);
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function ___syscall_getsockopt(fd, level, optname, optval, optlen, d1) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(16, 1, fd, level, optname, optval, optlen, d1);
+ try {
+ var sock = getSocketFromFD(fd);
+ if (level === 1) {
+ if (optname === 4) {
+ GROWABLE_HEAP_I32()[optval >> 2] = sock.error;
+ GROWABLE_HEAP_I32()[optlen >> 2] = 4;
+ sock.error = null;
+ return 0;
+ }
+ }
+ return -50;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function ___syscall_ioctl(fd, op, varargs) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(17, 1, fd, op, varargs);
+ SYSCALLS.varargs = varargs;
+ try {
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ switch (op) {
+ case 21509:
+ case 21505:
+ {
+ if (!stream.tty) return -59;
+ return 0;
+ }
+
+ case 21510:
+ case 21511:
+ case 21512:
+ case 21506:
+ case 21507:
+ case 21508:
+ {
+ if (!stream.tty) return -59;
+ return 0;
+ }
+
+ case 21519:
+ {
+ if (!stream.tty) return -59;
+ var argp = SYSCALLS.get();
+ GROWABLE_HEAP_I32()[argp >> 2] = 0;
+ return 0;
+ }
+
+ case 21520:
+ {
+ if (!stream.tty) return -59;
+ return -28;
+ }
+
+ case 21531:
+ {
+ var argp = SYSCALLS.get();
+ return FS.ioctl(stream, op, argp);
+ }
+
+ case 21523:
+ {
+ if (!stream.tty) return -59;
+ return 0;
+ }
+
+ case 21524:
+ {
+ if (!stream.tty) return -59;
+ return 0;
+ }
+
+ default:
+ return -28;
+ }
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function ___syscall_listen(fd, backlog) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(18, 1, fd, backlog);
+ try {
+ var sock = getSocketFromFD(fd);
+ sock.sock_ops.listen(sock, backlog);
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function ___syscall_lstat64(path, buf) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(19, 1, path, buf);
+ try {
+ path = SYSCALLS.getStr(path);
+ return SYSCALLS.doStat(FS.lstat, path, buf);
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function ___syscall_mkdirat(dirfd, path, mode) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(20, 1, dirfd, path, mode);
+ try {
+ path = SYSCALLS.getStr(path);
+ path = SYSCALLS.calculateAt(dirfd, path);
+ path = PATH.normalize(path);
+ if (path[path.length - 1] === "/") path = path.substr(0, path.length - 1);
+ FS.mkdir(path, mode, 0);
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function ___syscall_newfstatat(dirfd, path, buf, flags) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(21, 1, dirfd, path, buf, flags);
+ try {
+ path = SYSCALLS.getStr(path);
+ var nofollow = flags & 256;
+ var allowEmpty = flags & 4096;
+ flags = flags & ~6400;
+ assert(!flags, "unknown flags in __syscall_newfstatat: " + flags);
+ path = SYSCALLS.calculateAt(dirfd, path, allowEmpty);
+ return SYSCALLS.doStat(nofollow ? FS.lstat : FS.stat, path, buf);
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function ___syscall_openat(dirfd, path, flags, varargs) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(22, 1, dirfd, path, flags, varargs);
+ SYSCALLS.varargs = varargs;
+ try {
+ path = SYSCALLS.getStr(path);
+ path = SYSCALLS.calculateAt(dirfd, path);
+ var mode = varargs ? SYSCALLS.get() : 0;
+ return FS.open(path, flags, mode).fd;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function ___syscall_poll(fds, nfds, timeout) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(23, 1, fds, nfds, timeout);
+ try {
+ var nonzero = 0;
+ for (var i = 0; i < nfds; i++) {
+ var pollfd = fds + 8 * i;
+ var fd = GROWABLE_HEAP_I32()[pollfd >> 2];
+ var events = GROWABLE_HEAP_I16()[pollfd + 4 >> 1];
+ var mask = 32;
+ var stream = FS.getStream(fd);
+ if (stream) {
+ mask = SYSCALLS.DEFAULT_POLLMASK;
+ if (stream.stream_ops.poll) {
+ mask = stream.stream_ops.poll(stream);
+ }
+ }
+ mask &= events | 8 | 16;
+ if (mask) nonzero++;
+ GROWABLE_HEAP_I16()[pollfd + 6 >> 1] = mask;
+ }
+ return nonzero;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function ___syscall_readlinkat(dirfd, path, buf, bufsize) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(24, 1, dirfd, path, buf, bufsize);
+ try {
+ path = SYSCALLS.getStr(path);
+ path = SYSCALLS.calculateAt(dirfd, path);
+ if (bufsize <= 0) return -28;
+ var ret = FS.readlink(path);
+ var len = Math.min(bufsize, lengthBytesUTF8(ret));
+ var endChar = GROWABLE_HEAP_I8()[buf + len];
+ stringToUTF8(ret, buf, bufsize + 1);
+ GROWABLE_HEAP_I8()[buf + len] = endChar;
+ return len;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function ___syscall_recvfrom(fd, buf, len, flags, addr, addrlen) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(25, 1, fd, buf, len, flags, addr, addrlen);
+ try {
+ var sock = getSocketFromFD(fd);
+ var msg = sock.sock_ops.recvmsg(sock, len);
+ if (!msg) return 0;
+ if (addr) {
+ var errno = writeSockaddr(addr, sock.family, DNS.lookup_name(msg.addr), msg.port, addrlen);
+ assert(!errno);
+ }
+ GROWABLE_HEAP_U8().set(msg.buffer, buf);
+ return msg.buffer.byteLength;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function ___syscall_renameat(olddirfd, oldpath, newdirfd, newpath) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(26, 1, olddirfd, oldpath, newdirfd, newpath);
+ try {
+ oldpath = SYSCALLS.getStr(oldpath);
+ newpath = SYSCALLS.getStr(newpath);
+ oldpath = SYSCALLS.calculateAt(olddirfd, oldpath);
+ newpath = SYSCALLS.calculateAt(newdirfd, newpath);
+ FS.rename(oldpath, newpath);
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function ___syscall_rmdir(path) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(27, 1, path);
+ try {
+ path = SYSCALLS.getStr(path);
+ FS.rmdir(path);
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function ___syscall_sendto(fd, message, length, flags, addr, addr_len) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(28, 1, fd, message, length, flags, addr, addr_len);
+ try {
+ var sock = getSocketFromFD(fd);
+ var dest = getSocketAddress(addr, addr_len, true);
+ if (!dest) {
+ return FS.write(sock.stream, GROWABLE_HEAP_I8(), message, length);
+ }
+ return sock.sock_ops.sendmsg(sock, GROWABLE_HEAP_I8(), message, length, dest.addr, dest.port);
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function ___syscall_socket(domain, type, protocol) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(29, 1, domain, type, protocol);
+ try {
+ var sock = SOCKFS.createSocket(domain, type, protocol);
+ assert(sock.stream.fd < 64);
+ return sock.stream.fd;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function ___syscall_stat64(path, buf) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(30, 1, path, buf);
+ try {
+ path = SYSCALLS.getStr(path);
+ return SYSCALLS.doStat(FS.stat, path, buf);
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function ___syscall_statfs64(path, size, buf) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(31, 1, path, size, buf);
+ try {
+ path = SYSCALLS.getStr(path);
+ assert(size === 64);
+ GROWABLE_HEAP_I32()[buf + 4 >> 2] = 4096;
+ GROWABLE_HEAP_I32()[buf + 40 >> 2] = 4096;
+ GROWABLE_HEAP_I32()[buf + 8 >> 2] = 1e6;
+ GROWABLE_HEAP_I32()[buf + 12 >> 2] = 5e5;
+ GROWABLE_HEAP_I32()[buf + 16 >> 2] = 5e5;
+ GROWABLE_HEAP_I32()[buf + 20 >> 2] = FS.nextInode;
+ GROWABLE_HEAP_I32()[buf + 24 >> 2] = 1e6;
+ GROWABLE_HEAP_I32()[buf + 28 >> 2] = 42;
+ GROWABLE_HEAP_I32()[buf + 44 >> 2] = 2;
+ GROWABLE_HEAP_I32()[buf + 36 >> 2] = 255;
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function ___syscall_symlink(target, linkpath) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(32, 1, target, linkpath);
+ try {
+ target = SYSCALLS.getStr(target);
+ linkpath = SYSCALLS.getStr(linkpath);
+ FS.symlink(target, linkpath);
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function ___syscall_unlinkat(dirfd, path, flags) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(33, 1, dirfd, path, flags);
+ try {
+ path = SYSCALLS.getStr(path);
+ path = SYSCALLS.calculateAt(dirfd, path);
+ if (flags === 0) {
+ FS.unlink(path);
+ } else if (flags === 512) {
+ FS.rmdir(path);
+ } else {
+ abort("Invalid flags passed to unlinkat");
+ }
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+var nowIsMonotonic = true;
+
+function __emscripten_get_now_is_monotonic() {
+ return nowIsMonotonic;
+}
+
+function maybeExit() {
+ if (runtimeExited) {
+ return;
+ }
+ if (!keepRuntimeAlive()) {
+ try {
+ if (ENVIRONMENT_IS_PTHREAD) __emscripten_thread_exit(EXITSTATUS); else _exit(EXITSTATUS);
+ } catch (e) {
+ handleException(e);
+ }
+ }
+}
+
+function callUserCallback(func) {
+ if (runtimeExited || ABORT) {
+ err("user callback triggered after runtime exited or application aborted. Ignoring.");
+ return;
+ }
+ try {
+ func();
+ maybeExit();
+ } catch (e) {
+ handleException(e);
+ }
+}
+
+function __emscripten_thread_mailbox_await(pthread_ptr) {
+ if (typeof Atomics.waitAsync === "function") {
+ var wait = Atomics.waitAsync(GROWABLE_HEAP_I32(), pthread_ptr >> 2, pthread_ptr);
+ assert(wait.async);
+ wait.value.then(checkMailbox);
+ var waitingAsync = pthread_ptr + 128;
+ Atomics.store(GROWABLE_HEAP_I32(), waitingAsync >> 2, 1);
+ }
+}
+
+Module["__emscripten_thread_mailbox_await"] = __emscripten_thread_mailbox_await;
+
+function checkMailbox() {
+ var pthread_ptr = _pthread_self();
+ if (pthread_ptr) {
+ __emscripten_thread_mailbox_await(pthread_ptr);
+ callUserCallback(() => __emscripten_check_mailbox());
+ }
+}
+
+Module["checkMailbox"] = checkMailbox;
+
+function __emscripten_notify_mailbox_postmessage(targetThreadId, currThreadId, mainThreadId) {
+ if (targetThreadId == currThreadId) {
+ setTimeout(() => checkMailbox());
+ } else if (ENVIRONMENT_IS_PTHREAD) {
+ postMessage({
+ "targetThread": targetThreadId,
+ "cmd": "checkMailbox"
+ });
+ } else {
+ var worker = PThread.pthreads[targetThreadId];
+ if (!worker) {
+ err("Cannot send message to thread with ID " + targetThreadId + ", unknown thread ID!");
+ return;
+ }
+ worker.postMessage({
+ "cmd": "checkMailbox"
+ });
+ }
+}
+
+function webgl_enable_ANGLE_instanced_arrays(ctx) {
+ var ext = ctx.getExtension("ANGLE_instanced_arrays");
+ if (ext) {
+ ctx["vertexAttribDivisor"] = function(index, divisor) {
+ ext["vertexAttribDivisorANGLE"](index, divisor);
+ };
+ ctx["drawArraysInstanced"] = function(mode, first, count, primcount) {
+ ext["drawArraysInstancedANGLE"](mode, first, count, primcount);
+ };
+ ctx["drawElementsInstanced"] = function(mode, count, type, indices, primcount) {
+ ext["drawElementsInstancedANGLE"](mode, count, type, indices, primcount);
+ };
+ return 1;
+ }
+}
+
+function webgl_enable_OES_vertex_array_object(ctx) {
+ var ext = ctx.getExtension("OES_vertex_array_object");
+ if (ext) {
+ ctx["createVertexArray"] = function() {
+ return ext["createVertexArrayOES"]();
+ };
+ ctx["deleteVertexArray"] = function(vao) {
+ ext["deleteVertexArrayOES"](vao);
+ };
+ ctx["bindVertexArray"] = function(vao) {
+ ext["bindVertexArrayOES"](vao);
+ };
+ ctx["isVertexArray"] = function(vao) {
+ return ext["isVertexArrayOES"](vao);
+ };
+ return 1;
+ }
+}
+
+function webgl_enable_WEBGL_draw_buffers(ctx) {
+ var ext = ctx.getExtension("WEBGL_draw_buffers");
+ if (ext) {
+ ctx["drawBuffers"] = function(n, bufs) {
+ ext["drawBuffersWEBGL"](n, bufs);
+ };
+ return 1;
+ }
+}
+
+function webgl_enable_WEBGL_draw_instanced_base_vertex_base_instance(ctx) {
+ return !!(ctx.dibvbi = ctx.getExtension("WEBGL_draw_instanced_base_vertex_base_instance"));
+}
+
+function webgl_enable_WEBGL_multi_draw_instanced_base_vertex_base_instance(ctx) {
+ return !!(ctx.mdibvbi = ctx.getExtension("WEBGL_multi_draw_instanced_base_vertex_base_instance"));
+}
+
+function webgl_enable_WEBGL_multi_draw(ctx) {
+ return !!(ctx.multiDrawWebgl = ctx.getExtension("WEBGL_multi_draw"));
+}
+
+var GL = {
+ counter: 1,
+ buffers: [],
+ programs: [],
+ framebuffers: [],
+ renderbuffers: [],
+ textures: [],
+ shaders: [],
+ vaos: [],
+ contexts: {},
+ offscreenCanvases: {},
+ queries: [],
+ samplers: [],
+ transformFeedbacks: [],
+ syncs: [],
+ stringCache: {},
+ stringiCache: {},
+ unpackAlignment: 4,
+ recordError: function recordError(errorCode) {
+ if (!GL.lastError) {
+ GL.lastError = errorCode;
+ }
+ },
+ getNewId: function(table) {
+ var ret = GL.counter++;
+ for (var i = table.length; i < ret; i++) {
+ table[i] = null;
+ }
+ return ret;
+ },
+ getSource: function(shader, count, string, length) {
+ var source = "";
+ for (var i = 0; i < count; ++i) {
+ var len = length ? GROWABLE_HEAP_I32()[length + i * 4 >> 2] : -1;
+ source += UTF8ToString(GROWABLE_HEAP_I32()[string + i * 4 >> 2], len < 0 ? undefined : len);
+ }
+ return source;
+ },
+ createContext: function(canvas, webGLContextAttributes) {
+ if (webGLContextAttributes.renderViaOffscreenBackBuffer) webGLContextAttributes["preserveDrawingBuffer"] = true;
+ var ctx = webGLContextAttributes.majorVersion > 1 ? canvas.getContext("webgl2", webGLContextAttributes) : canvas.getContext("webgl", webGLContextAttributes);
+ if (!ctx) return 0;
+ var handle = GL.registerContext(ctx, webGLContextAttributes);
+ return handle;
+ },
+ enableOffscreenFramebufferAttributes: function(webGLContextAttributes) {
+ webGLContextAttributes.renderViaOffscreenBackBuffer = true;
+ webGLContextAttributes.preserveDrawingBuffer = true;
+ },
+ createOffscreenFramebuffer: function(context) {
+ var gl = context.GLctx;
+ var fbo = gl.createFramebuffer();
+ gl.bindFramebuffer(36160, fbo);
+ context.defaultFbo = fbo;
+ context.defaultFboForbidBlitFramebuffer = false;
+ if (gl.getContextAttributes().antialias) {
+ context.defaultFboForbidBlitFramebuffer = true;
+ }
+ context.defaultColorTarget = gl.createTexture();
+ context.defaultDepthTarget = gl.createRenderbuffer();
+ GL.resizeOffscreenFramebuffer(context);
+ gl.bindTexture(3553, context.defaultColorTarget);
+ gl.texParameteri(3553, 10241, 9728);
+ gl.texParameteri(3553, 10240, 9728);
+ gl.texParameteri(3553, 10242, 33071);
+ gl.texParameteri(3553, 10243, 33071);
+ gl.texImage2D(3553, 0, 6408, gl.canvas.width, gl.canvas.height, 0, 6408, 5121, null);
+ gl.framebufferTexture2D(36160, 36064, 3553, context.defaultColorTarget, 0);
+ gl.bindTexture(3553, null);
+ var depthTarget = gl.createRenderbuffer();
+ gl.bindRenderbuffer(36161, context.defaultDepthTarget);
+ gl.renderbufferStorage(36161, 33189, gl.canvas.width, gl.canvas.height);
+ gl.framebufferRenderbuffer(36160, 36096, 36161, context.defaultDepthTarget);
+ gl.bindRenderbuffer(36161, null);
+ var vertices = [ -1, -1, -1, 1, 1, -1, 1, 1 ];
+ var vb = gl.createBuffer();
+ gl.bindBuffer(34962, vb);
+ gl.bufferData(34962, new Float32Array(vertices), 35044);
+ gl.bindBuffer(34962, null);
+ context.blitVB = vb;
+ var vsCode = "attribute vec2 pos;" + "varying lowp vec2 tex;" + "void main() { tex = pos * 0.5 + vec2(0.5,0.5); gl_Position = vec4(pos, 0.0, 1.0); }";
+ var vs = gl.createShader(35633);
+ gl.shaderSource(vs, vsCode);
+ gl.compileShader(vs);
+ var fsCode = "varying lowp vec2 tex;" + "uniform sampler2D sampler;" + "void main() { gl_FragColor = texture2D(sampler, tex); }";
+ var fs = gl.createShader(35632);
+ gl.shaderSource(fs, fsCode);
+ gl.compileShader(fs);
+ var blitProgram = gl.createProgram();
+ gl.attachShader(blitProgram, vs);
+ gl.attachShader(blitProgram, fs);
+ gl.linkProgram(blitProgram);
+ context.blitProgram = blitProgram;
+ context.blitPosLoc = gl.getAttribLocation(blitProgram, "pos");
+ gl.useProgram(blitProgram);
+ gl.uniform1i(gl.getUniformLocation(blitProgram, "sampler"), 0);
+ gl.useProgram(null);
+ context.defaultVao = undefined;
+ if (gl.createVertexArray) {
+ context.defaultVao = gl.createVertexArray();
+ gl.bindVertexArray(context.defaultVao);
+ gl.enableVertexAttribArray(context.blitPosLoc);
+ gl.bindVertexArray(null);
+ }
+ },
+ resizeOffscreenFramebuffer: function(context) {
+ var gl = context.GLctx;
+ if (context.defaultColorTarget) {
+ var prevTextureBinding = gl.getParameter(32873);
+ gl.bindTexture(3553, context.defaultColorTarget);
+ gl.texImage2D(3553, 0, 6408, gl.drawingBufferWidth, gl.drawingBufferHeight, 0, 6408, 5121, null);
+ gl.bindTexture(3553, prevTextureBinding);
+ }
+ if (context.defaultDepthTarget) {
+ var prevRenderBufferBinding = gl.getParameter(36007);
+ gl.bindRenderbuffer(36161, context.defaultDepthTarget);
+ gl.renderbufferStorage(36161, 33189, gl.drawingBufferWidth, gl.drawingBufferHeight);
+ gl.bindRenderbuffer(36161, prevRenderBufferBinding);
+ }
+ },
+ blitOffscreenFramebuffer: function(context) {
+ var gl = context.GLctx;
+ var prevScissorTest = gl.getParameter(3089);
+ if (prevScissorTest) gl.disable(3089);
+ var prevFbo = gl.getParameter(36006);
+ if (gl.blitFramebuffer && !context.defaultFboForbidBlitFramebuffer) {
+ gl.bindFramebuffer(36008, context.defaultFbo);
+ gl.bindFramebuffer(36009, null);
+ gl.blitFramebuffer(0, 0, gl.canvas.width, gl.canvas.height, 0, 0, gl.canvas.width, gl.canvas.height, 16384, 9728);
+ } else {
+ gl.bindFramebuffer(36160, null);
+ var prevProgram = gl.getParameter(35725);
+ gl.useProgram(context.blitProgram);
+ var prevVB = gl.getParameter(34964);
+ gl.bindBuffer(34962, context.blitVB);
+ var prevActiveTexture = gl.getParameter(34016);
+ gl.activeTexture(33984);
+ var prevTextureBinding = gl.getParameter(32873);
+ gl.bindTexture(3553, context.defaultColorTarget);
+ var prevBlend = gl.getParameter(3042);
+ if (prevBlend) gl.disable(3042);
+ var prevCullFace = gl.getParameter(2884);
+ if (prevCullFace) gl.disable(2884);
+ var prevDepthTest = gl.getParameter(2929);
+ if (prevDepthTest) gl.disable(2929);
+ var prevStencilTest = gl.getParameter(2960);
+ if (prevStencilTest) gl.disable(2960);
+ function draw() {
+ gl.vertexAttribPointer(context.blitPosLoc, 2, 5126, false, 0, 0);
+ gl.drawArrays(5, 0, 4);
+ }
+ if (context.defaultVao) {
+ var prevVAO = gl.getParameter(34229);
+ gl.bindVertexArray(context.defaultVao);
+ draw();
+ gl.bindVertexArray(prevVAO);
+ } else {
+ var prevVertexAttribPointer = {
+ buffer: gl.getVertexAttrib(context.blitPosLoc, 34975),
+ size: gl.getVertexAttrib(context.blitPosLoc, 34339),
+ stride: gl.getVertexAttrib(context.blitPosLoc, 34340),
+ type: gl.getVertexAttrib(context.blitPosLoc, 34341),
+ normalized: gl.getVertexAttrib(context.blitPosLoc, 34922),
+ pointer: gl.getVertexAttribOffset(context.blitPosLoc, 34373)
+ };
+ var maxVertexAttribs = gl.getParameter(34921);
+ var prevVertexAttribEnables = [];
+ for (var i = 0; i < maxVertexAttribs; ++i) {
+ var prevEnabled = gl.getVertexAttrib(i, 34338);
+ var wantEnabled = i == context.blitPosLoc;
+ if (prevEnabled && !wantEnabled) {
+ gl.disableVertexAttribArray(i);
+ }
+ if (!prevEnabled && wantEnabled) {
+ gl.enableVertexAttribArray(i);
+ }
+ prevVertexAttribEnables[i] = prevEnabled;
+ }
+ draw();
+ for (var i = 0; i < maxVertexAttribs; ++i) {
+ var prevEnabled = prevVertexAttribEnables[i];
+ var nowEnabled = i == context.blitPosLoc;
+ if (prevEnabled && !nowEnabled) {
+ gl.enableVertexAttribArray(i);
+ }
+ if (!prevEnabled && nowEnabled) {
+ gl.disableVertexAttribArray(i);
+ }
+ }
+ gl.bindBuffer(34962, prevVertexAttribPointer.buffer);
+ gl.vertexAttribPointer(context.blitPosLoc, prevVertexAttribPointer.size, prevVertexAttribPointer.type, prevVertexAttribPointer.normalized, prevVertexAttribPointer.stride, prevVertexAttribPointer.offset);
+ }
+ if (prevStencilTest) gl.enable(2960);
+ if (prevDepthTest) gl.enable(2929);
+ if (prevCullFace) gl.enable(2884);
+ if (prevBlend) gl.enable(3042);
+ gl.bindTexture(3553, prevTextureBinding);
+ gl.activeTexture(prevActiveTexture);
+ gl.bindBuffer(34962, prevVB);
+ gl.useProgram(prevProgram);
+ }
+ gl.bindFramebuffer(36160, prevFbo);
+ if (prevScissorTest) gl.enable(3089);
+ },
+ registerContext: function(ctx, webGLContextAttributes) {
+ var handle = _malloc(8);
+ GROWABLE_HEAP_I32()[handle + 4 >> 2] = _pthread_self();
+ var context = {
+ handle: handle,
+ attributes: webGLContextAttributes,
+ version: webGLContextAttributes.majorVersion,
+ GLctx: ctx
+ };
+ if (ctx.canvas) ctx.canvas.GLctxObject = context;
+ GL.contexts[handle] = context;
+ if (typeof webGLContextAttributes.enableExtensionsByDefault == "undefined" || webGLContextAttributes.enableExtensionsByDefault) {
+ GL.initExtensions(context);
+ }
+ if (webGLContextAttributes.renderViaOffscreenBackBuffer) GL.createOffscreenFramebuffer(context);
+ return handle;
+ },
+ makeContextCurrent: function(contextHandle) {
+ GL.currentContext = GL.contexts[contextHandle];
+ Module.ctx = GLctx = GL.currentContext && GL.currentContext.GLctx;
+ return !(contextHandle && !GLctx);
+ },
+ getContext: function(contextHandle) {
+ return GL.contexts[contextHandle];
+ },
+ deleteContext: function(contextHandle) {
+ if (GL.currentContext === GL.contexts[contextHandle]) GL.currentContext = null;
+ if (typeof JSEvents == "object") JSEvents.removeAllHandlersOnTarget(GL.contexts[contextHandle].GLctx.canvas);
+ if (GL.contexts[contextHandle] && GL.contexts[contextHandle].GLctx.canvas) GL.contexts[contextHandle].GLctx.canvas.GLctxObject = undefined;
+ _free(GL.contexts[contextHandle].handle);
+ GL.contexts[contextHandle] = null;
+ },
+ initExtensions: function(context) {
+ if (!context) context = GL.currentContext;
+ if (context.initExtensionsDone) return;
+ context.initExtensionsDone = true;
+ var GLctx = context.GLctx;
+ webgl_enable_ANGLE_instanced_arrays(GLctx);
+ webgl_enable_OES_vertex_array_object(GLctx);
+ webgl_enable_WEBGL_draw_buffers(GLctx);
+ webgl_enable_WEBGL_draw_instanced_base_vertex_base_instance(GLctx);
+ webgl_enable_WEBGL_multi_draw_instanced_base_vertex_base_instance(GLctx);
+ if (context.version >= 2) {
+ GLctx.disjointTimerQueryExt = GLctx.getExtension("EXT_disjoint_timer_query_webgl2");
+ }
+ if (context.version < 2 || !GLctx.disjointTimerQueryExt) {
+ GLctx.disjointTimerQueryExt = GLctx.getExtension("EXT_disjoint_timer_query");
+ }
+ webgl_enable_WEBGL_multi_draw(GLctx);
+ var exts = GLctx.getSupportedExtensions() || [];
+ exts.forEach(function(ext) {
+ if (!ext.includes("lose_context") && !ext.includes("debug")) {
+ GLctx.getExtension(ext);
+ }
+ });
+ }
+};
+
+function __emscripten_proxied_gl_context_activated_from_main_browser_thread(contextHandle) {
+ GLctx = Module.ctx = GL.currentContext = contextHandle;
+ GL.currentContextIsProxied = true;
+}
+
+function __emscripten_set_offscreencanvas_size(target, width, height) {
+ err("emscripten_set_offscreencanvas_size: Build with -sOFFSCREENCANVAS_SUPPORT=1 to enable transferring canvases to pthreads.");
+ return -1;
+}
+
+function __emscripten_thread_set_strongref(thread) {}
+
+function __emscripten_throw_longjmp() {
+ throw Infinity;
+}
+
+function readI53FromI64(ptr) {
+ return GROWABLE_HEAP_U32()[ptr >> 2] + GROWABLE_HEAP_I32()[ptr + 4 >> 2] * 4294967296;
+}
+
+function __gmtime_js(time, tmPtr) {
+ var date = new Date(readI53FromI64(time) * 1e3);
+ GROWABLE_HEAP_I32()[tmPtr >> 2] = date.getUTCSeconds();
+ GROWABLE_HEAP_I32()[tmPtr + 4 >> 2] = date.getUTCMinutes();
+ GROWABLE_HEAP_I32()[tmPtr + 8 >> 2] = date.getUTCHours();
+ GROWABLE_HEAP_I32()[tmPtr + 12 >> 2] = date.getUTCDate();
+ GROWABLE_HEAP_I32()[tmPtr + 16 >> 2] = date.getUTCMonth();
+ GROWABLE_HEAP_I32()[tmPtr + 20 >> 2] = date.getUTCFullYear() - 1900;
+ GROWABLE_HEAP_I32()[tmPtr + 24 >> 2] = date.getUTCDay();
+ var start = Date.UTC(date.getUTCFullYear(), 0, 1, 0, 0, 0, 0);
+ var yday = (date.getTime() - start) / (1e3 * 60 * 60 * 24) | 0;
+ GROWABLE_HEAP_I32()[tmPtr + 28 >> 2] = yday;
+}
+
+function isLeapYear(year) {
+ return year % 4 === 0 && (year % 100 !== 0 || year % 400 === 0);
+}
+
+var MONTH_DAYS_LEAP_CUMULATIVE = [ 0, 31, 60, 91, 121, 152, 182, 213, 244, 274, 305, 335 ];
+
+var MONTH_DAYS_REGULAR_CUMULATIVE = [ 0, 31, 59, 90, 120, 151, 181, 212, 243, 273, 304, 334 ];
+
+function ydayFromDate(date) {
+ var leap = isLeapYear(date.getFullYear());
+ var monthDaysCumulative = leap ? MONTH_DAYS_LEAP_CUMULATIVE : MONTH_DAYS_REGULAR_CUMULATIVE;
+ var yday = monthDaysCumulative[date.getMonth()] + date.getDate() - 1;
+ return yday;
+}
+
+function __localtime_js(time, tmPtr) {
+ var date = new Date(readI53FromI64(time) * 1e3);
+ GROWABLE_HEAP_I32()[tmPtr >> 2] = date.getSeconds();
+ GROWABLE_HEAP_I32()[tmPtr + 4 >> 2] = date.getMinutes();
+ GROWABLE_HEAP_I32()[tmPtr + 8 >> 2] = date.getHours();
+ GROWABLE_HEAP_I32()[tmPtr + 12 >> 2] = date.getDate();
+ GROWABLE_HEAP_I32()[tmPtr + 16 >> 2] = date.getMonth();
+ GROWABLE_HEAP_I32()[tmPtr + 20 >> 2] = date.getFullYear() - 1900;
+ GROWABLE_HEAP_I32()[tmPtr + 24 >> 2] = date.getDay();
+ var yday = ydayFromDate(date) | 0;
+ GROWABLE_HEAP_I32()[tmPtr + 28 >> 2] = yday;
+ GROWABLE_HEAP_I32()[tmPtr + 36 >> 2] = -(date.getTimezoneOffset() * 60);
+ var start = new Date(date.getFullYear(), 0, 1);
+ var summerOffset = new Date(date.getFullYear(), 6, 1).getTimezoneOffset();
+ var winterOffset = start.getTimezoneOffset();
+ var dst = (summerOffset != winterOffset && date.getTimezoneOffset() == Math.min(winterOffset, summerOffset)) | 0;
+ GROWABLE_HEAP_I32()[tmPtr + 32 >> 2] = dst;
+}
+
+var timers = {};
+
+var _emscripten_get_now;
+
+_emscripten_get_now = () => performance.timeOrigin + performance.now();
+
+function __setitimer_js(which, timeout_ms) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(34, 1, which, timeout_ms);
+ if (timers[which]) {
+ clearTimeout(timers[which].id);
+ delete timers[which];
+ }
+ if (!timeout_ms) return 0;
+ var id = setTimeout(() => {
+ assert(which in timers);
+ delete timers[which];
+ callUserCallback(() => __emscripten_timeout(which, _emscripten_get_now()));
+ }, timeout_ms);
+ timers[which] = {
+ id: id,
+ timeout_ms: timeout_ms
+ };
+ return 0;
+}
+
+function stringToNewUTF8(str) {
+ var size = lengthBytesUTF8(str) + 1;
+ var ret = _malloc(size);
+ if (ret) stringToUTF8(str, ret, size);
+ return ret;
+}
+
+function __tzset_js(timezone, daylight, tzname) {
+ var currentYear = new Date().getFullYear();
+ var winter = new Date(currentYear, 0, 1);
+ var summer = new Date(currentYear, 6, 1);
+ var winterOffset = winter.getTimezoneOffset();
+ var summerOffset = summer.getTimezoneOffset();
+ var stdTimezoneOffset = Math.max(winterOffset, summerOffset);
+ GROWABLE_HEAP_U32()[timezone >> 2] = stdTimezoneOffset * 60;
+ GROWABLE_HEAP_I32()[daylight >> 2] = Number(winterOffset != summerOffset);
+ function extractZone(date) {
+ var match = date.toTimeString().match(/\(([A-Za-z ]+)\)$/);
+ return match ? match[1] : "GMT";
+ }
+ var winterName = extractZone(winter);
+ var summerName = extractZone(summer);
+ var winterNamePtr = stringToNewUTF8(winterName);
+ var summerNamePtr = stringToNewUTF8(summerName);
+ if (summerOffset < winterOffset) {
+ GROWABLE_HEAP_U32()[tzname >> 2] = winterNamePtr;
+ GROWABLE_HEAP_U32()[tzname + 4 >> 2] = summerNamePtr;
+ } else {
+ GROWABLE_HEAP_U32()[tzname >> 2] = summerNamePtr;
+ GROWABLE_HEAP_U32()[tzname + 4 >> 2] = winterNamePtr;
+ }
+}
+
+function _abort() {
+ abort("native code called abort()");
+}
+
+function _dlopen(handle) {
+ abort(dlopenMissingError);
+}
+
+function runtimeKeepalivePush() {
+ runtimeKeepaliveCounter += 1;
+}
+
+function _emscripten_set_main_loop_timing(mode, value) {
+ Browser.mainLoop.timingMode = mode;
+ Browser.mainLoop.timingValue = value;
+ if (!Browser.mainLoop.func) {
+ err("emscripten_set_main_loop_timing: Cannot set timing mode for main loop since a main loop does not exist! Call emscripten_set_main_loop first to set one up.");
+ return 1;
+ }
+ if (!Browser.mainLoop.running) {
+ runtimeKeepalivePush();
+ Browser.mainLoop.running = true;
+ }
+ if (mode == 0) {
+ Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setTimeout() {
+ var timeUntilNextTick = Math.max(0, Browser.mainLoop.tickStartTime + value - _emscripten_get_now()) | 0;
+ setTimeout(Browser.mainLoop.runner, timeUntilNextTick);
+ };
+ Browser.mainLoop.method = "timeout";
+ } else if (mode == 1) {
+ Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_rAF() {
+ Browser.requestAnimationFrame(Browser.mainLoop.runner);
+ };
+ Browser.mainLoop.method = "rAF";
+ } else if (mode == 2) {
+ if (typeof setImmediate == "undefined") {
+ var setImmediates = [];
+ var emscriptenMainLoopMessageId = "setimmediate";
+ var Browser_setImmediate_messageHandler = event => {
+ if (event.data === emscriptenMainLoopMessageId || event.data.target === emscriptenMainLoopMessageId) {
+ event.stopPropagation();
+ setImmediates.shift()();
+ }
+ };
+ addEventListener("message", Browser_setImmediate_messageHandler, true);
+ setImmediate = function Browser_emulated_setImmediate(func) {
+ setImmediates.push(func);
+ if (ENVIRONMENT_IS_WORKER) {
+ if (Module["setImmediates"] === undefined) Module["setImmediates"] = [];
+ Module["setImmediates"].push(func);
+ postMessage({
+ target: emscriptenMainLoopMessageId
+ });
+ } else postMessage(emscriptenMainLoopMessageId, "*");
+ };
+ }
+ Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setImmediate() {
+ setImmediate(Browser.mainLoop.runner);
+ };
+ Browser.mainLoop.method = "immediate";
+ }
+ return 0;
+}
+
+function runtimeKeepalivePop() {
+ assert(runtimeKeepaliveCounter > 0);
+ runtimeKeepaliveCounter -= 1;
+}
+
+function setMainLoop(browserIterationFunc, fps, simulateInfiniteLoop, arg, noSetTiming) {
+ assert(!Browser.mainLoop.func, "emscripten_set_main_loop: there can only be one main loop function at once: call emscripten_cancel_main_loop to cancel the previous one before setting a new one with different parameters.");
+ Browser.mainLoop.func = browserIterationFunc;
+ Browser.mainLoop.arg = arg;
+ var thisMainLoopId = Browser.mainLoop.currentlyRunningMainloop;
+ function checkIsRunning() {
+ if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) {
+ runtimeKeepalivePop();
+ maybeExit();
+ return false;
+ }
+ return true;
+ }
+ Browser.mainLoop.running = false;
+ Browser.mainLoop.runner = function Browser_mainLoop_runner() {
+ if (ABORT) return;
+ if (Browser.mainLoop.queue.length > 0) {
+ var start = Date.now();
+ var blocker = Browser.mainLoop.queue.shift();
+ blocker.func(blocker.arg);
+ if (Browser.mainLoop.remainingBlockers) {
+ var remaining = Browser.mainLoop.remainingBlockers;
+ var next = remaining % 1 == 0 ? remaining - 1 : Math.floor(remaining);
+ if (blocker.counted) {
+ Browser.mainLoop.remainingBlockers = next;
+ } else {
+ next = next + .5;
+ Browser.mainLoop.remainingBlockers = (8 * remaining + next) / 9;
+ }
+ }
+ out('main loop blocker "' + blocker.name + '" took ' + (Date.now() - start) + " ms");
+ Browser.mainLoop.updateStatus();
+ if (!checkIsRunning()) return;
+ setTimeout(Browser.mainLoop.runner, 0);
+ return;
+ }
+ if (!checkIsRunning()) return;
+ Browser.mainLoop.currentFrameNumber = Browser.mainLoop.currentFrameNumber + 1 | 0;
+ if (Browser.mainLoop.timingMode == 1 && Browser.mainLoop.timingValue > 1 && Browser.mainLoop.currentFrameNumber % Browser.mainLoop.timingValue != 0) {
+ Browser.mainLoop.scheduler();
+ return;
+ } else if (Browser.mainLoop.timingMode == 0) {
+ Browser.mainLoop.tickStartTime = _emscripten_get_now();
+ }
+ if (Browser.mainLoop.method === "timeout" && Module.ctx) {
+ warnOnce("Looks like you are rendering without using requestAnimationFrame for the main loop. You should use 0 for the frame rate in emscripten_set_main_loop in order to use requestAnimationFrame, as that can greatly improve your frame rates!");
+ Browser.mainLoop.method = "";
+ }
+ Browser.mainLoop.runIter(browserIterationFunc);
+ checkStackCookie();
+ if (!checkIsRunning()) return;
+ if (typeof SDL == "object" && SDL.audio && SDL.audio.queueNewAudioData) SDL.audio.queueNewAudioData();
+ Browser.mainLoop.scheduler();
+ };
+ if (!noSetTiming) {
+ if (fps && fps > 0) {
+ _emscripten_set_main_loop_timing(0, 1e3 / fps);
+ } else {
+ _emscripten_set_main_loop_timing(1, 1);
+ }
+ Browser.mainLoop.scheduler();
+ }
+ if (simulateInfiniteLoop) {
+ throw "unwind";
+ }
+}
+
+function safeSetTimeout(func, timeout) {
+ runtimeKeepalivePush();
+ return setTimeout(() => {
+ runtimeKeepalivePop();
+ callUserCallback(func);
+ }, timeout);
+}
+
+var Browser = {
+ mainLoop: {
+ running: false,
+ scheduler: null,
+ method: "",
+ currentlyRunningMainloop: 0,
+ func: null,
+ arg: 0,
+ timingMode: 0,
+ timingValue: 0,
+ currentFrameNumber: 0,
+ queue: [],
+ pause: function() {
+ Browser.mainLoop.scheduler = null;
+ Browser.mainLoop.currentlyRunningMainloop++;
+ },
+ resume: function() {
+ Browser.mainLoop.currentlyRunningMainloop++;
+ var timingMode = Browser.mainLoop.timingMode;
+ var timingValue = Browser.mainLoop.timingValue;
+ var func = Browser.mainLoop.func;
+ Browser.mainLoop.func = null;
+ setMainLoop(func, 0, false, Browser.mainLoop.arg, true);
+ _emscripten_set_main_loop_timing(timingMode, timingValue);
+ Browser.mainLoop.scheduler();
+ },
+ updateStatus: function() {
+ if (Module["setStatus"]) {
+ var message = Module["statusMessage"] || "Please wait...";
+ var remaining = Browser.mainLoop.remainingBlockers;
+ var expected = Browser.mainLoop.expectedBlockers;
+ if (remaining) {
+ if (remaining < expected) {
+ Module["setStatus"](message + " (" + (expected - remaining) + "/" + expected + ")");
+ } else {
+ Module["setStatus"](message);
+ }
+ } else {
+ Module["setStatus"]("");
+ }
+ }
+ },
+ runIter: function(func) {
+ if (ABORT) return;
+ if (Module["preMainLoop"]) {
+ var preRet = Module["preMainLoop"]();
+ if (preRet === false) {
+ return;
+ }
+ }
+ callUserCallback(func);
+ if (Module["postMainLoop"]) Module["postMainLoop"]();
+ }
+ },
+ isFullscreen: false,
+ pointerLock: false,
+ moduleContextCreatedCallbacks: [],
+ workers: [],
+ init: function() {
+ if (Browser.initted) return;
+ Browser.initted = true;
+ var imagePlugin = {};
+ imagePlugin["canHandle"] = function imagePlugin_canHandle(name) {
+ return !Module.noImageDecoding && /\.(jpg|jpeg|png|bmp)$/i.test(name);
+ };
+ imagePlugin["handle"] = function imagePlugin_handle(byteArray, name, onload, onerror) {
+ var b = new Blob([ byteArray ], {
+ type: Browser.getMimetype(name)
+ });
+ if (b.size !== byteArray.length) {
+ b = new Blob([ new Uint8Array(byteArray).buffer ], {
+ type: Browser.getMimetype(name)
+ });
+ }
+ var url = URL.createObjectURL(b);
+ assert(typeof url == "string", "createObjectURL must return a url as a string");
+ var img = new Image();
+ img.onload = () => {
+ assert(img.complete, "Image " + name + " could not be decoded");
+ var canvas = document.createElement("canvas");
+ canvas.width = img.width;
+ canvas.height = img.height;
+ var ctx = canvas.getContext("2d");
+ ctx.drawImage(img, 0, 0);
+ preloadedImages[name] = canvas;
+ URL.revokeObjectURL(url);
+ if (onload) onload(byteArray);
+ };
+ img.onerror = event => {
+ out("Image " + url + " could not be decoded");
+ if (onerror) onerror();
+ };
+ img.src = url;
+ };
+ preloadPlugins.push(imagePlugin);
+ var audioPlugin = {};
+ audioPlugin["canHandle"] = function audioPlugin_canHandle(name) {
+ return !Module.noAudioDecoding && name.substr(-4) in {
+ ".ogg": 1,
+ ".wav": 1,
+ ".mp3": 1
+ };
+ };
+ audioPlugin["handle"] = function audioPlugin_handle(byteArray, name, onload, onerror) {
+ var done = false;
+ function finish(audio) {
+ if (done) return;
+ done = true;
+ preloadedAudios[name] = audio;
+ if (onload) onload(byteArray);
+ }
+ function fail() {
+ if (done) return;
+ done = true;
+ preloadedAudios[name] = new Audio();
+ if (onerror) onerror();
+ }
+ var b = new Blob([ byteArray ], {
+ type: Browser.getMimetype(name)
+ });
+ var url = URL.createObjectURL(b);
+ assert(typeof url == "string", "createObjectURL must return a url as a string");
+ var audio = new Audio();
+ audio.addEventListener("canplaythrough", () => finish(audio), false);
+ audio.onerror = function audio_onerror(event) {
+ if (done) return;
+ err("warning: browser could not fully decode audio " + name + ", trying slower base64 approach");
+ function encode64(data) {
+ var BASE = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/";
+ var PAD = "=";
+ var ret = "";
+ var leftchar = 0;
+ var leftbits = 0;
+ for (var i = 0; i < data.length; i++) {
+ leftchar = leftchar << 8 | data[i];
+ leftbits += 8;
+ while (leftbits >= 6) {
+ var curr = leftchar >> leftbits - 6 & 63;
+ leftbits -= 6;
+ ret += BASE[curr];
+ }
+ }
+ if (leftbits == 2) {
+ ret += BASE[(leftchar & 3) << 4];
+ ret += PAD + PAD;
+ } else if (leftbits == 4) {
+ ret += BASE[(leftchar & 15) << 2];
+ ret += PAD;
+ }
+ return ret;
+ }
+ audio.src = "data:audio/x-" + name.substr(-3) + ";base64," + encode64(byteArray);
+ finish(audio);
+ };
+ audio.src = url;
+ safeSetTimeout(() => {
+ finish(audio);
+ }, 1e4);
+ };
+ preloadPlugins.push(audioPlugin);
+ function pointerLockChange() {
+ Browser.pointerLock = document["pointerLockElement"] === Module["canvas"] || document["mozPointerLockElement"] === Module["canvas"] || document["webkitPointerLockElement"] === Module["canvas"] || document["msPointerLockElement"] === Module["canvas"];
+ }
+ var canvas = Module["canvas"];
+ if (canvas) {
+ canvas.requestPointerLock = canvas["requestPointerLock"] || canvas["mozRequestPointerLock"] || canvas["webkitRequestPointerLock"] || canvas["msRequestPointerLock"] || (() => {});
+ canvas.exitPointerLock = document["exitPointerLock"] || document["mozExitPointerLock"] || document["webkitExitPointerLock"] || document["msExitPointerLock"] || (() => {});
+ canvas.exitPointerLock = canvas.exitPointerLock.bind(document);
+ document.addEventListener("pointerlockchange", pointerLockChange, false);
+ document.addEventListener("mozpointerlockchange", pointerLockChange, false);
+ document.addEventListener("webkitpointerlockchange", pointerLockChange, false);
+ document.addEventListener("mspointerlockchange", pointerLockChange, false);
+ if (Module["elementPointerLock"]) {
+ canvas.addEventListener("click", ev => {
+ if (!Browser.pointerLock && Module["canvas"].requestPointerLock) {
+ Module["canvas"].requestPointerLock();
+ ev.preventDefault();
+ }
+ }, false);
+ }
+ }
+ },
+ createContext: function(canvas, useWebGL, setInModule, webGLContextAttributes) {
+ if (useWebGL && Module.ctx && canvas == Module.canvas) return Module.ctx;
+ var ctx;
+ var contextHandle;
+ if (useWebGL) {
+ var contextAttributes = {
+ antialias: false,
+ alpha: false,
+ majorVersion: typeof WebGL2RenderingContext != "undefined" ? 2 : 1
+ };
+ if (webGLContextAttributes) {
+ for (var attribute in webGLContextAttributes) {
+ contextAttributes[attribute] = webGLContextAttributes[attribute];
+ }
+ }
+ if (typeof GL != "undefined") {
+ contextHandle = GL.createContext(canvas, contextAttributes);
+ if (contextHandle) {
+ ctx = GL.getContext(contextHandle).GLctx;
+ }
+ }
+ } else {
+ ctx = canvas.getContext("2d");
+ }
+ if (!ctx) return null;
+ if (setInModule) {
+ if (!useWebGL) assert(typeof GLctx == "undefined", "cannot set in module if GLctx is used, but we are a non-GL context that would replace it");
+ Module.ctx = ctx;
+ if (useWebGL) GL.makeContextCurrent(contextHandle);
+ Module.useWebGL = useWebGL;
+ Browser.moduleContextCreatedCallbacks.forEach(callback => callback());
+ Browser.init();
+ }
+ return ctx;
+ },
+ destroyContext: function(canvas, useWebGL, setInModule) {},
+ fullscreenHandlersInstalled: false,
+ lockPointer: undefined,
+ resizeCanvas: undefined,
+ requestFullscreen: function(lockPointer, resizeCanvas) {
+ Browser.lockPointer = lockPointer;
+ Browser.resizeCanvas = resizeCanvas;
+ if (typeof Browser.lockPointer == "undefined") Browser.lockPointer = true;
+ if (typeof Browser.resizeCanvas == "undefined") Browser.resizeCanvas = false;
+ var canvas = Module["canvas"];
+ function fullscreenChange() {
+ Browser.isFullscreen = false;
+ var canvasContainer = canvas.parentNode;
+ if ((document["fullscreenElement"] || document["mozFullScreenElement"] || document["msFullscreenElement"] || document["webkitFullscreenElement"] || document["webkitCurrentFullScreenElement"]) === canvasContainer) {
+ canvas.exitFullscreen = Browser.exitFullscreen;
+ if (Browser.lockPointer) canvas.requestPointerLock();
+ Browser.isFullscreen = true;
+ if (Browser.resizeCanvas) {
+ Browser.setFullscreenCanvasSize();
+ } else {
+ Browser.updateCanvasDimensions(canvas);
+ }
+ } else {
+ canvasContainer.parentNode.insertBefore(canvas, canvasContainer);
+ canvasContainer.parentNode.removeChild(canvasContainer);
+ if (Browser.resizeCanvas) {
+ Browser.setWindowedCanvasSize();
+ } else {
+ Browser.updateCanvasDimensions(canvas);
+ }
+ }
+ if (Module["onFullScreen"]) Module["onFullScreen"](Browser.isFullscreen);
+ if (Module["onFullscreen"]) Module["onFullscreen"](Browser.isFullscreen);
+ }
+ if (!Browser.fullscreenHandlersInstalled) {
+ Browser.fullscreenHandlersInstalled = true;
+ document.addEventListener("fullscreenchange", fullscreenChange, false);
+ document.addEventListener("mozfullscreenchange", fullscreenChange, false);
+ document.addEventListener("webkitfullscreenchange", fullscreenChange, false);
+ document.addEventListener("MSFullscreenChange", fullscreenChange, false);
+ }
+ var canvasContainer = document.createElement("div");
+ canvas.parentNode.insertBefore(canvasContainer, canvas);
+ canvasContainer.appendChild(canvas);
+ canvasContainer.requestFullscreen = canvasContainer["requestFullscreen"] || canvasContainer["mozRequestFullScreen"] || canvasContainer["msRequestFullscreen"] || (canvasContainer["webkitRequestFullscreen"] ? () => canvasContainer["webkitRequestFullscreen"](Element["ALLOW_KEYBOARD_INPUT"]) : null) || (canvasContainer["webkitRequestFullScreen"] ? () => canvasContainer["webkitRequestFullScreen"](Element["ALLOW_KEYBOARD_INPUT"]) : null);
+ canvasContainer.requestFullscreen();
+ },
+ requestFullScreen: function() {
+ abort("Module.requestFullScreen has been replaced by Module.requestFullscreen (without a capital S)");
+ },
+ exitFullscreen: function() {
+ if (!Browser.isFullscreen) {
+ return false;
+ }
+ var CFS = document["exitFullscreen"] || document["cancelFullScreen"] || document["mozCancelFullScreen"] || document["msExitFullscreen"] || document["webkitCancelFullScreen"] || (() => {});
+ CFS.apply(document, []);
+ return true;
+ },
+ nextRAF: 0,
+ fakeRequestAnimationFrame: function(func) {
+ var now = Date.now();
+ if (Browser.nextRAF === 0) {
+ Browser.nextRAF = now + 1e3 / 60;
+ } else {
+ while (now + 2 >= Browser.nextRAF) {
+ Browser.nextRAF += 1e3 / 60;
+ }
+ }
+ var delay = Math.max(Browser.nextRAF - now, 0);
+ setTimeout(func, delay);
+ },
+ requestAnimationFrame: function(func) {
+ if (typeof requestAnimationFrame == "function") {
+ requestAnimationFrame(func);
+ return;
+ }
+ var RAF = Browser.fakeRequestAnimationFrame;
+ RAF(func);
+ },
+ safeSetTimeout: function(func, timeout) {
+ return safeSetTimeout(func, timeout);
+ },
+ safeRequestAnimationFrame: function(func) {
+ runtimeKeepalivePush();
+ return Browser.requestAnimationFrame(() => {
+ runtimeKeepalivePop();
+ callUserCallback(func);
+ });
+ },
+ getMimetype: function(name) {
+ return {
+ "jpg": "image/jpeg",
+ "jpeg": "image/jpeg",
+ "png": "image/png",
+ "bmp": "image/bmp",
+ "ogg": "audio/ogg",
+ "wav": "audio/wav",
+ "mp3": "audio/mpeg"
+ }[name.substr(name.lastIndexOf(".") + 1)];
+ },
+ getUserMedia: function(func) {
+ if (!window.getUserMedia) {
+ window.getUserMedia = navigator["getUserMedia"] || navigator["mozGetUserMedia"];
+ }
+ window.getUserMedia(func);
+ },
+ getMovementX: function(event) {
+ return event["movementX"] || event["mozMovementX"] || event["webkitMovementX"] || 0;
+ },
+ getMovementY: function(event) {
+ return event["movementY"] || event["mozMovementY"] || event["webkitMovementY"] || 0;
+ },
+ getMouseWheelDelta: function(event) {
+ var delta = 0;
+ switch (event.type) {
+ case "DOMMouseScroll":
+ delta = event.detail / 3;
+ break;
+
+ case "mousewheel":
+ delta = event.wheelDelta / 120;
+ break;
+
+ case "wheel":
+ delta = event.deltaY;
+ switch (event.deltaMode) {
+ case 0:
+ delta /= 100;
+ break;
+
+ case 1:
+ delta /= 3;
+ break;
+
+ case 2:
+ delta *= 80;
+ break;
+
+ default:
+ throw "unrecognized mouse wheel delta mode: " + event.deltaMode;
+ }
+ break;
+
+ default:
+ throw "unrecognized mouse wheel event: " + event.type;
+ }
+ return delta;
+ },
+ mouseX: 0,
+ mouseY: 0,
+ mouseMovementX: 0,
+ mouseMovementY: 0,
+ touches: {},
+ lastTouches: {},
+ calculateMouseEvent: function(event) {
+ if (Browser.pointerLock) {
+ if (event.type != "mousemove" && "mozMovementX" in event) {
+ Browser.mouseMovementX = Browser.mouseMovementY = 0;
+ } else {
+ Browser.mouseMovementX = Browser.getMovementX(event);
+ Browser.mouseMovementY = Browser.getMovementY(event);
+ }
+ if (typeof SDL != "undefined") {
+ Browser.mouseX = SDL.mouseX + Browser.mouseMovementX;
+ Browser.mouseY = SDL.mouseY + Browser.mouseMovementY;
+ } else {
+ Browser.mouseX += Browser.mouseMovementX;
+ Browser.mouseY += Browser.mouseMovementY;
+ }
+ } else {
+ var rect = Module["canvas"].getBoundingClientRect();
+ var cw = Module["canvas"].width;
+ var ch = Module["canvas"].height;
+ var scrollX = typeof window.scrollX != "undefined" ? window.scrollX : window.pageXOffset;
+ var scrollY = typeof window.scrollY != "undefined" ? window.scrollY : window.pageYOffset;
+ assert(typeof scrollX != "undefined" && typeof scrollY != "undefined", "Unable to retrieve scroll position, mouse positions likely broken.");
+ if (event.type === "touchstart" || event.type === "touchend" || event.type === "touchmove") {
+ var touch = event.touch;
+ if (touch === undefined) {
+ return;
+ }
+ var adjustedX = touch.pageX - (scrollX + rect.left);
+ var adjustedY = touch.pageY - (scrollY + rect.top);
+ adjustedX = adjustedX * (cw / rect.width);
+ adjustedY = adjustedY * (ch / rect.height);
+ var coords = {
+ x: adjustedX,
+ y: adjustedY
+ };
+ if (event.type === "touchstart") {
+ Browser.lastTouches[touch.identifier] = coords;
+ Browser.touches[touch.identifier] = coords;
+ } else if (event.type === "touchend" || event.type === "touchmove") {
+ var last = Browser.touches[touch.identifier];
+ if (!last) last = coords;
+ Browser.lastTouches[touch.identifier] = last;
+ Browser.touches[touch.identifier] = coords;
+ }
+ return;
+ }
+ var x = event.pageX - (scrollX + rect.left);
+ var y = event.pageY - (scrollY + rect.top);
+ x = x * (cw / rect.width);
+ y = y * (ch / rect.height);
+ Browser.mouseMovementX = x - Browser.mouseX;
+ Browser.mouseMovementY = y - Browser.mouseY;
+ Browser.mouseX = x;
+ Browser.mouseY = y;
+ }
+ },
+ resizeListeners: [],
+ updateResizeListeners: function() {
+ var canvas = Module["canvas"];
+ Browser.resizeListeners.forEach(listener => listener(canvas.width, canvas.height));
+ },
+ setCanvasSize: function(width, height, noUpdates) {
+ var canvas = Module["canvas"];
+ Browser.updateCanvasDimensions(canvas, width, height);
+ if (!noUpdates) Browser.updateResizeListeners();
+ },
+ windowedWidth: 0,
+ windowedHeight: 0,
+ setFullscreenCanvasSize: function() {
+ if (typeof SDL != "undefined") {
+ var flags = GROWABLE_HEAP_U32()[SDL.screen >> 2];
+ flags = flags | 8388608;
+ GROWABLE_HEAP_I32()[SDL.screen >> 2] = flags;
+ }
+ Browser.updateCanvasDimensions(Module["canvas"]);
+ Browser.updateResizeListeners();
+ },
+ setWindowedCanvasSize: function() {
+ if (typeof SDL != "undefined") {
+ var flags = GROWABLE_HEAP_U32()[SDL.screen >> 2];
+ flags = flags & ~8388608;
+ GROWABLE_HEAP_I32()[SDL.screen >> 2] = flags;
+ }
+ Browser.updateCanvasDimensions(Module["canvas"]);
+ Browser.updateResizeListeners();
+ },
+ updateCanvasDimensions: function(canvas, wNative, hNative) {
+ if (wNative && hNative) {
+ canvas.widthNative = wNative;
+ canvas.heightNative = hNative;
+ } else {
+ wNative = canvas.widthNative;
+ hNative = canvas.heightNative;
+ }
+ var w = wNative;
+ var h = hNative;
+ if (Module["forcedAspectRatio"] && Module["forcedAspectRatio"] > 0) {
+ if (w / h < Module["forcedAspectRatio"]) {
+ w = Math.round(h * Module["forcedAspectRatio"]);
+ } else {
+ h = Math.round(w / Module["forcedAspectRatio"]);
+ }
+ }
+ if ((document["fullscreenElement"] || document["mozFullScreenElement"] || document["msFullscreenElement"] || document["webkitFullscreenElement"] || document["webkitCurrentFullScreenElement"]) === canvas.parentNode && typeof screen != "undefined") {
+ var factor = Math.min(screen.width / w, screen.height / h);
+ w = Math.round(w * factor);
+ h = Math.round(h * factor);
+ }
+ if (Browser.resizeCanvas) {
+ if (canvas.width != w) canvas.width = w;
+ if (canvas.height != h) canvas.height = h;
+ if (typeof canvas.style != "undefined") {
+ canvas.style.removeProperty("width");
+ canvas.style.removeProperty("height");
+ }
+ } else {
+ if (canvas.width != wNative) canvas.width = wNative;
+ if (canvas.height != hNative) canvas.height = hNative;
+ if (typeof canvas.style != "undefined") {
+ if (w != wNative || h != hNative) {
+ canvas.style.setProperty("width", w + "px", "important");
+ canvas.style.setProperty("height", h + "px", "important");
+ } else {
+ canvas.style.removeProperty("width");
+ canvas.style.removeProperty("height");
+ }
+ }
+ }
+ }
+};
+
+function _emscripten_cancel_main_loop() {
+ Browser.mainLoop.pause();
+ Browser.mainLoop.func = null;
+}
+
+function _emscripten_check_blocking_allowed() {
+ if (ENVIRONMENT_IS_WORKER) return;
+ warnOnce("Blocking on the main thread is very dangerous, see https://emscripten.org/docs/porting/pthreads.html#blocking-on-the-main-browser-thread");
+}
+
+function _emscripten_console_error(str) {
+ assert(typeof str == "number");
+ console.error(UTF8ToString(str));
+}
+
+function _emscripten_date_now() {
+ return Date.now();
+}
+
+function _emscripten_exit_with_live_runtime() {
+ runtimeKeepalivePush();
+ throw "unwind";
+}
+
+function _emscripten_force_exit(status) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(35, 1, status);
+ noExitRuntime = false;
+ runtimeKeepaliveCounter = 0;
+ _exit(status);
+}
+
+function _glActiveTexture(x0) {
+ GLctx.activeTexture(x0);
+}
+
+var _emscripten_glActiveTexture = _glActiveTexture;
+
+function _glAttachShader(program, shader) {
+ GLctx.attachShader(GL.programs[program], GL.shaders[shader]);
+}
+
+var _emscripten_glAttachShader = _glAttachShader;
+
+function _glBeginTransformFeedback(x0) {
+ GLctx.beginTransformFeedback(x0);
+}
+
+var _emscripten_glBeginTransformFeedback = _glBeginTransformFeedback;
+
+function _glBindBuffer(target, buffer) {
+ if (target == 35051) {
+ GLctx.currentPixelPackBufferBinding = buffer;
+ } else if (target == 35052) {
+ GLctx.currentPixelUnpackBufferBinding = buffer;
+ }
+ GLctx.bindBuffer(target, GL.buffers[buffer]);
+}
+
+var _emscripten_glBindBuffer = _glBindBuffer;
+
+function _glBindBufferBase(target, index, buffer) {
+ GLctx.bindBufferBase(target, index, GL.buffers[buffer]);
+}
+
+var _emscripten_glBindBufferBase = _glBindBufferBase;
+
+function _glBindBufferRange(target, index, buffer, offset, ptrsize) {
+ GLctx.bindBufferRange(target, index, GL.buffers[buffer], offset, ptrsize);
+}
+
+var _emscripten_glBindBufferRange = _glBindBufferRange;
+
+function _glBindFramebuffer(target, framebuffer) {
+ GLctx.bindFramebuffer(target, framebuffer ? GL.framebuffers[framebuffer] : GL.currentContext.defaultFbo);
+}
+
+var _emscripten_glBindFramebuffer = _glBindFramebuffer;
+
+function _glBindRenderbuffer(target, renderbuffer) {
+ GLctx.bindRenderbuffer(target, GL.renderbuffers[renderbuffer]);
+}
+
+var _emscripten_glBindRenderbuffer = _glBindRenderbuffer;
+
+function _glBindTexture(target, texture) {
+ GLctx.bindTexture(target, GL.textures[texture]);
+}
+
+var _emscripten_glBindTexture = _glBindTexture;
+
+function _glBindVertexArray(vao) {
+ GLctx.bindVertexArray(GL.vaos[vao]);
+}
+
+var _emscripten_glBindVertexArray = _glBindVertexArray;
+
+function _glBlendColor(x0, x1, x2, x3) {
+ GLctx.blendColor(x0, x1, x2, x3);
+}
+
+var _emscripten_glBlendColor = _glBlendColor;
+
+function _glBlendEquation(x0) {
+ GLctx.blendEquation(x0);
+}
+
+var _emscripten_glBlendEquation = _glBlendEquation;
+
+function _glBlendFunc(x0, x1) {
+ GLctx.blendFunc(x0, x1);
+}
+
+var _emscripten_glBlendFunc = _glBlendFunc;
+
+function _glBlendFuncSeparate(x0, x1, x2, x3) {
+ GLctx.blendFuncSeparate(x0, x1, x2, x3);
+}
+
+var _emscripten_glBlendFuncSeparate = _glBlendFuncSeparate;
+
+function _glBlitFramebuffer(x0, x1, x2, x3, x4, x5, x6, x7, x8, x9) {
+ GLctx.blitFramebuffer(x0, x1, x2, x3, x4, x5, x6, x7, x8, x9);
+}
+
+var _emscripten_glBlitFramebuffer = _glBlitFramebuffer;
+
+function _glBufferData(target, size, data, usage) {
+ if (GL.currentContext.version >= 2) {
+ if (data && size) {
+ GLctx.bufferData(target, GROWABLE_HEAP_U8(), usage, data, size);
+ } else {
+ GLctx.bufferData(target, size, usage);
+ }
+ } else {
+ GLctx.bufferData(target, data ? GROWABLE_HEAP_U8().subarray(data, data + size) : size, usage);
+ }
+}
+
+var _emscripten_glBufferData = _glBufferData;
+
+function _glBufferSubData(target, offset, size, data) {
+ if (GL.currentContext.version >= 2) {
+ size && GLctx.bufferSubData(target, offset, GROWABLE_HEAP_U8(), data, size);
+ return;
+ }
+ GLctx.bufferSubData(target, offset, GROWABLE_HEAP_U8().subarray(data, data + size));
+}
+
+var _emscripten_glBufferSubData = _glBufferSubData;
+
+function _glCheckFramebufferStatus(x0) {
+ return GLctx.checkFramebufferStatus(x0);
+}
+
+var _emscripten_glCheckFramebufferStatus = _glCheckFramebufferStatus;
+
+function _glClear(x0) {
+ GLctx.clear(x0);
+}
+
+var _emscripten_glClear = _glClear;
+
+function _glClearBufferfv(buffer, drawbuffer, value) {
+ GLctx.clearBufferfv(buffer, drawbuffer, GROWABLE_HEAP_F32(), value >> 2);
+}
+
+var _emscripten_glClearBufferfv = _glClearBufferfv;
+
+function _glClearColor(x0, x1, x2, x3) {
+ GLctx.clearColor(x0, x1, x2, x3);
+}
+
+var _emscripten_glClearColor = _glClearColor;
+
+function _glClearDepthf(x0) {
+ GLctx.clearDepth(x0);
+}
+
+var _emscripten_glClearDepthf = _glClearDepthf;
+
+function _glColorMask(red, green, blue, alpha) {
+ GLctx.colorMask(!!red, !!green, !!blue, !!alpha);
+}
+
+var _emscripten_glColorMask = _glColorMask;
+
+function _glCompileShader(shader) {
+ GLctx.compileShader(GL.shaders[shader]);
+}
+
+var _emscripten_glCompileShader = _glCompileShader;
+
+function _glCompressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data) {
+ if (GL.currentContext.version >= 2) {
+ if (GLctx.currentPixelUnpackBufferBinding || !imageSize) {
+ GLctx.compressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data);
+ } else {
+ GLctx.compressedTexImage2D(target, level, internalFormat, width, height, border, GROWABLE_HEAP_U8(), data, imageSize);
+ }
+ return;
+ }
+ GLctx.compressedTexImage2D(target, level, internalFormat, width, height, border, data ? GROWABLE_HEAP_U8().subarray(data, data + imageSize) : null);
+}
+
+var _emscripten_glCompressedTexImage2D = _glCompressedTexImage2D;
+
+function _glCopyBufferSubData(x0, x1, x2, x3, x4) {
+ GLctx.copyBufferSubData(x0, x1, x2, x3, x4);
+}
+
+var _emscripten_glCopyBufferSubData = _glCopyBufferSubData;
+
+function _glCreateProgram() {
+ var id = GL.getNewId(GL.programs);
+ var program = GLctx.createProgram();
+ program.name = id;
+ program.maxUniformLength = program.maxAttributeLength = program.maxUniformBlockNameLength = 0;
+ program.uniformIdCounter = 1;
+ GL.programs[id] = program;
+ return id;
+}
+
+var _emscripten_glCreateProgram = _glCreateProgram;
+
+function _glCreateShader(shaderType) {
+ var id = GL.getNewId(GL.shaders);
+ GL.shaders[id] = GLctx.createShader(shaderType);
+ return id;
+}
+
+var _emscripten_glCreateShader = _glCreateShader;
+
+function _glCullFace(x0) {
+ GLctx.cullFace(x0);
+}
+
+var _emscripten_glCullFace = _glCullFace;
+
+function _glDeleteBuffers(n, buffers) {
+ for (var i = 0; i < n; i++) {
+ var id = GROWABLE_HEAP_I32()[buffers + i * 4 >> 2];
+ var buffer = GL.buffers[id];
+ if (!buffer) continue;
+ GLctx.deleteBuffer(buffer);
+ buffer.name = 0;
+ GL.buffers[id] = null;
+ if (id == GLctx.currentPixelPackBufferBinding) GLctx.currentPixelPackBufferBinding = 0;
+ if (id == GLctx.currentPixelUnpackBufferBinding) GLctx.currentPixelUnpackBufferBinding = 0;
+ }
+}
+
+var _emscripten_glDeleteBuffers = _glDeleteBuffers;
+
+function _glDeleteFramebuffers(n, framebuffers) {
+ for (var i = 0; i < n; ++i) {
+ var id = GROWABLE_HEAP_I32()[framebuffers + i * 4 >> 2];
+ var framebuffer = GL.framebuffers[id];
+ if (!framebuffer) continue;
+ GLctx.deleteFramebuffer(framebuffer);
+ framebuffer.name = 0;
+ GL.framebuffers[id] = null;
+ }
+}
+
+var _emscripten_glDeleteFramebuffers = _glDeleteFramebuffers;
+
+function _glDeleteProgram(id) {
+ if (!id) return;
+ var program = GL.programs[id];
+ if (!program) {
+ GL.recordError(1281);
+ return;
+ }
+ GLctx.deleteProgram(program);
+ program.name = 0;
+ GL.programs[id] = null;
+}
+
+var _emscripten_glDeleteProgram = _glDeleteProgram;
+
+function _glDeleteQueries(n, ids) {
+ for (var i = 0; i < n; i++) {
+ var id = GROWABLE_HEAP_I32()[ids + i * 4 >> 2];
+ var query = GL.queries[id];
+ if (!query) continue;
+ GLctx.deleteQuery(query);
+ GL.queries[id] = null;
+ }
+}
+
+var _emscripten_glDeleteQueries = _glDeleteQueries;
+
+function _glDeleteRenderbuffers(n, renderbuffers) {
+ for (var i = 0; i < n; i++) {
+ var id = GROWABLE_HEAP_I32()[renderbuffers + i * 4 >> 2];
+ var renderbuffer = GL.renderbuffers[id];
+ if (!renderbuffer) continue;
+ GLctx.deleteRenderbuffer(renderbuffer);
+ renderbuffer.name = 0;
+ GL.renderbuffers[id] = null;
+ }
+}
+
+var _emscripten_glDeleteRenderbuffers = _glDeleteRenderbuffers;
+
+function _glDeleteShader(id) {
+ if (!id) return;
+ var shader = GL.shaders[id];
+ if (!shader) {
+ GL.recordError(1281);
+ return;
+ }
+ GLctx.deleteShader(shader);
+ GL.shaders[id] = null;
+}
+
+var _emscripten_glDeleteShader = _glDeleteShader;
+
+function _glDeleteSync(id) {
+ if (!id) return;
+ var sync = GL.syncs[id];
+ if (!sync) {
+ GL.recordError(1281);
+ return;
+ }
+ GLctx.deleteSync(sync);
+ sync.name = 0;
+ GL.syncs[id] = null;
+}
+
+var _emscripten_glDeleteSync = _glDeleteSync;
+
+function _glDeleteTextures(n, textures) {
+ for (var i = 0; i < n; i++) {
+ var id = GROWABLE_HEAP_I32()[textures + i * 4 >> 2];
+ var texture = GL.textures[id];
+ if (!texture) continue;
+ GLctx.deleteTexture(texture);
+ texture.name = 0;
+ GL.textures[id] = null;
+ }
+}
+
+var _emscripten_glDeleteTextures = _glDeleteTextures;
+
+function _glDeleteVertexArrays(n, vaos) {
+ for (var i = 0; i < n; i++) {
+ var id = GROWABLE_HEAP_I32()[vaos + i * 4 >> 2];
+ GLctx.deleteVertexArray(GL.vaos[id]);
+ GL.vaos[id] = null;
+ }
+}
+
+var _emscripten_glDeleteVertexArrays = _glDeleteVertexArrays;
+
+function _glDepthFunc(x0) {
+ GLctx.depthFunc(x0);
+}
+
+var _emscripten_glDepthFunc = _glDepthFunc;
+
+function _glDepthMask(flag) {
+ GLctx.depthMask(!!flag);
+}
+
+var _emscripten_glDepthMask = _glDepthMask;
+
+function _glDisable(x0) {
+ GLctx.disable(x0);
+}
+
+var _emscripten_glDisable = _glDisable;
+
+function _glDisableVertexAttribArray(index) {
+ GLctx.disableVertexAttribArray(index);
+}
+
+var _emscripten_glDisableVertexAttribArray = _glDisableVertexAttribArray;
+
+function _glDrawArrays(mode, first, count) {
+ GLctx.drawArrays(mode, first, count);
+}
+
+var _emscripten_glDrawArrays = _glDrawArrays;
+
+function _glDrawArraysInstanced(mode, first, count, primcount) {
+ GLctx.drawArraysInstanced(mode, first, count, primcount);
+}
+
+var _emscripten_glDrawArraysInstanced = _glDrawArraysInstanced;
+
+function _glDrawElements(mode, count, type, indices) {
+ GLctx.drawElements(mode, count, type, indices);
+}
+
+var _emscripten_glDrawElements = _glDrawElements;
+
+function _glDrawElementsInstanced(mode, count, type, indices, primcount) {
+ GLctx.drawElementsInstanced(mode, count, type, indices, primcount);
+}
+
+var _emscripten_glDrawElementsInstanced = _glDrawElementsInstanced;
+
+function _glEnable(x0) {
+ GLctx.enable(x0);
+}
+
+var _emscripten_glEnable = _glEnable;
+
+function _glEnableVertexAttribArray(index) {
+ GLctx.enableVertexAttribArray(index);
+}
+
+var _emscripten_glEnableVertexAttribArray = _glEnableVertexAttribArray;
+
+function _glEndTransformFeedback() {
+ GLctx.endTransformFeedback();
+}
+
+var _emscripten_glEndTransformFeedback = _glEndTransformFeedback;
+
+function _glFenceSync(condition, flags) {
+ var sync = GLctx.fenceSync(condition, flags);
+ if (sync) {
+ var id = GL.getNewId(GL.syncs);
+ sync.name = id;
+ GL.syncs[id] = sync;
+ return id;
+ }
+ return 0;
+}
+
+var _emscripten_glFenceSync = _glFenceSync;
+
+function _glFinish() {
+ GLctx.finish();
+}
+
+var _emscripten_glFinish = _glFinish;
+
+function _glFramebufferRenderbuffer(target, attachment, renderbuffertarget, renderbuffer) {
+ GLctx.framebufferRenderbuffer(target, attachment, renderbuffertarget, GL.renderbuffers[renderbuffer]);
+}
+
+var _emscripten_glFramebufferRenderbuffer = _glFramebufferRenderbuffer;
+
+function _glFramebufferTexture2D(target, attachment, textarget, texture, level) {
+ GLctx.framebufferTexture2D(target, attachment, textarget, GL.textures[texture], level);
+}
+
+var _emscripten_glFramebufferTexture2D = _glFramebufferTexture2D;
+
+function _glFramebufferTextureLayer(target, attachment, texture, level, layer) {
+ GLctx.framebufferTextureLayer(target, attachment, GL.textures[texture], level, layer);
+}
+
+var _emscripten_glFramebufferTextureLayer = _glFramebufferTextureLayer;
+
+function _glFrontFace(x0) {
+ GLctx.frontFace(x0);
+}
+
+var _emscripten_glFrontFace = _glFrontFace;
+
+function __glGenObject(n, buffers, createFunction, objectTable) {
+ for (var i = 0; i < n; i++) {
+ var buffer = GLctx[createFunction]();
+ var id = buffer && GL.getNewId(objectTable);
+ if (buffer) {
+ buffer.name = id;
+ objectTable[id] = buffer;
+ } else {
+ GL.recordError(1282);
+ }
+ GROWABLE_HEAP_I32()[buffers + i * 4 >> 2] = id;
+ }
+}
+
+function _glGenBuffers(n, buffers) {
+ __glGenObject(n, buffers, "createBuffer", GL.buffers);
+}
+
+var _emscripten_glGenBuffers = _glGenBuffers;
+
+function _glGenFramebuffers(n, ids) {
+ __glGenObject(n, ids, "createFramebuffer", GL.framebuffers);
+}
+
+var _emscripten_glGenFramebuffers = _glGenFramebuffers;
+
+function _glGenQueries(n, ids) {
+ __glGenObject(n, ids, "createQuery", GL.queries);
+}
+
+var _emscripten_glGenQueries = _glGenQueries;
+
+function _glGenRenderbuffers(n, renderbuffers) {
+ __glGenObject(n, renderbuffers, "createRenderbuffer", GL.renderbuffers);
+}
+
+var _emscripten_glGenRenderbuffers = _glGenRenderbuffers;
+
+function _glGenTextures(n, textures) {
+ __glGenObject(n, textures, "createTexture", GL.textures);
+}
+
+var _emscripten_glGenTextures = _glGenTextures;
+
+function _glGenVertexArrays(n, arrays) {
+ __glGenObject(n, arrays, "createVertexArray", GL.vaos);
+}
+
+var _emscripten_glGenVertexArrays = _glGenVertexArrays;
+
+function _glGenerateMipmap(x0) {
+ GLctx.generateMipmap(x0);
+}
+
+var _emscripten_glGenerateMipmap = _glGenerateMipmap;
+
+function readI53FromU64(ptr) {
+ return GROWABLE_HEAP_U32()[ptr >> 2] + GROWABLE_HEAP_U32()[ptr + 4 >> 2] * 4294967296;
+}
+
+function writeI53ToI64(ptr, num) {
+ GROWABLE_HEAP_U32()[ptr >> 2] = num;
+ GROWABLE_HEAP_U32()[ptr + 4 >> 2] = (num - GROWABLE_HEAP_U32()[ptr >> 2]) / 4294967296;
+ var deserialized = num >= 0 ? readI53FromU64(ptr) : readI53FromI64(ptr);
+ if (deserialized != num) warnOnce("writeI53ToI64() out of range: serialized JS Number " + num + " to Wasm heap as bytes lo=" + ptrToString(GROWABLE_HEAP_U32()[ptr >> 2]) + ", hi=" + ptrToString(GROWABLE_HEAP_U32()[ptr + 4 >> 2]) + ", which deserializes back to " + deserialized + " instead!");
+}
+
+function emscriptenWebGLGet(name_, p, type) {
+ if (!p) {
+ GL.recordError(1281);
+ return;
+ }
+ var ret = undefined;
+ switch (name_) {
+ case 36346:
+ ret = 1;
+ break;
+
+ case 36344:
+ if (type != 0 && type != 1) {
+ GL.recordError(1280);
+ }
+ return;
+
+ case 34814:
+ case 36345:
+ ret = 0;
+ break;
+
+ case 34466:
+ var formats = GLctx.getParameter(34467);
+ ret = formats ? formats.length : 0;
+ break;
+
+ case 33309:
+ if (GL.currentContext.version < 2) {
+ GL.recordError(1282);
+ return;
+ }
+ var exts = GLctx.getSupportedExtensions() || [];
+ ret = 2 * exts.length;
+ break;
+
+ case 33307:
+ case 33308:
+ if (GL.currentContext.version < 2) {
+ GL.recordError(1280);
+ return;
+ }
+ ret = name_ == 33307 ? 3 : 0;
+ break;
+ }
+ if (ret === undefined) {
+ var result = GLctx.getParameter(name_);
+ switch (typeof result) {
+ case "number":
+ ret = result;
+ break;
+
+ case "boolean":
+ ret = result ? 1 : 0;
+ break;
+
+ case "string":
+ GL.recordError(1280);
+ return;
+
+ case "object":
+ if (result === null) {
+ switch (name_) {
+ case 34964:
+ case 35725:
+ case 34965:
+ case 36006:
+ case 36007:
+ case 32873:
+ case 34229:
+ case 36662:
+ case 36663:
+ case 35053:
+ case 35055:
+ case 36010:
+ case 35097:
+ case 35869:
+ case 32874:
+ case 36389:
+ case 35983:
+ case 35368:
+ case 34068:
+ {
+ ret = 0;
+ break;
+ }
+
+ default:
+ {
+ GL.recordError(1280);
+ return;
+ }
+ }
+ } else if (result instanceof Float32Array || result instanceof Uint32Array || result instanceof Int32Array || result instanceof Array) {
+ for (var i = 0; i < result.length; ++i) {
+ switch (type) {
+ case 0:
+ GROWABLE_HEAP_I32()[p + i * 4 >> 2] = result[i];
+ break;
+
+ case 2:
+ GROWABLE_HEAP_F32()[p + i * 4 >> 2] = result[i];
+ break;
+
+ case 4:
+ GROWABLE_HEAP_I8()[p + i >> 0] = result[i] ? 1 : 0;
+ break;
+ }
+ }
+ return;
+ } else {
+ try {
+ ret = result.name | 0;
+ } catch (e) {
+ GL.recordError(1280);
+ err("GL_INVALID_ENUM in glGet" + type + "v: Unknown object returned from WebGL getParameter(" + name_ + ")! (error: " + e + ")");
+ return;
+ }
+ }
+ break;
+
+ default:
+ GL.recordError(1280);
+ err("GL_INVALID_ENUM in glGet" + type + "v: Native code calling glGet" + type + "v(" + name_ + ") and it returns " + result + " of type " + typeof result + "!");
+ return;
+ }
+ }
+ switch (type) {
+ case 1:
+ writeI53ToI64(p, ret);
+ break;
+
+ case 0:
+ GROWABLE_HEAP_I32()[p >> 2] = ret;
+ break;
+
+ case 2:
+ GROWABLE_HEAP_F32()[p >> 2] = ret;
+ break;
+
+ case 4:
+ GROWABLE_HEAP_I8()[p >> 0] = ret ? 1 : 0;
+ break;
+ }
+}
+
+function _glGetFloatv(name_, p) {
+ emscriptenWebGLGet(name_, p, 2);
+}
+
+var _emscripten_glGetFloatv = _glGetFloatv;
+
+function _glGetInteger64v(name_, p) {
+ emscriptenWebGLGet(name_, p, 1);
+}
+
+var _emscripten_glGetInteger64v = _glGetInteger64v;
+
+function _glGetProgramInfoLog(program, maxLength, length, infoLog) {
+ var log = GLctx.getProgramInfoLog(GL.programs[program]);
+ if (log === null) log = "(unknown error)";
+ var numBytesWrittenExclNull = maxLength > 0 && infoLog ? stringToUTF8(log, infoLog, maxLength) : 0;
+ if (length) GROWABLE_HEAP_I32()[length >> 2] = numBytesWrittenExclNull;
+}
+
+var _emscripten_glGetProgramInfoLog = _glGetProgramInfoLog;
+
+function _glGetProgramiv(program, pname, p) {
+ if (!p) {
+ GL.recordError(1281);
+ return;
+ }
+ if (program >= GL.counter) {
+ GL.recordError(1281);
+ return;
+ }
+ program = GL.programs[program];
+ if (pname == 35716) {
+ var log = GLctx.getProgramInfoLog(program);
+ if (log === null) log = "(unknown error)";
+ GROWABLE_HEAP_I32()[p >> 2] = log.length + 1;
+ } else if (pname == 35719) {
+ if (!program.maxUniformLength) {
+ for (var i = 0; i < GLctx.getProgramParameter(program, 35718); ++i) {
+ program.maxUniformLength = Math.max(program.maxUniformLength, GLctx.getActiveUniform(program, i).name.length + 1);
+ }
+ }
+ GROWABLE_HEAP_I32()[p >> 2] = program.maxUniformLength;
+ } else if (pname == 35722) {
+ if (!program.maxAttributeLength) {
+ for (var i = 0; i < GLctx.getProgramParameter(program, 35721); ++i) {
+ program.maxAttributeLength = Math.max(program.maxAttributeLength, GLctx.getActiveAttrib(program, i).name.length + 1);
+ }
+ }
+ GROWABLE_HEAP_I32()[p >> 2] = program.maxAttributeLength;
+ } else if (pname == 35381) {
+ if (!program.maxUniformBlockNameLength) {
+ for (var i = 0; i < GLctx.getProgramParameter(program, 35382); ++i) {
+ program.maxUniformBlockNameLength = Math.max(program.maxUniformBlockNameLength, GLctx.getActiveUniformBlockName(program, i).length + 1);
+ }
+ }
+ GROWABLE_HEAP_I32()[p >> 2] = program.maxUniformBlockNameLength;
+ } else {
+ GROWABLE_HEAP_I32()[p >> 2] = GLctx.getProgramParameter(program, pname);
+ }
+}
+
+var _emscripten_glGetProgramiv = _glGetProgramiv;
+
+function _glGetShaderInfoLog(shader, maxLength, length, infoLog) {
+ var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
+ if (log === null) log = "(unknown error)";
+ var numBytesWrittenExclNull = maxLength > 0 && infoLog ? stringToUTF8(log, infoLog, maxLength) : 0;
+ if (length) GROWABLE_HEAP_I32()[length >> 2] = numBytesWrittenExclNull;
+}
+
+var _emscripten_glGetShaderInfoLog = _glGetShaderInfoLog;
+
+function _glGetShaderiv(shader, pname, p) {
+ if (!p) {
+ GL.recordError(1281);
+ return;
+ }
+ if (pname == 35716) {
+ var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
+ if (log === null) log = "(unknown error)";
+ var logLength = log ? log.length + 1 : 0;
+ GROWABLE_HEAP_I32()[p >> 2] = logLength;
+ } else if (pname == 35720) {
+ var source = GLctx.getShaderSource(GL.shaders[shader]);
+ var sourceLength = source ? source.length + 1 : 0;
+ GROWABLE_HEAP_I32()[p >> 2] = sourceLength;
+ } else {
+ GROWABLE_HEAP_I32()[p >> 2] = GLctx.getShaderParameter(GL.shaders[shader], pname);
+ }
+}
+
+var _emscripten_glGetShaderiv = _glGetShaderiv;
+
+function _glGetString(name_) {
+ var ret = GL.stringCache[name_];
+ if (!ret) {
+ switch (name_) {
+ case 7939:
+ var exts = GLctx.getSupportedExtensions() || [];
+ exts = exts.concat(exts.map(function(e) {
+ return "GL_" + e;
+ }));
+ ret = stringToNewUTF8(exts.join(" "));
+ break;
+
+ case 7936:
+ case 7937:
+ case 37445:
+ case 37446:
+ var s = GLctx.getParameter(name_);
+ if (!s) {
+ GL.recordError(1280);
+ }
+ ret = s && stringToNewUTF8(s);
+ break;
+
+ case 7938:
+ var glVersion = GLctx.getParameter(7938);
+ if (GL.currentContext.version >= 2) glVersion = "OpenGL ES 3.0 (" + glVersion + ")"; else {
+ glVersion = "OpenGL ES 2.0 (" + glVersion + ")";
+ }
+ ret = stringToNewUTF8(glVersion);
+ break;
+
+ case 35724:
+ var glslVersion = GLctx.getParameter(35724);
+ var ver_re = /^WebGL GLSL ES ([0-9]\.[0-9][0-9]?)(?:$| .*)/;
+ var ver_num = glslVersion.match(ver_re);
+ if (ver_num !== null) {
+ if (ver_num[1].length == 3) ver_num[1] = ver_num[1] + "0";
+ glslVersion = "OpenGL ES GLSL ES " + ver_num[1] + " (" + glslVersion + ")";
+ }
+ ret = stringToNewUTF8(glslVersion);
+ break;
+
+ default:
+ GL.recordError(1280);
+ }
+ GL.stringCache[name_] = ret;
+ }
+ return ret;
+}
+
+var _emscripten_glGetString = _glGetString;
+
+function _glGetStringi(name, index) {
+ if (GL.currentContext.version < 2) {
+ GL.recordError(1282);
+ return 0;
+ }
+ var stringiCache = GL.stringiCache[name];
+ if (stringiCache) {
+ if (index < 0 || index >= stringiCache.length) {
+ GL.recordError(1281);
+ return 0;
+ }
+ return stringiCache[index];
+ }
+ switch (name) {
+ case 7939:
+ var exts = GLctx.getSupportedExtensions() || [];
+ exts = exts.concat(exts.map(function(e) {
+ return "GL_" + e;
+ }));
+ exts = exts.map(function(e) {
+ return stringToNewUTF8(e);
+ });
+ stringiCache = GL.stringiCache[name] = exts;
+ if (index < 0 || index >= stringiCache.length) {
+ GL.recordError(1281);
+ return 0;
+ }
+ return stringiCache[index];
+
+ default:
+ GL.recordError(1280);
+ return 0;
+ }
+}
+
+var _emscripten_glGetStringi = _glGetStringi;
+
+function _glGetSynciv(sync, pname, bufSize, length, values) {
+ if (bufSize < 0) {
+ GL.recordError(1281);
+ return;
+ }
+ if (!values) {
+ GL.recordError(1281);
+ return;
+ }
+ var ret = GLctx.getSyncParameter(GL.syncs[sync], pname);
+ if (ret !== null) {
+ GROWABLE_HEAP_I32()[values >> 2] = ret;
+ if (length) GROWABLE_HEAP_I32()[length >> 2] = 1;
+ }
+}
+
+var _emscripten_glGetSynciv = _glGetSynciv;
+
+function _glGetUniformBlockIndex(program, uniformBlockName) {
+ return GLctx.getUniformBlockIndex(GL.programs[program], UTF8ToString(uniformBlockName));
+}
+
+var _emscripten_glGetUniformBlockIndex = _glGetUniformBlockIndex;
+
+function webglGetLeftBracePos(name) {
+ return name.slice(-1) == "]" && name.lastIndexOf("[");
+}
+
+function webglPrepareUniformLocationsBeforeFirstUse(program) {
+ var uniformLocsById = program.uniformLocsById, uniformSizeAndIdsByName = program.uniformSizeAndIdsByName, i, j;
+ if (!uniformLocsById) {
+ program.uniformLocsById = uniformLocsById = {};
+ program.uniformArrayNamesById = {};
+ for (i = 0; i < GLctx.getProgramParameter(program, 35718); ++i) {
+ var u = GLctx.getActiveUniform(program, i);
+ var nm = u.name;
+ var sz = u.size;
+ var lb = webglGetLeftBracePos(nm);
+ var arrayName = lb > 0 ? nm.slice(0, lb) : nm;
+ var id = program.uniformIdCounter;
+ program.uniformIdCounter += sz;
+ uniformSizeAndIdsByName[arrayName] = [ sz, id ];
+ for (j = 0; j < sz; ++j) {
+ uniformLocsById[id] = j;
+ program.uniformArrayNamesById[id++] = arrayName;
+ }
+ }
+ }
+}
+
+function _glGetUniformLocation(program, name) {
+ name = UTF8ToString(name);
+ if (program = GL.programs[program]) {
+ webglPrepareUniformLocationsBeforeFirstUse(program);
+ var uniformLocsById = program.uniformLocsById;
+ var arrayIndex = 0;
+ var uniformBaseName = name;
+ var leftBrace = webglGetLeftBracePos(name);
+ if (leftBrace > 0) {
+ arrayIndex = jstoi_q(name.slice(leftBrace + 1)) >>> 0;
+ uniformBaseName = name.slice(0, leftBrace);
+ }
+ var sizeAndId = program.uniformSizeAndIdsByName[uniformBaseName];
+ if (sizeAndId && arrayIndex < sizeAndId[0]) {
+ arrayIndex += sizeAndId[1];
+ if (uniformLocsById[arrayIndex] = uniformLocsById[arrayIndex] || GLctx.getUniformLocation(program, name)) {
+ return arrayIndex;
+ }
+ }
+ } else {
+ GL.recordError(1281);
+ }
+ return -1;
+}
+
+var _emscripten_glGetUniformLocation = _glGetUniformLocation;
+
+function _glLinkProgram(program) {
+ program = GL.programs[program];
+ GLctx.linkProgram(program);
+ program.uniformLocsById = 0;
+ program.uniformSizeAndIdsByName = {};
+}
+
+var _emscripten_glLinkProgram = _glLinkProgram;
+
+function _glPixelStorei(pname, param) {
+ if (pname == 3317) {
+ GL.unpackAlignment = param;
+ }
+ GLctx.pixelStorei(pname, param);
+}
+
+var _emscripten_glPixelStorei = _glPixelStorei;
+
+function _glReadBuffer(x0) {
+ GLctx.readBuffer(x0);
+}
+
+var _emscripten_glReadBuffer = _glReadBuffer;
+
+function computeUnpackAlignedImageSize(width, height, sizePerPixel, alignment) {
+ function roundedToNextMultipleOf(x, y) {
+ return x + y - 1 & -y;
+ }
+ var plainRowSize = width * sizePerPixel;
+ var alignedRowSize = roundedToNextMultipleOf(plainRowSize, alignment);
+ return height * alignedRowSize;
+}
+
+function colorChannelsInGlTextureFormat(format) {
+ var colorChannels = {
+ 5: 3,
+ 6: 4,
+ 8: 2,
+ 29502: 3,
+ 29504: 4,
+ 26917: 2,
+ 26918: 2,
+ 29846: 3,
+ 29847: 4
+ };
+ return colorChannels[format - 6402] || 1;
+}
+
+function heapObjectForWebGLType(type) {
+ type -= 5120;
+ if (type == 0) return GROWABLE_HEAP_I8();
+ if (type == 1) return GROWABLE_HEAP_U8();
+ if (type == 2) return GROWABLE_HEAP_I16();
+ if (type == 4) return GROWABLE_HEAP_I32();
+ if (type == 6) return GROWABLE_HEAP_F32();
+ if (type == 5 || type == 28922 || type == 28520 || type == 30779 || type == 30782) return GROWABLE_HEAP_U32();
+ return GROWABLE_HEAP_U16();
+}
+
+function heapAccessShiftForWebGLHeap(heap) {
+ return 31 - Math.clz32(heap.BYTES_PER_ELEMENT);
+}
+
+function emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat) {
+ var heap = heapObjectForWebGLType(type);
+ var shift = heapAccessShiftForWebGLHeap(heap);
+ var byteSize = 1 << shift;
+ var sizePerPixel = colorChannelsInGlTextureFormat(format) * byteSize;
+ var bytes = computeUnpackAlignedImageSize(width, height, sizePerPixel, GL.unpackAlignment);
+ return heap.subarray(pixels >> shift, pixels + bytes >> shift);
+}
+
+function _glReadPixels(x, y, width, height, format, type, pixels) {
+ if (GL.currentContext.version >= 2) {
+ if (GLctx.currentPixelPackBufferBinding) {
+ GLctx.readPixels(x, y, width, height, format, type, pixels);
+ } else {
+ var heap = heapObjectForWebGLType(type);
+ GLctx.readPixels(x, y, width, height, format, type, heap, pixels >> heapAccessShiftForWebGLHeap(heap));
+ }
+ return;
+ }
+ var pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, format);
+ if (!pixelData) {
+ GL.recordError(1280);
+ return;
+ }
+ GLctx.readPixels(x, y, width, height, format, type, pixelData);
+}
+
+var _emscripten_glReadPixels = _glReadPixels;
+
+function _glRenderbufferStorage(x0, x1, x2, x3) {
+ GLctx.renderbufferStorage(x0, x1, x2, x3);
+}
+
+var _emscripten_glRenderbufferStorage = _glRenderbufferStorage;
+
+function _glScissor(x0, x1, x2, x3) {
+ GLctx.scissor(x0, x1, x2, x3);
+}
+
+var _emscripten_glScissor = _glScissor;
+
+function _glShaderSource(shader, count, string, length) {
+ var source = GL.getSource(shader, count, string, length);
+ GLctx.shaderSource(GL.shaders[shader], source);
+}
+
+var _emscripten_glShaderSource = _glShaderSource;
+
+function _glTexImage2D(target, level, internalFormat, width, height, border, format, type, pixels) {
+ if (GL.currentContext.version >= 2) {
+ if (GLctx.currentPixelUnpackBufferBinding) {
+ GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixels);
+ } else if (pixels) {
+ var heap = heapObjectForWebGLType(type);
+ GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, heap, pixels >> heapAccessShiftForWebGLHeap(heap));
+ } else {
+ GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, null);
+ }
+ return;
+ }
+ GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixels ? emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat) : null);
+}
+
+var _emscripten_glTexImage2D = _glTexImage2D;
+
