diff --git a/packages/@aws-cdk-testing/cli-integ/resources/cdk-apps/app/app.js b/packages/@aws-cdk-testing/cli-integ/resources/cdk-apps/app/app.js index 0f88ddf3bd467..54eb8842eeee8 100755 --- a/packages/@aws-cdk-testing/cli-integ/resources/cdk-apps/app/app.js +++ b/packages/@aws-cdk-testing/cli-integ/resources/cdk-apps/app/app.js @@ -776,6 +776,15 @@ class AppSyncHotswapStack extends cdk.Stack { } } +class MetadataStack extends cdk.Stack { + constructor(parent, id, props) { + super(parent, id, props); + const handle = new cdk.CfnWaitConditionHandle(this, 'WaitConditionHandle'); + handle.addMetadata('Key', process.env.INTEG_METADATA_VALUE ?? 'default') + + } +} + const app = new cdk.App({ context: { '@aws-cdk/core:assetHashSalt': process.env.CODEBUILD_BUILD_ID, // Force all assets to be unique, but consistent in one build @@ -877,6 +886,8 @@ switch (stackSet) { new ExportValueStack(app, `${stackPrefix}-export-value-stack`); new BundlingStage(app, `${stackPrefix}-bundling-stage`); + + new MetadataStack(app, `${stackPrefix}-metadata`); break; case 'stage-using-context': diff --git a/packages/@aws-cdk-testing/cli-integ/tests/cli-integ-tests/cli.integtest.ts b/packages/@aws-cdk-testing/cli-integ/tests/cli-integ-tests/cli.integtest.ts index de888c9062f22..82f18672cfac2 100644 --- a/packages/@aws-cdk-testing/cli-integ/tests/cli-integ-tests/cli.integtest.ts +++ b/packages/@aws-cdk-testing/cli-integ/tests/cli-integ-tests/cli.integtest.ts @@ -1064,6 +1064,46 @@ integTest( }), ); +integTest( + 'cdk diff doesnt show resource metadata changes', + withDefaultFixture(async (fixture) => { + + // GIVEN - small initial stack with default resource metadata + await fixture.cdkDeploy('metadata'); + + // WHEN - changing resource metadata value + const diff = await fixture.cdk(['diff', fixture.fullStackName('metadata')], { + verbose: true, + modEnv: { + INTEG_METADATA_VALUE: 'custom', + }, + }); + + // Assert there are no changes + expect(diff).toContain('There were no differences'); + }), +); + +integTest( + 'cdk diff shows resource metadata changes with --no-change-set', + withDefaultFixture(async (fixture) => { + + // GIVEN - small initial stack with default resource metadata + await fixture.cdkDeploy('metadata'); + + // WHEN - changing resource metadata value + const diff = await fixture.cdk(['diff --no-change-set', fixture.fullStackName('metadata')], { + verbose: true, + modEnv: { + INTEG_METADATA_VALUE: 'custom', + }, + }); + + // Assert there are changes + expect(diff).not.toContain('There were no differences'); + }), +); + integTest('cdk diff with large changeset and custom toolkit stack name and qualifier does not fail', withoutBootstrap(async (fixture) => { // Bootstrapping with custom toolkit stack name and qualifier const qualifier = 'abc1111'; diff --git a/packages/@aws-cdk-testing/framework-integ/test/aws-opensearchservice/test/integ.opensearch.min.js.snapshot/cdk-integ-opensearch-min.assets.json b/packages/@aws-cdk-testing/framework-integ/test/aws-opensearchservice/test/integ.opensearch.min.js.snapshot/cdk-integ-opensearch-min.assets.json index 1cec4f1cb8e0b..1a46aff65cd8a 100644 --- a/packages/@aws-cdk-testing/framework-integ/test/aws-opensearchservice/test/integ.opensearch.min.js.snapshot/cdk-integ-opensearch-min.assets.json +++ b/packages/@aws-cdk-testing/framework-integ/test/aws-opensearchservice/test/integ.opensearch.min.js.snapshot/cdk-integ-opensearch-min.assets.json @@ -1,7 +1,7 @@ { - "version": "36.0.5", + "version": "38.0.1", "files": { - "1255c7b5b61b498b41414039e46e2ac24d67f3f62d55fc817ef805f24fb4cccd": { + "347efe751381e33cbd7eb536719de834e98b857f37d84f81a62011031d13966c": { "source": { "path": "cdk-integ-opensearch-min.template.json", "packaging": "file" @@ -9,7 +9,7 @@ "destinations": { "current_account-current_region": { "bucketName": "cdk-hnb659fds-assets-${AWS::AccountId}-${AWS::Region}", - "objectKey": "1255c7b5b61b498b41414039e46e2ac24d67f3f62d55fc817ef805f24fb4cccd.json", + "objectKey": "347efe751381e33cbd7eb536719de834e98b857f37d84f81a62011031d13966c.json", "assumeRoleArn": "arn:${AWS::Partition}:iam::${AWS::AccountId}:role/cdk-hnb659fds-file-publishing-role-${AWS::AccountId}-${AWS::Region}" } } diff --git a/packages/@aws-cdk-testing/framework-integ/test/aws-opensearchservice/test/integ.opensearch.min.js.snapshot/cdk-integ-opensearch-min.template.json b/packages/@aws-cdk-testing/framework-integ/test/aws-opensearchservice/test/integ.opensearch.min.js.snapshot/cdk-integ-opensearch-min.template.json index d432e084b1001..b250d80512a0e 100644 --- a/packages/@aws-cdk-testing/framework-integ/test/aws-opensearchservice/test/integ.opensearch.min.js.snapshot/cdk-integ-opensearch-min.template.json +++ b/packages/@aws-cdk-testing/framework-integ/test/aws-opensearchservice/test/integ.opensearch.min.js.snapshot/cdk-integ-opensearch-min.template.json @@ -61,6 +61,37 @@ }, "UpdateReplacePolicy": "Delete", "DeletionPolicy": "Delete" + }, + "OpenSearch2174B754FE5": { + "Type": "AWS::OpenSearchService::Domain", + "Properties": { + "ClusterConfig": { + "DedicatedMasterEnabled": false, + "InstanceCount": 1, + "InstanceType": "r5.large.search", + "MultiAZWithStandbyEnabled": false, + "ZoneAwarenessEnabled": false + }, + "DomainEndpointOptions": { + "EnforceHTTPS": false, + "TLSSecurityPolicy": "Policy-Min-TLS-1-0-2019-07" + }, + "EBSOptions": { + "EBSEnabled": true, + "VolumeSize": 10, + "VolumeType": "gp2" + }, + "EncryptionAtRestOptions": { + "Enabled": false + }, + "EngineVersion": "OpenSearch_2.17", + "LogPublishingOptions": {}, + "NodeToNodeEncryptionOptions": { + "Enabled": false + } + }, + "UpdateReplacePolicy": "Delete", + "DeletionPolicy": "Delete" } }, "Parameters": { diff --git a/packages/@aws-cdk-testing/framework-integ/test/aws-opensearchservice/test/integ.opensearch.min.js.snapshot/cdk.out b/packages/@aws-cdk-testing/framework-integ/test/aws-opensearchservice/test/integ.opensearch.min.js.snapshot/cdk.out index bd5311dc372de..c6e612584e352 100644 --- a/packages/@aws-cdk-testing/framework-integ/test/aws-opensearchservice/test/integ.opensearch.min.js.snapshot/cdk.out +++ b/packages/@aws-cdk-testing/framework-integ/test/aws-opensearchservice/test/integ.opensearch.min.js.snapshot/cdk.out @@ -1 +1 @@ -{"version":"36.0.5"} \ No newline at end of file +{"version":"38.0.1"} \ No newline at end of file diff --git a/packages/@aws-cdk-testing/framework-integ/test/aws-opensearchservice/test/integ.opensearch.min.js.snapshot/integ.json b/packages/@aws-cdk-testing/framework-integ/test/aws-opensearchservice/test/integ.opensearch.min.js.snapshot/integ.json index dd0a795a8eeac..f73c9099f27f9 100644 --- a/packages/@aws-cdk-testing/framework-integ/test/aws-opensearchservice/test/integ.opensearch.min.js.snapshot/integ.json +++ b/packages/@aws-cdk-testing/framework-integ/test/aws-opensearchservice/test/integ.opensearch.min.js.snapshot/integ.json @@ -1,5 +1,5 @@ { - "version": "36.0.5", + "version": "38.0.1", "testCases": { "integ-openseach-min/DefaultTest": { "stacks": [ diff --git