+function _glTexImage3D(target, level, internalFormat, width, height, depth, border, format, type, pixels) {
+ if (GLctx.currentPixelUnpackBufferBinding) {
+ GLctx.texImage3D(target, level, internalFormat, width, height, depth, border, format, type, pixels);
+ } else if (pixels) {
+ var heap = heapObjectForWebGLType(type);
+ GLctx.texImage3D(target, level, internalFormat, width, height, depth, border, format, type, heap, pixels >> heapAccessShiftForWebGLHeap(heap));
+ } else {
+ GLctx.texImage3D(target, level, internalFormat, width, height, depth, border, format, type, null);
+ }
+}
+
+var _emscripten_glTexImage3D = _glTexImage3D;
+
+function _glTexParameterf(x0, x1, x2) {
+ GLctx.texParameterf(x0, x1, x2);
+}
+
+var _emscripten_glTexParameterf = _glTexParameterf;
+
+function _glTexParameteri(x0, x1, x2) {
+ GLctx.texParameteri(x0, x1, x2);
+}
+
+var _emscripten_glTexParameteri = _glTexParameteri;
+
+function _glTexStorage2D(x0, x1, x2, x3, x4) {
+ GLctx.texStorage2D(x0, x1, x2, x3, x4);
+}
+
+var _emscripten_glTexStorage2D = _glTexStorage2D;
+
+function _glTexSubImage3D(target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, pixels) {
+ if (GLctx.currentPixelUnpackBufferBinding) {
+ GLctx.texSubImage3D(target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, pixels);
+ } else if (pixels) {
+ var heap = heapObjectForWebGLType(type);
+ GLctx.texSubImage3D(target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, heap, pixels >> heapAccessShiftForWebGLHeap(heap));
+ } else {
+ GLctx.texSubImage3D(target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, null);
+ }
+}
+
+var _emscripten_glTexSubImage3D = _glTexSubImage3D;
+
+function _glTransformFeedbackVaryings(program, count, varyings, bufferMode) {
+ program = GL.programs[program];
+ var vars = [];
+ for (var i = 0; i < count; i++) vars.push(UTF8ToString(GROWABLE_HEAP_I32()[varyings + i * 4 >> 2]));
+ GLctx.transformFeedbackVaryings(program, vars, bufferMode);
+}
+
+var _emscripten_glTransformFeedbackVaryings = _glTransformFeedbackVaryings;
+
+function webglGetUniformLocation(location) {
+ var p = GLctx.currentProgram;
+ if (p) {
+ var webglLoc = p.uniformLocsById[location];
+ if (typeof webglLoc == "number") {
+ p.uniformLocsById[location] = webglLoc = GLctx.getUniformLocation(p, p.uniformArrayNamesById[location] + (webglLoc > 0 ? "[" + webglLoc + "]" : ""));
+ }
+ return webglLoc;
+ } else {
+ GL.recordError(1282);
+ }
+}
+
+function _glUniform1f(location, v0) {
+ GLctx.uniform1f(webglGetUniformLocation(location), v0);
+}
+
+var _emscripten_glUniform1f = _glUniform1f;
+
+function _glUniform1i(location, v0) {
+ GLctx.uniform1i(webglGetUniformLocation(location), v0);
+}
+
+var _emscripten_glUniform1i = _glUniform1i;
+
+var miniTempWebGLIntBuffers = [];
+
+function _glUniform1iv(location, count, value) {
+ if (GL.currentContext.version >= 2) {
+ count && GLctx.uniform1iv(webglGetUniformLocation(location), GROWABLE_HEAP_I32(), value >> 2, count);
+ return;
+ }
+ if (count <= 288) {
+ var view = miniTempWebGLIntBuffers[count - 1];
+ for (var i = 0; i < count; ++i) {
+ view[i] = GROWABLE_HEAP_I32()[value + 4 * i >> 2];
+ }
+ } else {
+ var view = GROWABLE_HEAP_I32().subarray(value >> 2, value + count * 4 >> 2);
+ }
+ GLctx.uniform1iv(webglGetUniformLocation(location), view);
+}
+
+var _emscripten_glUniform1iv = _glUniform1iv;
+
+function _glUniform1ui(location, v0) {
+ GLctx.uniform1ui(webglGetUniformLocation(location), v0);
+}
+
+var _emscripten_glUniform1ui = _glUniform1ui;
+
+function _glUniform1uiv(location, count, value) {
+ count && GLctx.uniform1uiv(webglGetUniformLocation(location), GROWABLE_HEAP_U32(), value >> 2, count);
+}
+
+var _emscripten_glUniform1uiv = _glUniform1uiv;
+
+function _glUniform2f(location, v0, v1) {
+ GLctx.uniform2f(webglGetUniformLocation(location), v0, v1);
+}
+
+var _emscripten_glUniform2f = _glUniform2f;
+
+var miniTempWebGLFloatBuffers = [];
+
+function _glUniform2fv(location, count, value) {
+ if (GL.currentContext.version >= 2) {
+ count && GLctx.uniform2fv(webglGetUniformLocation(location), GROWABLE_HEAP_F32(), value >> 2, count * 2);
+ return;
+ }
+ if (count <= 144) {
+ var view = miniTempWebGLFloatBuffers[2 * count - 1];
+ for (var i = 0; i < 2 * count; i += 2) {
+ view[i] = GROWABLE_HEAP_F32()[value + 4 * i >> 2];
+ view[i + 1] = GROWABLE_HEAP_F32()[value + (4 * i + 4) >> 2];
+ }
+ } else {
+ var view = GROWABLE_HEAP_F32().subarray(value >> 2, value + count * 8 >> 2);
+ }
+ GLctx.uniform2fv(webglGetUniformLocation(location), view);
+}
+
+var _emscripten_glUniform2fv = _glUniform2fv;
+
+function _glUniform2iv(location, count, value) {
+ if (GL.currentContext.version >= 2) {
+ count && GLctx.uniform2iv(webglGetUniformLocation(location), GROWABLE_HEAP_I32(), value >> 2, count * 2);
+ return;
+ }
+ if (count <= 144) {
+ var view = miniTempWebGLIntBuffers[2 * count - 1];
+ for (var i = 0; i < 2 * count; i += 2) {
+ view[i] = GROWABLE_HEAP_I32()[value + 4 * i >> 2];
+ view[i + 1] = GROWABLE_HEAP_I32()[value + (4 * i + 4) >> 2];
+ }
+ } else {
+ var view = GROWABLE_HEAP_I32().subarray(value >> 2, value + count * 8 >> 2);
+ }
+ GLctx.uniform2iv(webglGetUniformLocation(location), view);
+}
+
+var _emscripten_glUniform2iv = _glUniform2iv;
+
+function _glUniform3fv(location, count, value) {
+ if (GL.currentContext.version >= 2) {
+ count && GLctx.uniform3fv(webglGetUniformLocation(location), GROWABLE_HEAP_F32(), value >> 2, count * 3);
+ return;
+ }
+ if (count <= 96) {
+ var view = miniTempWebGLFloatBuffers[3 * count - 1];
+ for (var i = 0; i < 3 * count; i += 3) {
+ view[i] = GROWABLE_HEAP_F32()[value + 4 * i >> 2];
+ view[i + 1] = GROWABLE_HEAP_F32()[value + (4 * i + 4) >> 2];
+ view[i + 2] = GROWABLE_HEAP_F32()[value + (4 * i + 8) >> 2];
+ }
+ } else {
+ var view = GROWABLE_HEAP_F32().subarray(value >> 2, value + count * 12 >> 2);
+ }
+ GLctx.uniform3fv(webglGetUniformLocation(location), view);
+}
+
+var _emscripten_glUniform3fv = _glUniform3fv;
+
+function _glUniform4f(location, v0, v1, v2, v3) {
+ GLctx.uniform4f(webglGetUniformLocation(location), v0, v1, v2, v3);
+}
+
+var _emscripten_glUniform4f = _glUniform4f;
+
+function _glUniform4fv(location, count, value) {
+ if (GL.currentContext.version >= 2) {
+ count && GLctx.uniform4fv(webglGetUniformLocation(location), GROWABLE_HEAP_F32(), value >> 2, count * 4);
+ return;
+ }
+ if (count <= 72) {
+ var view = miniTempWebGLFloatBuffers[4 * count - 1];
+ var heap = GROWABLE_HEAP_F32();
+ value >>= 2;
+ for (var i = 0; i < 4 * count; i += 4) {
+ var dst = value + i;
+ view[i] = heap[dst];
+ view[i + 1] = heap[dst + 1];
+ view[i + 2] = heap[dst + 2];
+ view[i + 3] = heap[dst + 3];
+ }
+ } else {
+ var view = GROWABLE_HEAP_F32().subarray(value >> 2, value + count * 16 >> 2);
+ }
+ GLctx.uniform4fv(webglGetUniformLocation(location), view);
+}
+
+var _emscripten_glUniform4fv = _glUniform4fv;
+
+function _glUniformBlockBinding(program, uniformBlockIndex, uniformBlockBinding) {
+ program = GL.programs[program];
+ GLctx.uniformBlockBinding(program, uniformBlockIndex, uniformBlockBinding);
+}
+
+var _emscripten_glUniformBlockBinding = _glUniformBlockBinding;
+
+function _glUniformMatrix4fv(location, count, transpose, value) {
+ if (GL.currentContext.version >= 2) {
+ count && GLctx.uniformMatrix4fv(webglGetUniformLocation(location), !!transpose, GROWABLE_HEAP_F32(), value >> 2, count * 16);
+ return;
+ }
+ if (count <= 18) {
+ var view = miniTempWebGLFloatBuffers[16 * count - 1];
+ var heap = GROWABLE_HEAP_F32();
+ value >>= 2;
+ for (var i = 0; i < 16 * count; i += 16) {
+ var dst = value + i;
+ view[i] = heap[dst];
+ view[i + 1] = heap[dst + 1];
+ view[i + 2] = heap[dst + 2];
+ view[i + 3] = heap[dst + 3];
+ view[i + 4] = heap[dst + 4];
+ view[i + 5] = heap[dst + 5];
+ view[i + 6] = heap[dst + 6];
+ view[i + 7] = heap[dst + 7];
+ view[i + 8] = heap[dst + 8];
+ view[i + 9] = heap[dst + 9];
+ view[i + 10] = heap[dst + 10];
+ view[i + 11] = heap[dst + 11];
+ view[i + 12] = heap[dst + 12];
+ view[i + 13] = heap[dst + 13];
+ view[i + 14] = heap[dst + 14];
+ view[i + 15] = heap[dst + 15];
+ }
+ } else {
+ var view = GROWABLE_HEAP_F32().subarray(value >> 2, value + count * 64 >> 2);
+ }
+ GLctx.uniformMatrix4fv(webglGetUniformLocation(location), !!transpose, view);
+}
+
+var _emscripten_glUniformMatrix4fv = _glUniformMatrix4fv;
+
+function _glUseProgram(program) {
+ program = GL.programs[program];
+ GLctx.useProgram(program);
+ GLctx.currentProgram = program;
+}
+
+var _emscripten_glUseProgram = _glUseProgram;
+
+function _glVertexAttrib4f(x0, x1, x2, x3, x4) {
+ GLctx.vertexAttrib4f(x0, x1, x2, x3, x4);
+}
+
+var _emscripten_glVertexAttrib4f = _glVertexAttrib4f;
+
+function _glVertexAttribDivisor(index, divisor) {
+ GLctx.vertexAttribDivisor(index, divisor);
+}
+
+var _emscripten_glVertexAttribDivisor = _glVertexAttribDivisor;
+
+function _glVertexAttribI4ui(x0, x1, x2, x3, x4) {
+ GLctx.vertexAttribI4ui(x0, x1, x2, x3, x4);
+}
+
+var _emscripten_glVertexAttribI4ui = _glVertexAttribI4ui;
+
+function _glVertexAttribIPointer(index, size, type, stride, ptr) {
+ GLctx.vertexAttribIPointer(index, size, type, stride, ptr);
+}
+
+var _emscripten_glVertexAttribIPointer = _glVertexAttribIPointer;
+
+function _glVertexAttribPointer(index, size, type, normalized, stride, ptr) {
+ GLctx.vertexAttribPointer(index, size, type, !!normalized, stride, ptr);
+}
+
+var _emscripten_glVertexAttribPointer = _glVertexAttribPointer;
+
+function _glViewport(x0, x1, x2, x3) {
+ GLctx.viewport(x0, x1, x2, x3);
+}
+
+var _emscripten_glViewport = _glViewport;
+
+function _emscripten_num_logical_cores() {
+ return navigator["hardwareConcurrency"];
+}
+
+function withStackSave(f) {
+ var stack = stackSave();
+ var ret = f();
+ stackRestore(stack);
+ return ret;
+}
+
+function proxyToMainThread(index, sync) {
+ var numCallArgs = arguments.length - 2;
+ var outerArgs = arguments;
+ var maxArgs = 19;
+ if (numCallArgs > maxArgs) {
+ throw "proxyToMainThread: Too many arguments " + numCallArgs + " to proxied function idx=" + index + ", maximum supported is " + maxArgs;
+ }
+ return withStackSave(() => {
+ var serializedNumCallArgs = numCallArgs;
+ var args = stackAlloc(serializedNumCallArgs * 8);
+ var b = args >> 3;
+ for (var i = 0; i < numCallArgs; i++) {
+ var arg = outerArgs[2 + i];
+ GROWABLE_HEAP_F64()[b + i] = arg;
+ }
+ return __emscripten_run_in_main_runtime_thread_js(index, serializedNumCallArgs, args, sync);
+ });
+}
+
+var emscripten_receive_on_main_thread_js_callArgs = [];
+
+function _emscripten_receive_on_main_thread_js(index, numCallArgs, args) {
+ emscripten_receive_on_main_thread_js_callArgs.length = numCallArgs;
+ var b = args >> 3;
+ for (var i = 0; i < numCallArgs; i++) {
+ emscripten_receive_on_main_thread_js_callArgs[i] = GROWABLE_HEAP_F64()[b + i];
+ }
+ var func = proxiedFunctionTable[index];
+ assert(func.length == numCallArgs, "Call args mismatch in emscripten_receive_on_main_thread_js");
+ return func.apply(null, emscripten_receive_on_main_thread_js_callArgs);
+}
+
+function getHeapMax() {
+ return 2147483648;
+}
+
+function emscripten_realloc_buffer(size) {
+ var b = wasmMemory.buffer;
+ try {
+ wasmMemory.grow(size - b.byteLength + 65535 >>> 16);
+ updateMemoryViews();
+ return 1;
+ } catch (e) {
+ err(`emscripten_realloc_buffer: Attempted to grow heap from ${b.byteLength} bytes to ${size} bytes, but got error: ${e}`);
+ }
+}
+
+function _emscripten_resize_heap(requestedSize) {
+ var oldSize = GROWABLE_HEAP_U8().length;
+ requestedSize = requestedSize >>> 0;
+ if (requestedSize <= oldSize) {
+ return false;
+ }
+ var maxHeapSize = getHeapMax();
+ if (requestedSize > maxHeapSize) {
+ err(`Cannot enlarge memory, asked to go up to ${requestedSize} bytes, but the limit is ${maxHeapSize} bytes!`);
+ return false;
+ }
+ var alignUp = (x, multiple) => x + (multiple - x % multiple) % multiple;
+ for (var cutDown = 1; cutDown <= 4; cutDown *= 2) {
+ var overGrownHeapSize = oldSize * (1 + .2 / cutDown);
+ overGrownHeapSize = Math.min(overGrownHeapSize, requestedSize + 100663296);
+ var newSize = Math.min(maxHeapSize, alignUp(Math.max(requestedSize, overGrownHeapSize), 65536));
+ var replacement = emscripten_realloc_buffer(newSize);
+ if (replacement) {
+ return true;
+ }
+ }
+ err(`Failed to grow the heap from ${oldSize} bytes to ${newSize} bytes, not enough memory!`);
+ return false;
+}
+
+var JSEvents = {
+ inEventHandler: 0,
+ removeAllEventListeners: function() {
+ for (var i = JSEvents.eventHandlers.length - 1; i >= 0; --i) {
+ JSEvents._removeHandler(i);
+ }
+ JSEvents.eventHandlers = [];
+ JSEvents.deferredCalls = [];
+ },
+ registerRemoveEventListeners: function() {
+ if (!JSEvents.removeEventListenersRegistered) {
+ __ATEXIT__.push(JSEvents.removeAllEventListeners);
+ JSEvents.removeEventListenersRegistered = true;
+ }
+ },
+ deferredCalls: [],
+ deferCall: function(targetFunction, precedence, argsList) {
+ function arraysHaveEqualContent(arrA, arrB) {
+ if (arrA.length != arrB.length) return false;
+ for (var i in arrA) {
+ if (arrA[i] != arrB[i]) return false;
+ }
+ return true;
+ }
+ for (var i in JSEvents.deferredCalls) {
+ var call = JSEvents.deferredCalls[i];
+ if (call.targetFunction == targetFunction && arraysHaveEqualContent(call.argsList, argsList)) {
+ return;
+ }
+ }
+ JSEvents.deferredCalls.push({
+ targetFunction: targetFunction,
+ precedence: precedence,
+ argsList: argsList
+ });
+ JSEvents.deferredCalls.sort(function(x, y) {
+ return x.precedence < y.precedence;
+ });
+ },
+ removeDeferredCalls: function(targetFunction) {
+ for (var i = 0; i < JSEvents.deferredCalls.length; ++i) {
+ if (JSEvents.deferredCalls[i].targetFunction == targetFunction) {
+ JSEvents.deferredCalls.splice(i, 1);
+ --i;
+ }
+ }
+ },
+ canPerformEventHandlerRequests: function() {
+ return JSEvents.inEventHandler && JSEvents.currentEventHandler.allowsDeferredCalls;
+ },
+ runDeferredCalls: function() {
+ if (!JSEvents.canPerformEventHandlerRequests()) {
+ return;
+ }
+ for (var i = 0; i < JSEvents.deferredCalls.length; ++i) {
+ var call = JSEvents.deferredCalls[i];
+ JSEvents.deferredCalls.splice(i, 1);
+ --i;
+ call.targetFunction.apply(null, call.argsList);
+ }
+ },
+ eventHandlers: [],
+ removeAllHandlersOnTarget: function(target, eventTypeString) {
+ for (var i = 0; i < JSEvents.eventHandlers.length; ++i) {
+ if (JSEvents.eventHandlers[i].target == target && (!eventTypeString || eventTypeString == JSEvents.eventHandlers[i].eventTypeString)) {
+ JSEvents._removeHandler(i--);
+ }
+ }
+ },
+ _removeHandler: function(i) {
+ var h = JSEvents.eventHandlers[i];
+ h.target.removeEventListener(h.eventTypeString, h.eventListenerFunc, h.useCapture);
+ JSEvents.eventHandlers.splice(i, 1);
+ },
+ registerOrRemoveHandler: function(eventHandler) {
+ if (!eventHandler.target) {
+ err("registerOrRemoveHandler: the target element for event handler registration does not exist, when processing the following event handler registration:");
+ console.dir(eventHandler);
+ return -4;
+ }
+ var jsEventHandler = function jsEventHandler(event) {
+ ++JSEvents.inEventHandler;
+ JSEvents.currentEventHandler = eventHandler;
+ JSEvents.runDeferredCalls();
+ eventHandler.handlerFunc(event);
+ JSEvents.runDeferredCalls();
+ --JSEvents.inEventHandler;
+ };
+ if (eventHandler.callbackfunc) {
+ eventHandler.eventListenerFunc = jsEventHandler;
+ eventHandler.target.addEventListener(eventHandler.eventTypeString, jsEventHandler, eventHandler.useCapture);
+ JSEvents.eventHandlers.push(eventHandler);
+ JSEvents.registerRemoveEventListeners();
+ } else {
+ for (var i = 0; i < JSEvents.eventHandlers.length; ++i) {
+ if (JSEvents.eventHandlers[i].target == eventHandler.target && JSEvents.eventHandlers[i].eventTypeString == eventHandler.eventTypeString) {
+ JSEvents._removeHandler(i--);
+ }
+ }
+ }
+ return 0;
+ },
+ queueEventHandlerOnThread_iiii: function(targetThread, eventHandlerFunc, eventTypeId, eventData, userData) {
+ withStackSave(function() {
+ var varargs = stackAlloc(12);
+ GROWABLE_HEAP_I32()[varargs >> 2] = eventTypeId;
+ GROWABLE_HEAP_I32()[varargs + 4 >> 2] = eventData;
+ GROWABLE_HEAP_I32()[varargs + 8 >> 2] = userData;
+ _emscripten_dispatch_to_thread_(targetThread, 637534208, eventHandlerFunc, eventData, varargs);
+ });
+ },
+ getTargetThreadForEventCallback: function(targetThread) {
+ switch (targetThread) {
+ case 1:
+ return 0;
+
+ case 2:
+ return PThread.currentProxiedOperationCallerThread;
+
+ default:
+ return targetThread;
+ }
+ },
+ getNodeNameForTarget: function(target) {
+ if (!target) return "";
+ if (target == window) return "#window";
+ if (target == screen) return "#screen";
+ return target && target.nodeName ? target.nodeName : "";
+ },
+ fullscreenEnabled: function() {
+ return document.fullscreenEnabled || document.webkitFullscreenEnabled;
+ }
+};
+
+function maybeCStringToJsString(cString) {
+ return cString > 2 ? UTF8ToString(cString) : cString;
+}
+
+var specialHTMLTargets = [ 0, typeof document != "undefined" ? document : 0, typeof window != "undefined" ? window : 0 ];
+
+function findEventTarget(target) {
+ target = maybeCStringToJsString(target);
+ var domElement = specialHTMLTargets[target] || (typeof document != "undefined" ? document.querySelector(target) : undefined);
+ return domElement;
+}
+
+function findCanvasEventTarget(target) {
+ return findEventTarget(target);
+}
+
+function setCanvasElementSizeCallingThread(target, width, height) {
+ var canvas = findCanvasEventTarget(target);
+ if (!canvas) return -4;
+ if (!canvas.controlTransferredOffscreen) {
+ var autoResizeViewport = false;
+ if (canvas.GLctxObject && canvas.GLctxObject.GLctx) {
+ var prevViewport = canvas.GLctxObject.GLctx.getParameter(2978);
+ autoResizeViewport = prevViewport[0] === 0 && prevViewport[1] === 0 && prevViewport[2] === canvas.width && prevViewport[3] === canvas.height;
+ }
+ canvas.width = width;
+ canvas.height = height;
+ if (autoResizeViewport) {
+ canvas.GLctxObject.GLctx.viewport(0, 0, width, height);
+ }
+ } else {
+ return -4;
+ }
+ if (canvas.GLctxObject) GL.resizeOffscreenFramebuffer(canvas.GLctxObject);
+ return 0;
+}
+
+function setCanvasElementSizeMainThread(target, width, height) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(36, 1, target, width, height);
+ return setCanvasElementSizeCallingThread(target, width, height);
+}
+
+function _emscripten_set_canvas_element_size(target, width, height) {
+ var canvas = findCanvasEventTarget(target);
+ if (canvas) {
+ return setCanvasElementSizeCallingThread(target, width, height);
+ }
+ return setCanvasElementSizeMainThread(target, width, height);
+}
+
+function _emscripten_set_main_loop(func, fps, simulateInfiniteLoop) {
+ var browserIterationFunc = getWasmTableEntry(func);
+ setMainLoop(browserIterationFunc, fps, simulateInfiniteLoop);
+}
+
+function _emscripten_supports_offscreencanvas() {
+ return 0;
+}
+
+function _emscripten_webgl_destroy_context(contextHandle) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(37, 1, contextHandle);
+ if (GL.currentContext == contextHandle) GL.currentContext = 0;
+ GL.deleteContext(contextHandle);
+}
+
+function _emscripten_webgl_do_commit_frame() {
+ if (!GL.currentContext || !GL.currentContext.GLctx) {
+ return -3;
+ }
+ if (GL.currentContext.defaultFbo) {
+ GL.blitOffscreenFramebuffer(GL.currentContext);
+ return 0;
+ }
+ if (!GL.currentContext.attributes.explicitSwapControl) {
+ return -3;
+ }
+ return 0;
+}
+
+function _emscripten_webgl_create_context_proxied(target, attributes) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(38, 1, target, attributes);
+ return _emscripten_webgl_do_create_context(target, attributes);
+}
+
+var emscripten_webgl_power_preferences = [ "default", "low-power", "high-performance" ];
+
+function _emscripten_webgl_do_create_context(target, attributes) {
+ assert(attributes);
+ var a = attributes >> 2;
+ var powerPreference = GROWABLE_HEAP_I32()[a + (24 >> 2)];
+ var contextAttributes = {
+ "alpha": !!GROWABLE_HEAP_I32()[a + (0 >> 2)],
+ "depth": !!GROWABLE_HEAP_I32()[a + (4 >> 2)],
+ "stencil": !!GROWABLE_HEAP_I32()[a + (8 >> 2)],
+ "antialias": !!GROWABLE_HEAP_I32()[a + (12 >> 2)],
+ "premultipliedAlpha": !!GROWABLE_HEAP_I32()[a + (16 >> 2)],
+ "preserveDrawingBuffer": !!GROWABLE_HEAP_I32()[a + (20 >> 2)],
+ "powerPreference": emscripten_webgl_power_preferences[powerPreference],
+ "failIfMajorPerformanceCaveat": !!GROWABLE_HEAP_I32()[a + (28 >> 2)],
+ majorVersion: GROWABLE_HEAP_I32()[a + (32 >> 2)],
+ minorVersion: GROWABLE_HEAP_I32()[a + (36 >> 2)],
+ enableExtensionsByDefault: GROWABLE_HEAP_I32()[a + (40 >> 2)],
+ explicitSwapControl: GROWABLE_HEAP_I32()[a + (44 >> 2)],
+ proxyContextToMainThread: GROWABLE_HEAP_I32()[a + (48 >> 2)],
+ renderViaOffscreenBackBuffer: GROWABLE_HEAP_I32()[a + (52 >> 2)]
+ };
+ var canvas = findCanvasEventTarget(target);
+ if (ENVIRONMENT_IS_PTHREAD) {
+ if (contextAttributes.proxyContextToMainThread === 2 || !canvas && contextAttributes.proxyContextToMainThread === 1) {
+ if (typeof OffscreenCanvas == "undefined") {
+ GROWABLE_HEAP_I32()[attributes + 52 >> 2] = 1;
+ GROWABLE_HEAP_I32()[attributes + 20 >> 2] = 1;
+ }
+ return _emscripten_webgl_create_context_proxied(target, attributes);
+ }
+ }
+ if (!canvas) {
+ return 0;
+ }
+ if (contextAttributes.explicitSwapControl && !contextAttributes.renderViaOffscreenBackBuffer) {
+ contextAttributes.renderViaOffscreenBackBuffer = true;
+ }
+ var contextHandle = GL.createContext(canvas, contextAttributes);
+ return contextHandle;
+}
+
+function _emscripten_webgl_enable_extension(contextHandle, extension) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(39, 1, contextHandle, extension);
+ var context = GL.getContext(contextHandle);
+ var extString = UTF8ToString(extension);
+ if (extString.startsWith("GL_")) extString = extString.substr(3);
+ if (extString == "ANGLE_instanced_arrays") webgl_enable_ANGLE_instanced_arrays(GLctx);
+ if (extString == "OES_vertex_array_object") webgl_enable_OES_vertex_array_object(GLctx);
+ if (extString == "WEBGL_draw_buffers") webgl_enable_WEBGL_draw_buffers(GLctx);
+ if (extString == "WEBGL_draw_instanced_base_vertex_base_instance") webgl_enable_WEBGL_draw_instanced_base_vertex_base_instance(GLctx);
+ if (extString == "WEBGL_multi_draw_instanced_base_vertex_base_instance") webgl_enable_WEBGL_multi_draw_instanced_base_vertex_base_instance(GLctx);
+ if (extString == "WEBGL_multi_draw") webgl_enable_WEBGL_multi_draw(GLctx);
+ var ext = context.GLctx.getExtension(extString);
+ return !!ext;
+}
+
+function _emscripten_webgl_init_context_attributes(attributes) {
+ assert(attributes);
+ var a = attributes >> 2;
+ for (var i = 0; i < 56 >> 2; ++i) {
+ GROWABLE_HEAP_I32()[a + i] = 0;
+ }
+ GROWABLE_HEAP_I32()[a + (0 >> 2)] = GROWABLE_HEAP_I32()[a + (4 >> 2)] = GROWABLE_HEAP_I32()[a + (12 >> 2)] = GROWABLE_HEAP_I32()[a + (16 >> 2)] = GROWABLE_HEAP_I32()[a + (32 >> 2)] = GROWABLE_HEAP_I32()[a + (40 >> 2)] = 1;
+ if (ENVIRONMENT_IS_WORKER) GROWABLE_HEAP_I32()[attributes + 48 >> 2] = 1;
+}
+
+function _emscripten_webgl_make_context_current_calling_thread(contextHandle) {
+ var success = GL.makeContextCurrent(contextHandle);
+ if (success) GL.currentContextIsProxied = false;
+ return success ? 0 : -5;
+}
+
+var ENV = {};
+
+function getExecutableName() {
+ return thisProgram || "./this.program";
+}
+
+function getEnvStrings() {
+ if (!getEnvStrings.strings) {
+ var lang = (typeof navigator == "object" && navigator.languages && navigator.languages[0] || "C").replace("-", "_") + ".UTF-8";
+ var env = {
+ "USER": "web_user",
+ "LOGNAME": "web_user",
+ "PATH": "/",
+ "PWD": "/",
+ "HOME": "/home/web_user",
+ "LANG": lang,
+ "_": getExecutableName()
+ };
+ for (var x in ENV) {
+ if (ENV[x] === undefined) delete env[x]; else env[x] = ENV[x];
+ }
+ var strings = [];
+ for (var x in env) {
+ strings.push(x + "=" + env[x]);
+ }
+ getEnvStrings.strings = strings;
+ }
+ return getEnvStrings.strings;
+}
+
+function stringToAscii(str, buffer) {
+ for (var i = 0; i < str.length; ++i) {
+ assert(str.charCodeAt(i) === (str.charCodeAt(i) & 255));
+ GROWABLE_HEAP_I8()[buffer++ >> 0] = str.charCodeAt(i);
+ }
+ GROWABLE_HEAP_I8()[buffer >> 0] = 0;
+}
+
+function _environ_get(__environ, environ_buf) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(40, 1, __environ, environ_buf);
+ var bufSize = 0;
+ getEnvStrings().forEach(function(string, i) {
+ var ptr = environ_buf + bufSize;
+ GROWABLE_HEAP_U32()[__environ + i * 4 >> 2] = ptr;
+ stringToAscii(string, ptr);
+ bufSize += string.length + 1;
+ });
+ return 0;
+}
+
+function _environ_sizes_get(penviron_count, penviron_buf_size) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(41, 1, penviron_count, penviron_buf_size);
+ var strings = getEnvStrings();
+ GROWABLE_HEAP_U32()[penviron_count >> 2] = strings.length;
+ var bufSize = 0;
+ strings.forEach(function(string) {
+ bufSize += string.length + 1;
+ });
+ GROWABLE_HEAP_U32()[penviron_buf_size >> 2] = bufSize;
+ return 0;
+}
+
+function _fd_close(fd) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(42, 1, fd);
+ try {
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ FS.close(stream);
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return e.errno;
+ }
+}
+
+function _fd_fdstat_get(fd, pbuf) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(43, 1, fd, pbuf);
+ try {
+ var rightsBase = 0;
+ var rightsInheriting = 0;
+ var flags = 0;
+ {
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ var type = stream.tty ? 2 : FS.isDir(stream.mode) ? 3 : FS.isLink(stream.mode) ? 7 : 4;
+ }
+ GROWABLE_HEAP_I8()[pbuf >> 0] = type;
+ GROWABLE_HEAP_I16()[pbuf + 2 >> 1] = flags;
+ tempI64 = [ rightsBase >>> 0, (tempDouble = rightsBase, +Math.abs(tempDouble) >= 1 ? tempDouble > 0 ? +Math.floor(tempDouble / 4294967296) >>> 0 : ~~+Math.ceil((tempDouble - +(~~tempDouble >>> 0)) / 4294967296) >>> 0 : 0) ],
+ GROWABLE_HEAP_I32()[pbuf + 8 >> 2] = tempI64[0], GROWABLE_HEAP_I32()[pbuf + 12 >> 2] = tempI64[1];
+ tempI64 = [ rightsInheriting >>> 0, (tempDouble = rightsInheriting, +Math.abs(tempDouble) >= 1 ? tempDouble > 0 ? +Math.floor(tempDouble / 4294967296) >>> 0 : ~~+Math.ceil((tempDouble - +(~~tempDouble >>> 0)) / 4294967296) >>> 0 : 0) ],
+ GROWABLE_HEAP_I32()[pbuf + 16 >> 2] = tempI64[0], GROWABLE_HEAP_I32()[pbuf + 20 >> 2] = tempI64[1];
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return e.errno;
+ }
+}
+
+function doReadv(stream, iov, iovcnt, offset) {
+ var ret = 0;
+ for (var i = 0; i < iovcnt; i++) {
+ var ptr = GROWABLE_HEAP_U32()[iov >> 2];
+ var len = GROWABLE_HEAP_U32()[iov + 4 >> 2];
+ iov += 8;
+ var curr = FS.read(stream, GROWABLE_HEAP_I8(), ptr, len, offset);
+ if (curr < 0) return -1;
+ ret += curr;
+ if (curr < len) break;
+ if (typeof offset !== "undefined") {
+ offset += curr;
+ }
+ }
+ return ret;
+}
+
+function _fd_read(fd, iov, iovcnt, pnum) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(44, 1, fd, iov, iovcnt, pnum);
+ try {
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ var num = doReadv(stream, iov, iovcnt);
+ GROWABLE_HEAP_U32()[pnum >> 2] = num;
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return e.errno;
+ }
+}
+
+function convertI32PairToI53Checked(lo, hi) {
+ assert(lo == lo >>> 0 || lo == (lo | 0));
+ assert(hi === (hi | 0));
+ return hi + 2097152 >>> 0 < 4194305 - !!lo ? (lo >>> 0) + hi * 4294967296 : NaN;
+}
+
+function _fd_seek(fd, offset_low, offset_high, whence, newOffset) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(45, 1, fd, offset_low, offset_high, whence, newOffset);
+ try {
+ var offset = convertI32PairToI53Checked(offset_low, offset_high);
+ if (isNaN(offset)) return 61;
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ FS.llseek(stream, offset, whence);
+ tempI64 = [ stream.position >>> 0, (tempDouble = stream.position, +Math.abs(tempDouble) >= 1 ? tempDouble > 0 ? +Math.floor(tempDouble / 4294967296) >>> 0 : ~~+Math.ceil((tempDouble - +(~~tempDouble >>> 0)) / 4294967296) >>> 0 : 0) ],
+ GROWABLE_HEAP_I32()[newOffset >> 2] = tempI64[0], GROWABLE_HEAP_I32()[newOffset + 4 >> 2] = tempI64[1];
+ if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null;
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return e.errno;
+ }
+}
+
+function doWritev(stream, iov, iovcnt, offset) {
+ var ret = 0;
+ for (var i = 0; i < iovcnt; i++) {
+ var ptr = GROWABLE_HEAP_U32()[iov >> 2];
+ var len = GROWABLE_HEAP_U32()[iov + 4 >> 2];
+ iov += 8;
+ var curr = FS.write(stream, GROWABLE_HEAP_I8(), ptr, len, offset);
+ if (curr < 0) return -1;
+ ret += curr;
+ if (typeof offset !== "undefined") {
+ offset += curr;
+ }
+ }
+ return ret;
+}
+
+function _fd_write(fd, iov, iovcnt, pnum) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(46, 1, fd, iov, iovcnt, pnum);
+ try {
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ var num = doWritev(stream, iov, iovcnt);
+ GROWABLE_HEAP_U32()[pnum >> 2] = num;
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return e.errno;
+ }
+}
+
+function _getaddrinfo(node, service, hint, out) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(47, 1, node, service, hint, out);
+ var addrs = [];
+ var canon = null;
+ var addr = 0;
+ var port = 0;
+ var flags = 0;
+ var family = 0;
+ var type = 0;
+ var proto = 0;
+ var ai, last;
+ function allocaddrinfo(family, type, proto, canon, addr, port) {
+ var sa, salen, ai;
+ var errno;
+ salen = family === 10 ? 28 : 16;
+ addr = family === 10 ? inetNtop6(addr) : inetNtop4(addr);
+ sa = _malloc(salen);
+ errno = writeSockaddr(sa, family, addr, port);
+ assert(!errno);
+ ai = _malloc(32);
+ GROWABLE_HEAP_I32()[ai + 4 >> 2] = family;
+ GROWABLE_HEAP_I32()[ai + 8 >> 2] = type;
+ GROWABLE_HEAP_I32()[ai + 12 >> 2] = proto;
+ GROWABLE_HEAP_U32()[ai + 24 >> 2] = canon;
+ GROWABLE_HEAP_U32()[ai + 20 >> 2] = sa;
+ if (family === 10) {
+ GROWABLE_HEAP_I32()[ai + 16 >> 2] = 28;
+ } else {
+ GROWABLE_HEAP_I32()[ai + 16 >> 2] = 16;
+ }
+ GROWABLE_HEAP_I32()[ai + 28 >> 2] = 0;
+ return ai;
+ }
+ if (hint) {
+ flags = GROWABLE_HEAP_I32()[hint >> 2];
+ family = GROWABLE_HEAP_I32()[hint + 4 >> 2];
+ type = GROWABLE_HEAP_I32()[hint + 8 >> 2];
+ proto = GROWABLE_HEAP_I32()[hint + 12 >> 2];
+ }
+ if (type && !proto) {
+ proto = type === 2 ? 17 : 6;
+ }
+ if (!type && proto) {
+ type = proto === 17 ? 2 : 1;
+ }
+ if (proto === 0) {
+ proto = 6;
+ }
+ if (type === 0) {
+ type = 1;
+ }
+ if (!node && !service) {
+ return -2;
+ }
+ if (flags & ~(1 | 2 | 4 | 1024 | 8 | 16 | 32)) {
+ return -1;
+ }
+ if (hint !== 0 && GROWABLE_HEAP_I32()[hint >> 2] & 2 && !node) {
+ return -1;
+ }
+ if (flags & 32) {
+ return -2;
+ }
+ if (type !== 0 && type !== 1 && type !== 2) {
+ return -7;
+ }
+ if (family !== 0 && family !== 2 && family !== 10) {
+ return -6;
+ }
+ if (service) {
+ service = UTF8ToString(service);
+ port = parseInt(service, 10);
+ if (isNaN(port)) {
+ if (flags & 1024) {
+ return -2;
+ }
+ return -8;
+ }
+ }
+ if (!node) {
+ if (family === 0) {
+ family = 2;
+ }
+ if ((flags & 1) === 0) {
+ if (family === 2) {
+ addr = _htonl(2130706433);
+ } else {
+ addr = [ 0, 0, 0, 1 ];
+ }
+ }
+ ai = allocaddrinfo(family, type, proto, null, addr, port);
+ GROWABLE_HEAP_U32()[out >> 2] = ai;
+ return 0;
+ }
+ node = UTF8ToString(node);
+ addr = inetPton4(node);
+ if (addr !== null) {
+ if (family === 0 || family === 2) {
+ family = 2;
+ } else if (family === 10 && flags & 8) {
+ addr = [ 0, 0, _htonl(65535), addr ];
+ family = 10;
+ } else {
+ return -2;
+ }
+ } else {
+ addr = inetPton6(node);
+ if (addr !== null) {
+ if (family === 0 || family === 10) {
+ family = 10;
+ } else {
+ return -2;
+ }
+ }
+ }
+ if (addr != null) {
+ ai = allocaddrinfo(family, type, proto, node, addr, port);
+ GROWABLE_HEAP_U32()[out >> 2] = ai;
+ return 0;
+ }
+ if (flags & 4) {
+ return -2;
+ }
+ node = DNS.lookup_name(node);
+ addr = inetPton4(node);
+ if (family === 0) {
+ family = 2;
+ } else if (family === 10) {
+ addr = [ 0, 0, _htonl(65535), addr ];
+ }
+ ai = allocaddrinfo(family, type, proto, null, addr, port);
+ GROWABLE_HEAP_U32()[out >> 2] = ai;
+ return 0;
+}
+
+function _getnameinfo(sa, salen, node, nodelen, serv, servlen, flags) {
+ var info = readSockaddr(sa, salen);
+ if (info.errno) {
+ return -6;
+ }
+ var port = info.port;
+ var addr = info.addr;
+ var overflowed = false;
+ if (node && nodelen) {
+ var lookup;
+ if (flags & 1 || !(lookup = DNS.lookup_addr(addr))) {
+ if (flags & 8) {
+ return -2;
+ }
+ } else {
+ addr = lookup;
+ }
+ var numBytesWrittenExclNull = stringToUTF8(addr, node, nodelen);
+ if (numBytesWrittenExclNull + 1 >= nodelen) {
+ overflowed = true;
+ }
+ }
+ if (serv && servlen) {
+ port = "" + port;
+ var numBytesWrittenExclNull = stringToUTF8(port, serv, servlen);
+ if (numBytesWrittenExclNull + 1 >= servlen) {
+ overflowed = true;
+ }
+ }
+ if (overflowed) {
+ return -12;
+ }
+ return 0;
+}
+
+var GodotRuntime = {
+ get_func: function(ptr) {
+ return wasmTable.get(ptr);
+ },
+ error: function() {
+ err.apply(null, Array.from(arguments));
+ },
+ print: function() {
+ out.apply(null, Array.from(arguments));
+ },
+ malloc: function(p_size) {
+ return _malloc(p_size);
+ },
+ free: function(p_ptr) {
+ _free(p_ptr);
+ },
+ getHeapValue: function(p_ptr, p_type) {
+ return getValue(p_ptr, p_type);
+ },
+ setHeapValue: function(p_ptr, p_value, p_type) {
+ setValue(p_ptr, p_value, p_type);
+ },
+ heapSub: function(p_heap, p_ptr, p_len) {
+ const bytes = p_heap.BYTES_PER_ELEMENT;
+ return p_heap.subarray(p_ptr / bytes, p_ptr / bytes + p_len);
+ },
+ heapSlice: function(p_heap, p_ptr, p_len) {
+ const bytes = p_heap.BYTES_PER_ELEMENT;
+ return p_heap.slice(p_ptr / bytes, p_ptr / bytes + p_len);
+ },
+ heapCopy: function(p_dst, p_src, p_ptr) {
+ const bytes = p_src.BYTES_PER_ELEMENT;
+ return p_dst.set(p_src, p_ptr / bytes);
+ },
+ parseString: function(p_ptr) {
+ return UTF8ToString(p_ptr);
+ },
+ parseStringArray: function(p_ptr, p_size) {
+ const strings = [];
+ const ptrs = GodotRuntime.heapSub(GROWABLE_HEAP_I32(), p_ptr, p_size);
+ ptrs.forEach(function(ptr) {
+ strings.push(GodotRuntime.parseString(ptr));
+ });
+ return strings;
+ },
+ strlen: function(p_str) {
+ return lengthBytesUTF8(p_str);
+ },
+ allocString: function(p_str) {
+ const length = GodotRuntime.strlen(p_str) + 1;
+ const c_str = GodotRuntime.malloc(length);
+ stringToUTF8(p_str, c_str, length);
+ return c_str;
+ },
+ allocStringArray: function(p_strings) {
+ const size = p_strings.length;
+ const c_ptr = GodotRuntime.malloc(size * 4);
+ for (let i = 0; i < size; i++) {
+ GROWABLE_HEAP_I32()[(c_ptr >> 2) + i] = GodotRuntime.allocString(p_strings[i]);
+ }
+ return c_ptr;
+ },
+ freeStringArray: function(p_ptr, p_len) {
+ for (let i = 0; i < p_len; i++) {
+ GodotRuntime.free(GROWABLE_HEAP_I32()[(p_ptr >> 2) + i]);
+ }
+ GodotRuntime.free(p_ptr);
+ },
+ stringToHeap: function(p_str, p_ptr, p_len) {
+ return stringToUTF8Array(p_str, GROWABLE_HEAP_I8(), p_ptr, p_len);
+ }
+};
+
+var GodotConfig = {
+ canvas: null,
+ locale: "en",
+ canvas_resize_policy: 2,
+ virtual_keyboard: false,
+ persistent_drops: false,
+ on_execute: null,
+ on_exit: null,
+ init_config: function(p_opts) {
+ GodotConfig.canvas_resize_policy = p_opts["canvasResizePolicy"];
+ GodotConfig.canvas = p_opts["canvas"];
+ GodotConfig.locale = p_opts["locale"] || GodotConfig.locale;
+ GodotConfig.virtual_keyboard = p_opts["virtualKeyboard"];
+ GodotConfig.persistent_drops = !!p_opts["persistentDrops"];
+ GodotConfig.on_execute = p_opts["onExecute"];
+ GodotConfig.on_exit = p_opts["onExit"];
+ if (p_opts["focusCanvas"]) {
+ GodotConfig.canvas.focus();
+ }
+ },
+ locate_file: function(file) {
+ return Module["locateFile"](file);
+ },
+ clear: function() {
+ GodotConfig.canvas = null;
+ GodotConfig.locale = "en";
+ GodotConfig.canvas_resize_policy = 2;
+ GodotConfig.virtual_keyboard = false;
+ GodotConfig.persistent_drops = false;
+ GodotConfig.on_execute = null;
+ GodotConfig.on_exit = null;
+ }
+};
+
+var GodotFS = {
+ ENOENT: 44,
+ _idbfs: false,
+ _syncing: false,
+ _mount_points: [],
+ is_persistent: function() {
+ return GodotFS._idbfs ? 1 : 0;
+ },
+ init: function(persistentPaths) {
+ GodotFS._idbfs = false;
+ if (!Array.isArray(persistentPaths)) {
+ return Promise.reject(new Error("Persistent paths must be an array"));
+ }
+ if (!persistentPaths.length) {
+ return Promise.resolve();
+ }
+ GodotFS._mount_points = persistentPaths.slice();
+ function createRecursive(dir) {
+ try {
+ FS.stat(dir);
+ } catch (e) {
+ if (e.errno !== GodotFS.ENOENT) {
+ GodotRuntime.error(e);
+ }
+ FS.mkdirTree(dir);
+ }
+ }
+ GodotFS._mount_points.forEach(function(path) {
+ createRecursive(path);
+ FS.mount(IDBFS, {}, path);
+ });
+ return new Promise(function(resolve, reject) {
+ FS.syncfs(true, function(err) {
+ if (err) {
+ GodotFS._mount_points = [];
+ GodotFS._idbfs = false;
+ GodotRuntime.print(`IndexedDB not available: ${err.message}`);
+ } else {
+ GodotFS._idbfs = true;
+ }
+ resolve(err);
+ });
+ });
+ },
+ deinit: function() {
+ GodotFS._mount_points.forEach(function(path) {
+ try {
+ FS.unmount(path);
+ } catch (e) {
+ GodotRuntime.print("Already unmounted", e);
+ }
+ if (GodotFS._idbfs && IDBFS.dbs[path]) {
+ IDBFS.dbs[path].close();
+ delete IDBFS.dbs[path];
+ }
+ });
+ GodotFS._mount_points = [];
+ GodotFS._idbfs = false;
+ GodotFS._syncing = false;
+ },
+ sync: function() {
+ if (GodotFS._syncing) {
+ GodotRuntime.error("Already syncing!");
+ return Promise.resolve();
+ }
+ GodotFS._syncing = true;
+ return new Promise(function(resolve, reject) {
+ FS.syncfs(false, function(error) {
+ if (error) {
+ GodotRuntime.error(`Failed to save IDB file system: ${error.message}`);
+ }
+ GodotFS._syncing = false;
+ resolve(error);
+ });
+ });
+ },
+ copy_to_fs: function(path, buffer) {
+ const idx = path.lastIndexOf("/");
+ let dir = "/";
+ if (idx > 0) {
+ dir = path.slice(0, idx);
+ }
+ try {
+ FS.stat(dir);
+ } catch (e) {
+ if (e.errno !== GodotFS.ENOENT) {
+ GodotRuntime.error(e);
+ }
+ FS.mkdirTree(dir);
+ }
+ FS.writeFile(path, new Uint8Array(buffer));
+ }
+};
+
+var GodotOS = {
+ request_quit: function() {},
+ _async_cbs: [],
+ _fs_sync_promise: null,
+ atexit: function(p_promise_cb) {
+ GodotOS._async_cbs.push(p_promise_cb);
+ },
+ cleanup: function(exit_code) {
+ const cb = GodotConfig.on_exit;
+ GodotFS.deinit();
+ GodotConfig.clear();
+ if (cb) {
+ cb(exit_code);
+ }
+ },
+ finish_async: function(callback) {
+ GodotOS._fs_sync_promise.then(function(err) {
+ const promises = [];
+ GodotOS._async_cbs.forEach(function(cb) {
+ promises.push(new Promise(cb));
+ });
+ return Promise.all(promises);
+ }).then(function() {
+ return GodotFS.sync();
+ }).then(function(err) {
+ setTimeout(function() {
+ callback();
+ }, 0);
+ });
+ }
+};
+
+var GodotAudio = {
+ ctx: null,
+ input: null,
+ driver: null,
+ interval: 0,
+ init: function(mix_rate, latency, onstatechange, onlatencyupdate) {
+ const opts = {};
+ if (mix_rate) {
+ opts["sampleRate"] = mix_rate;
+ }
+ const ctx = new (window.AudioContext || window.webkitAudioContext)(opts);
+ GodotAudio.ctx = ctx;
+ ctx.onstatechange = function() {
+ let state = 0;
+ switch (ctx.state) {
+ case "suspended":
+ state = 0;
+ break;
+
+ case "running":
+ state = 1;
+ break;
+
+ case "closed":
+ state = 2;
+ break;
+ }
+ onstatechange(state);
+ };
+ ctx.onstatechange();
+ GodotAudio.interval = setInterval(function() {
+ let computed_latency = 0;
+ if (ctx.baseLatency) {
+ computed_latency += GodotAudio.ctx.baseLatency;
+ }
+ if (ctx.outputLatency) {
+ computed_latency += GodotAudio.ctx.outputLatency;
+ }
+ onlatencyupdate(computed_latency);
+ }, 1e3);
+ GodotOS.atexit(GodotAudio.close_async);
+ return ctx.destination.channelCount;
+ },
+ create_input: function(callback) {
+ if (GodotAudio.input) {
+ return 0;
+ }
+ function gotMediaInput(stream) {
+ try {
+ GodotAudio.input = GodotAudio.ctx.createMediaStreamSource(stream);
+ callback(GodotAudio.input);
+ } catch (e) {
+ GodotRuntime.error("Failed creating input.", e);
+ }
+ }
+ if (navigator.mediaDevices && navigator.mediaDevices.getUserMedia) {
+ navigator.mediaDevices.getUserMedia({
+ "audio": true
+ }).then(gotMediaInput, function(e) {
+ GodotRuntime.error("Error getting user media.", e);
+ });
+ } else {
+ if (!navigator.getUserMedia) {
+ navigator.getUserMedia = navigator.webkitGetUserMedia || navigator.mozGetUserMedia;
+ }
+ if (!navigator.getUserMedia) {
+ GodotRuntime.error("getUserMedia not available.");
+ return 1;
+ }
+ navigator.getUserMedia({
+ "audio": true
+ }, gotMediaInput, function(e) {
+ GodotRuntime.print(e);
+ });
+ }
+ return 0;
+ },
+ close_async: function(resolve, reject) {
+ const ctx = GodotAudio.ctx;
+ GodotAudio.ctx = null;
+ if (!ctx) {
+ resolve();
+ return;
+ }
+ if (GodotAudio.interval) {
+ clearInterval(GodotAudio.interval);
+ GodotAudio.interval = 0;
+ }
+ if (GodotAudio.input) {
+ GodotAudio.input.disconnect();
+ GodotAudio.input = null;
+ }
+ let closed = Promise.resolve();
+ if (GodotAudio.driver) {
+ closed = GodotAudio.driver.close();
+ }
+ closed.then(function() {
+ return ctx.close();
+ }).then(function() {
+ ctx.onstatechange = null;
+ resolve();
+ }).catch(function(e) {
+ ctx.onstatechange = null;
+ GodotRuntime.error("Error closing AudioContext", e);
+ resolve();
+ });
+ }
+};
+
+function _godot_audio_has_worklet() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(48, 1);
+ return GodotAudio.ctx && GodotAudio.ctx.audioWorklet ? 1 : 0;
+}
+
+function _godot_audio_init(p_mix_rate, p_latency, p_state_change, p_latency_update) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(49, 1, p_mix_rate, p_latency, p_state_change, p_latency_update);
+ const statechange = GodotRuntime.get_func(p_state_change);
+ const latencyupdate = GodotRuntime.get_func(p_latency_update);
+ const mix_rate = GodotRuntime.getHeapValue(p_mix_rate, "i32");
+ const channels = GodotAudio.init(mix_rate, p_latency, statechange, latencyupdate);
+ GodotRuntime.setHeapValue(p_mix_rate, GodotAudio.ctx.sampleRate, "i32");
+ return channels;
+}
+
+function _godot_audio_input_start() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(50, 1);
+ return GodotAudio.create_input(function(input) {
+ input.connect(GodotAudio.driver.get_node());
+ });
+}
+
+function _godot_audio_input_stop() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(51, 1);
+ if (GodotAudio.input) {
+ const tracks = GodotAudio.input["mediaStream"]["getTracks"]();
+ for (let i = 0; i < tracks.length; i++) {
+ tracks[i]["stop"]();
+ }
+ GodotAudio.input.disconnect();
+ GodotAudio.input = null;
+ }
+}
+
+function _godot_audio_is_available() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(52, 1);
+ if (!(window.AudioContext || window.webkitAudioContext)) {
+ return 0;
+ }
+ return 1;
+}
+
+function _godot_audio_resume() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(53, 1);
+ if (GodotAudio.ctx && GodotAudio.ctx.state !== "running") {
+ GodotAudio.ctx.resume();
+ }
+}
+
+var GodotAudioWorklet = {
+ promise: null,
+ worklet: null,
+ ring_buffer: null,
+ create: function(channels) {
+ const path = GodotConfig.locate_file("godot.audio.worklet.js");
+ GodotAudioWorklet.promise = GodotAudio.ctx.audioWorklet.addModule(path).then(function() {
+ GodotAudioWorklet.worklet = new AudioWorkletNode(GodotAudio.ctx, "godot-processor", {
+ "outputChannelCount": [ channels ]
+ });
+ return Promise.resolve();
+ });
+ GodotAudio.driver = GodotAudioWorklet;
+ },
+ start: function(in_buf, out_buf, state) {
+ GodotAudioWorklet.promise.then(function() {
+ const node = GodotAudioWorklet.worklet;
+ node.connect(GodotAudio.ctx.destination);
+ node.port.postMessage({
+ "cmd": "start",
+ "data": [ state, in_buf, out_buf ]
+ });
+ node.port.onmessage = function(event) {
+ GodotRuntime.error(event.data);
+ };
+ });
+ },
+ start_no_threads: function(p_out_buf, p_out_size, out_callback, p_in_buf, p_in_size, in_callback) {
+ function RingBuffer() {
+ let wpos = 0;
+ let rpos = 0;
+ let pending_samples = 0;
+ const wbuf = new Float32Array(p_out_size);
+ function send(port) {
+ if (pending_samples === 0) {
+ return;
+ }
+ const buffer = GodotRuntime.heapSub(GROWABLE_HEAP_F32(), p_out_buf, p_out_size);
+ const size = buffer.length;
+ const tot_sent = pending_samples;
+ out_callback(wpos, pending_samples);
+ if (wpos + pending_samples >= size) {
+ const high = size - wpos;
+ wbuf.set(buffer.subarray(wpos, size));
+ pending_samples -= high;
+ wpos = 0;
+ }
+ if (pending_samples > 0) {
+ wbuf.set(buffer.subarray(wpos, wpos + pending_samples), tot_sent - pending_samples);
+ }
+ port.postMessage({
+ "cmd": "chunk",
+ "data": wbuf.subarray(0, tot_sent)
+ });
+ wpos += pending_samples;
+ pending_samples = 0;
+ }
+ this.receive = function(recv_buf) {
+ const buffer = GodotRuntime.heapSub(GROWABLE_HEAP_F32(), p_in_buf, p_in_size);
+ const from = rpos;
+ let to_write = recv_buf.length;
+ let high = 0;
+ if (rpos + to_write >= p_in_size) {
+ high = p_in_size - rpos;
+ buffer.set(recv_buf.subarray(0, high), rpos);
+ to_write -= high;
+ rpos = 0;
+ }
+ if (to_write) {
+ buffer.set(recv_buf.subarray(high, to_write), rpos);
+ }
+ in_callback(from, recv_buf.length);
+ rpos += to_write;
+ };
+ this.consumed = function(size, port) {
+ pending_samples += size;
+ send(port);
+ };
+ }
+ GodotAudioWorklet.ring_buffer = new RingBuffer();
+ GodotAudioWorklet.promise.then(function() {
+ const node = GodotAudioWorklet.worklet;
+ const buffer = GodotRuntime.heapSlice(GROWABLE_HEAP_F32(), p_out_buf, p_out_size);
+ node.connect(GodotAudio.ctx.destination);
+ node.port.postMessage({
+ "cmd": "start_nothreads",
+ "data": [ buffer, p_in_size ]
+ });
+ node.port.onmessage = function(event) {
+ if (!GodotAudioWorklet.worklet) {
+ return;
+ }
+ if (event.data["cmd"] === "read") {
+ const read = event.data["data"];
+ GodotAudioWorklet.ring_buffer.consumed(read, GodotAudioWorklet.worklet.port);
+ } else if (event.data["cmd"] === "input") {
+ const buf = event.data["data"];
+ if (buf.length > p_in_size) {
+ GodotRuntime.error("Input chunk is too big");
+ return;
+ }
+ GodotAudioWorklet.ring_buffer.receive(buf);
+ } else {
+ GodotRuntime.error(event.data);
+ }
+ };
+ });
+ },
+ get_node: function() {
+ return GodotAudioWorklet.worklet;
+ },
+ close: function() {
+ return new Promise(function(resolve, reject) {
+ if (GodotAudioWorklet.promise === null) {
+ return;
+ }
+ const p = GodotAudioWorklet.promise;
+ p.then(function() {
+ GodotAudioWorklet.worklet.port.postMessage({
+ "cmd": "stop",
+ "data": null
+ });
+ GodotAudioWorklet.worklet.disconnect();
+ GodotAudioWorklet.worklet.port.onmessage = null;
+ GodotAudioWorklet.worklet = null;
+ GodotAudioWorklet.promise = null;
+ resolve();
+ }).catch(function(err) {
+ GodotRuntime.error(err);
+ });
+ });
+ }
+};
+
+function _godot_audio_worklet_create(channels) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(54, 1, channels);
+ try {
+ GodotAudioWorklet.create(channels);
+ } catch (e) {
+ GodotRuntime.error("Error starting AudioDriverWorklet", e);
+ return 1;
+ }
+ return 0;
+}
+
+function _godot_audio_worklet_start(p_in_buf, p_in_size, p_out_buf, p_out_size, p_state) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(55, 1, p_in_buf, p_in_size, p_out_buf, p_out_size, p_state);
+ const out_buffer = GodotRuntime.heapSub(GROWABLE_HEAP_F32(), p_out_buf, p_out_size);
+ const in_buffer = GodotRuntime.heapSub(GROWABLE_HEAP_F32(), p_in_buf, p_in_size);
+ const state = GodotRuntime.heapSub(GROWABLE_HEAP_I32(), p_state, 4);
+ GodotAudioWorklet.start(in_buffer, out_buffer, state);
+}
+
+function _godot_audio_worklet_state_add(p_state, p_idx, p_value) {
+ return Atomics.add(GROWABLE_HEAP_I32(), (p_state >> 2) + p_idx, p_value);
+}
+
+function _godot_audio_worklet_state_get(p_state, p_idx) {
+ return Atomics.load(GROWABLE_HEAP_I32(), (p_state >> 2) + p_idx);
+}
+
+function _godot_audio_worklet_state_wait(p_state, p_idx, p_expected, p_timeout) {
+ Atomics.wait(GROWABLE_HEAP_I32(), (p_state >> 2) + p_idx, p_expected, p_timeout);
+ return Atomics.load(GROWABLE_HEAP_I32(), (p_state >> 2) + p_idx);
+}
+
+function _godot_js_config_canvas_id_get(p_ptr, p_ptr_max) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(56, 1, p_ptr, p_ptr_max);
+ GodotRuntime.stringToHeap(`#${GodotConfig.canvas.id}`, p_ptr, p_ptr_max);
+}
+
+function _godot_js_config_locale_get(p_ptr, p_ptr_max) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(57, 1, p_ptr, p_ptr_max);
+ GodotRuntime.stringToHeap(GodotConfig.locale, p_ptr, p_ptr_max);
+}
+
+var GodotDisplayCursor = {
+ shape: "default",
+ visible: true,
+ cursors: {},
+ set_style: function(style) {
+ GodotConfig.canvas.style.cursor = style;
+ },
+ set_shape: function(shape) {
+ GodotDisplayCursor.shape = shape;
+ let css = shape;
+ if (shape in GodotDisplayCursor.cursors) {
+ const c = GodotDisplayCursor.cursors[shape];
+ css = `url("${c.url}") ${c.x} ${c.y}, default`;
+ }
+ if (GodotDisplayCursor.visible) {
+ GodotDisplayCursor.set_style(css);
+ }
+ },
+ clear: function() {
+ GodotDisplayCursor.set_style("");
+ GodotDisplayCursor.shape = "default";
+ GodotDisplayCursor.visible = true;
+ Object.keys(GodotDisplayCursor.cursors).forEach(function(key) {
+ URL.revokeObjectURL(GodotDisplayCursor.cursors[key]);
+ delete GodotDisplayCursor.cursors[key];
+ });
+ },
+ lockPointer: function() {
+ const canvas = GodotConfig.canvas;
+ if (canvas.requestPointerLock) {
+ canvas.requestPointerLock();
+ }
+ },
+ releasePointer: function() {
+ if (document.exitPointerLock) {
+ document.exitPointerLock();
+ }
+ },
+ isPointerLocked: function() {
+ return document.pointerLockElement === GodotConfig.canvas;
+ }
+};
+
+var GodotEventListeners = {
+ handlers: [],
+ has: function(target, event, method, capture) {
+ return GodotEventListeners.handlers.findIndex(function(e) {
+ return e.target === target && e.event === event && e.method === method && e.capture === capture;
+ }) !== -1;
+ },
+ add: function(target, event, method, capture) {
+ if (GodotEventListeners.has(target, event, method, capture)) {
+ return;
+ }
+ function Handler(p_target, p_event, p_method, p_capture) {
+ this.target = p_target;
+ this.event = p_event;
+ this.method = p_method;
+ this.capture = p_capture;
+ }
+ GodotEventListeners.handlers.push(new Handler(target, event, method, capture));
+ target.addEventListener(event, method, capture);
+ },
+ clear: function() {
+ GodotEventListeners.handlers.forEach(function(h) {
+ h.target.removeEventListener(h.event, h.method, h.capture);
+ });
+ GodotEventListeners.handlers.length = 0;
+ }
+};
+
+var GodotDisplayScreen = {
+ desired_size: [ 0, 0 ],
+ hidpi: true,
+ getPixelRatio: function() {
+ return GodotDisplayScreen.hidpi ? window.devicePixelRatio || 1 : 1;
+ },
+ isFullscreen: function() {
+ const elem = document.fullscreenElement || document.mozFullscreenElement || document.webkitFullscreenElement || document.msFullscreenElement;
+ if (elem) {
+ return elem === GodotConfig.canvas;
+ }
+ return document.fullscreen || document.mozFullScreen || document.webkitIsFullscreen;
+ },
+ hasFullscreen: function() {
+ return document.fullscreenEnabled || document.mozFullScreenEnabled || document.webkitFullscreenEnabled;
+ },
+ requestFullscreen: function() {
+ if (!GodotDisplayScreen.hasFullscreen()) {
+ return 1;
+ }
+ const canvas = GodotConfig.canvas;
+ try {
+ const promise = (canvas.requestFullscreen || canvas.msRequestFullscreen || canvas.mozRequestFullScreen || canvas.mozRequestFullscreen || canvas.webkitRequestFullscreen).call(canvas);
+ if (promise) {
+ promise.catch(function() {});
+ }
+ } catch (e) {
+ return 1;
+ }
+ return 0;
+ },
+ exitFullscreen: function() {
+ if (!GodotDisplayScreen.isFullscreen()) {
+ return 0;
+ }
+ try {
+ const promise = document.exitFullscreen();
+ if (promise) {
+ promise.catch(function() {});
+ }
+ } catch (e) {
+ return 1;
+ }
+ return 0;
+ },
+ _updateGL: function() {
+ const gl_context_handle = _emscripten_webgl_get_current_context();
+ const gl = GL.getContext(gl_context_handle);
+ if (gl) {
+ GL.resizeOffscreenFramebuffer(gl);
+ }
+ },
+ updateSize: function() {
+ const isFullscreen = GodotDisplayScreen.isFullscreen();
+ const wantsFullWindow = GodotConfig.canvas_resize_policy === 2;
+ const noResize = GodotConfig.canvas_resize_policy === 0;
+ const dWidth = GodotDisplayScreen.desired_size[0];
+ const dHeight = GodotDisplayScreen.desired_size[1];
+ const canvas = GodotConfig.canvas;
+ let width = dWidth;
+ let height = dHeight;
+ if (noResize) {
+ if (canvas.width !== width || canvas.height !== height) {
+ GodotDisplayScreen.desired_size = [ canvas.width, canvas.height ];
+ GodotDisplayScreen._updateGL();
+ return 1;
+ }
+ return 0;
+ }
+ const scale = GodotDisplayScreen.getPixelRatio();
+ if (isFullscreen || wantsFullWindow) {
+ width = window.innerWidth * scale;
+ height = window.innerHeight * scale;
+ }
+ const csw = `${width / scale}px`;
+ const csh = `${height / scale}px`;
+ if (canvas.style.width !== csw || canvas.style.height !== csh || canvas.width !== width || canvas.height !== height) {
+ canvas.width = width;
+ canvas.height = height;
+ canvas.style.width = csw;
+ canvas.style.height = csh;
+ GodotDisplayScreen._updateGL();
+ return 1;
+ }
+ return 0;
+ }
+};
+
+var GodotDisplayVK = {
+ textinput: null,
+ textarea: null,
+ available: function() {
+ return GodotConfig.virtual_keyboard && "ontouchstart" in window;
+ },
+ init: function(input_cb) {
+ function create(what) {
+ const elem = document.createElement(what);
+ elem.style.display = "none";
+ elem.style.position = "absolute";
+ elem.style.zIndex = "-1";
+ elem.style.background = "transparent";
+ elem.style.padding = "0px";
+ elem.style.margin = "0px";
+ elem.style.overflow = "hidden";
+ elem.style.width = "0px";
+ elem.style.height = "0px";
+ elem.style.border = "0px";
+ elem.style.outline = "none";
+ elem.readonly = true;
+ elem.disabled = true;
+ GodotEventListeners.add(elem, "input", function(evt) {
+ const c_str = GodotRuntime.allocString(elem.value);
+ input_cb(c_str, elem.selectionEnd);
+ GodotRuntime.free(c_str);
+ }, false);
+ GodotEventListeners.add(elem, "blur", function(evt) {
+ elem.style.display = "none";
+ elem.readonly = true;
+ elem.disabled = true;
+ }, false);
+ GodotConfig.canvas.insertAdjacentElement("beforebegin", elem);
+ return elem;
+ }
+ GodotDisplayVK.textinput = create("input");
+ GodotDisplayVK.textarea = create("textarea");
+ GodotDisplayVK.updateSize();
+ },
+ show: function(text, type, start, end) {
+ if (!GodotDisplayVK.textinput || !GodotDisplayVK.textarea) {
+ return;
+ }
+ if (GodotDisplayVK.textinput.style.display !== "" || GodotDisplayVK.textarea.style.display !== "") {
+ GodotDisplayVK.hide();
+ }
+ GodotDisplayVK.updateSize();
+ let elem = GodotDisplayVK.textinput;
+ switch (type) {
+ case 0:
+ elem.type = "text";
+ elem.inputmode = "";
+ break;
+
+ case 1:
+ elem = GodotDisplayVK.textarea;
+ break;
+
+ case 2:
+ elem.type = "text";
+ elem.inputmode = "numeric";
+ break;
+
+ case 3:
+ elem.type = "text";
+ elem.inputmode = "decimal";
+ break;
+
+ case 4:
+ elem.type = "tel";
+ elem.inputmode = "";
+ break;
+
+ case 5:
+ elem.type = "email";
+ elem.inputmode = "";
+ break;
+
+ case 6:
+ elem.type = "password";
+ elem.inputmode = "";
+ break;
+
+ case 7:
+ elem.type = "url";
+ elem.inputmode = "";
+ break;
+
+ default:
+ elem.type = "text";
+ elem.inputmode = "";
+ break;
+ }
+ elem.readonly = false;
+ elem.disabled = false;
+ elem.value = text;
+ elem.style.display = "block";
+ elem.focus();
+ elem.setSelectionRange(start, end);
+ },
+ hide: function() {
+ if (!GodotDisplayVK.textinput || !GodotDisplayVK.textarea) {
+ return;
+ }
+ [ GodotDisplayVK.textinput, GodotDisplayVK.textarea ].forEach(function(elem) {
+ elem.blur();
+ elem.style.display = "none";
+ elem.value = "";
+ });
+ },
+ updateSize: function() {
+ if (!GodotDisplayVK.textinput || !GodotDisplayVK.textarea) {
+ return;
+ }
+ const rect = GodotConfig.canvas.getBoundingClientRect();
+ function update(elem) {
+ elem.style.left = `${rect.left}px`;
+ elem.style.top = `${rect.top}px`;
+ elem.style.width = `${rect.width}px`;
+ elem.style.height = `${rect.height}px`;
+ }
+ update(GodotDisplayVK.textinput);
+ update(GodotDisplayVK.textarea);
+ },
+ clear: function() {
+ if (GodotDisplayVK.textinput) {
+ GodotDisplayVK.textinput.remove();
+ GodotDisplayVK.textinput = null;
+ }
+ if (GodotDisplayVK.textarea) {
+ GodotDisplayVK.textarea.remove();
+ GodotDisplayVK.textarea = null;
+ }
+ }
+};
+
+var GodotDisplay = {
+ window_icon: "",
+ getDPI: function() {
+ const dpi = Math.round(window.devicePixelRatio * 96);
+ return dpi >= 96 ? dpi : 96;
+ }
+};
+
+function _godot_js_display_alert(p_text) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(58, 1, p_text);
+ window.alert(GodotRuntime.parseString(p_text));
+}
+
+function _godot_js_display_canvas_focus() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(59, 1);
+ GodotConfig.canvas.focus();
+}
+
+function _godot_js_display_canvas_is_focused() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(60, 1);
+ return document.activeElement === GodotConfig.canvas;
+}
+
+function _godot_js_display_clipboard_get(callback) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(61, 1, callback);
+ const func = GodotRuntime.get_func(callback);
+ try {
+ navigator.clipboard.readText().then(function(result) {
+ const ptr = GodotRuntime.allocString(result);
+ func(ptr);
+ GodotRuntime.free(ptr);
+ }).catch(function(e) {});
+ } catch (e) {}
+}
+
+function _godot_js_display_clipboard_set(p_text) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(62, 1, p_text);
+ const text = GodotRuntime.parseString(p_text);
+ if (!navigator.clipboard || !navigator.clipboard.writeText) {
+ return 1;
+ }
+ navigator.clipboard.writeText(text).catch(function(e) {
+ GodotRuntime.error("Setting OS clipboard is only possible from an input callback for the Web platform. Exception:", e);
+ });
+ return 0;
+}
+
+function _godot_js_display_cursor_is_hidden() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(63, 1);
+ return !GodotDisplayCursor.visible;
+}
+
+function _godot_js_display_cursor_is_locked() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(64, 1);
+ return GodotDisplayCursor.isPointerLocked() ? 1 : 0;
+}
+
+function _godot_js_display_cursor_lock_set(p_lock) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(65, 1, p_lock);
+ if (p_lock) {
+ GodotDisplayCursor.lockPointer();
+ } else {
+ GodotDisplayCursor.releasePointer();
+ }
+}
+
+function _godot_js_display_cursor_set_custom_shape(p_shape, p_ptr, p_len, p_hotspot_x, p_hotspot_y) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(66, 1, p_shape, p_ptr, p_len, p_hotspot_x, p_hotspot_y);
+ const shape = GodotRuntime.parseString(p_shape);
+ const old_shape = GodotDisplayCursor.cursors[shape];
+ if (p_len > 0) {
+ const png = new Blob([ GodotRuntime.heapSlice(GROWABLE_HEAP_U8(), p_ptr, p_len) ], {
+ type: "image/png"
+ });
+ const url = URL.createObjectURL(png);
+ GodotDisplayCursor.cursors[shape] = {
+ url: url,
+ x: p_hotspot_x,
+ y: p_hotspot_y
+ };
+ } else {
+ delete GodotDisplayCursor.cursors[shape];
+ }
+ if (shape === GodotDisplayCursor.shape) {
+ GodotDisplayCursor.set_shape(GodotDisplayCursor.shape);
+ }
+ if (old_shape) {
+ URL.revokeObjectURL(old_shape.url);
+ }
+}
+
+function _godot_js_display_cursor_set_shape(p_string) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(67, 1, p_string);
+ GodotDisplayCursor.set_shape(GodotRuntime.parseString(p_string));
+}
+
+function _godot_js_display_cursor_set_visible(p_visible) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(68, 1, p_visible);
+ const visible = p_visible !== 0;
+ if (visible === GodotDisplayCursor.visible) {
+ return;
+ }
+ GodotDisplayCursor.visible = visible;
+ if (visible) {
+ GodotDisplayCursor.set_shape(GodotDisplayCursor.shape);
+ } else {
+ GodotDisplayCursor.set_style("none");
+ }
+}
+
+function _godot_js_display_desired_size_set(width, height) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(69, 1, width, height);
+ GodotDisplayScreen.desired_size = [ width, height ];
+ GodotDisplayScreen.updateSize();
+}
+
+function _godot_js_display_fullscreen_cb(callback) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(70, 1, callback);
+ const canvas = GodotConfig.canvas;
+ const func = GodotRuntime.get_func(callback);
+ function change_cb(evt) {
+ if (evt.target === canvas) {
+ func(GodotDisplayScreen.isFullscreen());
+ }
+ }
+ GodotEventListeners.add(document, "fullscreenchange", change_cb, false);
+ GodotEventListeners.add(document, "mozfullscreenchange", change_cb, false);
+ GodotEventListeners.add(document, "webkitfullscreenchange", change_cb, false);
+}
+
+function _godot_js_display_fullscreen_exit() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(71, 1);
+ return GodotDisplayScreen.exitFullscreen();
+}
+
+function _godot_js_display_fullscreen_request() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(72, 1);
+ return GodotDisplayScreen.requestFullscreen();
+}
+
+function _godot_js_display_has_webgl(p_version) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(73, 1, p_version);
+ if (p_version !== 1 && p_version !== 2) {
+ return false;
+ }
+ try {
+ return !!document.createElement("canvas").getContext(p_version === 2 ? "webgl2" : "webgl");
+ } catch (e) {}
+ return false;
+}
+
+function _godot_js_display_is_swap_ok_cancel() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(74, 1);
+ const win = [ "Windows", "Win64", "Win32", "WinCE" ];
+ const plat = navigator.platform || "";
+ if (win.indexOf(plat) !== -1) {
+ return 1;
+ }
+ return 0;
+}
+
+function _godot_js_display_notification_cb(callback, p_enter, p_exit, p_in, p_out) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(75, 1, callback, p_enter, p_exit, p_in, p_out);
+ const canvas = GodotConfig.canvas;
+ const func = GodotRuntime.get_func(callback);
+ const notif = [ p_enter, p_exit, p_in, p_out ];
+ [ "mouseover", "mouseleave", "focus", "blur" ].forEach(function(evt_name, idx) {
+ GodotEventListeners.add(canvas, evt_name, function() {
+ func(notif[idx]);
+ }, true);
+ });
+}
+
+function _godot_js_display_pixel_ratio_get() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(76, 1);
+ return GodotDisplayScreen.getPixelRatio();
+}
+
+function _godot_js_display_screen_dpi_get() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(77, 1);
+ return GodotDisplay.getDPI();
+}
+
+function _godot_js_display_screen_size_get(width, height) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(78, 1, width, height);
+ const scale = GodotDisplayScreen.getPixelRatio();
+ GodotRuntime.setHeapValue(width, window.screen.width * scale, "i32");
+ GodotRuntime.setHeapValue(height, window.screen.height * scale, "i32");
+}
+
+function _godot_js_display_setup_canvas(p_width, p_height, p_fullscreen, p_hidpi) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(79, 1, p_width, p_height, p_fullscreen, p_hidpi);
+ const canvas = GodotConfig.canvas;
+ GodotEventListeners.add(canvas, "contextmenu", function(ev) {
+ ev.preventDefault();
+ }, false);
+ GodotEventListeners.add(canvas, "webglcontextlost", function(ev) {
+ alert("WebGL context lost, please reload the page");
+ ev.preventDefault();
+ }, false);
+ GodotDisplayScreen.hidpi = !!p_hidpi;
+ switch (GodotConfig.canvas_resize_policy) {
+ case 0:
+ GodotDisplayScreen.desired_size = [ canvas.width, canvas.height ];
+ break;
+
+ case 1:
+ GodotDisplayScreen.desired_size = [ p_width, p_height ];
+ break;
+
+ default:
+ canvas.style.position = "absolute";
+ canvas.style.top = 0;
+ canvas.style.left = 0;
+ break;
+ }
+ GodotDisplayScreen.updateSize();
+ if (p_fullscreen) {
+ GodotDisplayScreen.requestFullscreen();
+ }
+}
+
+function _godot_js_display_size_update() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(80, 1);
+ const updated = GodotDisplayScreen.updateSize();
+ if (updated) {
+ GodotDisplayVK.updateSize();
+ }
+ return updated;
+}
+
+function _godot_js_display_touchscreen_is_available() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(81, 1);
+ return "ontouchstart" in window;
+}
+
+function _godot_js_display_tts_available() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(82, 1);
+ return "speechSynthesis" in window;
+}
+
+function _godot_js_display_vk_available() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(83, 1);
+ return GodotDisplayVK.available();
+}
+
+function _godot_js_display_vk_cb(p_input_cb) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(84, 1, p_input_cb);
+ const input_cb = GodotRuntime.get_func(p_input_cb);
+ if (GodotDisplayVK.available()) {
+ GodotDisplayVK.init(input_cb);
+ }
+}
+
+function _godot_js_display_vk_hide() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(85, 1);
+ GodotDisplayVK.hide();
+}
+
+function _godot_js_display_vk_show(p_text, p_type, p_start, p_end) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(86, 1, p_text, p_type, p_start, p_end);
+ const text = GodotRuntime.parseString(p_text);
+ const start = p_start > 0 ? p_start : 0;
+ const end = p_end > 0 ? p_end : start;
+ GodotDisplayVK.show(text, p_type, start, end);
+}
+
+function _godot_js_display_window_blur_cb(callback) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(87, 1, callback);
+ const func = GodotRuntime.get_func(callback);
+ GodotEventListeners.add(window, "blur", function() {
+ func();
+ }, false);
+}
+
+function _godot_js_display_window_icon_set(p_ptr, p_len) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(88, 1, p_ptr, p_len);
+ let link = document.getElementById("-gd-engine-icon");
+ const old_icon = GodotDisplay.window_icon;
+ if (p_ptr) {
+ if (link === null) {
+ link = document.createElement("link");
+ link.rel = "icon";
+ link.id = "-gd-engine-icon";
+ document.head.appendChild(link);
+ }
+ const png = new Blob([ GodotRuntime.heapSlice(GROWABLE_HEAP_U8(), p_ptr, p_len) ], {
+ type: "image/png"
+ });
+ GodotDisplay.window_icon = URL.createObjectURL(png);
+ link.href = GodotDisplay.window_icon;
+ } else {
+ if (link) {
+ link.remove();
+ }
+ GodotDisplay.window_icon = null;
+ }
+ if (old_icon) {
+ URL.revokeObjectURL(old_icon);
+ }
+}
+
+function _godot_js_display_window_size_get(p_width, p_height) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(89, 1, p_width, p_height);
+ GodotRuntime.setHeapValue(p_width, GodotConfig.canvas.width, "i32");
+ GodotRuntime.setHeapValue(p_height, GodotConfig.canvas.height, "i32");
+}
+
+function _godot_js_display_window_title_set(p_data) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(90, 1, p_data);
+ document.title = GodotRuntime.parseString(p_data);
+}
+
+function _godot_js_eval(p_js, p_use_global_ctx, p_union_ptr, p_byte_arr, p_byte_arr_write, p_callback) {
+ const js_code = GodotRuntime.parseString(p_js);
+ let eval_ret = null;
+ try {
+ if (p_use_global_ctx) {
+ const global_eval = eval;
+ eval_ret = global_eval(js_code);
+ } else {
+ eval_ret = eval(js_code);
+ }
+ } catch (e) {
+ GodotRuntime.error(e);
+ }
+ switch (typeof eval_ret) {
+ case "boolean":
+ GodotRuntime.setHeapValue(p_union_ptr, eval_ret, "i32");
+ return 1;
+
+ case "number":
+ GodotRuntime.setHeapValue(p_union_ptr, eval_ret, "double");
+ return 3;
+
+ case "string":
+ GodotRuntime.setHeapValue(p_union_ptr, GodotRuntime.allocString(eval_ret), "*");
+ return 4;
+
+ case "object":
+ if (eval_ret === null) {
+ break;
+ }
+ if (ArrayBuffer.isView(eval_ret) && !(eval_ret instanceof Uint8Array)) {
+ eval_ret = new Uint8Array(eval_ret.buffer);
+ } else if (eval_ret instanceof ArrayBuffer) {
+ eval_ret = new Uint8Array(eval_ret);
+ }
+ if (eval_ret instanceof Uint8Array) {
+ const func = GodotRuntime.get_func(p_callback);
+ const bytes_ptr = func(p_byte_arr, p_byte_arr_write, eval_ret.length);
+ GROWABLE_HEAP_U8().set(eval_ret, bytes_ptr);
+ return 29;
+ }
+ break;
+ }
+ return 0;
+}
+
+var IDHandler = {
+ _last_id: 0,
+ _references: {},
+ get: function(p_id) {
+ return IDHandler._references[p_id];
+ },
+ add: function(p_data) {
+ const id = ++IDHandler._last_id;
+ IDHandler._references[id] = p_data;
+ return id;
+ },
+ remove: function(p_id) {
+ delete IDHandler._references[p_id];
+ }
+};
+
+var GodotFetch = {
+ onread: function(id, result) {
+ const obj = IDHandler.get(id);
+ if (!obj) {
+ return;
+ }
+ if (result.value) {
+ obj.chunks.push(result.value);
+ }
+ obj.reading = false;
+ obj.done = result.done;
+ },
+ onresponse: function(id, response) {
+ const obj = IDHandler.get(id);
+ if (!obj) {
+ return;
+ }
+ let chunked = false;
+ response.headers.forEach(function(value, header) {
+ const v = value.toLowerCase().trim();
+ const h = header.toLowerCase().trim();
+ if (h === "transfer-encoding" && v === "chunked") {
+ chunked = true;
+ }
+ });
+ obj.status = response.status;
+ obj.response = response;
+ obj.reader = response.body.getReader();
+ obj.chunked = chunked;
+ },
+ onerror: function(id, err) {
+ GodotRuntime.error(err);
+ const obj = IDHandler.get(id);
+ if (!obj) {
+ return;
+ }
+ obj.error = err;
+ },
+ create: function(method, url, headers, body) {
+ const obj = {
+ request: null,
+ response: null,
+ reader: null,
+ error: null,
+ done: false,
+ reading: false,
+ status: 0,
+ chunks: []
+ };
+ const id = IDHandler.add(obj);
+ const init = {
+ method: method,
+ headers: headers,
+ body: body
+ };
+ obj.request = fetch(url, init);
+ obj.request.then(GodotFetch.onresponse.bind(null, id)).catch(GodotFetch.onerror.bind(null, id));
+ return id;
+ },
+ free: function(id) {
+ const obj = IDHandler.get(id);
+ if (!obj) {
+ return;
+ }
+ IDHandler.remove(id);
+ if (!obj.request) {
+ return;
+ }
+ obj.request.then(function(response) {
+ response.abort();
+ }).catch(function(e) {});
+ },
+ read: function(id) {
+ const obj = IDHandler.get(id);
+ if (!obj) {
+ return;
+ }
+ if (obj.reader && !obj.reading) {
+ if (obj.done) {
+ obj.reader = null;
+ return;
+ }
+ obj.reading = true;
+ obj.reader.read().then(GodotFetch.onread.bind(null, id)).catch(GodotFetch.onerror.bind(null, id));
+ }
+ }
+};
+
+function _godot_js_fetch_create(p_method, p_url, p_headers, p_headers_size, p_body, p_body_size) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(91, 1, p_method, p_url, p_headers, p_headers_size, p_body, p_body_size);
+ const method = GodotRuntime.parseString(p_method);
+ const url = GodotRuntime.parseString(p_url);
+ const headers = GodotRuntime.parseStringArray(p_headers, p_headers_size);
+ const body = p_body_size ? GodotRuntime.heapSlice(GROWABLE_HEAP_I8(), p_body, p_body_size) : null;
+ return GodotFetch.create(method, url, headers.map(function(hv) {
+ const idx = hv.indexOf(":");
+ if (idx <= 0) {
+ return [];
+ }
+ return [ hv.slice(0, idx).trim(), hv.slice(idx + 1).trim() ];
+ }).filter(function(v) {
+ return v.length === 2;
+ }), body);
+}
+
+function _godot_js_fetch_free(id) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(92, 1, id);
+ GodotFetch.free(id);
+}
+
+function _godot_js_fetch_http_status_get(p_id) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(93, 1, p_id);
+ const obj = IDHandler.get(p_id);
+ if (!obj || !obj.response) {
+ return 0;
+ }
+ return obj.status;
+}
+
+function _godot_js_fetch_is_chunked(p_id) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(94, 1, p_id);
+ const obj = IDHandler.get(p_id);
+ if (!obj || !obj.response) {
+ return -1;
+ }
+ return obj.chunked ? 1 : 0;
+}
+
+function _godot_js_fetch_read_chunk(p_id, p_buf, p_buf_size) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(95, 1, p_id, p_buf, p_buf_size);
+ const obj = IDHandler.get(p_id);
+ if (!obj || !obj.response) {
+ return 0;
+ }
+ let to_read = p_buf_size;
+ const chunks = obj.chunks;
+ while (to_read && chunks.length) {
+ const chunk = obj.chunks[0];
+ if (chunk.length > to_read) {
+ GodotRuntime.heapCopy(GROWABLE_HEAP_I8(), chunk.slice(0, to_read), p_buf);
+ chunks[0] = chunk.slice(to_read);
+ to_read = 0;
+ } else {
+ GodotRuntime.heapCopy(GROWABLE_HEAP_I8(), chunk, p_buf);
+ to_read -= chunk.length;
+ chunks.pop();
+ }
+ }
+ if (!chunks.length) {
+ GodotFetch.read(p_id);
+ }
+ return p_buf_size - to_read;
+}
+
+function _godot_js_fetch_read_headers(p_id, p_parse_cb, p_ref) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(96, 1, p_id, p_parse_cb, p_ref);
+ const obj = IDHandler.get(p_id);
+ if (!obj || !obj.response) {
+ return 1;
+ }
+ const cb = GodotRuntime.get_func(p_parse_cb);
+ const arr = [];
+ obj.response.headers.forEach(function(v, h) {
+ arr.push(`${h}:${v}`);
+ });
+ const c_ptr = GodotRuntime.allocStringArray(arr);
+ cb(arr.length, c_ptr, p_ref);
+ GodotRuntime.freeStringArray(c_ptr, arr.length);
+ return 0;
+}
+
+function _godot_js_fetch_state_get(p_id) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(97, 1, p_id);
+ const obj = IDHandler.get(p_id);
+ if (!obj) {
+ return -1;
+ }
+ if (obj.error) {
+ return -1;
+ }
+ if (!obj.response) {
+ return 0;
+ }
+ if (obj.reader) {
+ return 1;
+ }
+ if (obj.done) {
+ return 2;
+ }
+ return -1;
+}
+
+var GodotInputGamepads = {
+ samples: [],
+ get_pads: function() {
+ try {
+ const pads = navigator.getGamepads();
+ if (pads) {
+ return pads;
+ }
+ return [];
+ } catch (e) {
+ return [];
+ }
+ },
+ get_samples: function() {
+ return GodotInputGamepads.samples;
+ },
+ get_sample: function(index) {
+ const samples = GodotInputGamepads.samples;
+ return index < samples.length ? samples[index] : null;
+ },
+ sample: function() {
+ const pads = GodotInputGamepads.get_pads();
+ const samples = [];
+ for (let i = 0; i < pads.length; i++) {
+ const pad = pads[i];
+ if (!pad) {
+ samples.push(null);
+ continue;
+ }
+ const s = {
+ standard: pad.mapping === "standard",
+ buttons: [],
+ axes: [],
+ connected: pad.connected
+ };
+ for (let b = 0; b < pad.buttons.length; b++) {
+ s.buttons.push(pad.buttons[b].value);
+ }
+ for (let a = 0; a < pad.axes.length; a++) {
+ s.axes.push(pad.axes[a]);
+ }
+ samples.push(s);
+ }
+ GodotInputGamepads.samples = samples;
+ },
+ init: function(onchange) {
+ GodotInputGamepads.samples = [];
+ function add(pad) {
+ const guid = GodotInputGamepads.get_guid(pad);
+ const c_id = GodotRuntime.allocString(pad.id);
+ const c_guid = GodotRuntime.allocString(guid);
+ onchange(pad.index, 1, c_id, c_guid);
+ GodotRuntime.free(c_id);
+ GodotRuntime.free(c_guid);
+ }
+ const pads = GodotInputGamepads.get_pads();
+ for (let i = 0; i < pads.length; i++) {
+ if (pads[i]) {
+ add(pads[i]);
+ }
+ }
+ GodotEventListeners.add(window, "gamepadconnected", function(evt) {
+ if (evt.gamepad) {
+ add(evt.gamepad);
+ }
+ }, false);
+ GodotEventListeners.add(window, "gamepaddisconnected", function(evt) {
+ if (evt.gamepad) {
+ onchange(evt.gamepad.index, 0);
+ }
+ }, false);
+ },
+ get_guid: function(pad) {
+ if (pad.mapping) {
+ return pad.mapping;
+ }
+ const ua = navigator.userAgent;
+ let os = "Unknown";
+ if (ua.indexOf("Android") >= 0) {
+ os = "Android";
+ } else if (ua.indexOf("Linux") >= 0) {
+ os = "Linux";
+ } else if (ua.indexOf("iPhone") >= 0) {
+ os = "iOS";
+ } else if (ua.indexOf("Macintosh") >= 0) {
+ os = "MacOSX";
+ } else if (ua.indexOf("Windows") >= 0) {
+ os = "Windows";
+ }
+ const id = pad.id;
+ const exp1 = /vendor: ([0-9a-f]{4}) product: ([0-9a-f]{4})/i;
+ const exp2 = /^([0-9a-f]+)-([0-9a-f]+)-/i;
+ let vendor = "";
+ let product = "";
+ if (exp1.test(id)) {
+ const match = exp1.exec(id);
+ vendor = match[1].padStart(4, "0");
+ product = match[2].padStart(4, "0");
+ } else if (exp2.test(id)) {
+ const match = exp2.exec(id);
+ vendor = match[1].padStart(4, "0");
+ product = match[2].padStart(4, "0");
+ }
+ if (!vendor || !product) {
+ return `${os}Unknown`;
+ }
+ return os + vendor + product;
+ }
+};
+
+var GodotInputDragDrop = {
+ promises: [],
+ pending_files: [],
+ add_entry: function(entry) {
+ if (entry.isDirectory) {
+ GodotInputDragDrop.add_dir(entry);
+ } else if (entry.isFile) {
+ GodotInputDragDrop.add_file(entry);
+ } else {
+ GodotRuntime.error("Unrecognized entry...", entry);
+ }
+ },
+ add_dir: function(entry) {
+ GodotInputDragDrop.promises.push(new Promise(function(resolve, reject) {
+ const reader = entry.createReader();
+ reader.readEntries(function(entries) {
+ for (let i = 0; i < entries.length; i++) {
+ GodotInputDragDrop.add_entry(entries[i]);
+ }
+ resolve();
+ });
+ }));
+ },
+ add_file: function(entry) {
+ GodotInputDragDrop.promises.push(new Promise(function(resolve, reject) {
+ entry.file(function(file) {
+ const reader = new FileReader();
+ reader.onload = function() {
+ const f = {
+ "path": file.relativePath || file.webkitRelativePath,
+ "name": file.name,
+ "type": file.type,
+ "size": file.size,
+ "data": reader.result
+ };
+ if (!f["path"]) {
+ f["path"] = f["name"];
+ }
+ GodotInputDragDrop.pending_files.push(f);
+ resolve();
+ };
+ reader.onerror = function() {
+ GodotRuntime.print("Error reading file");
+ reject();
+ };
+ reader.readAsArrayBuffer(file);
+ }, function(err) {
+ GodotRuntime.print("Error!");
+ reject();
+ });
+ }));
+ },
+ process: function(resolve, reject) {
+ if (GodotInputDragDrop.promises.length === 0) {
+ resolve();
+ return;
+ }
+ GodotInputDragDrop.promises.pop().then(function() {
+ setTimeout(function() {
+ GodotInputDragDrop.process(resolve, reject);
+ }, 0);
+ });
+ },
+ _process_event: function(ev, callback) {
+ ev.preventDefault();
+ if (ev.dataTransfer.items) {
+ for (let i = 0; i < ev.dataTransfer.items.length; i++) {
+ const item = ev.dataTransfer.items[i];
+ let entry = null;
+ if ("getAsEntry" in item) {
+ entry = item.getAsEntry();
+ } else if ("webkitGetAsEntry" in item) {
+ entry = item.webkitGetAsEntry();
+ }
+ if (entry) {
+ GodotInputDragDrop.add_entry(entry);
+ }
+ }
+ } else {