a/packages/@aws-cdk-testing/framework-integ/test/aws-opensearchservice/test/integ.opensearch.min.js.snapshot/integopenseachminDefaultTestDeployAssert0EB58658.assets.json b/packages/@aws-cdk-testing/framework-integ/test/aws-opensearchservice/test/integ.opensearch.min.js.snapshot/integopenseachminDefaultTestDeployAssert0EB58658.assets.json index 400ae1dfbb9cc..06ec1d9e8848d 100644 --- a/packages/@aws-cdk-testing/framework-integ/test/aws-opensearchservice/test/integ.opensearch.min.js.snapshot/integopenseachminDefaultTestDeployAssert0EB58658.assets.json +++ b/packages/@aws-cdk-testing/framework-integ/test/aws-opensearchservice/test/integ.opensearch.min.js.snapshot/integopenseachminDefaultTestDeployAssert0EB58658.assets.json @@ -1,5 +1,5 @@ { - "version": "36.0.5", + "version": "38.0.1", "files": { "21fbb51d7b23f6a6c262b46a9caee79d744a3ac019fd45422d988b96d44b2a22": { "source": { diff --git a/packages/@aws-cdk-testing/framework-integ/test/aws-opensearchservice/test/integ.opensearch.min.js.snapshot/manifest.json b/packages/@aws-cdk-testing/framework-integ/test/aws-opensearchservice/test/integ.opensearch.min.js.snapshot/manifest.json index afd7651b2df69..5296543aa28c7 100644 --- a/packages/@aws-cdk-testing/framework-integ/test/aws-opensearchservice/test/integ.opensearch.min.js.snapshot/manifest.json +++ b/packages/@aws-cdk-testing/framework-integ/test/aws-opensearchservice/test/integ.opensearch.min.js.snapshot/manifest.json @@ -1,5 +1,5 @@ { - "version": "36.0.5", + "version": "38.0.1", "artifacts": { "cdk-integ-opensearch-min.assets": { "type": "cdk:asset-manifest", @@ -16,9 +16,10 @@ "templateFile": "cdk-integ-opensearch-min.template.json", "terminationProtection": false, "validateOnSynth": false, + "notificationArns": [], "assumeRoleArn": "arn:${AWS::Partition}:iam::${AWS::AccountId}:role/cdk-hnb659fds-deploy-role-${AWS::AccountId}-${AWS::Region}", "cloudFormationExecutionRoleArn": "arn:${AWS::Partition}:iam::${AWS::AccountId}:role/cdk-hnb659fds-cfn-exec-role-${AWS::AccountId}-${AWS::Region}", - "stackTemplateAssetObjectUrl": "s3://cdk-hnb659fds-assets-${AWS::AccountId}-${AWS::Region}/1255c7b5b61b498b41414039e46e2ac24d67f3f62d55fc817ef805f24fb4cccd.json", + "stackTemplateAssetObjectUrl": "s3://cdk-hnb659fds-assets-${AWS::AccountId}-${AWS::Region}/347efe751381e33cbd7eb536719de834e98b857f37d84f81a62011031d13966c.json", "requiresBootstrapStackVersion": 6, "bootstrapStackVersionSsmParameter": "/cdk-bootstrap/hnb659fds/version", "additionalDependencies": [ @@ -46,6 +47,12 @@ "data": "OpenSearch21566632C3A" } ], + "/cdk-integ-opensearch-min/OpenSearch_2.17/Resource": [ + { + "type": "aws:cdk:logicalId", + "data": "OpenSearch2174B754FE5" + } + ], "/cdk-integ-opensearch-min/BootstrapVersion": [ { "type": "aws:cdk:logicalId", @@ -76,6 +83,7 @@ "templateFile": "integopenseachminDefaultTestDeployAssert0EB58658.template.json", "terminationProtection": false, "validateOnSynth": false, + "notificationArns": [], "assumeRoleArn": "arn:${AWS::Partition}:iam::${AWS::AccountId}:role/cdk-hnb659fds-deploy-role-${AWS::AccountId}-${AWS::Region}", "cloudFormationExecutionRoleArn": "arn:${AWS::Partition}:iam::${AWS::AccountId}:role/cdk-hnb659fds-cfn-exec-role-${AWS::AccountId}-${AWS::Region}", "stackTemplateAssetObjectUrl": "s3://cdk-hnb659fds-assets-${AWS::AccountId}-${AWS::Region}/21fbb51d7b23f6a6c262b46a9caee79d744a3ac019fd45422d988b96d44b2a22.json", diff --git a/packages/@aws-cdk-testing/framework-integ/test/aws-opensearchservice/test/integ.opensearch.min.js.snapshot/tree.json