+ GodotRuntime.error("File upload not supported");
+ }
+ new Promise(GodotInputDragDrop.process).then(function() {
+ const DROP = `/tmp/drop-${parseInt(Math.random() * (1 << 30), 10)}/`;
+ const drops = [];
+ const files = [];
+ FS.mkdir(DROP.slice(0, -1));
+ GodotInputDragDrop.pending_files.forEach(elem => {
+ const path = elem["path"];
+ GodotFS.copy_to_fs(DROP + path, elem["data"]);
+ let idx = path.indexOf("/");
+ if (idx === -1) {
+ drops.push(DROP + path);
+ } else {
+ const sub = path.substr(0, idx);
+ idx = sub.indexOf("/");
+ if (idx < 0 && drops.indexOf(DROP + sub) === -1) {
+ drops.push(DROP + sub);
+ }
+ }
+ files.push(DROP + path);
+ });
+ GodotInputDragDrop.promises = [];
+ GodotInputDragDrop.pending_files = [];
+ callback(drops);
+ if (GodotConfig.persistent_drops) {
+ GodotOS.atexit(function(resolve, reject) {
+ GodotInputDragDrop.remove_drop(files, DROP);
+ resolve();
+ });
+ } else {
+ GodotInputDragDrop.remove_drop(files, DROP);
+ }
+ });
+ },
+ remove_drop: function(files, drop_path) {
+ const dirs = [ drop_path.substr(0, drop_path.length - 1) ];
+ files.forEach(function(file) {
+ FS.unlink(file);
+ let dir = file.replace(drop_path, "");
+ let idx = dir.lastIndexOf("/");
+ while (idx > 0) {
+ dir = dir.substr(0, idx);
+ if (dirs.indexOf(drop_path + dir) === -1) {
+ dirs.push(drop_path + dir);
+ }
+ idx = dir.lastIndexOf("/");
+ }
+ });
+ dirs.sort(function(a, b) {
+ const al = (a.match(/\//g) || []).length;
+ const bl = (b.match(/\//g) || []).length;
+ if (al > bl) {
+ return -1;
+ } else if (al < bl) {
+ return 1;
+ }
+ return 0;
+ }).forEach(function(dir) {
+ FS.rmdir(dir);
+ });
+ },
+ handler: function(callback) {
+ return function(ev) {
+ GodotInputDragDrop._process_event(ev, callback);
+ };
+ }
+};
+
+var GodotInput = {
+ getModifiers: function(evt) {
+ return evt.shiftKey + 0 + (evt.altKey + 0 << 1) + (evt.ctrlKey + 0 << 2) + (evt.metaKey + 0 << 3);
+ },
+ computePosition: function(evt, rect) {
+ const canvas = GodotConfig.canvas;
+ const rw = canvas.width / rect.width;
+ const rh = canvas.height / rect.height;
+ const x = (evt.clientX - rect.x) * rw;
+ const y = (evt.clientY - rect.y) * rh;
+ return [ x, y ];
+ }
+};
+
+function _godot_js_input_drop_files_cb(callback) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(98, 1, callback);
+ const func = GodotRuntime.get_func(callback);
+ const dropFiles = function(files) {
+ const args = files || [];
+ if (!args.length) {
+ return;
+ }
+ const argc = args.length;
+ const argv = GodotRuntime.allocStringArray(args);
+ func(argv, argc);
+ GodotRuntime.freeStringArray(argv, argc);
+ };
+ const canvas = GodotConfig.canvas;
+ GodotEventListeners.add(canvas, "dragover", function(ev) {
+ ev.preventDefault();
+ }, false);
+ GodotEventListeners.add(canvas, "drop", GodotInputDragDrop.handler(dropFiles));
+}
+
+function _godot_js_input_gamepad_cb(change_cb) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(99, 1, change_cb);
+ const onchange = GodotRuntime.get_func(change_cb);
+ GodotInputGamepads.init(onchange);
+}
+
+function _godot_js_input_gamepad_sample() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(100, 1);
+ GodotInputGamepads.sample();
+ return 0;
+}
+
+function _godot_js_input_gamepad_sample_count() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(101, 1);
+ return GodotInputGamepads.get_samples().length;
+}
+
+function _godot_js_input_gamepad_sample_get(p_index, r_btns, r_btns_num, r_axes, r_axes_num, r_standard) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(102, 1, p_index, r_btns, r_btns_num, r_axes, r_axes_num, r_standard);
+ const sample = GodotInputGamepads.get_sample(p_index);
+ if (!sample || !sample.connected) {
+ return 1;
+ }
+ const btns = sample.buttons;
+ const btns_len = btns.length < 16 ? btns.length : 16;
+ for (let i = 0; i < btns_len; i++) {
+ GodotRuntime.setHeapValue(r_btns + (i << 2), btns[i], "float");
+ }
+ GodotRuntime.setHeapValue(r_btns_num, btns_len, "i32");
+ const axes = sample.axes;
+ const axes_len = axes.length < 10 ? axes.length : 10;
+ for (let i = 0; i < axes_len; i++) {
+ GodotRuntime.setHeapValue(r_axes + (i << 2), axes[i], "float");
+ }
+ GodotRuntime.setHeapValue(r_axes_num, axes_len, "i32");
+ const is_standard = sample.standard ? 1 : 0;
+ GodotRuntime.setHeapValue(r_standard, is_standard, "i32");
+ return 0;
+}
+
+function _godot_js_input_key_cb(callback, code, key) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(103, 1, callback, code, key);
+ const func = GodotRuntime.get_func(callback);
+ function key_cb(pressed, evt) {
+ const modifiers = GodotInput.getModifiers(evt);
+ GodotRuntime.stringToHeap(evt.code, code, 32);
+ GodotRuntime.stringToHeap(evt.key, key, 32);
+ func(pressed, evt.repeat, modifiers);
+ evt.preventDefault();
+ }
+ GodotEventListeners.add(GodotConfig.canvas, "keydown", key_cb.bind(null, 1), false);
+ GodotEventListeners.add(GodotConfig.canvas, "keyup", key_cb.bind(null, 0), false);
+}
+
+function _godot_js_input_mouse_button_cb(callback) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(104, 1, callback);
+ const func = GodotRuntime.get_func(callback);
+ const canvas = GodotConfig.canvas;
+ function button_cb(p_pressed, evt) {
+ const rect = canvas.getBoundingClientRect();
+ const pos = GodotInput.computePosition(evt, rect);
+ const modifiers = GodotInput.getModifiers(evt);
+ if (p_pressed) {
+ GodotConfig.canvas.focus();
+ }
+ if (func(p_pressed, evt.button, pos[0], pos[1], modifiers)) {
+ evt.preventDefault();
+ }
+ }
+ GodotEventListeners.add(canvas, "mousedown", button_cb.bind(null, 1), false);
+ GodotEventListeners.add(window, "mouseup", button_cb.bind(null, 0), false);
+}
+
+function _godot_js_input_mouse_move_cb(callback) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(105, 1, callback);
+ const func = GodotRuntime.get_func(callback);
+ const canvas = GodotConfig.canvas;
+ function move_cb(evt) {
+ const rect = canvas.getBoundingClientRect();
+ const pos = GodotInput.computePosition(evt, rect);
+ const rw = canvas.width / rect.width;
+ const rh = canvas.height / rect.height;
+ const rel_pos_x = evt.movementX * rw;
+ const rel_pos_y = evt.movementY * rh;
+ const modifiers = GodotInput.getModifiers(evt);
+ func(pos[0], pos[1], rel_pos_x, rel_pos_y, modifiers);
+ }
+ GodotEventListeners.add(window, "mousemove", move_cb, false);
+}
+
+function _godot_js_input_mouse_wheel_cb(callback) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(106, 1, callback);
+ const func = GodotRuntime.get_func(callback);
+ function wheel_cb(evt) {
+ if (func(evt["deltaX"] || 0, evt["deltaY"] || 0)) {
+ evt.preventDefault();
+ }
+ }
+ GodotEventListeners.add(GodotConfig.canvas, "wheel", wheel_cb, false);
+}
+
+function _godot_js_input_paste_cb(callback) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(107, 1, callback);
+ const func = GodotRuntime.get_func(callback);
+ GodotEventListeners.add(window, "paste", function(evt) {
+ const text = evt.clipboardData.getData("text");
+ const ptr = GodotRuntime.allocString(text);
+ func(ptr);
+ GodotRuntime.free(ptr);
+ }, false);
+}
+
+function _godot_js_input_touch_cb(callback, ids, coords) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(108, 1, callback, ids, coords);
+ const func = GodotRuntime.get_func(callback);
+ const canvas = GodotConfig.canvas;
+ function touch_cb(type, evt) {
+ if (type === 0) {
+ GodotConfig.canvas.focus();
+ }
+ const rect = canvas.getBoundingClientRect();
+ const touches = evt.changedTouches;
+ for (let i = 0; i < touches.length; i++) {
+ const touch = touches[i];
+ const pos = GodotInput.computePosition(touch, rect);
+ GodotRuntime.setHeapValue(coords + i * 2 * 8, pos[0], "double");
+ GodotRuntime.setHeapValue(coords + (i * 2 + 1) * 8, pos[1], "double");
+ GodotRuntime.setHeapValue(ids + i * 4, touch.identifier, "i32");
+ }
+ func(type, touches.length);
+ if (evt.cancelable) {
+ evt.preventDefault();
+ }
+ }
+ GodotEventListeners.add(canvas, "touchstart", touch_cb.bind(null, 0), false);
+ GodotEventListeners.add(canvas, "touchend", touch_cb.bind(null, 1), false);
+ GodotEventListeners.add(canvas, "touchcancel", touch_cb.bind(null, 1), false);
+ GodotEventListeners.add(canvas, "touchmove", touch_cb.bind(null, 2), false);
+}
+
+function _godot_js_input_vibrate_handheld(p_duration_ms) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(109, 1, p_duration_ms);
+ if (typeof navigator.vibrate !== "function") {
+ GodotRuntime.print("This browser does not support vibration.");
+ } else {
+ navigator.vibrate(p_duration_ms);
+ }
+}
+
+function _godot_js_os_download_buffer(p_ptr, p_size, p_name, p_mime) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(110, 1, p_ptr, p_size, p_name, p_mime);
+ const buf = GodotRuntime.heapSlice(GROWABLE_HEAP_I8(), p_ptr, p_size);
+ const name = GodotRuntime.parseString(p_name);
+ const mime = GodotRuntime.parseString(p_mime);
+ const blob = new Blob([ buf ], {
+ type: mime
+ });
+ const url = window.URL.createObjectURL(blob);
+ const a = document.createElement("a");
+ a.href = url;
+ a.download = name;
+ a.style.display = "none";
+ document.body.appendChild(a);
+ a.click();
+ a.remove();
+ window.URL.revokeObjectURL(url);
+}
+
+function _godot_js_os_execute(p_json) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(111, 1, p_json);
+ const json_args = GodotRuntime.parseString(p_json);
+ const args = JSON.parse(json_args);
+ if (GodotConfig.on_execute) {
+ GodotConfig.on_execute(args);
+ return 0;
+ }
+ return 1;
+}
+
+function _godot_js_os_finish_async(p_callback) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(112, 1, p_callback);
+ const func = GodotRuntime.get_func(p_callback);
+ GodotOS.finish_async(func);
+}
+
+function _godot_js_os_fs_is_persistent() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(113, 1);
+ return GodotFS.is_persistent();
+}
+
+function _godot_js_os_fs_sync(callback) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(114, 1, callback);
+ const func = GodotRuntime.get_func(callback);
+ GodotOS._fs_sync_promise = GodotFS.sync();
+ GodotOS._fs_sync_promise.then(function(err) {
+ func();
+ });
+}
+
+function _godot_js_os_has_feature(p_ftr) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(115, 1, p_ftr);
+ const ftr = GodotRuntime.parseString(p_ftr);
+ const ua = navigator.userAgent;
+ if (ftr === "web_macos") {
+ return ua.indexOf("Mac") !== -1 ? 1 : 0;
+ }
+ if (ftr === "web_windows") {
+ return ua.indexOf("Windows") !== -1 ? 1 : 0;
+ }
+ if (ftr === "web_android") {
+ return ua.indexOf("Android") !== -1 ? 1 : 0;
+ }
+ if (ftr === "web_ios") {
+ return ua.indexOf("iPhone") !== -1 || ua.indexOf("iPad") !== -1 || ua.indexOf("iPod") !== -1 ? 1 : 0;
+ }
+ if (ftr === "web_linuxbsd") {
+ return ua.indexOf("CrOS") !== -1 || ua.indexOf("BSD") !== -1 || ua.indexOf("Linux") !== -1 || ua.indexOf("X11") !== -1 ? 1 : 0;
+ }
+ return 0;
+}
+
+function _godot_js_os_hw_concurrency_get() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(116, 1);
+ const concurrency = navigator.hardwareConcurrency || 1;
+ return concurrency < 2 ? concurrency : 2;
+}
+
+function _godot_js_os_request_quit_cb(p_callback) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(117, 1, p_callback);
+ GodotOS.request_quit = GodotRuntime.get_func(p_callback);
+}
+
+function _godot_js_os_shell_open(p_uri) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(118, 1, p_uri);
+ window.open(GodotRuntime.parseString(p_uri), "_blank");
+}
+
+var GodotPWA = {
+ hasUpdate: false,
+ updateState: function(cb, reg) {
+ if (!reg) {
+ return;
+ }
+ if (!reg.active) {
+ return;
+ }
+ if (reg.waiting) {
+ GodotPWA.hasUpdate = true;
+ cb();
+ }
+ GodotEventListeners.add(reg, "updatefound", function() {
+ const installing = reg.installing;
+ GodotEventListeners.add(installing, "statechange", function() {
+ if (installing.state === "installed") {
+ GodotPWA.hasUpdate = true;
+ cb();
+ }
+ });
+ });
+ }
+};
+
+function _godot_js_pwa_cb(p_update_cb) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(119, 1, p_update_cb);
+ if ("serviceWorker" in navigator) {
+ const cb = GodotRuntime.get_func(p_update_cb);
+ navigator.serviceWorker.getRegistration().then(GodotPWA.updateState.bind(null, cb));
+ }
+}
+
+function _godot_js_pwa_update() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(120, 1);
+ if ("serviceWorker" in navigator && GodotPWA.hasUpdate) {
+ navigator.serviceWorker.getRegistration().then(function(reg) {
+ if (!reg || !reg.waiting) {
+ return;
+ }
+ reg.waiting.postMessage("update");
+ });
+ return 0;
+ }
+ return 1;
+}
+
+var GodotRTCDataChannel = {
+ connect: function(p_id, p_on_open, p_on_message, p_on_error, p_on_close) {
+ const ref = IDHandler.get(p_id);
+ if (!ref) {
+ return;
+ }
+ ref.binaryType = "arraybuffer";
+ ref.onopen = function(event) {
+ p_on_open();
+ };
+ ref.onclose = function(event) {
+ p_on_close();
+ };
+ ref.onerror = function(event) {
+ p_on_error();
+ };
+ ref.onmessage = function(event) {
+ let buffer;
+ let is_string = 0;
+ if (event.data instanceof ArrayBuffer) {
+ buffer = new Uint8Array(event.data);
+ } else if (event.data instanceof Blob) {
+ GodotRuntime.error("Blob type not supported");
+ return;
+ } else if (typeof event.data === "string") {
+ is_string = 1;
+ const enc = new TextEncoder("utf-8");
+ buffer = new Uint8Array(enc.encode(event.data));
+ } else {
+ GodotRuntime.error("Unknown message type");
+ return;
+ }
+ const len = buffer.length * buffer.BYTES_PER_ELEMENT;
+ const out = GodotRuntime.malloc(len);
+ GROWABLE_HEAP_U8().set(buffer, out);
+ p_on_message(out, len, is_string);
+ GodotRuntime.free(out);
+ };
+ },
+ close: function(p_id) {
+ const ref = IDHandler.get(p_id);
+ if (!ref) {
+ return;
+ }
+ ref.onopen = null;
+ ref.onmessage = null;
+ ref.onerror = null;
+ ref.onclose = null;
+ ref.close();
+ },
+ get_prop: function(p_id, p_prop, p_def) {
+ const ref = IDHandler.get(p_id);
+ return ref && ref[p_prop] !== undefined ? ref[p_prop] : p_def;
+ }
+};
+
+function _godot_js_rtc_datachannel_close(p_id) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(121, 1, p_id);
+ const ref = IDHandler.get(p_id);
+ if (!ref) {
+ return;
+ }
+ GodotRTCDataChannel.close(p_id);
+}
+
+function _godot_js_rtc_datachannel_connect(p_id, p_ref, p_on_open, p_on_message, p_on_error, p_on_close) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(122, 1, p_id, p_ref, p_on_open, p_on_message, p_on_error, p_on_close);
+ const onopen = GodotRuntime.get_func(p_on_open).bind(null, p_ref);
+ const onmessage = GodotRuntime.get_func(p_on_message).bind(null, p_ref);
+ const onerror = GodotRuntime.get_func(p_on_error).bind(null, p_ref);
+ const onclose = GodotRuntime.get_func(p_on_close).bind(null, p_ref);
+ GodotRTCDataChannel.connect(p_id, onopen, onmessage, onerror, onclose);
+}
+
+function _godot_js_rtc_datachannel_destroy(p_id) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(123, 1, p_id);
+ GodotRTCDataChannel.close(p_id);
+ IDHandler.remove(p_id);
+}
+
+function _godot_js_rtc_datachannel_get_buffered_amount(p_id) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(124, 1, p_id);
+ return GodotRTCDataChannel.get_prop(p_id, "bufferedAmount", 0);
+}
+
+function _godot_js_rtc_datachannel_id_get(p_id) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(125, 1, p_id);
+ return GodotRTCDataChannel.get_prop(p_id, "id", 65535);
+}
+
+function _godot_js_rtc_datachannel_is_negotiated(p_id) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(126, 1, p_id);
+ return GodotRTCDataChannel.get_prop(p_id, "negotiated", 65535);
+}
+
+function _godot_js_rtc_datachannel_is_ordered(p_id) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(127, 1, p_id);
+ return GodotRTCDataChannel.get_prop(p_id, "ordered", true);
+}
+
+function _godot_js_rtc_datachannel_label_get(p_id) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(128, 1, p_id);
+ const ref = IDHandler.get(p_id);
+ if (!ref || !ref.label) {
+ return 0;
+ }
+ return GodotRuntime.allocString(ref.label);
+}
+
+function _godot_js_rtc_datachannel_max_packet_lifetime_get(p_id) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(129, 1, p_id);
+ const ref = IDHandler.get(p_id);
+ if (!ref) {
+ return 65535;
+ }
+ if (ref["maxPacketLifeTime"] !== undefined) {
+ return ref["maxPacketLifeTime"];
+ } else if (ref["maxRetransmitTime"] !== undefined) {
+ return ref["maxRetransmitTime"];
+ }
+ return 65535;
+}
+
+function _godot_js_rtc_datachannel_max_retransmits_get(p_id) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(130, 1, p_id);
+ return GodotRTCDataChannel.get_prop(p_id, "maxRetransmits", 65535);
+}
+
+function _godot_js_rtc_datachannel_protocol_get(p_id) {
+ const ref = IDHandler.get(p_id);
+ if (!ref || !ref.protocol) {
+ return 0;
+ }
+ return GodotRuntime.allocString(ref.protocol);
+}
+
+function _godot_js_rtc_datachannel_ready_state_get(p_id) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(131, 1, p_id);
+ const ref = IDHandler.get(p_id);
+ if (!ref) {
+ return 3;
+ }
+ switch (ref.readyState) {
+ case "connecting":
+ return 0;
+
+ case "open":
+ return 1;
+
+ case "closing":
+ return 2;
+
+ case "closed":
+ default:
+ return 3;
+ }
+}
+
+function _godot_js_rtc_datachannel_send(p_id, p_buffer, p_length, p_raw) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(132, 1, p_id, p_buffer, p_length, p_raw);
+ const ref = IDHandler.get(p_id);
+ if (!ref) {
+ return 1;
+ }
+ const bytes_array = new Uint8Array(p_length);
+ for (let i = 0; i < p_length; i++) {
+ bytes_array[i] = GodotRuntime.getHeapValue(p_buffer + i, "i8");
+ }
+ if (p_raw) {
+ ref.send(bytes_array.buffer);
+ } else {
+ const string = new TextDecoder("utf-8").decode(bytes_array);
+ ref.send(string);
+ }
+ return 0;
+}
+
+var GodotRTCPeerConnection = {
+ ConnectionState: {
+ new: 0,
+ connecting: 1,
+ connected: 2,
+ disconnected: 3,
+ failed: 4,
+ closed: 5
+ },
+ ConnectionStateCompat: {
+ new: 0,
+ checking: 1,
+ connected: 2,
+ completed: 2,
+ disconnected: 3,
+ failed: 4,
+ closed: 5
+ },
+ IceGatheringState: {
+ new: 0,
+ gathering: 1,
+ complete: 2
+ },
+ SignalingState: {
+ stable: 0,
+ "have-local-offer": 1,
+ "have-remote-offer": 2,
+ "have-local-pranswer": 3,
+ "have-remote-pranswer": 4,
+ closed: 5
+ },
+ create: function(config, onConnectionChange, onSignalingChange, onIceGatheringChange, onIceCandidate, onDataChannel) {
+ let conn = null;
+ try {
+ conn = new RTCPeerConnection(config);
+ } catch (e) {
+ GodotRuntime.error(e);
+ return 0;
+ }
+ const id = IDHandler.add(conn);
+ if ("connectionState" in conn && conn["connectionState"] !== undefined) {
+ conn.onconnectionstatechange = function(event) {
+ if (!IDHandler.get(id)) {
+ return;
+ }
+ onConnectionChange(GodotRTCPeerConnection.ConnectionState[conn.connectionState] || 0);
+ };
+ } else {
+ conn.oniceconnectionstatechange = function(event) {
+ if (!IDHandler.get(id)) {
+ return;
+ }
+ onConnectionChange(GodotRTCPeerConnection.ConnectionStateCompat[conn.iceConnectionState] || 0);
+ };
+ }
+ conn.onicegatheringstatechange = function(event) {
+ if (!IDHandler.get(id)) {
+ return;
+ }
+ onIceGatheringChange(GodotRTCPeerConnection.IceGatheringState[conn.iceGatheringState] || 0);
+ };
+ conn.onsignalingstatechange = function(event) {
+ if (!IDHandler.get(id)) {
+ return;
+ }
+ onSignalingChange(GodotRTCPeerConnection.SignalingState[conn.signalingState] || 0);
+ };
+ conn.onicecandidate = function(event) {
+ if (!IDHandler.get(id)) {
+ return;
+ }
+ const c = event.candidate;
+ if (!c || !c.candidate) {
+ return;
+ }
+ const candidate_str = GodotRuntime.allocString(c.candidate);
+ const mid_str = GodotRuntime.allocString(c.sdpMid);
+ onIceCandidate(mid_str, c.sdpMLineIndex, candidate_str);
+ GodotRuntime.free(candidate_str);
+ GodotRuntime.free(mid_str);
+ };
+ conn.ondatachannel = function(event) {
+ if (!IDHandler.get(id)) {
+ return;
+ }
+ const cid = IDHandler.add(event.channel);
+ onDataChannel(cid);
+ };
+ return id;
+ },
+ destroy: function(p_id) {
+ const conn = IDHandler.get(p_id);
+ if (!conn) {
+ return;
+ }
+ conn.onconnectionstatechange = null;
+ conn.oniceconnectionstatechange = null;
+ conn.onicegatheringstatechange = null;
+ conn.onsignalingstatechange = null;
+ conn.onicecandidate = null;
+ conn.ondatachannel = null;
+ IDHandler.remove(p_id);
+ },
+ onsession: function(p_id, callback, session) {
+ if (!IDHandler.get(p_id)) {
+ return;
+ }
+ const type_str = GodotRuntime.allocString(session.type);
+ const sdp_str = GodotRuntime.allocString(session.sdp);
+ callback(type_str, sdp_str);
+ GodotRuntime.free(type_str);
+ GodotRuntime.free(sdp_str);
+ },
+ onerror: function(p_id, callback, error) {
+ const ref = IDHandler.get(p_id);
+ if (!ref) {
+ return;
+ }
+ GodotRuntime.error(error);
+ callback();
+ }
+};
+
+function _godot_js_rtc_pc_close(p_id) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(133, 1, p_id);
+ const ref = IDHandler.get(p_id);
+ if (!ref) {
+ return;
+ }
+ ref.close();
+}
+
+function _godot_js_rtc_pc_create(p_config, p_ref, p_on_connection_state_change, p_on_ice_gathering_state_change, p_on_signaling_state_change, p_on_ice_candidate, p_on_datachannel) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(134, 1, p_config, p_ref, p_on_connection_state_change, p_on_ice_gathering_state_change, p_on_signaling_state_change, p_on_ice_candidate, p_on_datachannel);
+ const wrap = function(p_func) {
+ return GodotRuntime.get_func(p_func).bind(null, p_ref);
+ };
+ return GodotRTCPeerConnection.create(JSON.parse(GodotRuntime.parseString(p_config)), wrap(p_on_connection_state_change), wrap(p_on_signaling_state_change), wrap(p_on_ice_gathering_state_change), wrap(p_on_ice_candidate), wrap(p_on_datachannel));
+}
+
+function _godot_js_rtc_pc_datachannel_create(p_id, p_label, p_config) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(135, 1, p_id, p_label, p_config);
+ try {
+ const ref = IDHandler.get(p_id);
+ if (!ref) {
+ return 0;
+ }
+ const label = GodotRuntime.parseString(p_label);
+ const config = JSON.parse(GodotRuntime.parseString(p_config));
+ const channel = ref.createDataChannel(label, config);
+ return IDHandler.add(channel);
+ } catch (e) {
+ GodotRuntime.error(e);
+ return 0;
+ }
+}
+
+function _godot_js_rtc_pc_destroy(p_id) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(136, 1, p_id);
+ GodotRTCPeerConnection.destroy(p_id);
+}
+
+function _godot_js_rtc_pc_ice_candidate_add(p_id, p_mid_name, p_mline_idx, p_sdp) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(137, 1, p_id, p_mid_name, p_mline_idx, p_sdp);
+ const ref = IDHandler.get(p_id);
+ if (!ref) {
+ return;
+ }
+ const sdpMidName = GodotRuntime.parseString(p_mid_name);
+ const sdpName = GodotRuntime.parseString(p_sdp);
+ ref.addIceCandidate(new RTCIceCandidate({
+ "candidate": sdpName,
+ "sdpMid": sdpMidName,
+ "sdpMlineIndex": p_mline_idx
+ }));
+}
+
+function _godot_js_rtc_pc_local_description_set(p_id, p_type, p_sdp, p_obj, p_on_error) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(138, 1, p_id, p_type, p_sdp, p_obj, p_on_error);
+ const ref = IDHandler.get(p_id);
+ if (!ref) {
+ return;
+ }
+ const type = GodotRuntime.parseString(p_type);
+ const sdp = GodotRuntime.parseString(p_sdp);
+ const onerror = GodotRuntime.get_func(p_on_error).bind(null, p_obj);
+ ref.setLocalDescription({
+ "sdp": sdp,
+ "type": type
+ }).catch(function(error) {
+ GodotRTCPeerConnection.onerror(p_id, onerror, error);
+ });
+}
+
+function _godot_js_rtc_pc_offer_create(p_id, p_obj, p_on_session, p_on_error) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(139, 1, p_id, p_obj, p_on_session, p_on_error);
+ const ref = IDHandler.get(p_id);
+ if (!ref) {
+ return;
+ }
+ const onsession = GodotRuntime.get_func(p_on_session).bind(null, p_obj);
+ const onerror = GodotRuntime.get_func(p_on_error).bind(null, p_obj);
+ ref.createOffer().then(function(session) {
+ GodotRTCPeerConnection.onsession(p_id, onsession, session);
+ }).catch(function(error) {
+ GodotRTCPeerConnection.onerror(p_id, onerror, error);
+ });
+}
+
+function _godot_js_rtc_pc_remote_description_set(p_id, p_type, p_sdp, p_obj, p_session_created, p_on_error) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(140, 1, p_id, p_type, p_sdp, p_obj, p_session_created, p_on_error);
+ const ref = IDHandler.get(p_id);
+ if (!ref) {
+ return;
+ }
+ const type = GodotRuntime.parseString(p_type);
+ const sdp = GodotRuntime.parseString(p_sdp);
+ const onerror = GodotRuntime.get_func(p_on_error).bind(null, p_obj);
+ const onsession = GodotRuntime.get_func(p_session_created).bind(null, p_obj);
+ ref.setRemoteDescription({
+ "sdp": sdp,
+ "type": type
+ }).then(function() {
+ if (type !== "offer") {
+ return Promise.resolve();
+ }
+ return ref.createAnswer().then(function(session) {
+ GodotRTCPeerConnection.onsession(p_id, onsession, session);
+ });
+ }).catch(function(error) {
+ GodotRTCPeerConnection.onerror(p_id, onerror, error);
+ });
+}
+
+function _godot_js_tts_get_voices(p_callback) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(141, 1, p_callback);
+ const func = GodotRuntime.get_func(p_callback);
+ try {
+ const arr = [];
+ const voices = window.speechSynthesis.getVoices();
+ for (let i = 0; i < voices.length; i++) {
+ arr.push(`${voices[i].lang};${voices[i].name}`);
+ }
+ const c_ptr = GodotRuntime.allocStringArray(arr);
+ func(arr.length, c_ptr);
+ GodotRuntime.freeStringArray(c_ptr, arr.length);
+ } catch (e) {}
+}
+
+function _godot_js_tts_is_paused() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(142, 1);
+ return window.speechSynthesis.paused;
+}
+
+function _godot_js_tts_is_speaking() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(143, 1);
+ return window.speechSynthesis.speaking;
+}
+
+function _godot_js_tts_pause() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(144, 1);
+ window.speechSynthesis.pause();
+}
+
+function _godot_js_tts_resume() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(145, 1);
+ window.speechSynthesis.resume();
+}
+
+function _godot_js_tts_speak(p_text, p_voice, p_volume, p_pitch, p_rate, p_utterance_id, p_callback) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(146, 1, p_text, p_voice, p_volume, p_pitch, p_rate, p_utterance_id, p_callback);
+ const func = GodotRuntime.get_func(p_callback);
+ function listener_end(evt) {
+ evt.currentTarget.cb(1, evt.currentTarget.id, 0);
+ }
+ function listener_start(evt) {
+ evt.currentTarget.cb(0, evt.currentTarget.id, 0);
+ }
+ function listener_error(evt) {
+ evt.currentTarget.cb(2, evt.currentTarget.id, 0);
+ }
+ function listener_bound(evt) {
+ evt.currentTarget.cb(3, evt.currentTarget.id, evt.charIndex);
+ }
+ const utterance = new SpeechSynthesisUtterance(GodotRuntime.parseString(p_text));
+ utterance.rate = p_rate;
+ utterance.pitch = p_pitch;
+ utterance.volume = p_volume / 100;
+ utterance.addEventListener("end", listener_end);
+ utterance.addEventListener("start", listener_start);
+ utterance.addEventListener("error", listener_error);
+ utterance.addEventListener("boundary", listener_bound);
+ utterance.id = p_utterance_id;
+ utterance.cb = func;
+ const voice = GodotRuntime.parseString(p_voice);
+ const voices = window.speechSynthesis.getVoices();
+ for (let i = 0; i < voices.length; i++) {
+ if (voices[i].name === voice) {
+ utterance.voice = voices[i];
+ break;
+ }
+ }
+ window.speechSynthesis.resume();
+ window.speechSynthesis.speak(utterance);
+}
+
+function _godot_js_tts_stop() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(147, 1);
+ window.speechSynthesis.cancel();
+ window.speechSynthesis.resume();
+}
+
+var GodotWebSocket = {
+ _onopen: function(p_id, callback, event) {
+ const ref = IDHandler.get(p_id);
+ if (!ref) {
+ return;
+ }
+ const c_str = GodotRuntime.allocString(ref.protocol);
+ callback(c_str);
+ GodotRuntime.free(c_str);
+ },
+ _onmessage: function(p_id, callback, event) {
+ const ref = IDHandler.get(p_id);
+ if (!ref) {
+ return;
+ }
+ let buffer;
+ let is_string = 0;
+ if (event.data instanceof ArrayBuffer) {
+ buffer = new Uint8Array(event.data);
+ } else if (event.data instanceof Blob) {
+ GodotRuntime.error("Blob type not supported");
+ return;
+ } else if (typeof event.data === "string") {
+ is_string = 1;
+ const enc = new TextEncoder("utf-8");
+ buffer = new Uint8Array(enc.encode(event.data));
+ } else {
+ GodotRuntime.error("Unknown message type");
+ return;
+ }
+ const len = buffer.length * buffer.BYTES_PER_ELEMENT;
+ const out = GodotRuntime.malloc(len);
+ GROWABLE_HEAP_U8().set(buffer, out);
+ callback(out, len, is_string);
+ GodotRuntime.free(out);
+ },
+ _onerror: function(p_id, callback, event) {
+ const ref = IDHandler.get(p_id);
+ if (!ref) {
+ return;
+ }
+ callback();
+ },
+ _onclose: function(p_id, callback, event) {
+ const ref = IDHandler.get(p_id);
+ if (!ref) {
+ return;
+ }
+ const c_str = GodotRuntime.allocString(event.reason);
+ callback(event.code, c_str, event.wasClean ? 1 : 0);
+ GodotRuntime.free(c_str);
+ },
+ send: function(p_id, p_data) {
+ const ref = IDHandler.get(p_id);
+ if (!ref || ref.readyState !== ref.OPEN) {
+ return 1;
+ }
+ ref.send(p_data);
+ return 0;
+ },
+ bufferedAmount: function(p_id) {
+ const ref = IDHandler.get(p_id);
+ if (!ref) {
+ return 0;
+ }
+ return ref.bufferedAmount;
+ },
+ create: function(socket, p_on_open, p_on_message, p_on_error, p_on_close) {
+ const id = IDHandler.add(socket);
+ socket.onopen = GodotWebSocket._onopen.bind(null, id, p_on_open);
+ socket.onmessage = GodotWebSocket._onmessage.bind(null, id, p_on_message);
+ socket.onerror = GodotWebSocket._onerror.bind(null, id, p_on_error);
+ socket.onclose = GodotWebSocket._onclose.bind(null, id, p_on_close);
+ return id;
+ },
+ close: function(p_id, p_code, p_reason) {
+ const ref = IDHandler.get(p_id);
+ if (ref && ref.readyState < ref.CLOSING) {
+ const code = p_code;
+ const reason = p_reason;
+ ref.close(code, reason);
+ }
+ },
+ destroy: function(p_id) {
+ const ref = IDHandler.get(p_id);
+ if (!ref) {
+ return;
+ }
+ GodotWebSocket.close(p_id, 3001, "destroyed");
+ IDHandler.remove(p_id);
+ ref.onopen = null;
+ ref.onmessage = null;
+ ref.onerror = null;
+ ref.onclose = null;
+ }
+};
+
+function _godot_js_websocket_buffered_amount(p_id) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(148, 1, p_id);
+ return GodotWebSocket.bufferedAmount(p_id);
+}
+
+function _godot_js_websocket_close(p_id, p_code, p_reason) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(149, 1, p_id, p_code, p_reason);
+ const code = p_code;
+ const reason = GodotRuntime.parseString(p_reason);
+ GodotWebSocket.close(p_id, code, reason);
+}
+
+function _godot_js_websocket_create(p_ref, p_url, p_proto, p_on_open, p_on_message, p_on_error, p_on_close) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(150, 1, p_ref, p_url, p_proto, p_on_open, p_on_message, p_on_error, p_on_close);
+ const on_open = GodotRuntime.get_func(p_on_open).bind(null, p_ref);
+ const on_message = GodotRuntime.get_func(p_on_message).bind(null, p_ref);
+ const on_error = GodotRuntime.get_func(p_on_error).bind(null, p_ref);
+ const on_close = GodotRuntime.get_func(p_on_close).bind(null, p_ref);
+ const url = GodotRuntime.parseString(p_url);
+ const protos = GodotRuntime.parseString(p_proto);
+ let socket = null;
+ try {
+ if (protos) {
+ socket = new WebSocket(url, protos.split(","));
+ } else {
+ socket = new WebSocket(url);
+ }
+ } catch (e) {
+ return 0;
+ }
+ socket.binaryType = "arraybuffer";
+ return GodotWebSocket.create(socket, on_open, on_message, on_error, on_close);
+}
+
+function _godot_js_websocket_destroy(p_id) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(151, 1, p_id);
+ GodotWebSocket.destroy(p_id);
+}
+
+function _godot_js_websocket_send(p_id, p_buf, p_buf_len, p_raw) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(152, 1, p_id, p_buf, p_buf_len, p_raw);
+ const bytes_array = new Uint8Array(p_buf_len);
+ let i = 0;
+ for (i = 0; i < p_buf_len; i++) {
+ bytes_array[i] = GodotRuntime.getHeapValue(p_buf + i, "i8");
+ }
+ let out = bytes_array.buffer;
+ if (!p_raw) {
+ out = new TextDecoder("utf-8").decode(bytes_array);
+ }
+ return GodotWebSocket.send(p_id, out);
+}
+
+var GodotJSWrapper = {
+ proxies: null,
+ cb_ret: null,
+ MyProxy: function(val) {
+ const id = IDHandler.add(this);
+ GodotJSWrapper.proxies.set(val, id);
+ let refs = 1;
+ this.ref = function() {
+ refs++;
+ };
+ this.unref = function() {
+ refs--;
+ if (refs === 0) {
+ IDHandler.remove(id);
+ GodotJSWrapper.proxies.delete(val);
+ }
+ };
+ this.get_val = function() {
+ return val;
+ };
+ this.get_id = function() {
+ return id;
+ };
+ },
+ get_proxied: function(val) {
+ const id = GodotJSWrapper.proxies.get(val);
+ if (id === undefined) {
+ const proxy = new GodotJSWrapper.MyProxy(val);
+ return proxy.get_id();
+ }
+ IDHandler.get(id).ref();
+ return id;
+ },
+ get_proxied_value: function(id) {
+ const proxy = IDHandler.get(id);
+ if (proxy === undefined) {
+ return undefined;
+ }
+ return proxy.get_val();
+ },
+ variant2js: function(type, val) {
+ switch (type) {
+ case 0:
+ return null;
+
+ case 1:
+ return !!GodotRuntime.getHeapValue(val, "i64");
+
+ case 2:
+ return GodotRuntime.getHeapValue(val, "i64");
+
+ case 3:
+ return GodotRuntime.getHeapValue(val, "double");
+
+ case 4:
+ return GodotRuntime.parseString(GodotRuntime.getHeapValue(val, "*"));
+
+ case 24:
+ return GodotJSWrapper.get_proxied_value(GodotRuntime.getHeapValue(val, "i64"));
+
+ default:
+ return undefined;
+ }
+ },
+ js2variant: function(p_val, p_exchange) {
+ if (p_val === undefined || p_val === null) {
+ return 0;
+ }
+ const type = typeof p_val;
+ if (type === "boolean") {
+ GodotRuntime.setHeapValue(p_exchange, p_val, "i64");
+ return 1;
+ } else if (type === "number") {
+ if (Number.isInteger(p_val)) {
+ GodotRuntime.setHeapValue(p_exchange, p_val, "i64");
+ return 2;
+ }
+ GodotRuntime.setHeapValue(p_exchange, p_val, "double");
+ return 3;
+ } else if (type === "string") {
+ const c_str = GodotRuntime.allocString(p_val);
+ GodotRuntime.setHeapValue(p_exchange, c_str, "*");
+ return 4;
+ }
+ const id = GodotJSWrapper.get_proxied(p_val);
+ GodotRuntime.setHeapValue(p_exchange, id, "i64");
+ return 24;
+ }
+};
+
+function _godot_js_wrapper_create_cb(p_ref, p_func) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(153, 1, p_ref, p_func);
+ const func = GodotRuntime.get_func(p_func);
+ let id = 0;
+ const cb = function() {
+ if (!GodotJSWrapper.get_proxied_value(id)) {
+ return undefined;
+ }
+ GodotJSWrapper.cb_ret = null;
+ const args = Array.from(arguments);
+ const argsProxy = new GodotJSWrapper.MyProxy(args);
+ func(p_ref, argsProxy.get_id(), args.length);
+ argsProxy.unref();
+ const ret = GodotJSWrapper.cb_ret;
+ GodotJSWrapper.cb_ret = null;
+ return ret;
+ };
+ id = GodotJSWrapper.get_proxied(cb);
+ return id;
+}
+
+function _godot_js_wrapper_create_object(p_object, p_args, p_argc, p_convert_callback, p_exchange, p_lock, p_free_lock_callback) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(154, 1, p_object, p_args, p_argc, p_convert_callback, p_exchange, p_lock, p_free_lock_callback);
+ const name = GodotRuntime.parseString(p_object);
+ if (typeof window[name] === "undefined") {
+ return -1;
+ }
+ const convert = GodotRuntime.get_func(p_convert_callback);
+ const freeLock = GodotRuntime.get_func(p_free_lock_callback);
+ const args = new Array(p_argc);
+ for (let i = 0; i < p_argc; i++) {
+ const type = convert(p_args, i, p_exchange, p_lock);
+ const lock = GodotRuntime.getHeapValue(p_lock, "*");
+ args[i] = GodotJSWrapper.variant2js(type, p_exchange);
+ if (lock) {
+ freeLock(p_lock, type);
+ }
+ }
+ try {
+ const res = new window[name](...args);
+ return GodotJSWrapper.js2variant(res, p_exchange);
+ } catch (e) {
+ GodotRuntime.error(`Error calling constructor ${name} with args:`, args, "error:", e);
+ return -1;
+ }
+}
+
+function _godot_js_wrapper_interface_get(p_name) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(155, 1, p_name);
+ const name = GodotRuntime.parseString(p_name);
+ if (typeof window[name] !== "undefined") {
+ return GodotJSWrapper.get_proxied(window[name]);
+ }
+ return 0;
+}
+
+function _godot_js_wrapper_object_call(p_id, p_method, p_args, p_argc, p_convert_callback, p_exchange, p_lock, p_free_lock_callback) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(156, 1, p_id, p_method, p_args, p_argc, p_convert_callback, p_exchange, p_lock, p_free_lock_callback);
+ const obj = GodotJSWrapper.get_proxied_value(p_id);
+ if (obj === undefined) {
+ return -1;
+ }
+ const method = GodotRuntime.parseString(p_method);
+ const convert = GodotRuntime.get_func(p_convert_callback);
+ const freeLock = GodotRuntime.get_func(p_free_lock_callback);
+ const args = new Array(p_argc);
+ for (let i = 0; i < p_argc; i++) {
+ const type = convert(p_args, i, p_exchange, p_lock);
+ const lock = GodotRuntime.getHeapValue(p_lock, "*");
+ args[i] = GodotJSWrapper.variant2js(type, p_exchange);
+ if (lock) {
+ freeLock(p_lock, type);
+ }
+ }
+ try {
+ const res = obj[method](...args);
+ return GodotJSWrapper.js2variant(res, p_exchange);
+ } catch (e) {
+ GodotRuntime.error(`Error calling method ${method} on:`, obj, "error:", e);
+ return -1;
+ }
+}
+
+function _godot_js_wrapper_object_get(p_id, p_exchange, p_prop) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(157, 1, p_id, p_exchange, p_prop);
+ const obj = GodotJSWrapper.get_proxied_value(p_id);
+ if (obj === undefined) {
+ return 0;
+ }
+ if (p_prop) {
+ const prop = GodotRuntime.parseString(p_prop);
+ try {
+ return GodotJSWrapper.js2variant(obj[prop], p_exchange);
+ } catch (e) {
+ GodotRuntime.error(`Error getting variable ${prop} on object`, obj);
+ return 0;
+ }
+ }
+ return GodotJSWrapper.js2variant(obj, p_exchange);
+}
+
+function _godot_js_wrapper_object_getvar(p_id, p_type, p_exchange) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(158, 1, p_id, p_type, p_exchange);
+ const obj = GodotJSWrapper.get_proxied_value(p_id);
+ if (obj === undefined) {
+ return -1;
+ }
+ const prop = GodotJSWrapper.variant2js(p_type, p_exchange);
+ if (prop === undefined || prop === null) {
+ return -1;
+ }
+ try {
+ return GodotJSWrapper.js2variant(obj[prop], p_exchange);
+ } catch (e) {
+ GodotRuntime.error(`Error getting variable ${prop} on object`, obj, e);
+ return -1;
+ }
+}
+
+function _godot_js_wrapper_object_set(p_id, p_name, p_type, p_exchange) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(159, 1, p_id, p_name, p_type, p_exchange);
+ const obj = GodotJSWrapper.get_proxied_value(p_id);
+ if (obj === undefined) {
+ return;
+ }
+ const name = GodotRuntime.parseString(p_name);
+ try {
+ obj[name] = GodotJSWrapper.variant2js(p_type, p_exchange);
+ } catch (e) {
+ GodotRuntime.error(`Error setting variable ${name} on object`, obj);
+ }
+}
+
+function _godot_js_wrapper_object_set_cb_ret(p_val_type, p_val_ex) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(160, 1, p_val_type, p_val_ex);
+ GodotJSWrapper.cb_ret = GodotJSWrapper.variant2js(p_val_type, p_val_ex);
+}
+
+function _godot_js_wrapper_object_setvar(p_id, p_key_type, p_key_ex, p_val_type, p_val_ex) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(161, 1, p_id, p_key_type, p_key_ex, p_val_type, p_val_ex);
+ const obj = GodotJSWrapper.get_proxied_value(p_id);
+ if (obj === undefined) {
+ return -1;
+ }
+ const key = GodotJSWrapper.variant2js(p_key_type, p_key_ex);
+ try {
+ obj[key] = GodotJSWrapper.variant2js(p_val_type, p_val_ex);
+ return 0;
+ } catch (e) {
+ GodotRuntime.error(`Error setting variable ${key} on object`, obj);
+ return -1;
+ }
+}
+
+function _godot_js_wrapper_object_unref(p_id) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(162, 1, p_id);
+ const proxy = IDHandler.get(p_id);
+ if (proxy !== undefined) {
+ proxy.unref();
+ }
+}
+
+var GodotWebGL2 = {};
+
+function _godot_webgl2_glFramebufferTextureMultiviewOVR(target, attachment, texture, level, base_view_index, num_views) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(163, 1, target, attachment, texture, level, base_view_index, num_views);
+ const context = GL.currentContext;
+ if (typeof context.multiviewExt === "undefined") {
+ const ext = context.GLctx.getExtension("OVR_multiview2");
+ if (!ext) {
+ GodotRuntime.error("Trying to call glFramebufferTextureMultiviewOVR() without the OVR_multiview2 extension");
+ return;
+ }
+ context.multiviewExt = ext;
+ }
+ const ext = context.multiviewExt;
+ ext.framebufferTextureMultiviewOVR(target, attachment, GL.textures[texture], level, base_view_index, num_views);
+}
+
+function _godot_webgl2_glGetBufferSubData(target, offset, size, data) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(164, 1, target, offset, size, data);
+ const gl_context_handle = _emscripten_webgl_get_current_context();
+ const gl = GL.getContext(gl_context_handle);
+ if (gl) {
+ gl.GLctx["getBufferSubData"](target, offset, GROWABLE_HEAP_U8(), data, size);
+ }
+}
+
+var GodotWebXR = {
+ gl: null,
+ session: null,
+ gl_binding: null,
+ layer: null,
+ space: null,
+ frame: null,
+ pose: null,
+ view_count: 1,
+ input_sources: [ , , , , , , , , , , , , , , , ],
+ touches: [ , , , , ],
+ onsimpleevent: null,
+ orig_requestAnimationFrame: null,
+ requestAnimationFrame: callback => {
+ if (GodotWebXR.session && GodotWebXR.space) {
+ const onFrame = function(time, frame) {
+ GodotWebXR.frame = frame;
+ GodotWebXR.pose = frame.getViewerPose(GodotWebXR.space);
+ callback(time);
+ GodotWebXR.frame = null;
+ GodotWebXR.pose = null;
+ };
+ GodotWebXR.session.requestAnimationFrame(onFrame);
+ } else {
+ GodotWebXR.orig_requestAnimationFrame(callback);
+ }
+ },
+ monkeyPatchRequestAnimationFrame: enable => {
+ if (GodotWebXR.orig_requestAnimationFrame === null) {
+ GodotWebXR.orig_requestAnimationFrame = Browser.requestAnimationFrame;
+ }
+ Browser.requestAnimationFrame = enable ? GodotWebXR.requestAnimationFrame : GodotWebXR.orig_requestAnimationFrame;
+ },
+ pauseResumeMainLoop: () => {
+ Browser.mainLoop.pause();
+ runtimeKeepalivePush();
+ window.setTimeout(function() {
+ runtimeKeepalivePop();
+ Browser.mainLoop.resume();
+ }, 0);
+ },
+ getLayer: () => {
+ const new_view_count = GodotWebXR.pose ? GodotWebXR.pose.views.length : 1;
+ let layer = GodotWebXR.layer;
+ if (layer && GodotWebXR.view_count === new_view_count) {
+ return layer;
+ }
+ if (!GodotWebXR.session || !GodotWebXR.gl_binding) {
+ return null;
+ }
+ const gl = GodotWebXR.gl;
+ layer = GodotWebXR.gl_binding.createProjectionLayer({
+ textureType: new_view_count > 1 ? "texture-array" : "texture",
+ colorFormat: gl.RGBA8,
+ depthFormat: gl.DEPTH_COMPONENT24
+ });
+ GodotWebXR.session.updateRenderState({
+ layers: [ layer ]
+ });
+ GodotWebXR.layer = layer;
+ GodotWebXR.view_count = new_view_count;
+ return layer;
+ },
+ getSubImage: () => {
+ if (!GodotWebXR.pose) {
+ return null;
+ }
+ const layer = GodotWebXR.getLayer();
+ if (layer === null) {
+ return null;
+ }
+ return GodotWebXR.gl_binding.getViewSubImage(layer, GodotWebXR.pose.views[0]);
+ },
+ getTextureId: texture => {
+ if (texture.name !== undefined) {
+ return texture.name;
+ }
+ const id = GL.getNewId(GL.textures);
+ texture.name = id;
+ GL.textures[id] = texture;
+ return id;
+ },
+ addInputSource: input_source => {
+ let name = -1;
+ if (input_source.targetRayMode === "tracked-pointer" && input_source.handedness === "left") {
+ name = 0;
+ } else if (input_source.targetRayMode === "tracked-pointer" && input_source.handedness === "right") {
+ name = 1;
+ } else {
+ for (let i = 2; i < 16; i++) {
+ if (!GodotWebXR.input_sources[i]) {
+ name = i;
+ break;
+ }
+ }
+ }
+ if (name >= 0) {
+ GodotWebXR.input_sources[name] = input_source;
+ input_source.name = name;
+ if (input_source.targetRayMode === "screen") {
+ let touch_index = -1;
+ for (let i = 0; i < 5; i++) {
+ if (!GodotWebXR.touches[i]) {
+ touch_index = i;
+ break;
+ }
+ }
+ if (touch_index >= 0) {
+ GodotWebXR.touches[touch_index] = input_source;
+ input_source.touch_index = touch_index;
+ }
+ }
+ }
+ return name;
+ },
+ removeInputSource: input_source => {
+ if (input_source.name !== undefined) {
+ const name = input_source.name;
+ if (name >= 0 && name < 16) {
+ GodotWebXR.input_sources[name] = null;
+ }
+ if (input_source.touch_index !== undefined) {
+ const touch_index = input_source.touch_index;
+ if (touch_index >= 0 && touch_index < 5) {
+ GodotWebXR.touches[touch_index] = null;
+ }
+ }
+ return name;
+ }
+ return -1;
+ },
+ getInputSourceId: input_source => {
+ if (input_source !== undefined) {
+ return input_source.name;
+ }
+ return -1;
+ },
+ getTouchIndex: input_source => {
+ if (input_source.touch_index !== undefined) {
+ return input_source.touch_index;
+ }
+ return -1;
+ }
+};
+
+function _godot_webxr_get_bounds_geometry(r_points) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(165, 1, r_points);
+ if (!GodotWebXR.space || !GodotWebXR.space.boundsGeometry) {
+ return 0;
+ }
+ const point_count = GodotWebXR.space.boundsGeometry.length;
+ if (point_count === 0) {
+ return 0;
+ }
+ const buf = GodotRuntime.malloc(point_count * 3 * 4);
+ for (let i = 0; i < point_count; i++) {
+ const point = GodotWebXR.space.boundsGeometry[i];
+ GodotRuntime.setHeapValue(buf + (i * 3 + 0) * 4, point.x, "float");
+ GodotRuntime.setHeapValue(buf + (i * 3 + 1) * 4, point.y, "float");
+ GodotRuntime.setHeapValue(buf + (i * 3 + 2) * 4, point.z, "float");
+ }
+ GodotRuntime.setHeapValue(r_points, buf, "i32");
+ return point_count;
+}
+
+function _godot_webxr_get_color_texture() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(166, 1);
+ const subimage = GodotWebXR.getSubImage();
+ if (subimage === null) {
+ return 0;
+ }
+ return GodotWebXR.getTextureId(subimage.colorTexture);
+}
+
+function _godot_webxr_get_depth_texture() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(167, 1);
+ const subimage = GodotWebXR.getSubImage();
+ if (subimage === null) {
+ return 0;
+ }
+ if (!subimage.depthStencilTexture) {
+ return 0;
+ }
+ return GodotWebXR.getTextureId(subimage.depthStencilTexture);
+}
+
+function _godot_webxr_get_frame_rate() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(168, 1);
+ if (!GodotWebXR.session || GodotWebXR.session.frameRate === undefined) {
+ return 0;
+ }
+ return GodotWebXR.session.frameRate;
+}
+
+function _godot_webxr_get_projection_for_view(p_view, r_transform) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(169, 1, p_view, r_transform);
+ if (!GodotWebXR.session || !GodotWebXR.pose) {
+ return false;
+ }
+ const matrix = GodotWebXR.pose.views[p_view].projectionMatrix;
+ for (let i = 0; i < 16; i++) {
+ GodotRuntime.setHeapValue(r_transform + i * 4, matrix[i], "float");
+ }
+ return true;
+}
+
+function _godot_webxr_get_render_target_size(r_size) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(170, 1, r_size);
+ const subimage = GodotWebXR.getSubImage();
+ if (subimage === null) {
+ return false;
+ }
+ GodotRuntime.setHeapValue(r_size + 0, subimage.viewport.width, "i32");
+ GodotRuntime.setHeapValue(r_size + 4, subimage.viewport.height, "i32");
+ return true;
+}
+
+function _godot_webxr_get_supported_frame_rates(r_frame_rates) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(171, 1, r_frame_rates);
+ if (!GodotWebXR.session || GodotWebXR.session.supportedFrameRates === undefined) {
+ return 0;
+ }
+ const frame_rate_count = GodotWebXR.session.supportedFrameRates.length;
+ if (frame_rate_count === 0) {
+ return 0;
+ }
+ const buf = GodotRuntime.malloc(frame_rate_count * 4);
+ for (let i = 0; i < frame_rate_count; i++) {
+ GodotRuntime.setHeapValue(buf + i * 4, GodotWebXR.session.supportedFrameRates[i], "float");
+ }
+ GodotRuntime.setHeapValue(r_frame_rates, buf, "i32");
+ return frame_rate_count;
+}
+
+function _godot_webxr_get_transform_for_view(p_view, r_transform) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(172, 1, p_view, r_transform);
+ if (!GodotWebXR.session || !GodotWebXR.pose) {
+ return false;
+ }
+ const views = GodotWebXR.pose.views;
+ let matrix;
+ if (p_view >= 0) {
+ matrix = views[p_view].transform.matrix;
+ } else {
+ matrix = GodotWebXR.pose.transform.matrix;
+ }
+ for (let i = 0; i < 16; i++) {
+ GodotRuntime.setHeapValue(r_transform + i * 4, matrix[i], "float");
+ }
+ return true;
+}
+
+function _godot_webxr_get_velocity_texture() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(173, 1);
+ const subimage = GodotWebXR.getSubImage();
+ if (subimage === null) {
+ return 0;
+ }
+ if (!subimage.motionVectorTexture) {
+ return 0;
+ }
+ return GodotWebXR.getTextureId(subimage.motionVectorTexture);
+}
+
+function _godot_webxr_get_view_count() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(174, 1);
+ if (!GodotWebXR.session || !GodotWebXR.pose) {
+ return 1;
+ }
+ const view_count = GodotWebXR.pose.views.length;
+ return view_count > 0 ? view_count : 1;
+}
+
+function _godot_webxr_get_visibility_state() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(175, 1);
+ if (!GodotWebXR.session || !GodotWebXR.session.visibilityState) {
+ return 0;
+ }
+ return GodotRuntime.allocString(GodotWebXR.session.visibilityState);
+}
+
+function _godot_webxr_initialize(p_session_mode, p_required_features, p_optional_features, p_requested_reference_spaces, p_on_session_started, p_on_session_ended, p_on_session_failed, p_on_input_event, p_on_simple_event) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(176, 1, p_session_mode, p_required_features, p_optional_features, p_requested_reference_spaces, p_on_session_started, p_on_session_ended, p_on_session_failed, p_on_input_event, p_on_simple_event);
+ GodotWebXR.monkeyPatchRequestAnimationFrame(true);
+ const session_mode = GodotRuntime.parseString(p_session_mode);
+ const required_features = GodotRuntime.parseString(p_required_features).split(",").map(s => s.trim()).filter(s => s !== "");
+ const optional_features = GodotRuntime.parseString(p_optional_features).split(",").map(s => s.trim()).filter(s => s !== "");
+ const requested_reference_space_types = GodotRuntime.parseString(p_requested_reference_spaces).split(",").map(s => s.trim());
+ const onstarted = GodotRuntime.get_func(p_on_session_started);
+ const onended = GodotRuntime.get_func(p_on_session_ended);
+ const onfailed = GodotRuntime.get_func(p_on_session_failed);
+ const oninputevent = GodotRuntime.get_func(p_on_input_event);
+ const onsimpleevent = GodotRuntime.get_func(p_on_simple_event);
+ const session_init = {};
+ if (required_features.length > 0) {
+ session_init["requiredFeatures"] = required_features;
+ }
+ if (optional_features.length > 0) {
+ session_init["optionalFeatures"] = optional_features;
+ }
+ navigator.xr.requestSession(session_mode, session_init).then(function(session) {
+ GodotWebXR.session = session;
+ session.addEventListener("end", function(evt) {
+ onended();
+ });
+ session.addEventListener("inputsourceschange", function(evt) {
+ evt.added.forEach(GodotWebXR.addInputSource);
+ evt.removed.forEach(GodotWebXR.removeInputSource);
+ });
+ [ "selectstart", "selectend", "squeezestart", "squeezeend" ].forEach((input_event, index) => {
+ session.addEventListener(input_event, function(evt) {
+ GodotWebXR.frame = evt.frame;
+ oninputevent(index, GodotWebXR.getInputSourceId(evt.inputSource));
+ GodotWebXR.frame = null;
+ });
+ });
+ session.addEventListener("visibilitychange", function(evt) {
+ const c_str = GodotRuntime.allocString("visibility_state_changed");
+ onsimpleevent(c_str);
+ GodotRuntime.free(c_str);
+ });
+ GodotWebXR.onsimpleevent = onsimpleevent;
+ const gl_context_handle = _emscripten_webgl_get_current_context();
+ const gl = GL.getContext(gl_context_handle).GLctx;
+ GodotWebXR.gl = gl;
+ gl.makeXRCompatible().then(function() {
+ GodotWebXR.gl_binding = new XRWebGLBinding(session, gl);
+ GodotWebXR.getLayer();
+ function onReferenceSpaceSuccess(reference_space, reference_space_type) {
+ GodotWebXR.space = reference_space;
+ reference_space.onreset = function(evt) {
+ const c_str = GodotRuntime.allocString("reference_space_reset");
+ onsimpleevent(c_str);
+ GodotRuntime.free(c_str);
+ };
+ GodotWebXR.pauseResumeMainLoop();
+ window.setTimeout(function() {
+ const c_str = GodotRuntime.allocString(reference_space_type);
+ onstarted(c_str);
+ GodotRuntime.free(c_str);
+ }, 0);
+ }
+ function requestReferenceSpace() {
+ const reference_space_type = requested_reference_space_types.shift();
+ session.requestReferenceSpace(reference_space_type).then(refSpace => {
+ onReferenceSpaceSuccess(refSpace, reference_space_type);
+ }).catch(() => {
+ if (requested_reference_space_types.length === 0) {
+ const c_str = GodotRuntime.allocString("Unable to get any of the requested reference space types");
+ onfailed(c_str);
+ GodotRuntime.free(c_str);
+ } else {
+ requestReferenceSpace();
+ }
+ });
+ }
+ requestReferenceSpace();
+ }).catch(function(error) {
+ const c_str = GodotRuntime.allocString(`Unable to make WebGL context compatible with WebXR: ${error}`);
+ onfailed(c_str);
+ GodotRuntime.free(c_str);
+ });
+ }).catch(function(error) {
+ const c_str = GodotRuntime.allocString(`Unable to start session: ${error}`);
+ onfailed(c_str);
+ GodotRuntime.free(c_str);
+ });
+}
+
+function _godot_webxr_is_session_supported(p_session_mode, p_callback) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(177, 1, p_session_mode, p_callback);
+ const session_mode = GodotRuntime.parseString(p_session_mode);
+ const cb = GodotRuntime.get_func(p_callback);
+ if (navigator.xr) {
+ navigator.xr.isSessionSupported(session_mode).then(function(supported) {
+ const c_str = GodotRuntime.allocString(session_mode);
+ cb(c_str, supported ? 1 : 0);
+ GodotRuntime.free(c_str);
+ });
+ } else {
+ const c_str = GodotRuntime.allocString(session_mode);
+ cb(c_str, 0);
+ GodotRuntime.free(c_str);
+ }
+}
+
+function _godot_webxr_is_supported() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(178, 1);
+ return !!navigator.xr;
+}
+
+function _godot_webxr_uninitialize() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(179, 1);
+ if (GodotWebXR.session) {
+ GodotWebXR.session.end().catch(e => {});
+ }
+ GodotWebXR.session = null;
+ GodotWebXR.gl_binding = null;
+ GodotWebXR.layer = null;
+ GodotWebXR.space = null;
+ GodotWebXR.frame = null;
+ GodotWebXR.pose = null;
+ GodotWebXR.view_count = 1;
+ GodotWebXR.input_sources = new Array(16);
+ GodotWebXR.touches = new Array(5);
+ GodotWebXR.onsimpleevent = null;
+ GodotWebXR.monkeyPatchRequestAnimationFrame(false);
+ GodotWebXR.pauseResumeMainLoop();
+}
+
+function _godot_webxr_update_input_source(p_input_source_id, r_target_pose, r_target_ray_mode, r_touch_index, r_has_grip_pose, r_grip_pose, r_has_standard_mapping, r_button_count, r_buttons, r_axes_count, r_axes) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(180, 1, p_input_source_id, r_target_pose, r_target_ray_mode, r_touch_index, r_has_grip_pose, r_grip_pose, r_has_standard_mapping, r_button_count, r_buttons, r_axes_count, r_axes);
+ if (!GodotWebXR.session || !GodotWebXR.frame) {
+ return 0;
+ }
+ if (p_input_source_id < 0 || p_input_source_id >= GodotWebXR.input_sources.length || !GodotWebXR.input_sources[p_input_source_id]) {
+ return false;
+ }
+ const input_source = GodotWebXR.input_sources[p_input_source_id];
+ const frame = GodotWebXR.frame;
+ const space = GodotWebXR.space;
+ const target_pose = frame.getPose(input_source.targetRaySpace, space);
+ if (!target_pose) {
+ return false;
+ }
+ const target_pose_matrix = target_pose.transform.matrix;
+ for (let i = 0; i < 16; i++) {
+ GodotRuntime.setHeapValue(r_target_pose + i * 4, target_pose_matrix[i], "float");
+ }
+ let target_ray_mode = 0;
+ switch (input_source.targetRayMode) {
+ case "gaze":
+ target_ray_mode = 1;
+ break;
+
+ case "tracked-pointer":
+ target_ray_mode = 2;
+ break;
+
+ case "screen":
+ target_ray_mode = 3;
+ break;
+
+ default:
+ }
+ GodotRuntime.setHeapValue(r_target_ray_mode, target_ray_mode, "i32");
+ GodotRuntime.setHeapValue(r_touch_index, GodotWebXR.getTouchIndex(input_source), "i32");
+ let has_grip_pose = false;
+ if (input_source.gripSpace) {
+ const grip_pose = frame.getPose(input_source.gripSpace, space);
+ if (grip_pose) {
+ const grip_pose_matrix = grip_pose.transform.matrix;
+ for (let i = 0; i < 16; i++) {
+ GodotRuntime.setHeapValue(r_grip_pose + i * 4, grip_pose_matrix[i], "float");
+ }
+ has_grip_pose = true;
+ }
+ }
+ GodotRuntime.setHeapValue(r_has_grip_pose, has_grip_pose ? 1 : 0, "i32");
+ let has_standard_mapping = false;
+ let button_count = 0;
+ let axes_count = 0;
+ if (input_source.gamepad) {
+ if (input_source.gamepad.mapping === "xr-standard") {
+ has_standard_mapping = true;
+ }
+ button_count = Math.min(input_source.gamepad.buttons.length, 10);
+ for (let i = 0; i < button_count; i++) {
+ GodotRuntime.setHeapValue(r_buttons + i * 4, input_source.gamepad.buttons[i].value, "float");
+ }
+ axes_count = Math.min(input_source.gamepad.axes.length, 10);
+ for (let i = 0; i < axes_count; i++) {
+ GodotRuntime.setHeapValue(r_axes + i * 4, input_source.gamepad.axes[i], "float");
+ }
+ }
+ GodotRuntime.setHeapValue(r_has_standard_mapping, has_standard_mapping ? 1 : 0, "i32");
+ GodotRuntime.setHeapValue(r_button_count, button_count, "i32");
+ GodotRuntime.setHeapValue(r_axes_count, axes_count, "i32");
+ return true;
+}
+
+function _godot_webxr_update_target_frame_rate(p_frame_rate) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(181, 1, p_frame_rate);
+ if (!GodotWebXR.session || GodotWebXR.session.updateTargetFrameRate === undefined) {
+ return;
+ }
+ GodotWebXR.session.updateTargetFrameRate(p_frame_rate).then(() => {
+ const c_str = GodotRuntime.allocString("display_refresh_rate_changed");
+ GodotWebXR.onsimpleevent(c_str);
+ GodotRuntime.free(c_str);
+ });
+}
+
+function arraySum(array, index) {
+ var sum = 0;
+ for (var i = 0; i <= index; sum += array[i++]) {}
+ return sum;
+}
+
+var MONTH_DAYS_LEAP = [ 31, 29, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31 ];
+
+var MONTH_DAYS_REGULAR = [ 31, 28, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31 ];
+
+function addDays(date, days) {
+ var newDate = new Date(date.getTime());
+ while (days > 0) {
+ var leap = isLeapYear(newDate.getFullYear());
+ var currentMonth = newDate.getMonth();
+ var daysInCurrentMonth = (leap ? MONTH_DAYS_LEAP : MONTH_DAYS_REGULAR)[currentMonth];
+ if (days > daysInCurrentMonth - newDate.getDate()) {
+ days -= daysInCurrentMonth - newDate.getDate() + 1;
+ newDate.setDate(1);
+ if (currentMonth < 11) {
+ newDate.setMonth(currentMonth + 1);
+ } else {
+ newDate.setMonth(0);
+ newDate.setFullYear(newDate.getFullYear() + 1);
+ }
+ } else {
+ newDate.setDate(newDate.getDate() + days);
+ return newDate;
+ }
+ }
+ return newDate;
+}
+
+function writeArrayToMemory(array, buffer) {
+ assert(array.length >= 0, "writeArrayToMemory array must have a length (should be an array or typed array)");
+ GROWABLE_HEAP_I8().set(array, buffer);
+}
+
+function _strftime(s, maxsize, format, tm) {
+ var tm_zone = GROWABLE_HEAP_I32()[tm + 40 >> 2];
+ var date = {
+ tm_sec: GROWABLE_HEAP_I32()[tm >> 2],
+ tm_min: GROWABLE_HEAP_I32()[tm + 4 >> 2],
+ tm_hour: GROWABLE_HEAP_I32()[tm + 8 >> 2],
+ tm_mday: GROWABLE_HEAP_I32()[tm + 12 >> 2],
+ tm_mon: GROWABLE_HEAP_I32()[tm + 16 >> 2],
+ tm_year: GROWABLE_HEAP_I32()[tm + 20 >> 2],
+ tm_wday: GROWABLE_HEAP_I32()[tm + 24 >> 2],
+ tm_yday: GROWABLE_HEAP_I32()[tm + 28 >> 2],
+ tm_isdst: GROWABLE_HEAP_I32()[tm + 32 >> 2],
+ tm_gmtoff: GROWABLE_HEAP_I32()[tm + 36 >> 2],
+ tm_zone: tm_zone ? UTF8ToString(tm_zone) : ""
+ };
+ var pattern = UTF8ToString(format);
+ var EXPANSION_RULES_1 = {
+ "%c": "%a %b %d %H:%M:%S %Y",
+ "%D": "%m/%d/%y",
+ "%F": "%Y-%m-%d",
+ "%h": "%b",
+ "%r": "%I:%M:%S %p",
+ "%R": "%H:%M",
+ "%T": "%H:%M:%S",
+ "%x": "%m/%d/%y",
+ "%X": "%H:%M:%S",
+ "%Ec": "%c",
+ "%EC": "%C",
+ "%Ex": "%m/%d/%y",
+ "%EX": "%H:%M:%S",
+ "%Ey": "%y",
+ "%EY": "%Y",
+ "%Od": "%d",
+ "%Oe": "%e",
+ "%OH": "%H",
+ "%OI": "%I",
+ "%Om": "%m",
+ "%OM": "%M",
+ "%OS": "%S",
+ "%Ou": "%u",
+ "%OU": "%U",
+ "%OV": "%V",
+ "%Ow": "%w",
+ "%OW": "%W",
+ "%Oy": "%y"
+ };
+ for (var rule in EXPANSION_RULES_1) {
+ pattern = pattern.replace(new RegExp(rule, "g"), EXPANSION_RULES_1[rule]);
+ }
+ var WEEKDAYS = [ "Sunday", "Monday", "Tuesday", "Wednesday", "Thursday", "Friday", "Saturday" ];
+ var MONTHS = [ "January", "February", "March", "April", "May", "June", "July", "August", "September", "October", "November", "December" ];
+ function leadingSomething(value, digits, character) {
+ var str = typeof value == "number" ? value.toString() : value || "";
+ while (str.length < digits) {
+ str = character[0] + str;
+ }
+ return str;
+ }
+ function leadingNulls(value, digits) {
+ return leadingSomething(value, digits, "0");
+ }
+ function compareByDay(date1, date2) {
+ function sgn(value) {
+ return value < 0 ? -1 : value > 0 ? 1 : 0;
+ }
+ var compare;
+ if ((compare = sgn(date1.getFullYear() - date2.getFullYear())) === 0) {
+ if ((compare = sgn(date1.getMonth() - date2.getMonth())) === 0) {
+ compare = sgn(date1.getDate() - date2.getDate());
+ }
+ }
+ return compare;
+ }
+ function getFirstWeekStartDate(janFourth) {
+ switch (janFourth.getDay()) {
+ case 0:
+ return new Date(janFourth.getFullYear() - 1, 11, 29);
+
+ case 1:
+ return janFourth;
+
+ case 2:
+ return new Date(janFourth.getFullYear(), 0, 3);
+
+ case 3:
+ return new Date(janFourth.getFullYear(), 0, 2);
+
+ case 4:
+ return new Date(janFourth.getFullYear(), 0, 1);
+
+ case 5:
+ return new Date(janFourth.getFullYear() - 1, 11, 31);
+
+ case 6:
+ return new Date(janFourth.getFullYear() - 1, 11, 30);
+ }
+ }
+ function getWeekBasedYear(date) {
+ var thisDate = addDays(new Date(date.tm_year + 1900, 0, 1), date.tm_yday);
+ var janFourthThisYear = new Date(thisDate.getFullYear(), 0, 4);
+ var janFourthNextYear = new Date(thisDate.getFullYear() + 1, 0, 4);
+ var firstWeekStartThisYear = getFirstWeekStartDate(janFourthThisYear);
+ var firstWeekStartNextYear = getFirstWeekStartDate(janFourthNextYear);
+ if (compareByDay(firstWeekStartThisYear, thisDate) <= 0) {
+ if (compareByDay(firstWeekStartNextYear, thisDate) <= 0) {
+ return thisDate.getFullYear() + 1;
+ }
+ return thisDate.getFullYear();
+ }
+ return thisDate.getFullYear() - 1;
+ }
+ var EXPANSION_RULES_2 = {
+ "%a": function(date) {
+ return WEEKDAYS[date.tm_wday].substring(0, 3);
+ },
+ "%A": function(date) {
+ return WEEKDAYS[date.tm_wday];
+ },
+ "%b": function(date) {
+ return MONTHS[date.tm_mon].substring(0, 3);
+ },
+ "%B": function(date) {
+ return MONTHS[date.tm_mon];
+ },
+ "%C": function(date) {
+ var year = date.tm_year + 1900;
+ return leadingNulls(year / 100 | 0, 2);
+ },
+ "%d": function(date) {
+ return leadingNulls(date.tm_mday, 2);
+ },
+ "%e": function(date) {
+ return leadingSomething(date.tm_mday, 2, " ");
+ },
+ "%g": function(date) {
+ return getWeekBasedYear(date).toString().substring(2);
+ },
+ "%G": function(date) {
+ return getWeekBasedYear(date);
+ },
+ "%H": function(date) {
+ return leadingNulls(date.tm_hour, 2);
+ },
+ "%I": function(date) {
+ var twelveHour = date.tm_hour;
+ if (twelveHour == 0) twelveHour = 12; else if (twelveHour > 12) twelveHour -= 12;
+ return leadingNulls(twelveHour, 2);
+ },
+ "%j": function(date) {
+ return leadingNulls(date.tm_mday + arraySum(isLeapYear(date.tm_year + 1900) ? MONTH_DAYS_LEAP : MONTH_DAYS_REGULAR, date.tm_mon - 1), 3);
+ },
+ "%m": function(date) {
+ return leadingNulls(date.tm_mon + 1, 2);
+ },
+ "%M": function(date) {
+ return leadingNulls(date.tm_min, 2);
+ },
+ "%n": function() {
+ return "\n";
+ },
+ "%p": function(date) {
+ if (date.tm_hour >= 0 && date.tm_hour < 12) {
+ return "AM";
+ }
+ return "PM";
+ },
+ "%S": function(date) {
+ return leadingNulls(date.tm_sec, 2);
+ },
+ "%t": function() {
+ return "\t";
+ },
+ "%u": function(date) {
+ return date.tm_wday || 7;
+ },
+ "%U": function(date) {
+ var days = date.tm_yday + 7 - date.tm_wday;
+ return leadingNulls(Math.floor(days / 7), 2);
+ },
+ "%V": function(date) {
+ var val = Math.floor((date.tm_yday + 7 - (date.tm_wday + 6) % 7) / 7);
+ if ((date.tm_wday + 371 - date.tm_yday - 2) % 7 <= 2) {
+ val++;
+ }
+ if (!val) {
+ val = 52;
+ var dec31 = (date.tm_wday + 7 - date.tm_yday - 1) % 7;
+ if (dec31 == 4 || dec31 == 5 && isLeapYear(date.tm_year % 400 - 1)) {
+ val++;
+ }
+ } else if (val == 53) {
+ var jan1 = (date.tm_wday + 371 - date.tm_yday) % 7;
+ if (jan1 != 4 && (jan1 != 3 || !isLeapYear(date.tm_year))) val = 1;
+ }
+ return leadingNulls(val, 2);
+ },
+ "%w": function(date) {
+ return date.tm_wday;
+ },
+ "%W": function(date) {
+ var days = date.tm_yday + 7 - (date.tm_wday + 6) % 7;
+ return leadingNulls(Math.floor(days / 7), 2);
+ },
+ "%y": function(date) {
+ return (date.tm_year + 1900).toString().substring(2);
+ },
+ "%Y": function(date) {
+ return date.tm_year + 1900;
+ },
+ "%z": function(date) {
+ var off = date.tm_gmtoff;
+ var ahead = off >= 0;
+ off = Math.abs(off) / 60;
+ off = off / 60 * 100 + off % 60;
+ return (ahead ? "+" : "-") + String("0000" + off).slice(-4);
+ },
+ "%Z": function(date) {
+ return date.tm_zone;
+ },
+ "%%": function() {
+ return "%";
+ }
+ };
+ pattern = pattern.replace(/%%/g, "\0\0");
+ for (var rule in EXPANSION_RULES_2) {
+ if (pattern.includes(rule)) {
+ pattern = pattern.replace(new RegExp(rule, "g"), EXPANSION_RULES_2[rule](date));
+ }
+ }
+ pattern = pattern.replace(/\0\0/g, "%");
+ var bytes = intArrayFromString(pattern, false);
+ if (bytes.length > maxsize) {
+ return 0;
+ }
+ writeArrayToMemory(bytes, s);
+ return bytes.length - 1;
+}
+
+function _strftime_l(s, maxsize, format, tm, loc) {
+ return _strftime(s, maxsize, format, tm);
+}
+
+function stringToUTF8OnStack(str) {
+ var size = lengthBytesUTF8(str) + 1;
+ var ret = stackAlloc(size);
+ stringToUTF8(str, ret, size);
+ return ret;
+}
+
+function getCFunc(ident) {
+ var func = Module["_" + ident];
+ assert(func, "Cannot call unknown function " + ident + ", make sure it is exported");
+ return func;
+}
+
+function ccall(ident, returnType, argTypes, args, opts) {
+ var toC = {
+ "string": str => {
+ var ret = 0;
+ if (str !== null && str !== undefined && str !== 0) {
+ ret = stringToUTF8OnStack(str);
+ }
+ return ret;
+ },
+ "array": arr => {
+ var ret = stackAlloc(arr.length);
+ writeArrayToMemory(arr, ret);
+ return ret;
+ }
+ };
+ function convertReturnValue(ret) {
+ if (returnType === "string") {
+ return UTF8ToString(ret);
+ }
+ if (returnType === "boolean") return Boolean(ret);
+ return ret;
+ }
+ var func = getCFunc(ident);
+ var cArgs = [];
+ var stack = 0;
+ assert(returnType !== "array", 'Return type should not be "array".');
+ if (args) {
+ for (var i = 0; i < args.length; i++) {
+ var converter = toC[argTypes[i]];
+ if (converter) {
+ if (stack === 0) stack = stackSave();
+ cArgs[i] = converter(args[i]);
+ } else {
+ cArgs[i] = args[i];
+ }
+ }
+ }
+ var ret = func.apply(null, cArgs);
+ function onDone(ret) {
+ if (stack !== 0) stackRestore(stack);
+ return convertReturnValue(ret);
+ }
+ ret = onDone(ret);
+ return ret;
+}
+
+function cwrap(ident, returnType, argTypes, opts) {
+ return function() {
+ return ccall(ident, returnType, argTypes, arguments, opts);
+ };
+}
+
+PThread.init();
+
+var FSNode = function(parent, name, mode, rdev) {
+ if (!parent) {
+ parent = this;
+ }
+ this.parent = parent;
+ this.mount = parent.mount;
+ this.mounted = null;
+ this.id = FS.nextInode++;
+ this.name = name;
+ this.mode = mode;
+ this.node_ops = {};
+ this.stream_ops = {};
+ this.rdev = rdev;
+};
+
+var readMode = 292 | 73;
+
+var writeMode = 146;
+
+Object.defineProperties(FSNode.prototype, {
+ read: {
+ get: function() {
+ return (this.mode & readMode) === readMode;
+ },
+ set: function(val) {
+ val ? this.mode |= readMode : this.mode &= ~readMode;
+ }
+ },
+ write: {
+ get: function() {
+ return (this.mode & writeMode) === writeMode;
+ },
+ set: function(val) {
+ val ? this.mode |= writeMode : this.mode &= ~writeMode;
+ }
+ },
+ isFolder: {
+ get: function() {
+ return FS.isDir(this.mode);
+ }
+ },
+ isDevice: {
+ get: function() {
+ return FS.isChrdev(this.mode);
+ }
+ }
+});
+
+FS.FSNode = FSNode;
+
+FS.createPreloadedFile = FS_createPreloadedFile;
+
+FS.staticInit();
+
+ERRNO_CODES = {
+ "EPERM": 63,
+ "ENOENT": 44,
+ "ESRCH": 71,
+ "EINTR": 27,
+ "EIO": 29,
+ "ENXIO": 60,
+ "E2BIG": 1,
+ "ENOEXEC": 45,
+ "EBADF": 8,
+ "ECHILD": 12,
+ "EAGAIN": 6,
+ "EWOULDBLOCK": 6,
+ "ENOMEM": 48,
+ "EACCES": 2,
+ "EFAULT": 21,
+ "ENOTBLK": 105,
+ "EBUSY": 10,
+ "EEXIST": 20,
+ "EXDEV": 75,
+ "ENODEV": 43,
+ "ENOTDIR": 54,
+ "EISDIR": 31,
+ "EINVAL": 28,
+ "ENFILE": 41,
+ "EMFILE": 33,
+ "ENOTTY": 59,
+ "ETXTBSY": 74,
+ "EFBIG": 22,
+ "ENOSPC": 51,
+ "ESPIPE": 70,
+ "EROFS": 69,
+ "EMLINK": 34,
+ "EPIPE": 64,
+ "EDOM": 18,
+ "ERANGE": 68,
+ "ENOMSG": 49,
+ "EIDRM": 24,
+ "ECHRNG": 106,
+ "EL2NSYNC": 156,
+ "EL3HLT": 107,
+ "EL3RST": 108,
+ "ELNRNG": 109,
+ "EUNATCH": 110,
+ "ENOCSI": 111,
+ "EL2HLT": 112,
+ "EDEADLK": 16,
+ "ENOLCK": 46,
+ "EBADE": 113,
+ "EBADR": 114,
+ "EXFULL": 115,
+ "ENOANO": 104,
+ "EBADRQC": 103,
+ "EBADSLT": 102,
+ "EDEADLOCK": 16,
+ "EBFONT": 101,
+ "ENOSTR": 100,
+ "ENODATA": 116,
+ "ETIME": 117,
+ "ENOSR": 118,
+ "ENONET": 119,
+ "ENOPKG": 120,
+ "EREMOTE": 121,
+ "ENOLINK": 47,
+ "EADV": 122,
+ "ESRMNT": 123,
+ "ECOMM": 124,
+ "EPROTO": 65,
+ "EMULTIHOP": 36,
+ "EDOTDOT": 125,
+ "EBADMSG": 9,
+ "ENOTUNIQ": 126,
+ "EBADFD": 127,
+ "EREMCHG": 128,
+ "ELIBACC": 129,
+ "ELIBBAD": 130,
+ "ELIBSCN": 131,
+ "ELIBMAX": 132,
+ "ELIBEXEC": 133,
+ "ENOSYS": 52,
+ "ENOTEMPTY": 55,
+ "ENAMETOOLONG": 37,
+ "ELOOP": 32,
+ "EOPNOTSUPP": 138,
+ "EPFNOSUPPORT": 139,
+ "ECONNRESET": 15,
+ "ENOBUFS": 42,
+ "EAFNOSUPPORT": 5,
+ "EPROTOTYPE": 67,
+ "ENOTSOCK": 57,
+ "ENOPROTOOPT": 50,
+ "ESHUTDOWN": 140,
+ "ECONNREFUSED": 14,
+ "EADDRINUSE": 3,
+ "ECONNABORTED": 13,
+ "ENETUNREACH": 40,
+ "ENETDOWN": 38,
+ "ETIMEDOUT": 73,
+ "EHOSTDOWN": 142,
+ "EHOSTUNREACH": 23,
+ "EINPROGRESS": 26,
+ "EALREADY": 7,
+ "EDESTADDRREQ": 17,
+ "EMSGSIZE": 35,
+ "EPROTONOSUPPORT": 66,
+ "ESOCKTNOSUPPORT": 137,
+ "EADDRNOTAVAIL": 4,
+ "ENETRESET": 39,
+ "EISCONN": 30,
+ "ENOTCONN": 53,
+ "ETOOMANYREFS": 141,
+ "EUSERS": 136,
+ "EDQUOT": 19,
+ "ESTALE": 72,
+ "ENOTSUP": 138,
+ "ENOMEDIUM": 148,
+ "EILSEQ": 25,
+ "EOVERFLOW": 61,
+ "ECANCELED": 11,
+ "ENOTRECOVERABLE": 56,
+ "EOWNERDEAD": 62,
+ "ESTRPIPE": 135
+};
+
+var GLctx;
+
+Module["requestFullscreen"] = function Module_requestFullscreen(lockPointer, resizeCanvas) {
+ Browser.requestFullscreen(lockPointer, resizeCanvas);
+};
+
+Module["requestFullScreen"] = function Module_requestFullScreen() {
+ Browser.requestFullScreen();
+};
+
+Module["requestAnimationFrame"] = function Module_requestAnimationFrame(func) {
+ Browser.requestAnimationFrame(func);
+};
+
+Module["setCanvasSize"] = function Module_setCanvasSize(width, height, noUpdates) {
+ Browser.setCanvasSize(width, height, noUpdates);
+};
+
+Module["pauseMainLoop"] = function Module_pauseMainLoop() {
+ Browser.mainLoop.pause();
+};
+
+Module["resumeMainLoop"] = function Module_resumeMainLoop() {
+ Browser.mainLoop.resume();
+};
+
+Module["getUserMedia"] = function Module_getUserMedia() {
+ Browser.getUserMedia();
+};
+
+Module["createContext"] = function Module_createContext(canvas, useWebGL, setInModule, webGLContextAttributes) {
+ return Browser.createContext(canvas, useWebGL, setInModule, webGLContextAttributes);
+};
+
+var preloadedImages = {};
+
+var preloadedAudios = {};
+
+var miniTempWebGLIntBuffersStorage = new Int32Array(288);
+
+for (var i = 0; i < 288; ++i) {
+ miniTempWebGLIntBuffers[i] = miniTempWebGLIntBuffersStorage.subarray(0, i + 1);
+}
+
+var miniTempWebGLFloatBuffersStorage = new Float32Array(288);
+
+for (var i = 0; i < 288; ++i) {
+ miniTempWebGLFloatBuffers[i] = miniTempWebGLFloatBuffersStorage.subarray(0, i + 1);
+}
+
+Module["request_quit"] = function() {
+ GodotOS.request_quit();
+};
+
+Module["onExit"] = GodotOS.cleanup;
+
+GodotOS._fs_sync_promise = Promise.resolve();
+
+Module["initConfig"] = GodotConfig.init_config;
+
+Module["initFS"] = GodotFS.init;
+
+Module["copyToFS"] = GodotFS.copy_to_fs;
+
+GodotOS.atexit(function(resolve, reject) {
+ GodotDisplayCursor.clear();
+ resolve();
+});
+
+GodotOS.atexit(function(resolve, reject) {
+ GodotEventListeners.clear();
+ resolve();
+});
+
+GodotOS.atexit(function(resolve, reject) {
+ GodotDisplayVK.clear();
+ resolve();
+});
+
+GodotJSWrapper.proxies = new Map();
+
+var proxiedFunctionTable = [ null, _proc_exit, exitOnMainThread, pthreadCreateProxied, ___syscall__newselect, ___syscall_accept4, ___syscall_bind, ___syscall_chdir, ___syscall_chmod, ___syscall_connect, ___syscall_faccessat, ___syscall_fchmod, ___syscall_fcntl64, ___syscall_getcwd, ___syscall_getdents64, ___syscall_getsockname, ___syscall_getsockopt, ___syscall_ioctl, ___syscall_listen, ___syscall_lstat64, ___syscall_mkdirat, ___syscall_newfstatat, ___syscall_openat, ___syscall_poll, ___syscall_readlinkat, ___syscall_recvfrom, ___syscall_renameat, ___syscall_rmdir, ___syscall_sendto, ___syscall_socket, ___syscall_stat64, ___syscall_statfs64, ___syscall_symlink, ___syscall_unlinkat, __setitimer_js, _emscripten_force_exit, setCanvasElementSizeMainThread, _emscripten_webgl_destroy_context, _emscripten_webgl_create_context_proxied, _emscripten_webgl_enable_extension, _environ_get, _environ_sizes_get, _fd_close, _fd_fdstat_get, _fd_read, _fd_seek, _fd_write, _getaddrinfo, _godot_audio_has_worklet, _godot_audio_init, _godot_audio_input_start, _godot_audio_input_stop, _godot_audio_is_available, _godot_audio_resume, _godot_audio_worklet_create, _godot_audio_worklet_start, _godot_js_config_canvas_id_get, _godot_js_config_locale_get, _godot_js_display_alert, _godot_js_display_canvas_focus, _godot_js_display_canvas_is_focused, _godot_js_display_clipboard_get, _godot_js_display_clipboard_set, _godot_js_display_cursor_is_hidden, _godot_js_display_cursor_is_locked, _godot_js_display_cursor_lock_set, _godot_js_display_cursor_set_custom_shape, _godot_js_display_cursor_set_shape, _godot_js_display_cursor_set_visible, _godot_js_display_desired_size_set, _godot_js_display_fullscreen_cb, _godot_js_display_fullscreen_exit, _godot_js_display_fullscreen_request, _godot_js_display_has_webgl, _godot_js_display_is_swap_ok_cancel, _godot_js_display_notification_cb, _godot_js_display_pixel_ratio_get, _godot_js_display_screen_dpi_get, _godot_js_display_screen_size_get, _godot_js_display_setup_canvas, _godot_js_display_size_update, _godot_js_display_touchscreen_is_available, _godot_js_display_tts_available, _godot_js_display_vk_available, _godot_js_display_vk_cb, _godot_js_display_vk_hide, _godot_js_display_vk_show, _godot_js_display_window_blur_cb, _godot_js_display_window_icon_set, _godot_js_display_window_size_get, _godot_js_display_window_title_set, _godot_js_fetch_create, _godot_js_fetch_free, _godot_js_fetch_http_status_get, _godot_js_fetch_is_chunked, _godot_js_fetch_read_chunk, _godot_js_fetch_read_headers, _godot_js_fetch_state_get, _godot_js_input_drop_files_cb, _godot_js_input_gamepad_cb, _godot_js_input_gamepad_sample, _godot_js_input_gamepad_sample_count, _godot_js_input_gamepad_sample_get, _godot_js_input_key_cb, _godot_js_input_mouse_button_cb, _godot_js_input_mouse_move_cb, _godot_js_input_mouse_wheel_cb, _godot_js_input_paste_cb, _godot_js_input_touch_cb, _godot_js_input_vibrate_handheld, _godot_js_os_download_buffer, _godot_js_os_execute, _godot_js_os_finish_async, _godot_js_os_fs_is_persistent, _godot_js_os_fs_sync, _godot_js_os_has_feature, _godot_js_os_hw_concurrency_get, _godot_js_os_request_quit_cb, _godot_js_os_shell_open, _godot_js_pwa_cb, _godot_js_pwa_update, _godot_js_rtc_datachannel_close, _godot_js_rtc_datachannel_connect, _godot_js_rtc_datachannel_destroy, _godot_js_rtc_datachannel_get_buffered_amount, _godot_js_rtc_datachannel_id_get, _godot_js_rtc_datachannel_is_negotiated, _godot_js_rtc_datachannel_is_ordered, _godot_js_rtc_datachannel_label_get, _godot_js_rtc_datachannel_max_packet_lifetime_get, _godot_js_rtc_datachannel_max_retransmits_get, _godot_js_rtc_datachannel_ready_state_get, _godot_js_rtc_datachannel_send, _godot_js_rtc_pc_close, _godot_js_rtc_pc_create, _godot_js_rtc_pc_datachannel_create, _godot_js_rtc_pc_destroy, _godot_js_rtc_pc_ice_candidate_add, _godot_js_rtc_pc_local_description_set, _godot_js_rtc_pc_offer_create, _godot_js_rtc_pc_remote_description_set, _godot_js_tts_get_voices, _godot_js_tts_is_paused, _godot_js_tts_is_speaking, _godot_js_tts_pause, _godot_js_tts_resume, _godot_js_tts_speak, _godot_js_tts_stop, _godot_js_websocket_buffered_amount, _godot_js_websocket_close, _godot_js_websocket_create, _godot_js_websocket_destroy, _godot_js_websocket_send, _godot_js_wrapper_create_cb, _godot_js_wrapper_create_object, _godot_js_wrapper_interface_get, _godot_js_wrapper_object_call, _godot_js_wrapper_object_get, _godot_js_wrapper_object_getvar, _godot_js_wrapper_object_set, _godot_js_wrapper_object_set_cb_ret, _godot_js_wrapper_object_setvar, _godot_js_wrapper_object_unref, _godot_webgl2_glFramebufferTextureMultiviewOVR, _godot_webgl2_glGetBufferSubData, _godot_webxr_get_bounds_geometry, _godot_webxr_get_color_texture, _godot_webxr_get_depth_texture, _godot_webxr_get_frame_rate, _godot_webxr_get_projection_for_view, _godot_webxr_get_render_target_size, _godot_webxr_get_supported_frame_rates, _godot_webxr_get_transform_for_view, _godot_webxr_get_velocity_texture, _godot_webxr_get_view_count, _godot_webxr_get_visibility_state, _godot_webxr_initialize, _godot_webxr_is_session_supported, _godot_webxr_is_supported, _godot_webxr_uninitialize, _godot_webxr_update_input_source, _godot_webxr_update_target_frame_rate ];
+
+function checkIncomingModuleAPI() {
+ ignoredModuleProp("fetchSettings");
+}
+
+var wasmImports = {
+ "__assert_fail": ___assert_fail,
+ "__call_sighandler": ___call_sighandler,
+ "__dlsym": ___dlsym,
+ "__emscripten_init_main_thread_js": ___emscripten_init_main_thread_js,
+ "__emscripten_thread_cleanup": ___emscripten_thread_cleanup,
+ "__pthread_create_js": ___pthread_create_js,
+ "__syscall__newselect": ___syscall__newselect,
+ "__syscall_accept4": ___syscall_accept4,
+ "__syscall_bind": ___syscall_bind,
+ "__syscall_chdir": ___syscall_chdir,
+ "__syscall_chmod": ___syscall_chmod,
+ "__syscall_connect": ___syscall_connect,
+ "__syscall_faccessat": ___syscall_faccessat,
+ "__syscall_fchmod": ___syscall_fchmod,
+ "__syscall_fcntl64": ___syscall_fcntl64,
+ "__syscall_getcwd": ___syscall_getcwd,
+ "__syscall_getdents64": ___syscall_getdents64,
+ "__syscall_getsockname": ___syscall_getsockname,
+ "__syscall_getsockopt": ___syscall_getsockopt,
+ "__syscall_ioctl": ___syscall_ioctl,
+ "__syscall_listen": ___syscall_listen,
+ "__syscall_lstat64": ___syscall_lstat64,
+ "__syscall_mkdirat": ___syscall_mkdirat,
+ "__syscall_newfstatat": ___syscall_newfstatat,
+ "__syscall_openat": ___syscall_openat,
+ "__syscall_poll": ___syscall_poll,
+ "__syscall_readlinkat": ___syscall_readlinkat,
+ "__syscall_recvfrom": ___syscall_recvfrom,
+ "__syscall_renameat": ___syscall_renameat,
+ "__syscall_rmdir": ___syscall_rmdir,
+ "__syscall_sendto": ___syscall_sendto,
+ "__syscall_socket": ___syscall_socket,
+ "__syscall_stat64": ___syscall_stat64,
+ "__syscall_statfs64": ___syscall_statfs64,
+ "__syscall_symlink": ___syscall_symlink,
+ "__syscall_unlinkat": ___syscall_unlinkat,
+ "_emscripten_get_now_is_monotonic": __emscripten_get_now_is_monotonic,
+ "_emscripten_notify_mailbox_postmessage": __emscripten_notify_mailbox_postmessage,
+ "_emscripten_proxied_gl_context_activated_from_main_browser_thread": __emscripten_proxied_gl_context_activated_from_main_browser_thread,
+ "_emscripten_set_offscreencanvas_size": __emscripten_set_offscreencanvas_size,
+ "_emscripten_thread_mailbox_await": __emscripten_thread_mailbox_await,
+ "_emscripten_thread_set_strongref": __emscripten_thread_set_strongref,
+ "_emscripten_throw_longjmp": __emscripten_throw_longjmp,
+ "_gmtime_js": __gmtime_js,
+ "_localtime_js": __localtime_js,
+ "_setitimer_js": __setitimer_js,
+ "_tzset_js": __tzset_js,
+ "abort": _abort,
+ "dlopen": _dlopen,
+ "emscripten_cancel_main_loop": _emscripten_cancel_main_loop,
+ "emscripten_check_blocking_allowed": _emscripten_check_blocking_allowed,
+ "emscripten_console_error": _emscripten_console_error,
+ "emscripten_date_now": _emscripten_date_now,
+ "emscripten_exit_with_live_runtime": _emscripten_exit_with_live_runtime,
+ "emscripten_force_exit": _emscripten_force_exit,
+ "emscripten_get_now": _emscripten_get_now,
+ "emscripten_glActiveTexture": _emscripten_glActiveTexture,
+ "emscripten_glAttachShader": _emscripten_glAttachShader,
+ "emscripten_glBeginTransformFeedback": _emscripten_glBeginTransformFeedback,
+ "emscripten_glBindBuffer": _emscripten_glBindBuffer,
+ "emscripten_glBindBufferBase": _emscripten_glBindBufferBase,
+ "emscripten_glBindBufferRange": _emscripten_glBindBufferRange,
+ "emscripten_glBindFramebuffer": _emscripten_glBindFramebuffer,
+ "emscripten_glBindRenderbuffer": _emscripten_glBindRenderbuffer,
+ "emscripten_glBindTexture": _emscripten_glBindTexture,
+ "emscripten_glBindVertexArray": _emscripten_glBindVertexArray,
+ "emscripten_glBlendColor": _emscripten_glBlendColor,
+ "emscripten_glBlendEquation": _emscripten_glBlendEquation,
+ "emscripten_glBlendFunc": _emscripten_glBlendFunc,
+ "emscripten_glBlendFuncSeparate": _emscripten_glBlendFuncSeparate,
+ "emscripten_glBlitFramebuffer": _emscripten_glBlitFramebuffer,
+ "emscripten_glBufferData": _emscripten_glBufferData,
+ "emscripten_glBufferSubData": _emscripten_glBufferSubData,
+ "emscripten_glCheckFramebufferStatus": _emscripten_glCheckFramebufferStatus,
+ "emscripten_glClear": _emscripten_glClear,
+ "emscripten_glClearBufferfv": _emscripten_glClearBufferfv,
+ "emscripten_glClearColor": _emscripten_glClearColor,
+ "emscripten_glClearDepthf": _emscripten_glClearDepthf,
+ "emscripten_glColorMask": _emscripten_glColorMask,
+ "emscripten_glCompileShader": _emscripten_glCompileShader,
+ "emscripten_glCompressedTexImage2D": _emscripten_glCompressedTexImage2D,
+ "emscripten_glCopyBufferSubData": _emscripten_glCopyBufferSubData,
+ "emscripten_glCreateProgram": _emscripten_glCreateProgram,
+ "emscripten_glCreateShader": _emscripten_glCreateShader,
+ "emscripten_glCullFace": _emscripten_glCullFace,
+ "emscripten_glDeleteBuffers": _emscripten_glDeleteBuffers,
+ "emscripten_glDeleteFramebuffers": _emscripten_glDeleteFramebuffers,
+ "emscripten_glDeleteProgram": _emscripten_glDeleteProgram,
+ "emscripten_glDeleteQueries": _emscripten_glDeleteQueries,
+ "emscripten_glDeleteRenderbuffers": _emscripten_glDeleteRenderbuffers,
+ "emscripten_glDeleteShader": _emscripten_glDeleteShader,
+ "emscripten_glDeleteSync": _emscripten_glDeleteSync,
+ "emscripten_glDeleteTextures": _emscripten_glDeleteTextures,
+ "emscripten_glDeleteVertexArrays": _emscripten_glDeleteVertexArrays,
+ "emscripten_glDepthFunc": _emscripten_glDepthFunc,
+ "emscripten_glDepthMask": _emscripten_glDepthMask,
+ "emscripten_glDisable": _emscripten_glDisable,
+ "emscripten_glDisableVertexAttribArray": _emscripten_glDisableVertexAttribArray,
+ "emscripten_glDrawArrays": _emscripten_glDrawArrays,
+ "emscripten_glDrawArraysInstanced": _emscripten_glDrawArraysInstanced,
+ "emscripten_glDrawElements": _emscripten_glDrawElements,
+ "emscripten_glDrawElementsInstanced": _emscripten_glDrawElementsInstanced,
+ "emscripten_glEnable": _emscripten_glEnable,
+ "emscripten_glEnableVertexAttribArray": _emscripten_glEnableVertexAttribArray,
+ "emscripten_glEndTransformFeedback": _emscripten_glEndTransformFeedback,
+ "emscripten_glFenceSync": _emscripten_glFenceSync,
+ "emscripten_glFinish": _emscripten_glFinish,
+ "emscripten_glFramebufferRenderbuffer": _emscripten_glFramebufferRenderbuffer,
+ "emscripten_glFramebufferTexture2D": _emscripten_glFramebufferTexture2D,
+ "emscripten_glFramebufferTextureLayer": _emscripten_glFramebufferTextureLayer,
+ "emscripten_glFrontFace": _emscripten_glFrontFace,
+ "emscripten_glGenBuffers": _emscripten_glGenBuffers,
+ "emscripten_glGenFramebuffers": _emscripten_glGenFramebuffers,
+ "emscripten_glGenQueries": _emscripten_glGenQueries,
+ "emscripten_glGenRenderbuffers": _emscripten_glGenRenderbuffers,
+ "emscripten_glGenTextures": _emscripten_glGenTextures,
+ "emscripten_glGenVertexArrays": _emscripten_glGenVertexArrays,
+ "emscripten_glGenerateMipmap": _emscripten_glGenerateMipmap,
+ "emscripten_glGetFloatv": _emscripten_glGetFloatv,
+ "emscripten_glGetInteger64v": _emscripten_glGetInteger64v,
+ "emscripten_glGetProgramInfoLog": _emscripten_glGetProgramInfoLog,
+ "emscripten_glGetProgramiv": _emscripten_glGetProgramiv,
+ "emscripten_glGetShaderInfoLog": _emscripten_glGetShaderInfoLog,
+ "emscripten_glGetShaderiv": _emscripten_glGetShaderiv,
+ "emscripten_glGetString": _emscripten_glGetString,
+ "emscripten_glGetStringi": _emscripten_glGetStringi,
+ "emscripten_glGetSynciv": _emscripten_glGetSynciv,
+ "emscripten_glGetUniformBlockIndex": _emscripten_glGetUniformBlockIndex,
+ "emscripten_glGetUniformLocation": _emscripten_glGetUniformLocation,
+ "emscripten_glLinkProgram": _emscripten_glLinkProgram,
+ "emscripten_glPixelStorei": _emscripten_glPixelStorei,
+ "emscripten_glReadBuffer": _emscripten_glReadBuffer,
+ "emscripten_glReadPixels": _emscripten_glReadPixels,
+ "emscripten_glRenderbufferStorage": _emscripten_glRenderbufferStorage,
+ "emscripten_glScissor": _emscripten_glScissor,
+ "emscripten_glShaderSource": _emscripten_glShaderSource,
+ "emscripten_glTexImage2D": _emscripten_glTexImage2D,
+ "emscripten_glTexImage3D": _emscripten_glTexImage3D,
+ "emscripten_glTexParameterf": _emscripten_glTexParameterf,
+ "emscripten_glTexParameteri": _emscripten_glTexParameteri,
+ "emscripten_glTexStorage2D": _emscripten_glTexStorage2D,
+ "emscripten_glTexSubImage3D": _emscripten_glTexSubImage3D,
+ "emscripten_glTransformFeedbackVaryings": _emscripten_glTransformFeedbackVaryings,
+ "emscripten_glUniform1f": _emscripten_glUniform1f,
+ "emscripten_glUniform1i": _emscripten_glUniform1i,
+ "emscripten_glUniform1iv": _emscripten_glUniform1iv,
+ "emscripten_glUniform1ui": _emscripten_glUniform1ui,
+ "emscripten_glUniform1uiv": _emscripten_glUniform1uiv,
+ "emscripten_glUniform2f": _emscripten_glUniform2f,
+ "emscripten_glUniform2fv": _emscripten_glUniform2fv,
+ "emscripten_glUniform2iv": _emscripten_glUniform2iv,
+ "emscripten_glUniform3fv": _emscripten_glUniform3fv,
+ "emscripten_glUniform4f": _emscripten_glUniform4f,
+ "emscripten_glUniform4fv": _emscripten_glUniform4fv,
+ "emscripten_glUniformBlockBinding": _emscripten_glUniformBlockBinding,
+ "emscripten_glUniformMatrix4fv": _emscripten_glUniformMatrix4fv,
+ "emscripten_glUseProgram": _emscripten_glUseProgram,
+ "emscripten_glVertexAttrib4f": _emscripten_glVertexAttrib4f,
+ "emscripten_glVertexAttribDivisor": _emscripten_glVertexAttribDivisor,
+ "emscripten_glVertexAttribI4ui": _emscripten_glVertexAttribI4ui,
+ "emscripten_glVertexAttribIPointer": _emscripten_glVertexAttribIPointer,
+ "emscripten_glVertexAttribPointer": _emscripten_glVertexAttribPointer,
+ "emscripten_glViewport": _emscripten_glViewport,
+ "emscripten_num_logical_cores": _emscripten_num_logical_cores,
+ "emscripten_receive_on_main_thread_js": _emscripten_receive_on_main_thread_js,
+ "emscripten_resize_heap": _emscripten_resize_heap,
+ "emscripten_set_canvas_element_size": _emscripten_set_canvas_element_size,
+ "emscripten_set_main_loop": _emscripten_set_main_loop,
+ "emscripten_supports_offscreencanvas": _emscripten_supports_offscreencanvas,
+ "emscripten_webgl_destroy_context": _emscripten_webgl_destroy_context,
+ "emscripten_webgl_do_commit_frame": _emscripten_webgl_do_commit_frame,
+ "emscripten_webgl_do_create_context": _emscripten_webgl_do_create_context,
+ "emscripten_webgl_enable_extension": _emscripten_webgl_enable_extension,
+ "emscripten_webgl_init_context_attributes": _emscripten_webgl_init_context_attributes,
+ "emscripten_webgl_make_context_current_calling_thread": _emscripten_webgl_make_context_current_calling_thread,
+ "environ_get": _environ_get,
+ "environ_sizes_get": _environ_sizes_get,
+ "exit": _exit,
+ "fd_close": _fd_close,
+ "fd_fdstat_get": _fd_fdstat_get,
+ "fd_read": _fd_read,
+ "fd_seek": _fd_seek,
+ "fd_write": _fd_write,
+ "getaddrinfo": _getaddrinfo,
+ "getnameinfo": _getnameinfo,
+ "godot_audio_has_worklet": _godot_audio_has_worklet,
+ "godot_audio_init": _godot_audio_init,
+ "godot_audio_input_start": _godot_audio_input_start,
+ "godot_audio_input_stop": _godot_audio_input_stop,
+ "godot_audio_is_available": _godot_audio_is_available,
+ "godot_audio_resume": _godot_audio_resume,
+ "godot_audio_worklet_create": _godot_audio_worklet_create,
+ "godot_audio_worklet_start": _godot_audio_worklet_start,
+ "godot_audio_worklet_state_add": _godot_audio_worklet_state_add,
+ "godot_audio_worklet_state_get": _godot_audio_worklet_state_get,
+ "godot_audio_worklet_state_wait": _godot_audio_worklet_state_wait,
+ "godot_js_config_canvas_id_get": _godot_js_config_canvas_id_get,
+ "godot_js_config_locale_get": _godot_js_config_locale_get,
+ "godot_js_display_alert": _godot_js_display_alert,
+ "godot_js_display_canvas_focus": _godot_js_display_canvas_focus,
+ "godot_js_display_canvas_is_focused": _godot_js_display_canvas_is_focused,
+ "godot_js_display_clipboard_get": _godot_js_display_clipboard_get,
+ "godot_js_display_clipboard_set": _godot_js_display_clipboard_set,
+ "godot_js_display_cursor_is_hidden": _godot_js_display_cursor_is_hidden,
+ "godot_js_display_cursor_is_locked": _godot_js_display_cursor_is_locked,
+ "godot_js_display_cursor_lock_set": _godot_js_display_cursor_lock_set,
+ "godot_js_display_cursor_set_custom_shape": _godot_js_display_cursor_set_custom_shape,
+ "godot_js_display_cursor_set_shape": _godot_js_display_cursor_set_shape,
+ "godot_js_display_cursor_set_visible": _godot_js_display_cursor_set_visible,
+ "godot_js_display_desired_size_set": _godot_js_display_desired_size_set,
+ "godot_js_display_fullscreen_cb": _godot_js_display_fullscreen_cb,
+ "godot_js_display_fullscreen_exit": _godot_js_display_fullscreen_exit,
+ "godot_js_display_fullscreen_request": _godot_js_display_fullscreen_request,
+ "godot_js_display_has_webgl": _godot_js_display_has_webgl,
+ "godot_js_display_is_swap_ok_cancel": _godot_js_display_is_swap_ok_cancel,
+ "godot_js_display_notification_cb": _godot_js_display_notification_cb,
+ "godot_js_display_pixel_ratio_get": _godot_js_display_pixel_ratio_get,
+ "godot_js_display_screen_dpi_get": _godot_js_display_screen_dpi_get,
+ "godot_js_display_screen_size_get": _godot_js_display_screen_size_get,
+ "godot_js_display_setup_canvas": _godot_js_display_setup_canvas,
+ "godot_js_display_size_update": _godot_js_display_size_update,
+ "godot_js_display_touchscreen_is_available": _godot_js_display_touchscreen_is_available,
+ "godot_js_display_tts_available": _godot_js_display_tts_available,
+ "godot_js_display_vk_available": _godot_js_display_vk_available,
+ "godot_js_display_vk_cb": _godot_js_display_vk_cb,
+ "godot_js_display_vk_hide": _godot_js_display_vk_hide,
+ "godot_js_display_vk_show": _godot_js_display_vk_show,
+ "godot_js_display_window_blur_cb": _godot_js_display_window_blur_cb,
+ "godot_js_display_window_icon_set": _godot_js_display_window_icon_set,
+ "godot_js_display_window_size_get": _godot_js_display_window_size_get,
+ "godot_js_display_window_title_set": _godot_js_display_window_title_set,
+ "godot_js_eval": _godot_js_eval,
+ "godot_js_fetch_create": _godot_js_fetch_create,
+ "godot_js_fetch_free": _godot_js_fetch_free,
+ "godot_js_fetch_http_status_get": _godot_js_fetch_http_status_get,
+ "godot_js_fetch_is_chunked": _godot_js_fetch_is_chunked,
+ "godot_js_fetch_read_chunk": _godot_js_fetch_read_chunk,
+ "godot_js_fetch_read_headers": _godot_js_fetch_read_headers,
+ "godot_js_fetch_state_get": _godot_js_fetch_state_get,
+ "godot_js_input_drop_files_cb": _godot_js_input_drop_files_cb,
+ "godot_js_input_gamepad_cb": _godot_js_input_gamepad_cb,
+ "godot_js_input_gamepad_sample": _godot_js_input_gamepad_sample,
+ "godot_js_input_gamepad_sample_count": _godot_js_input_gamepad_sample_count,
+ "godot_js_input_gamepad_sample_get": _godot_js_input_gamepad_sample_get,
+ "godot_js_input_key_cb": _godot_js_input_key_cb,
+ "godot_js_input_mouse_button_cb": _godot_js_input_mouse_button_cb,
+ "godot_js_input_mouse_move_cb": _godot_js_input_mouse_move_cb,
+ "godot_js_input_mouse_wheel_cb": _godot_js_input_mouse_wheel_cb,
+ "godot_js_input_paste_cb": _godot_js_input_paste_cb,
+ "godot_js_input_touch_cb": _godot_js_input_touch_cb,
+ "godot_js_input_vibrate_handheld": _godot_js_input_vibrate_handheld,
+ "godot_js_os_download_buffer": _godot_js_os_download_buffer,
+ "godot_js_os_execute": _godot_js_os_execute,
+ "godot_js_os_finish_async": _godot_js_os_finish_async,
+ "godot_js_os_fs_is_persistent": _godot_js_os_fs_is_persistent,
+ "godot_js_os_fs_sync": _godot_js_os_fs_sync,
+ "godot_js_os_has_feature": _godot_js_os_has_feature,
+ "godot_js_os_hw_concurrency_get": _godot_js_os_hw_concurrency_get,
+ "godot_js_os_request_quit_cb": _godot_js_os_request_quit_cb,
+ "godot_js_os_shell_open": _godot_js_os_shell_open,
+ "godot_js_pwa_cb": _godot_js_pwa_cb,
+ "godot_js_pwa_update": _godot_js_pwa_update,
+ "godot_js_rtc_datachannel_close": _godot_js_rtc_datachannel_close,
+ "godot_js_rtc_datachannel_connect": _godot_js_rtc_datachannel_connect,
+ "godot_js_rtc_datachannel_destroy": _godot_js_rtc_datachannel_destroy,
+ "godot_js_rtc_datachannel_get_buffered_amount": _godot_js_rtc_datachannel_get_buffered_amount,
+ "godot_js_rtc_datachannel_id_get": _godot_js_rtc_datachannel_id_get,
+ "godot_js_rtc_datachannel_is_negotiated": _godot_js_rtc_datachannel_is_negotiated,
+ "godot_js_rtc_datachannel_is_ordered": _godot_js_rtc_datachannel_is_ordered,
+ "godot_js_rtc_datachannel_label_get": _godot_js_rtc_datachannel_label_get,
+ "godot_js_rtc_datachannel_max_packet_lifetime_get": _godot_js_rtc_datachannel_max_packet_lifetime_get,
+ "godot_js_rtc_datachannel_max_retransmits_get": _godot_js_rtc_datachannel_max_retransmits_get,
+ "godot_js_rtc_datachannel_protocol_get": _godot_js_rtc_datachannel_protocol_get,
+ "godot_js_rtc_datachannel_ready_state_get": _godot_js_rtc_datachannel_ready_state_get,
+ "godot_js_rtc_datachannel_send": _godot_js_rtc_datachannel_send,
+ "godot_js_rtc_pc_close": _godot_js_rtc_pc_close,
+ "godot_js_rtc_pc_create": _godot_js_rtc_pc_create,
+ "godot_js_rtc_pc_datachannel_create": _godot_js_rtc_pc_datachannel_create,
+ "godot_js_rtc_pc_destroy": _godot_js_rtc_pc_destroy,
+ "godot_js_rtc_pc_ice_candidate_add": _godot_js_rtc_pc_ice_candidate_add,
+ "godot_js_rtc_pc_local_description_set": _godot_js_rtc_pc_local_description_set,
+ "godot_js_rtc_pc_offer_create": _godot_js_rtc_pc_offer_create,
+ "godot_js_rtc_pc_remote_description_set": _godot_js_rtc_pc_remote_description_set,
+ "godot_js_tts_get_voices": _godot_js_tts_get_voices,
+ "godot_js_tts_is_paused": _godot_js_tts_is_paused,
+ "godot_js_tts_is_speaking": _godot_js_tts_is_speaking,
+ "godot_js_tts_pause": _godot_js_tts_pause,
+ "godot_js_tts_resume": _godot_js_tts_resume,
+ "godot_js_tts_speak": _godot_js_tts_speak,
+ "godot_js_tts_stop": _godot_js_tts_stop,
+ "godot_js_websocket_buffered_amount": _godot_js_websocket_buffered_amount,
+ "godot_js_websocket_close": _godot_js_websocket_close,
+ "godot_js_websocket_create": _godot_js_websocket_create,
+ "godot_js_websocket_destroy": _godot_js_websocket_destroy,
+ "godot_js_websocket_send": _godot_js_websocket_send,
+ "godot_js_wrapper_create_cb": _godot_js_wrapper_create_cb,
+ "godot_js_wrapper_create_object": _godot_js_wrapper_create_object,
+ "godot_js_wrapper_interface_get": _godot_js_wrapper_interface_get,
+ "godot_js_wrapper_object_call": _godot_js_wrapper_object_call,
+ "godot_js_wrapper_object_get": _godot_js_wrapper_object_get,
+ "godot_js_wrapper_object_getvar": _godot_js_wrapper_object_getvar,
+ "godot_js_wrapper_object_set": _godot_js_wrapper_object_set,
+ "godot_js_wrapper_object_set_cb_ret": _godot_js_wrapper_object_set_cb_ret,
+ "godot_js_wrapper_object_setvar": _godot_js_wrapper_object_setvar,
+ "godot_js_wrapper_object_unref": _godot_js_wrapper_object_unref,
+ "godot_webgl2_glFramebufferTextureMultiviewOVR": _godot_webgl2_glFramebufferTextureMultiviewOVR,
+ "godot_webgl2_glGetBufferSubData": _godot_webgl2_glGetBufferSubData,
+ "godot_webxr_get_bounds_geometry": _godot_webxr_get_bounds_geometry,
+ "godot_webxr_get_color_texture": _godot_webxr_get_color_texture,
+ "godot_webxr_get_depth_texture": _godot_webxr_get_depth_texture,
+ "godot_webxr_get_frame_rate": _godot_webxr_get_frame_rate,
+ "godot_webxr_get_projection_for_view": _godot_webxr_get_projection_for_view,
+ "godot_webxr_get_render_target_size": _godot_webxr_get_render_target_size,
+ "godot_webxr_get_supported_frame_rates": _godot_webxr_get_supported_frame_rates,
+ "godot_webxr_get_transform_for_view": _godot_webxr_get_transform_for_view,
+ "godot_webxr_get_velocity_texture": _godot_webxr_get_velocity_texture,
+ "godot_webxr_get_view_count": _godot_webxr_get_view_count,
+ "godot_webxr_get_visibility_state": _godot_webxr_get_visibility_state,
+ "godot_webxr_initialize": _godot_webxr_initialize,
+ "godot_webxr_is_session_supported": _godot_webxr_is_session_supported,
+ "godot_webxr_is_supported": _godot_webxr_is_supported,
+ "godot_webxr_uninitialize": _godot_webxr_uninitialize,
+ "godot_webxr_update_input_source": _godot_webxr_update_input_source,
+ "godot_webxr_update_target_frame_rate": _godot_webxr_update_target_frame_rate,
+ "invoke_ii": invoke_ii,
+ "invoke_iii": invoke_iii,
+ "invoke_iiii": invoke_iiii,
+ "invoke_iiiii": invoke_iiiii,
+ "invoke_iiiiii": invoke_iiiiii,
+ "invoke_vi": invoke_vi,
+ "invoke_vii": invoke_vii,
+ "invoke_viii": invoke_viii,
+ "invoke_viiii": invoke_viiii,
+ "invoke_viiiiiii": invoke_viiiiiii,
+ "invoke_viiiiiiii": invoke_viiiiiiii,
+ "invoke_viiij": invoke_viiij,
+ "memory": wasmMemory || Module["wasmMemory"],
+ "strftime": _strftime,
+ "strftime_l": _strftime_l
+};
+
+var asm = createWasm();
+
+var ___wasm_call_ctors = createExportWrapper("__wasm_call_ctors");
+
+var _emscripten_webgl_commit_frame = createExportWrapper("emscripten_webgl_commit_frame");
+
+var _free = createExportWrapper("free");
+
+var __Z14godot_web_mainiPPc = Module["__Z14godot_web_mainiPPc"] = createExportWrapper("_Z14godot_web_mainiPPc");
+
+var _main = Module["_main"] = createExportWrapper("__main_argc_argv");
+
+var _malloc = createExportWrapper("malloc");
+
+var ___errno_location = createExportWrapper("__errno_location");
+
+var _fflush = Module["_fflush"] = createExportWrapper("fflush");
+
+var _htonl = createExportWrapper("htonl");
+
+var _htons = createExportWrapper("htons");
+
+var _ntohs = createExportWrapper("ntohs");
+
+var __emwebxr_on_input_event = Module["__emwebxr_on_input_event"] = createExportWrapper("_emwebxr_on_input_event");
+
+var __emwebxr_on_simple_event = Module["__emwebxr_on_simple_event"] = createExportWrapper("_emwebxr_on_simple_event");
+
+var __emscripten_tls_init = Module["__emscripten_tls_init"] = createExportWrapper("_emscripten_tls_init");
+
+var _pthread_self = Module["_pthread_self"] = function() {
+ return (_pthread_self = Module["_pthread_self"] = Module["asm"]["pthread_self"]).apply(null, arguments);
+};
+
+var _emscripten_webgl_get_current_context = createExportWrapper("emscripten_webgl_get_current_context");
+
+var _emscripten_dispatch_to_thread_ = createExportWrapper("emscripten_dispatch_to_thread_");
+
+var ___funcs_on_exit = createExportWrapper("__funcs_on_exit");
+
+var __emscripten_thread_init = Module["__emscripten_thread_init"] = createExportWrapper("_emscripten_thread_init");
+
+var __emscripten_thread_crashed = Module["__emscripten_thread_crashed"] = createExportWrapper("_emscripten_thread_crashed");
+
+var _emscripten_main_thread_process_queued_calls = createExportWrapper("emscripten_main_thread_process_queued_calls");
+
+var _emscripten_main_runtime_thread_id = createExportWrapper("emscripten_main_runtime_thread_id");
+
+var __emscripten_run_in_main_runtime_thread_js = createExportWrapper("_emscripten_run_in_main_runtime_thread_js");
+
+var _emscripten_stack_get_base = function() {
+ return (_emscripten_stack_get_base = Module["asm"]["emscripten_stack_get_base"]).apply(null, arguments);
+};
+
+var _emscripten_stack_get_end = function() {
+ return (_emscripten_stack_get_end = Module["asm"]["emscripten_stack_get_end"]).apply(null, arguments);
+};
+
+var __emscripten_thread_free_data = createExportWrapper("_emscripten_thread_free_data");
+
+var __emscripten_thread_exit = Module["__emscripten_thread_exit"] = createExportWrapper("_emscripten_thread_exit");
+
+var __emscripten_timeout = createExportWrapper("_emscripten_timeout");
+
+var __emscripten_check_mailbox = Module["__emscripten_check_mailbox"] = createExportWrapper("_emscripten_check_mailbox");
+
+var _setThrew = createExportWrapper("setThrew");
+
+var _emscripten_stack_init = function() {
+ return (_emscripten_stack_init = Module["asm"]["emscripten_stack_init"]).apply(null, arguments);
+};
+
+var _emscripten_stack_set_limits = function() {
+ return (_emscripten_stack_set_limits = Module["asm"]["emscripten_stack_set_limits"]).apply(null, arguments);
+};
+
+var _emscripten_stack_get_free = function() {
+ return (_emscripten_stack_get_free = Module["asm"]["emscripten_stack_get_free"]).apply(null, arguments);
+};
+
+var stackSave = createExportWrapper("stackSave");
+
+var stackRestore = createExportWrapper("stackRestore");
+
+var stackAlloc = createExportWrapper("stackAlloc");
+
+var _emscripten_stack_get_current = function() {
+ return (_emscripten_stack_get_current = Module["asm"]["emscripten_stack_get_current"]).apply(null, arguments);
+};
+
+var ___cxa_increment_exception_refcount = createExportWrapper("__cxa_increment_exception_refcount");
+
+var ___cxa_is_pointer_type = createExportWrapper("__cxa_is_pointer_type");
+
+var dynCall_vjiii = Module["dynCall_vjiii"] = createExportWrapper("dynCall_vjiii");
+
+var dynCall_viiiiji = Module["dynCall_viiiiji"] = createExportWrapper("dynCall_viiiiji");
+
+var dynCall_viiiiij = Module["dynCall_viiiiij"] = createExportWrapper("dynCall_viiiiij");
+
+var dynCall_viiiij = Module["dynCall_viiiij"] = createExportWrapper("dynCall_viiiij");
+
+var dynCall_ji = Module["dynCall_ji"] = createExportWrapper("dynCall_ji");
+
+var dynCall_viiijii = Module["dynCall_viiijii"] = createExportWrapper("dynCall_viiijii");
+
+var dynCall_vijiii = Module["dynCall_vijiii"] = createExportWrapper("dynCall_vijiii");
+
+var dynCall_jij = Module["dynCall_jij"] = createExportWrapper("dynCall_jij");
+
+var dynCall_iiij = Module["dynCall_iiij"] = createExportWrapper("dynCall_iiij");
+
+var dynCall_iij = Module["dynCall_iij"] = createExportWrapper("dynCall_iij");
+
+var dynCall_viij = Module["dynCall_viij"] = createExportWrapper("dynCall_viij");
+
+var dynCall_jiij = Module["dynCall_jiij"] = createExportWrapper("dynCall_jiij");
+
+var dynCall_jiii = Module["dynCall_jiii"] = createExportWrapper("dynCall_jiii");
+
+var dynCall_jiiiiiii = Module["dynCall_jiiiiiii"] = createExportWrapper("dynCall_jiiiiiii");
+
+var dynCall_jiiiii = Module["dynCall_jiiiii"] = createExportWrapper("dynCall_jiiiii");
+
+var dynCall_ij = Module["dynCall_ij"] = createExportWrapper("dynCall_ij");
+
+var dynCall_jiiiiiiiiii = Module["dynCall_jiiiiiiiiii"] = createExportWrapper("dynCall_jiiiiiiiiii");
+
+var dynCall_jiiiiii = Module["dynCall_jiiiiii"] = createExportWrapper("dynCall_jiiiiii");
+
+var dynCall_jiiiiiiii = Module["dynCall_jiiiiiiii"] = createExportWrapper("dynCall_jiiiiiiii");
+
+var dynCall_jii = Module["dynCall_jii"] = createExportWrapper("dynCall_jii");
+
+var dynCall_vij = Module["dynCall_vij"] = createExportWrapper("dynCall_vij");
+
+var dynCall_viiij = Module["dynCall_viiij"] = createExportWrapper("dynCall_viiij");
+
+var dynCall_viiiiiiij = Module["dynCall_viiiiiiij"] = createExportWrapper("dynCall_viiiiiiij");
+
+var dynCall_jiji = Module["dynCall_jiji"] = createExportWrapper("dynCall_jiji");
+
+var dynCall_jiiifi = Module["dynCall_jiiifi"] = createExportWrapper("dynCall_jiiifi");
+
+var dynCall_jiifff = Module["dynCall_jiifff"] = createExportWrapper("dynCall_jiifff");
+
+var dynCall_vijf = Module["dynCall_vijf"] = createExportWrapper("dynCall_vijf");
+
+var dynCall_viiiiifiijii = Module["dynCall_viiiiifiijii"] = createExportWrapper("dynCall_viiiiifiijii");
+
+var dynCall_viiiiifiiijjii = Module["dynCall_viiiiifiiijjii"] = createExportWrapper("dynCall_viiiiifiiijjii");
+
+var dynCall_viiiiifiiijii = Module["dynCall_viiiiifiiijii"] = createExportWrapper("dynCall_viiiiifiiijii");
+
+var dynCall_viiiiifiiiijjii = Module["dynCall_viiiiifiiiijjii"] = createExportWrapper("dynCall_viiiiifiiiijjii");
+
+var dynCall_vijiiii = Module["dynCall_vijiiii"] = createExportWrapper("dynCall_vijiiii");
+
+var dynCall_vijii = Module["dynCall_vijii"] = createExportWrapper("dynCall_vijii");
+
+var dynCall_viijiiiiiiiii = Module["dynCall_viijiiiiiiiii"] = createExportWrapper("dynCall_viijiiiiiiiii");
+
+var dynCall_viiiiiji = Module["dynCall_viiiiiji"] = createExportWrapper("dynCall_viiiiiji");
+
+var dynCall_vijj = Module["dynCall_vijj"] = createExportWrapper("dynCall_vijj");
+
+var dynCall_vijiiiiiidddd = Module["dynCall_vijiiiiiidddd"] = createExportWrapper("dynCall_vijiiiiiidddd");
+
+var dynCall_jiiii = Module["dynCall_jiiii"] = createExportWrapper("dynCall_jiiii");
+
+var dynCall_jiijiiii = Module["dynCall_jiijiiii"] = createExportWrapper("dynCall_jiijiiii");
+
+var dynCall_jiiji = Module["dynCall_jiiji"] = createExportWrapper("dynCall_jiiji");
+
+var dynCall_jiiiji = Module["dynCall_jiiiji"] = createExportWrapper("dynCall_jiiiji");
+
+var dynCall_jiijii = Module["dynCall_jiijii"] = createExportWrapper("dynCall_jiijii");
+
+var dynCall_iijiiij = Module["dynCall_iijiiij"] = createExportWrapper("dynCall_iijiiij");
+
+var dynCall_jijjjiiiiijii = Module["dynCall_jijjjiiiiijii"] = createExportWrapper("dynCall_jijjjiiiiijii");
+
+var dynCall_jijiiiiifiii = Module["dynCall_jijiiiiifiii"] = createExportWrapper("dynCall_jijiiiiifiii");
+
+var dynCall_viijiiiiiifiii = Module["dynCall_viijiiiiiifiii"] = createExportWrapper("dynCall_viijiiiiiifiii");
+
+var dynCall_viji = Module["dynCall_viji"] = createExportWrapper("dynCall_viji");
+
+var dynCall_viiji = Module["dynCall_viiji"] = createExportWrapper("dynCall_viiji");
+
+var dynCall_vijji = Module["dynCall_vijji"] = createExportWrapper("dynCall_vijji");
+
+var dynCall_vijjii = Module["dynCall_vijjii"] = createExportWrapper("dynCall_vijjii");
+
+var dynCall_fij = Module["dynCall_fij"] = createExportWrapper("dynCall_fij");
+
+var dynCall_vijiffifff = Module["dynCall_vijiffifff"] = createExportWrapper("dynCall_vijiffifff");
+
+var dynCall_vijff = Module["dynCall_vijff"] = createExportWrapper("dynCall_vijff");
+
+var dynCall_vijiffff = Module["dynCall_vijiffff"] = createExportWrapper("dynCall_vijiffff");
+
+var dynCall_vijjf = Module["dynCall_vijjf"] = createExportWrapper("dynCall_vijjf");
+
+var dynCall_vijij = Module["dynCall_vijij"] = createExportWrapper("dynCall_vijij");
+
+var dynCall_vijif = Module["dynCall_vijif"] = createExportWrapper("dynCall_vijif");
+
+var dynCall_vijiiifi = Module["dynCall_vijiiifi"] = createExportWrapper("dynCall_vijiiifi");
+
+var dynCall_vijiifi = Module["dynCall_vijiifi"] = createExportWrapper("dynCall_vijiifi");
+
+var dynCall_vijiif = Module["dynCall_vijiif"] = createExportWrapper("dynCall_vijiif");
+
+var dynCall_vijifi = Module["dynCall_vijifi"] = createExportWrapper("dynCall_vijifi");
+
+var dynCall_vijijiii = Module["dynCall_vijijiii"] = createExportWrapper("dynCall_vijijiii");
+
+var dynCall_vijijiiii = Module["dynCall_vijijiiii"] = createExportWrapper("dynCall_vijijiiii");
+
+var dynCall_vijijiiiff = Module["dynCall_vijijiiiff"] = createExportWrapper("dynCall_vijijiiiff");
+
+var dynCall_vijijii = Module["dynCall_vijijii"] = createExportWrapper("dynCall_vijijii");
+
+var dynCall_vijiijiiiiii = Module["dynCall_vijiijiiiiii"] = createExportWrapper("dynCall_vijiijiiiiii");
+
+var dynCall_vijiiij = Module["dynCall_vijiiij"] = createExportWrapper("dynCall_vijiiij");
+
+var dynCall_vijiiiiiiji = Module["dynCall_vijiiiiiiji"] = createExportWrapper("dynCall_vijiiiiiiji");
+
+var dynCall_vijjj = Module["dynCall_vijjj"] = createExportWrapper("dynCall_vijjj");
+
+var dynCall_vijdddd = Module["dynCall_vijdddd"] = createExportWrapper("dynCall_vijdddd");
+
+var dynCall_vijififi = Module["dynCall_vijififi"] = createExportWrapper("dynCall_vijififi");
+
+var dynCall_iijji = Module["dynCall_iijji"] = createExportWrapper("dynCall_iijji");
+
+var dynCall_viijj = Module["dynCall_viijj"] = createExportWrapper("dynCall_viijj");
+
+var dynCall_iiiij = Module["dynCall_iiiij"] = createExportWrapper("dynCall_iiiij");
+
+var dynCall_dij = Module["dynCall_dij"] = createExportWrapper("dynCall_dij");
+
+var dynCall_vijd = Module["dynCall_vijd"] = createExportWrapper("dynCall_vijd");
+
+var dynCall_viijiiii = Module["dynCall_viijiiii"] = createExportWrapper("dynCall_viijiiii");
+
+var dynCall_viijiii = Module["dynCall_viijiii"] = createExportWrapper("dynCall_viijiii");
+
+var dynCall_iiji = Module["dynCall_iiji"] = createExportWrapper("dynCall_iiji");
+
+var dynCall_iiiijf = Module["dynCall_iiiijf"] = createExportWrapper("dynCall_iiiijf");
+
+var dynCall_vijiiiii = Module["dynCall_vijiiiii"] = createExportWrapper("dynCall_vijiiiii");
+
+var dynCall_viijd = Module["dynCall_viijd"] = createExportWrapper("dynCall_viijd");
+
+var dynCall_diij = Module["dynCall_diij"] = createExportWrapper("dynCall_diij");
+
+var dynCall_viiiji = Module["dynCall_viiiji"] = createExportWrapper("dynCall_viiiji");
+
+var dynCall_viiijj = Module["dynCall_viiijj"] = createExportWrapper("dynCall_viiijj");
+
+var dynCall_viijji = Module["dynCall_viijji"] = createExportWrapper("dynCall_viijji");
+
+var dynCall_jiiij = Module["dynCall_jiiij"] = createExportWrapper("dynCall_jiiij");
+
+var dynCall_viijii = Module["dynCall_viijii"] = createExportWrapper("dynCall_viijii");
+
+var dynCall_jiijjj = Module["dynCall_jiijjj"] = createExportWrapper("dynCall_jiijjj");
+
+var dynCall_jiijj = Module["dynCall_jiijj"] = createExportWrapper("dynCall_jiijj");
+
+var dynCall_viiijiji = Module["dynCall_viiijiji"] = createExportWrapper("dynCall_viiijiji");
+
+var dynCall_viiijjiji = Module["dynCall_viiijjiji"] = createExportWrapper("dynCall_viiijjiji");
+
+var dynCall_viijiji = Module["dynCall_viijiji"] = createExportWrapper("dynCall_viijiji");
+
+var dynCall_iiiiijiii = Module["dynCall_iiiiijiii"] = createExportWrapper("dynCall_iiiiijiii");
+
+var dynCall_iiiiiijd = Module["dynCall_iiiiiijd"] = createExportWrapper("dynCall_iiiiiijd");
+
+var dynCall_diidj = Module["dynCall_diidj"] = createExportWrapper("dynCall_diidj");
+
+var dynCall_viiiijij = Module["dynCall_viiiijij"] = createExportWrapper("dynCall_viiiijij");
+
+var dynCall_viiidjj = Module["dynCall_viiidjj"] = createExportWrapper("dynCall_viiidjj");
+
+var dynCall_viidj = Module["dynCall_viidj"] = createExportWrapper("dynCall_viidj");
+
+var dynCall_iiijj = Module["dynCall_iiijj"] = createExportWrapper("dynCall_iiijj");
+
+var dynCall_jiid = Module["dynCall_jiid"] = createExportWrapper("dynCall_jiid");
+
+var dynCall_viiiiddji = Module["dynCall_viiiiddji"] = createExportWrapper("dynCall_viiiiddji");
+
+var dynCall_vijiiiiiiiii = Module["dynCall_vijiiiiiiiii"] = createExportWrapper("dynCall_vijiiiiiiiii");
+
+var dynCall_vijiiiffi = Module["dynCall_vijiiiffi"] = createExportWrapper("dynCall_vijiiiffi");
+
+var dynCall_vijiiifii = Module["dynCall_vijiiifii"] = createExportWrapper("dynCall_vijiiifii");
+
+var dynCall_viijfii = Module["dynCall_viijfii"] = createExportWrapper("dynCall_viijfii");
+
+var dynCall_viiiiiiiiiiijjjjjjifiiiiii = Module["dynCall_viiiiiiiiiiijjjjjjifiiiiii"] = createExportWrapper("dynCall_viiiiiiiiiiijjjjjjifiiiiii");
+
+var dynCall_vijifff = Module["dynCall_vijifff"] = createExportWrapper("dynCall_vijifff");
+
+var dynCall_fiji = Module["dynCall_fiji"] = createExportWrapper("dynCall_fiji");
+
+var dynCall_vijiiffifffi = Module["dynCall_vijiiffifffi"] = createExportWrapper("dynCall_vijiiffifffi");
+
+var dynCall_iijj = Module["dynCall_iijj"] = createExportWrapper("dynCall_iijj");
+
+var dynCall_iijjfj = Module["dynCall_iijjfj"] = createExportWrapper("dynCall_iijjfj");
+
+var dynCall_vijiji = Module["dynCall_vijiji"] = createExportWrapper("dynCall_vijiji");
+
+var dynCall_jijii = Module["dynCall_jijii"] = createExportWrapper("dynCall_jijii");
+
+var dynCall_vijid = Module["dynCall_vijid"] = createExportWrapper("dynCall_vijid");
+
+var dynCall_vijiiiiii = Module["dynCall_vijiiiiii"] = createExportWrapper("dynCall_vijiiiiii");
+
+var dynCall_vijiff = Module["dynCall_vijiff"] = createExportWrapper("dynCall_vijiff");
+
+var dynCall_vijjjj = Module["dynCall_vijjjj"] = createExportWrapper("dynCall_vijjjj");
+
+var dynCall_vijiiiiiii = Module["dynCall_vijiiiiiii"] = createExportWrapper("dynCall_vijiiiiiii");
+
+var dynCall_jiiifiiiii = Module["dynCall_jiiifiiiii"] = createExportWrapper("dynCall_jiiifiiiii");
+
+var dynCall_viiiifijii = Module["dynCall_viiiifijii"] = createExportWrapper("dynCall_viiiifijii");
+
+var dynCall_viiiifiijjii = Module["dynCall_viiiifiijjii"] = createExportWrapper("dynCall_viiiifiijjii");
+
+var dynCall_vijiiifiijii = Module["dynCall_vijiiifiijii"] = createExportWrapper("dynCall_vijiiifiijii");
+
+var dynCall_vijiiifiiijjii = Module["dynCall_vijiiifiiijjii"] = createExportWrapper("dynCall_vijiiifiiijjii");
+
+var dynCall_vijiiifiiijii = Module["dynCall_vijiiifiiijii"] = createExportWrapper("dynCall_vijiiifiiijii");
+
+var dynCall_vijiiifiiiijjii = Module["dynCall_vijiiifiiiijjii"] = createExportWrapper("dynCall_vijiiifiiiijjii");
+
+var dynCall_fijiiii = Module["dynCall_fijiiii"] = createExportWrapper("dynCall_fijiiii");
+
+var dynCall_fijiiiii = Module["dynCall_fijiiiii"] = createExportWrapper("dynCall_fijiiiii");
+
+var dynCall_iijii = Module["dynCall_iijii"] = createExportWrapper("dynCall_iijii");
+
+var dynCall_iijiijiiiii = Module["dynCall_iijiijiiiii"] = createExportWrapper("dynCall_iijiijiiiii");
+
+var dynCall_iijijiiiii = Module["dynCall_iijijiiiii"] = createExportWrapper("dynCall_iijijiiiii");
+
+var dynCall_vijijj = Module["dynCall_vijijj"] = createExportWrapper("dynCall_vijijj");
+
+var dynCall_vijiiijj = Module["dynCall_vijiiijj"] = createExportWrapper("dynCall_vijiiijj");
+
+var dynCall_vijiijj = Module["dynCall_vijiijj"] = createExportWrapper("dynCall_vijiijj");
+
+var dynCall_vijjiji = Module["dynCall_vijjiji"] = createExportWrapper("dynCall_vijjiji");
+
+var dynCall_vijjiijii = Module["dynCall_vijjiijii"] = createExportWrapper("dynCall_vijjiijii");
+
+var dynCall_fijii = Module["dynCall_fijii"] = createExportWrapper("dynCall_fijii");
+
+var dynCall_iiiiiiij = Module["dynCall_iiiiiiij"] = createExportWrapper("dynCall_iiiiiiij");
+
+var dynCall_vijiiiij = Module["dynCall_vijiiiij"] = createExportWrapper("dynCall_vijiiiij");
+
+var dynCall_jijj = Module["dynCall_jijj"] = createExportWrapper("dynCall_jijj");
+
+var dynCall_jiiif = Module["dynCall_jiiif"] = createExportWrapper("dynCall_jiiif");
+
+var dynCall_vijfff = Module["dynCall_vijfff"] = createExportWrapper("dynCall_vijfff");
+
+var dynCall_vijfiff = Module["dynCall_vijfiff"] = createExportWrapper("dynCall_vijfiff");
+
+var dynCall_vijfi = Module["dynCall_vijfi"] = createExportWrapper("dynCall_vijfi");
+
+var dynCall_vijffffi = Module["dynCall_vijffffi"] = createExportWrapper("dynCall_vijffffi");
+
+var dynCall_vijiiffi = Module["dynCall_vijiiffi"] = createExportWrapper("dynCall_vijiiffi");
+
+var dynCall_vijiifffffff = Module["dynCall_vijiifffffff"] = createExportWrapper("dynCall_vijiifffffff");
+
+var dynCall_vijifiifffffifff = Module["dynCall_vijifiifffffifff"] = createExportWrapper("dynCall_vijifiifffffifff");
+
+var dynCall_vijiiffffiffffj = Module["dynCall_vijiiffffiffffj"] = createExportWrapper("dynCall_vijiiffffiffffj");
+
+var dynCall_vijiifff = Module["dynCall_vijiifff"] = createExportWrapper("dynCall_vijiifff");
+
+var dynCall_vijiffffffff = Module["dynCall_vijiffffffff"] = createExportWrapper("dynCall_vijiffffffff");
+
+var dynCall_vijiifiififff = Module["dynCall_vijiifiififff"] = createExportWrapper("dynCall_vijiifiififff");
+
+var dynCall_vijifffij = Module["dynCall_vijifffij"] = createExportWrapper("dynCall_vijifffij");
+
+var dynCall_viijjjiifjii = Module["dynCall_viijjjiifjii"] = createExportWrapper("dynCall_viijjjiifjii");
+
+var dynCall_vijjjii = Module["dynCall_vijjjii"] = createExportWrapper("dynCall_vijjjii");
+
+var dynCall_fijj = Module["dynCall_fijj"] = createExportWrapper("dynCall_fijj");
+
+var dynCall_iijjiii = Module["dynCall_iijjiii"] = createExportWrapper("dynCall_iijjiii");
+
+var dynCall_iiiiij = Module["dynCall_iiiiij"] = createExportWrapper("dynCall_iiiiij");
+
+var dynCall_iiiiijj = Module["dynCall_iiiiijj"] = createExportWrapper("dynCall_iiiiijj");
+
+var dynCall_iiiiiijj = Module["dynCall_iiiiiijj"] = createExportWrapper("dynCall_iiiiiijj");
+
+function invoke_vii(index, a1, a2) {
+ var sp = stackSave();
+ try {
+ getWasmTableEntry(index)(a1, a2);
+ } catch (e) {
+ stackRestore(sp);
+ if (e !== e + 0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_vi(index, a1) {
+ var sp = stackSave();
+ try {
+ getWasmTableEntry(index)(a1);
+ } catch (e) {
+ stackRestore(sp);
+ if (e !== e + 0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_iiii(index, a1, a2, a3) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1, a2, a3);
+ } catch (e) {
+ stackRestore(sp);
+ if (e !== e + 0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_ii(index, a1) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1);
+ } catch (e) {
+ stackRestore(sp);
+ if (e !== e + 0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_iiiiii(index, a1, a2, a3, a4, a5) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1, a2, a3, a4, a5);
+ } catch (e) {
+ stackRestore(sp);
+ if (e !== e + 0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_viiii(index, a1, a2, a3, a4) {
+ var sp = stackSave();
+ try {
+ getWasmTableEntry(index)(a1, a2, a3, a4);
+ } catch (e) {
+ stackRestore(sp);
+ if (e !== e + 0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_iii(index, a1, a2) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1, a2);
+ } catch (e) {
+ stackRestore(sp);
+ if (e !== e + 0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_iiiii(index, a1, a2, a3, a4) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1, a2, a3, a4);
+ } catch (e) {
+ stackRestore(sp);
+ if (e !== e + 0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_viiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
+ var sp = stackSave();
+ try {
+ getWasmTableEntry(index)(a1, a2, a3, a4, a5, a6, a7, a8);
+ } catch (e) {
+ stackRestore(sp);
+ if (e !== e + 0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_viii(index, a1, a2, a3) {
+ var sp = stackSave();
+ try {
+ getWasmTableEntry(index)(a1, a2, a3);
+ } catch (e) {
+ stackRestore(sp);
+ if (e !== e + 0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_viiiiiii(index, a1, a2, a3, a4, a5, a6, a7) {
+ var sp = stackSave();
+ try {
+ getWasmTableEntry(index)(a1, a2, a3, a4, a5, a6, a7);
+ } catch (e) {
+ stackRestore(sp);
+ if (e !== e + 0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_viiij(index, a1, a2, a3, a4, a5) {
+ var sp = stackSave();
+ try {
+ dynCall_viiij(index, a1, a2, a3, a4, a5);
+ } catch (e) {
+ stackRestore(sp);
+ if (e !== e + 0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+Module["callMain"] = callMain;
+
+Module["keepRuntimeAlive"] = keepRuntimeAlive;
+
+Module["wasmMemory"] = wasmMemory;
+
+Module["cwrap"] = cwrap;
+
+Module["ExitStatus"] = ExitStatus;
+
+Module["PThread"] = PThread;
+
+var missingLibrarySymbols = [ "getHostByName", "traverseStack", "getCallstack", "emscriptenLog", "convertPCtoSourceLocation", "readEmAsmArgs", "jstoi_s", "listenOnce", "autoResumeAudioContext", "dynCallLegacy", "getDynCaller", "dynCall", "asmjsMangle", "HandleAllocator", "getNativeTypeSize", "STACK_SIZE", "STACK_ALIGN", "POINTER_SIZE", "ASSERTIONS", "writeI53ToI64Clamped", "writeI53ToI64Signaling", "writeI53ToU64Clamped", "writeI53ToU64Signaling", "convertI32PairToI53", "convertU32PairToI53", "uleb128Encode", "sigToWasmTypes", "generateFuncType", "convertJsFunctionToWasm", "getEmptyTableSlot", "updateTableMap", "getFunctionAddress", "addFunction", "removeFunction", "reallyNegative", "unSign", "strLen", "reSign", "formatString", "intArrayToString", "AsciiToString", "UTF16ToString", "stringToUTF16", "lengthBytesUTF16", "UTF32ToString", "stringToUTF32", "lengthBytesUTF32", "registerKeyEventCallback", "getBoundingClientRect", "fillMouseEventData", "registerMouseEventCallback", "registerWheelEventCallback", "registerUiEventCallback", "registerFocusEventCallback", "fillDeviceOrientationEventData", "registerDeviceOrientationEventCallback", "fillDeviceMotionEventData", "registerDeviceMotionEventCallback", "screenOrientation", "fillOrientationChangeEventData", "registerOrientationChangeEventCallback", "fillFullscreenChangeEventData", "registerFullscreenChangeEventCallback", "JSEvents_requestFullscreen", "JSEvents_resizeCanvasForFullscreen", "registerRestoreOldStyle", "hideEverythingExceptGivenElement", "restoreHiddenElements", "setLetterbox", "softFullscreenResizeWebGLRenderTarget", "doRequestFullscreen", "fillPointerlockChangeEventData", "registerPointerlockChangeEventCallback", "registerPointerlockErrorEventCallback", "requestPointerLock", "fillVisibilityChangeEventData", "registerVisibilityChangeEventCallback", "registerTouchEventCallback", "fillGamepadEventData", "registerGamepadEventCallback", "registerBeforeUnloadEventCallback", "fillBatteryEventData", "battery", "registerBatteryEventCallback", "setCanvasElementSize", "getCanvasSizeCallingThread", "getCanvasSizeMainThread", "getCanvasElementSize", "jsStackTrace", "stackTrace", "checkWasiClock", "wasiRightsToMuslOFlags", "wasiOFlagsToMuslOFlags", "createDyncallWrapper", "setImmediateWrapped", "clearImmediateWrapped", "polyfillSetImmediate", "getPromise", "makePromise", "idsToPromises", "makePromiseCallback", "ExceptionInfo", "_setNetworkCallback", "emscriptenWebGLGetUniform", "emscriptenWebGLGetVertexAttrib", "__glGetActiveAttribOrUniform", "writeGLArray", "emscripten_webgl_destroy_context_before_on_calling_thread", "registerWebGlEventCallback", "runAndAbortIfError", "SDL_unicode", "SDL_ttfContext", "SDL_audio", "GLFW_Window", "emscriptenWebGLGetIndexed", "ALLOC_NORMAL", "ALLOC_STACK", "allocate", "writeStringToMemory", "writeAsciiToMemory" ];
+
+missingLibrarySymbols.forEach(missingLibrarySymbol);
+
+var unexportedSymbols = [ "run", "addOnPreRun", "addOnInit", "addOnPreMain", "addOnExit", "addOnPostRun", "addRunDependency", "removeRunDependency", "FS_createFolder", "FS_createPath", "FS_createDataFile", "FS_createLazyFile", "FS_createLink", "FS_createDevice", "FS_unlink", "out", "err", "abort", "stackAlloc", "stackSave", "stackRestore", "getTempRet0", "setTempRet0", "GROWABLE_HEAP_I8", "GROWABLE_HEAP_U8", "GROWABLE_HEAP_I16", "GROWABLE_HEAP_U16", "GROWABLE_HEAP_I32", "GROWABLE_HEAP_U32", "GROWABLE_HEAP_F32", "GROWABLE_HEAP_F64", "writeStackCookie", "checkStackCookie", "ptrToString", "zeroMemory", "exitJS", "getHeapMax", "emscripten_realloc_buffer", "ENV", "MONTH_DAYS_REGULAR", "MONTH_DAYS_LEAP", "MONTH_DAYS_REGULAR_CUMULATIVE", "MONTH_DAYS_LEAP_CUMULATIVE", "isLeapYear", "ydayFromDate", "arraySum", "addDays", "ERRNO_CODES", "ERRNO_MESSAGES", "setErrNo", "inetPton4", "inetNtop4", "inetPton6", "inetNtop6", "readSockaddr", "writeSockaddr", "DNS", "Protocols", "Sockets", "initRandomFill", "randomFill", "timers", "warnOnce", "UNWIND_CACHE", "readEmAsmArgsArray", "jstoi_q", "getExecutableName", "handleException", "runtimeKeepalivePush", "runtimeKeepalivePop", "callUserCallback", "maybeExit", "safeSetTimeout", "asyncLoad", "alignMemory", "mmapAlloc", "writeI53ToI64", "readI53FromI64", "readI53FromU64", "convertI32PairToI53Checked", "getCFunc", "ccall", "freeTableIndexes", "functionsInTableMap", "setValue", "getValue", "PATH", "PATH_FS", "UTF8Decoder", "UTF8ArrayToString", "UTF8ToString", "stringToUTF8Array", "stringToUTF8", "lengthBytesUTF8", "intArrayFromString", "stringToAscii", "UTF16Decoder", "stringToNewUTF8", "stringToUTF8OnStack", "writeArrayToMemory", "SYSCALLS", "getSocketFromFD", "getSocketAddress", "JSEvents", "specialHTMLTargets", "maybeCStringToJsString", "findEventTarget", "findCanvasEventTarget", "currentFullscreenStrategy", "restoreOldWindowedStyle", "setCanvasElementSizeCallingThread", "setCanvasElementSizeMainThread", "demangle", "demangleAll", "getEnvStrings", "doReadv", "doWritev", "dlopenMissingError", "promiseMap", "uncaughtExceptionCount", "exceptionLast", "exceptionCaught", "Browser", "setMainLoop", "wget", "preloadPlugins", "FS_createPreloadedFile", "FS_modeStringToFlags", "FS_getMode", "FS", "MEMFS", "TTY", "PIPEFS", "SOCKFS", "tempFixedLengthArray", "miniTempWebGLFloatBuffers", "miniTempWebGLIntBuffers", "heapObjectForWebGLType", "heapAccessShiftForWebGLHeap", "webgl_enable_ANGLE_instanced_arrays", "webgl_enable_OES_vertex_array_object", "webgl_enable_WEBGL_draw_buffers", "webgl_enable_WEBGL_multi_draw", "GL", "emscriptenWebGLGet", "computeUnpackAlignedImageSize", "colorChannelsInGlTextureFormat", "emscriptenWebGLGetTexPixelData", "__glGenObject", "webglGetUniformLocation", "webglPrepareUniformLocationsBeforeFirstUse", "webglGetLeftBracePos", "emscripten_webgl_power_preferences", "AL", "GLUT", "EGL", "GLEW", "IDBStore", "SDL", "SDL_gfx", "GLFW", "webgl_enable_WEBGL_draw_instanced_base_vertex_base_instance", "webgl_enable_WEBGL_multi_draw_instanced_base_vertex_base_instance", "allocateUTF8", "allocateUTF8OnStack", "terminateWorker", "killThread", "cleanupThread", "registerTLSInit", "cancelThread", "spawnThread", "exitOnMainThread", "proxyToMainThread", "emscripten_receive_on_main_thread_js_callArgs", "invokeEntryPoint", "checkMailbox", "GodotWebXR", "GodotWebSocket", "GodotRTCDataChannel", "GodotRTCPeerConnection", "GodotAudio", "GodotAudioWorklet", "GodotAudioScript", "GodotDisplayVK", "GodotDisplayCursor", "GodotDisplayScreen", "GodotDisplay", "GodotFetch", "IDHandler", "GodotConfig", "GodotFS", "GodotOS", "GodotEventListeners", "GodotPWA", "GodotRuntime", "GodotInputGamepads", "GodotInputDragDrop", "GodotInput", "GodotWebGL2", "GodotJSWrapper", "IDBFS" ];
+
+unexportedSymbols.forEach(unexportedRuntimeSymbol);
+
+var calledRun;
+
+dependenciesFulfilled = function runCaller() {
+ if (!calledRun) run();
+ if (!calledRun) dependenciesFulfilled = runCaller;
+};
+
+function callMain(args = []) {
+ assert(runDependencies == 0, 'cannot call main when async dependencies remain! (listen on Module["onRuntimeInitialized"])');
+ assert(__ATPRERUN__.length == 0, "cannot call main when preRun functions remain to be called");
+ var entryFunction = _main;
+ args.unshift(thisProgram);
+ var argc = args.length;
+ var argv = stackAlloc((argc + 1) * 4);
+ var argv_ptr = argv >> 2;
+ args.forEach(arg => {
+ GROWABLE_HEAP_I32()[argv_ptr++] = stringToUTF8OnStack(arg);
+ });
+ GROWABLE_HEAP_I32()[argv_ptr] = 0;
+ try {
+ var ret = entryFunction(argc, argv);
+ exitJS(ret, true);
+ return ret;
+ } catch (e) {
+ return handleException(e);
+ }
+}
+
+function stackCheckInit() {
+ assert(!ENVIRONMENT_IS_PTHREAD);
+ _emscripten_stack_init();
+ writeStackCookie();
+}
+
+function run(args = arguments_) {
+ if (runDependencies > 0) {
+ return;
+ }
+ if (!ENVIRONMENT_IS_PTHREAD) stackCheckInit();
+ if (ENVIRONMENT_IS_PTHREAD) {
+ readyPromiseResolve(Module);
+ initRuntime();
+ startWorker(Module);
+ return;
+ }
+ preRun();
+ if (runDependencies > 0) {
+ return;
+ }
+ function doRun() {
+ if (calledRun) return;
+ calledRun = true;
+ Module["calledRun"] = true;
+ if (ABORT) return;
+ initRuntime();
+ preMain();
+ readyPromiseResolve(Module);
+ if (Module["onRuntimeInitialized"]) Module["onRuntimeInitialized"]();
+ if (shouldRunNow) callMain(args);
+ postRun();
+ }
+ if (Module["setStatus"]) {
+ Module["setStatus"]("Running...");
+ setTimeout(function() {
+ setTimeout(function() {
+ Module["setStatus"]("");
+ }, 1);
+ doRun();
+ }, 1);
+ } else {
+ doRun();
+ }
+ checkStackCookie();
+}
+
+if (Module["preInit"]) {
+ if (typeof Module["preInit"] == "function") Module["preInit"] = [ Module["preInit"] ];
+ while (Module["preInit"].length > 0) {
+ Module["preInit"].pop()();
+ }
+}
+
+var shouldRunNow = false;
+
+if (Module["noInitialRun"]) shouldRunNow = false;
+
+run();
+
+
+ return Godot.ready
+}
+
+);
+})();
+if (typeof exports === 'object' && typeof module === 'object')
+ module.exports = Godot;
+else if (typeof define === 'function' && define['amd'])
+ define([], function() { return Godot; });
+else if (typeof exports === 'object')
+ exports["Godot"] = Godot;
+
+const Features = { // eslint-disable-line no-unused-vars
+ /**
+ * Check whether WebGL is available. Optionally, specify a particular version of WebGL to check for.
+ *
+ * @param {number=} [majorVersion=1] The major WebGL version to check for.
+ * @returns {boolean} If the given major version of WebGL is available.
+ * @function Engine.isWebGLAvailable
+ */
+ isWebGLAvailable: function (majorVersion = 1) {
+ try {
+ return !!document.createElement('canvas').getContext(['webgl', 'webgl2'][majorVersion - 1]);
+ } catch (e) { /* Not available */ }
+ return false;
+ },
+
+ /**
+ * Check whether the Fetch API available and supports streaming responses.
+ *
+ * @returns {boolean} If the Fetch API is available and supports streaming responses.
+ * @function Engine.isFetchAvailable
+ */
+ isFetchAvailable: function () {
+ return 'fetch' in window && 'Response' in window && 'body' in window.Response.prototype;
+ },
+
+ /**
+ * Check whether the engine is running in a Secure Context.
+ *
+ * @returns {boolean} If the engine is running in a Secure Context.
+ * @function Engine.isSecureContext
+ */
+ isSecureContext: function () {
+ return window['isSecureContext'] === true;
+ },
+
+ /**
+ * Check whether the engine is cross origin isolated.
+ * This value is dependent on Cross-Origin-Opener-Policy and Cross-Origin-Embedder-Policy headers sent by the server.
+ *
+ * @returns {boolean} If the engine is running in a Secure Context.
+ * @function Engine.isSecureContext
+ */
+ isCrossOriginIsolated: function () {
+ return window['crossOriginIsolated'] === true;
+ },
+
+ /**
+ * Check whether SharedBufferArray is available.
+ *
+ * Most browsers require the page to be running in a secure context, and the
+ * the server to provide specific CORS headers for SharedArrayBuffer to be available.
+ *
+ * @returns {boolean} If SharedArrayBuffer is available.
+ * @function Engine.isSharedArrayBufferAvailable
+ */
+ isSharedArrayBufferAvailable: function () {
+ return 'SharedArrayBuffer' in window;
+ },
+
+ /**
+ * Check whether the AudioContext supports AudioWorkletNodes.
+ *
+ * @returns {boolean} If AudioWorkletNode is available.
+ * @function Engine.isAudioWorkletAvailable
+ */
+ isAudioWorkletAvailable: function () {
+ return 'AudioContext' in window && 'audioWorklet' in AudioContext.prototype;
+ },
+
+ /**
+ * Return an array of missing required features (as string).
+ *
+ * @returns {Array} A list of human-readable missing features.
+ * @function Engine.getMissingFeatures
+ */
+ getMissingFeatures: function () {
+ const missing = [];
+ if (!Features.isWebGLAvailable(2)) {
+ missing.push('WebGL2 - Check web browser configuration and hardware support');
+ }
+ if (!Features.isFetchAvailable()) {
+ missing.push('Fetch - Check web browser version');
+ }
+ if (!Features.isSecureContext()) {
+ missing.push('Secure Context - Check web server configuration (use HTTPS)');
+ }
+ if (!Features.isCrossOriginIsolated()) {
+ missing.push('Cross Origin Isolation - Check web server configuration (send correct headers)');
+ }
+ if (!Features.isSharedArrayBufferAvailable()) {
+ missing.push('SharedArrayBuffer - Check web server configuration (send correct headers)');
+ }
+ // Audio is normally optional since we have a dummy fallback.
+ return missing;
+ },
+};
+
+const Preloader = /** @constructor */ function () { // eslint-disable-line no-unused-vars
+ function getTrackedResponse(response, load_status) {
+ function onloadprogress(reader, controller) {
+ return reader.read().then(function (result) {
+ if (load_status.done) {
+ return Promise.resolve();
+ }
+ if (result.value) {
+ controller.enqueue(result.value);
+ load_status.loaded += result.value.length;
+ }
+ if (!result.done) {
+ return onloadprogress(reader, controller);
+ }
+ load_status.done = true;
+ return Promise.resolve();
+ });
+ }
+ const reader = response.body.getReader();
+ return new Response(new ReadableStream({
+ start: function (controller) {
+ onloadprogress(reader, controller).then(function () {
+ controller.close();
+ });
+ },
+ }), { headers: response.headers });
+ }
+
+ function loadFetch(file, tracker, fileSize, raw) {
+ tracker[file] = {
+ total: fileSize || 0,
+ loaded: 0,
+ done: false,
+ };
+ return fetch(file).then(function (response) {
+ if (!response.ok) {
+ return Promise.reject(new Error(`Failed loading file '${file}'`));
+ }
+ const tr = getTrackedResponse(response, tracker[file]);
+ if (raw) {
+ return Promise.resolve(tr);
+ }
+ return tr.arrayBuffer();
+ });
+ }
+
+ function retry(func, attempts = 1) {
+ function onerror(err) {
+ if (attempts <= 1) {
+ return Promise.reject(err);
+ }
+ return new Promise(function (resolve, reject) {
+ setTimeout(function () {
+ retry(func, attempts - 1).then(resolve).catch(reject);
+ }, 1000);
+ });
+ }
+ return func().catch(onerror);
+ }
+
+ const DOWNLOAD_ATTEMPTS_MAX = 4;
+ const loadingFiles = {};
+ const lastProgress = { loaded: 0, total: 0 };
+ let progressFunc = null;
+
+ const animateProgress = function () {
+ let loaded = 0;
+ let total = 0;
+ let totalIsValid = true;
+ let progressIsFinal = true;
+
+ Object.keys(loadingFiles).forEach(function (file) {
+ const stat = loadingFiles[file];
+ if (!stat.done) {
+ progressIsFinal = false;
+ }
+ if (!totalIsValid || stat.total === 0) {
+ totalIsValid = false;
+ total = 0;
+ } else {
+ total += stat.total;
+ }
+ loaded += stat.loaded;
+ });
+ if (loaded !== lastProgress.loaded || total !== lastProgress.total) {
+ lastProgress.loaded = loaded;
+ lastProgress.total = total;
+ if (typeof progressFunc === 'function') {
+ progressFunc(loaded, total);
+ }
+ }
+ if (!progressIsFinal) {
+ requestAnimationFrame(animateProgress);
+ }
+ };
+
+ this.animateProgress = animateProgress;
+
+ this.setProgressFunc = function (callback) {
+ progressFunc = callback;
+ };
+
+ this.loadPromise = function (file, fileSize, raw = false) {
+ return retry(loadFetch.bind(null, file, loadingFiles, fileSize, raw), DOWNLOAD_ATTEMPTS_MAX);
+ };
+
+ this.preloadedFiles = [];
+ this.preload = function (pathOrBuffer, destPath, fileSize) {
+ let buffer = null;
+ if (typeof pathOrBuffer === 'string') {
+ const me = this;
+ return this.loadPromise(pathOrBuffer, fileSize).then(function (buf) {
+ me.preloadedFiles.push({
+ path: destPath || pathOrBuffer,
+ buffer: buf,
+ });
+ return Promise.resolve();
+ });
+ } else if (pathOrBuffer instanceof ArrayBuffer) {
+ buffer = new Uint8Array(pathOrBuffer);
+ } else if (ArrayBuffer.isView(pathOrBuffer)) {
+ buffer = new Uint8Array(pathOrBuffer.buffer);
+ }
+ if (buffer) {
+ this.preloadedFiles.push({
+ path: destPath,
+ buffer: pathOrBuffer,
+ });
+ return Promise.resolve();
+ }
+ return Promise.reject(new Error('Invalid object for preloading'));
+ };
+};
+
+/**
+ * An object used to configure the Engine instance based on godot export options, and to override those in custom HTML
+ * templates if needed.
+ *
+ * @header Engine configuration
+ * @summary The Engine configuration object. This is just a typedef, create it like a regular object, e.g.:
+ *
+ * ``const MyConfig = { executable: 'godot', unloadAfterInit: false }``
+ *
+ * @typedef {Object} EngineConfig
+ */
+const EngineConfig = {}; // eslint-disable-line no-unused-vars
+
+/**
+ * @struct
+ * @constructor
+ * @ignore
+ */
+const InternalConfig = function (initConfig) { // eslint-disable-line no-unused-vars
+ const cfg = /** @lends {InternalConfig.prototype} */ {
+ /**
+ * Whether the unload the engine automatically after the instance is initialized.
+ *
+ * @memberof EngineConfig
+ * @default
+ * @type {boolean}
+ */
+ unloadAfterInit: true,
+ /**
+ * The HTML DOM Canvas object to use.
+ *
+ * By default, the first canvas element in the document will be used is none is specified.
+ *
+ * @memberof EngineConfig
+ * @default
+ * @type {?HTMLCanvasElement}
+ */
+ canvas: null,
+ /**
+ * The name of the WASM file without the extension. (Set by Godot Editor export process).
+ *
+ * @memberof EngineConfig
+ * @default
+ * @type {string}
+ */
+ executable: '',
+ /**
+ * An alternative name for the game pck to load. The executable name is used otherwise.
+ *
+ * @memberof EngineConfig
+ * @default
+ * @type {?string}
+ */
+ mainPack: null,
+ /**
+ * Specify a language code to select the proper localization for the game.
+ *
+ * The browser locale will be used if none is specified. See complete list of
+ * :ref:`supported locales `.
+ *
+ * @memberof EngineConfig
+ * @type {?string}
+ * @default
+ */
+ locale: null,
+ /**
+ * The canvas resize policy determines how the canvas should be resized by Godot.
+ *
+ * ``0`` means Godot won't do any resizing. This is useful if you want to control the canvas size from
+ * javascript code in your template.
+ *
+ * ``1`` means Godot will resize the canvas on start, and when changing window size via engine functions.
+ *
+ * ``2`` means Godot will adapt the canvas size to match the whole browser window.
+ *
+ * @memberof EngineConfig
+ * @type {number}
+ * @default
+ */
+ canvasResizePolicy: 2,
+ /**
+ * The arguments to be passed as command line arguments on startup.
+ *
+ * See :ref:`command line tutorial `.
+ *
+ * **Note**: :js:meth:`startGame ` will always add the ``--main-pack`` argument.
+ *
+ * @memberof EngineConfig
+ * @type {Array}
+ * @default
+ */
+ args: [],
+ /**
+ * When enabled, the game canvas will automatically grab the focus when the engine starts.
+ *
+ * @memberof EngineConfig
+ * @type {boolean}
+ * @default
+ */
+ focusCanvas: true,
+ /**
+ * When enabled, this will turn on experimental virtual keyboard support on mobile.
+ *
+ * @memberof EngineConfig
+ * @type {boolean}
+ * @default
+ */
+ experimentalVK: false,
+ /**
+ * The progressive web app service worker to install.
+ * @memberof EngineConfig
+ * @default
+ * @type {string}
+ */
+ serviceWorker: '',
+ /**
+ * @ignore
+ * @type {Array.}
+ */
+ persistentPaths: ['/userfs'],
+ /**
+ * @ignore
+ * @type {boolean}
+ */
+ persistentDrops: false,
+ /**
+ * @ignore
+ * @type {Array.}
+ */
+ gdextensionLibs: [],
+ /**
+ * @ignore
+ * @type {Array.}
+ */
+ fileSizes: [],
+ /**
+ * A callback function for handling Godot's ``OS.execute`` calls.
+ *
+ * This is for example used in the Web Editor template to switch between project manager and editor, and for running the game.
+ *
+ * @callback EngineConfig.onExecute
+ * @param {string} path The path that Godot's wants executed.
+ * @param {Array.} args The arguments of the "command" to execute.
+ */
+ /**
+ * @ignore
+ * @type {?function(string, Array.)}
+ */
+ onExecute: null,
+ /**
+ * A callback function for being notified when the Godot instance quits.
+ *
+ * **Note**: This function will not be called if the engine crashes or become unresponsive.
+ *
+ * @callback EngineConfig.onExit
+ * @param {number} status_code The status code returned by Godot on exit.
+ */
+ /**
+ * @ignore
+ * @type {?function(number)}
+ */
+ onExit: null,
+ /**
+ * A callback function for displaying download progress.
+ *
+ * The function is called once per frame while downloading files, so the usage of ``requestAnimationFrame()``
+ * is not necessary.
+ *
+ * If the callback function receives a total amount of bytes as 0, this means that it is impossible to calculate.
+ * Possible reasons include:
+ *
+ * - Files are delivered with server-side chunked compression
+ * - Files are delivered with server-side compression on Chromium
+ * - Not all file downloads have started yet (usually on servers without multi-threading)
+ *
+ * @callback EngineConfig.onProgress
+ * @param {number} current The current amount of downloaded bytes so far.
+ * @param {number} total The total amount of bytes to be downloaded.
+ */
+ /**
+ * @ignore
+ * @type {?function(number, number)}
+ */
+ onProgress: null,
+ /**
+ * A callback function for handling the standard output stream. This method should usually only be used in debug pages.
+ *
+ * By default, ``console.log()`` is used.
+ *
+ * @callback EngineConfig.onPrint
+ * @param {...*} [var_args] A variadic number of arguments to be printed.
+ */
+ /**
+ * @ignore
+ * @type {?function(...*)}
+ */
+ onPrint: function () {
+ console.log.apply(console, Array.from(arguments)); // eslint-disable-line no-console
+ },
+ /**
+ * A callback function for handling the standard error stream. This method should usually only be used in debug pages.
+ *
+ * By default, ``console.error()`` is used.
+ *
+ * @callback EngineConfig.onPrintError
+ * @param {...*} [var_args] A variadic number of arguments to be printed as errors.
+ */
+ /**
+ * @ignore
+ * @type {?function(...*)}
+ */
+ onPrintError: function (var_args) {
+ console.error.apply(console, Array.from(arguments)); // eslint-disable-line no-console
+ },
+ };
+
+ /**
+ * @ignore
+ * @struct
+ * @constructor
+ * @param {EngineConfig} opts
+ */
+ function Config(opts) {
+ this.update(opts);
+ }
+
+ Config.prototype = cfg;
+
+ /**
+ * @ignore
+ * @param {EngineConfig} opts
+ */
+ Config.prototype.update = function (opts) {
+ const config = opts || {};
+ // NOTE: We must explicitly pass the default, accessing it via
+ // the key will fail due to closure compiler renames.
+ function parse(key, def) {
+ if (typeof (config[key]) === 'undefined') {
+ return def;
+ }
+ return config[key];
+ }
+ // Module config
+ this.unloadAfterInit = parse('unloadAfterInit', this.unloadAfterInit);
+ this.onPrintError = parse('onPrintError', this.onPrintError);
+ this.onPrint = parse('onPrint', this.onPrint);
+ this.onProgress = parse('onProgress', this.onProgress);
+
+ // Godot config
+ this.canvas = parse('canvas', this.canvas);
+ this.executable = parse('executable', this.executable);
+ this.mainPack = parse('mainPack', this.mainPack);
+ this.locale = parse('locale', this.locale);
+ this.canvasResizePolicy = parse('canvasResizePolicy', this.canvasResizePolicy);
+ this.persistentPaths = parse('persistentPaths', this.persistentPaths);
+ this.persistentDrops = parse('persistentDrops', this.persistentDrops);
+ this.experimentalVK = parse('experimentalVK', this.experimentalVK);
+ this.focusCanvas = parse('focusCanvas', this.focusCanvas);
+ this.serviceWorker = parse('serviceWorker', this.serviceWorker);
+ this.gdextensionLibs = parse('gdextensionLibs', this.gdextensionLibs);
+ this.fileSizes = parse('fileSizes', this.fileSizes);
+ this.args = parse('args', this.args);
+ this.onExecute = parse('onExecute', this.onExecute);
+ this.onExit = parse('onExit', this.onExit);
+ };
+
+ /**
+ * @ignore
+ * @param {string} loadPath
+ * @param {Response} response
+ */
+ Config.prototype.getModuleConfig = function (loadPath, response) {
+ let r = response;
+ return {
+ 'print': this.onPrint,
+ 'printErr': this.onPrintError,
+ 'thisProgram': this.executable,
+ 'noExitRuntime': false,
+ 'dynamicLibraries': [`${loadPath}.side.wasm`],
+ 'instantiateWasm': function (imports, onSuccess) {
+ function done(result) {
+ onSuccess(result['instance'], result['module']);
+ }
+ if (typeof (WebAssembly.instantiateStreaming) !== 'undefined') {
+ WebAssembly.instantiateStreaming(Promise.resolve(r), imports).then(done);
+ } else {
+ r.arrayBuffer().then(function (buffer) {
+ WebAssembly.instantiate(buffer, imports).then(done);
+ });
+ }
+ r = null;
+ return {};
+ },
+ 'locateFile': function (path) {
+ if (!path.startsWith('godot.')) {
+ return path;
+ } else if (path.endsWith('.worker.js')) {
+ return `${loadPath}.worker.js`;
+ } else if (path.endsWith('.audio.worklet.js')) {
+ return `${loadPath}.audio.worklet.js`;
+ } else if (path.endsWith('.js')) {
+ return `${loadPath}.js`;
+ } else if (path.endsWith('.side.wasm')) {
+ return `${loadPath}.side.wasm`;
+ } else if (path.endsWith('.wasm')) {
+ return `${loadPath}.wasm`;
+ }
+ return path;
+ },
+ };
+ };
+
+ /**
+ * @ignore
+ * @param {function()} cleanup
+ */
+ Config.prototype.getGodotConfig = function (cleanup) {
+ // Try to find a canvas
+ if (!(this.canvas instanceof HTMLCanvasElement)) {
+ const nodes = document.getElementsByTagName('canvas');
+ if (nodes.length && nodes[0] instanceof HTMLCanvasElement) {
+ const first = nodes[0];
+ this.canvas = /** @type {!HTMLCanvasElement} */ (first);
+ }
+ if (!this.canvas) {
+ throw new Error('No canvas found in page');
+ }
+ }
+ // Canvas can grab focus on click, or key events won't work.
+ if (this.canvas.tabIndex < 0) {
+ this.canvas.tabIndex = 0;
+ }
+
+ // Browser locale, or custom one if defined.
+ let locale = this.locale;
+ if (!locale) {
+ locale = navigator.languages ? navigator.languages[0] : navigator.language;
+ locale = locale.split('.')[0];
+ }
+ locale = locale.replace('-', '_');
+ const onExit = this.onExit;
+
+ // Godot configuration.
+ return {
+ 'canvas': this.canvas,
+ 'canvasResizePolicy': this.canvasResizePolicy,
+ 'locale': locale,
+ 'persistentDrops': this.persistentDrops,
+ 'virtualKeyboard': this.experimentalVK,
+ 'focusCanvas': this.focusCanvas,
+ 'onExecute': this.onExecute,
+ 'onExit': function (p_code) {
+ cleanup(); // We always need to call the cleanup callback to free memory.
+ if (typeof (onExit) === 'function') {
+ onExit(p_code);
+ }
+ },
+ };
+ };
+ return new Config(initConfig);
+};
+
+/**
+ * Projects exported for the Web expose the :js:class:`Engine` class to the JavaScript environment, that allows
+ * fine control over the engine's start-up process.
+ *
+ * This API is built in an asynchronous manner and requires basic understanding
+ * of `Promises `__.
+ *
+ * @module Engine
+ * @header Web export JavaScript reference
+ */
+const Engine = (function () {
+ const preloader = new Preloader();
+
+ let loadPromise = null;
+ let loadPath = '';
+ let initPromise = null;
+
+ /**
+ * @classdesc The ``Engine`` class provides methods for loading and starting exported projects on the Web. For default export
+ * settings, this is already part of the exported HTML page. To understand practical use of the ``Engine`` class,
+ * see :ref:`Custom HTML page for Web export `.
+ *
+ * @description Create a new Engine instance with the given configuration.
+ *
+ * @global
+ * @constructor
+ * @param {EngineConfig} initConfig The initial config for this instance.
+ */
+ function Engine(initConfig) { // eslint-disable-line no-shadow
+ this.config = new InternalConfig(initConfig);
+ this.rtenv = null;
+ }
+
+ /**
+ * Load the engine from the specified base path.
+ *
+ * @param {string} basePath Base path of the engine to load.
+ * @param {number=} [size=0] The file size if known.
+ * @returns {Promise} A Promise that resolves once the engine is loaded.
+ *
+ * @function Engine.load
+ */
+ Engine.load = function (basePath, size) {
+ if (loadPromise == null) {
+ loadPath = basePath;
+ loadPromise = preloader.loadPromise(`${loadPath}.wasm`, size, true);
+ requestAnimationFrame(preloader.animateProgress);
+ }
+ return loadPromise;
+ };
+
+ /**
+ * Unload the engine to free memory.
+ *
+ * This method will be called automatically depending on the configuration. See :js:attr:`unloadAfterInit`.
+ *
+ * @function Engine.unload
+ */
+ Engine.unload = function () {
+ loadPromise = null;
+ };
+
+ /**
+ * Safe Engine constructor, creates a new prototype for every new instance to avoid prototype pollution.
+ * @ignore
+ * @constructor
+ */
+ function SafeEngine(initConfig) {
+ const proto = /** @lends Engine.prototype */ {
+ /**
+ * Initialize the engine instance. Optionally, pass the base path to the engine to load it,
+ * if it hasn't been loaded yet. See :js:meth:`Engine.load`.
+ *
+ * @param {string=} basePath Base path of the engine to load.
+ * @return {Promise} A ``Promise`` that resolves once the engine is loaded and initialized.
+ */
+ init: function (basePath) {
+ if (initPromise) {
+ return initPromise;
+ }
+ if (loadPromise == null) {
+ if (!basePath) {
+ initPromise = Promise.reject(new Error('A base path must be provided when calling `init` and the engine is not loaded.'));
+ return initPromise;
+ }
+ Engine.load(basePath, this.config.fileSizes[`${basePath}.wasm`]);
+ }
+ const me = this;
+ function doInit(promise) {
+ // Care! Promise chaining is bogus with old emscripten versions.
+ // This caused a regression with the Mono build (which uses an older emscripten version).
+ // Make sure to test that when refactoring.
+ return new Promise(function (resolve, reject) {
+ promise.then(function (response) {
+ const cloned = new Response(response.clone().body, { 'headers': [['content-type', 'application/wasm']] });
+ Godot(me.config.getModuleConfig(loadPath, cloned)).then(function (module) {
+ const paths = me.config.persistentPaths;
+ module['initFS'](paths).then(function (err) {
+ me.rtenv = module;
+ if (me.config.unloadAfterInit) {
+ Engine.unload();
+ }
+ resolve();
+ });
+ });
+ });
+ });
+ }
+ preloader.setProgressFunc(this.config.onProgress);
+ initPromise = doInit(loadPromise);
+ return initPromise;
+ },
+
+ /**
+ * Load a file so it is available in the instance's file system once it runs. Must be called **before** starting the
+ * instance.
+ *
+ * If not provided, the ``path`` is derived from the URL of the loaded file.
+ *
+ * @param {string|ArrayBuffer} file The file to preload.
+ *
+ * If a ``string`` the file will be loaded from that path.
+ *
+ * If an ``ArrayBuffer`` or a view on one, the buffer will used as the content of the file.
+ *
+ * @param {string=} path Path by which the file will be accessible. Required, if ``file`` is not a string.
+ *
+ * @returns {Promise} A Promise that resolves once the file is loaded.
+ */
+ preloadFile: function (file, path) {
+ return preloader.preload(file, path, this.config.fileSizes[file]);
+ },
+
+ /**
+ * Start the engine instance using the given override configuration (if any).
+ * :js:meth:`startGame ` can be used in typical cases instead.
+ *
+ * This will initialize the instance if it is not initialized. For manual initialization, see :js:meth:`init `.
+ * The engine must be loaded beforehand.
+ *
+ * Fails if a canvas cannot be found on the page, or not specified in the configuration.
+ *
+ * @param {EngineConfig} override An optional configuration override.
+ * @return {Promise} Promise that resolves once the engine started.
+ */
+ start: function (override) {
+ this.config.update(override);
+ const me = this;
+ return me.init().then(function () {
+ if (!me.rtenv) {
+ return Promise.reject(new Error('The engine must be initialized before it can be started'));
+ }
+
+ let config = {};
+ try {
+ config = me.config.getGodotConfig(function () {
+ me.rtenv = null;
+ });
+ } catch (e) {
+ return Promise.reject(e);
+ }
+ // Godot configuration.
+ me.rtenv['initConfig'](config);
+
+ // Preload GDExtension libraries.
+ const libs = [];
+ if (me.config.gdextensionLibs.length > 0 && !me.rtenv['loadDynamicLibrary']) {
+ return Promise.reject(new Error('GDExtension libraries are not supported by this engine version. '
+ + 'Enable "Extensions Support" for your export preset and/or build your custom template with "dlink_enabled=yes".'));
+ }
+ me.config.gdextensionLibs.forEach(function (lib) {
+ libs.push(me.rtenv['loadDynamicLibrary'](lib, { 'loadAsync': true }));
+ });
+ return Promise.all(libs).then(function () {
+ return new Promise(function (resolve, reject) {
+ preloader.preloadedFiles.forEach(function (file) {
+ me.rtenv['copyToFS'](file.path, file.buffer);
+ });
+ preloader.preloadedFiles.length = 0; // Clear memory
+ me.rtenv['callMain'](me.config.args);
+ initPromise = null;
+ if (me.config.serviceWorker && 'serviceWorker' in navigator) {
+ navigator.serviceWorker.register(me.config.serviceWorker);
+ }
+ resolve();
+ });
+ });
+ });
+ },
+
+ /**
+ * Start the game instance using the given configuration override (if any).
+ *
+ * This will initialize the instance if it is not initialized. For manual initialization, see :js:meth:`init `.
+ *
+ * This will load the engine if it is not loaded, and preload the main pck.
+ *
+ * This method expects the initial config (or the override) to have both the :js:attr:`executable` and :js:attr:`mainPack`
+ * properties set (normally done by the editor during export).
+ *
+ * @param {EngineConfig} override An optional configuration override.
+ * @return {Promise} Promise that resolves once the game started.
+ */
+ startGame: function (override) {
+ this.config.update(override);
+ // Add main-pack argument.
+ const exe = this.config.executable;
+ const pack = this.config.mainPack || `${exe}.pck`;
+ this.config.args = ['--main-pack', pack].concat(this.config.args);
+ // Start and init with execName as loadPath if not inited.
+ const me = this;
+ return Promise.all([
+ this.init(exe),
+ this.preloadFile(pack, pack),
+ ]).then(function () {
+ return me.start.apply(me);
+ });
+ },
+
+ /**
+ * Create a file at the specified ``path`` with the passed as ``buffer`` in the instance's file system.
+ *
+ * @param {string} path The location where the file will be created.
+ * @param {ArrayBuffer} buffer The content of the file.
+ */
+ copyToFS: function (path, buffer) {
+ if (this.rtenv == null) {
+ throw new Error('Engine must be inited before copying files');
+ }
+ this.rtenv['copyToFS'](path, buffer);
+ },
+
+ /**
+ * Request that the current instance quit.
+ *
+ * This is akin the user pressing the close button in the window manager, and will
+ * have no effect if the engine has crashed, or is stuck in a loop.
+ *
+ */
+ requestQuit: function () {
+ if (this.rtenv) {
+ this.rtenv['request_quit']();
+ }
+ },
+ };
+
+ Engine.prototype = proto;
+ // Closure compiler exported instance methods.
+ Engine.prototype['init'] = Engine.prototype.init;
+ Engine.prototype['preloadFile'] = Engine.prototype.preloadFile;
+ Engine.prototype['start'] = Engine.prototype.start;
+ Engine.prototype['startGame'] = Engine.prototype.startGame;
+ Engine.prototype['copyToFS'] = Engine.prototype.copyToFS;
+ Engine.prototype['requestQuit'] = Engine.prototype.requestQuit;
+ // Also expose static methods as instance methods
+ Engine.prototype['load'] = Engine.load;
+ Engine.prototype['unload'] = Engine.unload;
+ return new Engine(initConfig);
+ }
+
+ // Closure compiler exported static methods.
+ SafeEngine['load'] = Engine.load;
+ SafeEngine['unload'] = Engine.unload;
+
+ // Feature-detection utilities.