b/packages/@aws-cdk-testing/framework-integ/test/aws-opensearchservice/test/integ.opensearch.min.js.snapshot/tree.json index 7e6411c8151b4..e1a8dac723875 100644 --- a/packages/@aws-cdk-testing/framework-integ/test/aws-opensearchservice/test/integ.opensearch.min.js.snapshot/tree.json +++ b/packages/@aws-cdk-testing/framework-integ/test/aws-opensearchservice/test/integ.opensearch.min.js.snapshot/tree.json @@ -102,6 +102,53 @@ "version": "0.0.0" } }, + "OpenSearch_2.17": { + "id": "OpenSearch_2.17", + "path": "cdk-integ-opensearch-min/OpenSearch_2.17", + "children": { + "Resource": { + "id": "Resource", + "path": "cdk-integ-opensearch-min/OpenSearch_2.17/Resource", + "attributes": { + "aws:cdk:cloudformation:type": "AWS::OpenSearchService::Domain", + "aws:cdk:cloudformation:props": { + "clusterConfig": { + "dedicatedMasterEnabled": false, + "instanceCount": 1, + "instanceType": "r5.large.search", + "multiAzWithStandbyEnabled": false, + "zoneAwarenessEnabled": false + }, + "domainEndpointOptions": { + "enforceHttps": false, + "tlsSecurityPolicy": "Policy-Min-TLS-1-0-2019-07" + }, + "ebsOptions": { + "ebsEnabled": true, + "volumeSize": 10, + "volumeType": "gp2" + }, + "encryptionAtRestOptions": { + "enabled": false + }, + "engineVersion": "OpenSearch_2.17", + "logPublishingOptions": {}, + "nodeToNodeEncryptionOptions": { + "enabled": false + } + } + }, + "constructInfo": { + "fqn": "aws-cdk-lib.aws_opensearchservice.CfnDomain", + "version": "0.0.0" + } + } + }, + "constructInfo": { + "fqn": "aws-cdk-lib.aws_opensearchservice.Domain", + "version": "0.0.0" + } + }, "BootstrapVersion": { "id": "BootstrapVersion", "path": "cdk-integ-opensearch-min/BootstrapVersion", @@ -137,7 +184,7 @@ "path": "integ-openseach-min/DefaultTest/Default", "constructInfo": { "fqn": "constructs.Construct", - "version": "10.3.0" + "version": "10.4.2" } }, "DeployAssert": { @@ -183,7 +230,7 @@ "path": "Tree", "constructInfo": { "fqn": "constructs.Construct", - "version": "10.3.0" + "version": "10.4.2" } } }, diff --git a/packages/@aws-cdk-testing/framework-integ/test/aws-opensearchservice/test/integ.opensearch.min.ts b/packages/@aws-cdk-testing/framework-integ/test/aws-opensearchservice/test/integ.opensearch.min.ts index 79813d35d5d75..a59fbba674a60 100644 --- a/packages/@aws-cdk-testing/framework-integ/test/aws-opensearchservice/test/integ.opensearch.min.ts +++ b/packages/@aws-cdk-testing/framework-integ/test/aws-opensearchservice/test/integ.opensearch.min.ts @@ -10,6 +10,7 @@ class TestStack extends Stack { const versions = [ opensearch.EngineVersion.OPENSEARCH_2_13, opensearch.EngineVersion.OPENSEARCH_2_15, + opensearch.EngineVersion.OPENSEARCH_2_17, ]; // deploy opensearch domain with minimal configuration diff --git a/packages/@aws-cdk/aws-scheduler-targets-alpha/README.md b/packages/@aws-cdk/aws-scheduler-targets-alpha/README.md index f6f28b8b7853b..43b0581471849 100644 --- a/packages/@aws-cdk/aws-scheduler-targets-alpha/README.md +++ b/packages/@aws-cdk/aws-scheduler-targets-alpha/README.md @@ -257,8 +257,8 @@ The code snippet below creates an event rule with a delivery stream as a target called every hour by EventBridge Scheduler with a custom payload. ```ts -import * as firehose from 'aws-cdk-lib/aws-kinesisfirehose'; -declare const deliveryStream: firehose.CfnDeliveryStream; +import * as firehose from '@aws-cdk/aws-kinesisfirehose-alpha'; +declare const deliveryStream: firehose.IDeliveryStream; const payload = { Data: "record", diff --git a/packages/@aws-cdk/aws-scheduler-targets-alpha/lib/kinesis-data-firehose-put-record.ts