+ SafeEngine['isWebGLAvailable'] = Features.isWebGLAvailable;
+ SafeEngine['isFetchAvailable'] = Features.isFetchAvailable;
+ SafeEngine['isSecureContext'] = Features.isSecureContext;
+ SafeEngine['isCrossOriginIsolated'] = Features.isCrossOriginIsolated;
+ SafeEngine['isSharedArrayBufferAvailable'] = Features.isSharedArrayBufferAvailable;
+ SafeEngine['isAudioWorkletAvailable'] = Features.isAudioWorkletAvailable;
+ SafeEngine['getMissingFeatures'] = Features.getMissingFeatures;
+
+ return SafeEngine;
+}());
+if (typeof window !== 'undefined') {
+ window['Engine'] = Engine;
+}
diff --git a/early_access/index.manifest.json b/early_access/index.manifest.json
new file mode 100644
index 000000000000..35e5a39f2f0d
--- /dev/null
+++ b/early_access/index.manifest.json
@@ -0,0 +1 @@
+{"background_color":"#000000","display":"standalone","icons":[{"sizes":"144x144","src":"index.144x144.png","type":"image/png"},{"sizes":"180x180","src":"index.180x180.png","type":"image/png"},{"sizes":"512x512","src":"index.512x512.png","type":"image/png"}],"name":"Pixelorama","orientation":"any","start_url":"./index.html"}
\ No newline at end of file
diff --git a/early_access/index.offline.html b/early_access/index.offline.html
new file mode 100644
index 000000000000..ae5298ae46e7
--- /dev/null
+++ b/early_access/index.offline.html
@@ -0,0 +1,41 @@
+
+
+
+
+
+
+ You are offline
+
+
+
+ You are offline
+ This application requires an Internet connection to run for the first time.
+ Press the button below to try reloading:
+
+
+
+
diff --git a/early_access/index.pck b/early_access/index.pck
new file mode 100644
index 000000000000..ad8b32a242c3
Binary files /dev/null and b/early_access/index.pck differ
diff --git a/early_access/index.png b/early_access/index.png
new file mode 100644
index 000000000000..62a9bca70b9b
Binary files /dev/null and b/early_access/index.png differ
diff --git a/early_access/index.service.worker.js b/early_access/index.service.worker.js
new file mode 100644
index 000000000000..fa3c9bbbc21b
--- /dev/null
+++ b/early_access/index.service.worker.js
@@ -0,0 +1,106 @@
+// This service worker is required to expose an exported Godot project as a
+// Progressive Web App. It provides an offline fallback page telling the user
+// that they need an Internet connection to run the project if desired.
+// Incrementing CACHE_VERSION will kick off the install event and force
+// previously cached resources to be updated from the network.
+const CACHE_VERSION = "1715807352|11737425";
+const CACHE_PREFIX = "Pixelorama-sw-cache-";
+const CACHE_NAME = CACHE_PREFIX + CACHE_VERSION;
+const OFFLINE_URL = "index.offline.html";
+// Files that will be cached on load.
+const CACHED_FILES = ["index.html","index.js","index.offline.html","index.icon.png","index.apple-touch-icon.png","index.worker.js","index.audio.worklet.js"];
+// Files that we might not want the user to preload, and will only be cached on first load.
+const CACHABLE_FILES = ["index.wasm","index.pck"];
+const FULL_CACHE = CACHED_FILES.concat(CACHABLE_FILES);
+
+self.addEventListener("install", (event) => {
+ event.waitUntil(caches.open(CACHE_NAME).then(cache => cache.addAll(CACHED_FILES)));
+});
+
+self.addEventListener("activate", (event) => {
+ event.waitUntil(caches.keys().then(
+ function (keys) {
+ // Remove old caches.
+ return Promise.all(keys.filter(key => key.startsWith(CACHE_PREFIX) && key != CACHE_NAME).map(key => caches.delete(key)));
+ }).then(function() {
+ // Enable navigation preload if available.
+ return ("navigationPreload" in self.registration) ? self.registration.navigationPreload.enable() : Promise.resolve();
+ })
+ );
+});
+
+async function fetchAndCache(event, cache, isCachable) {
+ // Use the preloaded response, if it's there
+ let response = await event.preloadResponse;
+ if (!response) {
+ // Or, go over network.
+ response = await self.fetch(event.request);
+ }
+ if (isCachable) {
+ // And update the cache
+ cache.put(event.request, response.clone());
+ }
+ return response;
+}
+
+self.addEventListener("fetch", (event) => {
+ const isNavigate = event.request.mode === "navigate";
+ const url = event.request.url || "";
+ const referrer = event.request.referrer || "";
+ const base = referrer.slice(0, referrer.lastIndexOf("/") + 1);
+ const local = url.startsWith(base) ? url.replace(base, "") : "";
+ const isCachable = FULL_CACHE.some(v => v === local) || (base === referrer && base.endsWith(CACHED_FILES[0]));
+ if (isNavigate || isCachable) {
+ event.respondWith(async function () {
+ // Try to use cache first
+ const cache = await caches.open(CACHE_NAME);
+ if (event.request.mode === "navigate") {
+ // Check if we have full cache during HTML page request.
+ const fullCache = await Promise.all(FULL_CACHE.map(name => cache.match(name)));
+ const missing = fullCache.some(v => v === undefined);
+ if (missing) {
+ try {
+ // Try network if some cached file is missing (so we can display offline page in case).
+ return await fetchAndCache(event, cache, isCachable);
+ } catch (e) {
+ // And return the hopefully always cached offline page in case of network failure.
+ console.error("Network error: ", e);
+ return await caches.match(OFFLINE_URL);
+ }
+ }
+ }
+ const cached = await cache.match(event.request);
+ if (cached) {
+ return cached;
+ } else {
+ // Try network if don't have it in cache.
+ return await fetchAndCache(event, cache, isCachable);
+ }
+ }());
+ }
+});
+
+self.addEventListener("message", (event) => {
+ // No cross origin
+ if (event.origin != self.origin) {
+ return;
+ }
+ const id = event.source.id || "";
+ const msg = event.data || "";
+ // Ensure it's one of our clients.
+ self.clients.get(id).then(function (client) {
+ if (!client) {
+ return; // Not a valid client.
+ }
+ if (msg === "claim") {
+ self.skipWaiting().then(() => self.clients.claim());
+ } else if (msg === "clear") {
+ caches.delete(CACHE_NAME);
+ } else if (msg === "update") {
+ self.skipWaiting().then(() => self.clients.claim()).then(() => self.clients.matchAll()).then(all => all.forEach(c => c.navigate(c.url)));
+ } else {
+ onClientMessage(event);
+ }
+ });
+});
+
diff --git a/early_access/index.wasm b/early_access/index.wasm
new file mode 100644
index 000000000000..52498442d12a
Binary files /dev/null and b/early_access/index.wasm differ
diff --git a/early_access/index.worker.js b/early_access/index.worker.js
new file mode 100644
index 000000000000..95147a2b80f1
--- /dev/null
+++ b/early_access/index.worker.js
@@ -0,0 +1,161 @@
+/**
+ * @license
+ * Copyright 2015 The Emscripten Authors
+ * SPDX-License-Identifier: MIT
+ */
+
+// Pthread Web Worker startup routine:
+// This is the entry point file that is loaded first by each Web Worker
+// that executes pthreads on the Emscripten application.
+
+'use strict';
+
+var Module = {};
+
+// Thread-local guard variable for one-time init of the JS state
+var initializedJS = false;
+
+function assert(condition, text) {
+ if (!condition) abort('Assertion failed: ' + text);
+}
+
+function threadPrintErr() {
+ var text = Array.prototype.slice.call(arguments).join(' ');
+ console.error(text);
+}
+function threadAlert() {
+ var text = Array.prototype.slice.call(arguments).join(' ');
+ postMessage({cmd: 'alert', text: text, threadId: Module['_pthread_self']()});
+}
+// We don't need out() for now, but may need to add it if we want to use it
+// here. Or, if this code all moves into the main JS, that problem will go
+// away. (For now, adding it here increases code size for no benefit.)
+var out = () => { throw 'out() is not defined in worker.js.'; }
+var err = threadPrintErr;
+self.alert = threadAlert;
+
+Module['instantiateWasm'] = (info, receiveInstance) => {
+ // Instantiate from the module posted from the main thread.
+ // We can just use sync instantiation in the worker.
+ var module = Module['wasmModule'];
+ // We don't need the module anymore; new threads will be spawned from the main thread.
+ Module['wasmModule'] = null;
+ var instance = new WebAssembly.Instance(module, info);
+ // TODO: Due to Closure regression https://github.com/google/closure-compiler/issues/3193,
+ // the above line no longer optimizes out down to the following line.
+ // When the regression is fixed, we can remove this if/else.
+ return receiveInstance(instance);
+}
+
+// Turn unhandled rejected promises into errors so that the main thread will be
+// notified about them.
+self.onunhandledrejection = (e) => {
+ throw e.reason ?? e;
+};
+
+function handleMessage(e) {
+ try {
+ if (e.data.cmd === 'load') { // Preload command that is called once per worker to parse and load the Emscripten code.
+
+ // Until we initialize the runtime, queue up any further incoming messages.
+ let messageQueue = [];
+ self.onmessage = (e) => messageQueue.push(e);
+
+ // And add a callback for when the runtime is initialized.
+ self.startWorker = (instance) => {
+ Module = instance;
+ // Notify the main thread that this thread has loaded.
+ postMessage({ 'cmd': 'loaded' });
+ // Process any messages that were queued before the thread was ready.
+ for (let msg of messageQueue) {
+ handleMessage(msg);
+ }
+ // Restore the real message handler.
+ self.onmessage = handleMessage;
+ };
+
+ // Module and memory were sent from main thread
+ Module['wasmModule'] = e.data.wasmModule;
+
+ // Use `const` here to ensure that the variable is scoped only to
+ // that iteration, allowing safe reference from a closure.
+ for (const handler of e.data.handlers) {
+ Module[handler] = function() {
+ postMessage({ cmd: 'callHandler', handler, args: [...arguments] });
+ }
+ }
+
+ Module['wasmMemory'] = e.data.wasmMemory;
+
+ Module['buffer'] = Module['wasmMemory'].buffer;
+
+ Module['workerID'] = e.data.workerID;
+
+ Module['ENVIRONMENT_IS_PTHREAD'] = true;
+
+ if (typeof e.data.urlOrBlob == 'string') {
+ importScripts(e.data.urlOrBlob);
+ } else {
+ var objectUrl = URL.createObjectURL(e.data.urlOrBlob);
+ importScripts(objectUrl);
+ URL.revokeObjectURL(objectUrl);
+ }
+ Godot(Module);
+ } else if (e.data.cmd === 'run') {
+ // Pass the thread address to wasm to store it for fast access.
+ Module['__emscripten_thread_init'](e.data.pthread_ptr, /*isMainBrowserThread=*/0, /*isMainRuntimeThread=*/0, /*canBlock=*/1);
+
+ // Await mailbox notifications with `Atomics.waitAsync` so we can start
+ // using the fast `Atomics.notify` notification path.
+ Module['__emscripten_thread_mailbox_await'](e.data.pthread_ptr);
+
+ assert(e.data.pthread_ptr);
+ // Also call inside JS module to set up the stack frame for this pthread in JS module scope
+ Module['establishStackSpace']();
+ Module['PThread'].receiveObjectTransfer(e.data);
+ Module['PThread'].threadInitTLS();
+
+ if (!initializedJS) {
+ initializedJS = true;
+ }
+
+ try {
+ Module['invokeEntryPoint'](e.data.start_routine, e.data.arg);
+ } catch(ex) {
+ if (ex != 'unwind') {
+ // The pthread "crashed". Do not call `_emscripten_thread_exit` (which
+ // would make this thread joinable). Instead, re-throw the exception
+ // and let the top level handler propagate it back to the main thread.
+ throw ex;
+ }
+ }
+ } else if (e.data.cmd === 'cancel') { // Main thread is asking for a pthread_cancel() on this thread.
+ if (Module['_pthread_self']()) {
+ Module['__emscripten_thread_exit'](-1);
+ }
+ } else if (e.data.target === 'setimmediate') {
+ // no-op
+ } else if (e.data.cmd === 'checkMailbox') {
+ if (initializedJS) {
+ Module['checkMailbox']();
+ }
+ } else if (e.data.cmd) {
+ // The received message looks like something that should be handled by this message
+ // handler, (since there is a e.data.cmd field present), but is not one of the
+ // recognized commands:
+ err('worker.js received unknown command ' + e.data.cmd);
+ err(e.data);
+ }
+ } catch(ex) {
+ err('worker.js onmessage() captured an uncaught exception: ' + ex);
+ if (ex && ex.stack) err(ex.stack);
+ if (Module['__emscripten_thread_crashed']) {
+ Module['__emscripten_thread_crashed']();
+ }
+ throw ex;
+ }
+};
+
+self.onmessage = handleMessage;
+
+
diff --git a/index.144x144.png b/index.144x144.png
new file mode 100644
index 000000000000..c8730bd3b285
Binary files /dev/null and b/index.144x144.png differ
diff --git a/index.180x180.png b/index.180x180.png
new file mode 100644
index 000000000000..a173b0820adb
Binary files /dev/null and b/index.180x180.png differ
diff --git a/index.512x512.png b/index.512x512.png
new file mode 100644
index 000000000000..b687b9f80178
Binary files /dev/null and b/index.512x512.png differ
diff --git a/index.apple-touch-icon.png b/index.apple-touch-icon.png
new file mode 100644
index 000000000000..a173b0820adb
Binary files /dev/null and b/index.apple-touch-icon.png differ
diff --git a/index.audio.worklet.js b/index.audio.worklet.js
new file mode 100644
index 000000000000..d9330c735f3d
--- /dev/null
+++ b/index.audio.worklet.js
@@ -0,0 +1,211 @@
+/**************************************************************************/
+/* audio.worklet.js */
+/**************************************************************************/
+/* This file is part of: */
+/* GODOT ENGINE */
+/* https://godotengine.org */
+/**************************************************************************/
+/* Copyright (c) 2014-present Godot Engine contributors (see AUTHORS.md). */
+/* Copyright (c) 2007-2014 Juan Linietsky, Ariel Manzur. */
+/* */
+/* Permission is hereby granted, free of charge, to any person obtaining */
+/* a copy of this software and associated documentation files (the */
+/* "Software"), to deal in the Software without restriction, including */
+/* without limitation the rights to use, copy, modify, merge, publish, */
+/* distribute, sublicense, and/or sell copies of the Software, and to */
+/* permit persons to whom the Software is furnished to do so, subject to */
+/* the following conditions: */
+/* */
+/* The above copyright notice and this permission notice shall be */
+/* included in all copies or substantial portions of the Software. */
+/* */
+/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */
+/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */
+/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. */
+/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */
+/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */
+/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */
+/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */
+/**************************************************************************/
+
+class RingBuffer {
+ constructor(p_buffer, p_state, p_threads) {
+ this.buffer = p_buffer;
+ this.avail = p_state;
+ this.threads = p_threads;
+ this.rpos = 0;
+ this.wpos = 0;
+ }
+
+ data_left() {
+ return this.threads ? Atomics.load(this.avail, 0) : this.avail;
+ }
+
+ space_left() {
+ return this.buffer.length - this.data_left();
+ }
+
+ read(output) {
+ const size = this.buffer.length;
+ let from = 0;
+ let to_write = output.length;
+ if (this.rpos + to_write > size) {
+ const high = size - this.rpos;
+ output.set(this.buffer.subarray(this.rpos, size));
+ from = high;
+ to_write -= high;
+ this.rpos = 0;
+ }
+ if (to_write) {
+ output.set(this.buffer.subarray(this.rpos, this.rpos + to_write), from);
+ }
+ this.rpos += to_write;
+ if (this.threads) {
+ Atomics.add(this.avail, 0, -output.length);
+ Atomics.notify(this.avail, 0);
+ } else {
+ this.avail -= output.length;
+ }
+ }
+
+ write(p_buffer) {
+ const to_write = p_buffer.length;
+ const mw = this.buffer.length - this.wpos;
+ if (mw >= to_write) {
+ this.buffer.set(p_buffer, this.wpos);
+ this.wpos += to_write;
+ if (mw === to_write) {
+ this.wpos = 0;
+ }
+ } else {
+ const high = p_buffer.subarray(0, mw);
+ const low = p_buffer.subarray(mw);
+ this.buffer.set(high, this.wpos);
+ this.buffer.set(low);
+ this.wpos = low.length;
+ }
+ if (this.threads) {
+ Atomics.add(this.avail, 0, to_write);
+ Atomics.notify(this.avail, 0);
+ } else {
+ this.avail += to_write;
+ }
+ }
+}
+
+class GodotProcessor extends AudioWorkletProcessor {
+ constructor() {
+ super();
+ this.threads = false;
+ this.running = true;
+ this.lock = null;
+ this.notifier = null;
+ this.output = null;
+ this.output_buffer = new Float32Array();
+ this.input = null;
+ this.input_buffer = new Float32Array();
+ this.port.onmessage = (event) => {
+ const cmd = event.data['cmd'];
+ const data = event.data['data'];
+ this.parse_message(cmd, data);
+ };
+ }
+
+ process_notify() {
+ if (this.notifier) {
+ Atomics.add(this.notifier, 0, 1);
+ Atomics.notify(this.notifier, 0);
+ }
+ }
+
+ parse_message(p_cmd, p_data) {
+ if (p_cmd === 'start' && p_data) {
+ const state = p_data[0];
+ let idx = 0;
+ this.threads = true;
+ this.lock = state.subarray(idx, ++idx);
+ this.notifier = state.subarray(idx, ++idx);
+ const avail_in = state.subarray(idx, ++idx);
+ const avail_out = state.subarray(idx, ++idx);
+ this.input = new RingBuffer(p_data[1], avail_in, true);
+ this.output = new RingBuffer(p_data[2], avail_out, true);
+ } else if (p_cmd === 'stop') {
+ this.running = false;
+ this.output = null;
+ this.input = null;
+ } else if (p_cmd === 'start_nothreads') {
+ this.output = new RingBuffer(p_data[0], p_data[0].length, false);
+ } else if (p_cmd === 'chunk') {
+ this.output.write(p_data);
+ }
+ }
+
+ static array_has_data(arr) {
+ return arr.length && arr[0].length && arr[0][0].length;
+ }
+
+ process(inputs, outputs, parameters) {
+ if (!this.running) {
+ return false; // Stop processing.
+ }
+ if (this.output === null) {
+ return true; // Not ready yet, keep processing.
+ }
+ const process_input = GodotProcessor.array_has_data(inputs);
+ if (process_input) {
+ const input = inputs[0];
+ const chunk = input[0].length * input.length;
+ if (this.input_buffer.length !== chunk) {
+ this.input_buffer = new Float32Array(chunk);
+ }
+ if (!this.threads) {
+ GodotProcessor.write_input(this.input_buffer, input);
+ this.port.postMessage({ 'cmd': 'input', 'data': this.input_buffer });
+ } else if (this.input.space_left() >= chunk) {
+ GodotProcessor.write_input(this.input_buffer, input);
+ this.input.write(this.input_buffer);
+ } else {
+ this.port.postMessage('Input buffer is full! Skipping input frame.');
+ }
+ }
+ const process_output = GodotProcessor.array_has_data(outputs);
+ if (process_output) {
+ const output = outputs[0];
+ const chunk = output[0].length * output.length;
+ if (this.output_buffer.length !== chunk) {
+ this.output_buffer = new Float32Array(chunk);
+ }
+ if (this.output.data_left() >= chunk) {
+ this.output.read(this.output_buffer);
+ GodotProcessor.write_output(output, this.output_buffer);
+ if (!this.threads) {
+ this.port.postMessage({ 'cmd': 'read', 'data': chunk });
+ }
+ } else {
+ this.port.postMessage('Output buffer has not enough frames! Skipping output frame.');
+ }
+ }
+ this.process_notify();
+ return true;
+ }
+
+ static write_output(dest, source) {
+ const channels = dest.length;
+ for (let ch = 0; ch < channels; ch++) {
+ for (let sample = 0; sample < dest[ch].length; sample++) {
+ dest[ch][sample] = source[sample * channels + ch];
+ }
+ }
+ }
+
+ static write_input(dest, source) {
+ const channels = source.length;
+ for (let ch = 0; ch < channels; ch++) {
+ for (let sample = 0; sample < source[ch].length; sample++) {
+ dest[sample * channels + ch] = source[ch][sample];
+ }
+ }
+ }
+}
+
+registerProcessor('godot-processor', GodotProcessor);
diff --git a/index.html b/index.html
new file mode 100644
index 000000000000..dd1127191098
--- /dev/null
+++ b/index.html
@@ -0,0 +1,249 @@
+
+
+
+
+
+ Pixelorama
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/index.icon.png b/index.icon.png
new file mode 100644
index 000000000000..0164c591acf7
Binary files /dev/null and b/index.icon.png differ
diff --git a/index.js b/index.js
new file mode 100644
index 000000000000..a34f13cca082
--- /dev/null
+++ b/index.js
@@ -0,0 +1,796 @@
+
+var Godot = (() => {
+ var _scriptDir = typeof document !== 'undefined' && document.currentScript ? document.currentScript.src : undefined;
+
+ return (
+function(Godot) {
+ Godot = Godot || {};
+
+var Module=typeof Godot!="undefined"?Godot:{};var readyPromiseResolve,readyPromiseReject;Module["ready"]=new Promise(function(resolve,reject){readyPromiseResolve=resolve;readyPromiseReject=reject});var moduleOverrides=Object.assign({},Module);var arguments_=[];var thisProgram="./this.program";var quit_=(status,toThrow)=>{throw toThrow};var ENVIRONMENT_IS_WEB=typeof window=="object";var ENVIRONMENT_IS_WORKER=typeof importScripts=="function";var ENVIRONMENT_IS_NODE=typeof process=="object"&&typeof process.versions=="object"&&typeof process.versions.node=="string";var scriptDirectory="";function locateFile(path){if(Module["locateFile"]){return Module["locateFile"](path,scriptDirectory)}return scriptDirectory+path}var read_,readAsync,readBinary,setWindowTitle;if(ENVIRONMENT_IS_WEB||ENVIRONMENT_IS_WORKER){if(ENVIRONMENT_IS_WORKER){scriptDirectory=self.location.href}else if(typeof document!="undefined"&&document.currentScript){scriptDirectory=document.currentScript.src}if(_scriptDir){scriptDirectory=_scriptDir}if(scriptDirectory.indexOf("blob:")!==0){scriptDirectory=scriptDirectory.substr(0,scriptDirectory.replace(/[?#].*/,"").lastIndexOf("/")+1)}else{scriptDirectory=""}{read_=url=>{var xhr=new XMLHttpRequest;xhr.open("GET",url,false);xhr.send(null);return xhr.responseText};if(ENVIRONMENT_IS_WORKER){readBinary=url=>{var xhr=new XMLHttpRequest;xhr.open("GET",url,false);xhr.responseType="arraybuffer";xhr.send(null);return new Uint8Array(xhr.response)}}readAsync=(url,onload,onerror)=>{var xhr=new XMLHttpRequest;xhr.open("GET",url,true);xhr.responseType="arraybuffer";xhr.onload=()=>{if(xhr.status==200||xhr.status==0&&xhr.response){onload(xhr.response);return}onerror()};xhr.onerror=onerror;xhr.send(null)}}setWindowTitle=title=>document.title=title}else{}var out=Module["print"]||console.log.bind(console);var err=Module["printErr"]||console.warn.bind(console);Object.assign(Module,moduleOverrides);moduleOverrides=null;if(Module["arguments"])arguments_=Module["arguments"];if(Module["thisProgram"])thisProgram=Module["thisProgram"];if(Module["quit"])quit_=Module["quit"];function warnOnce(text){if(!warnOnce.shown)warnOnce.shown={};if(!warnOnce.shown[text]){warnOnce.shown[text]=1;err(text)}}var tempRet0=0;var setTempRet0=value=>{tempRet0=value};var getTempRet0=()=>tempRet0;var wasmBinary;if(Module["wasmBinary"])wasmBinary=Module["wasmBinary"];var noExitRuntime=Module["noExitRuntime"]||false;if(typeof WebAssembly!="object"){abort("no native wasm support detected")}var wasmMemory;var ABORT=false;var EXITSTATUS;function assert(condition,text){if(!condition){abort(text)}}function getCFunc(ident){var func=Module["_"+ident];return func}function ccall(ident,returnType,argTypes,args,opts){var toC={"string":function(str){var ret=0;if(str!==null&&str!==undefined&&str!==0){var len=(str.length<<2)+1;ret=stackAlloc(len);stringToUTF8(str,ret,len)}return ret},"array":function(arr){var ret=stackAlloc(arr.length);writeArrayToMemory(arr,ret);return ret}};function convertReturnValue(ret){if(returnType==="string"){return UTF8ToString(ret)}if(returnType==="boolean")return Boolean(ret);return ret}var func=getCFunc(ident);var cArgs=[];var stack=0;if(args){for(var i=0;i=endIdx))++endPtr;if(endPtr-idx>16&&heapOrArray.buffer&&UTF8Decoder){return UTF8Decoder.decode(heapOrArray.subarray(idx,endPtr))}else{var str="";while(idx>10,56320|ch&1023)}}}return str}function UTF8ToString(ptr,maxBytesToRead){return ptr?UTF8ArrayToString(HEAPU8,ptr,maxBytesToRead):""}function stringToUTF8Array(str,heap,outIdx,maxBytesToWrite){if(!(maxBytesToWrite>0))return 0;var startIdx=outIdx;var endIdx=outIdx+maxBytesToWrite-1;for(var i=0;i=55296&&u<=57343){var u1=str.charCodeAt(++i);u=65536+((u&1023)<<10)|u1&1023}if(u<=127){if(outIdx>=endIdx)break;heap[outIdx++]=u}else if(u<=2047){if(outIdx+1>=endIdx)break;heap[outIdx++]=192|u>>6;heap[outIdx++]=128|u&63}else if(u<=65535){if(outIdx+2>=endIdx)break;heap[outIdx++]=224|u>>12;heap[outIdx++]=128|u>>6&63;heap[outIdx++]=128|u&63}else{if(outIdx+3>=endIdx)break;heap[outIdx++]=240|u>>18;heap[outIdx++]=128|u>>12&63;heap[outIdx++]=128|u>>6&63;heap[outIdx++]=128|u&63}}heap[outIdx]=0;return outIdx-startIdx}function stringToUTF8(str,outPtr,maxBytesToWrite){return stringToUTF8Array(str,HEAPU8,outPtr,maxBytesToWrite)}function lengthBytesUTF8(str){var len=0;for(var i=0;i=55296&&u<=57343)u=65536+((u&1023)<<10)|str.charCodeAt(++i)&1023;if(u<=127)++len;else if(u<=2047)len+=2;else if(u<=65535)len+=3;else len+=4}return len}function allocateUTF8(str){var size=lengthBytesUTF8(str)+1;var ret=_malloc(size);if(ret)stringToUTF8Array(str,HEAP8,ret,size);return ret}function allocateUTF8OnStack(str){var size=lengthBytesUTF8(str)+1;var ret=stackAlloc(size);stringToUTF8Array(str,HEAP8,ret,size);return ret}function writeArrayToMemory(array,buffer){HEAP8.set(array,buffer)}function writeAsciiToMemory(str,buffer,dontAddNull){for(var i=0;i>0]=str.charCodeAt(i)}if(!dontAddNull)HEAP8[buffer>>0]=0}var buffer,HEAP8,HEAPU8,HEAP16,HEAPU16,HEAP32,HEAPU32,HEAPF32,HEAPF64;function updateGlobalBufferAndViews(buf){buffer=buf;Module["HEAP8"]=HEAP8=new Int8Array(buf);Module["HEAP16"]=HEAP16=new Int16Array(buf);Module["HEAP32"]=HEAP32=new Int32Array(buf);Module["HEAPU8"]=HEAPU8=new Uint8Array(buf);Module["HEAPU16"]=HEAPU16=new Uint16Array(buf);Module["HEAPU32"]=HEAPU32=new Uint32Array(buf);Module["HEAPF32"]=HEAPF32=new Float32Array(buf);Module["HEAPF64"]=HEAPF64=new Float64Array(buf)}var INITIAL_MEMORY=Module["INITIAL_MEMORY"]||33554432;var wasmTable;var __ATPRERUN__=[];var __ATINIT__=[];var __ATMAIN__=[];var __ATEXIT__=[];var __ATPOSTRUN__=[];var runtimeInitialized=false;var runtimeExited=false;var runtimeKeepaliveCounter=0;function keepRuntimeAlive(){return noExitRuntime||runtimeKeepaliveCounter>0}function preRun(){if(Module["preRun"]){if(typeof Module["preRun"]=="function")Module["preRun"]=[Module["preRun"]];while(Module["preRun"].length){addOnPreRun(Module["preRun"].shift())}}callRuntimeCallbacks(__ATPRERUN__)}function initRuntime(){runtimeInitialized=true;if(!Module["noFSInit"]&&!FS.init.initialized)FS.init();FS.ignorePermissions=false;TTY.init();SOCKFS.root=FS.mount(SOCKFS,{},null);callRuntimeCallbacks(__ATINIT__)}function preMain(){callRuntimeCallbacks(__ATMAIN__)}function exitRuntime(){___funcs_on_exit();callRuntimeCallbacks(__ATEXIT__);FS.quit();TTY.shutdown();IDBFS.quit();runtimeExited=true}function postRun(){if(Module["postRun"]){if(typeof Module["postRun"]=="function")Module["postRun"]=[Module["postRun"]];while(Module["postRun"].length){addOnPostRun(Module["postRun"].shift())}}callRuntimeCallbacks(__ATPOSTRUN__)}function addOnPreRun(cb){__ATPRERUN__.unshift(cb)}function addOnInit(cb){__ATINIT__.unshift(cb)}function addOnPostRun(cb){__ATPOSTRUN__.unshift(cb)}var runDependencies=0;var runDependencyWatcher=null;var dependenciesFulfilled=null;function getUniqueRunDependency(id){return id}function addRunDependency(id){runDependencies++;if(Module["monitorRunDependencies"]){Module["monitorRunDependencies"](runDependencies)}}function removeRunDependency(id){runDependencies--;if(Module["monitorRunDependencies"]){Module["monitorRunDependencies"](runDependencies)}if(runDependencies==0){if(runDependencyWatcher!==null){clearInterval(runDependencyWatcher);runDependencyWatcher=null}if(dependenciesFulfilled){var callback=dependenciesFulfilled;dependenciesFulfilled=null;callback()}}}function abort(what){{if(Module["onAbort"]){Module["onAbort"](what)}}what="Aborted("+what+")";err(what);ABORT=true;EXITSTATUS=1;what+=". Build with -sASSERTIONS for more info.";var e=new WebAssembly.RuntimeError(what);readyPromiseReject(e);throw e}var dataURIPrefix="data:application/octet-stream;base64,";function isDataURI(filename){return filename.startsWith(dataURIPrefix)}var wasmBinaryFile;wasmBinaryFile="godot.javascript.opt.wasm";if(!isDataURI(wasmBinaryFile)){wasmBinaryFile=locateFile(wasmBinaryFile)}function getBinary(file){try{if(file==wasmBinaryFile&&wasmBinary){return new Uint8Array(wasmBinary)}if(readBinary){return readBinary(file)}else{throw"both async and sync fetching of the wasm failed"}}catch(err){abort(err)}}function getBinaryPromise(){if(!wasmBinary&&(ENVIRONMENT_IS_WEB||ENVIRONMENT_IS_WORKER)){if(typeof fetch=="function"){return fetch(wasmBinaryFile,{credentials:"same-origin"}).then(function(response){if(!response["ok"]){throw"failed to load wasm binary file at '"+wasmBinaryFile+"'"}return response["arrayBuffer"]()}).catch(function(){return getBinary(wasmBinaryFile)})}}return Promise.resolve().then(function(){return getBinary(wasmBinaryFile)})}function createWasm(){var info={"a":asmLibraryArg};function receiveInstance(instance,module){var exports=instance.exports;Module["asm"]=exports;wasmMemory=Module["asm"]["dk"];updateGlobalBufferAndViews(wasmMemory.buffer);wasmTable=Module["asm"]["rk"];addOnInit(Module["asm"]["ek"]);removeRunDependency("wasm-instantiate")}addRunDependency("wasm-instantiate");function receiveInstantiationResult(result){receiveInstance(result["instance"])}function instantiateArrayBuffer(receiver){return getBinaryPromise().then(function(binary){return WebAssembly.instantiate(binary,info)}).then(function(instance){return instance}).then(receiver,function(reason){err("failed to asynchronously prepare wasm: "+reason);abort(reason)})}function instantiateAsync(){if(!wasmBinary&&typeof WebAssembly.instantiateStreaming=="function"&&!isDataURI(wasmBinaryFile)&&typeof fetch=="function"){return fetch(wasmBinaryFile,{credentials:"same-origin"}).then(function(response){var result=WebAssembly.instantiateStreaming(response,info);return result.then(receiveInstantiationResult,function(reason){err("wasm streaming compile failed: "+reason);err("falling back to ArrayBuffer instantiation");return instantiateArrayBuffer(receiveInstantiationResult)})})}else{return instantiateArrayBuffer(receiveInstantiationResult)}}if(Module["instantiateWasm"]){try{var exports=Module["instantiateWasm"](info,receiveInstance);return exports}catch(e){err("Module.instantiateWasm callback failed with error: "+e);return false}}instantiateAsync().catch(readyPromiseReject);return{}}var tempDouble;var tempI64;function callRuntimeCallbacks(callbacks){while(callbacks.length>0){var callback=callbacks.shift();if(typeof callback=="function"){callback(Module);continue}var func=callback.func;if(typeof func=="number"){if(callback.arg===undefined){getWasmTableEntry(func)()}else{getWasmTableEntry(func)(callback.arg)}}else{func(callback.arg===undefined?null:callback.arg)}}}function getValue(ptr,type="i8"){if(type.endsWith("*"))type="i32";switch(type){case"i1":return HEAP8[ptr>>0];case"i8":return HEAP8[ptr>>0];case"i16":return HEAP16[ptr>>1];case"i32":return HEAP32[ptr>>2];case"i64":return HEAP32[ptr>>2];case"float":return HEAPF32[ptr>>2];case"double":return Number(HEAPF64[ptr>>3]);default:abort("invalid type for getValue: "+type)}return null}function getWasmTableEntry(funcPtr){return wasmTable.get(funcPtr)}function handleException(e){if(e instanceof ExitStatus||e=="unwind"){return EXITSTATUS}quit_(1,e)}function setValue(ptr,value,type="i8"){if(type.endsWith("*"))type="i32";switch(type){case"i1":HEAP8[ptr>>0]=value;break;case"i8":HEAP8[ptr>>0]=value;break;case"i16":HEAP16[ptr>>1]=value;break;case"i32":HEAP32[ptr>>2]=value;break;case"i64":tempI64=[value>>>0,(tempDouble=value,+Math.abs(tempDouble)>=1?tempDouble>0?(Math.min(+Math.floor(tempDouble/4294967296),4294967295)|0)>>>0:~~+Math.ceil((tempDouble-+(~~tempDouble>>>0))/4294967296)>>>0:0)],HEAP32[ptr>>2]=tempI64[0],HEAP32[ptr+4>>2]=tempI64[1];break;case"float":HEAPF32[ptr>>2]=value;break;case"double":HEAPF64[ptr>>3]=value;break;default:abort("invalid type for setValue: "+type)}}function ___call_sighandler(fp,sig){getWasmTableEntry(fp)(sig)}var PATH={isAbs:path=>path.charAt(0)==="/",splitPath:filename=>{var splitPathRe=/^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/;return splitPathRe.exec(filename).slice(1)},normalizeArray:(parts,allowAboveRoot)=>{var up=0;for(var i=parts.length-1;i>=0;i--){var last=parts[i];if(last==="."){parts.splice(i,1)}else if(last===".."){parts.splice(i,1);up++}else if(up){parts.splice(i,1);up--}}if(allowAboveRoot){for(;up;up--){parts.unshift("..")}}return parts},normalize:path=>{var isAbsolute=PATH.isAbs(path),trailingSlash=path.substr(-1)==="/";path=PATH.normalizeArray(path.split("/").filter(p=>!!p),!isAbsolute).join("/");if(!path&&!isAbsolute){path="."}if(path&&trailingSlash){path+="/"}return(isAbsolute?"/":"")+path},dirname:path=>{var result=PATH.splitPath(path),root=result[0],dir=result[1];if(!root&&!dir){return"."}if(dir){dir=dir.substr(0,dir.length-1)}return root+dir},basename:path=>{if(path==="/")return"/";path=PATH.normalize(path);path=path.replace(/\/$/,"");var lastSlash=path.lastIndexOf("/");if(lastSlash===-1)return path;return path.substr(lastSlash+1)},join:function(){var paths=Array.prototype.slice.call(arguments,0);return PATH.normalize(paths.join("/"))},join2:(l,r)=>{return PATH.normalize(l+"/"+r)}};function getRandomDevice(){if(typeof crypto=="object"&&typeof crypto["getRandomValues"]=="function"){var randomBuffer=new Uint8Array(1);return function(){crypto.getRandomValues(randomBuffer);return randomBuffer[0]}}else return function(){abort("randomDevice")}}var PATH_FS={resolve:function(){var resolvedPath="",resolvedAbsolute=false;for(var i=arguments.length-1;i>=-1&&!resolvedAbsolute;i--){var path=i>=0?arguments[i]:FS.cwd();if(typeof path!="string"){throw new TypeError("Arguments to path.resolve must be strings")}else if(!path){return""}resolvedPath=path+"/"+resolvedPath;resolvedAbsolute=PATH.isAbs(path)}resolvedPath=PATH.normalizeArray(resolvedPath.split("/").filter(p=>!!p),!resolvedAbsolute).join("/");return(resolvedAbsolute?"/":"")+resolvedPath||"."},relative:(from,to)=>{from=PATH_FS.resolve(from).substr(1);to=PATH_FS.resolve(to).substr(1);function trim(arr){var start=0;for(;start=0;end--){if(arr[end]!=="")break}if(start>end)return[];return arr.slice(start,end-start+1)}var fromParts=trim(from.split("/"));var toParts=trim(to.split("/"));var length=Math.min(fromParts.length,toParts.length);var samePartsLength=length;for(var i=0;i0){out(UTF8ArrayToString(tty.output,0));tty.output=[]}}},default_tty1_ops:{put_char:function(tty,val){if(val===null||val===10){err(UTF8ArrayToString(tty.output,0));tty.output=[]}else{if(val!=0)tty.output.push(val)}},flush:function(tty){if(tty.output&&tty.output.length>0){err(UTF8ArrayToString(tty.output,0));tty.output=[]}}}};function zeroMemory(address,size){HEAPU8.fill(0,address,address+size)}function mmapAlloc(size){abort()}var MEMFS={ops_table:null,mount:function(mount){return MEMFS.createNode(null,"/",16384|511,0)},createNode:function(parent,name,mode,dev){if(FS.isBlkdev(mode)||FS.isFIFO(mode)){throw new FS.ErrnoError(63)}if(!MEMFS.ops_table){MEMFS.ops_table={dir:{node:{getattr:MEMFS.node_ops.getattr,setattr:MEMFS.node_ops.setattr,lookup:MEMFS.node_ops.lookup,mknod:MEMFS.node_ops.mknod,rename:MEMFS.node_ops.rename,unlink:MEMFS.node_ops.unlink,rmdir:MEMFS.node_ops.rmdir,readdir:MEMFS.node_ops.readdir,symlink:MEMFS.node_ops.symlink},stream:{llseek:MEMFS.stream_ops.llseek}},file:{node:{getattr:MEMFS.node_ops.getattr,setattr:MEMFS.node_ops.setattr},stream:{llseek:MEMFS.stream_ops.llseek,read:MEMFS.stream_ops.read,write:MEMFS.stream_ops.write,allocate:MEMFS.stream_ops.allocate,mmap:MEMFS.stream_ops.mmap,msync:MEMFS.stream_ops.msync}},link:{node:{getattr:MEMFS.node_ops.getattr,setattr:MEMFS.node_ops.setattr,readlink:MEMFS.node_ops.readlink},stream:{}},chrdev:{node:{getattr:MEMFS.node_ops.getattr,setattr:MEMFS.node_ops.setattr},stream:FS.chrdev_stream_ops}}}var node=FS.createNode(parent,name,mode,dev);if(FS.isDir(node.mode)){node.node_ops=MEMFS.ops_table.dir.node;node.stream_ops=MEMFS.ops_table.dir.stream;node.contents={}}else if(FS.isFile(node.mode)){node.node_ops=MEMFS.ops_table.file.node;node.stream_ops=MEMFS.ops_table.file.stream;node.usedBytes=0;node.contents=null}else if(FS.isLink(node.mode)){node.node_ops=MEMFS.ops_table.link.node;node.stream_ops=MEMFS.ops_table.link.stream}else if(FS.isChrdev(node.mode)){node.node_ops=MEMFS.ops_table.chrdev.node;node.stream_ops=MEMFS.ops_table.chrdev.stream}node.timestamp=Date.now();if(parent){parent.contents[name]=node;parent.timestamp=node.timestamp}return node},getFileDataAsTypedArray:function(node){if(!node.contents)return new Uint8Array(0);if(node.contents.subarray)return node.contents.subarray(0,node.usedBytes);return new Uint8Array(node.contents)},expandFileStorage:function(node,newCapacity){var prevCapacity=node.contents?node.contents.length:0;if(prevCapacity>=newCapacity)return;var CAPACITY_DOUBLING_MAX=1024*1024;newCapacity=Math.max(newCapacity,prevCapacity*(prevCapacity>>0);if(prevCapacity!=0)newCapacity=Math.max(newCapacity,256);var oldContents=node.contents;node.contents=new Uint8Array(newCapacity);if(node.usedBytes>0)node.contents.set(oldContents.subarray(0,node.usedBytes),0)},resizeFileStorage:function(node,newSize){if(node.usedBytes==newSize)return;if(newSize==0){node.contents=null;node.usedBytes=0}else{var oldContents=node.contents;node.contents=new Uint8Array(newSize);if(oldContents){node.contents.set(oldContents.subarray(0,Math.min(newSize,node.usedBytes)))}node.usedBytes=newSize}},node_ops:{getattr:function(node){var attr={};attr.dev=FS.isChrdev(node.mode)?node.id:1;attr.ino=node.id;attr.mode=node.mode;attr.nlink=1;attr.uid=0;attr.gid=0;attr.rdev=node.rdev;if(FS.isDir(node.mode)){attr.size=4096}else if(FS.isFile(node.mode)){attr.size=node.usedBytes}else if(FS.isLink(node.mode)){attr.size=node.link.length}else{attr.size=0}attr.atime=new Date(node.timestamp);attr.mtime=new Date(node.timestamp);attr.ctime=new Date(node.timestamp);attr.blksize=4096;attr.blocks=Math.ceil(attr.size/attr.blksize);return attr},setattr:function(node,attr){if(attr.mode!==undefined){node.mode=attr.mode}if(attr.timestamp!==undefined){node.timestamp=attr.timestamp}if(attr.size!==undefined){MEMFS.resizeFileStorage(node,attr.size)}},lookup:function(parent,name){throw FS.genericErrors[44]},mknod:function(parent,name,mode,dev){return MEMFS.createNode(parent,name,mode,dev)},rename:function(old_node,new_dir,new_name){if(FS.isDir(old_node.mode)){var new_node;try{new_node=FS.lookupNode(new_dir,new_name)}catch(e){}if(new_node){for(var i in new_node.contents){throw new FS.ErrnoError(55)}}}delete old_node.parent.contents[old_node.name];old_node.parent.timestamp=Date.now();old_node.name=new_name;new_dir.contents[new_name]=old_node;new_dir.timestamp=old_node.parent.timestamp;old_node.parent=new_dir},unlink:function(parent,name){delete parent.contents[name];parent.timestamp=Date.now()},rmdir:function(parent,name){var node=FS.lookupNode(parent,name);for(var i in node.contents){throw new FS.ErrnoError(55)}delete parent.contents[name];parent.timestamp=Date.now()},readdir:function(node){var entries=[".",".."];for(var key in node.contents){if(!node.contents.hasOwnProperty(key)){continue}entries.push(key)}return entries},symlink:function(parent,newname,oldpath){var node=MEMFS.createNode(parent,newname,511|40960,0);node.link=oldpath;return node},readlink:function(node){if(!FS.isLink(node.mode)){throw new FS.ErrnoError(28)}return node.link}},stream_ops:{read:function(stream,buffer,offset,length,position){var contents=stream.node.contents;if(position>=stream.node.usedBytes)return 0;var size=Math.min(stream.node.usedBytes-position,length);if(size>8&&contents.subarray){buffer.set(contents.subarray(position,position+size),offset)}else{for(var i=0;i0||position+length{if(typeof indexedDB!="undefined")return indexedDB;var ret=null;if(typeof window=="object")ret=window.indexedDB||window.mozIndexedDB||window.webkitIndexedDB||window.msIndexedDB;assert(ret,"IDBFS used, but indexedDB not supported");return ret},DB_VERSION:21,DB_STORE_NAME:"FILE_DATA",mount:function(mount){return MEMFS.mount.apply(null,arguments)},syncfs:(mount,populate,callback)=>{IDBFS.getLocalSet(mount,(err,local)=>{if(err)return callback(err);IDBFS.getRemoteSet(mount,(err,remote)=>{if(err)return callback(err);var src=populate?remote:local;var dst=populate?local:remote;IDBFS.reconcile(src,dst,callback)})})},quit:()=>{Object.values(IDBFS.dbs).forEach(value=>value.close());IDBFS.dbs={}},getDB:(name,callback)=>{var db=IDBFS.dbs[name];if(db){return callback(null,db)}var req;try{req=IDBFS.indexedDB().open(name,IDBFS.DB_VERSION)}catch(e){return callback(e)}if(!req){return callback("Unable to connect to IndexedDB")}req.onupgradeneeded=e=>{var db=e.target.result;var transaction=e.target.transaction;var fileStore;if(db.objectStoreNames.contains(IDBFS.DB_STORE_NAME)){fileStore=transaction.objectStore(IDBFS.DB_STORE_NAME)}else{fileStore=db.createObjectStore(IDBFS.DB_STORE_NAME)}if(!fileStore.indexNames.contains("timestamp")){fileStore.createIndex("timestamp","timestamp",{unique:false})}};req.onsuccess=()=>{db=req.result;IDBFS.dbs[name]=db;callback(null,db)};req.onerror=e=>{callback(this.error);e.preventDefault()}},getLocalSet:(mount,callback)=>{var entries={};function isRealDir(p){return p!=="."&&p!==".."}function toAbsolute(root){return p=>{return PATH.join2(root,p)}}var check=FS.readdir(mount.mountpoint).filter(isRealDir).map(toAbsolute(mount.mountpoint));while(check.length){var path=check.pop();var stat;try{stat=FS.stat(path)}catch(e){return callback(e)}if(FS.isDir(stat.mode)){check.push.apply(check,FS.readdir(path).filter(isRealDir).map(toAbsolute(path)))}entries[path]={"timestamp":stat.mtime}}return callback(null,{type:"local",entries:entries})},getRemoteSet:(mount,callback)=>{var entries={};IDBFS.getDB(mount.mountpoint,(err,db)=>{if(err)return callback(err);try{var transaction=db.transaction([IDBFS.DB_STORE_NAME],"readonly");transaction.onerror=e=>{callback(this.error);e.preventDefault()};var store=transaction.objectStore(IDBFS.DB_STORE_NAME);var index=store.index("timestamp");index.openKeyCursor().onsuccess=event=>{var cursor=event.target.result;if(!cursor){return callback(null,{type:"remote",db:db,entries:entries})}entries[cursor.primaryKey]={"timestamp":cursor.key};cursor.continue()}}catch(e){return callback(e)}})},loadLocalEntry:(path,callback)=>{var stat,node;try{var lookup=FS.lookupPath(path);node=lookup.node;stat=FS.stat(path)}catch(e){return callback(e)}if(FS.isDir(stat.mode)){return callback(null,{"timestamp":stat.mtime,"mode":stat.mode})}else if(FS.isFile(stat.mode)){node.contents=MEMFS.getFileDataAsTypedArray(node);return callback(null,{"timestamp":stat.mtime,"mode":stat.mode,"contents":node.contents})}else{return callback(new Error("node type not supported"))}},storeLocalEntry:(path,entry,callback)=>{try{if(FS.isDir(entry["mode"])){FS.mkdirTree(path,entry["mode"])}else if(FS.isFile(entry["mode"])){FS.writeFile(path,entry["contents"],{canOwn:true})}else{return callback(new Error("node type not supported"))}FS.chmod(path,entry["mode"]);FS.utime(path,entry["timestamp"],entry["timestamp"])}catch(e){return callback(e)}callback(null)},removeLocalEntry:(path,callback)=>{try{var stat=FS.stat(path);if(FS.isDir(stat.mode)){FS.rmdir(path)}else if(FS.isFile(stat.mode)){FS.unlink(path)}}catch(e){return callback(e)}callback(null)},loadRemoteEntry:(store,path,callback)=>{var req=store.get(path);req.onsuccess=event=>{callback(null,event.target.result)};req.onerror=e=>{callback(this.error);e.preventDefault()}},storeRemoteEntry:(store,path,entry,callback)=>{try{var req=store.put(entry,path)}catch(e){callback(e);return}req.onsuccess=()=>{callback(null)};req.onerror=e=>{callback(this.error);e.preventDefault()}},removeRemoteEntry:(store,path,callback)=>{var req=store.delete(path);req.onsuccess=()=>{callback(null)};req.onerror=e=>{callback(this.error);e.preventDefault()}},reconcile:(src,dst,callback)=>{var total=0;var create=[];Object.keys(src.entries).forEach(function(key){var e=src.entries[key];var e2=dst.entries[key];if(!e2||e["timestamp"].getTime()!=e2["timestamp"].getTime()){create.push(key);total++}});var remove=[];Object.keys(dst.entries).forEach(function(key){if(!src.entries[key]){remove.push(key);total++}});if(!total){return callback(null)}var errored=false;var db=src.type==="remote"?src.db:dst.db;var transaction=db.transaction([IDBFS.DB_STORE_NAME],"readwrite");var store=transaction.objectStore(IDBFS.DB_STORE_NAME);function done(err){if(err&&!errored){errored=true;return callback(err)}}transaction.onerror=e=>{done(this.error);e.preventDefault()};transaction.oncomplete=e=>{if(!errored){callback(null)}};create.sort().forEach(path=>{if(dst.type==="local"){IDBFS.loadRemoteEntry(store,path,(err,entry)=>{if(err)return done(err);IDBFS.storeLocalEntry(path,entry,done)})}else{IDBFS.loadLocalEntry(path,(err,entry)=>{if(err)return done(err);IDBFS.storeRemoteEntry(store,path,entry,done)})}});remove.sort().reverse().forEach(path=>{if(dst.type==="local"){IDBFS.removeLocalEntry(path,done)}else{IDBFS.removeRemoteEntry(store,path,done)}})}};var FS={root:null,mounts:[],devices:{},streams:[],nextInode:1,nameTable:null,currentPath:"/",initialized:false,ignorePermissions:true,ErrnoError:null,genericErrors:{},filesystems:null,syncFSRequests:0,lookupPath:(path,opts={})=>{path=PATH_FS.resolve(FS.cwd(),path);if(!path)return{path:"",node:null};var defaults={follow_mount:true,recurse_count:0};opts=Object.assign(defaults,opts);if(opts.recurse_count>8){throw new FS.ErrnoError(32)}var parts=PATH.normalizeArray(path.split("/").filter(p=>!!p),false);var current=FS.root;var current_path="/";for(var i=0;i40){throw new FS.ErrnoError(32)}}}}return{path:current_path,node:current}},getPath:node=>{var path;while(true){if(FS.isRoot(node)){var mount=node.mount.mountpoint;if(!path)return mount;return mount[mount.length-1]!=="/"?mount+"/"+path:mount+path}path=path?node.name+"/"+path:node.name;node=node.parent}},hashName:(parentid,name)=>{var hash=0;for(var i=0;i>>0)%FS.nameTable.length},hashAddNode:node=>{var hash=FS.hashName(node.parent.id,node.name);node.name_next=FS.nameTable[hash];FS.nameTable[hash]=node},hashRemoveNode:node=>{var hash=FS.hashName(node.parent.id,node.name);if(FS.nameTable[hash]===node){FS.nameTable[hash]=node.name_next}else{var current=FS.nameTable[hash];while(current){if(current.name_next===node){current.name_next=node.name_next;break}current=current.name_next}}},lookupNode:(parent,name)=>{var errCode=FS.mayLookup(parent);if(errCode){throw new FS.ErrnoError(errCode,parent)}var hash=FS.hashName(parent.id,name);for(var node=FS.nameTable[hash];node;node=node.name_next){var nodeName=node.name;if(node.parent.id===parent.id&&nodeName===name){return node}}return FS.lookup(parent,name)},createNode:(parent,name,mode,rdev)=>{var node=new FS.FSNode(parent,name,mode,rdev);FS.hashAddNode(node);return node},destroyNode:node=>{FS.hashRemoveNode(node)},isRoot:node=>{return node===node.parent},isMountpoint:node=>{return!!node.mounted},isFile:mode=>{return(mode&61440)===32768},isDir:mode=>{return(mode&61440)===16384},isLink:mode=>{return(mode&61440)===40960},isChrdev:mode=>{return(mode&61440)===8192},isBlkdev:mode=>{return(mode&61440)===24576},isFIFO:mode=>{return(mode&61440)===4096},isSocket:mode=>{return(mode&49152)===49152},flagModes:{"r":0,"r+":2,"w":577,"w+":578,"a":1089,"a+":1090},modeStringToFlags:str=>{var flags=FS.flagModes[str];if(typeof flags=="undefined"){throw new Error("Unknown file open mode: "+str)}return flags},flagsToPermissionString:flag=>{var perms=["r","w","rw"][flag&3];if(flag&512){perms+="w"}return perms},nodePermissions:(node,perms)=>{if(FS.ignorePermissions){return 0}if(perms.includes("r")&&!(node.mode&292)){return 2}else if(perms.includes("w")&&!(node.mode&146)){return 2}else if(perms.includes("x")&&!(node.mode&73)){return 2}return 0},mayLookup:dir=>{var errCode=FS.nodePermissions(dir,"x");if(errCode)return errCode;if(!dir.node_ops.lookup)return 2;return 0},mayCreate:(dir,name)=>{try{var node=FS.lookupNode(dir,name);return 20}catch(e){}return FS.nodePermissions(dir,"wx")},mayDelete:(dir,name,isdir)=>{var node;try{node=FS.lookupNode(dir,name)}catch(e){return e.errno}var errCode=FS.nodePermissions(dir,"wx");if(errCode){return errCode}if(isdir){if(!FS.isDir(node.mode)){return 54}if(FS.isRoot(node)||FS.getPath(node)===FS.cwd()){return 10}}else{if(FS.isDir(node.mode)){return 31}}return 0},mayOpen:(node,flags)=>{if(!node){return 44}if(FS.isLink(node.mode)){return 32}else if(FS.isDir(node.mode)){if(FS.flagsToPermissionString(flags)!=="r"||flags&512){return 31}}return FS.nodePermissions(node,FS.flagsToPermissionString(flags))},MAX_OPEN_FDS:4096,nextfd:(fd_start=0,fd_end=FS.MAX_OPEN_FDS)=>{for(var fd=fd_start;fd<=fd_end;fd++){if(!FS.streams[fd]){return fd}}throw new FS.ErrnoError(33)},getStream:fd=>FS.streams[fd],createStream:(stream,fd_start,fd_end)=>{if(!FS.FSStream){FS.FSStream=function(){this.shared={}};FS.FSStream.prototype={};Object.defineProperties(FS.FSStream.prototype,{object:{get:function(){return this.node},set:function(val){this.node=val}},isRead:{get:function(){return(this.flags&2097155)!==1}},isWrite:{get:function(){return(this.flags&2097155)!==0}},isAppend:{get:function(){return this.flags&1024}},flags:{get:function(){return this.shared.flags},set:function(val){this.shared.flags=val}},position:{get:function(){return this.shared.position},set:function(val){this.shared.position=val}}})}stream=Object.assign(new FS.FSStream,stream);var fd=FS.nextfd(fd_start,fd_end);stream.fd=fd;FS.streams[fd]=stream;return stream},closeStream:fd=>{FS.streams[fd]=null},chrdev_stream_ops:{open:stream=>{var device=FS.getDevice(stream.node.rdev);stream.stream_ops=device.stream_ops;if(stream.stream_ops.open){stream.stream_ops.open(stream)}},llseek:()=>{throw new FS.ErrnoError(70)}},major:dev=>dev>>8,minor:dev=>dev&255,makedev:(ma,mi)=>ma<<8|mi,registerDevice:(dev,ops)=>{FS.devices[dev]={stream_ops:ops}},getDevice:dev=>FS.devices[dev],getMounts:mount=>{var mounts=[];var check=[mount];while(check.length){var m=check.pop();mounts.push(m);check.push.apply(check,m.mounts)}return mounts},syncfs:(populate,callback)=>{if(typeof populate=="function"){callback=populate;populate=false}FS.syncFSRequests++;if(FS.syncFSRequests>1){err("warning: "+FS.syncFSRequests+" FS.syncfs operations in flight at once, probably just doing extra work")}var mounts=FS.getMounts(FS.root.mount);var completed=0;function doCallback(errCode){FS.syncFSRequests--;return callback(errCode)}function done(errCode){if(errCode){if(!done.errored){done.errored=true;return doCallback(errCode)}return}if(++completed>=mounts.length){doCallback(null)}}mounts.forEach(mount=>{if(!mount.type.syncfs){return done(null)}mount.type.syncfs(mount,populate,done)})},mount:(type,opts,mountpoint)=>{var root=mountpoint==="/";var pseudo=!mountpoint;var node;if(root&&FS.root){throw new FS.ErrnoError(10)}else if(!root&&!pseudo){var lookup=FS.lookupPath(mountpoint,{follow_mount:false});mountpoint=lookup.path;node=lookup.node;if(FS.isMountpoint(node)){throw new FS.ErrnoError(10)}if(!FS.isDir(node.mode)){throw new FS.ErrnoError(54)}}var mount={type:type,opts:opts,mountpoint:mountpoint,mounts:[]};var mountRoot=type.mount(mount);mountRoot.mount=mount;mount.root=mountRoot;if(root){FS.root=mountRoot}else if(node){node.mounted=mount;if(node.mount){node.mount.mounts.push(mount)}}return mountRoot},unmount:mountpoint=>{var lookup=FS.lookupPath(mountpoint,{follow_mount:false});if(!FS.isMountpoint(lookup.node)){throw new FS.ErrnoError(28)}var node=lookup.node;var mount=node.mounted;var mounts=FS.getMounts(mount);Object.keys(FS.nameTable).forEach(hash=>{var current=FS.nameTable[hash];while(current){var next=current.name_next;if(mounts.includes(current.mount)){FS.destroyNode(current)}current=next}});node.mounted=null;var idx=node.mount.mounts.indexOf(mount);node.mount.mounts.splice(idx,1)},lookup:(parent,name)=>{return parent.node_ops.lookup(parent,name)},mknod:(path,mode,dev)=>{var lookup=FS.lookupPath(path,{parent:true});var parent=lookup.node;var name=PATH.basename(path);if(!name||name==="."||name===".."){throw new FS.ErrnoError(28)}var errCode=FS.mayCreate(parent,name);if(errCode){throw new FS.ErrnoError(errCode)}if(!parent.node_ops.mknod){throw new FS.ErrnoError(63)}return parent.node_ops.mknod(parent,name,mode,dev)},create:(path,mode)=>{mode=mode!==undefined?mode:438;mode&=4095;mode|=32768;return FS.mknod(path,mode,0)},mkdir:(path,mode)=>{mode=mode!==undefined?mode:511;mode&=511|512;mode|=16384;return FS.mknod(path,mode,0)},mkdirTree:(path,mode)=>{var dirs=path.split("/");var d="";for(var i=0;i{if(typeof dev=="undefined"){dev=mode;mode=438}mode|=8192;return FS.mknod(path,mode,dev)},symlink:(oldpath,newpath)=>{if(!PATH_FS.resolve(oldpath)){throw new FS.ErrnoError(44)}var lookup=FS.lookupPath(newpath,{parent:true});var parent=lookup.node;if(!parent){throw new FS.ErrnoError(44)}var newname=PATH.basename(newpath);var errCode=FS.mayCreate(parent,newname);if(errCode){throw new FS.ErrnoError(errCode)}if(!parent.node_ops.symlink){throw new FS.ErrnoError(63)}return parent.node_ops.symlink(parent,newname,oldpath)},rename:(old_path,new_path)=>{var old_dirname=PATH.dirname(old_path);var new_dirname=PATH.dirname(new_path);var old_name=PATH.basename(old_path);var new_name=PATH.basename(new_path);var lookup,old_dir,new_dir;lookup=FS.lookupPath(old_path,{parent:true});old_dir=lookup.node;lookup=FS.lookupPath(new_path,{parent:true});new_dir=lookup.node;if(!old_dir||!new_dir)throw new FS.ErrnoError(44);if(old_dir.mount!==new_dir.mount){throw new FS.ErrnoError(75)}var old_node=FS.lookupNode(old_dir,old_name);var relative=PATH_FS.relative(old_path,new_dirname);if(relative.charAt(0)!=="."){throw new FS.ErrnoError(28)}relative=PATH_FS.relative(new_path,old_dirname);if(relative.charAt(0)!=="."){throw new FS.ErrnoError(55)}var new_node;try{new_node=FS.lookupNode(new_dir,new_name)}catch(e){}if(old_node===new_node){return}var isdir=FS.isDir(old_node.mode);var errCode=FS.mayDelete(old_dir,old_name,isdir);if(errCode){throw new FS.ErrnoError(errCode)}errCode=new_node?FS.mayDelete(new_dir,new_name,isdir):FS.mayCreate(new_dir,new_name);if(errCode){throw new FS.ErrnoError(errCode)}if(!old_dir.node_ops.rename){throw new FS.ErrnoError(63)}if(FS.isMountpoint(old_node)||new_node&&FS.isMountpoint(new_node)){throw new FS.ErrnoError(10)}if(new_dir!==old_dir){errCode=FS.nodePermissions(old_dir,"w");if(errCode){throw new FS.ErrnoError(errCode)}}FS.hashRemoveNode(old_node);try{old_dir.node_ops.rename(old_node,new_dir,new_name)}catch(e){throw e}finally{FS.hashAddNode(old_node)}},rmdir:path=>{var lookup=FS.lookupPath(path,{parent:true});var parent=lookup.node;var name=PATH.basename(path);var node=FS.lookupNode(parent,name);var errCode=FS.mayDelete(parent,name,true);if(errCode){throw new FS.ErrnoError(errCode)}if(!parent.node_ops.rmdir){throw new FS.ErrnoError(63)}if(FS.isMountpoint(node)){throw new FS.ErrnoError(10)}parent.node_ops.rmdir(parent,name);FS.destroyNode(node)},readdir:path=>{var lookup=FS.lookupPath(path,{follow:true});var node=lookup.node;if(!node.node_ops.readdir){throw new FS.ErrnoError(54)}return node.node_ops.readdir(node)},unlink:path=>{var lookup=FS.lookupPath(path,{parent:true});var parent=lookup.node;if(!parent){throw new FS.ErrnoError(44)}var name=PATH.basename(path);var node=FS.lookupNode(parent,name);var errCode=FS.mayDelete(parent,name,false);if(errCode){throw new FS.ErrnoError(errCode)}if(!parent.node_ops.unlink){throw new FS.ErrnoError(63)}if(FS.isMountpoint(node)){throw new FS.ErrnoError(10)}parent.node_ops.unlink(parent,name);FS.destroyNode(node)},readlink:path=>{var lookup=FS.lookupPath(path);var link=lookup.node;if(!link){throw new FS.ErrnoError(44)}if(!link.node_ops.readlink){throw new FS.ErrnoError(28)}return PATH_FS.resolve(FS.getPath(link.parent),link.node_ops.readlink(link))},stat:(path,dontFollow)=>{var lookup=FS.lookupPath(path,{follow:!dontFollow});var node=lookup.node;if(!node){throw new FS.ErrnoError(44)}if(!node.node_ops.getattr){throw new FS.ErrnoError(63)}return node.node_ops.getattr(node)},lstat:path=>{return FS.stat(path,true)},chmod:(path,mode,dontFollow)=>{var node;if(typeof path=="string"){var lookup=FS.lookupPath(path,{follow:!dontFollow});node=lookup.node}else{node=path}if(!node.node_ops.setattr){throw new FS.ErrnoError(63)}node.node_ops.setattr(node,{mode:mode&4095|node.mode&~4095,timestamp:Date.now()})},lchmod:(path,mode)=>{FS.chmod(path,mode,true)},fchmod:(fd,mode)=>{var stream=FS.getStream(fd);if(!stream){throw new FS.ErrnoError(8)}FS.chmod(stream.node,mode)},chown:(path,uid,gid,dontFollow)=>{var node;if(typeof path=="string"){var lookup=FS.lookupPath(path,{follow:!dontFollow});node=lookup.node}else{node=path}if(!node.node_ops.setattr){throw new FS.ErrnoError(63)}node.node_ops.setattr(node,{timestamp:Date.now()})},lchown:(path,uid,gid)=>{FS.chown(path,uid,gid,true)},fchown:(fd,uid,gid)=>{var stream=FS.getStream(fd);if(!stream){throw new FS.ErrnoError(8)}FS.chown(stream.node,uid,gid)},truncate:(path,len)=>{if(len<0){throw new FS.ErrnoError(28)}var node;if(typeof path=="string"){var lookup=FS.lookupPath(path,{follow:true});node=lookup.node}else{node=path}if(!node.node_ops.setattr){throw new FS.ErrnoError(63)}if(FS.isDir(node.mode)){throw new FS.ErrnoError(31)}if(!FS.isFile(node.mode)){throw new FS.ErrnoError(28)}var errCode=FS.nodePermissions(node,"w");if(errCode){throw new FS.ErrnoError(errCode)}node.node_ops.setattr(node,{size:len,timestamp:Date.now()})},ftruncate:(fd,len)=>{var stream=FS.getStream(fd);if(!stream){throw new FS.ErrnoError(8)}if((stream.flags&2097155)===0){throw new FS.ErrnoError(28)}FS.truncate(stream.node,len)},utime:(path,atime,mtime)=>{var lookup=FS.lookupPath(path,{follow:true});var node=lookup.node;node.node_ops.setattr(node,{timestamp:Math.max(atime,mtime)})},open:(path,flags,mode)=>{if(path===""){throw new FS.ErrnoError(44)}flags=typeof flags=="string"?FS.modeStringToFlags(flags):flags;mode=typeof mode=="undefined"?438:mode;if(flags&64){mode=mode&4095|32768}else{mode=0}var node;if(typeof path=="object"){node=path}else{path=PATH.normalize(path);try{var lookup=FS.lookupPath(path,{follow:!(flags&131072)});node=lookup.node}catch(e){}}var created=false;if(flags&64){if(node){if(flags&128){throw new FS.ErrnoError(20)}}else{node=FS.mknod(path,mode,0);created=true}}if(!node){throw new FS.ErrnoError(44)}if(FS.isChrdev(node.mode)){flags&=~512}if(flags&65536&&!FS.isDir(node.mode)){throw new FS.ErrnoError(54)}if(!created){var errCode=FS.mayOpen(node,flags);if(errCode){throw new FS.ErrnoError(errCode)}}if(flags&512&&!created){FS.truncate(node,0)}flags&=~(128|512|131072);var stream=FS.createStream({node:node,path:FS.getPath(node),flags:flags,seekable:true,position:0,stream_ops:node.stream_ops,ungotten:[],error:false});if(stream.stream_ops.open){stream.stream_ops.open(stream)}if(Module["logReadFiles"]&&!(flags&1)){if(!FS.readFiles)FS.readFiles={};if(!(path in FS.readFiles)){FS.readFiles[path]=1}}return stream},close:stream=>{if(FS.isClosed(stream)){throw new FS.ErrnoError(8)}if(stream.getdents)stream.getdents=null;try{if(stream.stream_ops.close){stream.stream_ops.close(stream)}}catch(e){throw e}finally{FS.closeStream(stream.fd)}stream.fd=null},isClosed:stream=>{return stream.fd===null},llseek:(stream,offset,whence)=>{if(FS.isClosed(stream)){throw new FS.ErrnoError(8)}if(!stream.seekable||!stream.stream_ops.llseek){throw new FS.ErrnoError(70)}if(whence!=0&&whence!=1&&whence!=2){throw new FS.ErrnoError(28)}stream.position=stream.stream_ops.llseek(stream,offset,whence);stream.ungotten=[];return stream.position},read:(stream,buffer,offset,length,position)=>{if(length<0||position<0){throw new FS.ErrnoError(28)}if(FS.isClosed(stream)){throw new FS.ErrnoError(8)}if((stream.flags&2097155)===1){throw new FS.ErrnoError(8)}if(FS.isDir(stream.node.mode)){throw new FS.ErrnoError(31)}if(!stream.stream_ops.read){throw new FS.ErrnoError(28)}var seeking=typeof position!="undefined";if(!seeking){position=stream.position}else if(!stream.seekable){throw new FS.ErrnoError(70)}var bytesRead=stream.stream_ops.read(stream,buffer,offset,length,position);if(!seeking)stream.position+=bytesRead;return bytesRead},write:(stream,buffer,offset,length,position,canOwn)=>{if(length<0||position<0){throw new FS.ErrnoError(28)}if(FS.isClosed(stream)){throw new FS.ErrnoError(8)}if((stream.flags&2097155)===0){throw new FS.ErrnoError(8)}if(FS.isDir(stream.node.mode)){throw new FS.ErrnoError(31)}if(!stream.stream_ops.write){throw new FS.ErrnoError(28)}if(stream.seekable&&stream.flags&1024){FS.llseek(stream,0,2)}var seeking=typeof position!="undefined";if(!seeking){position=stream.position}else if(!stream.seekable){throw new FS.ErrnoError(70)}var bytesWritten=stream.stream_ops.write(stream,buffer,offset,length,position,canOwn);if(!seeking)stream.position+=bytesWritten;return bytesWritten},allocate:(stream,offset,length)=>{if(FS.isClosed(stream)){throw new FS.ErrnoError(8)}if(offset<0||length<=0){throw new FS.ErrnoError(28)}if((stream.flags&2097155)===0){throw new FS.ErrnoError(8)}if(!FS.isFile(stream.node.mode)&&!FS.isDir(stream.node.mode)){throw new FS.ErrnoError(43)}if(!stream.stream_ops.allocate){throw new FS.ErrnoError(138)}stream.stream_ops.allocate(stream,offset,length)},mmap:(stream,length,position,prot,flags)=>{if((prot&2)!==0&&(flags&2)===0&&(stream.flags&2097155)!==2){throw new FS.ErrnoError(2)}if((stream.flags&2097155)===1){throw new FS.ErrnoError(2)}if(!stream.stream_ops.mmap){throw new FS.ErrnoError(43)}return stream.stream_ops.mmap(stream,length,position,prot,flags)},msync:(stream,buffer,offset,length,mmapFlags)=>{if(!stream||!stream.stream_ops.msync){return 0}return stream.stream_ops.msync(stream,buffer,offset,length,mmapFlags)},munmap:stream=>0,ioctl:(stream,cmd,arg)=>{if(!stream.stream_ops.ioctl){throw new FS.ErrnoError(59)}return stream.stream_ops.ioctl(stream,cmd,arg)},readFile:(path,opts={})=>{opts.flags=opts.flags||0;opts.encoding=opts.encoding||"binary";if(opts.encoding!=="utf8"&&opts.encoding!=="binary"){throw new Error('Invalid encoding type "'+opts.encoding+'"')}var ret;var stream=FS.open(path,opts.flags);var stat=FS.stat(path);var length=stat.size;var buf=new Uint8Array(length);FS.read(stream,buf,0,length,0);if(opts.encoding==="utf8"){ret=UTF8ArrayToString(buf,0)}else if(opts.encoding==="binary"){ret=buf}FS.close(stream);return ret},writeFile:(path,data,opts={})=>{opts.flags=opts.flags||577;var stream=FS.open(path,opts.flags,opts.mode);if(typeof data=="string"){var buf=new Uint8Array(lengthBytesUTF8(data)+1);var actualNumBytes=stringToUTF8Array(data,buf,0,buf.length);FS.write(stream,buf,0,actualNumBytes,undefined,opts.canOwn)}else if(ArrayBuffer.isView(data)){FS.write(stream,data,0,data.byteLength,undefined,opts.canOwn)}else{throw new Error("Unsupported data type")}FS.close(stream)},cwd:()=>FS.currentPath,chdir:path=>{var lookup=FS.lookupPath(path,{follow:true});if(lookup.node===null){throw new FS.ErrnoError(44)}if(!FS.isDir(lookup.node.mode)){throw new FS.ErrnoError(54)}var errCode=FS.nodePermissions(lookup.node,"x");if(errCode){throw new FS.ErrnoError(errCode)}FS.currentPath=lookup.path},createDefaultDirectories:()=>{FS.mkdir("/tmp");FS.mkdir("/home");FS.mkdir("/home/web_user")},createDefaultDevices:()=>{FS.mkdir("/dev");FS.registerDevice(FS.makedev(1,3),{read:()=>0,write:(stream,buffer,offset,length,pos)=>length});FS.mkdev("/dev/null",FS.makedev(1,3));TTY.register(FS.makedev(5,0),TTY.default_tty_ops);TTY.register(FS.makedev(6,0),TTY.default_tty1_ops);FS.mkdev("/dev/tty",FS.makedev(5,0));FS.mkdev("/dev/tty1",FS.makedev(6,0));var random_device=getRandomDevice();FS.createDevice("/dev","random",random_device);FS.createDevice("/dev","urandom",random_device);FS.mkdir("/dev/shm");FS.mkdir("/dev/shm/tmp")},createSpecialDirectories:()=>{FS.mkdir("/proc");var proc_self=FS.mkdir("/proc/self");FS.mkdir("/proc/self/fd");FS.mount({mount:()=>{var node=FS.createNode(proc_self,"fd",16384|511,73);node.node_ops={lookup:(parent,name)=>{var fd=+name;var stream=FS.getStream(fd);if(!stream)throw new FS.ErrnoError(8);var ret={parent:null,mount:{mountpoint:"fake"},node_ops:{readlink:()=>stream.path}};ret.parent=ret;return ret}};return node}},{},"/proc/self/fd")},createStandardStreams:()=>{if(Module["stdin"]){FS.createDevice("/dev","stdin",Module["stdin"])}else{FS.symlink("/dev/tty","/dev/stdin")}if(Module["stdout"]){FS.createDevice("/dev","stdout",null,Module["stdout"])}else{FS.symlink("/dev/tty","/dev/stdout")}if(Module["stderr"]){FS.createDevice("/dev","stderr",null,Module["stderr"])}else{FS.symlink("/dev/tty1","/dev/stderr")}var stdin=FS.open("/dev/stdin",0);var stdout=FS.open("/dev/stdout",1);var stderr=FS.open("/dev/stderr",1)},ensureErrnoError:()=>{if(FS.ErrnoError)return;FS.ErrnoError=function ErrnoError(errno,node){this.node=node;this.setErrno=function(errno){this.errno=errno};this.setErrno(errno);this.message="FS error"};FS.ErrnoError.prototype=new Error;FS.ErrnoError.prototype.constructor=FS.ErrnoError;[44].forEach(code=>{FS.genericErrors[code]=new FS.ErrnoError(code);FS.genericErrors[code].stack=""})},staticInit:()=>{FS.ensureErrnoError();FS.nameTable=new Array(4096);FS.mount(MEMFS,{},"/");FS.createDefaultDirectories();FS.createDefaultDevices();FS.createSpecialDirectories();FS.filesystems={"MEMFS":MEMFS,"IDBFS":IDBFS}},init:(input,output,error)=>{FS.init.initialized=true;FS.ensureErrnoError();Module["stdin"]=input||Module["stdin"];Module["stdout"]=output||Module["stdout"];Module["stderr"]=error||Module["stderr"];FS.createStandardStreams()},quit:()=>{FS.init.initialized=false;_fflush(0);for(var i=0;i{var mode=0;if(canRead)mode|=292|73;if(canWrite)mode|=146;return mode},findObject:(path,dontResolveLastLink)=>{var ret=FS.analyzePath(path,dontResolveLastLink);if(ret.exists){return ret.object}else{return null}},analyzePath:(path,dontResolveLastLink)=>{try{var lookup=FS.lookupPath(path,{follow:!dontResolveLastLink});path=lookup.path}catch(e){}var ret={isRoot:false,exists:false,error:0,name:null,path:null,object:null,parentExists:false,parentPath:null,parentObject:null};try{var lookup=FS.lookupPath(path,{parent:true});ret.parentExists=true;ret.parentPath=lookup.path;ret.parentObject=lookup.node;ret.name=PATH.basename(path);lookup=FS.lookupPath(path,{follow:!dontResolveLastLink});ret.exists=true;ret.path=lookup.path;ret.object=lookup.node;ret.name=lookup.node.name;ret.isRoot=lookup.path==="/"}catch(e){ret.error=e.errno}return ret},createPath:(parent,path,canRead,canWrite)=>{parent=typeof parent=="string"?parent:FS.getPath(parent);var parts=path.split("/").reverse();while(parts.length){var part=parts.pop();if(!part)continue;var current=PATH.join2(parent,part);try{FS.mkdir(current)}catch(e){}parent=current}return current},createFile:(parent,name,properties,canRead,canWrite)=>{var path=PATH.join2(typeof parent=="string"?parent:FS.getPath(parent),name);var mode=FS.getMode(canRead,canWrite);return FS.create(path,mode)},createDataFile:(parent,name,data,canRead,canWrite,canOwn)=>{var path=name;if(parent){parent=typeof parent=="string"?parent:FS.getPath(parent);path=name?PATH.join2(parent,name):parent}var mode=FS.getMode(canRead,canWrite);var node=FS.create(path,mode);if(data){if(typeof data=="string"){var arr=new Array(data.length);for(var i=0,len=data.length;i{var path=PATH.join2(typeof parent=="string"?parent:FS.getPath(parent),name);var mode=FS.getMode(!!input,!!output);if(!FS.createDevice.major)FS.createDevice.major=64;var dev=FS.makedev(FS.createDevice.major++,0);FS.registerDevice(dev,{open:stream=>{stream.seekable=false},close:stream=>{if(output&&output.buffer&&output.buffer.length){output(10)}},read:(stream,buffer,offset,length,pos)=>{var bytesRead=0;for(var i=0;i{for(var i=0;i{if(obj.isDevice||obj.isFolder||obj.link||obj.contents)return true;if(typeof XMLHttpRequest!="undefined"){throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread.")}else if(read_){try{obj.contents=intArrayFromString(read_(obj.url),true);obj.usedBytes=obj.contents.length}catch(e){throw new FS.ErrnoError(29)}}else{throw new Error("Cannot load without read() or XMLHttpRequest.")}},createLazyFile:(parent,name,url,canRead,canWrite)=>{function LazyUint8Array(){this.lengthKnown=false;this.chunks=[]}LazyUint8Array.prototype.get=function LazyUint8Array_get(idx){if(idx>this.length-1||idx<0){return undefined}var chunkOffset=idx%this.chunkSize;var chunkNum=idx/this.chunkSize|0;return this.getter(chunkNum)[chunkOffset]};LazyUint8Array.prototype.setDataGetter=function LazyUint8Array_setDataGetter(getter){this.getter=getter};LazyUint8Array.prototype.cacheLength=function LazyUint8Array_cacheLength(){var xhr=new XMLHttpRequest;xhr.open("HEAD",url,false);xhr.send(null);if(!(xhr.status>=200&&xhr.status<300||xhr.status===304))throw new Error("Couldn't load "+url+". Status: "+xhr.status);var datalength=Number(xhr.getResponseHeader("Content-length"));var header;var hasByteServing=(header=xhr.getResponseHeader("Accept-Ranges"))&&header==="bytes";var usesGzip=(header=xhr.getResponseHeader("Content-Encoding"))&&header==="gzip";var chunkSize=1024*1024;if(!hasByteServing)chunkSize=datalength;var doXHR=(from,to)=>{if(from>to)throw new Error("invalid range ("+from+", "+to+") or no bytes requested!");if(to>datalength-1)throw new Error("only "+datalength+" bytes available! programmer error!");var xhr=new XMLHttpRequest;xhr.open("GET",url,false);if(datalength!==chunkSize)xhr.setRequestHeader("Range","bytes="+from+"-"+to);xhr.responseType="arraybuffer";if(xhr.overrideMimeType){xhr.overrideMimeType("text/plain; charset=x-user-defined")}xhr.send(null);if(!(xhr.status>=200&&xhr.status<300||xhr.status===304))throw new Error("Couldn't load "+url+". Status: "+xhr.status);if(xhr.response!==undefined){return new Uint8Array(xhr.response||[])}else{return intArrayFromString(xhr.responseText||"",true)}};var lazyArray=this;lazyArray.setDataGetter(chunkNum=>{var start=chunkNum*chunkSize;var end=(chunkNum+1)*chunkSize-1;end=Math.min(end,datalength-1);if(typeof lazyArray.chunks[chunkNum]=="undefined"){lazyArray.chunks[chunkNum]=doXHR(start,end)}if(typeof lazyArray.chunks[chunkNum]=="undefined")throw new Error("doXHR failed!");return lazyArray.chunks[chunkNum]});if(usesGzip||!datalength){chunkSize=datalength=1;datalength=this.getter(0).length;chunkSize=datalength;out("LazyFiles on gzip forces download of the whole file when length is accessed")}this._length=datalength;this._chunkSize=chunkSize;this.lengthKnown=true};if(typeof XMLHttpRequest!="undefined"){if(!ENVIRONMENT_IS_WORKER)throw"Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc";var lazyArray=new LazyUint8Array;Object.defineProperties(lazyArray,{length:{get:function(){if(!this.lengthKnown){this.cacheLength()}return this._length}},chunkSize:{get:function(){if(!this.lengthKnown){this.cacheLength()}return this._chunkSize}}});var properties={isDevice:false,contents:lazyArray}}else{var properties={isDevice:false,url:url}}var node=FS.createFile(parent,name,properties,canRead,canWrite);if(properties.contents){node.contents=properties.contents}else if(properties.url){node.contents=null;node.url=properties.url}Object.defineProperties(node,{usedBytes:{get:function(){return this.contents.length}}});var stream_ops={};var keys=Object.keys(node.stream_ops);keys.forEach(key=>{var fn=node.stream_ops[key];stream_ops[key]=function forceLoadLazyFile(){FS.forceLoadFile(node);return fn.apply(null,arguments)}});function writeChunks(stream,buffer,offset,length,position){var contents=stream.node.contents;if(position>=contents.length)return 0;var size=Math.min(contents.length-position,length);if(contents.slice){for(var i=0;i{FS.forceLoadFile(node);return writeChunks(stream,buffer,offset,length,position)};stream_ops.mmap=(stream,length,position,prot,flags)=>{FS.forceLoadFile(node);var ptr=mmapAlloc(length);if(!ptr){throw new FS.ErrnoError(48)}writeChunks(stream,HEAP8,ptr,length,position);return{ptr:ptr,allocated:true}};node.stream_ops=stream_ops;return node},createPreloadedFile:(parent,name,url,canRead,canWrite,onload,onerror,dontCreateFile,canOwn,preFinish)=>{var fullname=name?PATH_FS.resolve(PATH.join2(parent,name)):parent;var dep=getUniqueRunDependency("cp "+fullname);function processData(byteArray){function finish(byteArray){if(preFinish)preFinish();if(!dontCreateFile){FS.createDataFile(parent,name,byteArray,canRead,canWrite,canOwn)}if(onload)onload();removeRunDependency(dep)}if(Browser.handledByPreloadPlugin(byteArray,fullname,finish,()=>{if(onerror)onerror();removeRunDependency(dep)})){return}finish(byteArray)}addRunDependency(dep);if(typeof url=="string"){asyncLoad(url,byteArray=>processData(byteArray),onerror)}else{processData(url)}},indexedDB:()=>{return window.indexedDB||window.mozIndexedDB||window.webkitIndexedDB||window.msIndexedDB},DB_NAME:()=>{return"EM_FS_"+window.location.pathname},DB_VERSION:20,DB_STORE_NAME:"FILE_DATA",saveFilesToDB:(paths,onload,onerror)=>{onload=onload||(()=>{});onerror=onerror||(()=>{});var indexedDB=FS.indexedDB();try{var openRequest=indexedDB.open(FS.DB_NAME(),FS.DB_VERSION)}catch(e){return onerror(e)}openRequest.onupgradeneeded=()=>{out("creating db");var db=openRequest.result;db.createObjectStore(FS.DB_STORE_NAME)};openRequest.onsuccess=()=>{var db=openRequest.result;var transaction=db.transaction([FS.DB_STORE_NAME],"readwrite");var files=transaction.objectStore(FS.DB_STORE_NAME);var ok=0,fail=0,total=paths.length;function finish(){if(fail==0)onload();else onerror()}paths.forEach(path=>{var putRequest=files.put(FS.analyzePath(path).object.contents,path);putRequest.onsuccess=()=>{ok++;if(ok+fail==total)finish()};putRequest.onerror=()=>{fail++;if(ok+fail==total)finish()}});transaction.onerror=onerror};openRequest.onerror=onerror},loadFilesFromDB:(paths,onload,onerror)=>{onload=onload||(()=>{});onerror=onerror||(()=>{});var indexedDB=FS.indexedDB();try{var openRequest=indexedDB.open(FS.DB_NAME(),FS.DB_VERSION)}catch(e){return onerror(e)}openRequest.onupgradeneeded=onerror;openRequest.onsuccess=()=>{var db=openRequest.result;try{var transaction=db.transaction([FS.DB_STORE_NAME],"readonly")}catch(e){onerror(e);return}var files=transaction.objectStore(FS.DB_STORE_NAME);var ok=0,fail=0,total=paths.length;function finish(){if(fail==0)onload();else onerror()}paths.forEach(path=>{var getRequest=files.get(path);getRequest.onsuccess=()=>{if(FS.analyzePath(path).exists){FS.unlink(path)}FS.createDataFile(PATH.dirname(path),PATH.basename(path),getRequest.result,true,true,true);ok++;if(ok+fail==total)finish()};getRequest.onerror=()=>{fail++;if(ok+fail==total)finish()}});transaction.onerror=onerror};openRequest.onerror=onerror}};var SYSCALLS={DEFAULT_POLLMASK:5,calculateAt:function(dirfd,path,allowEmpty){if(PATH.isAbs(path)){return path}var dir;if(dirfd===-100){dir=FS.cwd()}else{var dirstream=FS.getStream(dirfd);if(!dirstream)throw new FS.ErrnoError(8);dir=dirstream.path}if(path.length==0){if(!allowEmpty){throw new FS.ErrnoError(44)}return dir}return PATH.join2(dir,path)},doStat:function(func,path,buf){try{var stat=func(path)}catch(e){if(e&&e.node&&PATH.normalize(path)!==PATH.normalize(FS.getPath(e.node))){return-54}throw e}HEAP32[buf>>2]=stat.dev;HEAP32[buf+4>>2]=0;HEAP32[buf+8>>2]=stat.ino;HEAP32[buf+12>>2]=stat.mode;HEAP32[buf+16>>2]=stat.nlink;HEAP32[buf+20>>2]=stat.uid;HEAP32[buf+24>>2]=stat.gid;HEAP32[buf+28>>2]=stat.rdev;HEAP32[buf+32>>2]=0;tempI64=[stat.size>>>0,(tempDouble=stat.size,+Math.abs(tempDouble)>=1?tempDouble>0?(Math.min(+Math.floor(tempDouble/4294967296),4294967295)|0)>>>0:~~+Math.ceil((tempDouble-+(~~tempDouble>>>0))/4294967296)>>>0:0)],HEAP32[buf+40>>2]=tempI64[0],HEAP32[buf+44>>2]=tempI64[1];HEAP32[buf+48>>2]=4096;HEAP32[buf+52>>2]=stat.blocks;HEAP32[buf+56>>2]=stat.atime.getTime()/1e3|0;HEAP32[buf+60>>2]=0;HEAP32[buf+64>>2]=stat.mtime.getTime()/1e3|0;HEAP32[buf+68>>2]=0;HEAP32[buf+72>>2]=stat.ctime.getTime()/1e3|0;HEAP32[buf+76>>2]=0;tempI64=[stat.ino>>>0,(tempDouble=stat.ino,+Math.abs(tempDouble)>=1?tempDouble>0?(Math.min(+Math.floor(tempDouble/4294967296),4294967295)|0)>>>0:~~+Math.ceil((tempDouble-+(~~tempDouble>>>0))/4294967296)>>>0:0)],HEAP32[buf+80>>2]=tempI64[0],HEAP32[buf+84>>2]=tempI64[1];return 0},doMsync:function(addr,stream,len,flags,offset){var buffer=HEAPU8.slice(addr,addr+len);FS.msync(stream,buffer,offset,len,flags)},varargs:undefined,get:function(){SYSCALLS.varargs+=4;var ret=HEAP32[SYSCALLS.varargs-4>>2];return ret},getStr:function(ptr){var ret=UTF8ToString(ptr);return ret},getStreamFromFD:function(fd){var stream=FS.getStream(fd);if(!stream)throw new FS.ErrnoError(8);return stream}};function ___syscall__newselect(nfds,readfds,writefds,exceptfds,timeout){try{var total=0;var srcReadLow=readfds?HEAP32[readfds>>2]:0,srcReadHigh=readfds?HEAP32[readfds+4>>2]:0;var srcWriteLow=writefds?HEAP32[writefds>>2]:0,srcWriteHigh=writefds?HEAP32[writefds+4>>2]:0;var srcExceptLow=exceptfds?HEAP32[exceptfds>>2]:0,srcExceptHigh=exceptfds?HEAP32[exceptfds+4>>2]:0;var dstReadLow=0,dstReadHigh=0;var dstWriteLow=0,dstWriteHigh=0;var dstExceptLow=0,dstExceptHigh=0;var allLow=(readfds?HEAP32[readfds>>2]:0)|(writefds?HEAP32[writefds>>2]:0)|(exceptfds?HEAP32[exceptfds>>2]:0);var allHigh=(readfds?HEAP32[readfds+4>>2]:0)|(writefds?HEAP32[writefds+4>>2]:0)|(exceptfds?HEAP32[exceptfds+4>>2]:0);var check=function(fd,low,high,val){return fd<32?low&val:high&val};for(var fd=0;fd>2]=dstReadLow;HEAP32[readfds+4>>2]=dstReadHigh}if(writefds){HEAP32[writefds>>2]=dstWriteLow;HEAP32[writefds+4>>2]=dstWriteHigh}if(exceptfds){HEAP32[exceptfds>>2]=dstExceptLow;HEAP32[exceptfds+4>>2]=dstExceptHigh}return total}catch(e){if(typeof FS=="undefined"||!(e instanceof FS.ErrnoError))throw e;return-e.errno}}var SOCKFS={mount:function(mount){Module["websocket"]=Module["websocket"]&&"object"===typeof Module["websocket"]?Module["websocket"]:{};Module["websocket"]._callbacks={};Module["websocket"]["on"]=function(event,callback){if("function"===typeof callback){this._callbacks[event]=callback}return this};Module["websocket"].emit=function(event,param){if("function"===typeof this._callbacks[event]){this._callbacks[event].call(this,param)}};return FS.createNode(null,"/",16384|511,0)},createSocket:function(family,type,protocol){type&=~526336;var streaming=type==1;if(streaming&&protocol&&protocol!=6){throw new FS.ErrnoError(66)}var sock={family:family,type:type,protocol:protocol,server:null,error:null,peers:{},pending:[],recv_queue:[],sock_ops:SOCKFS.websocket_sock_ops};var name=SOCKFS.nextname();var node=FS.createNode(SOCKFS.root,name,49152,0);node.sock=sock;var stream=FS.createStream({path:name,node:node,flags:2,seekable:false,stream_ops:SOCKFS.stream_ops});sock.stream=stream;return sock},getSocket:function(fd){var stream=FS.getStream(fd);if(!stream||!FS.isSocket(stream.node.mode)){return null}return stream.node.sock},stream_ops:{poll:function(stream){var sock=stream.node.sock;return sock.sock_ops.poll(sock)},ioctl:function(stream,request,varargs){var sock=stream.node.sock;return sock.sock_ops.ioctl(sock,request,varargs)},read:function(stream,buffer,offset,length,position){var sock=stream.node.sock;var msg=sock.sock_ops.recvmsg(sock,length);if(!msg){return 0}buffer.set(msg.buffer,offset);return msg.buffer.length},write:function(stream,buffer,offset,length,position){var sock=stream.node.sock;return sock.sock_ops.sendmsg(sock,buffer,offset,length)},close:function(stream){var sock=stream.node.sock;sock.sock_ops.close(sock)}},nextname:function(){if(!SOCKFS.nextname.current){SOCKFS.nextname.current=0}return"socket["+SOCKFS.nextname.current+++"]"},websocket_sock_ops:{createPeer:function(sock,addr,port){var ws;if(typeof addr=="object"){ws=addr;addr=null;port=null}if(ws){if(ws._socket){addr=ws._socket.remoteAddress;port=ws._socket.remotePort}else{var result=/ws[s]?:\/\/([^:]+):(\d+)/.exec(ws.url);if(!result){throw new Error("WebSocket URL must be in the format ws(s)://address:port")}addr=result[1];port=parseInt(result[2],10)}}else{try{var runtimeConfig=Module["websocket"]&&"object"===typeof Module["websocket"];var url="ws:#".replace("#","//");if(runtimeConfig){if("string"===typeof Module["websocket"]["url"]){url=Module["websocket"]["url"]}}if(url==="ws://"||url==="wss://"){var parts=addr.split("/");url=url+parts[0]+":"+port+"/"+parts.slice(1).join("/")}var subProtocols="binary";if(runtimeConfig){if("string"===typeof Module["websocket"]["subprotocol"]){subProtocols=Module["websocket"]["subprotocol"]}}var opts=undefined;if(subProtocols!=="null"){subProtocols=subProtocols.replace(/^ +| +$/g,"").split(/ *, */);opts=subProtocols}if(runtimeConfig&&null===Module["websocket"]["subprotocol"]){subProtocols="null";opts=undefined}var WebSocketConstructor;{WebSocketConstructor=WebSocket}ws=new WebSocketConstructor(url,opts);ws.binaryType="arraybuffer"}catch(e){throw new FS.ErrnoError(23)}}var peer={addr:addr,port:port,socket:ws,dgram_send_queue:[]};SOCKFS.websocket_sock_ops.addPeer(sock,peer);SOCKFS.websocket_sock_ops.handlePeerEvents(sock,peer);if(sock.type===2&&typeof sock.sport!="undefined"){peer.dgram_send_queue.push(new Uint8Array([255,255,255,255,"p".charCodeAt(0),"o".charCodeAt(0),"r".charCodeAt(0),"t".charCodeAt(0),(sock.sport&65280)>>8,sock.sport&255]))}return peer},getPeer:function(sock,addr,port){return sock.peers[addr+":"+port]},addPeer:function(sock,peer){sock.peers[peer.addr+":"+peer.port]=peer},removePeer:function(sock,peer){delete sock.peers[peer.addr+":"+peer.port]},handlePeerEvents:function(sock,peer){var first=true;var handleOpen=function(){Module["websocket"].emit("open",sock.stream.fd);try{var queued=peer.dgram_send_queue.shift();while(queued){peer.socket.send(queued);queued=peer.dgram_send_queue.shift()}}catch(e){peer.socket.close()}};function handleMessage(data){if(typeof data=="string"){var encoder=new TextEncoder;data=encoder.encode(data)}else{assert(data.byteLength!==undefined);if(data.byteLength==0){return}else{data=new Uint8Array(data)}}var wasfirst=first;first=false;if(wasfirst&&data.length===10&&data[0]===255&&data[1]===255&&data[2]===255&&data[3]===255&&data[4]==="p".charCodeAt(0)&&data[5]==="o".charCodeAt(0)&&data[6]==="r".charCodeAt(0)&&data[7]==="t".charCodeAt(0)){var newport=data[8]<<8|data[9];SOCKFS.websocket_sock_ops.removePeer(sock,peer);peer.port=newport;SOCKFS.websocket_sock_ops.addPeer(sock,peer);return}sock.recv_queue.push({addr:peer.addr,port:peer.port,data:data});Module["websocket"].emit("message",sock.stream.fd)}if(ENVIRONMENT_IS_NODE){peer.socket.on("open",handleOpen);peer.socket.on("message",function(data,isBinary){if(!isBinary){return}handleMessage(new Uint8Array(data).buffer)});peer.socket.on("close",function(){Module["websocket"].emit("close",sock.stream.fd)});peer.socket.on("error",function(error){sock.error=14;Module["websocket"].emit("error",[sock.stream.fd,sock.error,"ECONNREFUSED: Connection refused"])})}else{peer.socket.onopen=handleOpen;peer.socket.onclose=function(){Module["websocket"].emit("close",sock.stream.fd)};peer.socket.onmessage=function peer_socket_onmessage(event){handleMessage(event.data)};peer.socket.onerror=function(error){sock.error=14;Module["websocket"].emit("error",[sock.stream.fd,sock.error,"ECONNREFUSED: Connection refused"])}}},poll:function(sock){if(sock.type===1&&sock.server){return sock.pending.length?64|1:0}var mask=0;var dest=sock.type===1?SOCKFS.websocket_sock_ops.getPeer(sock,sock.daddr,sock.dport):null;if(sock.recv_queue.length||!dest||dest&&dest.socket.readyState===dest.socket.CLOSING||dest&&dest.socket.readyState===dest.socket.CLOSED){mask|=64|1}if(!dest||dest&&dest.socket.readyState===dest.socket.OPEN){mask|=4}if(dest&&dest.socket.readyState===dest.socket.CLOSING||dest&&dest.socket.readyState===dest.socket.CLOSED){mask|=16}return mask},ioctl:function(sock,request,arg){switch(request){case 21531:var bytes=0;if(sock.recv_queue.length){bytes=sock.recv_queue[0].data.length}HEAP32[arg>>2]=bytes;return 0;default:return 28}},close:function(sock){if(sock.server){try{sock.server.close()}catch(e){}sock.server=null}var peers=Object.keys(sock.peers);for(var i=0;i>2]=value;return value}function inetPton4(str){var b=str.split(".");for(var i=0;i<4;i++){var tmp=Number(b[i]);if(isNaN(tmp))return null;b[i]=tmp}return(b[0]|b[1]<<8|b[2]<<16|b[3]<<24)>>>0}function jstoi_q(str){return parseInt(str)}function inetPton6(str){var words;var w,offset,z;var valid6regx=/^((?=.*::)(?!.*::.+::)(::)?([\dA-F]{1,4}:(:|\b)|){5}|([\dA-F]{1,4}:){6})((([\dA-F]{1,4}((?!\3)::|:\b|$))|(?!\2\3)){2}|(((2[0-4]|1\d|[1-9])?\d|25[0-5])\.?\b){4})$/i;var parts=[];if(!valid6regx.test(str)){return null}if(str==="::"){return[0,0,0,0,0,0,0,0]}if(str.startsWith("::")){str=str.replace("::","Z:")}else{str=str.replace("::",":Z:")}if(str.indexOf(".")>0){str=str.replace(new RegExp("[.]","g"),":");words=str.split(":");words[words.length-4]=jstoi_q(words[words.length-4])+jstoi_q(words[words.length-3])*256;words[words.length-3]=jstoi_q(words[words.length-2])+jstoi_q(words[words.length-1])*256;words=words.slice(0,words.length-2)}else{words=str.split(":")}offset=0;z=0;for(w=0;w>2]=16}HEAP16[sa>>1]=family;HEAP32[sa+4>>2]=addr;HEAP16[sa+2>>1]=_htons(port);break;case 10:addr=inetPton6(addr);zeroMemory(sa,28);if(addrlen){HEAP32[addrlen>>2]=28}HEAP32[sa>>2]=family;HEAP32[sa+8>>2]=addr[0];HEAP32[sa+12>>2]=addr[1];HEAP32[sa+16>>2]=addr[2];HEAP32[sa+20>>2]=addr[3];HEAP16[sa+2>>1]=_htons(port);break;default:return 5}return 0}var DNS={address_map:{id:1,addrs:{},names:{}},lookup_name:function(name){var res=inetPton4(name);if(res!==null){return name}res=inetPton6(name);if(res!==null){return name}var addr;if(DNS.address_map.addrs[name]){addr=DNS.address_map.addrs[name]}else{var id=DNS.address_map.id++;assert(id<65535,"exceeded max address mappings of 65535");addr="172.29."+(id&255)+"."+(id&65280);DNS.address_map.names[addr]=name;DNS.address_map.addrs[name]=addr}return addr},lookup_addr:function(addr){if(DNS.address_map.names[addr]){return DNS.address_map.names[addr]}return null}};function ___syscall_accept4(fd,addr,addrlen,flags){try{var sock=getSocketFromFD(fd);var newsock=sock.sock_ops.accept(sock);if(addr){var errno=writeSockaddr(addr,newsock.family,DNS.lookup_name(newsock.daddr),newsock.dport,addrlen)}return newsock.stream.fd}catch(e){if(typeof FS=="undefined"||!(e instanceof FS.ErrnoError))throw e;return-e.errno}}function inetNtop4(addr){return(addr&255)+"."+(addr>>8&255)+"."+(addr>>16&255)+"."+(addr>>24&255)}function inetNtop6(ints){var str="";var word=0;var longest=0;var lastzero=0;var zstart=0;var len=0;var i=0;var parts=[ints[0]&65535,ints[0]>>16,ints[1]&65535,ints[1]>>16,ints[2]&65535,ints[2]>>16,ints[3]&65535,ints[3]>>16];var hasipv4=true;var v4part="";for(i=0;i<5;i++){if(parts[i]!==0){hasipv4=false;break}}if(hasipv4){v4part=inetNtop4(parts[6]|parts[7]<<16);if(parts[5]===-1){str="::ffff:";str+=v4part;return str}if(parts[5]===0){str="::";if(v4part==="0.0.0.0")v4part="";if(v4part==="0.0.0.1")v4part="1";str+=v4part;return str}}for(word=0;word<8;word++){if(parts[word]===0){if(word-lastzero>1){len=0}lastzero=word;len++}if(len>longest){longest=len;zstart=word-longest+1}}for(word=0;word<8;word++){if(longest>1){if(parts[word]===0&&word>=zstart&&word>1];var port=_ntohs(HEAPU16[sa+2>>1]);var addr;switch(family){case 2:if(salen!==16){return{errno:28}}addr=HEAP32[sa+4>>2];addr=inetNtop4(addr);break;case 10:if(salen!==28){return{errno:28}}addr=[HEAP32[sa+8>>2],HEAP32[sa+12>>2],HEAP32[sa+16>>2],HEAP32[sa+20>>2]];addr=inetNtop6(addr);break;default:return{errno:5}}return{family:family,addr:addr,port:port}}function getSocketAddress(addrp,addrlen,allowNull){if(allowNull&&addrp===0)return null;var info=readSockaddr(addrp,addrlen);if(info.errno)throw new FS.ErrnoError(info.errno);info.addr=DNS.lookup_addr(info.addr)||info.addr;return info}function ___syscall_bind(fd,addr,addrlen){try{var sock=getSocketFromFD(fd);var info=getSocketAddress(addr,addrlen);sock.sock_ops.bind(sock,info.addr,info.port);return 0}catch(e){if(typeof FS=="undefined"||!(e instanceof FS.ErrnoError))throw e;return-e.errno}}function ___syscall_chdir(path){try{path=SYSCALLS.getStr(path);FS.chdir(path);return 0}catch(e){if(typeof FS=="undefined"||!(e instanceof FS.ErrnoError))throw e;return-e.errno}}function ___syscall_chmod(path,mode){try{path=SYSCALLS.getStr(path);FS.chmod(path,mode);return 0}catch(e){if(typeof FS=="undefined"||!(e instanceof FS.ErrnoError))throw e;return-e.errno}}function ___syscall_connect(fd,addr,addrlen){try{var sock=getSocketFromFD(fd);var info=getSocketAddress(addr,addrlen);sock.sock_ops.connect(sock,info.addr,info.port);return 0}catch(e){if(typeof FS=="undefined"||!(e instanceof FS.ErrnoError))throw e;return-e.errno}}function ___syscall_faccessat(dirfd,path,amode,flags){try{path=SYSCALLS.getStr(path);path=SYSCALLS.calculateAt(dirfd,path);if(amode&~7){return-28}var lookup=FS.lookupPath(path,{follow:true});var node=lookup.node;if(!node){return-44}var perms="";if(amode&4)perms+="r";if(amode&2)perms+="w";if(amode&1)perms+="x";if(perms&&FS.nodePermissions(node,perms)){return-2}return 0}catch(e){if(typeof FS=="undefined"||!(e instanceof FS.ErrnoError))throw e;return-e.errno}}function ___syscall_fcntl64(fd,cmd,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(fd);switch(cmd){case 0:{var arg=SYSCALLS.get();if(arg<0){return-28}var newStream;newStream=FS.createStream(stream,arg);return newStream.fd}case 1:case 2:return 0;case 3:return stream.flags;case 4:{var arg=SYSCALLS.get();stream.flags|=arg;return 0}case 5:{var arg=SYSCALLS.get();var offset=0;HEAP16[arg+offset>>1]=2;return 0}case 6:case 7:return 0;case 16:case 8:return-28;case 9:setErrNo(28);return-1;default:{return-28}}}catch(e){if(typeof FS=="undefined"||!(e instanceof FS.ErrnoError))throw e;return-e.errno}}function ___syscall_getcwd(buf,size){try{if(size===0)return-28;var cwd=FS.cwd();var cwdLengthInBytes=lengthBytesUTF8(cwd)+1;if(size>>0,(tempDouble=id,+Math.abs(tempDouble)>=1?tempDouble>0?(Math.min(+Math.floor(tempDouble/4294967296),4294967295)|0)>>>0:~~+Math.ceil((tempDouble-+(~~tempDouble>>>0))/4294967296)>>>0:0)],HEAP32[dirp+pos>>2]=tempI64[0],HEAP32[dirp+pos+4>>2]=tempI64[1];tempI64=[(idx+1)*struct_size>>>0,(tempDouble=(idx+1)*struct_size,+Math.abs(tempDouble)>=1?tempDouble>0?(Math.min(+Math.floor(tempDouble/4294967296),4294967295)|0)>>>0:~~+Math.ceil((tempDouble-+(~~tempDouble>>>0))/4294967296)>>>0:0)],HEAP32[dirp+pos+8>>2]=tempI64[0],HEAP32[dirp+pos+12>>2]=tempI64[1];HEAP16[dirp+pos+16>>1]=280;HEAP8[dirp+pos+18>>0]=type;stringToUTF8(name,dirp+pos+19,256);pos+=struct_size;idx+=1}FS.llseek(stream,idx*struct_size,0);return pos}catch(e){if(typeof FS=="undefined"||!(e instanceof FS.ErrnoError))throw e;return-e.errno}}function ___syscall_getsockname(fd,addr,addrlen){try{err("__syscall_getsockname "+fd);var sock=getSocketFromFD(fd);var errno=writeSockaddr(addr,sock.family,DNS.lookup_name(sock.saddr||"0.0.0.0"),sock.sport,addrlen);return 0}catch(e){if(typeof FS=="undefined"||!(e instanceof FS.ErrnoError))throw e;return-e.errno}}function ___syscall_getsockopt(fd,level,optname,optval,optlen){try{var sock=getSocketFromFD(fd);if(level===1){if(optname===4){HEAP32[optval>>2]=sock.error;HEAP32[optlen>>2]=4;sock.error=null;return 0}}return-50}catch(e){if(typeof FS=="undefined"||!(e instanceof FS.ErrnoError))throw e;return-e.errno}}function ___syscall_ioctl(fd,op,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(fd);switch(op){case 21509:case 21505:{if(!stream.tty)return-59;return 0}case 21510:case 21511:case 21512:case 21506:case 21507:case 21508:{if(!stream.tty)return-59;return 0}case 21519:{if(!stream.tty)return-59;var argp=SYSCALLS.get();HEAP32[argp>>2]=0;return 0}case 21520:{if(!stream.tty)return-59;return-28}case 21531:{var argp=SYSCALLS.get();return FS.ioctl(stream,op,argp)}case 21523:{if(!stream.tty)return-59;return 0}case 21524:{if(!stream.tty)return-59;return 0}default:abort("bad ioctl syscall "+op)}}catch(e){if(typeof FS=="undefined"||!(e instanceof FS.ErrnoError))throw e;return-e.errno}}function ___syscall_listen(fd,backlog){try{var sock=getSocketFromFD(fd);sock.sock_ops.listen(sock,backlog);return 0}catch(e){if(typeof FS=="undefined"||!(e instanceof FS.ErrnoError))throw e;return-e.errno}}function ___syscall_lstat64(path,buf){try{path=SYSCALLS.getStr(path);return SYSCALLS.doStat(FS.lstat,path,buf)}catch(e){if(typeof FS=="undefined"||!(e instanceof FS.ErrnoError))throw e;return-e.errno}}function ___syscall_mkdirat(dirfd,path,mode){try{path=SYSCALLS.getStr(path);path=SYSCALLS.calculateAt(dirfd,path);path=PATH.normalize(path);if(path[path.length-1]==="/")path=path.substr(0,path.length-1);FS.mkdir(path,mode,0);return 0}catch(e){if(typeof FS=="undefined"||!(e instanceof FS.ErrnoError))throw e;return-e.errno}}function ___syscall_newfstatat(dirfd,path,buf,flags){try{path=SYSCALLS.getStr(path);var nofollow=flags&256;var allowEmpty=flags&4096;flags=flags&~4352;path=SYSCALLS.calculateAt(dirfd,path,allowEmpty);return SYSCALLS.doStat(nofollow?FS.lstat:FS.stat,path,buf)}catch(e){if(typeof FS=="undefined"||!(e instanceof FS.ErrnoError))throw e;return-e.errno}}function ___syscall_openat(dirfd,path,flags,varargs){SYSCALLS.varargs=varargs;try{path=SYSCALLS.getStr(path);path=SYSCALLS.calculateAt(dirfd,path);var mode=varargs?SYSCALLS.get():0;return FS.open(path,flags,mode).fd}catch(e){if(typeof FS=="undefined"||!(e instanceof FS.ErrnoError))throw e;return-e.errno}}function ___syscall_poll(fds,nfds,timeout){try{var nonzero=0;for(var i=0;i>2];var events=HEAP16[pollfd+4>>1];var mask=32;var stream=FS.getStream(fd);if(stream){mask=SYSCALLS.DEFAULT_POLLMASK;if(stream.stream_ops.poll){mask=stream.stream_ops.poll(stream)}}mask&=events|8|16;if(mask)nonzero++;HEAP16[pollfd+6>>1]=mask}return nonzero}catch(e){if(typeof FS=="undefined"||!(e instanceof FS.ErrnoError))throw e;return-e.errno}}function ___syscall_readlinkat(dirfd,path,buf,bufsize){try{path=SYSCALLS.getStr(path);path=SYSCALLS.calculateAt(dirfd,path);if(bufsize<=0)return-28;var ret=FS.readlink(path);var len=Math.min(bufsize,lengthBytesUTF8(ret));var endChar=HEAP8[buf+len];stringToUTF8(ret,buf,bufsize+1);HEAP8[buf+len]=endChar;return len}catch(e){if(typeof FS=="undefined"||!(e instanceof FS.ErrnoError))throw e;return-e.errno}}function ___syscall_recvfrom(fd,buf,len,flags,addr,addrlen){try{var sock=getSocketFromFD(fd);var msg=sock.sock_ops.recvmsg(sock,len);if(!msg)return 0;if(addr){var errno=writeSockaddr(addr,sock.family,DNS.lookup_name(msg.addr),msg.port,addrlen)}HEAPU8.set(msg.buffer,buf);return msg.buffer.byteLength}catch(e){if(typeof FS=="undefined"||!(e instanceof FS.ErrnoError))throw e;return-e.errno}}function ___syscall_renameat(olddirfd,oldpath,newdirfd,newpath){try{oldpath=SYSCALLS.getStr(oldpath);newpath=SYSCALLS.getStr(newpath);oldpath=SYSCALLS.calculateAt(olddirfd,oldpath);newpath=SYSCALLS.calculateAt(newdirfd,newpath);FS.rename(oldpath,newpath);return 0}catch(e){if(typeof FS=="undefined"||!(e instanceof FS.ErrnoError))throw e;return-e.errno}}function ___syscall_rmdir(path){try{path=SYSCALLS.getStr(path);FS.rmdir(path);return 0}catch(e){if(typeof FS=="undefined"||!(e instanceof FS.ErrnoError))throw e;return-e.errno}}function ___syscall_sendto(fd,message,length,flags,addr,addr_len){try{var sock=getSocketFromFD(fd);var dest=getSocketAddress(addr,addr_len,true);if(!dest){return FS.write(sock.stream,HEAP8,message,length)}else{return sock.sock_ops.sendmsg(sock,HEAP8,message,length,dest.addr,dest.port)}}catch(e){if(typeof FS=="undefined"||!(e instanceof FS.ErrnoError))throw e;return-e.errno}}function ___syscall_socket(domain,type,protocol){try{var sock=SOCKFS.createSocket(domain,type,protocol);return sock.stream.fd}catch(e){if(typeof FS=="undefined"||!(e instanceof FS.ErrnoError))throw e;return-e.errno}}function ___syscall_stat64(path,buf){try{path=SYSCALLS.getStr(path);return SYSCALLS.doStat(FS.stat,path,buf)}catch(e){if(typeof FS=="undefined"||!(e instanceof FS.ErrnoError))throw e;return-e.errno}}function ___syscall_statfs64(path,size,buf){try{path=SYSCALLS.getStr(path);HEAP32[buf+4>>2]=4096;HEAP32[buf+40>>2]=4096;HEAP32[buf+8>>2]=1e6;HEAP32[buf+12>>2]=5e5;HEAP32[buf+16>>2]=5e5;HEAP32[buf+20>>2]=FS.nextInode;HEAP32[buf+24>>2]=1e6;HEAP32[buf+28>>2]=42;HEAP32[buf+44>>2]=2;HEAP32[buf+36>>2]=255;return 0}catch(e){if(typeof FS=="undefined"||!(e instanceof FS.ErrnoError))throw e;return-e.errno}}function ___syscall_symlink(target,linkpath){try{target=SYSCALLS.getStr(target);linkpath=SYSCALLS.getStr(linkpath);FS.symlink(target,linkpath);return 0}catch(e){if(typeof FS=="undefined"||!(e instanceof FS.ErrnoError))throw e;return-e.errno}}function ___syscall_unlinkat(dirfd,path,flags){try{path=SYSCALLS.getStr(path);path=SYSCALLS.calculateAt(dirfd,path);if(flags===0){FS.unlink(path)}else if(flags===512){FS.rmdir(path)}else{abort("Invalid flags passed to unlinkat")}return 0}catch(e){if(typeof FS=="undefined"||!(e instanceof FS.ErrnoError))throw e;return-e.errno}}function __dlinit(main_dso_handle){}var dlopenMissingError="To use dlopen, you need enable dynamic linking, see https://github.com/emscripten-core/emscripten/wiki/Linking";function __dlopen_js(filename,flag){abort(dlopenMissingError)}function __dlsym_js(handle,symbol){abort(dlopenMissingError)}function __emscripten_date_now(){return Date.now()}var nowIsMonotonic=true;function __emscripten_get_now_is_monotonic(){return nowIsMonotonic}function __emscripten_throw_longjmp(){throw Infinity}function __gmtime_js(time,tmPtr){var date=new Date(HEAP32[time>>2]*1e3);HEAP32[tmPtr>>2]=date.getUTCSeconds();HEAP32[tmPtr+4>>2]=date.getUTCMinutes();HEAP32[tmPtr+8>>2]=date.getUTCHours();HEAP32[tmPtr+12>>2]=date.getUTCDate();HEAP32[tmPtr+16>>2]=date.getUTCMonth();HEAP32[tmPtr+20>>2]=date.getUTCFullYear()-1900;HEAP32[tmPtr+24>>2]=date.getUTCDay();var start=Date.UTC(date.getUTCFullYear(),0,1,0,0,0,0);var yday=(date.getTime()-start)/(1e3*60*60*24)|0;HEAP32[tmPtr+28>>2]=yday}function __localtime_js(time,tmPtr){var date=new Date(HEAP32[time>>2]*1e3);HEAP32[tmPtr>>2]=date.getSeconds();HEAP32[tmPtr+4>>2]=date.getMinutes();HEAP32[tmPtr+8>>2]=date.getHours();HEAP32[tmPtr+12>>2]=date.getDate();HEAP32[tmPtr+16>>2]=date.getMonth();HEAP32[tmPtr+20>>2]=date.getFullYear()-1900;HEAP32[tmPtr+24>>2]=date.getDay();var start=new Date(date.getFullYear(),0,1);var yday=(date.getTime()-start.getTime())/(1e3*60*60*24)|0;HEAP32[tmPtr+28>>2]=yday;HEAP32[tmPtr+36>>2]=-(date.getTimezoneOffset()*60);var summerOffset=new Date(date.getFullYear(),6,1).getTimezoneOffset();var winterOffset=start.getTimezoneOffset();var dst=(summerOffset!=winterOffset&&date.getTimezoneOffset()==Math.min(winterOffset,summerOffset))|0;HEAP32[tmPtr+32>>2]=dst}function _tzset_impl(timezone,daylight,tzname){var currentYear=(new Date).getFullYear();var winter=new Date(currentYear,0,1);var summer=new Date(currentYear,6,1);var winterOffset=winter.getTimezoneOffset();var summerOffset=summer.getTimezoneOffset();var stdTimezoneOffset=Math.max(winterOffset,summerOffset);HEAP32[timezone>>2]=stdTimezoneOffset*60;HEAP32[daylight>>2]=Number(winterOffset!=summerOffset);function extractZone(date){var match=date.toTimeString().match(/\(([A-Za-z ]+)\)$/);return match?match[1]:"GMT"}var winterName=extractZone(winter);var summerName=extractZone(summer);var winterNamePtr=allocateUTF8(winterName);var summerNamePtr=allocateUTF8(summerName);if(summerOffset>2]=winterNamePtr;HEAPU32[tzname+4>>2]=summerNamePtr}else{HEAPU32[tzname>>2]=summerNamePtr;HEAPU32[tzname+4>>2]=winterNamePtr}}function __tzset_js(timezone,daylight,tzname){if(__tzset_js.called)return;__tzset_js.called=true;_tzset_impl(timezone,daylight,tzname)}function _abort(){abort("")}function _emscripten_set_main_loop_timing(mode,value){Browser.mainLoop.timingMode=mode;Browser.mainLoop.timingValue=value;if(!Browser.mainLoop.func){return 1}if(!Browser.mainLoop.running){runtimeKeepalivePush();Browser.mainLoop.running=true}if(mode==0){Browser.mainLoop.scheduler=function Browser_mainLoop_scheduler_setTimeout(){var timeUntilNextTick=Math.max(0,Browser.mainLoop.tickStartTime+value-_emscripten_get_now())|0;setTimeout(Browser.mainLoop.runner,timeUntilNextTick)};Browser.mainLoop.method="timeout"}else if(mode==1){Browser.mainLoop.scheduler=function Browser_mainLoop_scheduler_rAF(){Browser.requestAnimationFrame(Browser.mainLoop.runner)};Browser.mainLoop.method="rAF"}else if(mode==2){if(typeof setImmediate=="undefined"){var setImmediates=[];var emscriptenMainLoopMessageId="setimmediate";var Browser_setImmediate_messageHandler=function(event){if(event.data===emscriptenMainLoopMessageId||event.data.target===emscriptenMainLoopMessageId){event.stopPropagation();setImmediates.shift()()}};addEventListener("message",Browser_setImmediate_messageHandler,true);setImmediate=function Browser_emulated_setImmediate(func){setImmediates.push(func);if(ENVIRONMENT_IS_WORKER){if(Module["setImmediates"]===undefined)Module["setImmediates"]=[];Module["setImmediates"].push(func);postMessage({target:emscriptenMainLoopMessageId})}else postMessage(emscriptenMainLoopMessageId,"*")}}Browser.mainLoop.scheduler=function Browser_mainLoop_scheduler_setImmediate(){setImmediate(Browser.mainLoop.runner)};Browser.mainLoop.method="immediate"}return 0}var _emscripten_get_now;_emscripten_get_now=()=>performance.now();function _emscripten_webgl_do_commit_frame(){if(!GL.currentContext||!GL.currentContext.GLctx){return-3}if(GL.currentContext.defaultFbo){GL.blitOffscreenFramebuffer(GL.currentContext);return 0}if(!GL.currentContext.attributes.explicitSwapControl){return-3}return 0}function _emscripten_webgl_commit_frame(){return _emscripten_webgl_do_commit_frame()}function runtimeKeepalivePush(){runtimeKeepaliveCounter+=1}function _exit(status){exit(status)}function maybeExit(){if(!keepRuntimeAlive()){try{_exit(EXITSTATUS)}catch(e){handleException(e)}}}function setMainLoop(browserIterationFunc,fps,simulateInfiniteLoop,arg,noSetTiming){assert(!Browser.mainLoop.func,"emscripten_set_main_loop: there can only be one main loop function at once: call emscripten_cancel_main_loop to cancel the previous one before setting a new one with different parameters.");Browser.mainLoop.func=browserIterationFunc;Browser.mainLoop.arg=arg;var thisMainLoopId=Browser.mainLoop.currentlyRunningMainloop;function checkIsRunning(){if(thisMainLoopId0){var start=Date.now();var blocker=Browser.mainLoop.queue.shift();blocker.func(blocker.arg);if(Browser.mainLoop.remainingBlockers){var remaining=Browser.mainLoop.remainingBlockers;var next=remaining%1==0?remaining-1:Math.floor(remaining);if(blocker.counted){Browser.mainLoop.remainingBlockers=next}else{next=next+.5;Browser.mainLoop.remainingBlockers=(8*remaining+next)/9}}out('main loop blocker "'+blocker.name+'" took '+(Date.now()-start)+" ms");Browser.mainLoop.updateStatus();if(!checkIsRunning())return;setTimeout(Browser.mainLoop.runner,0);return}if(!checkIsRunning())return;Browser.mainLoop.currentFrameNumber=Browser.mainLoop.currentFrameNumber+1|0;if(Browser.mainLoop.timingMode==1&&Browser.mainLoop.timingValue>1&&Browser.mainLoop.currentFrameNumber%Browser.mainLoop.timingValue!=0){Browser.mainLoop.scheduler();return}else if(Browser.mainLoop.timingMode==0){Browser.mainLoop.tickStartTime=_emscripten_get_now()}Browser.mainLoop.runIter(browserIterationFunc);if(!checkIsRunning())return;if(typeof SDL=="object"&&SDL.audio&&SDL.audio.queueNewAudioData)SDL.audio.queueNewAudioData();Browser.mainLoop.scheduler()};if(!noSetTiming){if(fps&&fps>0)_emscripten_set_main_loop_timing(0,1e3/fps);else _emscripten_set_main_loop_timing(1,1);Browser.mainLoop.scheduler()}if(simulateInfiniteLoop){throw"unwind"}}function callUserCallback(func,synchronous){if(runtimeExited||ABORT){return}if(synchronous){func();return}try{func();maybeExit()}catch(e){handleException(e)}}function runtimeKeepalivePop(){runtimeKeepaliveCounter-=1}function safeSetTimeout(func,timeout){runtimeKeepalivePush();return setTimeout(function(){runtimeKeepalivePop();callUserCallback(func)},timeout)}var Browser={mainLoop:{running:false,scheduler:null,method:"",currentlyRunningMainloop:0,func:null,arg:0,timingMode:0,timingValue:0,currentFrameNumber:0,queue:[],pause:function(){Browser.mainLoop.scheduler=null;Browser.mainLoop.currentlyRunningMainloop++},resume:function(){Browser.mainLoop.currentlyRunningMainloop++;var timingMode=Browser.mainLoop.timingMode;var timingValue=Browser.mainLoop.timingValue;var func=Browser.mainLoop.func;Browser.mainLoop.func=null;setMainLoop(func,0,false,Browser.mainLoop.arg,true);_emscripten_set_main_loop_timing(timingMode,timingValue);Browser.mainLoop.scheduler()},updateStatus:function(){if(Module["setStatus"]){var message=Module["statusMessage"]||"Please wait...";var remaining=Browser.mainLoop.remainingBlockers;var expected=Browser.mainLoop.expectedBlockers;if(remaining){if(remaining{assert(img.complete,"Image "+name+" could not be decoded");var canvas=document.createElement("canvas");canvas.width=img.width;canvas.height=img.height;var ctx=canvas.getContext("2d");ctx.drawImage(img,0,0);preloadedImages[name]=canvas;Browser.URLObject.revokeObjectURL(url);if(onload)onload(byteArray)};img.onerror=event=>{out("Image "+url+" could not be decoded");if(onerror)onerror()};img.src=url};Module["preloadPlugins"].push(imagePlugin);var audioPlugin={};audioPlugin["canHandle"]=function audioPlugin_canHandle(name){return!Module.noAudioDecoding&&name.substr(-4)in{".ogg":1,".wav":1,".mp3":1}};audioPlugin["handle"]=function audioPlugin_handle(byteArray,name,onload,onerror){var done=false;function finish(audio){if(done)return;done=true;preloadedAudios[name]=audio;if(onload)onload(byteArray)}function fail(){if(done)return;done=true;preloadedAudios[name]=new Audio;if(onerror)onerror()}if(Browser.hasBlobConstructor){try{var b=new Blob([byteArray],{type:Browser.getMimetype(name)})}catch(e){return fail()}var url=Browser.URLObject.createObjectURL(b);var audio=new Audio;audio.addEventListener("canplaythrough",function(){finish(audio)},false);audio.onerror=function audio_onerror(event){if(done)return;out("warning: browser could not fully decode audio "+name+", trying slower base64 approach");function encode64(data){var BASE="ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/";var PAD="=";var ret="";var leftchar=0;var leftbits=0;for(var i=0;i=6){var curr=leftchar>>leftbits-6&63;leftbits-=6;ret+=BASE[curr]}}if(leftbits==2){ret+=BASE[(leftchar&3)<<4];ret+=PAD+PAD}else if(leftbits==4){ret+=BASE[(leftchar&15)<<2];ret+=PAD}return ret}audio.src="data:audio/x-"+name.substr(-3)+";base64,"+encode64(byteArray);finish(audio)};audio.src=url;safeSetTimeout(function(){finish(audio)},1e4)}else{return fail()}};Module["preloadPlugins"].push(audioPlugin);function pointerLockChange(){Browser.pointerLock=document["pointerLockElement"]===Module["canvas"]||document["mozPointerLockElement"]===Module["canvas"]||document["webkitPointerLockElement"]===Module["canvas"]||document["msPointerLockElement"]===Module["canvas"]}var canvas=Module["canvas"];if(canvas){canvas.requestPointerLock=canvas["requestPointerLock"]||canvas["mozRequestPointerLock"]||canvas["webkitRequestPointerLock"]||canvas["msRequestPointerLock"]||function(){};canvas.exitPointerLock=document["exitPointerLock"]||document["mozExitPointerLock"]||document["webkitExitPointerLock"]||document["msExitPointerLock"]||function(){};canvas.exitPointerLock=canvas.exitPointerLock.bind(document);document.addEventListener("pointerlockchange",pointerLockChange,false);document.addEventListener("mozpointerlockchange",pointerLockChange,false);document.addEventListener("webkitpointerlockchange",pointerLockChange,false);document.addEventListener("mspointerlockchange",pointerLockChange,false);if(Module["elementPointerLock"]){canvas.addEventListener("click",function(ev){if(!Browser.pointerLock&&Module["canvas"].requestPointerLock){Module["canvas"].requestPointerLock();ev.preventDefault()}},false)}}},handledByPreloadPlugin:function(byteArray,fullname,finish,onerror){Browser.init();var handled=false;Module["preloadPlugins"].forEach(function(plugin){if(handled)return;if(plugin["canHandle"](fullname)){plugin["handle"](byteArray,fullname,finish,onerror);handled=true}});return handled},createContext:function(canvas,useWebGL,setInModule,webGLContextAttributes){if(useWebGL&&Module.ctx&&canvas==Module.canvas)return Module.ctx;var ctx;var contextHandle;if(useWebGL){var contextAttributes={antialias:false,alpha:false,majorVersion:typeof WebGL2RenderingContext!="undefined"?2:1};if(webGLContextAttributes){for(var attribute in webGLContextAttributes){contextAttributes[attribute]=webGLContextAttributes[attribute]}}if(typeof GL!="undefined"){contextHandle=GL.createContext(canvas,contextAttributes);if(contextHandle){ctx=GL.getContext(contextHandle).GLctx}}}else{ctx=canvas.getContext("2d")}if(!ctx)return null;if(setInModule){if(!useWebGL)assert(typeof GLctx=="undefined","cannot set in module if GLctx is used, but we are a non-GL context that would replace it");Module.ctx=ctx;if(useWebGL)GL.makeContextCurrent(contextHandle);Module.useWebGL=useWebGL;Browser.moduleContextCreatedCallbacks.forEach(function(callback){callback()});Browser.init()}return ctx},destroyContext:function(canvas,useWebGL,setInModule){},fullscreenHandlersInstalled:false,lockPointer:undefined,resizeCanvas:undefined,requestFullscreen:function(lockPointer,resizeCanvas){Browser.lockPointer=lockPointer;Browser.resizeCanvas=resizeCanvas;if(typeof Browser.lockPointer=="undefined")Browser.lockPointer=true;if(typeof Browser.resizeCanvas=="undefined")Browser.resizeCanvas=false;var canvas=Module["canvas"];function fullscreenChange(){Browser.isFullscreen=false;var canvasContainer=canvas.parentNode;if((document["fullscreenElement"]||document["mozFullScreenElement"]||document["msFullscreenElement"]||document["webkitFullscreenElement"]||document["webkitCurrentFullScreenElement"])===canvasContainer){canvas.exitFullscreen=Browser.exitFullscreen;if(Browser.lockPointer)canvas.requestPointerLock();Browser.isFullscreen=true;if(Browser.resizeCanvas){Browser.setFullscreenCanvasSize()}else{Browser.updateCanvasDimensions(canvas)}}else{canvasContainer.parentNode.insertBefore(canvas,canvasContainer);canvasContainer.parentNode.removeChild(canvasContainer);if(Browser.resizeCanvas){Browser.setWindowedCanvasSize()}else{Browser.updateCanvasDimensions(canvas)}}if(Module["onFullScreen"])Module["onFullScreen"](Browser.isFullscreen);if(Module["onFullscreen"])Module["onFullscreen"](Browser.isFullscreen)}if(!Browser.fullscreenHandlersInstalled){Browser.fullscreenHandlersInstalled=true;document.addEventListener("fullscreenchange",fullscreenChange,false);document.addEventListener("mozfullscreenchange",fullscreenChange,false);document.addEventListener("webkitfullscreenchange",fullscreenChange,false);document.addEventListener("MSFullscreenChange",fullscreenChange,false)}var canvasContainer=document.createElement("div");canvas.parentNode.insertBefore(canvasContainer,canvas);canvasContainer.appendChild(canvas);canvasContainer.requestFullscreen=canvasContainer["requestFullscreen"]||canvasContainer["mozRequestFullScreen"]||canvasContainer["msRequestFullscreen"]||(canvasContainer["webkitRequestFullscreen"]?function(){canvasContainer["webkitRequestFullscreen"](Element["ALLOW_KEYBOARD_INPUT"])}:null)||(canvasContainer["webkitRequestFullScreen"]?function(){canvasContainer["webkitRequestFullScreen"](Element["ALLOW_KEYBOARD_INPUT"])}:null);canvasContainer.requestFullscreen()},exitFullscreen:function(){if(!Browser.isFullscreen){return false}var CFS=document["exitFullscreen"]||document["cancelFullScreen"]||document["mozCancelFullScreen"]||document["msExitFullscreen"]||document["webkitCancelFullScreen"]||function(){};CFS.apply(document,[]);return true},nextRAF:0,fakeRequestAnimationFrame:function(func){var now=Date.now();if(Browser.nextRAF===0){Browser.nextRAF=now+1e3/60}else{while(now+2>=Browser.nextRAF){Browser.nextRAF+=1e3/60}}var delay=Math.max(Browser.nextRAF-now,0);setTimeout(func,delay)},requestAnimationFrame:function(func){if(typeof requestAnimationFrame=="function"){requestAnimationFrame(func);return}var RAF=Browser.fakeRequestAnimationFrame;RAF(func)},safeSetTimeout:function(func){return safeSetTimeout(func)},safeRequestAnimationFrame:function(func){runtimeKeepalivePush();return Browser.requestAnimationFrame(function(){runtimeKeepalivePop();callUserCallback(func)})},getMimetype:function(name){return{"jpg":"image/jpeg","jpeg":"image/jpeg","png":"image/png","bmp":"image/bmp","ogg":"audio/ogg","wav":"audio/wav","mp3":"audio/mpeg"}[name.substr(name.lastIndexOf(".")+1)]},getUserMedia:function(func){if(!window.getUserMedia){window.getUserMedia=navigator["getUserMedia"]||navigator["mozGetUserMedia"]}window.getUserMedia(func)},getMovementX:function(event){return event["movementX"]||event["mozMovementX"]||event["webkitMovementX"]||0},getMovementY:function(event){return event["movementY"]||event["mozMovementY"]||event["webkitMovementY"]||0},getMouseWheelDelta:function(event){var delta=0;switch(event.type){case"DOMMouseScroll":delta=event.detail/3;break;case"mousewheel":delta=event.wheelDelta/120;break;case"wheel":delta=event.deltaY;switch(event.deltaMode){case 0:delta/=100;break;case 1:delta/=3;break;case 2:delta*=80;break;default:throw"unrecognized mouse wheel delta mode: "+event.deltaMode}break;default:throw"unrecognized mouse wheel event: "+event.type}return delta},mouseX:0,mouseY:0,mouseMovementX:0,mouseMovementY:0,touches:{},lastTouches:{},calculateMouseEvent:function(event){if(Browser.pointerLock){if(event.type!="mousemove"&&"mozMovementX"in event){Browser.mouseMovementX=Browser.mouseMovementY=0}else{Browser.mouseMovementX=Browser.getMovementX(event);Browser.mouseMovementY=Browser.getMovementY(event)}if(typeof SDL!="undefined"){Browser.mouseX=SDL.mouseX+Browser.mouseMovementX;Browser.mouseY=SDL.mouseY+Browser.mouseMovementY}else{Browser.mouseX+=Browser.mouseMovementX;Browser.mouseY+=Browser.mouseMovementY}}else{var rect=Module["canvas"].getBoundingClientRect();var cw=Module["canvas"].width;var ch=Module["canvas"].height;var scrollX=typeof window.scrollX!="undefined"?window.scrollX:window.pageXOffset;var scrollY=typeof window.scrollY!="undefined"?window.scrollY:window.pageYOffset;if(event.type==="touchstart"||event.type==="touchend"||event.type==="touchmove"){var touch=event.touch;if(touch===undefined){return}var adjustedX=touch.pageX-(scrollX+rect.left);var adjustedY=touch.pageY-(scrollY+rect.top);adjustedX=adjustedX*(cw/rect.width);adjustedY=adjustedY*(ch/rect.height);var coords={x:adjustedX,y:adjustedY};if(event.type==="touchstart"){Browser.lastTouches[touch.identifier]=coords;Browser.touches[touch.identifier]=coords}else if(event.type==="touchend"||event.type==="touchmove"){var last=Browser.touches[touch.identifier];if(!last)last=coords;Browser.lastTouches[touch.identifier]=last;Browser.touches[touch.identifier]=coords}return}var x=event.pageX-(scrollX+rect.left);var y=event.pageY-(scrollY+rect.top);x=x*(cw/rect.width);y=y*(ch/rect.height);Browser.mouseMovementX=x-Browser.mouseX;Browser.mouseMovementY=y-Browser.mouseY;Browser.mouseX=x;Browser.mouseY=y}},resizeListeners:[],updateResizeListeners:function(){var canvas=Module["canvas"];Browser.resizeListeners.forEach(function(listener){listener(canvas.width,canvas.height)})},setCanvasSize:function(width,height,noUpdates){var canvas=Module["canvas"];Browser.updateCanvasDimensions(canvas,width,height);if(!noUpdates)Browser.updateResizeListeners()},windowedWidth:0,windowedHeight:0,setFullscreenCanvasSize:function(){if(typeof SDL!="undefined"){var flags=HEAPU32[SDL.screen>>2];flags=flags|8388608;HEAP32[SDL.screen>>2]=flags}Browser.updateCanvasDimensions(Module["canvas"]);Browser.updateResizeListeners()},setWindowedCanvasSize:function(){if(typeof SDL!="undefined"){var flags=HEAPU32[SDL.screen>>2];flags=flags&~8388608;HEAP32[SDL.screen>>2]=flags}Browser.updateCanvasDimensions(Module["canvas"]);Browser.updateResizeListeners()},updateCanvasDimensions:function(canvas,wNative,hNative){if(wNative&&hNative){canvas.widthNative=wNative;canvas.heightNative=hNative}else{wNative=canvas.widthNative;hNative=canvas.heightNative}var w=wNative;var h=hNative;if(Module["forcedAspectRatio"]&&Module["forcedAspectRatio"]>0){if(w/h>2]:-1;source+=UTF8ToString(HEAP32[string+i*4>>2],len<0?undefined:len)}return source},createContext:function(canvas,webGLContextAttributes){if(webGLContextAttributes.renderViaOffscreenBackBuffer)webGLContextAttributes["preserveDrawingBuffer"]=true;if(!canvas.getContextSafariWebGL2Fixed){canvas.getContextSafariWebGL2Fixed=canvas.getContext;function fixedGetContext(ver,attrs){var gl=canvas.getContextSafariWebGL2Fixed(ver,attrs);return ver=="webgl"==gl instanceof WebGLRenderingContext?gl:null}canvas.getContext=fixedGetContext}var ctx=webGLContextAttributes.majorVersion>1?canvas.getContext("webgl2",webGLContextAttributes):canvas.getContext("webgl",webGLContextAttributes);if(!ctx)return 0;var handle=GL.registerContext(ctx,webGLContextAttributes);return handle},enableOffscreenFramebufferAttributes:function(webGLContextAttributes){webGLContextAttributes.renderViaOffscreenBackBuffer=true;webGLContextAttributes.preserveDrawingBuffer=true},createOffscreenFramebuffer:function(context){var gl=context.GLctx;var fbo=gl.createFramebuffer();gl.bindFramebuffer(36160,fbo);context.defaultFbo=fbo;context.defaultFboForbidBlitFramebuffer=false;if(gl.getContextAttributes().antialias){context.defaultFboForbidBlitFramebuffer=true}else{var firefoxMatch=navigator.userAgent.toLowerCase().match(/firefox\/(\d\d)/);if(firefoxMatch!=null){var firefoxVersion=firefoxMatch[1];context.defaultFboForbidBlitFramebuffer=firefoxVersion<67}}context.defaultColorTarget=gl.createTexture();context.defaultDepthTarget=gl.createRenderbuffer();GL.resizeOffscreenFramebuffer(context);gl.bindTexture(3553,context.defaultColorTarget);gl.texParameteri(3553,10241,9728);gl.texParameteri(3553,10240,9728);gl.texParameteri(3553,10242,33071);gl.texParameteri(3553,10243,33071);gl.texImage2D(3553,0,6408,gl.canvas.width,gl.canvas.height,0,6408,5121,null);gl.framebufferTexture2D(36160,36064,3553,context.defaultColorTarget,0);gl.bindTexture(3553,null);var depthTarget=gl.createRenderbuffer();gl.bindRenderbuffer(36161,context.defaultDepthTarget);gl.renderbufferStorage(36161,33189,gl.canvas.width,gl.canvas.height);gl.framebufferRenderbuffer(36160,36096,36161,context.defaultDepthTarget);gl.bindRenderbuffer(36161,null);var vertices=[-1,-1,-1,1,1,-1,1,1];var vb=gl.createBuffer();gl.bindBuffer(34962,vb);gl.bufferData(34962,new Float32Array(vertices),35044);gl.bindBuffer(34962,null);context.blitVB=vb;var vsCode="attribute vec2 pos;"+"varying lowp vec2 tex;"+"void main() { tex = pos * 0.5 + vec2(0.5,0.5); gl_Position = vec4(pos, 0.0, 1.0); }";var vs=gl.createShader(35633);gl.shaderSource(vs,vsCode);gl.compileShader(vs);var fsCode="varying lowp vec2 tex;"+"uniform sampler2D sampler;"+"void main() { gl_FragColor = texture2D(sampler, tex); }";var fs=gl.createShader(35632);gl.shaderSource(fs,fsCode);gl.compileShader(fs);var blitProgram=gl.createProgram();gl.attachShader(blitProgram,vs);gl.attachShader(blitProgram,fs);gl.linkProgram(blitProgram);context.blitProgram=blitProgram;context.blitPosLoc=gl.getAttribLocation(blitProgram,"pos");gl.useProgram(blitProgram);gl.uniform1i(gl.getUniformLocation(blitProgram,"sampler"),0);gl.useProgram(null);context.defaultVao=undefined;if(gl.createVertexArray){context.defaultVao=gl.createVertexArray();gl.bindVertexArray(context.defaultVao);gl.enableVertexAttribArray(context.blitPosLoc);gl.bindVertexArray(null)}},resizeOffscreenFramebuffer:function(context){var gl=context.GLctx;if(context.defaultColorTarget){var prevTextureBinding=gl.getParameter(32873);gl.bindTexture(3553,context.defaultColorTarget);gl.texImage2D(3553,0,6408,gl.drawingBufferWidth,gl.drawingBufferHeight,0,6408,5121,null);gl.bindTexture(3553,prevTextureBinding)}if(context.defaultDepthTarget){var prevRenderBufferBinding=gl.getParameter(36007);gl.bindRenderbuffer(36161,context.defaultDepthTarget);gl.renderbufferStorage(36161,33189,gl.drawingBufferWidth,gl.drawingBufferHeight);gl.bindRenderbuffer(36161,prevRenderBufferBinding)}},blitOffscreenFramebuffer:function(context){var gl=context.GLctx;var prevScissorTest=gl.getParameter(3089);if(prevScissorTest)gl.disable(3089);var prevFbo=gl.getParameter(36006);if(gl.blitFramebuffer&&!context.defaultFboForbidBlitFramebuffer){gl.bindFramebuffer(36008,context.defaultFbo);gl.bindFramebuffer(36009,null);gl.blitFramebuffer(0,0,gl.canvas.width,gl.canvas.height,0,0,gl.canvas.width,gl.canvas.height,16384,9728)}else{gl.bindFramebuffer(36160,null);var prevProgram=gl.getParameter(35725);gl.useProgram(context.blitProgram);var prevVB=gl.getParameter(34964);gl.bindBuffer(34962,context.blitVB);var prevActiveTexture=gl.getParameter(34016);gl.activeTexture(33984);var prevTextureBinding=gl.getParameter(32873);gl.bindTexture(3553,context.defaultColorTarget);var prevBlend=gl.getParameter(3042);if(prevBlend)gl.disable(3042);var prevCullFace=gl.getParameter(2884);if(prevCullFace)gl.disable(2884);var prevDepthTest=gl.getParameter(2929);if(prevDepthTest)gl.disable(2929);var prevStencilTest=gl.getParameter(2960);if(prevStencilTest)gl.disable(2960);function draw(){gl.vertexAttribPointer(context.blitPosLoc,2,5126,false,0,0);gl.drawArrays(5,0,4)}if(context.defaultVao){var prevVAO=gl.getParameter(34229);gl.bindVertexArray(context.defaultVao);draw();gl.bindVertexArray(prevVAO)}else{var prevVertexAttribPointer={buffer:gl.getVertexAttrib(context.blitPosLoc,34975),size:gl.getVertexAttrib(context.blitPosLoc,34339),stride:gl.getVertexAttrib(context.blitPosLoc,34340),type:gl.getVertexAttrib(context.blitPosLoc,34341),normalized:gl.getVertexAttrib(context.blitPosLoc,34922),pointer:gl.getVertexAttribOffset(context.blitPosLoc,34373)};var maxVertexAttribs=gl.getParameter(34921);var prevVertexAttribEnables=[];for(var i=0;i=2){GLctx.disjointTimerQueryExt=GLctx.getExtension("EXT_disjoint_timer_query_webgl2")}if(context.version<2||!GLctx.disjointTimerQueryExt){GLctx.disjointTimerQueryExt=GLctx.getExtension("EXT_disjoint_timer_query")}__webgl_enable_WEBGL_multi_draw(GLctx);var exts=GLctx.getSupportedExtensions()||[];exts.forEach(function(ext){if(!ext.includes("lose_context")&&!ext.includes("debug")){GLctx.getExtension(ext)}})}};function _emscripten_glActiveTexture(x0){GLctx["activeTexture"](x0)}function _emscripten_glAttachShader(program,shader){GLctx.attachShader(GL.programs[program],GL.shaders[shader])}function _emscripten_glBeginQuery(target,id){GLctx["beginQuery"](target,GL.queries[id])}function _emscripten_glBeginQueryEXT(target,id){GLctx.disjointTimerQueryExt["beginQueryEXT"](target,GL.queries[id])}function _emscripten_glBeginTransformFeedback(x0){GLctx["beginTransformFeedback"](x0)}function _emscripten_glBindAttribLocation(program,index,name){GLctx.bindAttribLocation(GL.programs[program],index,UTF8ToString(name))}function _emscripten_glBindBuffer(target,buffer){if(target==35051){GLctx.currentPixelPackBufferBinding=buffer}else if(target==35052){GLctx.currentPixelUnpackBufferBinding=buffer}GLctx.bindBuffer(target,GL.buffers[buffer])}function _emscripten_glBindBufferBase(target,index,buffer){GLctx["bindBufferBase"](target,index,GL.buffers[buffer])}function _emscripten_glBindBufferRange(target,index,buffer,offset,ptrsize){GLctx["bindBufferRange"](target,index,GL.buffers[buffer],offset,ptrsize)}function _emscripten_glBindFramebuffer(target,framebuffer){GLctx.bindFramebuffer(target,framebuffer?GL.framebuffers[framebuffer]:GL.currentContext.defaultFbo)}function _emscripten_glBindRenderbuffer(target,renderbuffer){GLctx.bindRenderbuffer(target,GL.renderbuffers[renderbuffer])}function _emscripten_glBindSampler(unit,sampler){GLctx["bindSampler"](unit,GL.samplers[sampler])}function _emscripten_glBindTexture(target,texture){GLctx.bindTexture(target,GL.textures[texture])}function _emscripten_glBindTransformFeedback(target,id){GLctx["bindTransformFeedback"](target,GL.transformFeedbacks[id])}function _emscripten_glBindVertexArray(vao){GLctx["bindVertexArray"](GL.vaos[vao])}function _emscripten_glBindVertexArrayOES(vao){GLctx["bindVertexArray"](GL.vaos[vao])}function _emscripten_glBlendColor(x0,x1,x2,x3){GLctx["blendColor"](x0,x1,x2,x3)}function _emscripten_glBlendEquation(x0){GLctx["blendEquation"](x0)}function _emscripten_glBlendEquationSeparate(x0,x1){GLctx["blendEquationSeparate"](x0,x1)}function _emscripten_glBlendFunc(x0,x1){GLctx["blendFunc"](x0,x1)}function _emscripten_glBlendFuncSeparate(x0,x1,x2,x3){GLctx["blendFuncSeparate"](x0,x1,x2,x3)}function _emscripten_glBlitFramebuffer(x0,x1,x2,x3,x4,x5,x6,x7,x8,x9){GLctx["blitFramebuffer"](x0,x1,x2,x3,x4,x5,x6,x7,x8,x9)}function _emscripten_glBufferData(target,size,data,usage){if(GL.currentContext.version>=2){if(data&&size){GLctx.bufferData(target,HEAPU8,usage,data,size)}else{GLctx.bufferData(target,size,usage)}}else{GLctx.bufferData(target,data?HEAPU8.subarray(data,data+size):size,usage)}}function _emscripten_glBufferSubData(target,offset,size,data){if(GL.currentContext.version>=2){size&&GLctx.bufferSubData(target,offset,HEAPU8,data,size);return}GLctx.bufferSubData(target,offset,HEAPU8.subarray(data,data+size))}function _emscripten_glCheckFramebufferStatus(x0){return GLctx["checkFramebufferStatus"](x0)}function _emscripten_glClear(x0){GLctx["clear"](x0)}function _emscripten_glClearBufferfi(x0,x1,x2,x3){GLctx["clearBufferfi"](x0,x1,x2,x3)}function _emscripten_glClearBufferfv(buffer,drawbuffer,value){GLctx["clearBufferfv"](buffer,drawbuffer,HEAPF32,value>>2)}function _emscripten_glClearBufferiv(buffer,drawbuffer,value){GLctx["clearBufferiv"](buffer,drawbuffer,HEAP32,value>>2)}function _emscripten_glClearBufferuiv(buffer,drawbuffer,value){GLctx["clearBufferuiv"](buffer,drawbuffer,HEAPU32,value>>2)}function _emscripten_glClearColor(x0,x1,x2,x3){GLctx["clearColor"](x0,x1,x2,x3)}function _emscripten_glClearDepthf(x0){GLctx["clearDepth"](x0)}function _emscripten_glClearStencil(x0){GLctx["clearStencil"](x0)}function convertI32PairToI53(lo,hi){return(lo>>>0)+hi*4294967296}function _emscripten_glClientWaitSync(sync,flags,timeoutLo,timeoutHi){return GLctx.clientWaitSync(GL.syncs[sync],flags,convertI32PairToI53(timeoutLo,timeoutHi))}function _emscripten_glColorMask(red,green,blue,alpha){GLctx.colorMask(!!red,!!green,!!blue,!!alpha)}function _emscripten_glCompileShader(shader){GLctx.compileShader(GL.shaders[shader])}function _emscripten_glCompressedTexImage2D(target,level,internalFormat,width,height,border,imageSize,data){if(GL.currentContext.version>=2){if(GLctx.currentPixelUnpackBufferBinding||!imageSize){GLctx["compressedTexImage2D"](target,level,internalFormat,width,height,border,imageSize,data)}else{GLctx["compressedTexImage2D"](target,level,internalFormat,width,height,border,HEAPU8,data,imageSize)}return}GLctx["compressedTexImage2D"](target,level,internalFormat,width,height,border,data?HEAPU8.subarray(data,data+imageSize):null)}function _emscripten_glCompressedTexImage3D(target,level,internalFormat,width,height,depth,border,imageSize,data){if(GLctx.currentPixelUnpackBufferBinding){GLctx["compressedTexImage3D"](target,level,internalFormat,width,height,depth,border,imageSize,data)}else{GLctx["compressedTexImage3D"](target,level,internalFormat,width,height,depth,border,HEAPU8,data,imageSize)}}function _emscripten_glCompressedTexSubImage2D(target,level,xoffset,yoffset,width,height,format,imageSize,data){if(GL.currentContext.version>=2){if(GLctx.currentPixelUnpackBufferBinding||!imageSize){GLctx["compressedTexSubImage2D"](target,level,xoffset,yoffset,width,height,format,imageSize,data)}else{GLctx["compressedTexSubImage2D"](target,level,xoffset,yoffset,width,height,format,HEAPU8,data,imageSize)}return}GLctx["compressedTexSubImage2D"](target,level,xoffset,yoffset,width,height,format,data?HEAPU8.subarray(data,data+imageSize):null)}function _emscripten_glCompressedTexSubImage3D(target,level,xoffset,yoffset,zoffset,width,height,depth,format,imageSize,data){if(GLctx.currentPixelUnpackBufferBinding){GLctx["compressedTexSubImage3D"](target,level,xoffset,yoffset,zoffset,width,height,depth,format,imageSize,data)}else{GLctx["compressedTexSubImage3D"](target,level,xoffset,yoffset,zoffset,width,height,depth,format,HEAPU8,data,imageSize)}}function _emscripten_glCopyBufferSubData(x0,x1,x2,x3,x4){GLctx["copyBufferSubData"](x0,x1,x2,x3,x4)}function _emscripten_glCopyTexImage2D(x0,x1,x2,x3,x4,x5,x6,x7){GLctx["copyTexImage2D"](x0,x1,x2,x3,x4,x5,x6,x7)}function _emscripten_glCopyTexSubImage2D(x0,x1,x2,x3,x4,x5,x6,x7){GLctx["copyTexSubImage2D"](x0,x1,x2,x3,x4,x5,x6,x7)}function _emscripten_glCopyTexSubImage3D(x0,x1,x2,x3,x4,x5,x6,x7,x8){GLctx["copyTexSubImage3D"](x0,x1,x2,x3,x4,x5,x6,x7,x8)}function _emscripten_glCreateProgram(){var id=GL.getNewId(GL.programs);var program=GLctx.createProgram();program.name=id;program.maxUniformLength=program.maxAttributeLength=program.maxUniformBlockNameLength=0;program.uniformIdCounter=1;GL.programs[id]=program;return id}function _emscripten_glCreateShader(shaderType){var id=GL.getNewId(GL.shaders);GL.shaders[id]=GLctx.createShader(shaderType);return id}function _emscripten_glCullFace(x0){GLctx["cullFace"](x0)}function _emscripten_glDeleteBuffers(n,buffers){for(var i=0;i>2];var buffer=GL.buffers[id];if(!buffer)continue;GLctx.deleteBuffer(buffer);buffer.name=0;GL.buffers[id]=null;if(id==GLctx.currentPixelPackBufferBinding)GLctx.currentPixelPackBufferBinding=0;if(id==GLctx.currentPixelUnpackBufferBinding)GLctx.currentPixelUnpackBufferBinding=0}}function _emscripten_glDeleteFramebuffers(n,framebuffers){for(var i=0;i>2];var framebuffer=GL.framebuffers[id];if(!framebuffer)continue;GLctx.deleteFramebuffer(framebuffer);framebuffer.name=0;GL.framebuffers[id]=null}}function _emscripten_glDeleteProgram(id){if(!id)return;var program=GL.programs[id];if(!program){GL.recordError(1281);return}GLctx.deleteProgram(program);program.name=0;GL.programs[id]=null}function _emscripten_glDeleteQueries(n,ids){for(var i=0;i>2];var query=GL.queries[id];if(!query)continue;GLctx["deleteQuery"](query);GL.queries[id]=null}}function _emscripten_glDeleteQueriesEXT(n,ids){for(var i=0;i>2];var query=GL.queries[id];if(!query)continue;GLctx.disjointTimerQueryExt["deleteQueryEXT"](query);GL.queries[id]=null}}function _emscripten_glDeleteRenderbuffers(n,renderbuffers){for(var i=0;i>2];var renderbuffer=GL.renderbuffers[id];if(!renderbuffer)continue;GLctx.deleteRenderbuffer(renderbuffer);renderbuffer.name=0;GL.renderbuffers[id]=null}}function _emscripten_glDeleteSamplers(n,samplers){for(var i=0;i>2];var sampler=GL.samplers[id];if(!sampler)continue;GLctx["deleteSampler"](sampler);sampler.name=0;GL.samplers[id]=null}}function _emscripten_glDeleteShader(id){if(!id)return;var shader=GL.shaders[id];if(!shader){GL.recordError(1281);return}GLctx.deleteShader(shader);GL.shaders[id]=null}function _emscripten_glDeleteSync(id){if(!id)return;var sync=GL.syncs[id];if(!sync){GL.recordError(1281);return}GLctx.deleteSync(sync);sync.name=0;GL.syncs[id]=null}function _emscripten_glDeleteTextures(n,textures){for(var i=0;i>2];var texture=GL.textures[id];if(!texture)continue;GLctx.deleteTexture(texture);texture.name=0;GL.textures[id]=null}}function _emscripten_glDeleteTransformFeedbacks(n,ids){for(var i=0;i>2];var transformFeedback=GL.transformFeedbacks[id];if(!transformFeedback)continue;GLctx["deleteTransformFeedback"](transformFeedback);transformFeedback.name=0;GL.transformFeedbacks[id]=null}}function _emscripten_glDeleteVertexArrays(n,vaos){for(var i=0;i>2];GLctx["deleteVertexArray"](GL.vaos[id]);GL.vaos[id]=null}}function _emscripten_glDeleteVertexArraysOES(n,vaos){for(var i=0;i>2];GLctx["deleteVertexArray"](GL.vaos[id]);GL.vaos[id]=null}}function _emscripten_glDepthFunc(x0){GLctx["depthFunc"](x0)}function _emscripten_glDepthMask(flag){GLctx.depthMask(!!flag)}function _emscripten_glDepthRangef(x0,x1){GLctx["depthRange"](x0,x1)}function _emscripten_glDetachShader(program,shader){GLctx.detachShader(GL.programs[program],GL.shaders[shader])}function _emscripten_glDisable(x0){GLctx["disable"](x0)}function _emscripten_glDisableVertexAttribArray(index){GLctx.disableVertexAttribArray(index)}function _emscripten_glDrawArrays(mode,first,count){GLctx.drawArrays(mode,first,count)}function _emscripten_glDrawArraysInstanced(mode,first,count,primcount){GLctx["drawArraysInstanced"](mode,first,count,primcount)}function _emscripten_glDrawArraysInstancedANGLE(mode,first,count,primcount){GLctx["drawArraysInstanced"](mode,first,count,primcount)}function _emscripten_glDrawArraysInstancedARB(mode,first,count,primcount){GLctx["drawArraysInstanced"](mode,first,count,primcount)}function _emscripten_glDrawArraysInstancedEXT(mode,first,count,primcount){GLctx["drawArraysInstanced"](mode,first,count,primcount)}function _emscripten_glDrawArraysInstancedNV(mode,first,count,primcount){GLctx["drawArraysInstanced"](mode,first,count,primcount)}var tempFixedLengthArray=[];function _emscripten_glDrawBuffers(n,bufs){var bufArray=tempFixedLengthArray[n];for(var i=0;i>2]}GLctx["drawBuffers"](bufArray)}function _emscripten_glDrawBuffersEXT(n,bufs){var bufArray=tempFixedLengthArray[n];for(var i=0;i>2]}GLctx["drawBuffers"](bufArray)}function _emscripten_glDrawBuffersWEBGL(n,bufs){var bufArray=tempFixedLengthArray[n];for(var i=0;i>2]}GLctx["drawBuffers"](bufArray)}function _emscripten_glDrawElements(mode,count,type,indices){GLctx.drawElements(mode,count,type,indices)}function _emscripten_glDrawElementsInstanced(mode,count,type,indices,primcount){GLctx["drawElementsInstanced"](mode,count,type,indices,primcount)}function _emscripten_glDrawElementsInstancedANGLE(mode,count,type,indices,primcount){GLctx["drawElementsInstanced"](mode,count,type,indices,primcount)}function _emscripten_glDrawElementsInstancedARB(mode,count,type,indices,primcount){GLctx["drawElementsInstanced"](mode,count,type,indices,primcount)}function _emscripten_glDrawElementsInstancedEXT(mode,count,type,indices,primcount){GLctx["drawElementsInstanced"](mode,count,type,indices,primcount)}function _emscripten_glDrawElementsInstancedNV(mode,count,type,indices,primcount){GLctx["drawElementsInstanced"](mode,count,type,indices,primcount)}function _glDrawElements(mode,count,type,indices){GLctx.drawElements(mode,count,type,indices)}function _emscripten_glDrawRangeElements(mode,start,end,count,type,indices){_glDrawElements(mode,count,type,indices)}function _emscripten_glEnable(x0){GLctx["enable"](x0)}function _emscripten_glEnableVertexAttribArray(index){GLctx.enableVertexAttribArray(index)}function _emscripten_glEndQuery(x0){GLctx["endQuery"](x0)}function _emscripten_glEndQueryEXT(target){GLctx.disjointTimerQueryExt["endQueryEXT"](target)}function _emscripten_glEndTransformFeedback(){GLctx["endTransformFeedback"]()}function _emscripten_glFenceSync(condition,flags){var sync=GLctx.fenceSync(condition,flags);if(sync){var id=GL.getNewId(GL.syncs);sync.name=id;GL.syncs[id]=sync;return id}else{return 0}}function _emscripten_glFinish(){GLctx["finish"]()}function _emscripten_glFlush(){GLctx["flush"]()}function _emscripten_glFramebufferRenderbuffer(target,attachment,renderbuffertarget,renderbuffer){GLctx.framebufferRenderbuffer(target,attachment,renderbuffertarget,GL.renderbuffers[renderbuffer])}function _emscripten_glFramebufferTexture2D(target,attachment,textarget,texture,level){GLctx.framebufferTexture2D(target,attachment,textarget,GL.textures[texture],level)}function _emscripten_glFramebufferTextureLayer(target,attachment,texture,level,layer){GLctx.framebufferTextureLayer(target,attachment,GL.textures[texture],level,layer)}function _emscripten_glFrontFace(x0){GLctx["frontFace"](x0)}function __glGenObject(n,buffers,createFunction,objectTable){for(var i=0;i>2]=id}}function _emscripten_glGenBuffers(n,buffers){__glGenObject(n,buffers,"createBuffer",GL.buffers)}function _emscripten_glGenFramebuffers(n,ids){__glGenObject(n,ids,"createFramebuffer",GL.framebuffers)}function _emscripten_glGenQueries(n,ids){__glGenObject(n,ids,"createQuery",GL.queries)}function _emscripten_glGenQueriesEXT(n,ids){for(var i=0;i>2]=0;return}var id=GL.getNewId(GL.queries);query.name=id;GL.queries[id]=query;HEAP32[ids+i*4>>2]=id}}function _emscripten_glGenRenderbuffers(n,renderbuffers){__glGenObject(n,renderbuffers,"createRenderbuffer",GL.renderbuffers)}function _emscripten_glGenSamplers(n,samplers){__glGenObject(n,samplers,"createSampler",GL.samplers)}function _emscripten_glGenTextures(n,textures){__glGenObject(n,textures,"createTexture",GL.textures)}function _emscripten_glGenTransformFeedbacks(n,ids){__glGenObject(n,ids,"createTransformFeedback",GL.transformFeedbacks)}function _emscripten_glGenVertexArrays(n,arrays){__glGenObject(n,arrays,"createVertexArray",GL.vaos)}function _emscripten_glGenVertexArraysOES(n,arrays){__glGenObject(n,arrays,"createVertexArray",GL.vaos)}function _emscripten_glGenerateMipmap(x0){GLctx["generateMipmap"](x0)}function __glGetActiveAttribOrUniform(funcName,program,index,bufSize,length,size,type,name){program=GL.programs[program];var info=GLctx[funcName](program,index);if(info){var numBytesWrittenExclNull=name&&stringToUTF8(info.name,name,bufSize);if(length)HEAP32[length>>2]=numBytesWrittenExclNull;if(size)HEAP32[size>>2]=info.size;if(type)HEAP32[type>>2]=info.type}}function _emscripten_glGetActiveAttrib(program,index,bufSize,length,size,type,name){__glGetActiveAttribOrUniform("getActiveAttrib",program,index,bufSize,length,size,type,name)}function _emscripten_glGetActiveUniform(program,index,bufSize,length,size,type,name){__glGetActiveAttribOrUniform("getActiveUniform",program,index,bufSize,length,size,type,name)}function _emscripten_glGetActiveUniformBlockName(program,uniformBlockIndex,bufSize,length,uniformBlockName){program=GL.programs[program];var result=GLctx["getActiveUniformBlockName"](program,uniformBlockIndex);if(!result)return;if(uniformBlockName&&bufSize>0){var numBytesWrittenExclNull=stringToUTF8(result,uniformBlockName,bufSize);if(length)HEAP32[length>>2]=numBytesWrittenExclNull}else{if(length)HEAP32[length>>2]=0}}function _emscripten_glGetActiveUniformBlockiv(program,uniformBlockIndex,pname,params){if(!params){GL.recordError(1281);return}program=GL.programs[program];if(pname==35393){var name=GLctx["getActiveUniformBlockName"](program,uniformBlockIndex);HEAP32[params>>2]=name.length+1;return}var result=GLctx["getActiveUniformBlockParameter"](program,uniformBlockIndex,pname);if(result===null)return;if(pname==35395){for(var i=0;i>2]=result[i]}}else{HEAP32[params>>2]=result}}function _emscripten_glGetActiveUniformsiv(program,uniformCount,uniformIndices,pname,params){if(!params){GL.recordError(1281);return}if(uniformCount>0&&uniformIndices==0){GL.recordError(1281);return}program=GL.programs[program];var ids=[];for(var i=0;i>2])}var result=GLctx["getActiveUniforms"](program,ids,pname);if(!result)return;var len=result.length;for(var i=0;i>2]=result[i]}}function _emscripten_glGetAttachedShaders(program,maxCount,count,shaders){var result=GLctx.getAttachedShaders(GL.programs[program]);var len=result.length;if(len>maxCount){len=maxCount}HEAP32[count>>2]=len;for(var i=0;i>2]=id}}function _emscripten_glGetAttribLocation(program,name){return GLctx.getAttribLocation(GL.programs[program],UTF8ToString(name))}function writeI53ToI64(ptr,num){HEAPU32[ptr>>2]=num;HEAPU32[ptr+4>>2]=(num-HEAPU32[ptr>>2])/4294967296}function emscriptenWebGLGet(name_,p,type){if(!p){GL.recordError(1281);return}var ret=undefined;switch(name_){case 36346:ret=1;break;case 36344:if(type!=0&&type!=1){GL.recordError(1280)}return;case 34814:case 36345:ret=0;break;case 34466:var formats=GLctx.getParameter(34467);ret=formats?formats.length:0;break;case 33309:if(GL.currentContext.version<2){GL.recordError(1282);return}var exts=GLctx.getSupportedExtensions()||[];ret=2*exts.length;break;case 33307:case 33308:if(GL.currentContext.version<2){GL.recordError(1280);return}ret=name_==33307?3:0;break}if(ret===undefined){var result=GLctx.getParameter(name_);switch(typeof result){case"number":ret=result;break;case"boolean":ret=result?1:0;break;case"string":GL.recordError(1280);return;case"object":if(result===null){switch(name_){case 34964:case 35725:case 34965:case 36006:case 36007:case 32873:case 34229:case 36662:case 36663:case 35053:case 35055:case 36010:case 35097:case 35869:case 32874:case 36389:case 35983:case 35368:case 34068:{ret=0;break}default:{GL.recordError(1280);return}}}else if(result instanceof Float32Array||result instanceof Uint32Array||result instanceof Int32Array||result instanceof Array){for(var i=0;i>2]=result[i];break;case 2:HEAPF32[p+i*4>>2]=result[i];break;case 4:HEAP8[p+i>>0]=result[i]?1:0;break}}return}else{try{ret=result.name|0}catch(e){GL.recordError(1280);err("GL_INVALID_ENUM in glGet"+type+"v: Unknown object returned from WebGL getParameter("+name_+")! (error: "+e+")");return}}break;default:GL.recordError(1280);err("GL_INVALID_ENUM in glGet"+type+"v: Native code calling glGet"+type+"v("+name_+") and it returns "+result+" of type "+typeof result+"!");return}}switch(type){case 1:writeI53ToI64(p,ret);break;case 0:HEAP32[p>>2]=ret;break;case 2:HEAPF32[p>>2]=ret;break;case 4:HEAP8[p>>0]=ret?1:0;break}}function _emscripten_glGetBooleanv(name_,p){emscriptenWebGLGet(name_,p,4)}function _emscripten_glGetBufferParameteri64v(target,value,data){if(!data){GL.recordError(1281);return}writeI53ToI64(data,GLctx.getBufferParameter(target,value))}function _emscripten_glGetBufferParameteriv(target,value,data){if(!data){GL.recordError(1281);return}HEAP32[data>>2]=GLctx.getBufferParameter(target,value)}function _emscripten_glGetError(){var error=GLctx.getError()||GL.lastError;GL.lastError=0;return error}function _emscripten_glGetFloatv(name_,p){emscriptenWebGLGet(name_,p,2)}function _emscripten_glGetFragDataLocation(program,name){return GLctx["getFragDataLocation"](GL.programs[program],UTF8ToString(name))}function _emscripten_glGetFramebufferAttachmentParameteriv(target,attachment,pname,params){var result=GLctx.getFramebufferAttachmentParameter(target,attachment,pname);if(result instanceof WebGLRenderbuffer||result instanceof WebGLTexture){result=result.name|0}HEAP32[params>>2]=result}function emscriptenWebGLGetIndexed(target,index,data,type){if(!data){GL.recordError(1281);return}var result=GLctx["getIndexedParameter"](target,index);var ret;switch(typeof result){case"boolean":ret=result?1:0;break;case"number":ret=result;break;case"object":if(result===null){switch(target){case 35983:case 35368:ret=0;break;default:{GL.recordError(1280);return}}}else if(result instanceof WebGLBuffer){ret=result.name|0}else{GL.recordError(1280);return}break;default:GL.recordError(1280);return}switch(type){case 1:writeI53ToI64(data,ret);break;case 0:HEAP32[data>>2]=ret;break;case 2:HEAPF32[data>>2]=ret;break;case 4:HEAP8[data>>0]=ret?1:0;break;default:throw"internal emscriptenWebGLGetIndexed() error, bad type: "+type}}function _emscripten_glGetInteger64i_v(target,index,data){emscriptenWebGLGetIndexed(target,index,data,1)}function _emscripten_glGetInteger64v(name_,p){emscriptenWebGLGet(name_,p,1)}function _emscripten_glGetIntegeri_v(target,index,data){emscriptenWebGLGetIndexed(target,index,data,0)}function _emscripten_glGetIntegerv(name_,p){emscriptenWebGLGet(name_,p,0)}function _emscripten_glGetInternalformativ(target,internalformat,pname,bufSize,params){if(bufSize<0){GL.recordError(1281);return}if(!params){GL.recordError(1281);return}var ret=GLctx["getInternalformatParameter"](target,internalformat,pname);if(ret===null)return;for(var i=0;i>2]=ret[i]}}function _emscripten_glGetProgramBinary(program,bufSize,length,binaryFormat,binary){GL.recordError(1282)}function _emscripten_glGetProgramInfoLog(program,maxLength,length,infoLog){var log=GLctx.getProgramInfoLog(GL.programs[program]);if(log===null)log="(unknown error)";var numBytesWrittenExclNull=maxLength>0&&infoLog?stringToUTF8(log,infoLog,maxLength):0;if(length)HEAP32[length>>2]=numBytesWrittenExclNull}function _emscripten_glGetProgramiv(program,pname,p){if(!p){GL.recordError(1281);return}if(program>=GL.counter){GL.recordError(1281);return}program=GL.programs[program];if(pname==35716){var log=GLctx.getProgramInfoLog(program);if(log===null)log="(unknown error)";HEAP32[p>>2]=log.length+1}else if(pname==35719){if(!program.maxUniformLength){for(var i=0;i>2]=program.maxUniformLength}else if(pname==35722){if(!program.maxAttributeLength){for(var i=0;i>2]=program.maxAttributeLength}else if(pname==35381){if(!program.maxUniformBlockNameLength){for(var i=0;i>2]=program.maxUniformBlockNameLength}else{HEAP32[p>>2]=GLctx.getProgramParameter(program,pname)}}function _emscripten_glGetQueryObjecti64vEXT(id,pname,params){if(!params){GL.recordError(1281);return}var query=GL.queries[id];var param;if(GL.currentContext.version<2){param=GLctx.disjointTimerQueryExt["getQueryObjectEXT"](query,pname)}else{param=GLctx["getQueryParameter"](query,pname)}var ret;if(typeof param=="boolean"){ret=param?1:0}else{ret=param}writeI53ToI64(params,ret)}function _emscripten_glGetQueryObjectivEXT(id,pname,params){if(!params){GL.recordError(1281);return}var query=GL.queries[id];var param=GLctx.disjointTimerQueryExt["getQueryObjectEXT"](query,pname);var ret;if(typeof param=="boolean"){ret=param?1:0}else{ret=param}HEAP32[params>>2]=ret}function _emscripten_glGetQueryObjectui64vEXT(id,pname,params){if(!params){GL.recordError(1281);return}var query=GL.queries[id];var param;if(GL.currentContext.version<2){param=GLctx.disjointTimerQueryExt["getQueryObjectEXT"](query,pname)}else{param=GLctx["getQueryParameter"](query,pname)}var ret;if(typeof param=="boolean"){ret=param?1:0}else{ret=param}writeI53ToI64(params,ret)}function _emscripten_glGetQueryObjectuiv(id,pname,params){if(!params){GL.recordError(1281);return}var query=GL.queries[id];var param=GLctx["getQueryParameter"](query,pname);var ret;if(typeof param=="boolean"){ret=param?1:0}else{ret=param}HEAP32[params>>2]=ret}function _emscripten_glGetQueryObjectuivEXT(id,pname,params){if(!params){GL.recordError(1281);return}var query=GL.queries[id];var param=GLctx.disjointTimerQueryExt["getQueryObjectEXT"](query,pname);var ret;if(typeof param=="boolean"){ret=param?1:0}else{ret=param}HEAP32[params>>2]=ret}function _emscripten_glGetQueryiv(target,pname,params){if(!params){GL.recordError(1281);return}HEAP32[params>>2]=GLctx["getQuery"](target,pname)}function _emscripten_glGetQueryivEXT(target,pname,params){if(!params){GL.recordError(1281);return}HEAP32[params>>2]=GLctx.disjointTimerQueryExt["getQueryEXT"](target,pname)}function _emscripten_glGetRenderbufferParameteriv(target,pname,params){if(!params){GL.recordError(1281);return}HEAP32[params>>2]=GLctx.getRenderbufferParameter(target,pname)}function _emscripten_glGetSamplerParameterfv(sampler,pname,params){if(!params){GL.recordError(1281);return}HEAPF32[params>>2]=GLctx["getSamplerParameter"](GL.samplers[sampler],pname)}function _emscripten_glGetSamplerParameteriv(sampler,pname,params){if(!params){GL.recordError(1281);return}HEAP32[params>>2]=GLctx["getSamplerParameter"](GL.samplers[sampler],pname)}function _emscripten_glGetShaderInfoLog(shader,maxLength,length,infoLog){var log=GLctx.getShaderInfoLog(GL.shaders[shader]);if(log===null)log="(unknown error)";var numBytesWrittenExclNull=maxLength>0&&infoLog?stringToUTF8(log,infoLog,maxLength):0;if(length)HEAP32[length>>2]=numBytesWrittenExclNull}function _emscripten_glGetShaderPrecisionFormat(shaderType,precisionType,range,precision){var result=GLctx.getShaderPrecisionFormat(shaderType,precisionType);HEAP32[range>>2]=result.rangeMin;HEAP32[range+4>>2]=result.rangeMax;HEAP32[precision>>2]=result.precision}function _emscripten_glGetShaderSource(shader,bufSize,length,source){var result=GLctx.getShaderSource(GL.shaders[shader]);if(!result)return;var numBytesWrittenExclNull=bufSize>0&&source?stringToUTF8(result,source,bufSize):0;if(length)HEAP32[length>>2]=numBytesWrittenExclNull}function _emscripten_glGetShaderiv(shader,pname,p){if(!p){GL.recordError(1281);return}if(pname==35716){var log=GLctx.getShaderInfoLog(GL.shaders[shader]);if(log===null)log="(unknown error)";var logLength=log?log.length+1:0;HEAP32[p>>2]=logLength}else if(pname==35720){var source=GLctx.getShaderSource(GL.shaders[shader]);var sourceLength=source?source.length+1:0;HEAP32[p>>2]=sourceLength}else{HEAP32[p>>2]=GLctx.getShaderParameter(GL.shaders[shader],pname)}}function stringToNewUTF8(jsString){var length=lengthBytesUTF8(jsString)+1;var cString=_malloc(length);stringToUTF8(jsString,cString,length);return cString}function _emscripten_glGetString(name_){var ret=GL.stringCache[name_];if(!ret){switch(name_){case 7939:var exts=GLctx.getSupportedExtensions()||[];exts=exts.concat(exts.map(function(e){return"GL_"+e}));ret=stringToNewUTF8(exts.join(" "));break;case 7936:case 7937:case 37445:case 37446:var s=GLctx.getParameter(name_);if(!s){GL.recordError(1280)}ret=s&&stringToNewUTF8(s);break;case 7938:var glVersion=GLctx.getParameter(7938);if(GL.currentContext.version>=2)glVersion="OpenGL ES 3.0 ("+glVersion+")";else{glVersion="OpenGL ES 2.0 ("+glVersion+")"}ret=stringToNewUTF8(glVersion);break;case 35724:var glslVersion=GLctx.getParameter(35724);var ver_re=/^WebGL GLSL ES ([0-9]\.[0-9][0-9]?)(?:$| .*)/;var ver_num=glslVersion.match(ver_re);if(ver_num!==null){if(ver_num[1].length==3)ver_num[1]=ver_num[1]+"0";glslVersion="OpenGL ES GLSL ES "+ver_num[1]+" ("+glslVersion+")"}ret=stringToNewUTF8(glslVersion);break;default:GL.recordError(1280)}GL.stringCache[name_]=ret}return ret}function _emscripten_glGetStringi(name,index){if(GL.currentContext.version<2){GL.recordError(1282);return 0}var stringiCache=GL.stringiCache[name];if(stringiCache){if(index<0||index>=stringiCache.length){GL.recordError(1281);return 0}return stringiCache[index]}switch(name){case 7939:var exts=GLctx.getSupportedExtensions()||[];exts=exts.concat(exts.map(function(e){return"GL_"+e}));exts=exts.map(function(e){return stringToNewUTF8(e)});stringiCache=GL.stringiCache[name]=exts;if(index<0||index>=stringiCache.length){GL.recordError(1281);return 0}return stringiCache[index];default:GL.recordError(1280);return 0}}function _emscripten_glGetSynciv(sync,pname,bufSize,length,values){if(bufSize<0){GL.recordError(1281);return}if(!values){GL.recordError(1281);return}var ret=GLctx.getSyncParameter(GL.syncs[sync],pname);if(ret!==null){HEAP32[values>>2]=ret;if(length)HEAP32[length>>2]=1}}function _emscripten_glGetTexParameterfv(target,pname,params){if(!params){GL.recordError(1281);return}HEAPF32[params>>2]=GLctx.getTexParameter(target,pname)}function _emscripten_glGetTexParameteriv(target,pname,params){if(!params){GL.recordError(1281);return}HEAP32[params>>2]=GLctx.getTexParameter(target,pname)}function _emscripten_glGetTransformFeedbackVarying(program,index,bufSize,length,size,type,name){program=GL.programs[program];var info=GLctx["getTransformFeedbackVarying"](program,index);if(!info)return;if(name&&bufSize>0){var numBytesWrittenExclNull=stringToUTF8(info.name,name,bufSize);if(length)HEAP32[length>>2]=numBytesWrittenExclNull}else{if(length)HEAP32[length>>2]=0}if(size)HEAP32[size>>2]=info.size;if(type)HEAP32[type>>2]=info.type}function _emscripten_glGetUniformBlockIndex(program,uniformBlockName){return GLctx["getUniformBlockIndex"](GL.programs[program],UTF8ToString(uniformBlockName))}function _emscripten_glGetUniformIndices(program,uniformCount,uniformNames,uniformIndices){if(!uniformIndices){GL.recordError(1281);return}if(uniformCount>0&&(uniformNames==0||uniformIndices==0)){GL.recordError(1281);return}program=GL.programs[program];var names=[];for(var i=0;i>2]));var result=GLctx["getUniformIndices"](program,names);if(!result)return;var len=result.length;for(var i=0;i>2]=result[i]}}function webglGetLeftBracePos(name){return name.slice(-1)=="]"&&name.lastIndexOf("[")}function webglPrepareUniformLocationsBeforeFirstUse(program){var uniformLocsById=program.uniformLocsById,uniformSizeAndIdsByName=program.uniformSizeAndIdsByName,i,j;if(!uniformLocsById){program.uniformLocsById=uniformLocsById={};program.uniformArrayNamesById={};for(i=0;i0?nm.slice(0,lb):nm;var id=program.uniformIdCounter;program.uniformIdCounter+=sz;uniformSizeAndIdsByName[arrayName]=[sz,id];for(j=0;j0){arrayIndex=jstoi_q(name.slice(leftBrace+1))>>>0;uniformBaseName=name.slice(0,leftBrace)}var sizeAndId=program.uniformSizeAndIdsByName[uniformBaseName];if(sizeAndId&&arrayIndex0?"["+webglLoc+"]":""))}return webglLoc}else{GL.recordError(1282)}}function emscriptenWebGLGetUniform(program,location,params,type){if(!params){GL.recordError(1281);return}program=GL.programs[program];webglPrepareUniformLocationsBeforeFirstUse(program);var data=GLctx.getUniform(program,webglGetUniformLocation(location));if(typeof data=="number"||typeof data=="boolean"){switch(type){case 0:HEAP32[params>>2]=data;break;case 2:HEAPF32[params>>2]=data;break}}else{for(var i=0;i>2]=data[i];break;case 2:HEAPF32[params+i*4>>2]=data[i];break}}}}function _emscripten_glGetUniformfv(program,location,params){emscriptenWebGLGetUniform(program,location,params,2)}function _emscripten_glGetUniformiv(program,location,params){emscriptenWebGLGetUniform(program,location,params,0)}function _emscripten_glGetUniformuiv(program,location,params){emscriptenWebGLGetUniform(program,location,params,0)}function emscriptenWebGLGetVertexAttrib(index,pname,params,type){if(!params){GL.recordError(1281);return}var data=GLctx.getVertexAttrib(index,pname);if(pname==34975){HEAP32[params>>2]=data&&data["name"]}else if(typeof data=="number"||typeof data=="boolean"){switch(type){case 0:HEAP32[params>>2]=data;break;case 2:HEAPF32[params>>2]=data;break;case 5:HEAP32[params>>2]=Math.fround(data);break}}else{for(var i=0;i>2]=data[i];break;case 2:HEAPF32[params+i*4>>2]=data[i];break;case 5:HEAP32[params+i*4>>2]=Math.fround(data[i]);break}}}}function _emscripten_glGetVertexAttribIiv(index,pname,params){emscriptenWebGLGetVertexAttrib(index,pname,params,0)}function _emscripten_glGetVertexAttribIuiv(index,pname,params){emscriptenWebGLGetVertexAttrib(index,pname,params,0)}function _emscripten_glGetVertexAttribPointerv(index,pname,pointer){if(!pointer){GL.recordError(1281);return}HEAP32[pointer>>2]=GLctx.getVertexAttribOffset(index,pname)}function _emscripten_glGetVertexAttribfv(index,pname,params){emscriptenWebGLGetVertexAttrib(index,pname,params,2)}function _emscripten_glGetVertexAttribiv(index,pname,params){emscriptenWebGLGetVertexAttrib(index,pname,params,5)}function _emscripten_glHint(x0,x1){GLctx["hint"](x0,x1)}function _emscripten_glInvalidateFramebuffer(target,numAttachments,attachments){var list=tempFixedLengthArray[numAttachments];for(var i=0;i>2]}GLctx["invalidateFramebuffer"](target,list)}function _emscripten_glInvalidateSubFramebuffer(target,numAttachments,attachments,x,y,width,height){var list=tempFixedLengthArray[numAttachments];for(var i=0;i>2]}GLctx["invalidateSubFramebuffer"](target,list,x,y,width,height)}function _emscripten_glIsBuffer(buffer){var b=GL.buffers[buffer];if(!b)return 0;return GLctx.isBuffer(b)}function _emscripten_glIsEnabled(x0){return GLctx["isEnabled"](x0)}function _emscripten_glIsFramebuffer(framebuffer){var fb=GL.framebuffers[framebuffer];if(!fb)return 0;return GLctx.isFramebuffer(fb)}function _emscripten_glIsProgram(program){program=GL.programs[program];if(!program)return 0;return GLctx.isProgram(program)}function _emscripten_glIsQuery(id){var query=GL.queries[id];if(!query)return 0;return GLctx["isQuery"](query)}function _emscripten_glIsQueryEXT(id){var query=GL.queries[id];if(!query)return 0;return GLctx.disjointTimerQueryExt["isQueryEXT"](query)}function _emscripten_glIsRenderbuffer(renderbuffer){var rb=GL.renderbuffers[renderbuffer];if(!rb)return 0;return GLctx.isRenderbuffer(rb)}function _emscripten_glIsSampler(id){var sampler=GL.samplers[id];if(!sampler)return 0;return GLctx["isSampler"](sampler)}function _emscripten_glIsShader(shader){var s=GL.shaders[shader];if(!s)return 0;return GLctx.isShader(s)}function _emscripten_glIsSync(sync){return GLctx.isSync(GL.syncs[sync])}function _emscripten_glIsTexture(id){var texture=GL.textures[id];if(!texture)return 0;return GLctx.isTexture(texture)}function _emscripten_glIsTransformFeedback(id){return GLctx["isTransformFeedback"](GL.transformFeedbacks[id])}function _emscripten_glIsVertexArray(array){var vao=GL.vaos[array];if(!vao)return 0;return GLctx["isVertexArray"](vao)}function _emscripten_glIsVertexArrayOES(array){var vao=GL.vaos[array];if(!vao)return 0;return GLctx["isVertexArray"](vao)}function _emscripten_glLineWidth(x0){GLctx["lineWidth"](x0)}function _emscripten_glLinkProgram(program){program=GL.programs[program];GLctx.linkProgram(program);program.uniformLocsById=0;program.uniformSizeAndIdsByName={}}function _emscripten_glPauseTransformFeedback(){GLctx["pauseTransformFeedback"]()}function _emscripten_glPixelStorei(pname,param){if(pname==3317){GL.unpackAlignment=param}GLctx.pixelStorei(pname,param)}function _emscripten_glPolygonOffset(x0,x1){GLctx["polygonOffset"](x0,x1)}function _emscripten_glProgramBinary(program,binaryFormat,binary,length){GL.recordError(1280)}function _emscripten_glProgramParameteri(program,pname,value){GL.recordError(1280)}function _emscripten_glQueryCounterEXT(id,target){GLctx.disjointTimerQueryExt["queryCounterEXT"](GL.queries[id],target)}function _emscripten_glReadBuffer(x0){GLctx["readBuffer"](x0)}function computeUnpackAlignedImageSize(width,height,sizePerPixel,alignment){function roundedToNextMultipleOf(x,y){return x+y-1&-y}var plainRowSize=width*sizePerPixel;var alignedRowSize=roundedToNextMultipleOf(plainRowSize,alignment);return height*alignedRowSize}function __colorChannelsInGlTextureFormat(format){var colorChannels={5:3,6:4,8:2,29502:3,29504:4,26917:2,26918:2,29846:3,29847:4};return colorChannels[format-6402]||1}function heapObjectForWebGLType(type){type-=5120;if(type==0)return HEAP8;if(type==1)return HEAPU8;if(type==2)return HEAP16;if(type==4)return HEAP32;if(type==6)return HEAPF32;if(type==5||type==28922||type==28520||type==30779||type==30782)return HEAPU32;return HEAPU16}function heapAccessShiftForWebGLHeap(heap){return 31-Math.clz32(heap.BYTES_PER_ELEMENT)}function emscriptenWebGLGetTexPixelData(type,format,width,height,pixels,internalFormat){var heap=heapObjectForWebGLType(type);var shift=heapAccessShiftForWebGLHeap(heap);var byteSize=1<>shift,pixels+bytes>>shift)}function _emscripten_glReadPixels(x,y,width,height,format,type,pixels){if(GL.currentContext.version>=2){if(GLctx.currentPixelPackBufferBinding){GLctx.readPixels(x,y,width,height,format,type,pixels)}else{var heap=heapObjectForWebGLType(type);GLctx.readPixels(x,y,width,height,format,type,heap,pixels>>heapAccessShiftForWebGLHeap(heap))}return}var pixelData=emscriptenWebGLGetTexPixelData(type,format,width,height,pixels,format);if(!pixelData){GL.recordError(1280);return}GLctx.readPixels(x,y,width,height,format,type,pixelData)}function _emscripten_glReleaseShaderCompiler(){}function _emscripten_glRenderbufferStorage(x0,x1,x2,x3){GLctx["renderbufferStorage"](x0,x1,x2,x3)}function _emscripten_glRenderbufferStorageMultisample(x0,x1,x2,x3,x4){GLctx["renderbufferStorageMultisample"](x0,x1,x2,x3,x4)}function _emscripten_glResumeTransformFeedback(){GLctx["resumeTransformFeedback"]()}function _emscripten_glSampleCoverage(value,invert){GLctx.sampleCoverage(value,!!invert)}function _emscripten_glSamplerParameterf(sampler,pname,param){GLctx["samplerParameterf"](GL.samplers[sampler],pname,param)}function _emscripten_glSamplerParameterfv(sampler,pname,params){var param=HEAPF32[params>>2];GLctx["samplerParameterf"](GL.samplers[sampler],pname,param)}function _emscripten_glSamplerParameteri(sampler,pname,param){GLctx["samplerParameteri"](GL.samplers[sampler],pname,param)}function _emscripten_glSamplerParameteriv(sampler,pname,params){var param=HEAP32[params>>2];GLctx["samplerParameteri"](GL.samplers[sampler],pname,param)}function _emscripten_glScissor(x0,x1,x2,x3){GLctx["scissor"](x0,x1,x2,x3)}function _emscripten_glShaderBinary(){GL.recordError(1280)}function _emscripten_glShaderSource(shader,count,string,length){var source=GL.getSource(shader,count,string,length);GLctx.shaderSource(GL.shaders[shader],source)}function _emscripten_glStencilFunc(x0,x1,x2){GLctx["stencilFunc"](x0,x1,x2)}function _emscripten_glStencilFuncSeparate(x0,x1,x2,x3){GLctx["stencilFuncSeparate"](x0,x1,x2,x3)}function _emscripten_glStencilMask(x0){GLctx["stencilMask"](x0)}function _emscripten_glStencilMaskSeparate(x0,x1){GLctx["stencilMaskSeparate"](x0,x1)}function _emscripten_glStencilOp(x0,x1,x2){GLctx["stencilOp"](x0,x1,x2)}function _emscripten_glStencilOpSeparate(x0,x1,x2,x3){GLctx["stencilOpSeparate"](x0,x1,x2,x3)}function _emscripten_glTexImage2D(target,level,internalFormat,width,height,border,format,type,pixels){if(GL.currentContext.version>=2){if(GLctx.currentPixelUnpackBufferBinding){GLctx.texImage2D(target,level,internalFormat,width,height,border,format,type,pixels)}else if(pixels){var heap=heapObjectForWebGLType(type);GLctx.texImage2D(target,level,internalFormat,width,height,border,format,type,heap,pixels>>heapAccessShiftForWebGLHeap(heap))}else{GLctx.texImage2D(target,level,internalFormat,width,height,border,format,type,null)}return}GLctx.texImage2D(target,level,internalFormat,width,height,border,format,type,pixels?emscriptenWebGLGetTexPixelData(type,format,width,height,pixels,internalFormat):null)}function _emscripten_glTexImage3D(target,level,internalFormat,width,height,depth,border,format,type,pixels){if(GLctx.currentPixelUnpackBufferBinding){GLctx["texImage3D"](target,level,internalFormat,width,height,depth,border,format,type,pixels)}else if(pixels){var heap=heapObjectForWebGLType(type);GLctx["texImage3D"](target,level,internalFormat,width,height,depth,border,format,type,heap,pixels>>heapAccessShiftForWebGLHeap(heap))}else{GLctx["texImage3D"](target,level,internalFormat,width,height,depth,border,format,type,null)}}function _emscripten_glTexParameterf(x0,x1,x2){GLctx["texParameterf"](x0,x1,x2)}function _emscripten_glTexParameterfv(target,pname,params){var param=HEAPF32[params>>2];GLctx.texParameterf(target,pname,param)}function _emscripten_glTexParameteri(x0,x1,x2){GLctx["texParameteri"](x0,x1,x2)}function _emscripten_glTexParameteriv(target,pname,params){var param=HEAP32[params>>2];GLctx.texParameteri(target,pname,param)}function _emscripten_glTexStorage2D(x0,x1,x2,x3,x4){GLctx["texStorage2D"](x0,x1,x2,x3,x4)}function _emscripten_glTexStorage3D(x0,x1,x2,x3,x4,x5){GLctx["texStorage3D"](x0,x1,x2,x3,x4,x5)}function _emscripten_glTexSubImage2D(target,level,xoffset,yoffset,width,height,format,type,pixels){if(GL.currentContext.version>=2){if(GLctx.currentPixelUnpackBufferBinding){GLctx.texSubImage2D(target,level,xoffset,yoffset,width,height,format,type,pixels)}else if(pixels){var heap=heapObjectForWebGLType(type);GLctx.texSubImage2D(target,level,xoffset,yoffset,width,height,format,type,heap,pixels>>heapAccessShiftForWebGLHeap(heap))}else{GLctx.texSubImage2D(target,level,xoffset,yoffset,width,height,format,type,null)}return}var pixelData=null;if(pixels)pixelData=emscriptenWebGLGetTexPixelData(type,format,width,height,pixels,0);GLctx.texSubImage2D(target,level,xoffset,yoffset,width,height,format,type,pixelData)}function _emscripten_glTexSubImage3D(target,level,xoffset,yoffset,zoffset,width,height,depth,format,type,pixels){if(GLctx.currentPixelUnpackBufferBinding){GLctx["texSubImage3D"](target,level,xoffset,yoffset,zoffset,width,height,depth,format,type,pixels)}else if(pixels){var heap=heapObjectForWebGLType(type);GLctx["texSubImage3D"](target,level,xoffset,yoffset,zoffset,width,height,depth,format,type,heap,pixels>>heapAccessShiftForWebGLHeap(heap))}else{GLctx["texSubImage3D"](target,level,xoffset,yoffset,zoffset,width,height,depth,format,type,null)}}function _emscripten_glTransformFeedbackVaryings(program,count,varyings,bufferMode){program=GL.programs[program];var vars=[];for(var i=0;i>2]));GLctx["transformFeedbackVaryings"](program,vars,bufferMode)}function _emscripten_glUniform1f(location,v0){GLctx.uniform1f(webglGetUniformLocation(location),v0)}var miniTempWebGLFloatBuffers=[];function _emscripten_glUniform1fv(location,count,value){if(GL.currentContext.version>=2){count&&GLctx.uniform1fv(webglGetUniformLocation(location),HEAPF32,value>>2,count);return}if(count<=288){var view=miniTempWebGLFloatBuffers[count-1];for(var i=0;i>2]}}else{var view=HEAPF32.subarray(value>>2,value+count*4>>2)}GLctx.uniform1fv(webglGetUniformLocation(location),view)}function _emscripten_glUniform1i(location,v0){GLctx.uniform1i(webglGetUniformLocation(location),v0)}var __miniTempWebGLIntBuffers=[];function _emscripten_glUniform1iv(location,count,value){if(GL.currentContext.version>=2){count&&GLctx.uniform1iv(webglGetUniformLocation(location),HEAP32,value>>2,count);return}if(count<=288){var view=__miniTempWebGLIntBuffers[count-1];for(var i=0;i>2]}}else{var view=HEAP32.subarray(value>>2,value+count*4>>2)}GLctx.uniform1iv(webglGetUniformLocation(location),view)}function _emscripten_glUniform1ui(location,v0){GLctx.uniform1ui(webglGetUniformLocation(location),v0)}function _emscripten_glUniform1uiv(location,count,value){count&&GLctx.uniform1uiv(webglGetUniformLocation(location),HEAPU32,value>>2,count)}function _emscripten_glUniform2f(location,v0,v1){GLctx.uniform2f(webglGetUniformLocation(location),v0,v1)}function _emscripten_glUniform2fv(location,count,value){if(GL.currentContext.version>=2){count&&GLctx.uniform2fv(webglGetUniformLocation(location),HEAPF32,value>>2,count*2);return}if(count<=144){var view=miniTempWebGLFloatBuffers[2*count-1];for(var i=0;i<2*count;i+=2){view[i]=HEAPF32[value+4*i>>2];view[i+1]=HEAPF32[value+(4*i+4)>>2]}}else{var view=HEAPF32.subarray(value>>2,value+count*8>>2)}GLctx.uniform2fv(webglGetUniformLocation(location),view)}function _emscripten_glUniform2i(location,v0,v1){GLctx.uniform2i(webglGetUniformLocation(location),v0,v1)}function _emscripten_glUniform2iv(location,count,value){if(GL.currentContext.version>=2){count&&GLctx.uniform2iv(webglGetUniformLocation(location),HEAP32,value>>2,count*2);return}if(count<=144){var view=__miniTempWebGLIntBuffers[2*count-1];for(var i=0;i<2*count;i+=2){view[i]=HEAP32[value+4*i>>2];view[i+1]=HEAP32[value+(4*i+4)>>2]}}else{var view=HEAP32.subarray(value>>2,value+count*8>>2)}GLctx.uniform2iv(webglGetUniformLocation(location),view)}function _emscripten_glUniform2ui(location,v0,v1){GLctx.uniform2ui(webglGetUniformLocation(location),v0,v1)}function _emscripten_glUniform2uiv(location,count,value){count&&GLctx.uniform2uiv(webglGetUniformLocation(location),HEAPU32,value>>2,count*2)}function _emscripten_glUniform3f(location,v0,v1,v2){GLctx.uniform3f(webglGetUniformLocation(location),v0,v1,v2)}function _emscripten_glUniform3fv(location,count,value){if(GL.currentContext.version>=2){count&&GLctx.uniform3fv(webglGetUniformLocation(location),HEAPF32,value>>2,count*3);return}if(count<=96){var view=miniTempWebGLFloatBuffers[3*count-1];for(var i=0;i<3*count;i+=3){view[i]=HEAPF32[value+4*i>>2];view[i+1]=HEAPF32[value+(4*i+4)>>2];view[i+2]=HEAPF32[value+(4*i+8)>>2]}}else{var view=HEAPF32.subarray(value>>2,value+count*12>>2)}GLctx.uniform3fv(webglGetUniformLocation(location),view)}function _emscripten_glUniform3i(location,v0,v1,v2){GLctx.uniform3i(webglGetUniformLocation(location),v0,v1,v2)}function _emscripten_glUniform3iv(location,count,value){if(GL.currentContext.version>=2){count&&GLctx.uniform3iv(webglGetUniformLocation(location),HEAP32,value>>2,count*3);return}if(count<=96){var view=__miniTempWebGLIntBuffers[3*count-1];for(var i=0;i<3*count;i+=3){view[i]=HEAP32[value+4*i>>2];view[i+1]=HEAP32[value+(4*i+4)>>2];view[i+2]=HEAP32[value+(4*i+8)>>2]}}else{var view=HEAP32.subarray(value>>2,value+count*12>>2)}GLctx.uniform3iv(webglGetUniformLocation(location),view)}function _emscripten_glUniform3ui(location,v0,v1,v2){GLctx.uniform3ui(webglGetUniformLocation(location),v0,v1,v2)}function _emscripten_glUniform3uiv(location,count,value){count&&GLctx.uniform3uiv(webglGetUniformLocation(location),HEAPU32,value>>2,count*3)}function _emscripten_glUniform4f(location,v0,v1,v2,v3){GLctx.uniform4f(webglGetUniformLocation(location),v0,v1,v2,v3)}function _emscripten_glUniform4fv(location,count,value){if(GL.currentContext.version>=2){count&&GLctx.uniform4fv(webglGetUniformLocation(location),HEAPF32,value>>2,count*4);return}if(count<=72){var view=miniTempWebGLFloatBuffers[4*count-1];var heap=HEAPF32;value>>=2;for(var i=0;i<4*count;i+=4){var dst=value+i;view[i]=heap[dst];view[i+1]=heap[dst+1];view[i+2]=heap[dst+2];view[i+3]=heap[dst+3]}}else{var view=HEAPF32.subarray(value>>2,value+count*16>>2)}GLctx.uniform4fv(webglGetUniformLocation(location),view)}function _emscripten_glUniform4i(location,v0,v1,v2,v3){GLctx.uniform4i(webglGetUniformLocation(location),v0,v1,v2,v3)}function _emscripten_glUniform4iv(location,count,value){if(GL.currentContext.version>=2){count&&GLctx.uniform4iv(webglGetUniformLocation(location),HEAP32,value>>2,count*4);return}if(count<=72){var view=__miniTempWebGLIntBuffers[4*count-1];for(var i=0;i<4*count;i+=4){view[i]=HEAP32[value+4*i>>2];view[i+1]=HEAP32[value+(4*i+4)>>2];view[i+2]=HEAP32[value+(4*i+8)>>2];view[i+3]=HEAP32[value+(4*i+12)>>2]}}else{var view=HEAP32.subarray(value>>2,value+count*16>>2)}GLctx.uniform4iv(webglGetUniformLocation(location),view)}function _emscripten_glUniform4ui(location,v0,v1,v2,v3){GLctx.uniform4ui(webglGetUniformLocation(location),v0,v1,v2,v3)}function _emscripten_glUniform4uiv(location,count,value){count&&GLctx.uniform4uiv(webglGetUniformLocation(location),HEAPU32,value>>2,count*4)}function _emscripten_glUniformBlockBinding(program,uniformBlockIndex,uniformBlockBinding){program=GL.programs[program];GLctx["uniformBlockBinding"](program,uniformBlockIndex,uniformBlockBinding)}function _emscripten_glUniformMatrix2fv(location,count,transpose,value){if(GL.currentContext.version>=2){count&&GLctx.uniformMatrix2fv(webglGetUniformLocation(location),!!transpose,HEAPF32,value>>2,count*4);return}if(count<=72){var view=miniTempWebGLFloatBuffers[4*count-1];for(var i=0;i<4*count;i+=4){view[i]=HEAPF32[value+4*i>>2];view[i+1]=HEAPF32[value+(4*i+4)>>2];view[i+2]=HEAPF32[value+(4*i+8)>>2];view[i+3]=HEAPF32[value+(4*i+12)>>2]}}else{var view=HEAPF32.subarray(value>>2,value+count*16>>2)}GLctx.uniformMatrix2fv(webglGetUniformLocation(location),!!transpose,view)}function _emscripten_glUniformMatrix2x3fv(location,count,transpose,value){count&&GLctx.uniformMatrix2x3fv(webglGetUniformLocation(location),!!transpose,HEAPF32,value>>2,count*6)}function _emscripten_glUniformMatrix2x4fv(location,count,transpose,value){count&&GLctx.uniformMatrix2x4fv(webglGetUniformLocation(location),!!transpose,HEAPF32,value>>2,count*8)}function _emscripten_glUniformMatrix3fv(location,count,transpose,value){if(GL.currentContext.version>=2){count&&GLctx.uniformMatrix3fv(webglGetUniformLocation(location),!!transpose,HEAPF32,value>>2,count*9);return}if(count<=32){var view=miniTempWebGLFloatBuffers[9*count-1];for(var i=0;i<9*count;i+=9){view[i]=HEAPF32[value+4*i>>2];view[i+1]=HEAPF32[value+(4*i+4)>>2];view[i+2]=HEAPF32[value+(4*i+8)>>2];view[i+3]=HEAPF32[value+(4*i+12)>>2];view[i+4]=HEAPF32[value+(4*i+16)>>2];view[i+5]=HEAPF32[value+(4*i+20)>>2];view[i+6]=HEAPF32[value+(4*i+24)>>2];view[i+7]=HEAPF32[value+(4*i+28)>>2];view[i+8]=HEAPF32[value+(4*i+32)>>2]}}else{var view=HEAPF32.subarray(value>>2,value+count*36>>2)}GLctx.uniformMatrix3fv(webglGetUniformLocation(location),!!transpose,view)}function _emscripten_glUniformMatrix3x2fv(location,count,transpose,value){count&&GLctx.uniformMatrix3x2fv(webglGetUniformLocation(location),!!transpose,HEAPF32,value>>2,count*6)}function _emscripten_glUniformMatrix3x4fv(location,count,transpose,value){count&&GLctx.uniformMatrix3x4fv(webglGetUniformLocation(location),!!transpose,HEAPF32,value>>2,count*12)}function _emscripten_glUniformMatrix4fv(location,count,transpose,value){if(GL.currentContext.version>=2){count&&GLctx.uniformMatrix4fv(webglGetUniformLocation(location),!!transpose,HEAPF32,value>>2,count*16);return}if(count<=18){var view=miniTempWebGLFloatBuffers[16*count-1];var heap=HEAPF32;value>>=2;for(var i=0;i<16*count;i+=16){var dst=value+i;view[i]=heap[dst];view[i+1]=heap[dst+1];view[i+2]=heap[dst+2];view[i+3]=heap[dst+3];view[i+4]=heap[dst+4];view[i+5]=heap[dst+5];view[i+6]=heap[dst+6];view[i+7]=heap[dst+7];view[i+8]=heap[dst+8];view[i+9]=heap[dst+9];view[i+10]=heap[dst+10];view[i+11]=heap[dst+11];view[i+12]=heap[dst+12];view[i+13]=heap[dst+13];view[i+14]=heap[dst+14];view[i+15]=heap[dst+15]}}else{var view=HEAPF32.subarray(value>>2,value+count*64>>2)}GLctx.uniformMatrix4fv(webglGetUniformLocation(location),!!transpose,view)}function _emscripten_glUniformMatrix4x2fv(location,count,transpose,value){count&&GLctx.uniformMatrix4x2fv(webglGetUniformLocation(location),!!transpose,HEAPF32,value>>2,count*8)}function _emscripten_glUniformMatrix4x3fv(location,count,transpose,value){count&&GLctx.uniformMatrix4x3fv(webglGetUniformLocation(location),!!transpose,HEAPF32,value>>2,count*12)}function _emscripten_glUseProgram(program){program=GL.programs[program];GLctx.useProgram(program);GLctx.currentProgram=program}function _emscripten_glValidateProgram(program){GLctx.validateProgram(GL.programs[program])}function _emscripten_glVertexAttrib1f(x0,x1){GLctx["vertexAttrib1f"](x0,x1)}function _emscripten_glVertexAttrib1fv(index,v){GLctx.vertexAttrib1f(index,HEAPF32[v>>2])}function _emscripten_glVertexAttrib2f(x0,x1,x2){GLctx["vertexAttrib2f"](x0,x1,x2)}function _emscripten_glVertexAttrib2fv(index,v){GLctx.vertexAttrib2f(index,HEAPF32[v>>2],HEAPF32[v+4>>2])}function _emscripten_glVertexAttrib3f(x0,x1,x2,x3){GLctx["vertexAttrib3f"](x0,x1,x2,x3)}function _emscripten_glVertexAttrib3fv(index,v){GLctx.vertexAttrib3f(index,HEAPF32[v>>2],HEAPF32[v+4>>2],HEAPF32[v+8>>2])}function _emscripten_glVertexAttrib4f(x0,x1,x2,x3,x4){GLctx["vertexAttrib4f"](x0,x1,x2,x3,x4)}function _emscripten_glVertexAttrib4fv(index,v){GLctx.vertexAttrib4f(index,HEAPF32[v>>2],HEAPF32[v+4>>2],HEAPF32[v+8>>2],HEAPF32[v+12>>2])}function _emscripten_glVertexAttribDivisor(index,divisor){GLctx["vertexAttribDivisor"](index,divisor)}function _emscripten_glVertexAttribDivisorANGLE(index,divisor){GLctx["vertexAttribDivisor"](index,divisor)}function _emscripten_glVertexAttribDivisorARB(index,divisor){GLctx["vertexAttribDivisor"](index,divisor)}function _emscripten_glVertexAttribDivisorEXT(index,divisor){GLctx["vertexAttribDivisor"](index,divisor)}function _emscripten_glVertexAttribDivisorNV(index,divisor){GLctx["vertexAttribDivisor"](index,divisor)}function _emscripten_glVertexAttribI4i(x0,x1,x2,x3,x4){GLctx["vertexAttribI4i"](x0,x1,x2,x3,x4)}function _emscripten_glVertexAttribI4iv(index,v){GLctx.vertexAttribI4i(index,HEAP32[v>>2],HEAP32[v+4>>2],HEAP32[v+8>>2],HEAP32[v+12>>2])}function _emscripten_glVertexAttribI4ui(x0,x1,x2,x3,x4){GLctx["vertexAttribI4ui"](x0,x1,x2,x3,x4)}function _emscripten_glVertexAttribI4uiv(index,v){GLctx.vertexAttribI4ui(index,HEAPU32[v>>2],HEAPU32[v+4>>2],HEAPU32[v+8>>2],HEAPU32[v+12>>2])}function _emscripten_glVertexAttribIPointer(index,size,type,stride,ptr){GLctx["vertexAttribIPointer"](index,size,type,stride,ptr)}function _emscripten_glVertexAttribPointer(index,size,type,normalized,stride,ptr){GLctx.vertexAttribPointer(index,size,type,!!normalized,stride,ptr)}function _emscripten_glViewport(x0,x1,x2,x3){GLctx["viewport"](x0,x1,x2,x3)}function _emscripten_glWaitSync(sync,flags,timeoutLo,timeoutHi){GLctx.waitSync(GL.syncs[sync],flags,convertI32PairToI53(timeoutLo,timeoutHi))}function _emscripten_memcpy_big(dest,src,num){HEAPU8.copyWithin(dest,src,src+num)}function getHeapMax(){return 2147483648}function emscripten_realloc_buffer(size){try{wasmMemory.grow(size-buffer.byteLength+65535>>>16);updateGlobalBufferAndViews(wasmMemory.buffer);return 1}catch(e){}}function _emscripten_resize_heap(requestedSize){var oldSize=HEAPU8.length;requestedSize=requestedSize>>>0;var maxHeapSize=getHeapMax();if(requestedSize>maxHeapSize){return false}let alignUp=(x,multiple)=>x+(multiple-x%multiple)%multiple;for(var cutDown=1;cutDown<=4;cutDown*=2){var overGrownHeapSize=oldSize*(1+.2/cutDown);overGrownHeapSize=Math.min(overGrownHeapSize,requestedSize+100663296);var newSize=Math.min(maxHeapSize,alignUp(Math.max(requestedSize,overGrownHeapSize),65536));var replacement=emscripten_realloc_buffer(newSize);if(replacement){return true}}return false}function _emscripten_set_main_loop(func,fps,simulateInfiniteLoop){var browserIterationFunc=getWasmTableEntry(func);setMainLoop(browserIterationFunc,fps,simulateInfiniteLoop)}var JSEvents={inEventHandler:0,removeAllEventListeners:function(){for(var i=JSEvents.eventHandlers.length-1;i>=0;--i){JSEvents._removeHandler(i)}JSEvents.eventHandlers=[];JSEvents.deferredCalls=[]},registerRemoveEventListeners:function(){if(!JSEvents.removeEventListenersRegistered){__ATEXIT__.push(JSEvents.removeAllEventListeners);JSEvents.removeEventListenersRegistered=true}},deferredCalls:[],deferCall:function(targetFunction,precedence,argsList){function arraysHaveEqualContent(arrA,arrB){if(arrA.length!=arrB.length)return false;for(var i in arrA){if(arrA[i]!=arrB[i])return false}return true}for(var i in JSEvents.deferredCalls){var call=JSEvents.deferredCalls[i];if(call.targetFunction==targetFunction&&arraysHaveEqualContent(call.argsList,argsList)){return}}JSEvents.deferredCalls.push({targetFunction:targetFunction,precedence:precedence,argsList:argsList});JSEvents.deferredCalls.sort(function(x,y){return x.precedence2?UTF8ToString(cString):cString}var specialHTMLTargets=[0,typeof document!="undefined"?document:0,typeof window!="undefined"?window:0];function findEventTarget(target){target=maybeCStringToJsString(target);var domElement=specialHTMLTargets[target]||(typeof document!="undefined"?document.querySelector(target):undefined);return domElement}function findCanvasEventTarget(target){return findEventTarget(target)}function _emscripten_webgl_do_create_context(target,attributes){var a=attributes>>2;var powerPreference=HEAP32[a+(24>>2)];var contextAttributes={"alpha":!!HEAP32[a+(0>>2)],"depth":!!HEAP32[a+(4>>2)],"stencil":!!HEAP32[a+(8>>2)],"antialias":!!HEAP32[a+(12>>2)],"premultipliedAlpha":!!HEAP32[a+(16>>2)],"preserveDrawingBuffer":!!HEAP32[a+(20>>2)],"powerPreference":__emscripten_webgl_power_preferences[powerPreference],"failIfMajorPerformanceCaveat":!!HEAP32[a+(28>>2)],majorVersion:HEAP32[a+(32>>2)],minorVersion:HEAP32[a+(36>>2)],enableExtensionsByDefault:HEAP32[a+(40>>2)],explicitSwapControl:HEAP32[a+(44>>2)],proxyContextToMainThread:HEAP32[a+(48>>2)],renderViaOffscreenBackBuffer:HEAP32[a+(52>>2)]};var canvas=findCanvasEventTarget(target);if(!canvas){return 0}if(contextAttributes.explicitSwapControl&&!contextAttributes.renderViaOffscreenBackBuffer){contextAttributes.renderViaOffscreenBackBuffer=true}var contextHandle=GL.createContext(canvas,contextAttributes);return contextHandle}function _emscripten_webgl_create_context(a0,a1){return _emscripten_webgl_do_create_context(a0,a1)}function _emscripten_webgl_destroy_context(contextHandle){if(GL.currentContext==contextHandle)GL.currentContext=0;GL.deleteContext(contextHandle)}function _emscripten_webgl_init_context_attributes(attributes){var a=attributes>>2;for(var i=0;i<56>>2;++i){HEAP32[a+i]=0}HEAP32[a+(0>>2)]=HEAP32[a+(4>>2)]=HEAP32[a+(12>>2)]=HEAP32[a+(16>>2)]=HEAP32[a+(32>>2)]=HEAP32[a+(40>>2)]=1}function _emscripten_webgl_make_context_current(contextHandle){var success=GL.makeContextCurrent(contextHandle);return success?0:-5}var ENV={};function getExecutableName(){return thisProgram||"./this.program"}function getEnvStrings(){if(!getEnvStrings.strings){var lang=(typeof navigator=="object"&&navigator.languages&&navigator.languages[0]||"C").replace("-","_")+".UTF-8";var env={"USER":"web_user","LOGNAME":"web_user","PATH":"/","PWD":"/","HOME":"/home/web_user","LANG":lang,"_":getExecutableName()};for(var x in ENV){if(ENV[x]===undefined)delete env[x];else env[x]=ENV[x]}var strings=[];for(var x in env){strings.push(x+"="+env[x])}getEnvStrings.strings=strings}return getEnvStrings.strings}function _environ_get(__environ,environ_buf){var bufSize=0;getEnvStrings().forEach(function(string,i){var ptr=environ_buf+bufSize;HEAPU32[__environ+i*4>>2]=ptr;writeAsciiToMemory(string,ptr);bufSize+=string.length+1});return 0}function _environ_sizes_get(penviron_count,penviron_buf_size){var strings=getEnvStrings();HEAPU32[penviron_count>>2]=strings.length;var bufSize=0;strings.forEach(function(string){bufSize+=string.length+1});HEAPU32[penviron_buf_size>>2]=bufSize;return 0}function _fd_close(fd){try{var stream=SYSCALLS.getStreamFromFD(fd);FS.close(stream);return 0}catch(e){if(typeof FS=="undefined"||!(e instanceof FS.ErrnoError))throw e;return e.errno}}function _fd_fdstat_get(fd,pbuf){try{var stream=SYSCALLS.getStreamFromFD(fd);var type=stream.tty?2:FS.isDir(stream.mode)?3:FS.isLink(stream.mode)?7:4;HEAP8[pbuf>>0]=type;return 0}catch(e){if(typeof FS=="undefined"||!(e instanceof FS.ErrnoError))throw e;return e.errno}}function doReadv(stream,iov,iovcnt,offset){var ret=0;for(var i=0;i>2];var len=HEAPU32[iov+4>>2];iov+=8;var curr=FS.read(stream,HEAP8,ptr,len,offset);if(curr<0)return-1;ret+=curr;if(curr>2]=num;return 0}catch(e){if(typeof FS=="undefined"||!(e instanceof FS.ErrnoError))throw e;return e.errno}}function convertI32PairToI53Checked(lo,hi){return hi+2097152>>>0<4194305-!!lo?(lo>>>0)+hi*4294967296:NaN}function _fd_seek(fd,offset_low,offset_high,whence,newOffset){try{var offset=convertI32PairToI53Checked(offset_low,offset_high);if(isNaN(offset))return 61;var stream=SYSCALLS.getStreamFromFD(fd);FS.llseek(stream,offset,whence);tempI64=[stream.position>>>0,(tempDouble=stream.position,+Math.abs(tempDouble)>=1?tempDouble>0?(Math.min(+Math.floor(tempDouble/4294967296),4294967295)|0)>>>0:~~+Math.ceil((tempDouble-+(~~tempDouble>>>0))/4294967296)>>>0:0)],HEAP32[newOffset>>2]=tempI64[0],HEAP32[newOffset+4>>2]=tempI64[1];if(stream.getdents&&offset===0&&whence===0)stream.getdents=null;return 0}catch(e){if(typeof FS=="undefined"||!(e instanceof FS.ErrnoError))throw e;return e.errno}}function doWritev(stream,iov,iovcnt,offset){var ret=0;for(var i=0;i>2];var len=HEAPU32[iov+4>>2];iov+=8;var curr=FS.write(stream,HEAP8,ptr,len,offset);if(curr<0)return-1;ret+=curr}return ret}function _fd_write(fd,iov,iovcnt,pnum){try{var stream=SYSCALLS.getStreamFromFD(fd);var num=doWritev(stream,iov,iovcnt);HEAPU32[pnum>>2]=num;return 0}catch(e){if(typeof FS=="undefined"||!(e instanceof FS.ErrnoError))throw e;return e.errno}}function _getTempRet0(){return getTempRet0()}function _getaddrinfo(node,service,hint,out){var addr=0;var port=0;var flags=0;var family=0;var type=0;var proto=0;var ai;function allocaddrinfo(family,type,proto,canon,addr,port){var sa,salen,ai;var errno;salen=family===10?28:16;addr=family===10?inetNtop6(addr):inetNtop4(addr);sa=_malloc(salen);errno=writeSockaddr(sa,family,addr,port);assert(!errno);ai=_malloc(32);HEAP32[ai+4>>2]=family;HEAP32[ai+8>>2]=type;HEAP32[ai+12>>2]=proto;HEAP32[ai+24>>2]=canon;HEAPU32[ai+20>>2]=sa;if(family===10){HEAP32[ai+16>>2]=28}else{HEAP32[ai+16>>2]=16}HEAP32[ai+28>>2]=0;return ai}if(hint){flags=HEAP32[hint>>2];family=HEAP32[hint+4>>2];type=HEAP32[hint+8>>2];proto=HEAP32[hint+12>>2]}if(type&&!proto){proto=type===2?17:6}if(!type&&proto){type=proto===17?2:1}if(proto===0){proto=6}if(type===0){type=1}if(!node&&!service){return-2}if(flags&~(1|2|4|1024|8|16|32)){return-1}if(hint!==0&&HEAP32[hint>>2]&2&&!node){return-1}if(flags&32){return-2}if(type!==0&&type!==1&&type!==2){return-7}if(family!==0&&family!==2&&family!==10){return-6}if(service){service=UTF8ToString(service);port=parseInt(service,10);if(isNaN(port)){if(flags&1024){return-2}return-8}}if(!node){if(family===0){family=2}if((flags&1)===0){if(family===2){addr=_htonl(2130706433)}else{addr=[0,0,0,1]}}ai=allocaddrinfo(family,type,proto,null,addr,port);HEAPU32[out>>2]=ai;return 0}node=UTF8ToString(node);addr=inetPton4(node);if(addr!==null){if(family===0||family===2){family=2}else if(family===10&&flags&8){addr=[0,0,_htonl(65535),addr];family=10}else{return-2}}else{addr=inetPton6(node);if(addr!==null){if(family===0||family===10){family=10}else{return-2}}}if(addr!=null){ai=allocaddrinfo(family,type,proto,node,addr,port);HEAPU32[out>>2]=ai;return 0}if(flags&4){return-2}node=DNS.lookup_name(node);addr=inetPton4(node);if(family===0){family=2}else if(family===10){addr=[0,0,_htonl(65535),addr]}ai=allocaddrinfo(family,type,proto,null,addr,port);HEAPU32[out>>2]=ai;return 0}function _getnameinfo(sa,salen,node,nodelen,serv,servlen,flags){var info=readSockaddr(sa,salen);if(info.errno){return-6}var port=info.port;var addr=info.addr;var overflowed=false;if(node&&nodelen){var lookup;if(flags&1||!(lookup=DNS.lookup_addr(addr))){if(flags&8){return-2}}else{addr=lookup}var numBytesWrittenExclNull=stringToUTF8(addr,node,nodelen);if(numBytesWrittenExclNull+1>=nodelen){overflowed=true}}if(serv&&servlen){port=""+port;var numBytesWrittenExclNull=stringToUTF8(port,serv,servlen);if(numBytesWrittenExclNull+1>=servlen){overflowed=true}}if(overflowed){return-12}return 0}function _glActiveTexture(x0){GLctx["activeTexture"](x0)}function _glAttachShader(program,shader){GLctx.attachShader(GL.programs[program],GL.shaders[shader])}function _glBeginTransformFeedback(x0){GLctx["beginTransformFeedback"](x0)}function _glBindAttribLocation(program,index,name){GLctx.bindAttribLocation(GL.programs[program],index,UTF8ToString(name))}function _glBindBuffer(target,buffer){if(target==35051){GLctx.currentPixelPackBufferBinding=buffer}else if(target==35052){GLctx.currentPixelUnpackBufferBinding=buffer}GLctx.bindBuffer(target,GL.buffers[buffer])}function _glBindBufferBase(target,index,buffer){GLctx["bindBufferBase"](target,index,GL.buffers[buffer])}function _glBindFramebuffer(target,framebuffer){GLctx.bindFramebuffer(target,framebuffer?GL.framebuffers[framebuffer]:GL.currentContext.defaultFbo)}function _glBindRenderbuffer(target,renderbuffer){GLctx.bindRenderbuffer(target,GL.renderbuffers[renderbuffer])}function _glBindTexture(target,texture){GLctx.bindTexture(target,GL.textures[texture])}function _glBindVertexArray(vao){GLctx["bindVertexArray"](GL.vaos[vao])}function _glBlendEquation(x0){GLctx["blendEquation"](x0)}function _glBlendFunc(x0,x1){GLctx["blendFunc"](x0,x1)}function _glBlendFuncSeparate(x0,x1,x2,x3){GLctx["blendFuncSeparate"](x0,x1,x2,x3)}function _glBlitFramebuffer(x0,x1,x2,x3,x4,x5,x6,x7,x8,x9){GLctx["blitFramebuffer"](x0,x1,x2,x3,x4,x5,x6,x7,x8,x9)}function _glBufferData(target,size,data,usage){if(GL.currentContext.version>=2){if(data&&size){GLctx.bufferData(target,HEAPU8,usage,data,size)}else{GLctx.bufferData(target,size,usage)}}else{GLctx.bufferData(target,data?HEAPU8.subarray(data,data+size):size,usage)}}function _glBufferSubData(target,offset,size,data){if(GL.currentContext.version>=2){size&&GLctx.bufferSubData(target,offset,HEAPU8,data,size);return}GLctx.bufferSubData(target,offset,HEAPU8.subarray(data,data+size))}function _glCheckFramebufferStatus(x0){return GLctx["checkFramebufferStatus"](x0)}function _glClear(x0){GLctx["clear"](x0)}function _glClearBufferfv(buffer,drawbuffer,value){GLctx["clearBufferfv"](buffer,drawbuffer,HEAPF32,value>>2)}function _glClearColor(x0,x1,x2,x3){GLctx["clearColor"](x0,x1,x2,x3)}function _glClearDepthf(x0){GLctx["clearDepth"](x0)}function _glColorMask(red,green,blue,alpha){GLctx.colorMask(!!red,!!green,!!blue,!!alpha)}function _glCompileShader(shader){GLctx.compileShader(GL.shaders[shader])}function _glCompressedTexImage2D(target,level,internalFormat,width,height,border,imageSize,data){if(GL.currentContext.version>=2){if(GLctx.currentPixelUnpackBufferBinding||!imageSize){GLctx["compressedTexImage2D"](target,level,internalFormat,width,height,border,imageSize,data)}else{GLctx["compressedTexImage2D"](target,level,internalFormat,width,height,border,HEAPU8,data,imageSize)}return}GLctx["compressedTexImage2D"](target,level,internalFormat,width,height,border,data?HEAPU8.subarray(data,data+imageSize):null)}function _glCompressedTexSubImage2D(target,level,xoffset,yoffset,width,height,format,imageSize,data){if(GL.currentContext.version>=2){if(GLctx.currentPixelUnpackBufferBinding||!imageSize){GLctx["compressedTexSubImage2D"](target,level,xoffset,yoffset,width,height,format,imageSize,data)}else{GLctx["compressedTexSubImage2D"](target,level,xoffset,yoffset,width,height,format,HEAPU8,data,imageSize)}return}GLctx["compressedTexSubImage2D"](target,level,xoffset,yoffset,width,height,format,data?HEAPU8.subarray(data,data+imageSize):null)}function _glCompressedTexSubImage3D(target,level,xoffset,yoffset,zoffset,width,height,depth,format,imageSize,data){if(GLctx.currentPixelUnpackBufferBinding){GLctx["compressedTexSubImage3D"](target,level,xoffset,yoffset,zoffset,width,height,depth,format,imageSize,data)}else{GLctx["compressedTexSubImage3D"](target,level,xoffset,yoffset,zoffset,width,height,depth,format,HEAPU8,data,imageSize)}}function _glCopyBufferSubData(x0,x1,x2,x3,x4){GLctx["copyBufferSubData"](x0,x1,x2,x3,x4)}function _glCopyTexSubImage2D(x0,x1,x2,x3,x4,x5,x6,x7){GLctx["copyTexSubImage2D"](x0,x1,x2,x3,x4,x5,x6,x7)}function _glCreateProgram(){var id=GL.getNewId(GL.programs);var program=GLctx.createProgram();program.name=id;program.maxUniformLength=program.maxAttributeLength=program.maxUniformBlockNameLength=0;program.uniformIdCounter=1;GL.programs[id]=program;return id}function _glCreateShader(shaderType){var id=GL.getNewId(GL.shaders);GL.shaders[id]=GLctx.createShader(shaderType);return id}function _glCullFace(x0){GLctx["cullFace"](x0)}function _glDeleteBuffers(n,buffers){for(var i=0;i>2];var buffer=GL.buffers[id];if(!buffer)continue;GLctx.deleteBuffer(buffer);buffer.name=0;GL.buffers[id]=null;if(id==GLctx.currentPixelPackBufferBinding)GLctx.currentPixelPackBufferBinding=0;if(id==GLctx.currentPixelUnpackBufferBinding)GLctx.currentPixelUnpackBufferBinding=0}}function _glDeleteFramebuffers(n,framebuffers){for(var i=0;i>2];var framebuffer=GL.framebuffers[id];if(!framebuffer)continue;GLctx.deleteFramebuffer(framebuffer);framebuffer.name=0;GL.framebuffers[id]=null}}function _glDeleteProgram(id){if(!id)return;var program=GL.programs[id];if(!program){GL.recordError(1281);return}GLctx.deleteProgram(program);program.name=0;GL.programs[id]=null}function _glDeleteRenderbuffers(n,renderbuffers){for(var i=0;i>2];var renderbuffer=GL.renderbuffers[id];if(!renderbuffer)continue;GLctx.deleteRenderbuffer(renderbuffer);renderbuffer.name=0;GL.renderbuffers[id]=null}}function _glDeleteShader(id){if(!id)return;var shader=GL.shaders[id];if(!shader){GL.recordError(1281);return}GLctx.deleteShader(shader);GL.shaders[id]=null}function _glDeleteTextures(n,textures){for(var i=0;i>2];var texture=GL.textures[id];if(!texture)continue;GLctx.deleteTexture(texture);texture.name=0;GL.textures[id]=null}}function _glDeleteVertexArrays(n,vaos){for(var i=0;i>2];GLctx["deleteVertexArray"](GL.vaos[id]);GL.vaos[id]=null}}function _glDepthFunc(x0){GLctx["depthFunc"](x0)}function _glDepthMask(flag){GLctx.depthMask(!!flag)}function _glDisable(x0){GLctx["disable"](x0)}function _glDisableVertexAttribArray(index){GLctx.disableVertexAttribArray(index)}function _glDrawArrays(mode,first,count){GLctx.drawArrays(mode,first,count)}function _glDrawArraysInstanced(mode,first,count,primcount){GLctx["drawArraysInstanced"](mode,first,count,primcount)}function _glDrawBuffers(n,bufs){var bufArray=tempFixedLengthArray[n];for(var i=0;i>2]}GLctx["drawBuffers"](bufArray)}function _glDrawElementsInstanced(mode,count,type,indices,primcount){GLctx["drawElementsInstanced"](mode,count,type,indices,primcount)}function _glEnable(x0){GLctx["enable"](x0)}function _glEnableVertexAttribArray(index){GLctx.enableVertexAttribArray(index)}function _glEndTransformFeedback(){GLctx["endTransformFeedback"]()}function _glFinish(){GLctx["finish"]()}function _glFramebufferRenderbuffer(target,attachment,renderbuffertarget,renderbuffer){GLctx.framebufferRenderbuffer(target,attachment,renderbuffertarget,GL.renderbuffers[renderbuffer])}function _glFramebufferTexture2D(target,attachment,textarget,texture,level){GLctx.framebufferTexture2D(target,attachment,textarget,GL.textures[texture],level)}function _glFramebufferTextureLayer(target,attachment,texture,level,layer){GLctx.framebufferTextureLayer(target,attachment,GL.textures[texture],level,layer)}function _glFrontFace(x0){GLctx["frontFace"](x0)}function _glGenBuffers(n,buffers){__glGenObject(n,buffers,"createBuffer",GL.buffers)}function _glGenFramebuffers(n,ids){__glGenObject(n,ids,"createFramebuffer",GL.framebuffers)}function _glGenRenderbuffers(n,renderbuffers){__glGenObject(n,renderbuffers,"createRenderbuffer",GL.renderbuffers)}function _glGenTextures(n,textures){__glGenObject(n,textures,"createTexture",GL.textures)}function _glGenVertexArrays(n,arrays){__glGenObject(n,arrays,"createVertexArray",GL.vaos)}function _glGenerateMipmap(x0){GLctx["generateMipmap"](x0)}function _glGetError(){var error=GLctx.getError()||GL.lastError;GL.lastError=0;return error}function _glGetFloatv(name_,p){emscriptenWebGLGet(name_,p,2)}function _glGetIntegerv(name_,p){emscriptenWebGLGet(name_,p,0)}function _glGetProgramBinary(program,bufSize,length,binaryFormat,binary){GL.recordError(1282)}function _glGetProgramInfoLog(program,maxLength,length,infoLog){var log=GLctx.getProgramInfoLog(GL.programs[program]);if(log===null)log="(unknown error)";var numBytesWrittenExclNull=maxLength>0&&infoLog?stringToUTF8(log,infoLog,maxLength):0;if(length)HEAP32[length>>2]=numBytesWrittenExclNull}function _glGetProgramiv(program,pname,p){if(!p){GL.recordError(1281);return}if(program>=GL.counter){GL.recordError(1281);return}program=GL.programs[program];if(pname==35716){var log=GLctx.getProgramInfoLog(program);if(log===null)log="(unknown error)";HEAP32[p>>2]=log.length+1}else if(pname==35719){if(!program.maxUniformLength){for(var i=0;i>2]=program.maxUniformLength}else if(pname==35722){if(!program.maxAttributeLength){for(var i=0;i>2]=program.maxAttributeLength}else if(pname==35381){if(!program.maxUniformBlockNameLength){for(var i=0;i>2]=program.maxUniformBlockNameLength}else{HEAP32[p>>2]=GLctx.getProgramParameter(program,pname)}}function _glGetShaderInfoLog(shader,maxLength,length,infoLog){var log=GLctx.getShaderInfoLog(GL.shaders[shader]);if(log===null)log="(unknown error)";var numBytesWrittenExclNull=maxLength>0&&infoLog?stringToUTF8(log,infoLog,maxLength):0;if(length)HEAP32[length>>2]=numBytesWrittenExclNull}function _glGetShaderSource(shader,bufSize,length,source){var result=GLctx.getShaderSource(GL.shaders[shader]);if(!result)return;var numBytesWrittenExclNull=bufSize>0&&source?stringToUTF8(result,source,bufSize):0;if(length)HEAP32[length>>2]=numBytesWrittenExclNull}function _glGetShaderiv(shader,pname,p){if(!p){GL.recordError(1281);return}if(pname==35716){var log=GLctx.getShaderInfoLog(GL.shaders[shader]);if(log===null)log="(unknown error)";var logLength=log?log.length+1:0;HEAP32[p>>2]=logLength}else if(pname==35720){var source=GLctx.getShaderSource(GL.shaders[shader]);var sourceLength=source?source.length+1:0;HEAP32[p>>2]=sourceLength}else{HEAP32[p>>2]=GLctx.getShaderParameter(GL.shaders[shader],pname)}}function _glGetString(name_){var ret=GL.stringCache[name_];if(!ret){switch(name_){case 7939:var exts=GLctx.getSupportedExtensions()||[];exts=exts.concat(exts.map(function(e){return"GL_"+e}));ret=stringToNewUTF8(exts.join(" "));break;case 7936:case 7937:case 37445:case 37446:var s=GLctx.getParameter(name_);if(!s){GL.recordError(1280)}ret=s&&stringToNewUTF8(s);break;case 7938:var glVersion=GLctx.getParameter(7938);if(GL.currentContext.version>=2)glVersion="OpenGL ES 3.0 ("+glVersion+")";else{glVersion="OpenGL ES 2.0 ("+glVersion+")"}ret=stringToNewUTF8(glVersion);break;case 35724:var glslVersion=GLctx.getParameter(35724);var ver_re=/^WebGL GLSL ES ([0-9]\.[0-9][0-9]?)(?:$| .*)/;var ver_num=glslVersion.match(ver_re);if(ver_num!==null){if(ver_num[1].length==3)ver_num[1]=ver_num[1]+"0";glslVersion="OpenGL ES GLSL ES "+ver_num[1]+" ("+glslVersion+")"}ret=stringToNewUTF8(glslVersion);break;default:GL.recordError(1280)}GL.stringCache[name_]=ret}return ret}function _glGetStringi(name,index){if(GL.currentContext.version<2){GL.recordError(1282);return 0}var stringiCache=GL.stringiCache[name];if(stringiCache){if(index<0||index>=stringiCache.length){GL.recordError(1281);return 0}return stringiCache[index]}switch(name){case 7939:var exts=GLctx.getSupportedExtensions()||[];exts=exts.concat(exts.map(function(e){return"GL_"+e}));exts=exts.map(function(e){return stringToNewUTF8(e)});stringiCache=GL.stringiCache[name]=exts;if(index<0||index>=stringiCache.length){GL.recordError(1281);return 0}return stringiCache[index];default:GL.recordError(1280);return 0}}function _glGetUniformBlockIndex(program,uniformBlockName){return GLctx["getUniformBlockIndex"](GL.programs[program],UTF8ToString(uniformBlockName))}function _glGetUniformLocation(program,name){name=UTF8ToString(name);if(program=GL.programs[program]){webglPrepareUniformLocationsBeforeFirstUse(program);var uniformLocsById=program.uniformLocsById;var arrayIndex=0;var uniformBaseName=name;var leftBrace=webglGetLeftBracePos(name);if(leftBrace>0){arrayIndex=jstoi_q(name.slice(leftBrace+1))>>>0;uniformBaseName=name.slice(0,leftBrace)}var sizeAndId=program.uniformSizeAndIdsByName[uniformBaseName];if(sizeAndId&&arrayIndex>2]}GLctx["invalidateFramebuffer"](target,list)}function _glLinkProgram(program){program=GL.programs[program];GLctx.linkProgram(program);program.uniformLocsById=0;program.uniformSizeAndIdsByName={}}function _glPixelStorei(pname,param){if(pname==3317){GL.unpackAlignment=param}GLctx.pixelStorei(pname,param)}function _glProgramBinary(program,binaryFormat,binary,length){GL.recordError(1280)}function _glProgramParameteri(program,pname,value){GL.recordError(1280)}function _glReadBuffer(x0){GLctx["readBuffer"](x0)}function _glReadPixels(x,y,width,height,format,type,pixels){if(GL.currentContext.version>=2){if(GLctx.currentPixelPackBufferBinding){GLctx.readPixels(x,y,width,height,format,type,pixels)}else{var heap=heapObjectForWebGLType(type);GLctx.readPixels(x,y,width,height,format,type,heap,pixels>>heapAccessShiftForWebGLHeap(heap))}return}var pixelData=emscriptenWebGLGetTexPixelData(type,format,width,height,pixels,format);if(!pixelData){GL.recordError(1280);return}GLctx.readPixels(x,y,width,height,format,type,pixelData)}function _glRenderbufferStorage(x0,x1,x2,x3){GLctx["renderbufferStorage"](x0,x1,x2,x3)}function _glRenderbufferStorageMultisample(x0,x1,x2,x3,x4){GLctx["renderbufferStorageMultisample"](x0,x1,x2,x3,x4)}function _glScissor(x0,x1,x2,x3){GLctx["scissor"](x0,x1,x2,x3)}function _glShaderSource(shader,count,string,length){var source=GL.getSource(shader,count,string,length);GLctx.shaderSource(GL.shaders[shader],source)}function _glTexImage2D(target,level,internalFormat,width,height,border,format,type,pixels){if(GL.currentContext.version>=2){if(GLctx.currentPixelUnpackBufferBinding){GLctx.texImage2D(target,level,internalFormat,width,height,border,format,type,pixels)}else if(pixels){var heap=heapObjectForWebGLType(type);GLctx.texImage2D(target,level,internalFormat,width,height,border,format,type,heap,pixels>>heapAccessShiftForWebGLHeap(heap))}else{GLctx.texImage2D(target,level,internalFormat,width,height,border,format,type,null)}return}GLctx.texImage2D(target,level,internalFormat,width,height,border,format,type,pixels?emscriptenWebGLGetTexPixelData(type,format,width,height,pixels,internalFormat):null)}function _glTexImage3D(target,level,internalFormat,width,height,depth,border,format,type,pixels){if(GLctx.currentPixelUnpackBufferBinding){GLctx["texImage3D"](target,level,internalFormat,width,height,depth,border,format,type,pixels)}else if(pixels){var heap=heapObjectForWebGLType(type);GLctx["texImage3D"](target,level,internalFormat,width,height,depth,border,format,type,heap,pixels>>heapAccessShiftForWebGLHeap(heap))}else{GLctx["texImage3D"](target,level,internalFormat,width,height,depth,border,format,type,null)}}function _glTexParameterf(x0,x1,x2){GLctx["texParameterf"](x0,x1,x2)}function _glTexParameteri(x0,x1,x2){GLctx["texParameteri"](x0,x1,x2)}function _glTexStorage2D(x0,x1,x2,x3,x4){GLctx["texStorage2D"](x0,x1,x2,x3,x4)}function _glTexSubImage2D(target,level,xoffset,yoffset,width,height,format,type,pixels){if(GL.currentContext.version>=2){if(GLctx.currentPixelUnpackBufferBinding){GLctx.texSubImage2D(target,level,xoffset,yoffset,width,height,format,type,pixels)}else if(pixels){var heap=heapObjectForWebGLType(type);GLctx.texSubImage2D(target,level,xoffset,yoffset,width,height,format,type,heap,pixels>>heapAccessShiftForWebGLHeap(heap))}else{GLctx.texSubImage2D(target,level,xoffset,yoffset,width,height,format,type,null)}return}var pixelData=null;if(pixels)pixelData=emscriptenWebGLGetTexPixelData(type,format,width,height,pixels,0);GLctx.texSubImage2D(target,level,xoffset,yoffset,width,height,format,type,pixelData)}function _glTexSubImage3D(target,level,xoffset,yoffset,zoffset,width,height,depth,format,type,pixels){if(GLctx.currentPixelUnpackBufferBinding){GLctx["texSubImage3D"](target,level,xoffset,yoffset,zoffset,width,height,depth,format,type,pixels)}else if(pixels){var heap=heapObjectForWebGLType(type);GLctx["texSubImage3D"](target,level,xoffset,yoffset,zoffset,width,height,depth,format,type,heap,pixels>>heapAccessShiftForWebGLHeap(heap))}else{GLctx["texSubImage3D"](target,level,xoffset,yoffset,zoffset,width,height,depth,format,type,null)}}function _glTransformFeedbackVaryings(program,count,varyings,bufferMode){program=GL.programs[program];var vars=[];for(var i=0;i>2]));GLctx["transformFeedbackVaryings"](program,vars,bufferMode)}function _glUniform1f(location,v0){GLctx.uniform1f(webglGetUniformLocation(location),v0)}function _glUniform1i(location,v0){GLctx.uniform1i(webglGetUniformLocation(location),v0)}function _glUniform1iv(location,count,value){if(GL.currentContext.version>=2){count&&GLctx.uniform1iv(webglGetUniformLocation(location),HEAP32,value>>2,count);return}if(count<=288){var view=__miniTempWebGLIntBuffers[count-1];for(var i=0;i>2]}}else{var view=HEAP32.subarray(value>>2,value+count*4>>2)}GLctx.uniform1iv(webglGetUniformLocation(location),view)}function _glUniform1ui(location,v0){GLctx.uniform1ui(webglGetUniformLocation(location),v0)}function _glUniform2f(location,v0,v1){GLctx.uniform2f(webglGetUniformLocation(location),v0,v1)}function _glUniform2fv(location,count,value){if(GL.currentContext.version>=2){count&&GLctx.uniform2fv(webglGetUniformLocation(location),HEAPF32,value>>2,count*2);return}if(count<=144){var view=miniTempWebGLFloatBuffers[2*count-1];for(var i=0;i<2*count;i+=2){view[i]=HEAPF32[value+4*i>>2];view[i+1]=HEAPF32[value+(4*i+4)>>2]}}else{var view=HEAPF32.subarray(value>>2,value+count*8>>2)}GLctx.uniform2fv(webglGetUniformLocation(location),view)}function _glUniform2i(location,v0,v1){GLctx.uniform2i(webglGetUniformLocation(location),v0,v1)}function _glUniform2iv(location,count,value){if(GL.currentContext.version>=2){count&&GLctx.uniform2iv(webglGetUniformLocation(location),HEAP32,value>>2,count*2);return}if(count<=144){var view=__miniTempWebGLIntBuffers[2*count-1];for(var i=0;i<2*count;i+=2){view[i]=HEAP32[value+4*i>>2];view[i+1]=HEAP32[value+(4*i+4)>>2]}}else{var view=HEAP32.subarray(value>>2,value+count*8>>2)}GLctx.uniform2iv(webglGetUniformLocation(location),view)}function _glUniform3f(location,v0,v1,v2){GLctx.uniform3f(webglGetUniformLocation(location),v0,v1,v2)}function _glUniform3fv(location,count,value){if(GL.currentContext.version>=2){count&&GLctx.uniform3fv(webglGetUniformLocation(location),HEAPF32,value>>2,count*3);return}if(count<=96){var view=miniTempWebGLFloatBuffers[3*count-1];for(var i=0;i<3*count;i+=3){view[i]=HEAPF32[value+4*i>>2];view[i+1]=HEAPF32[value+(4*i+4)>>2];view[i+2]=HEAPF32[value+(4*i+8)>>2]}}else{var view=HEAPF32.subarray(value>>2,value+count*12>>2)}GLctx.uniform3fv(webglGetUniformLocation(location),view)}function _glUniform3i(location,v0,v1,v2){GLctx.uniform3i(webglGetUniformLocation(location),v0,v1,v2)}function _glUniform4f(location,v0,v1,v2,v3){GLctx.uniform4f(webglGetUniformLocation(location),v0,v1,v2,v3)}function _glUniform4fv(location,count,value){if(GL.currentContext.version>=2){count&&GLctx.uniform4fv(webglGetUniformLocation(location),HEAPF32,value>>2,count*4);return}if(count<=72){var view=miniTempWebGLFloatBuffers[4*count-1];var heap=HEAPF32;value>>=2;for(var i=0;i<4*count;i+=4){var dst=value+i;view[i]=heap[dst];view[i+1]=heap[dst+1];view[i+2]=heap[dst+2];view[i+3]=heap[dst+3]}}else{var view=HEAPF32.subarray(value>>2,value+count*16>>2)}GLctx.uniform4fv(webglGetUniformLocation(location),view)}function _glUniform4i(location,v0,v1,v2,v3){GLctx.uniform4i(webglGetUniformLocation(location),v0,v1,v2,v3)}function _glUniformBlockBinding(program,uniformBlockIndex,uniformBlockBinding){program=GL.programs[program];GLctx["uniformBlockBinding"](program,uniformBlockIndex,uniformBlockBinding)}function _glUniformMatrix2fv(location,count,transpose,value){if(GL.currentContext.version>=2){count&&GLctx.uniformMatrix2fv(webglGetUniformLocation(location),!!transpose,HEAPF32,value>>2,count*4);return}if(count<=72){var view=miniTempWebGLFloatBuffers[4*count-1];for(var i=0;i<4*count;i+=4){view[i]=HEAPF32[value+4*i>>2];view[i+1]=HEAPF32[value+(4*i+4)>>2];view[i+2]=HEAPF32[value+(4*i+8)>>2];view[i+3]=HEAPF32[value+(4*i+12)>>2]}}else{var view=HEAPF32.subarray(value>>2,value+count*16>>2)}GLctx.uniformMatrix2fv(webglGetUniformLocation(location),!!transpose,view)}function _glUniformMatrix3fv(location,count,transpose,value){if(GL.currentContext.version>=2){count&&GLctx.uniformMatrix3fv(webglGetUniformLocation(location),!!transpose,HEAPF32,value>>2,count*9);return}if(count<=32){var view=miniTempWebGLFloatBuffers[9*count-1];for(var i=0;i<9*count;i+=9){view[i]=HEAPF32[value+4*i>>2];view[i+1]=HEAPF32[value+(4*i+4)>>2];view[i+2]=HEAPF32[value+(4*i+8)>>2];view[i+3]=HEAPF32[value+(4*i+12)>>2];view[i+4]=HEAPF32[value+(4*i+16)>>2];view[i+5]=HEAPF32[value+(4*i+20)>>2];view[i+6]=HEAPF32[value+(4*i+24)>>2];view[i+7]=HEAPF32[value+(4*i+28)>>2];view[i+8]=HEAPF32[value+(4*i+32)>>2]}}else{var view=HEAPF32.subarray(value>>2,value+count*36>>2)}GLctx.uniformMatrix3fv(webglGetUniformLocation(location),!!transpose,view)}function _glUniformMatrix4fv(location,count,transpose,value){if(GL.currentContext.version>=2){count&&GLctx.uniformMatrix4fv(webglGetUniformLocation(location),!!transpose,HEAPF32,value>>2,count*16);return}if(count<=18){var view=miniTempWebGLFloatBuffers[16*count-1];var heap=HEAPF32;value>>=2;for(var i=0;i<16*count;i+=16){var dst=value+i;view[i]=heap[dst];view[i+1]=heap[dst+1];view[i+2]=heap[dst+2];view[i+3]=heap[dst+3];view[i+4]=heap[dst+4];view[i+5]=heap[dst+5];view[i+6]=heap[dst+6];view[i+7]=heap[dst+7];view[i+8]=heap[dst+8];view[i+9]=heap[dst+9];view[i+10]=heap[dst+10];view[i+11]=heap[dst+11];view[i+12]=heap[dst+12];view[i+13]=heap[dst+13];view[i+14]=heap[dst+14];view[i+15]=heap[dst+15]}}else{var view=HEAPF32.subarray(value>>2,value+count*64>>2)}GLctx.uniformMatrix4fv(webglGetUniformLocation(location),!!transpose,view)}function _glUseProgram(program){program=GL.programs[program];GLctx.useProgram(program);GLctx.currentProgram=program}function _glVertexAttrib4f(x0,x1,x2,x3,x4){GLctx["vertexAttrib4f"](x0,x1,x2,x3,x4)}function _glVertexAttrib4fv(index,v){GLctx.vertexAttrib4f(index,HEAPF32[v>>2],HEAPF32[v+4>>2],HEAPF32[v+8>>2],HEAPF32[v+12>>2])}function _glVertexAttribDivisor(index,divisor){GLctx["vertexAttribDivisor"](index,divisor)}function _glVertexAttribI4ui(x0,x1,x2,x3,x4){GLctx["vertexAttribI4ui"](x0,x1,x2,x3,x4)}function _glVertexAttribIPointer(index,size,type,stride,ptr){GLctx["vertexAttribIPointer"](index,size,type,stride,ptr)}function _glVertexAttribPointer(index,size,type,normalized,stride,ptr){GLctx.vertexAttribPointer(index,size,type,!!normalized,stride,ptr)}function _glViewport(x0,x1,x2,x3){GLctx["viewport"](x0,x1,x2,x3)}var GodotRuntime={get_func:function(ptr){return wasmTable.get(ptr)},error:function(){err.apply(null,Array.from(arguments))},print:function(){out.apply(null,Array.from(arguments))},malloc:function(p_size){return _malloc(p_size)},free:function(p_ptr){_free(p_ptr)},getHeapValue:function(p_ptr,p_type){return getValue(p_ptr,p_type)},setHeapValue:function(p_ptr,p_value,p_type){setValue(p_ptr,p_value,p_type)},heapSub:function(p_heap,p_ptr,p_len){const bytes=p_heap.BYTES_PER_ELEMENT;return p_heap.subarray(p_ptr/bytes,p_ptr/bytes+p_len)},heapSlice:function(p_heap,p_ptr,p_len){const bytes=p_heap.BYTES_PER_ELEMENT;return p_heap.slice(p_ptr/bytes,p_ptr/bytes+p_len)},heapCopy:function(p_dst,p_src,p_ptr){const bytes=p_src.BYTES_PER_ELEMENT;return p_dst.set(p_src,p_ptr/bytes)},parseString:function(p_ptr){return UTF8ToString(p_ptr)},parseStringArray:function(p_ptr,p_size){const strings=[];const ptrs=GodotRuntime.heapSub(HEAP32,p_ptr,p_size);ptrs.forEach(function(ptr){strings.push(GodotRuntime.parseString(ptr))});return strings},strlen:function(p_str){return lengthBytesUTF8(p_str)},allocString:function(p_str){const length=GodotRuntime.strlen(p_str)+1;const c_str=GodotRuntime.malloc(length);stringToUTF8(p_str,c_str,length);return c_str},allocStringArray:function(p_strings){const size=p_strings.length;const c_ptr=GodotRuntime.malloc(size*4);for(let i=0;i>2)+i]=GodotRuntime.allocString(p_strings[i])}return c_ptr},freeStringArray:function(p_ptr,p_len){for(let i=0;i>2)+i])}GodotRuntime.free(p_ptr)},stringToHeap:function(p_str,p_ptr,p_len){return stringToUTF8Array(p_str,HEAP8,p_ptr,p_len)}};var GodotConfig={canvas:null,locale:"en",canvas_resize_policy:2,virtual_keyboard:false,persistent_drops:false,on_execute:null,on_exit:null,init_config:function(p_opts){GodotConfig.canvas_resize_policy=p_opts["canvasResizePolicy"];GodotConfig.canvas=p_opts["canvas"];GodotConfig.locale=p_opts["locale"]||GodotConfig.locale;GodotConfig.virtual_keyboard=p_opts["virtualKeyboard"];GodotConfig.persistent_drops=!!p_opts["persistentDrops"];GodotConfig.on_execute=p_opts["onExecute"];GodotConfig.on_exit=p_opts["onExit"];if(p_opts["focusCanvas"]){GodotConfig.canvas.focus()}},locate_file:function(file){return Module["locateFile"](file)},clear:function(){GodotConfig.canvas=null;GodotConfig.locale="en";GodotConfig.canvas_resize_policy=2;GodotConfig.virtual_keyboard=false;GodotConfig.persistent_drops=false;GodotConfig.on_execute=null;GodotConfig.on_exit=null}};var ERRNO_CODES={};var GodotFS={_idbfs:false,_syncing:false,_mount_points:[],is_persistent:function(){return GodotFS._idbfs?1:0},init:function(persistentPaths){GodotFS._idbfs=false;if(!Array.isArray(persistentPaths)){return Promise.reject(new Error("Persistent paths must be an array"))}if(!persistentPaths.length){return Promise.resolve()}GodotFS._mount_points=persistentPaths.slice();function createRecursive(dir){try{FS.stat(dir)}catch(e){if(e.errno!==ERRNO_CODES.ENOENT){throw e}FS.mkdirTree(dir)}}GodotFS._mount_points.forEach(function(path){createRecursive(path);FS.mount(IDBFS,{},path)});return new Promise(function(resolve,reject){FS.syncfs(true,function(err){if(err){GodotFS._mount_points=[];GodotFS._idbfs=false;GodotRuntime.print(`IndexedDB not available: ${err.message}`)}else{GodotFS._idbfs=true}resolve(err)})})},deinit:function(){GodotFS._mount_points.forEach(function(path){try{FS.unmount(path)}catch(e){GodotRuntime.print("Already unmounted",e)}if(GodotFS._idbfs&&IDBFS.dbs[path]){IDBFS.dbs[path].close();delete IDBFS.dbs[path]}});GodotFS._mount_points=[];GodotFS._idbfs=false;GodotFS._syncing=false},sync:function(){if(GodotFS._syncing){GodotRuntime.error("Already syncing!");return Promise.resolve()}GodotFS._syncing=true;return new Promise(function(resolve,reject){FS.syncfs(false,function(error){if(error){GodotRuntime.error(`Failed to save IDB file system: ${error.message}`)}GodotFS._syncing=false;resolve(error)})})},copy_to_fs:function(path,buffer){const idx=path.lastIndexOf("/");let dir="/";if(idx>0){dir=path.slice(0,idx)}try{FS.stat(dir)}catch(e){if(e.errno!==ERRNO_CODES.ENOENT){throw e}FS.mkdirTree(dir)}FS.writeFile(path,new Uint8Array(buffer))}};var GodotOS={request_quit:function(){},_async_cbs:[],_fs_sync_promise:null,atexit:function(p_promise_cb){GodotOS._async_cbs.push(p_promise_cb)},cleanup:function(exit_code){const cb=GodotConfig.on_exit;GodotFS.deinit();GodotConfig.clear();if(cb){cb(exit_code)}},finish_async:function(callback){GodotOS._fs_sync_promise.then(function(err){const promises=[];GodotOS._async_cbs.forEach(function(cb){promises.push(new Promise(cb))});return Promise.all(promises)}).then(function(){return GodotFS.sync()}).then(function(err){setTimeout(function(){callback()},0)})}};var GodotAudio={ctx:null,input:null,driver:null,interval:0,init:function(mix_rate,latency,onstatechange,onlatencyupdate){const opts={};if(mix_rate){opts["sampleRate"]=mix_rate}const ctx=new(window.AudioContext||window.webkitAudioContext)(opts);GodotAudio.ctx=ctx;ctx.onstatechange=function(){let state=0;switch(ctx.state){case"suspended":state=0;break;case"running":state=1;break;case"closed":state=2;break}onstatechange(state)};ctx.onstatechange();GodotAudio.interval=setInterval(function(){let computed_latency=0;if(ctx.baseLatency){computed_latency+=GodotAudio.ctx.baseLatency}if(ctx.outputLatency){computed_latency+=GodotAudio.ctx.outputLatency}onlatencyupdate(computed_latency)},1e3);GodotOS.atexit(GodotAudio.close_async);return ctx.destination.channelCount},create_input:function(callback){if(GodotAudio.input){return 0}function gotMediaInput(stream){try{GodotAudio.input=GodotAudio.ctx.createMediaStreamSource(stream);callback(GodotAudio.input)}catch(e){GodotRuntime.error("Failed creaating input.",e)}}if(navigator.mediaDevices&&navigator.mediaDevices.getUserMedia){navigator.mediaDevices.getUserMedia({"audio":true}).then(gotMediaInput,function(e){GodotRuntime.error("Error getting user media.",e)})}else{if(!navigator.getUserMedia){navigator.getUserMedia=navigator.webkitGetUserMedia||navigator.mozGetUserMedia}if(!navigator.getUserMedia){GodotRuntime.error("getUserMedia not available.");return 1}navigator.getUserMedia({"audio":true},gotMediaInput,function(e){GodotRuntime.print(e)})}return 0},close_async:function(resolve,reject){const ctx=GodotAudio.ctx;GodotAudio.ctx=null;if(!ctx){resolve();return}if(GodotAudio.interval){clearInterval(GodotAudio.interval);GodotAudio.interval=0}if(GodotAudio.input){GodotAudio.input.disconnect();GodotAudio.input=null}let closed=Promise.resolve();if(GodotAudio.driver){closed=GodotAudio.driver.close()}closed.then(function(){return ctx.close()}).then(function(){ctx.onstatechange=null;resolve()}).catch(function(e){ctx.onstatechange=null;GodotRuntime.error("Error closing AudioContext",e);resolve()})}};function _godot_audio_capture_start(){return GodotAudio.create_input(function(input){input.connect(GodotAudio.driver.get_node())})}function _godot_audio_capture_stop(){if(GodotAudio.input){const tracks=GodotAudio.input["mediaStream"]["getTracks"]();for(let i=0;i=size){const high=size-wpos;wbuf.set(buffer.subarray(wpos,size));pending_samples-=high;wpos=0}if(pending_samples>0){wbuf.set(buffer.subarray(wpos,wpos+pending_samples),tot_sent-pending_samples)}port.postMessage({"cmd":"chunk","data":wbuf.subarray(0,tot_sent)});wpos+=pending_samples;pending_samples=0}this.receive=function(recv_buf){const buffer=GodotRuntime.heapSub(HEAPF32,p_in_buf,p_in_size);const from=rpos;let to_write=recv_buf.length;let high=0;if(rpos+to_write>=p_in_size){high=p_in_size-rpos;buffer.set(recv_buf.subarray(0,high),rpos);to_write-=high;rpos=0}if(to_write){buffer.set(recv_buf.subarray(high,to_write),rpos)}in_callback(from,recv_buf.length);rpos+=to_write};this.consumed=function(size,port){pending_samples+=size;send(port)}}GodotAudioWorklet.ring_buffer=new RingBuffer;GodotAudioWorklet.promise.then(function(){const node=GodotAudioWorklet.worklet;const buffer=GodotRuntime.heapSlice(HEAPF32,p_out_buf,p_out_size);node.connect(GodotAudio.ctx.destination);node.port.postMessage({"cmd":"start_nothreads","data":[buffer,p_in_size]});node.port.onmessage=function(event){if(!GodotAudioWorklet.worklet){return}if(event.data["cmd"]==="read"){const read=event.data["data"];GodotAudioWorklet.ring_buffer.consumed(read,GodotAudioWorklet.worklet.port)}else if(event.data["cmd"]==="input"){const buf=event.data["data"];if(buf.length>p_in_size){GodotRuntime.error("Input chunk is too big");return}GodotAudioWorklet.ring_buffer.receive(buf)}else{GodotRuntime.error(event.data)}}})},get_node:function(){return GodotAudioWorklet.worklet},close:function(){return new Promise(function(resolve,reject){if(GodotAudioWorklet.promise===null){return}GodotAudioWorklet.promise.then(function(){GodotAudioWorklet.worklet.port.postMessage({"cmd":"stop","data":null});GodotAudioWorklet.worklet.disconnect();GodotAudioWorklet.worklet=null;GodotAudioWorklet.promise=null;resolve()}).catch(function(err){})})}};function _godot_audio_worklet_create(channels){try{GodotAudioWorklet.create(channels)}catch(e){GodotRuntime.error("Error starting AudioDriverWorklet",e);return 1}return 0}function _godot_audio_worklet_start_no_threads(p_out_buf,p_out_size,p_out_callback,p_in_buf,p_in_size,p_in_callback){const out_callback=GodotRuntime.get_func(p_out_callback);const in_callback=GodotRuntime.get_func(p_in_callback);GodotAudioWorklet.start_no_threads(p_out_buf,p_out_size,out_callback,p_in_buf,p_in_size,in_callback)}function _godot_js_config_canvas_id_get(p_ptr,p_ptr_max){GodotRuntime.stringToHeap(`#${GodotConfig.canvas.id}`,p_ptr,p_ptr_max)}function _godot_js_config_locale_get(p_ptr,p_ptr_max){GodotRuntime.stringToHeap(GodotConfig.locale,p_ptr,p_ptr_max)}var GodotDisplayCursor={shape:"default",visible:true,cursors:{},set_style:function(style){GodotConfig.canvas.style.cursor=style},set_shape:function(shape){GodotDisplayCursor.shape=shape;let css=shape;if(shape in GodotDisplayCursor.cursors){const c=GodotDisplayCursor.cursors[shape];css=`url("${c.url}") ${c.x} ${c.y}, default`}if(GodotDisplayCursor.visible){GodotDisplayCursor.set_style(css)}},clear:function(){GodotDisplayCursor.set_style("");GodotDisplayCursor.shape="default";GodotDisplayCursor.visible=true;Object.keys(GodotDisplayCursor.cursors).forEach(function(key){URL.revokeObjectURL(GodotDisplayCursor.cursors[key]);delete GodotDisplayCursor.cursors[key]})},lockPointer:function(){const canvas=GodotConfig.canvas;if(canvas.requestPointerLock){canvas.requestPointerLock()}},releasePointer:function(){if(document.exitPointerLock){document.exitPointerLock()}},isPointerLocked:function(){return document.pointerLockElement===GodotConfig.canvas}};var GodotEventListeners={handlers:[],has:function(target,event,method,capture){return GodotEventListeners.handlers.findIndex(function(e){return e.target===target&&e.event===event&&e.method===method&&e.capture===capture})!==-1},add:function(target,event,method,capture){if(GodotEventListeners.has(target,event,method,capture)){return}function Handler(p_target,p_event,p_method,p_capture){this.target=p_target;this.event=p_event;this.method=p_method;this.capture=p_capture}GodotEventListeners.handlers.push(new Handler(target,event,method,capture));target.addEventListener(event,method,capture)},clear:function(){GodotEventListeners.handlers.forEach(function(h){h.target.removeEventListener(h.event,h.method,h.capture)});GodotEventListeners.handlers.length=0}};function _emscripten_webgl_do_get_current_context(){return GL.currentContext?GL.currentContext.handle:0}function _emscripten_webgl_get_current_context(){return _emscripten_webgl_do_get_current_context()}var GodotDisplayScreen={desired_size:[0,0],hidpi:true,getPixelRatio:function(){return GodotDisplayScreen.hidpi?window.devicePixelRatio||1:1},isFullscreen:function(){const elem=document.fullscreenElement||document.mozFullscreenElement||document.webkitFullscreenElement||document.msFullscreenElement;if(elem){return elem===GodotConfig.canvas}return document.fullscreen||document.mozFullScreen||document.webkitIsFullscreen},hasFullscreen:function(){return document.fullscreenEnabled||document.mozFullScreenEnabled||document.webkitFullscreenEnabled},requestFullscreen:function(){if(!GodotDisplayScreen.hasFullscreen()){return 1}const canvas=GodotConfig.canvas;try{const promise=(canvas.requestFullscreen||canvas.msRequestFullscreen||canvas.mozRequestFullScreen||canvas.mozRequestFullscreen||canvas.webkitRequestFullscreen).call(canvas);if(promise){promise.catch(function(){})}}catch(e){return 1}return 0},exitFullscreen:function(){if(!GodotDisplayScreen.isFullscreen()){return 0}try{const promise=document.exitFullscreen();if(promise){promise.catch(function(){})}}catch(e){return 1}return 0},_updateGL:function(){const gl_context_handle=_emscripten_webgl_get_current_context();const gl=GL.getContext(gl_context_handle);if(gl){GL.resizeOffscreenFramebuffer(gl)}},updateSize:function(){const isFullscreen=GodotDisplayScreen.isFullscreen();const wantsFullWindow=GodotConfig.canvas_resize_policy===2;const noResize=GodotConfig.canvas_resize_policy===0;const wwidth=GodotDisplayScreen.desired_size[0];const wheight=GodotDisplayScreen.desired_size[1];const canvas=GodotConfig.canvas;let width=wwidth;let height=wheight;if(noResize){if(canvas.width!==width||canvas.height!==height){GodotDisplayScreen.desired_size=[canvas.width,canvas.height];GodotDisplayScreen._updateGL();return 1}return 0}const scale=GodotDisplayScreen.getPixelRatio();if(isFullscreen||wantsFullWindow){width=window.innerWidth*scale;height=window.innerHeight*scale}const csw=`${width/scale}px`;const csh=`${height/scale}px`;if(canvas.style.width!==csw||canvas.style.height!==csh||canvas.width!==width||canvas.height!==height){canvas.width=width;canvas.height=height;canvas.style.width=csw;canvas.style.height=csh;GodotDisplayScreen._updateGL();return 1}return 0}};var GodotDisplayVK={textinput:null,textarea:null,available:function(){return GodotConfig.virtual_keyboard&&"ontouchstart"in window},init:function(input_cb){function create(what){const elem=document.createElement(what);elem.style.display="none";elem.style.position="absolute";elem.style.zIndex="-1";elem.style.background="transparent";elem.style.padding="0px";elem.style.margin="0px";elem.style.overflow="hidden";elem.style.width="0px";elem.style.height="0px";elem.style.border="0px";elem.style.outline="none";elem.readonly=true;elem.disabled=true;GodotEventListeners.add(elem,"input",function(evt){const c_str=GodotRuntime.allocString(elem.value);input_cb(c_str,elem.selectionEnd);GodotRuntime.free(c_str)},false);GodotEventListeners.add(elem,"blur",function(evt){elem.style.display="none";elem.readonly=true;elem.disabled=true},false);GodotConfig.canvas.insertAdjacentElement("beforebegin",elem);return elem}GodotDisplayVK.textinput=create("input");GodotDisplayVK.textarea=create("textarea");GodotDisplayVK.updateSize()},show:function(text,multiline,start,end){if(!GodotDisplayVK.textinput||!GodotDisplayVK.textarea){return}if(GodotDisplayVK.textinput.style.display!==""||GodotDisplayVK.textarea.style.display!==""){GodotDisplayVK.hide()}GodotDisplayVK.updateSize();const elem=multiline?GodotDisplayVK.textarea:GodotDisplayVK.textinput;elem.readonly=false;elem.disabled=false;elem.value=text;elem.style.display="block";elem.focus();elem.setSelectionRange(start,end)},hide:function(){if(!GodotDisplayVK.textinput||!GodotDisplayVK.textarea){return}[GodotDisplayVK.textinput,GodotDisplayVK.textarea].forEach(function(elem){elem.blur();elem.style.display="none";elem.value=""})},updateSize:function(){if(!GodotDisplayVK.textinput||!GodotDisplayVK.textarea){return}const rect=GodotConfig.canvas.getBoundingClientRect();function update(elem){elem.style.left=`${rect.left}px`;elem.style.top=`${rect.top}px`;elem.style.width=`${rect.width}px`;elem.style.height=`${rect.height}px`}update(GodotDisplayVK.textinput);update(GodotDisplayVK.textarea)},clear:function(){if(GodotDisplayVK.textinput){GodotDisplayVK.textinput.remove();GodotDisplayVK.textinput=null}if(GodotDisplayVK.textarea){GodotDisplayVK.textarea.remove();GodotDisplayVK.textarea=null}}};var GodotDisplay={window_icon:"",findDPI:function(){function testDPI(dpi){return window.matchMedia(`(max-resolution: ${dpi}dpi)`).matches}function bisect(low,high,func){const mid=parseInt((high-low)/2+low,10);if(high-low<=1){return func(high)?high:low}if(func(mid)){return bisect(low,mid,func)}return bisect(mid,high,func)}try{const dpi=bisect(0,800,testDPI);return dpi>=96?dpi:96}catch(e){return 96}}};function _godot_js_display_alert(p_text){window.alert(GodotRuntime.parseString(p_text))}function _godot_js_display_canvas_focus(){GodotConfig.canvas.focus()}function _godot_js_display_canvas_is_focused(){return document.activeElement===GodotConfig.canvas}function _godot_js_display_clipboard_get(callback){const func=GodotRuntime.get_func(callback);try{navigator.clipboard.readText().then(function(result){const ptr=GodotRuntime.allocString(result);func(ptr);GodotRuntime.free(ptr)}).catch(function(e){})}catch(e){}}function _godot_js_display_clipboard_set(p_text){const text=GodotRuntime.parseString(p_text);if(!navigator.clipboard||!navigator.clipboard.writeText){return 1}navigator.clipboard.writeText(text).catch(function(e){GodotRuntime.error("Setting OS clipboard is only possible from an input callback for the HTML5 plafrom. Exception:",e)});return 0}function _godot_js_display_cursor_is_hidden(){return!GodotDisplayCursor.visible}function _godot_js_display_cursor_is_locked(){return GodotDisplayCursor.isPointerLocked()?1:0}function _godot_js_display_cursor_lock_set(p_lock){if(p_lock){GodotDisplayCursor.lockPointer()}else{GodotDisplayCursor.releasePointer()}}function _godot_js_display_cursor_set_custom_shape(p_shape,p_ptr,p_len,p_hotspot_x,p_hotspot_y){const shape=GodotRuntime.parseString(p_shape);const old_shape=GodotDisplayCursor.cursors[shape];if(p_len>0){const png=new Blob([GodotRuntime.heapSlice(HEAPU8,p_ptr,p_len)],{type:"image/png"});const url=URL.createObjectURL(png);GodotDisplayCursor.cursors[shape]={url:url,x:p_hotspot_x,y:p_hotspot_y}}else{delete GodotDisplayCursor.cursors[shape]}if(shape===GodotDisplayCursor.shape){GodotDisplayCursor.set_shape(GodotDisplayCursor.shape)}if(old_shape){URL.revokeObjectURL(old_shape.url)}}function _godot_js_display_cursor_set_shape(p_string){GodotDisplayCursor.set_shape(GodotRuntime.parseString(p_string))}function _godot_js_display_cursor_set_visible(p_visible){const visible=p_visible!==0;if(visible===GodotDisplayCursor.visible){return}GodotDisplayCursor.visible=visible;if(visible){GodotDisplayCursor.set_shape(GodotDisplayCursor.shape)}else{GodotDisplayCursor.set_style("none")}}function _godot_js_display_desired_size_set(width,height){GodotDisplayScreen.desired_size=[width,height];GodotDisplayScreen.updateSize()}function _godot_js_display_fullscreen_cb(callback){const canvas=GodotConfig.canvas;const func=GodotRuntime.get_func(callback);function change_cb(evt){if(evt.target===canvas){func(GodotDisplayScreen.isFullscreen())}}GodotEventListeners.add(document,"fullscreenchange",change_cb,false);GodotEventListeners.add(document,"mozfullscreenchange",change_cb,false);GodotEventListeners.add(document,"webkitfullscreenchange",change_cb,false)}function _godot_js_display_fullscreen_exit(){return GodotDisplayScreen.exitFullscreen()}function _godot_js_display_fullscreen_request(){return GodotDisplayScreen.requestFullscreen()}function _godot_js_display_glGetBufferSubData(target,offset,size,data){const gl_context_handle=_emscripten_webgl_get_current_context();const gl=GL.getContext(gl_context_handle);if(gl){gl.GLctx["getBufferSubData"](target,offset,HEAPU8,data,size)}}function _godot_js_display_has_webgl(p_version){if(p_version!==1&&p_version!==2){return false}try{return!!document.createElement("canvas").getContext(p_version===2?"webgl2":"webgl")}catch(e){}return false}function _godot_js_display_is_swap_ok_cancel(){const win=["Windows","Win64","Win32","WinCE"];const plat=navigator.platform||"";if(win.indexOf(plat)!==-1){return 1}return 0}function _godot_js_display_notification_cb(callback,p_enter,p_exit,p_in,p_out){const canvas=GodotConfig.canvas;const func=GodotRuntime.get_func(callback);const notif=[p_enter,p_exit,p_in,p_out];["mouseover","mouseleave","focus","blur"].forEach(function(evt_name,idx){GodotEventListeners.add(canvas,evt_name,function(){func(notif[idx])},true)})}function _godot_js_display_pixel_ratio_get(){return GodotDisplayScreen.getPixelRatio()}function _godot_js_display_screen_dpi_get(){return GodotDisplay.findDPI()}function _godot_js_display_screen_size_get(width,height){const scale=GodotDisplayScreen.getPixelRatio();GodotRuntime.setHeapValue(width,window.screen.width*scale,"i32");GodotRuntime.setHeapValue(height,window.screen.height*scale,"i32")}function _godot_js_display_setup_canvas(p_width,p_height,p_fullscreen,p_hidpi){const canvas=GodotConfig.canvas;GodotEventListeners.add(canvas,"contextmenu",function(ev){ev.preventDefault()},false);GodotEventListeners.add(canvas,"webglcontextlost",function(ev){alert("WebGL context lost, please reload the page");ev.preventDefault()},false);GodotDisplayScreen.hidpi=!!p_hidpi;switch(GodotConfig.canvas_resize_policy){case 0:GodotDisplayScreen.desired_size=[canvas.width,canvas.height];break;case 1:GodotDisplayScreen.desired_size=[p_width,p_height];break;default:canvas.style.position="absolute";canvas.style.top=0;canvas.style.left=0;break}GodotDisplayScreen.updateSize();if(p_fullscreen){GodotDisplayScreen.requestFullscreen()}}function _godot_js_display_size_update(){const updated=GodotDisplayScreen.updateSize();if(updated){GodotDisplayVK.updateSize()}return updated}function _godot_js_display_touchscreen_is_available(){return"ontouchstart"in window}function _godot_js_display_vk_available(){return GodotDisplayVK.available()}function _godot_js_display_vk_cb(p_input_cb){const input_cb=GodotRuntime.get_func(p_input_cb);if(GodotDisplayVK.available()){GodotDisplayVK.init(input_cb)}}function _godot_js_display_vk_hide(){GodotDisplayVK.hide()}function _godot_js_display_vk_show(p_text,p_multiline,p_start,p_end){const text=GodotRuntime.parseString(p_text);const start=p_start>0?p_start:0;const end=p_end>0?p_end:start;GodotDisplayVK.show(text,p_multiline,start,end)}function _godot_js_display_window_blur_cb(callback){const func=GodotRuntime.get_func(callback);GodotEventListeners.add(window,"blur",function(){func()},false)}function _godot_js_display_window_icon_set(p_ptr,p_len){let link=document.getElementById("-gd-engine-icon");if(link===null){link=document.createElement("link");link.rel="icon";link.id="-gd-engine-icon";document.head.appendChild(link)}const old_icon=GodotDisplay.window_icon;const png=new Blob([GodotRuntime.heapSlice(HEAPU8,p_ptr,p_len)],{type:"image/png"});GodotDisplay.window_icon=URL.createObjectURL(png);link.href=GodotDisplay.window_icon;if(old_icon){URL.revokeObjectURL(old_icon)}}function _godot_js_display_window_size_get(p_width,p_height){GodotRuntime.setHeapValue(p_width,GodotConfig.canvas.width,"i32");GodotRuntime.setHeapValue(p_height,GodotConfig.canvas.height,"i32")}function _godot_js_display_window_title_set(p_data){document.title=GodotRuntime.parseString(p_data)}function _godot_js_eval(p_js,p_use_global_ctx,p_union_ptr,p_byte_arr,p_byte_arr_write,p_callback){const js_code=GodotRuntime.parseString(p_js);let eval_ret=null;try{if(p_use_global_ctx){const global_eval=eval;eval_ret=global_eval(js_code)}else{eval_ret=eval(js_code)}}catch(e){GodotRuntime.error(e)}switch(typeof eval_ret){case"boolean":GodotRuntime.setHeapValue(p_union_ptr,eval_ret,"i32");return 1;case"number":GodotRuntime.setHeapValue(p_union_ptr,eval_ret,"double");return 3;case"string":GodotRuntime.setHeapValue(p_union_ptr,GodotRuntime.allocString(eval_ret),"*");return 4;case"object":if(eval_ret===null){break}if(ArrayBuffer.isView(eval_ret)&&!(eval_ret instanceof Uint8Array)){eval_ret=new Uint8Array(eval_ret.buffer)}else if(eval_ret instanceof ArrayBuffer){eval_ret=new Uint8Array(eval_ret)}if(eval_ret instanceof Uint8Array){const func=GodotRuntime.get_func(p_callback);const bytes_ptr=func(p_byte_arr,p_byte_arr_write,eval_ret.length);HEAPU8.set(eval_ret,bytes_ptr);return 20}break}return 0}var IDHandler={_last_id:0,_references:{},get:function(p_id){return IDHandler._references[p_id]},add:function(p_data){const id=++IDHandler._last_id;IDHandler._references[id]=p_data;return id},remove:function(p_id){delete IDHandler._references[p_id]}};var GodotFetch={onread:function(id,result){const obj=IDHandler.get(id);if(!obj){return}if(result.value){obj.chunks.push(result.value)}obj.reading=false;obj.done=result.done},onresponse:function(id,response){const obj=IDHandler.get(id);if(!obj){return}let chunked=false;response.headers.forEach(function(value,header){const v=value.toLowerCase().trim();const h=header.toLowerCase().trim();if(h==="transfer-encoding"&&v==="chunked"){chunked=true}});obj.status=response.status;obj.response=response;obj.reader=response.body.getReader();obj.chunked=chunked},onerror:function(id,err){GodotRuntime.error(err);const obj=IDHandler.get(id);if(!obj){return}obj.error=err},create:function(method,url,headers,body){const obj={request:null,response:null,reader:null,error:null,done:false,reading:false,status:0,chunks:[],bodySize:-1};const id=IDHandler.add(obj);const init={method:method,headers:headers,body:body};obj.request=fetch(url,init);obj.request.then(GodotFetch.onresponse.bind(null,id)).catch(GodotFetch.onerror.bind(null,id));return id},free:function(id){const obj=IDHandler.get(id);if(!obj){return}IDHandler.remove(id);if(!obj.request){return}obj.request.then(function(response){response.abort()}).catch(function(e){})},read:function(id){const obj=IDHandler.get(id);if(!obj){return}if(obj.reader&&!obj.reading){if(obj.done){obj.reader=null;return}obj.reading=true;obj.reader.read().then(GodotFetch.onread.bind(null,id)).catch(GodotFetch.onerror.bind(null,id))}}};function _godot_js_fetch_body_length_get(p_id){const obj=IDHandler.get(p_id);if(!obj||!obj.response){return-1}return obj.bodySize}function _godot_js_fetch_create(p_method,p_url,p_headers,p_headers_size,p_body,p_body_size){const method=GodotRuntime.parseString(p_method);const url=GodotRuntime.parseString(p_url);const headers=GodotRuntime.parseStringArray(p_headers,p_headers_size);const body=p_body_size?GodotRuntime.heapSlice(HEAP8,p_body,p_body_size):null;return GodotFetch.create(method,url,headers.map(function(hv){const idx=hv.indexOf(":");if(idx<=0){return[]}return[hv.slice(0,idx).trim(),hv.slice(idx+1).trim()]}).filter(function(v){return v.length===2}),body)}function _godot_js_fetch_free(id){GodotFetch.free(id)}function _godot_js_fetch_http_status_get(p_id){const obj=IDHandler.get(p_id);if(!obj||!obj.response){return 0}return obj.status}function _godot_js_fetch_is_chunked(p_id){const obj=IDHandler.get(p_id);if(!obj||!obj.response){return-1}return obj.chunked?1:0}function _godot_js_fetch_read_chunk(p_id,p_buf,p_buf_size){const obj=IDHandler.get(p_id);if(!obj||!obj.response){return 0}let to_read=p_buf_size;const chunks=obj.chunks;while(to_read&&chunks.length){const chunk=obj.chunks[0];if(chunk.length>to_read){GodotRuntime.heapCopy(HEAP8,chunk.slice(0,to_read),p_buf);chunks[0]=chunk.slice(to_read);to_read=0}else{GodotRuntime.heapCopy(HEAP8,chunk,p_buf);to_read-=chunk.length;chunks.pop()}}if(!chunks.length){GodotFetch.read(p_id)}return p_buf_size-to_read}function _godot_js_fetch_read_headers(p_id,p_parse_cb,p_ref){const obj=IDHandler.get(p_id);if(!obj||!obj.response){return 1}const cb=GodotRuntime.get_func(p_parse_cb);const arr=[];obj.response.headers.forEach(function(v,h){arr.push(`${h}:${v}`)});const c_ptr=GodotRuntime.allocStringArray(arr);cb(arr.length,c_ptr,p_ref);GodotRuntime.freeStringArray(c_ptr,arr.length);return 0}function _godot_js_fetch_state_get(p_id){const obj=IDHandler.get(p_id);if(!obj){return-1}if(obj.error){return-1}if(!obj.response){return 0}if(obj.reader){return 1}if(obj.done){return 2}return-1}var GodotInputGamepads={samples:[],get_pads:function(){try{const pads=navigator.getGamepads();if(pads){return pads}return[]}catch(e){return[]}},get_samples:function(){return GodotInputGamepads.samples},get_sample:function(index){const samples=GodotInputGamepads.samples;return index=0){os="Android"}else if(ua.indexOf("Linux")>=0){os="Linux"}else if(ua.indexOf("iPhone")>=0){os="iOS"}else if(ua.indexOf("Macintosh")>=0){os="MacOSX"}else if(ua.indexOf("Windows")>=0){os="Windows"}const id=pad.id;const exp1=/vendor: ([0-9a-f]{4}) product: ([0-9a-f]{4})/i;const exp2=/^([0-9a-f]+)-([0-9a-f]+)-/i;let vendor="";let product="";if(exp1.test(id)){const match=exp1.exec(id);vendor=match[1].padStart(4,"0");product=match[2].padStart(4,"0")}else if(exp2.test(id)){const match=exp2.exec(id);vendor=match[1].padStart(4,"0");product=match[2].padStart(4,"0")}if(!vendor||!product){return`${os}Unknown`}return os+vendor+product}};var GodotInputDragDrop={promises:[],pending_files:[],add_entry:function(entry){if(entry.isDirectory){GodotInputDragDrop.add_dir(entry)}else if(entry.isFile){GodotInputDragDrop.add_file(entry)}else{GodotRuntime.error("Unrecognized entry...",entry)}},add_dir:function(entry){GodotInputDragDrop.promises.push(new Promise(function(resolve,reject){const reader=entry.createReader();reader.readEntries(function(entries){for(let i=0;i{const path=elem["path"];GodotFS.copy_to_fs(DROP+path,elem["data"]);let idx=path.indexOf("/");if(idx===-1){drops.push(DROP+path)}else{const sub=path.substr(0,idx);idx=sub.indexOf("/");if(idx<0&&drops.indexOf(DROP+sub)===-1){drops.push(DROP+sub)}}files.push(DROP+path)});GodotInputDragDrop.promises=[];GodotInputDragDrop.pending_files=[];callback(drops);if(GodotConfig.persistent_drops){GodotOS.atexit(function(resolve,reject){GodotInputDragDrop.remove_drop(files,DROP);resolve()})}else{GodotInputDragDrop.remove_drop(files,DROP)}})},remove_drop:function(files,drop_path){const dirs=[drop_path.substr(0,drop_path.length-1)];files.forEach(function(file){FS.unlink(file);let dir=file.replace(drop_path,"");let idx=dir.lastIndexOf("/");while(idx>0){dir=dir.substr(0,idx);if(dirs.indexOf(drop_path+dir)===-1){dirs.push(drop_path+dir)}idx=dir.lastIndexOf("/")}});dirs.sort(function(a,b){const al=(a.match(/\//g)||[]).length;const bl=(b.match(/\//g)||[]).length;if(al>bl){return-1}else if(al{if(GodotWebXR.session&&GodotWebXR.space){const onFrame=function(time,frame){GodotWebXR.frame=frame;GodotWebXR.pose=frame.getViewerPose(GodotWebXR.space);callback(time);GodotWebXR.frame=null;GodotWebXR.pose=null};GodotWebXR.session.requestAnimationFrame(onFrame)}else{GodotWebXR.orig_requestAnimationFrame(callback)}},monkeyPatchRequestAnimationFrame:enable=>{if(GodotWebXR.orig_requestAnimationFrame===null){GodotWebXR.orig_requestAnimationFrame=Browser.requestAnimationFrame}Browser.requestAnimationFrame=enable?GodotWebXR.requestAnimationFrame:GodotWebXR.orig_requestAnimationFrame},pauseResumeMainLoop:()=>{Browser.mainLoop.pause();window.setTimeout(function(){Browser.mainLoop.resume()},0)},shaderProgram:null,programInfo:null,buffer:null,vsSource:"\n\t\t\tconst vec2 scale = vec2(0.5, 0.5);\n\t\t\tattribute vec4 aVertexPosition;\n\n\t\t\tvarying highp vec2 vTextureCoord;\n\n\t\t\tvoid main () {\n\t\t\t\tgl_Position = aVertexPosition;\n\t\t\t\tvTextureCoord = aVertexPosition.xy * scale + scale;\n\t\t\t}\n\t\t",fsSource:"\n\t\t\tvarying highp vec2 vTextureCoord;\n\n\t\t\tuniform sampler2D uSampler;\n\n\t\t\tvoid main() {\n\t\t\t\tgl_FragColor = texture2D(uSampler, vTextureCoord);\n\t\t\t}\n\t\t",initShaderProgram:(gl,vsSource,fsSource)=>{const vertexShader=GodotWebXR.loadShader(gl,gl.VERTEX_SHADER,vsSource);const fragmentShader=GodotWebXR.loadShader(gl,gl.FRAGMENT_SHADER,fsSource);const shaderProgram=gl.createProgram();gl.attachShader(shaderProgram,vertexShader);gl.attachShader(shaderProgram,fragmentShader);gl.linkProgram(shaderProgram);if(!gl.getProgramParameter(shaderProgram,gl.LINK_STATUS)){GodotRuntime.error(`Unable to initialize the shader program: ${gl.getProgramInfoLog(shaderProgram)}`);return null}return shaderProgram},loadShader:(gl,type,source)=>{const shader=gl.createShader(type);gl.shaderSource(shader,source);gl.compileShader(shader);if(!gl.getShaderParameter(shader,gl.COMPILE_STATUS)){GodotRuntime.error(`An error occurred compiling the shader: ${gl.getShaderInfoLog(shader)}`);gl.deleteShader(shader);return null}return shader},initBuffer:gl=>{const positionBuffer=gl.createBuffer();gl.bindBuffer(gl.ARRAY_BUFFER,positionBuffer);const positions=[-1,-1,1,-1,-1,1,1,1];gl.bufferData(gl.ARRAY_BUFFER,new Float32Array(positions),gl.STATIC_DRAW);return positionBuffer},blitTexture:(gl,texture)=>{if(GodotWebXR.shaderProgram===null){GodotWebXR.shaderProgram=GodotWebXR.initShaderProgram(gl,GodotWebXR.vsSource,GodotWebXR.fsSource);GodotWebXR.programInfo={program:GodotWebXR.shaderProgram,attribLocations:{vertexPosition:gl.getAttribLocation(GodotWebXR.shaderProgram,"aVertexPosition")},uniformLocations:{uSampler:gl.getUniformLocation(GodotWebXR.shaderProgram,"uSampler")}};GodotWebXR.buffer=GodotWebXR.initBuffer(gl)}const orig_program=gl.getParameter(gl.CURRENT_PROGRAM);gl.useProgram(GodotWebXR.shaderProgram);gl.bindBuffer(gl.ARRAY_BUFFER,GodotWebXR.buffer);gl.vertexAttribPointer(GodotWebXR.programInfo.attribLocations.vertexPosition,2,gl.FLOAT,false,0,0);gl.enableVertexAttribArray(GodotWebXR.programInfo.attribLocations.vertexPosition);gl.activeTexture(gl.TEXTURE0);gl.bindTexture(gl.TEXTURE_2D,texture);gl.uniform1i(GodotWebXR.programInfo.uniformLocations.uSampler,0);gl.drawArrays(gl.TRIANGLE_STRIP,0,4);gl.bindTexture(gl.TEXTURE_2D,null);gl.disableVertexAttribArray(GodotWebXR.programInfo.attribLocations.vertexPosition);gl.bindBuffer(gl.ARRAY_BUFFER,null);gl.useProgram(orig_program)},controllers:[],sampleControllers:()=>{if(!GodotWebXR.session){return}let other_index=2;const controllers=[];GodotWebXR.session.inputSources.forEach(input_source=>{if(input_source.targetRayMode==="tracked-pointer"){if(input_source.handedness==="right"){controllers[1]=input_source}else if(input_source.handedness==="left"||!controllers[0]){controllers[0]=input_source}}else{controllers[other_index++]=input_source}});GodotWebXR.controllers=controllers},getControllerId:input_source=>GodotWebXR.controllers.indexOf(input_source)};function _godot_webxr_commit_for_eye(p_eye,p_texture_id){if(!GodotWebXR.session||!GodotWebXR.pose){return}const view_index=p_eye===2?1:0;const glLayer=GodotWebXR.session.renderState.baseLayer;const view=GodotWebXR.pose.views[view_index];const viewport=glLayer.getViewport(view);const gl=GodotWebXR.gl;const orig_framebuffer=gl.getParameter(gl.FRAMEBUFFER_BINDING);const orig_viewport=gl.getParameter(gl.VIEWPORT);gl.bindFramebuffer(gl.FRAMEBUFFER,glLayer.framebuffer);gl.viewport(viewport.x,viewport.y,viewport.width,viewport.height);GodotWebXR.blitTexture(gl,GL.textures[p_texture_id]);gl.bindFramebuffer(gl.FRAMEBUFFER,orig_framebuffer);gl.viewport(orig_viewport[0],orig_viewport[1],orig_viewport[2],orig_viewport[3])}function _godot_webxr_get_bounds_geometry(){if(!GodotWebXR.space||!GodotWebXR.space.boundsGeometry){return 0}const point_count=GodotWebXR.space.boundsGeometry.length;if(point_count===0){return 0}const buf=GodotRuntime.malloc((point_count*3+1)*4);GodotRuntime.setHeapValue(buf,point_count,"i32");for(let i=0;i=GodotWebXR.controllers.length){return 0}const controller=GodotWebXR.controllers[p_controller];if(!controller){return 0}switch(controller.targetRayMode){case"gaze":return 1;case"tracked-pointer":return 2;case"screen":return 3;default:break}return 0}function _godot_webxr_get_controller_transform(p_controller){if(!GodotWebXR.session||!GodotWebXR.frame){return 0}const controller=GodotWebXR.controllers[p_controller];if(!controller){return 0}const frame=GodotWebXR.frame;const space=GodotWebXR.space;const pose=frame.getPose(controller.targetRaySpace,space);if(!pose){return 0}const matrix=pose.transform.matrix;const buf=GodotRuntime.malloc(16*4);for(let i=0;i<16;i++){GodotRuntime.setHeapValue(buf+i*4,matrix[i],"float")}return buf}function _godot_webxr_get_projection_for_eye(p_eye){if(!GodotWebXR.session||!GodotWebXR.pose){return 0}const view_index=p_eye===2?1:0;const matrix=GodotWebXR.pose.views[view_index].projectionMatrix;const buf=GodotRuntime.malloc(16*4);for(let i=0;i<16;i++){GodotRuntime.setHeapValue(buf+i*4,matrix[i],"float")}return buf}function _godot_webxr_get_render_targetsize(){if(!GodotWebXR.session||!GodotWebXR.pose){return 0}const glLayer=GodotWebXR.session.renderState.baseLayer;const view=GodotWebXR.pose.views[0];const viewport=glLayer.getViewport(view);const buf=GodotRuntime.malloc(2*4);GodotRuntime.setHeapValue(buf+0,viewport.width,"i32");GodotRuntime.setHeapValue(buf+4,viewport.height,"i32");return buf}function _godot_webxr_get_transform_for_eye(p_eye){if(!GodotWebXR.session||!GodotWebXR.pose){return 0}const views=GodotWebXR.pose.views;let matrix;if(p_eye===0){matrix=GodotWebXR.pose.transform.matrix}else{matrix=views[p_eye-1].transform.matrix}const buf=GodotRuntime.malloc(16*4);for(let i=0;i<16;i++){GodotRuntime.setHeapValue(buf+i*4,matrix[i],"float")}return buf}function _godot_webxr_get_view_count(){if(!GodotWebXR.session||!GodotWebXR.pose){return 0}return GodotWebXR.pose.views.length}function _godot_webxr_get_visibility_state(){if(!GodotWebXR.session||!GodotWebXR.session.visibilityState){return 0}return GodotRuntime.allocString(GodotWebXR.session.visibilityState)}function _godot_webxr_initialize(p_session_mode,p_required_features,p_optional_features,p_requested_reference_spaces,p_on_session_started,p_on_session_ended,p_on_session_failed,p_on_controller_changed,p_on_input_event,p_on_simple_event){GodotWebXR.monkeyPatchRequestAnimationFrame(true);const session_mode=GodotRuntime.parseString(p_session_mode);const required_features=GodotRuntime.parseString(p_required_features).split(",").map(s=>s.trim()).filter(s=>s!=="");const optional_features=GodotRuntime.parseString(p_optional_features).split(",").map(s=>s.trim()).filter(s=>s!=="");const requested_reference_space_types=GodotRuntime.parseString(p_requested_reference_spaces).split(",").map(s=>s.trim());const onstarted=GodotRuntime.get_func(p_on_session_started);const onended=GodotRuntime.get_func(p_on_session_ended);const onfailed=GodotRuntime.get_func(p_on_session_failed);const oncontroller=GodotRuntime.get_func(p_on_controller_changed);const oninputevent=GodotRuntime.get_func(p_on_input_event);const onsimpleevent=GodotRuntime.get_func(p_on_simple_event);const session_init={};if(required_features.length>0){session_init["requiredFeatures"]=required_features}if(optional_features.length>0){session_init["optionalFeatures"]=optional_features}navigator.xr.requestSession(session_mode,session_init).then(function(session){GodotWebXR.session=session;session.addEventListener("end",function(evt){onended()});session.addEventListener("inputsourceschange",function(evt){let controller_changed=false;[evt.added,evt.removed].forEach(lst=>{lst.forEach(input_source=>{if(input_source.targetRayMode==="tracked-pointer"){controller_changed=true}})});if(controller_changed){oncontroller()}});["selectstart","selectend","select","squeezestart","squeezeend","squeeze"].forEach((input_event,index)=>{session.addEventListener(input_event,function(evt){GodotWebXR.sampleControllers();oninputevent(index,GodotWebXR.getControllerId(evt.inputSource))})});session.addEventListener("visibilitychange",function(evt){const c_str=GodotRuntime.allocString("visibility_state_changed");onsimpleevent(c_str);GodotRuntime.free(c_str)});const gl_context_handle=_emscripten_webgl_get_current_context();const gl=GL.getContext(gl_context_handle).GLctx;GodotWebXR.gl=gl;gl.makeXRCompatible().then(function(){session.updateRenderState({baseLayer:new XRWebGLLayer(session,gl)});function onReferenceSpaceSuccess(reference_space,reference_space_type){GodotWebXR.space=reference_space;reference_space.onreset=function(evt){const c_str=GodotRuntime.allocString("reference_space_reset");onsimpleevent(c_str);GodotRuntime.free(c_str)};GodotWebXR.pauseResumeMainLoop();window.setTimeout(function(){const c_str=GodotRuntime.allocString(reference_space_type);onstarted(c_str);GodotRuntime.free(c_str)},0)}function requestReferenceSpace(){const reference_space_type=requested_reference_space_types.shift();session.requestReferenceSpace(reference_space_type).then(refSpace=>{onReferenceSpaceSuccess(refSpace,reference_space_type)}).catch(()=>{if(requested_reference_space_types.length===0){const c_str=GodotRuntime.allocString("Unable to get any of the requested reference space types");onfailed(c_str);GodotRuntime.free(c_str)}else{requestReferenceSpace()}})}requestReferenceSpace()}).catch(function(error){const c_str=GodotRuntime.allocString(`Unable to make WebGL context compatible with WebXR: ${error}`);onfailed(c_str);GodotRuntime.free(c_str)})}).catch(function(error){const c_str=GodotRuntime.allocString(`Unable to start session: ${error}`);onfailed(c_str);GodotRuntime.free(c_str)})}function _godot_webxr_is_controller_connected(p_controller){if(!GodotWebXR.session||!GodotWebXR.frame){return false}return!!GodotWebXR.controllers[p_controller]}function _godot_webxr_is_session_supported(p_session_mode,p_callback){const session_mode=GodotRuntime.parseString(p_session_mode);const cb=GodotRuntime.get_func(p_callback);if(navigator.xr){navigator.xr.isSessionSupported(session_mode).then(function(supported){const c_str=GodotRuntime.allocString(session_mode);cb(c_str,supported?1:0);GodotRuntime.free(c_str)})}else{const c_str=GodotRuntime.allocString(session_mode);cb(c_str,0);GodotRuntime.free(c_str)}}function _godot_webxr_is_supported(){return!!navigator.xr}function _godot_webxr_sample_controller_data(){GodotWebXR.sampleControllers()}function _godot_webxr_uninitialize(){if(GodotWebXR.session){GodotWebXR.session.end().catch(e=>{})}GodotWebXR.session=null;GodotWebXR.space=null;GodotWebXR.frame=null;GodotWebXR.pose=null;GodotWebXR.monkeyPatchRequestAnimationFrame(false);GodotWebXR.pauseResumeMainLoop()}function _setTempRet0(val){setTempRet0(val)}function __isLeapYear(year){return year%4===0&&(year%100!==0||year%400===0)}function __arraySum(array,index){var sum=0;for(var i=0;i<=index;sum+=array[i++]){}return sum}var __MONTH_DAYS_LEAP=[31,29,31,30,31,30,31,31,30,31,30,31];var __MONTH_DAYS_REGULAR=[31,28,31,30,31,30,31,31,30,31,30,31];function __addDays(date,days){var newDate=new Date(date.getTime());while(days>0){var leap=__isLeapYear(newDate.getFullYear());var currentMonth=newDate.getMonth();var daysInCurrentMonth=(leap?__MONTH_DAYS_LEAP:__MONTH_DAYS_REGULAR)[currentMonth];if(days>daysInCurrentMonth-newDate.getDate()){days-=daysInCurrentMonth-newDate.getDate()+1;newDate.setDate(1);if(currentMonth<11){newDate.setMonth(currentMonth+1)}else{newDate.setMonth(0);newDate.setFullYear(newDate.getFullYear()+1)}}else{newDate.setDate(newDate.getDate()+days);return newDate}}return newDate}function _strftime(s,maxsize,format,tm){var tm_zone=HEAP32[tm+40>>2];var date={tm_sec:HEAP32[tm>>2],tm_min:HEAP32[tm+4>>2],tm_hour:HEAP32[tm+8>>2],tm_mday:HEAP32[tm+12>>2],tm_mon:HEAP32[tm+16>>2],tm_year:HEAP32[tm+20>>2],tm_wday:HEAP32[tm+24>>2],tm_yday:HEAP32[tm+28>>2],tm_isdst:HEAP32[tm+32>>2],tm_gmtoff:HEAP32[tm+36>>2],tm_zone:tm_zone?UTF8ToString(tm_zone):""};var pattern=UTF8ToString(format);var EXPANSION_RULES_1={"%c":"%a %b %d %H:%M:%S %Y","%D":"%m/%d/%y","%F":"%Y-%m-%d","%h":"%b","%r":"%I:%M:%S %p","%R":"%H:%M","%T":"%H:%M:%S","%x":"%m/%d/%y","%X":"%H:%M:%S","%Ec":"%c","%EC":"%C","%Ex":"%m/%d/%y","%EX":"%H:%M:%S","%Ey":"%y","%EY":"%Y","%Od":"%d","%Oe":"%e","%OH":"%H","%OI":"%I","%Om":"%m","%OM":"%M","%OS":"%S","%Ou":"%u","%OU":"%U","%OV":"%V","%Ow":"%w","%OW":"%W","%Oy":"%y"};for(var rule in EXPANSION_RULES_1){pattern=pattern.replace(new RegExp(rule,"g"),EXPANSION_RULES_1[rule])}var WEEKDAYS=["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"];var MONTHS=["January","February","March","April","May","June","July","August","September","October","November","December"];function leadingSomething(value,digits,character){var str=typeof value=="number"?value.toString():value||"";while(str.length0?1:0}var compare;if((compare=sgn(date1.getFullYear()-date2.getFullYear()))===0){if((compare=sgn(date1.getMonth()-date2.getMonth()))===0){compare=sgn(date1.getDate()-date2.getDate())}}return compare}function getFirstWeekStartDate(janFourth){switch(janFourth.getDay()){case 0:return new Date(janFourth.getFullYear()-1,11,29);case 1:return janFourth;case 2:return new Date(janFourth.getFullYear(),0,3);case 3:return new Date(janFourth.getFullYear(),0,2);case 4:return new Date(janFourth.getFullYear(),0,1);case 5:return new Date(janFourth.getFullYear()-1,11,31);case 6:return new Date(janFourth.getFullYear()-1,11,30)}}function getWeekBasedYear(date){var thisDate=__addDays(new Date(date.tm_year+1900,0,1),date.tm_yday);var janFourthThisYear=new Date(thisDate.getFullYear(),0,4);var janFourthNextYear=new Date(thisDate.getFullYear()+1,0,4);var firstWeekStartThisYear=getFirstWeekStartDate(janFourthThisYear);var firstWeekStartNextYear=getFirstWeekStartDate(janFourthNextYear);if(compareByDay(firstWeekStartThisYear,thisDate)<=0){if(compareByDay(firstWeekStartNextYear,thisDate)<=0){return thisDate.getFullYear()+1}else{return thisDate.getFullYear()}}else{return thisDate.getFullYear()-1}}var EXPANSION_RULES_2={"%a":function(date){return WEEKDAYS[date.tm_wday].substring(0,3)},"%A":function(date){return WEEKDAYS[date.tm_wday]},"%b":function(date){return MONTHS[date.tm_mon].substring(0,3)},"%B":function(date){return MONTHS[date.tm_mon]},"%C":function(date){var year=date.tm_year+1900;return leadingNulls(year/100|0,2)},"%d":function(date){return leadingNulls(date.tm_mday,2)},"%e":function(date){return leadingSomething(date.tm_mday,2," ")},"%g":function(date){return getWeekBasedYear(date).toString().substring(2)},"%G":function(date){return getWeekBasedYear(date)},"%H":function(date){return leadingNulls(date.tm_hour,2)},"%I":function(date){var twelveHour=date.tm_hour;if(twelveHour==0)twelveHour=12;else if(twelveHour>12)twelveHour-=12;return leadingNulls(twelveHour,2)},"%j":function(date){return leadingNulls(date.tm_mday+__arraySum(__isLeapYear(date.tm_year+1900)?__MONTH_DAYS_LEAP:__MONTH_DAYS_REGULAR,date.tm_mon-1),3)},"%m":function(date){return leadingNulls(date.tm_mon+1,2)},"%M":function(date){return leadingNulls(date.tm_min,2)},"%n":function(){return"\n"},"%p":function(date){if(date.tm_hour>=0&&date.tm_hour<12){return"AM"}else{return"PM"}},"%S":function(date){return leadingNulls(date.tm_sec,2)},"%t":function(){return"\t"},"%u":function(date){return date.tm_wday||7},"%U":function(date){var days=date.tm_yday+7-date.tm_wday;return leadingNulls(Math.floor(days/7),2)},"%V":function(date){var val=Math.floor((date.tm_yday+7-(date.tm_wday+6)%7)/7);if((date.tm_wday+371-date.tm_yday-2)%7<=2){val++}if(!val){val=52;var dec31=(date.tm_wday+7-date.tm_yday-1)%7;if(dec31==4||dec31==5&&__isLeapYear(date.tm_year%400-1)){val++}}else if(val==53){var jan1=(date.tm_wday+371-date.tm_yday)%7;if(jan1!=4&&(jan1!=3||!__isLeapYear(date.tm_year)))val=1}return leadingNulls(val,2)},"%w":function(date){return date.tm_wday},"%W":function(date){var days=date.tm_yday+7-(date.tm_wday+6)%7;return leadingNulls(Math.floor(days/7),2)},"%y":function(date){return(date.tm_year+1900).toString().substring(2)},"%Y":function(date){return date.tm_year+1900},"%z":function(date){var off=date.tm_gmtoff;var ahead=off>=0;off=Math.abs(off)/60;off=off/60*100+off%60;return(ahead?"+":"-")+String("0000"+off).slice(-4)},"%Z":function(date){return date.tm_zone},"%%":function(){return"%"}};pattern=pattern.replace(/%%/g,"\0\0");for(var rule in EXPANSION_RULES_2){if(pattern.includes(rule)){pattern=pattern.replace(new RegExp(rule,"g"),EXPANSION_RULES_2[rule](date))}}pattern=pattern.replace(/\0\0/g,"%");var bytes=intArrayFromString(pattern,false);if(bytes.length>maxsize){return 0}writeArrayToMemory(bytes,s);return bytes.length-1}function _strftime_l(s,maxsize,format,tm){return _strftime(s,maxsize,format,tm)}var FSNode=function(parent,name,mode,rdev){if(!parent){parent=this}this.parent=parent;this.mount=parent.mount;this.mounted=null;this.id=FS.nextInode++;this.name=name;this.mode=mode;this.node_ops={};this.stream_ops={};this.rdev=rdev};var readMode=292|73;var writeMode=146;Object.defineProperties(FSNode.prototype,{read:{get:function(){return(this.mode&readMode)===readMode},set:function(val){val?this.mode|=readMode:this.mode&=~readMode}},write:{get:function(){return(this.mode&writeMode)===writeMode},set:function(val){val?this.mode|=writeMode:this.mode&=~writeMode}},isFolder:{get:function(){return FS.isDir(this.mode)}},isDevice:{get:function(){return FS.isChrdev(this.mode)}}});FS.FSNode=FSNode;FS.staticInit();Module["requestFullscreen"]=function Module_requestFullscreen(lockPointer,resizeCanvas){Browser.requestFullscreen(lockPointer,resizeCanvas)};Module["requestAnimationFrame"]=function Module_requestAnimationFrame(func){Browser.requestAnimationFrame(func)};Module["setCanvasSize"]=function Module_setCanvasSize(width,height,noUpdates){Browser.setCanvasSize(width,height,noUpdates)};Module["pauseMainLoop"]=function Module_pauseMainLoop(){Browser.mainLoop.pause()};Module["resumeMainLoop"]=function Module_resumeMainLoop(){Browser.mainLoop.resume()};Module["getUserMedia"]=function Module_getUserMedia(){Browser.getUserMedia()};Module["createContext"]=function Module_createContext(canvas,useWebGL,setInModule,webGLContextAttributes){return Browser.createContext(canvas,useWebGL,setInModule,webGLContextAttributes)};var preloadedImages={};var preloadedAudios={};var GLctx;for(var i=0;i<32;++i)tempFixedLengthArray.push(new Array(i));var miniTempWebGLFloatBuffersStorage=new Float32Array(288);for(var i=0;i<288;++i){miniTempWebGLFloatBuffers[i]=miniTempWebGLFloatBuffersStorage.subarray(0,i+1)}var __miniTempWebGLIntBuffersStorage=new Int32Array(288);for(var i=0;i<288;++i){__miniTempWebGLIntBuffers[i]=__miniTempWebGLIntBuffersStorage.subarray(0,i+1)}Module["request_quit"]=function(){GodotOS.request_quit()};Module["onExit"]=GodotOS.cleanup;GodotOS._fs_sync_promise=Promise.resolve();Module["initConfig"]=GodotConfig.init_config;Module["initFS"]=GodotFS.init;Module["copyToFS"]=GodotFS.copy_to_fs;ERRNO_CODES={"EPERM":63,"ENOENT":44,"ESRCH":71,"EINTR":27,"EIO":29,"ENXIO":60,"E2BIG":1,"ENOEXEC":45,"EBADF":8,"ECHILD":12,"EAGAIN":6,"EWOULDBLOCK":6,"ENOMEM":48,"EACCES":2,"EFAULT":21,"ENOTBLK":105,"EBUSY":10,"EEXIST":20,"EXDEV":75,"ENODEV":43,"ENOTDIR":54,"EISDIR":31,"EINVAL":28,"ENFILE":41,"EMFILE":33,"ENOTTY":59,"ETXTBSY":74,"EFBIG":22,"ENOSPC":51,"ESPIPE":70,"EROFS":69,"EMLINK":34,"EPIPE":64,"EDOM":18,"ERANGE":68,"ENOMSG":49,"EIDRM":24,"ECHRNG":106,"EL2NSYNC":156,"EL3HLT":107,"EL3RST":108,"ELNRNG":109,"EUNATCH":110,"ENOCSI":111,"EL2HLT":112,"EDEADLK":16,"ENOLCK":46,"EBADE":113,"EBADR":114,"EXFULL":115,"ENOANO":104,"EBADRQC":103,"EBADSLT":102,"EDEADLOCK":16,"EBFONT":101,"ENOSTR":100,"ENODATA":116,"ETIME":117,"ENOSR":118,"ENONET":119,"ENOPKG":120,"EREMOTE":121,"ENOLINK":47,"EADV":122,"ESRMNT":123,"ECOMM":124,"EPROTO":65,"EMULTIHOP":36,"EDOTDOT":125,"EBADMSG":9,"ENOTUNIQ":126,"EBADFD":127,"EREMCHG":128,"ELIBACC":129,"ELIBBAD":130,"ELIBSCN":131,"ELIBMAX":132,"ELIBEXEC":133,"ENOSYS":52,"ENOTEMPTY":55,"ENAMETOOLONG":37,"ELOOP":32,"EOPNOTSUPP":138,"EPFNOSUPPORT":139,"ECONNRESET":15,"ENOBUFS":42,"EAFNOSUPPORT":5,"EPROTOTYPE":67,"ENOTSOCK":57,"ENOPROTOOPT":50,"ESHUTDOWN":140,"ECONNREFUSED":14,"EADDRINUSE":3,"ECONNABORTED":13,"ENETUNREACH":40,"ENETDOWN":38,"ETIMEDOUT":73,"EHOSTDOWN":142,"EHOSTUNREACH":23,"EINPROGRESS":26,"EALREADY":7,"EDESTADDRREQ":17,"EMSGSIZE":35,"EPROTONOSUPPORT":66,"ESOCKTNOSUPPORT":137,"EADDRNOTAVAIL":4,"ENETRESET":39,"EISCONN":30,"ENOTCONN":53,"ETOOMANYREFS":141,"EUSERS":136,"EDQUOT":19,"ESTALE":72,"ENOTSUP":138,"ENOMEDIUM":148,"EILSEQ":25,"EOVERFLOW":61,"ECANCELED":11,"ENOTRECOVERABLE":56,"EOWNERDEAD":62,"ESTRPIPE":135};GodotOS.atexit(function(resolve,reject){GodotDisplayCursor.clear();resolve()});GodotOS.atexit(function(resolve,reject){GodotEventListeners.clear();resolve()});GodotOS.atexit(function(resolve,reject){GodotDisplayVK.clear();resolve()});GodotJSWrapper.proxies=new Map;function intArrayFromString(stringy,dontAddNull,length){var len=length>0?length:lengthBytesUTF8(stringy)+1;var u8array=new Array(len);var numBytesWritten=stringToUTF8Array(stringy,u8array,0,u8array.length);if(dontAddNull)u8array.length=numBytesWritten;return u8array}var asmLibraryArg={"Xc":___call_sighandler,"Rc":___syscall__newselect,"Mc":___syscall_accept4,"Lc":___syscall_bind,"rd":___syscall_chdir,"qd":___syscall_chmod,"Kc":___syscall_connect,"sd":___syscall_faccessat,"Fa":___syscall_fcntl64,"fd":___syscall_getcwd,"Wc":___syscall_getdents64,"Jc":___syscall_getsockname,"Ic":___syscall_getsockopt,"mb":___syscall_ioctl,"Hc":___syscall_listen,"ad":___syscall_lstat64,"_c":___syscall_mkdirat,"$c":___syscall_newfstatat,"nb":___syscall_openat,"Zc":___syscall_poll,"Vc":___syscall_readlinkat,"Gc":___syscall_recvfrom,"Sc":___syscall_renameat,"Tc":___syscall_rmdir,"Fc":___syscall_sendto,"jb":___syscall_socket,"bd":___syscall_stat64,"Qc":___syscall_statfs64,"Pc":___syscall_symlink,"Uc":___syscall_unlinkat,"nd":__dlinit,"pd":__dlopen_js,"od":__dlsym_js,"Va":__emscripten_date_now,"id":__emscripten_get_now_is_monotonic,"Ec":__emscripten_throw_longjmp,"jd":__gmtime_js,"kd":__localtime_js,"md":__tzset_js,"ja":_abort,"qb":_emscripten_cancel_main_loop,"Jh":_emscripten_force_exit,"Ua":_emscripten_get_now,"yi":_emscripten_glActiveTexture,"xi":_emscripten_glAttachShader,"mf":_emscripten_glBeginQuery,"Qi":_emscripten_glBeginQueryEXT,"Ue":_emscripten_glBeginTransformFeedback,"wi":_emscripten_glBindAttribLocation,"vi":_emscripten_glBindBuffer,"Qe":_emscripten_glBindBufferBase,"Re":_emscripten_glBindBufferRange,"ui":_emscripten_glBindFramebuffer,"ti":_emscripten_glBindRenderbuffer,"Td":_emscripten_glBindSampler,"si":_emscripten_glBindTexture,"Kd":_emscripten_glBindTransformFeedback,"Ze":_emscripten_glBindVertexArray,"Hi":_emscripten_glBindVertexArrayOES,"ri":_emscripten_glBlendColor,"qi":_emscripten_glBlendEquation,"pi":_emscripten_glBlendEquationSeparate,"ni":_emscripten_glBlendFunc,"mi":_emscripten_glBlendFuncSeparate,"af":_emscripten_glBlitFramebuffer,"li":_emscripten_glBufferData,"ki":_emscripten_glBufferSubData,"ji":_emscripten_glCheckFramebufferStatus,"ii":_emscripten_glClear,"re":_emscripten_glClearBufferfi,"se":_emscripten_glClearBufferfv,"ue":_emscripten_glClearBufferiv,"te":_emscripten_glClearBufferuiv,"hi":_emscripten_glClearColor,"gi":_emscripten_glClearDepthf,"fi":_emscripten_glClearStencil,"ce":_emscripten_glClientWaitSync,"ei":_emscripten_glColorMask,"bi":_emscripten_glCompileShader,"ai":_emscripten_glCompressedTexImage2D,"rf":_emscripten_glCompressedTexImage3D,"$h":_emscripten_glCompressedTexSubImage2D,"qf":_emscripten_glCompressedTexSubImage3D,"pe":_emscripten_glCopyBufferSubData,"_h":_emscripten_glCopyTexImage2D,"Zh":_emscripten_glCopyTexSubImage2D,"sf":_emscripten_glCopyTexSubImage3D,"Yh":_emscripten_glCreateProgram,"Xh":_emscripten_glCreateShader,"Wh":_emscripten_glCullFace,"Vh":_emscripten_glDeleteBuffers,"Uh":_emscripten_glDeleteFramebuffers,"Th":_emscripten_glDeleteProgram,"of":_emscripten_glDeleteQueries,"Si":_emscripten_glDeleteQueriesEXT,"Sh":_emscripten_glDeleteRenderbuffers,"Vd":_emscripten_glDeleteSamplers,"Rh":_emscripten_glDeleteShader,"de":_emscripten_glDeleteSync,"Qh":_emscripten_glDeleteTextures,"Jd":_emscripten_glDeleteTransformFeedbacks,"Ye":_emscripten_glDeleteVertexArrays,"Gi":_emscripten_glDeleteVertexArraysOES,"Ph":_emscripten_glDepthFunc,"Oh":_emscripten_glDepthMask,"Nh":_emscripten_glDepthRangef,"Mh":_emscripten_glDetachShader,"Lh":_emscripten_glDisable,"Kh":_emscripten_glDisableVertexAttribArray,"Ih":_emscripten_glDrawArrays,"he":_emscripten_glDrawArraysInstanced,"Ci":_emscripten_glDrawArraysInstancedANGLE,"Bf":_emscripten_glDrawArraysInstancedARB,"Cf":_emscripten_glDrawArraysInstancedEXT,"td":_emscripten_glDrawArraysInstancedNV,"hf":_emscripten_glDrawBuffers,"xf":_emscripten_glDrawBuffersEXT,"Di":_emscripten_glDrawBuffersWEBGL,"Hh":_emscripten_glDrawElements,"ge":_emscripten_glDrawElementsInstanced,"Bi":_emscripten_glDrawElementsInstancedANGLE,"yf":_emscripten_glDrawElementsInstancedARB,"zf":_emscripten_glDrawElementsInstancedEXT,"Af":_emscripten_glDrawElementsInstancedNV,"vf":_emscripten_glDrawRangeElements,"Gh":_emscripten_glEnable,"Fh":_emscripten_glEnableVertexAttribArray,"lf":_emscripten_glEndQuery,"Pi":_emscripten_glEndQueryEXT,"Se":_emscripten_glEndTransformFeedback,"fe":_emscripten_glFenceSync,"Eh":_emscripten_glFinish,"Dh":_emscripten_glFlush,"Ch":_emscripten_glFramebufferRenderbuffer,"Bh":_emscripten_glFramebufferTexture2D,"_e":_emscripten_glFramebufferTextureLayer,"Ah":_emscripten_glFrontFace,"zh":_emscripten_glGenBuffers,"xh":_emscripten_glGenFramebuffers,"pf":_emscripten_glGenQueries,"Ti":_emscripten_glGenQueriesEXT,"wh":_emscripten_glGenRenderbuffers,"Wd":_emscripten_glGenSamplers,"vh":_emscripten_glGenTextures,"Id":_emscripten_glGenTransformFeedbacks,"Xe":_emscripten_glGenVertexArrays,"Fi":_emscripten_glGenVertexArraysOES,"yh":_emscripten_glGenerateMipmap,"uh":_emscripten_glGetActiveAttrib,"th":_emscripten_glGetActiveUniform,"je":_emscripten_glGetActiveUniformBlockName,"ke":_emscripten_glGetActiveUniformBlockiv,"ne":_emscripten_glGetActiveUniformsiv,"sh":_emscripten_glGetAttachedShaders,"rh":_emscripten_glGetAttribLocation,"qh":_emscripten_glGetBooleanv,"Xd":_emscripten_glGetBufferParameteri64v,"ph":_emscripten_glGetBufferParameteriv,"nh":_emscripten_glGetError,"mh":_emscripten_glGetFloatv,"Ee":_emscripten_glGetFragDataLocation,"lh":_emscripten_glGetFramebufferAttachmentParameteriv,"Yd":_emscripten_glGetInteger64i_v,"_d":_emscripten_glGetInteger64v,"Ve":_emscripten_glGetIntegeri_v,"kh":_emscripten_glGetIntegerv,"wd":_emscripten_glGetInternalformativ,"Dd":_emscripten_glGetProgramBinary,"ih":_emscripten_glGetProgramInfoLog,"jh":_emscripten_glGetProgramiv,"Ji":_emscripten_glGetQueryObjecti64vEXT,"Mi":_emscripten_glGetQueryObjectivEXT,"Ii":_emscripten_glGetQueryObjectui64vEXT,"jf":_emscripten_glGetQueryObjectuiv,"Li":_emscripten_glGetQueryObjectuivEXT,"kf":_emscripten_glGetQueryiv,"Ni":_emscripten_glGetQueryivEXT,"hh":_emscripten_glGetRenderbufferParameteriv,"Md":_emscripten_glGetSamplerParameterfv,"Nd":_emscripten_glGetSamplerParameteriv,"fh":_emscripten_glGetShaderInfoLog,"eh":_emscripten_glGetShaderPrecisionFormat,"ch":_emscripten_glGetShaderSource,"gh":_emscripten_glGetShaderiv,"bh":_emscripten_glGetString,"qe":_emscripten_glGetStringi,"Zd":_emscripten_glGetSynciv,"ah":_emscripten_glGetTexParameterfv,"$g":_emscripten_glGetTexParameteriv,"Oe":_emscripten_glGetTransformFeedbackVarying,"le":_emscripten_glGetUniformBlockIndex,"oe":_emscripten_glGetUniformIndices,"Yg":_emscripten_glGetUniformLocation,"_g":_emscripten_glGetUniformfv,"Zg":_emscripten_glGetUniformiv,"Fe":_emscripten_glGetUniformuiv,"Me":_emscripten_glGetVertexAttribIiv,"Le":_emscripten_glGetVertexAttribIuiv,"Vg":_emscripten_glGetVertexAttribPointerv,"Xg":_emscripten_glGetVertexAttribfv,"Wg":_emscripten_glGetVertexAttribiv,"Tg":_emscripten_glHint,"Ad":_emscripten_glInvalidateFramebuffer,"zd":_emscripten_glInvalidateSubFramebuffer,"Sg":_emscripten_glIsBuffer,"Rg":_emscripten_glIsEnabled,"Qg":_emscripten_glIsFramebuffer,"Pg":_emscripten_glIsProgram,"nf":_emscripten_glIsQuery,"Ri":_emscripten_glIsQueryEXT,"Og":_emscripten_glIsRenderbuffer,"Ud":_emscripten_glIsSampler,"Ng":_emscripten_glIsShader,"ee":_emscripten_glIsSync,"Mg":_emscripten_glIsTexture,"Hd":_emscripten_glIsTransformFeedback,"We":_emscripten_glIsVertexArray,"Ei":_emscripten_glIsVertexArrayOES,"Lg":_emscripten_glLineWidth,"Kg":_emscripten_glLinkProgram,"Fd":_emscripten_glPauseTransformFeedback,"Ig":_emscripten_glPixelStorei,"Hg":_emscripten_glPolygonOffset,"Cd":_emscripten_glProgramBinary,"Bd":_emscripten_glProgramParameteri,"Oi":_emscripten_glQueryCounterEXT,"wf":_emscripten_glReadBuffer,"Gg":_emscripten_glReadPixels,"Fg":_emscripten_glReleaseShaderCompiler,"Eg":_emscripten_glRenderbufferStorage,"$e":_emscripten_glRenderbufferStorageMultisample,"Ed":_emscripten_glResumeTransformFeedback,"Dg":_emscripten_glSampleCoverage,"Pd":_emscripten_glSamplerParameterf,"Od":_emscripten_glSamplerParameterfv,"Sd":_emscripten_glSamplerParameteri,"Qd":_emscripten_glSamplerParameteriv,"Cg":_emscripten_glScissor,"Bg":_emscripten_glShaderBinary,"Ag":_emscripten_glShaderSource,"zg":_emscripten_glStencilFunc,"xg":_emscripten_glStencilFuncSeparate,"wg":_emscripten_glStencilMask,"vg":_emscripten_glStencilMaskSeparate,"ug":_emscripten_glStencilOp,"tg":_emscripten_glStencilOpSeparate,"sg":_emscripten_glTexImage2D,"uf":_emscripten_glTexImage3D,"rg":_emscripten_glTexParameterf,"qg":_emscripten_glTexParameterfv,"pg":_emscripten_glTexParameteri,"og":_emscripten_glTexParameteriv,"yd":_emscripten_glTexStorage2D,"xd":_emscripten_glTexStorage3D,"mg":_emscripten_glTexSubImage2D,"tf":_emscripten_glTexSubImage3D,"Pe":_emscripten_glTransformFeedbackVaryings,"lg":_emscripten_glUniform1f,"kg":_emscripten_glUniform1fv,"jg":_emscripten_glUniform1i,"ig":_emscripten_glUniform1iv,"De":_emscripten_glUniform1ui,"ze":_emscripten_glUniform1uiv,"hg":_emscripten_glUniform2f,"gg":_emscripten_glUniform2fv,"fg":_emscripten_glUniform2i,"eg":_emscripten_glUniform2iv,"Ce":_emscripten_glUniform2ui,"ye":_emscripten_glUniform2uiv,"dg":_emscripten_glUniform3f,"ag":_emscripten_glUniform3fv,"$f":_emscripten_glUniform3i,"_f":_emscripten_glUniform3iv,"Be":_emscripten_glUniform3ui,"we":_emscripten_glUniform3uiv,"Zf":_emscripten_glUniform4f,"Yf":_emscripten_glUniform4fv,"Xf":_emscripten_glUniform4i,"Wf":_emscripten_glUniform4iv,"Ae":_emscripten_glUniform4ui,"ve":_emscripten_glUniform4uiv,"ie":_emscripten_glUniformBlockBinding,"Vf":_emscripten_glUniformMatrix2fv,"gf":_emscripten_glUniformMatrix2x3fv,"ef":_emscripten_glUniformMatrix2x4fv,"Uf":_emscripten_glUniformMatrix3fv,"ff":_emscripten_glUniformMatrix3x2fv,"cf":_emscripten_glUniformMatrix3x4fv,"Tf":_emscripten_glUniformMatrix4fv,"df":_emscripten_glUniformMatrix4x2fv,"bf":_emscripten_glUniformMatrix4x3fv,"Rf":_emscripten_glUseProgram,"Qf":_emscripten_glValidateProgram,"Pf":_emscripten_glVertexAttrib1f,"Of":_emscripten_glVertexAttrib1fv,"Nf":_emscripten_glVertexAttrib2f,"Mf":_emscripten_glVertexAttrib2fv,"Lf":_emscripten_glVertexAttrib3f,"Kf":_emscripten_glVertexAttrib3fv,"Jf":_emscripten_glVertexAttrib4f,"If":_emscripten_glVertexAttrib4fv,"Ld":_emscripten_glVertexAttribDivisor,"Ai":_emscripten_glVertexAttribDivisorANGLE,"Df":_emscripten_glVertexAttribDivisorARB,"Ef":_emscripten_glVertexAttribDivisorEXT,"ud":_emscripten_glVertexAttribDivisorNV,"Ke":_emscripten_glVertexAttribI4i,"He":_emscripten_glVertexAttribI4iv,"Je":_emscripten_glVertexAttribI4ui,"Ge":_emscripten_glVertexAttribI4uiv,"Ne":_emscripten_glVertexAttribIPointer,"Gf":_emscripten_glVertexAttribPointer,"Ff":_emscripten_glViewport,"$d":_emscripten_glWaitSync,"hd":_emscripten_memcpy_big,"Ta":_emscripten_resize_heap,"pb":_emscripten_set_main_loop,"fb":_emscripten_webgl_commit_frame,"Cc":_emscripten_webgl_create_context,"bc":_emscripten_webgl_destroy_context,"Oc":_emscripten_webgl_init_context_attributes,"xc":_emscripten_webgl_make_context_current,"dd":_environ_get,"ed":_environ_sizes_get,"ua":_fd_close,"cd":_fd_fdstat_get,"lb":_fd_read,"Ac":_fd_seek,"kb":_fd_write,"k":_getTempRet0,"Sa":_getaddrinfo,"Pb":_getnameinfo,"c":_glActiveTexture,"Na":_glAttachShader,"bb":_glBeginTransformFeedback,"vb":_glBindAttribLocation,"b":_glBindBuffer,"P":_glBindBufferBase,"e":_glBindFramebuffer,"_":_glBindRenderbuffer,"a":_glBindTexture,"m":_glBindVertexArray,"D":_glBlendEquation,"X":_glBlendFunc,"w":_glBlendFuncSeparate,"ha":_glBlitFramebuffer,"q":_glBufferData,"K":_glBufferSubData,"M":_glCheckFramebufferStatus,"J":_glClear,"qa":_glClearBufferfv,"O":_glClearColor,"aa":_glClearDepthf,"N":_glColorMask,"ka":_glCompileShader,"Ab":_glCompressedTexImage2D,"gj":_glCompressedTexSubImage2D,"zb":_glCompressedTexSubImage3D,"ej":_glCopyBufferSubData,"_a":_glCopyTexSubImage2D,"$a":_glCreateProgram,"Da":_glCreateShader,"ra":_glCullFace,"L":_glDeleteBuffers,"F":_glDeleteFramebuffers,"Q":_glDeleteProgram,"U":_glDeleteRenderbuffers,"I":_glDeleteShader,"A":_glDeleteTextures,"ea":_glDeleteVertexArrays,"Y":_glDepthFunc,"H":_glDepthMask,"i":_glDisable,"p":_glDisableVertexAttribArray,"B":_glDrawArrays,"ya":_glDrawArraysInstanced,"Ja":_glDrawBuffers,"ba":_glDrawElements,"Ka":_glDrawElementsInstanced,"s":_glEnable,"j":_glEnableVertexAttribArray,"ab":_glEndTransformFeedback,"Db":_glFinish,"Z":_glFramebufferRenderbuffer,"x":_glFramebufferTexture2D,"fj":_glFramebufferTextureLayer,"Bb":_glFrontFace,"C":_glGenBuffers,"E":_glGenFramebuffers,"ga":_glGenRenderbuffers,"v":_glGenTextures,"W":_glGenVertexArrays,"R":_glGenerateMipmap,"Cb":_glGetError,"wb":_glGetFloatv,"$":_glGetIntegerv,"Zi":_glGetProgramBinary,"tb":_glGetProgramInfoLog,"Ea":_glGetProgramiv,"Oa":_glGetShaderInfoLog,"Vi":_glGetShaderSource,"da":_glGetShaderiv,"wa":_glGetString,"dj":_glGetStringi,"Xi":_glGetUniformBlockIndex,"va":_glGetUniformLocation,"lj":_glInvalidateFramebuffer,"ub":_glLinkProgram,"la":_glPixelStorei,"bj":_glProgramBinary,"_i":_glProgramParameteri,"ia":_glReadBuffer,"cb":_glReadPixels,"fa":_glRenderbufferStorage,"Ga":_glRenderbufferStorageMultisample,"T":_glScissor,"Pa":_glShaderSource,"r":_glTexImage2D,"Ia":_glTexImage3D,"g":_glTexParameterf,"d":_glTexParameteri,"ij":_glTexStorage2D,"Ha":_glTexSubImage2D,"Qa":_glTexSubImage3D,"$i":_glTransformFeedbackVaryings,"f":_glUniform1f,"u":_glUniform1i,"db":_glUniform1iv,"xb":_glUniform1ui,"Za":_glUniform2f,"n":_glUniform2fv,"Ca":_glUniform2i,"ma":_glUniform2iv,"Ya":_glUniform3f,"V":_glUniform3fv,"Ba":_glUniform3i,"xa":_glUniform4f,"y":_glUniform4fv,"Aa":_glUniform4i,"Wi":_glUniformBlockBinding,"sb":_glUniformMatrix2fv,"rb":_glUniformMatrix3fv,"o":_glUniformMatrix4fv,"pa":_glUseProgram,"z":_glVertexAttrib4f,"S":_glVertexAttrib4fv,"G":_glVertexAttribDivisor,"pj":_glVertexAttribI4ui,"La":_glVertexAttribIPointer,"h":_glVertexAttribPointer,"t":_glViewport,"di":_godot_audio_capture_start,"cg":_godot_audio_capture_stop,"be":_godot_audio_has_script_processor,"dc":_godot_audio_has_worklet,"bk":_godot_audio_init,"ck":_godot_audio_is_available,"kj":_godot_audio_resume,"yc":_godot_audio_script_create,"nc":_godot_audio_script_start,"Ub":_godot_audio_worklet_create,"ak":_godot_audio_worklet_start_no_threads,"Sb":_godot_js_config_canvas_id_get,"dh":_godot_js_config_locale_get,"_b":_godot_js_display_alert,"me":_godot_js_display_canvas_focus,"xe":_godot_js_display_canvas_is_focused,"ld":_godot_js_display_clipboard_get,"vd":_godot_js_display_clipboard_set,"Te":_godot_js_display_cursor_is_hidden,"Ie":_godot_js_display_cursor_is_locked,"Wa":_godot_js_display_cursor_lock_set,"ob":_godot_js_display_cursor_set_custom_shape,"Hf":_godot_js_display_cursor_set_shape,"Xa":_godot_js_display_cursor_set_visible,"yg":_godot_js_display_desired_size_set,"oc":_godot_js_display_fullscreen_cb,"Sf":_godot_js_display_fullscreen_exit,"bg":_godot_js_display_fullscreen_request,"Rj":_godot_js_display_glGetBufferSubData,"ib":_godot_js_display_has_webgl,"Yc":_godot_js_display_is_swap_ok_cancel,"lc":_godot_js_display_notification_cb,"cc":_godot_js_display_pixel_ratio_get,"ec":_godot_js_display_screen_dpi_get,"Jg":_godot_js_display_screen_size_get,"gd":_godot_js_display_setup_canvas,"Ug":_godot_js_display_size_update,"ae":_godot_js_display_touchscreen_is_available,"jc":_godot_js_display_vk_available,"kc":_godot_js_display_vk_cb,"hc":_godot_js_display_vk_hide,"ic":_godot_js_display_vk_show,"mc":_godot_js_display_window_blur_cb,"Yb":_godot_js_display_window_icon_set,"ng":_godot_js_display_window_size_get,"Zb":_godot_js_display_window_title_set,"zi":_godot_js_eval,"qj":_godot_js_fetch_body_length_get,"Aj":_godot_js_fetch_create,"Jb":_godot_js_fetch_free,"nj":_godot_js_fetch_http_status_get,"rj":_godot_js_fetch_is_chunked,"oj":_godot_js_fetch_read_chunk,"mj":_godot_js_fetch_read_headers,"eb":_godot_js_fetch_state_get,"pc":_godot_js_input_drop_files_cb,"rc":_godot_js_input_gamepad_cb,"fc":_godot_js_input_gamepad_sample,"Rd":_godot_js_input_gamepad_sample_count,"Gd":_godot_js_input_gamepad_sample_get,"sc":_godot_js_input_key_cb,"wc":_godot_js_input_mouse_button_cb,"vc":_godot_js_input_mouse_move_cb,"uc":_godot_js_input_mouse_wheel_cb,"qc":_godot_js_input_paste_cb,"tc":_godot_js_input_touch_cb,"Wb":_godot_js_input_vibrate_handheld,"oi":_godot_js_os_download_buffer,"ac":_godot_js_os_execute,"oh":_godot_js_os_finish_async,"Rb":_godot_js_os_fs_is_persistent,"gc":_godot_js_os_fs_sync,"$b":_godot_js_os_hw_concurrency_get,"Tb":_godot_js_os_request_quit_cb,"Xb":_godot_js_os_shell_open,"Qb":_godot_js_pwa_cb,"Vb":_godot_js_pwa_update,"Ob":_godot_js_rtc_datachannel_close,"Vj":_godot_js_rtc_datachannel_connect,"Sj":_godot_js_rtc_datachannel_destroy,"Wj":_godot_js_rtc_datachannel_get_buffered_amount,"_j":_godot_js_rtc_datachannel_id_get,"Xj":_godot_js_rtc_datachannel_is_negotiated,"$j":_godot_js_rtc_datachannel_is_ordered,"Uj":_godot_js_rtc_datachannel_label_get,"Zj":_godot_js_rtc_datachannel_max_packet_lifetime_get,"Yj":_godot_js_rtc_datachannel_max_retransmits_get,"Tj":_godot_js_rtc_datachannel_protocol_get,"Nb":_godot_js_rtc_datachannel_ready_state_get,"Mb":_godot_js_rtc_datachannel_send,"Qj":_godot_js_rtc_pc_close,"Lj":_godot_js_rtc_pc_create,"Kj":_godot_js_rtc_pc_datachannel_create,"Lb":_godot_js_rtc_pc_destroy,"Mj":_godot_js_rtc_pc_ice_candidate_add,"Oj":_godot_js_rtc_pc_local_description_set,"Pj":_godot_js_rtc_pc_offer_create,"Nj":_godot_js_rtc_pc_remote_description_set,"Kb":_godot_js_websocket_buffered_amount,"Ij":_godot_js_websocket_close,"Hj":_godot_js_websocket_create,"Ib":_godot_js_websocket_destroy,"Jj":_godot_js_websocket_send,"Yi":_godot_js_wrapper_create_cb,"Ki":_godot_js_wrapper_create_object,"Ui":_godot_js_wrapper_interface_get,"aj":_godot_js_wrapper_object_call,"hj":_godot_js_wrapper_object_get,"yb":_godot_js_wrapper_object_getvar,"jj":_godot_js_wrapper_object_set,"cj":_godot_js_wrapper_object_setvar,"ci":_godot_js_wrapper_object_unref,"vj":_godot_webxr_commit_for_eye,"Ej":_godot_webxr_get_bounds_geometry,"Fb":_godot_webxr_get_controller_axes,"sj":_godot_webxr_get_controller_buttons,"uj":_godot_webxr_get_controller_count,"Ra":_godot_webxr_get_controller_target_ray_mode,"tj":_godot_webxr_get_controller_transform,"wj":_godot_webxr_get_projection_for_eye,"yj":_godot_webxr_get_render_targetsize,"xj":_godot_webxr_get_transform_for_eye,"Dj":_godot_webxr_get_view_count,"Fj":_godot_webxr_get_visibility_state,"Bj":_godot_webxr_initialize,"Gb":_godot_webxr_is_controller_connected,"Gj":_godot_webxr_is_session_supported,"Cj":_godot_webxr_is_supported,"Hb":_godot_webxr_sample_controller_data,"zj":_godot_webxr_uninitialize,"za":invoke_ii,"na":invoke_iii,"gb":invoke_iiii,"hb":invoke_iiiii,"Dc":invoke_iiiiii,"Bc":invoke_iiiiiii,"zc":invoke_iij,"ca":invoke_vi,"oa":invoke_vii,"ta":invoke_viii,"sa":invoke_viiii,"Ma":invoke_viiiiiii,"l":_setTempRet0,"Eb":_strftime,"Nc":_strftime_l};var asm=createWasm();var ___wasm_call_ctors=Module["___wasm_call_ctors"]=function(){return(___wasm_call_ctors=Module["___wasm_call_ctors"]=Module["asm"]["ek"]).apply(null,arguments)};var _free=Module["_free"]=function(){return(_free=Module["_free"]=Module["asm"]["fk"]).apply(null,arguments)};var __Z13godot_js_mainiPPc=Module["__Z13godot_js_mainiPPc"]=function(){return(__Z13godot_js_mainiPPc=Module["__Z13godot_js_mainiPPc"]=Module["asm"]["gk"]).apply(null,arguments)};var _main=Module["_main"]=function(){return(_main=Module["_main"]=Module["asm"]["hk"]).apply(null,arguments)};var _malloc=Module["_malloc"]=function(){return(_malloc=Module["_malloc"]=Module["asm"]["ik"]).apply(null,arguments)};var _htonl=Module["_htonl"]=function(){return(_htonl=Module["_htonl"]=Module["asm"]["jk"]).apply(null,arguments)};var _htons=Module["_htons"]=function(){return(_htons=Module["_htons"]=Module["asm"]["kk"]).apply(null,arguments)};var _ntohs=Module["_ntohs"]=function(){return(_ntohs=Module["_ntohs"]=Module["asm"]["lk"]).apply(null,arguments)};var ___errno_location=Module["___errno_location"]=function(){return(___errno_location=Module["___errno_location"]=Module["asm"]["mk"]).apply(null,arguments)};var _fflush=Module["_fflush"]=function(){return(_fflush=Module["_fflush"]=Module["asm"]["nk"]).apply(null,arguments)};var __emwebxr_on_input_event=Module["__emwebxr_on_input_event"]=function(){return(__emwebxr_on_input_event=Module["__emwebxr_on_input_event"]=Module["asm"]["ok"]).apply(null,arguments)};var __emwebxr_on_simple_event=Module["__emwebxr_on_simple_event"]=function(){return(__emwebxr_on_simple_event=Module["__emwebxr_on_simple_event"]=Module["asm"]["pk"]).apply(null,arguments)};var ___funcs_on_exit=Module["___funcs_on_exit"]=function(){return(___funcs_on_exit=Module["___funcs_on_exit"]=Module["asm"]["qk"]).apply(null,arguments)};var _setThrew=Module["_setThrew"]=function(){return(_setThrew=Module["_setThrew"]=Module["asm"]["sk"]).apply(null,arguments)};var stackSave=Module["stackSave"]=function(){return(stackSave=Module["stackSave"]=Module["asm"]["tk"]).apply(null,arguments)};var stackRestore=Module["stackRestore"]=function(){return(stackRestore=Module["stackRestore"]=Module["asm"]["uk"]).apply(null,arguments)};var stackAlloc=Module["stackAlloc"]=function(){return(stackAlloc=Module["stackAlloc"]=Module["asm"]["vk"]).apply(null,arguments)};var dynCall_iij=Module["dynCall_iij"]=function(){return(dynCall_iij=Module["dynCall_iij"]=Module["asm"]["wk"]).apply(null,arguments)};function invoke_vii(index,a1,a2){var sp=stackSave();try{getWasmTableEntry(index)(a1,a2)}catch(e){stackRestore(sp);if(e!==e+0)throw e;_setThrew(1,0)}}function invoke_vi(index,a1){var sp=stackSave();try{getWasmTableEntry(index)(a1)}catch(e){stackRestore(sp);if(e!==e+0)throw e;_setThrew(1,0)}}function invoke_viii(index,a1,a2,a3){var sp=stackSave();try{getWasmTableEntry(index)(a1,a2,a3)}catch(e){stackRestore(sp);if(e!==e+0)throw e;_setThrew(1,0)}}function invoke_ii(index,a1){var sp=stackSave();try{return getWasmTableEntry(index)(a1)}catch(e){stackRestore(sp);if(e!==e+0)throw e;_setThrew(1,0)}}function invoke_iii(index,a1,a2){var sp=stackSave();try{return getWasmTableEntry(index)(a1,a2)}catch(e){stackRestore(sp);if(e!==e+0)throw e;_setThrew(1,0)}}function invoke_iiiii(index,a1,a2,a3,a4){var sp=stackSave();try{return getWasmTableEntry(index)(a1,a2,a3,a4)}catch(e){stackRestore(sp);if(e!==e+0)throw e;_setThrew(1,0)}}function invoke_iiiiii(index,a1,a2,a3,a4,a5){var sp=stackSave();try{return getWasmTableEntry(index)(a1,a2,a3,a4,a5)}catch(e){stackRestore(sp);if(e!==e+0)throw e;_setThrew(1,0)}}function invoke_viiii(index,a1,a2,a3,a4){var sp=stackSave();try{getWasmTableEntry(index)(a1,a2,a3,a4)}catch(e){stackRestore(sp);if(e!==e+0)throw e;_setThrew(1,0)}}function invoke_iiii(index,a1,a2,a3){var sp=stackSave();try{return getWasmTableEntry(index)(a1,a2,a3)}catch(e){stackRestore(sp);if(e!==e+0)throw e;_setThrew(1,0)}}function invoke_viiiiiii(index,a1,a2,a3,a4,a5,a6,a7){var sp=stackSave();try{getWasmTableEntry(index)(a1,a2,a3,a4,a5,a6,a7)}catch(e){stackRestore(sp);if(e!==e+0)throw e;_setThrew(1,0)}}function invoke_iiiiiii(index,a1,a2,a3,a4,a5,a6){var sp=stackSave();try{return getWasmTableEntry(index)(a1,a2,a3,a4,a5,a6)}catch(e){stackRestore(sp);if(e!==e+0)throw e;_setThrew(1,0)}}function invoke_iij(index,a1,a2,a3){var sp=stackSave();try{return dynCall_iij(index,a1,a2,a3)}catch(e){stackRestore(sp);if(e!==e+0)throw e;_setThrew(1,0)}}Module["cwrap"]=cwrap;Module["callMain"]=callMain;var calledRun;function ExitStatus(status){this.name="ExitStatus";this.message="Program terminated with exit("+status+")";this.status=status}var calledMain=false;dependenciesFulfilled=function runCaller(){if(!calledRun)run();if(!calledRun)dependenciesFulfilled=runCaller};function callMain(args){var entryFunction=Module["_main"];args=args||[];args.unshift(thisProgram);var argc=args.length;var argv=stackAlloc((argc+1)*4);var argv_ptr=argv>>2;args.forEach(arg=>{HEAP32[argv_ptr++]=allocateUTF8OnStack(arg)});HEAP32[argv_ptr]=0;try{var ret=entryFunction(argc,argv);exit(ret,true);return ret}catch(e){return handleException(e)}finally{calledMain=true}}function run(args){args=args||arguments_;if(runDependencies>0){return}preRun();if(runDependencies>0){return}function doRun(){if(calledRun)return;calledRun=true;Module["calledRun"]=true;if(ABORT)return;initRuntime();preMain();readyPromiseResolve(Module);if(Module["onRuntimeInitialized"])Module["onRuntimeInitialized"]();if(shouldRunNow)callMain(args);postRun()}if(Module["setStatus"]){Module["setStatus"]("Running...");setTimeout(function(){setTimeout(function(){Module["setStatus"]("")},1);doRun()},1)}else{doRun()}}Module["run"]=run;function exit(status,implicit){EXITSTATUS=status;if(!keepRuntimeAlive()){exitRuntime()}procExit(status)}function procExit(code){EXITSTATUS=code;if(!keepRuntimeAlive()){if(Module["onExit"])Module["onExit"](code);ABORT=true}quit_(code,new ExitStatus(code))}if(Module["preInit"]){if(typeof Module["preInit"]=="function")Module["preInit"]=[Module["preInit"]];while(Module["preInit"].length>0){Module["preInit"].pop()()}}var shouldRunNow=false;if(Module["noInitialRun"])shouldRunNow=false;run();
+
+
+ return Godot.ready
+}
+);
+})();
+if (typeof exports === 'object' && typeof module === 'object')
+ module.exports = Godot;
+else if (typeof define === 'function' && define['amd'])
+ define([], function() { return Godot; });
+else if (typeof exports === 'object')
+ exports["Godot"] = Godot;
+
+const Preloader = /** @constructor */ function () { // eslint-disable-line no-unused-vars
+ function getTrackedResponse(response, load_status) {
+ function onloadprogress(reader, controller) {
+ return reader.read().then(function (result) {
+ if (load_status.done) {
+ return Promise.resolve();
+ }
+ if (result.value) {
+ controller.enqueue(result.value);
+ load_status.loaded += result.value.length;
+ }
+ if (!result.done) {
+ return onloadprogress(reader, controller);
+ }
+ load_status.done = true;
+ return Promise.resolve();
+ });
+ }
+ const reader = response.body.getReader();
+ return new Response(new ReadableStream({
+ start: function (controller) {
+ onloadprogress(reader, controller).then(function () {
+ controller.close();
+ });
+ },
+ }), { headers: response.headers });
+ }
+
+ function loadFetch(file, tracker, fileSize, raw) {
+ tracker[file] = {
+ total: fileSize || 0,
+ loaded: 0,
+ done: false,
+ };
+ return fetch(file).then(function (response) {
+ if (!response.ok) {
+ return Promise.reject(new Error(`Failed loading file '${file}'`));
+ }
+ const tr = getTrackedResponse(response, tracker[file]);
+ if (raw) {
+ return Promise.resolve(tr);
+ }
+ return tr.arrayBuffer();
+ });
+ }
+
+ function retry(func, attempts = 1) {
+ function onerror(err) {
+ if (attempts <= 1) {
+ return Promise.reject(err);
+ }
+ return new Promise(function (resolve, reject) {
+ setTimeout(function () {
+ retry(func, attempts - 1).then(resolve).catch(reject);
+ }, 1000);
+ });
+ }
+ return func().catch(onerror);
+ }
+
+ const DOWNLOAD_ATTEMPTS_MAX = 4;
+ const loadingFiles = {};
+ const lastProgress = { loaded: 0, total: 0 };
+ let progressFunc = null;
+
+ const animateProgress = function () {
+ let loaded = 0;
+ let total = 0;
+ let totalIsValid = true;
+ let progressIsFinal = true;
+
+ Object.keys(loadingFiles).forEach(function (file) {
+ const stat = loadingFiles[file];
+ if (!stat.done) {
+ progressIsFinal = false;
+ }
+ if (!totalIsValid || stat.total === 0) {
+ totalIsValid = false;
+ total = 0;
+ } else {
+ total += stat.total;
+ }
+ loaded += stat.loaded;
+ });
+ if (loaded !== lastProgress.loaded || total !== lastProgress.total) {
+ lastProgress.loaded = loaded;
+ lastProgress.total = total;
+ if (typeof progressFunc === 'function') {
+ progressFunc(loaded, total);
+ }
+ }
+ if (!progressIsFinal) {
+ requestAnimationFrame(animateProgress);
+ }
+ };
+
+ this.animateProgress = animateProgress;
+
+ this.setProgressFunc = function (callback) {
+ progressFunc = callback;
+ };
+
+ this.loadPromise = function (file, fileSize, raw = false) {
+ return retry(loadFetch.bind(null, file, loadingFiles, fileSize, raw), DOWNLOAD_ATTEMPTS_MAX);
+ };
+
+ this.preloadedFiles = [];
+ this.preload = function (pathOrBuffer, destPath, fileSize) {
+ let buffer = null;
+ if (typeof pathOrBuffer === 'string') {
+ const me = this;
+ return this.loadPromise(pathOrBuffer, fileSize).then(function (buf) {
+ me.preloadedFiles.push({
+ path: destPath || pathOrBuffer,
+ buffer: buf,
+ });
+ return Promise.resolve();
+ });
+ } else if (pathOrBuffer instanceof ArrayBuffer) {
+ buffer = new Uint8Array(pathOrBuffer);
+ } else if (ArrayBuffer.isView(pathOrBuffer)) {
+ buffer = new Uint8Array(pathOrBuffer.buffer);
+ }
+ if (buffer) {
+ this.preloadedFiles.push({
+ path: destPath,
+ buffer: pathOrBuffer,
+ });
+ return Promise.resolve();
+ }
+ return Promise.reject(new Error('Invalid object for preloading'));
+ };
+};
+
+/**
+ * An object used to configure the Engine instance based on godot export options, and to override those in custom HTML
+ * templates if needed.
+ *
+ * @header Engine configuration
+ * @summary The Engine configuration object. This is just a typedef, create it like a regular object, e.g.:
+ *
+ * ``const MyConfig = { executable: 'godot', unloadAfterInit: false }``
+ *
+ * @typedef {Object} EngineConfig
+ */
+const EngineConfig = {}; // eslint-disable-line no-unused-vars
+
+/**
+ * @struct
+ * @constructor
+ * @ignore
+ */
+const InternalConfig = function (initConfig) { // eslint-disable-line no-unused-vars
+ const cfg = /** @lends {InternalConfig.prototype} */ {
+ /**
+ * Whether the unload the engine automatically after the instance is initialized.
+ *
+ * @memberof EngineConfig
+ * @default
+ * @type {boolean}
+ */
+ unloadAfterInit: true,
+ /**
+ * The HTML DOM Canvas object to use.
+ *
+ * By default, the first canvas element in the document will be used is none is specified.
+ *
+ * @memberof EngineConfig
+ * @default
+ * @type {?HTMLCanvasElement}
+ */
+ canvas: null,
+ /**
+ * The name of the WASM file without the extension. (Set by Godot Editor export process).
+ *
+ * @memberof EngineConfig
+ * @default
+ * @type {string}
+ */
+ executable: '',
+ /**
+ * An alternative name for the game pck to load. The executable name is used otherwise.
+ *
+ * @memberof EngineConfig
+ * @default
+ * @type {?string}
+ */
+ mainPack: null,
+ /**
+ * Specify a language code to select the proper localization for the game.
+ *
+ * The browser locale will be used if none is specified. See complete list of
+ * :ref:`supported locales `.
+ *
+ * @memberof EngineConfig
+ * @type {?string}
+ * @default
+ */
+ locale: null,
+ /**
+ * The canvas resize policy determines how the canvas should be resized by Godot.
+ *
+ * ``0`` means Godot won't do any resizing. This is useful if you want to control the canvas size from
+ * javascript code in your template.
+ *
+ * ``1`` means Godot will resize the canvas on start, and when changing window size via engine functions.
+ *
+ * ``2`` means Godot will adapt the canvas size to match the whole browser window.
+ *
+ * @memberof EngineConfig
+ * @type {number}
+ * @default
+ */
+ canvasResizePolicy: 2,
+ /**
+ * The arguments to be passed as command line arguments on startup.
+ *
+ * See :ref:`command line tutorial `.
+ *
+ * **Note**: :js:meth:`startGame ` will always add the ``--main-pack`` argument.
+ *
+ * @memberof EngineConfig
+ * @type {Array}
+ * @default
+ */
+ args: [],
+ /**
+ * When enabled, the game canvas will automatically grab the focus when the engine starts.
+ *
+ * @memberof EngineConfig
+ * @type {boolean}
+ * @default
+ */
+ focusCanvas: true,
+ /**
+ * When enabled, this will turn on experimental virtual keyboard support on mobile.
+ *
+ * @memberof EngineConfig
+ * @type {boolean}
+ * @default
+ */
+ experimentalVK: false,
+ /**
+ * The progressive web app service worker to install.
+ * @memberof EngineConfig
+ * @default
+ * @type {string}
+ */
+ serviceWorker: '',
+ /**
+ * @ignore
+ * @type {Array.}
+ */
+ persistentPaths: ['/userfs'],
+ /**
+ * @ignore
+ * @type {boolean}
+ */
+ persistentDrops: false,
+ /**
+ * @ignore
+ * @type {Array.}
+ */
+ gdnativeLibs: [],
+ /**
+ * @ignore
+ * @type {Array.}
+ */
+ fileSizes: [],
+ /**
+ * A callback function for handling Godot's ``OS.execute`` calls.
+ *
+ * This is for example used in the Web Editor template to switch between project manager and editor, and for running the game.
+ *
+ * @callback EngineConfig.onExecute
+ * @param {string} path The path that Godot's wants executed.
+ * @param {Array.} args The arguments of the "command" to execute.
+ */
+ /**
+ * @ignore
+ * @type {?function(string, Array.)}
+ */
+ onExecute: null,
+ /**
+ * A callback function for being notified when the Godot instance quits.
+ *
+ * **Note**: This function will not be called if the engine crashes or become unresponsive.
+ *
+ * @callback EngineConfig.onExit
+ * @param {number} status_code The status code returned by Godot on exit.
+ */
+ /**
+ * @ignore
+ * @type {?function(number)}
+ */
+ onExit: null,
+ /**
+ * A callback function for displaying download progress.
+ *
+ * The function is called once per frame while downloading files, so the usage of ``requestAnimationFrame()``
+ * is not necessary.
+ *
+ * If the callback function receives a total amount of bytes as 0, this means that it is impossible to calculate.
+ * Possible reasons include:
+ *
+ * - Files are delivered with server-side chunked compression
+ * - Files are delivered with server-side compression on Chromium
+ * - Not all file downloads have started yet (usually on servers without multi-threading)
+ *
+ * @callback EngineConfig.onProgress
+ * @param {number} current The current amount of downloaded bytes so far.
+ * @param {number} total The total amount of bytes to be downloaded.
+ */
+ /**
+ * @ignore
+ * @type {?function(number, number)}
+ */
+ onProgress: null,
+ /**
+ * A callback function for handling the standard output stream. This method should usually only be used in debug pages.
+ *
+ * By default, ``console.log()`` is used.
+ *
+ * @callback EngineConfig.onPrint
+ * @param {...*} [var_args] A variadic number of arguments to be printed.
+ */
+ /**
+ * @ignore
+ * @type {?function(...*)}
+ */
+ onPrint: function () {
+ console.log.apply(console, Array.from(arguments)); // eslint-disable-line no-console
+ },
+ /**
+ * A callback function for handling the standard error stream. This method should usually only be used in debug pages.
+ *
+ * By default, ``console.error()`` is used.
+ *
+ * @callback EngineConfig.onPrintError
+ * @param {...*} [var_args] A variadic number of arguments to be printed as errors.
+ */
+ /**
+ * @ignore
+ * @type {?function(...*)}
+ */
+ onPrintError: function (var_args) {
+ console.error.apply(console, Array.from(arguments)); // eslint-disable-line no-console
+ },
+ };
+
+ /**
+ * @ignore
+ * @struct
+ * @constructor
+ * @param {EngineConfig} opts
+ */
+ function Config(opts) {
+ this.update(opts);
+ }
+
+ Config.prototype = cfg;
+
+ /**
+ * @ignore
+ * @param {EngineConfig} opts
+ */
+ Config.prototype.update = function (opts) {
+ const config = opts || {};
+ // NOTE: We must explicitly pass the default, accessing it via
+ // the key will fail due to closure compiler renames.
+ function parse(key, def) {
+ if (typeof (config[key]) === 'undefined') {
+ return def;
+ }
+ return config[key];
+ }
+ // Module config
+ this.unloadAfterInit = parse('unloadAfterInit', this.unloadAfterInit);
+ this.onPrintError = parse('onPrintError', this.onPrintError);
+ this.onPrint = parse('onPrint', this.onPrint);
+ this.onProgress = parse('onProgress', this.onProgress);
+
+ // Godot config
+ this.canvas = parse('canvas', this.canvas);
+ this.executable = parse('executable', this.executable);
+ this.mainPack = parse('mainPack', this.mainPack);
+ this.locale = parse('locale', this.locale);
+ this.canvasResizePolicy = parse('canvasResizePolicy', this.canvasResizePolicy);
+ this.persistentPaths = parse('persistentPaths', this.persistentPaths);
+ this.persistentDrops = parse('persistentDrops', this.persistentDrops);
+ this.experimentalVK = parse('experimentalVK', this.experimentalVK);
+ this.focusCanvas = parse('focusCanvas', this.focusCanvas);
+ this.serviceWorker = parse('serviceWorker', this.serviceWorker);
+ this.gdnativeLibs = parse('gdnativeLibs', this.gdnativeLibs);
+ this.fileSizes = parse('fileSizes', this.fileSizes);
+ this.args = parse('args', this.args);
+ this.onExecute = parse('onExecute', this.onExecute);
+ this.onExit = parse('onExit', this.onExit);
+ };
+
+ /**
+ * @ignore
+ * @param {string} loadPath
+ * @param {Response} response
+ */
+ Config.prototype.getModuleConfig = function (loadPath, response) {
+ let r = response;
+ return {
+ 'print': this.onPrint,
+ 'printErr': this.onPrintError,
+ 'thisProgram': this.executable,
+ 'noExitRuntime': true,
+ 'dynamicLibraries': [`${loadPath}.side.wasm`],
+ 'instantiateWasm': function (imports, onSuccess) {
+ function done(result) {
+ onSuccess(result['instance'], result['module']);
+ }
+ if (typeof (WebAssembly.instantiateStreaming) !== 'undefined') {
+ WebAssembly.instantiateStreaming(Promise.resolve(r), imports).then(done);
+ } else {
+ r.arrayBuffer().then(function (buffer) {
+ WebAssembly.instantiate(buffer, imports).then(done);
+ });
+ }
+ r = null;
+ return {};
+ },
+ 'locateFile': function (path) {
+ if (path.endsWith('.worker.js')) {
+ return `${loadPath}.worker.js`;
+ } else if (path.endsWith('.audio.worklet.js')) {
+ return `${loadPath}.audio.worklet.js`;
+ } else if (path.endsWith('.js')) {
+ return `${loadPath}.js`;
+ } else if (path.endsWith('.side.wasm')) {
+ return `${loadPath}.side.wasm`;
+ } else if (path.endsWith('.wasm')) {
+ return `${loadPath}.wasm`;
+ }
+ return path;
+ },
+ };
+ };
+
+ /**
+ * @ignore
+ * @param {function()} cleanup
+ */
+ Config.prototype.getGodotConfig = function (cleanup) {
+ // Try to find a canvas
+ if (!(this.canvas instanceof HTMLCanvasElement)) {
+ const nodes = document.getElementsByTagName('canvas');
+ if (nodes.length && nodes[0] instanceof HTMLCanvasElement) {
+ this.canvas = nodes[0];
+ }
+ if (!this.canvas) {
+ throw new Error('No canvas found in page');
+ }
+ }
+ // Canvas can grab focus on click, or key events won't work.
+ if (this.canvas.tabIndex < 0) {
+ this.canvas.tabIndex = 0;
+ }
+
+ // Browser locale, or custom one if defined.
+ let locale = this.locale;
+ if (!locale) {
+ locale = navigator.languages ? navigator.languages[0] : navigator.language;
+ locale = locale.split('.')[0];
+ }
+ locale = locale.replace('-', '_');
+ const onExit = this.onExit;
+
+ // Godot configuration.
+ return {
+ 'canvas': this.canvas,
+ 'canvasResizePolicy': this.canvasResizePolicy,
+ 'locale': locale,
+ 'persistentDrops': this.persistentDrops,
+ 'virtualKeyboard': this.experimentalVK,
+ 'focusCanvas': this.focusCanvas,
+ 'onExecute': this.onExecute,
+ 'onExit': function (p_code) {
+ cleanup(); // We always need to call the cleanup callback to free memory.
+ if (typeof (onExit) === 'function') {
+ onExit(p_code);
+ }
+ },
+ };
+ };
+ return new Config(initConfig);
+};
+
+/**
+ * Projects exported for the Web expose the :js:class:`Engine` class to the JavaScript environment, that allows
+ * fine control over the engine's start-up process.
+ *
+ * This API is built in an asynchronous manner and requires basic understanding
+ * of `Promises `__.
+ *
+ * @module Engine
+ * @header HTML5 shell class reference
+ */
+const Engine = (function () {
+ const preloader = new Preloader();
+
+ let loadPromise = null;
+ let loadPath = '';
+ let initPromise = null;
+
+ /**
+ * @classdesc The ``Engine`` class provides methods for loading and starting exported projects on the Web. For default export
+ * settings, this is already part of the exported HTML page. To understand practical use of the ``Engine`` class,
+ * see :ref:`Custom HTML page for Web export `.
+ *
+ * @description Create a new Engine instance with the given configuration.
+ *
+ * @global
+ * @constructor
+ * @param {EngineConfig} initConfig The initial config for this instance.
+ */
+ function Engine(initConfig) { // eslint-disable-line no-shadow
+ this.config = new InternalConfig(initConfig);
+ this.rtenv = null;
+ }
+
+ /**
+ * Load the engine from the specified base path.
+ *
+ * @param {string} basePath Base path of the engine to load.
+ * @param {number=} [size=0] The file size if known.
+ * @returns {Promise} A Promise that resolves once the engine is loaded.
+ *
+ * @function Engine.load
+ */
+ Engine.load = function (basePath, size) {
+ if (loadPromise == null) {
+ loadPath = basePath;
+ loadPromise = preloader.loadPromise(`${loadPath}.wasm`, size, true);
+ requestAnimationFrame(preloader.animateProgress);
+ }
+ return loadPromise;
+ };
+
+ /**
+ * Unload the engine to free memory.
+ *
+ * This method will be called automatically depending on the configuration. See :js:attr:`unloadAfterInit`.
+ *
+ * @function Engine.unload
+ */
+ Engine.unload = function () {
+ loadPromise = null;
+ };
+
+ /**
+ * Check whether WebGL is available. Optionally, specify a particular version of WebGL to check for.
+ *
+ * @param {number=} [majorVersion=1] The major WebGL version to check for.
+ * @returns {boolean} If the given major version of WebGL is available.
+ * @function Engine.isWebGLAvailable
+ */
+ Engine.isWebGLAvailable = function (majorVersion = 1) {
+ try {
+ return !!document.createElement('canvas').getContext(['webgl', 'webgl2'][majorVersion - 1]);
+ } catch (e) { /* Not available */ }
+ return false;
+ };
+
+ /**
+ * Safe Engine constructor, creates a new prototype for every new instance to avoid prototype pollution.
+ * @ignore
+ * @constructor
+ */
+ function SafeEngine(initConfig) {
+ const proto = /** @lends Engine.prototype */ {
+ /**
+ * Initialize the engine instance. Optionally, pass the base path to the engine to load it,
+ * if it hasn't been loaded yet. See :js:meth:`Engine.load`.
+ *
+ * @param {string=} basePath Base path of the engine to load.
+ * @return {Promise} A ``Promise`` that resolves once the engine is loaded and initialized.
+ */
+ init: function (basePath) {
+ if (initPromise) {
+ return initPromise;
+ }
+ if (loadPromise == null) {
+ if (!basePath) {
+ initPromise = Promise.reject(new Error('A base path must be provided when calling `init` and the engine is not loaded.'));
+ return initPromise;
+ }
+ Engine.load(basePath, this.config.fileSizes[`${basePath}.wasm`]);
+ }
+ const me = this;
+ function doInit(promise) {
+ // Care! Promise chaining is bogus with old emscripten versions.
+ // This caused a regression with the Mono build (which uses an older emscripten version).
+ // Make sure to test that when refactoring.
+ return new Promise(function (resolve, reject) {
+ promise.then(function (response) {
+ const cloned = new Response(response.clone().body, { 'headers': [['content-type', 'application/wasm']] });
+ Godot(me.config.getModuleConfig(loadPath, cloned)).then(function (module) {
+ const paths = me.config.persistentPaths;
+ module['initFS'](paths).then(function (err) {
+ me.rtenv = module;
+ if (me.config.unloadAfterInit) {
+ Engine.unload();
+ }
+ resolve();
+ });
+ });
+ });
+ });
+ }
+ preloader.setProgressFunc(this.config.onProgress);
+ initPromise = doInit(loadPromise);
+ return initPromise;
+ },
+
+ /**
+ * Load a file so it is available in the instance's file system once it runs. Must be called **before** starting the
+ * instance.
+ *
+ * If not provided, the ``path`` is derived from the URL of the loaded file.
+ *
+ * @param {string|ArrayBuffer} file The file to preload.
+ *
+ * If a ``string`` the file will be loaded from that path.
+ *
+ * If an ``ArrayBuffer`` or a view on one, the buffer will used as the content of the file.
+ *
+ * @param {string=} path Path by which the file will be accessible. Required, if ``file`` is not a string.
+ *
+ * @returns {Promise} A Promise that resolves once the file is loaded.
+ */
+ preloadFile: function (file, path) {
+ return preloader.preload(file, path, this.config.fileSizes[file]);
+ },
+
+ /**
+ * Start the engine instance using the given override configuration (if any).
+ * :js:meth:`startGame ` can be used in typical cases instead.
+ *
+ * This will initialize the instance if it is not initialized. For manual initialization, see :js:meth:`init `.
+ * The engine must be loaded beforehand.
+ *
+ * Fails if a canvas cannot be found on the page, or not specified in the configuration.
+ *
+ * @param {EngineConfig} override An optional configuration override.
+ * @return {Promise} Promise that resolves once the engine started.
+ */
+ start: function (override) {
+ this.config.update(override);
+ const me = this;
+ return me.init().then(function () {
+ if (!me.rtenv) {
+ return Promise.reject(new Error('The engine must be initialized before it can be started'));
+ }
+
+ let config = {};
+ try {
+ config = me.config.getGodotConfig(function () {
+ me.rtenv = null;
+ });
+ } catch (e) {
+ return Promise.reject(e);
+ }
+ // Godot configuration.
+ me.rtenv['initConfig'](config);
+
+ // Preload GDNative libraries.
+ const libs = [];
+ me.config.gdnativeLibs.forEach(function (lib) {
+ libs.push(me.rtenv['loadDynamicLibrary'](lib, { 'loadAsync': true }));
+ });
+ return Promise.all(libs).then(function () {
+ return new Promise(function (resolve, reject) {
+ preloader.preloadedFiles.forEach(function (file) {
+ me.rtenv['copyToFS'](file.path, file.buffer);
+ });
+ preloader.preloadedFiles.length = 0; // Clear memory
+ me.rtenv['callMain'](me.config.args);
+ initPromise = null;
+ if (me.config.serviceWorker && 'serviceWorker' in navigator) {
+ navigator.serviceWorker.register(me.config.serviceWorker);
+ }
+ resolve();
+ });
+ });
+ });
+ },
+
+ /**
+ * Start the game instance using the given configuration override (if any).
+ *
+ * This will initialize the instance if it is not initialized. For manual initialization, see :js:meth:`init `.
+ *
+ * This will load the engine if it is not loaded, and preload the main pck.
+ *
+ * This method expects the initial config (or the override) to have both the :js:attr:`executable` and :js:attr:`mainPack`
+ * properties set (normally done by the editor during export).
+ *
+ * @param {EngineConfig} override An optional configuration override.
+ * @return {Promise} Promise that resolves once the game started.
+ */
+ startGame: function (override) {
+ this.config.update(override);
+ // Add main-pack argument.
+ const exe = this.config.executable;
+ const pack = this.config.mainPack || `${exe}.pck`;
+ this.config.args = ['--main-pack', pack].concat(this.config.args);
+ // Start and init with execName as loadPath if not inited.
+ const me = this;
+ return Promise.all([
+ this.init(exe),
+ this.preloadFile(pack, pack),
+ ]).then(function () {
+ return me.start.apply(me);
+ });
+ },
+
+ /**
+ * Create a file at the specified ``path`` with the passed as ``buffer`` in the instance's file system.
+ *
+ * @param {string} path The location where the file will be created.
+ * @param {ArrayBuffer} buffer The content of the file.
+ */
+ copyToFS: function (path, buffer) {
+ if (this.rtenv == null) {
+ throw new Error('Engine must be inited before copying files');
+ }
+ this.rtenv['copyToFS'](path, buffer);
+ },
+
+ /**
+ * Request that the current instance quit.
+ *
+ * This is akin the user pressing the close button in the window manager, and will
+ * have no effect if the engine has crashed, or is stuck in a loop.
+ *
+ */
+ requestQuit: function () {
+ if (this.rtenv) {
+ this.rtenv['request_quit']();
+ }
+ },
+ };
+
+ Engine.prototype = proto;
+ // Closure compiler exported instance methods.
+ Engine.prototype['init'] = Engine.prototype.init;
+ Engine.prototype['preloadFile'] = Engine.prototype.preloadFile;
+ Engine.prototype['start'] = Engine.prototype.start;
+ Engine.prototype['startGame'] = Engine.prototype.startGame;
+ Engine.prototype['copyToFS'] = Engine.prototype.copyToFS;
+ Engine.prototype['requestQuit'] = Engine.prototype.requestQuit;
+ // Also expose static methods as instance methods
+ Engine.prototype['load'] = Engine.load;
+ Engine.prototype['unload'] = Engine.unload;
+ Engine.prototype['isWebGLAvailable'] = Engine.isWebGLAvailable;
+ return new Engine(initConfig);
+ }
+
+ // Closure compiler exported static methods.
+ SafeEngine['load'] = Engine.load;
+ SafeEngine['unload'] = Engine.unload;
+ SafeEngine['isWebGLAvailable'] = Engine.isWebGLAvailable;
+
+ return SafeEngine;
+}());
+if (typeof window !== 'undefined') {
+ window['Engine'] = Engine;
+}
diff --git a/index.manifest.json b/index.manifest.json
new file mode 100644
index 000000000000..35e5a39f2f0d
--- /dev/null
+++ b/index.manifest.json
@@ -0,0 +1 @@
+{"background_color":"#000000","display":"standalone","icons":[{"sizes":"144x144","src":"index.144x144.png","type":"image/png"},{"sizes":"180x180","src":"index.180x180.png","type":"image/png"},{"sizes":"512x512","src":"index.512x512.png","type":"image/png"}],"name":"Pixelorama","orientation":"any","start_url":"./index.html"}
\ No newline at end of file
diff --git a/index.offline.html b/index.offline.html
new file mode 100644
index 000000000000..41ab42b04ba2
--- /dev/null
+++ b/index.offline.html
@@ -0,0 +1,42 @@
+
+
+
+
+
+
+ You are offline
+
+
+
+ You are offline
+ This application requires an Internet connection to run for the first time.
+ Press the button below to try reloading:
+
+
+
+
+
diff --git a/index.pck b/index.pck
new file mode 100644
index 000000000000..effdb8973cea
Binary files /dev/null and b/index.pck differ
diff --git a/index.png b/index.png
new file mode 100644
index 000000000000..daf1410f4b7b
Binary files /dev/null and b/index.png differ
diff --git a/index.service.worker.js b/index.service.worker.js
new file mode 100644
index 000000000000..8eb986c1cfd8
--- /dev/null
+++ b/index.service.worker.js
@@ -0,0 +1,106 @@
+// This service worker is required to expose an exported Godot project as a
+// Progressive Web App. It provides an offline fallback page telling the user
+// that they need an Internet connection to run the project if desired.
+// Incrementing CACHE_VERSION will kick off the install event and force
+// previously cached resources to be updated from the network.
+const CACHE_VERSION = "1713361558|3403684";
+const CACHE_PREFIX = "Pixelorama-sw-cache-";
+const CACHE_NAME = CACHE_PREFIX + CACHE_VERSION;
+const OFFLINE_URL = "index.offline.html";
+// Files that will be cached on load.
+const CACHED_FILES = ["index.html","index.js","index.offline.html","index.icon.png","index.apple-touch-icon.png"];
+// Files that we might not want the user to preload, and will only be cached on first load.
+const CACHABLE_FILES = ["index.wasm","index.pck"];
+const FULL_CACHE = CACHED_FILES.concat(CACHABLE_FILES);
+
+self.addEventListener("install", (event) => {
+ event.waitUntil(caches.open(CACHE_NAME).then(cache => cache.addAll(CACHED_FILES)));
+});
+
+self.addEventListener("activate", (event) => {
+ event.waitUntil(caches.keys().then(
+ function (keys) {
+ // Remove old caches.
+ return Promise.all(keys.filter(key => key.startsWith(CACHE_PREFIX) && key != CACHE_NAME).map(key => caches.delete(key)));
+ }).then(function() {
+ // Enable navigation preload if available.
+ return ("navigationPreload" in self.registration) ? self.registration.navigationPreload.enable() : Promise.resolve();
+ })
+ );
+});
+
+async function fetchAndCache(event, cache, isCachable) {
+ // Use the preloaded response, if it's there
+ let response = await event.preloadResponse;
+ if (!response) {
+ // Or, go over network.
+ response = await self.fetch(event.request);
+ }
+ if (isCachable) {
+ // And update the cache
+ cache.put(event.request, response.clone());
+ }
+ return response;
+}
+
+self.addEventListener("fetch", (event) => {
+ const isNavigate = event.request.mode === "navigate";
+ const url = event.request.url || "";
+ const referrer = event.request.referrer || "";
+ const base = referrer.slice(0, referrer.lastIndexOf("/") + 1);
+ const local = url.startsWith(base) ? url.replace(base, "") : "";
+ const isCachable = FULL_CACHE.some(v => v === local) || (base === referrer && base.endsWith(CACHED_FILES[0]));
+ if (isNavigate || isCachable) {
+ event.respondWith(async function () {
+ // Try to use cache first
+ const cache = await caches.open(CACHE_NAME);
+ if (event.request.mode === "navigate") {
+ // Check if we have full cache during HTML page request.
+ const fullCache = await Promise.all(FULL_CACHE.map(name => cache.match(name)));
+ const missing = fullCache.some(v => v === undefined);
+ if (missing) {
+ try {
+ // Try network if some cached file is missing (so we can display offline page in case).
+ return await fetchAndCache(event, cache, isCachable);
+ } catch (e) {
+ // And return the hopefully always cached offline page in case of network failure.
+ console.error("Network error: ", e);
+ return await caches.match(OFFLINE_URL);
+ }
+ }
+ }
+ const cached = await cache.match(event.request);
+ if (cached) {
+ return cached;
+ } else {
+ // Try network if don't have it in cache.
+ return await fetchAndCache(event, cache, isCachable);
+ }
+ }());
+ }
+});
+
+self.addEventListener("message", (event) => {
+ // No cross origin
+ if (event.origin != self.origin) {
+ return;
+ }
+ const id = event.source.id || "";
+ const msg = event.data || "";
+ // Ensure it's one of our clients.
+ self.clients.get(id).then(function (client) {
+ if (!client) {
+ return; // Not a valid client.
+ }
+ if (msg === "claim") {
+ self.skipWaiting().then(() => self.clients.claim());
+ } else if (msg === "clear") {
+ caches.delete(CACHE_NAME);
+ } else if (msg === "update") {
+ self.skipWaiting().then(() => self.clients.claim()).then(() => self.clients.matchAll()).then(all => all.forEach(c => c.navigate(c.url)));
+ } else {
+ onClientMessage(event);
+ }
+ });
+});
+
diff --git a/index.wasm b/index.wasm
new file mode 100644
index 000000000000..af0c84d084ca
Binary files /dev/null and b/index.wasm differ