b/packages/@aws-cdk/aws-scheduler-targets-alpha/lib/kinesis-data-firehose-put-record.ts index 83586c5e7126c..f4d48b4f9bcad 100644 --- a/packages/@aws-cdk/aws-scheduler-targets-alpha/lib/kinesis-data-firehose-put-record.ts +++ b/packages/@aws-cdk/aws-scheduler-targets-alpha/lib/kinesis-data-firehose-put-record.ts @@ -1,6 +1,6 @@ +import { IDeliveryStream } from '@aws-cdk/aws-kinesisfirehose-alpha'; import { IScheduleTarget } from '@aws-cdk/aws-scheduler-alpha'; import { IRole, PolicyStatement } from 'aws-cdk-lib/aws-iam'; -import { CfnDeliveryStream } from 'aws-cdk-lib/aws-kinesisfirehose'; import { ScheduleTargetBase, ScheduleTargetBaseProps } from './target'; /** @@ -8,17 +8,17 @@ import { ScheduleTargetBase, ScheduleTargetBaseProps } from './target'; */ export class KinesisDataFirehosePutRecord extends ScheduleTargetBase implements IScheduleTarget { constructor( - private readonly deliveryStream: CfnDeliveryStream, + private readonly deliveryStream: IDeliveryStream, props: ScheduleTargetBaseProps = {}, ) { - super(props, deliveryStream.attrArn); + super(props, deliveryStream.deliveryStreamArn); } protected addTargetActionToRole(role: IRole): void { role.addToPrincipalPolicy(new PolicyStatement({ actions: ['firehose:PutRecord'], - resources: [this.deliveryStream.attrArn], + resources: [this.deliveryStream.deliveryStreamArn], })); } } diff --git a/packages/@aws-cdk/aws-scheduler-targets-alpha/package.json b/packages/@aws-cdk/aws-scheduler-targets-alpha/package.json index 9a0f7dc965f60..c7842a6fa637b 100644 --- a/packages/@aws-cdk/aws-scheduler-targets-alpha/package.json +++ b/packages/@aws-cdk/aws-scheduler-targets-alpha/package.json @@ -82,19 +82,23 @@ }, "license": "Apache-2.0", "devDependencies": { + "@aws-cdk/aws-kinesisfirehose-destinations-alpha": "0.0.0", + "@aws-cdk/aws-kinesisfirehose-alpha": "0.0.0", + "@aws-cdk/aws-scheduler-alpha": "0.0.0", "@aws-cdk/cdk-build-tools": "0.0.0", "@aws-cdk/integ-runner": "0.0.0", + "@aws-cdk/integ-tests-alpha": "0.0.0", "@aws-cdk/pkglint": "0.0.0", "@types/jest": "^29.5.14", "aws-cdk-lib": "0.0.0", - "@aws-cdk/aws-scheduler-alpha": "0.0.0", - "constructs": "^10.0.0", - "@aws-cdk/integ-tests-alpha": "0.0.0" + "constructs": "^10.0.0" }, "dependencies": {}, "peerDependencies": { - "aws-cdk-lib": "^0.0.0", + "@aws-cdk/aws-kinesisfirehose-destinations-alpha": "0.0.0", + "@aws-cdk/aws-kinesisfirehose-alpha": "0.0.0", "@aws-cdk/aws-scheduler-alpha": "0.0.0", + "aws-cdk-lib": "^0.0.0", "constructs": "^10.0.0" }, "engines": { diff --git a/packages/@aws-cdk/aws-scheduler-targets-alpha/test/integ.kinesis-data-firehose-put-record.js.snapshot/asset.d1a40db4788714a346364a87b7de0ff15b732e7367f085acf14f4a680c57c418.bundle/index.js b/packages/@aws-cdk/aws-scheduler-targets-alpha/test/integ.kinesis-data-firehose-put-record.js.snapshot/asset.b98abee59e034ed29eeb601684dc34752baa86509a7d457d72305d4e19ecc80b.bundle/index.js similarity index 87% rename from packages/@aws-cdk/aws-scheduler-targets-alpha/test/integ.kinesis-data-firehose-put-record.js.snapshot/asset.d1a40db4788714a346364a87b7de0ff15b732e7367f085acf14f4a680c57c418.bundle/index.js rename to packages/@aws-cdk/aws-scheduler-targets-alpha/test/integ.kinesis-data-firehose-put-record.js.snapshot/asset.b98abee59e034ed29eeb601684dc34752baa86509a7d457d72305d4e19ecc80b.bundle/index.js index bcc09cb30ad90..b585fd2bb4a19 100644 --- a/packages/@aws-cdk/aws-scheduler-targets-alpha/test/integ.kinesis-data-firehose-put-record.js.snapshot/asset.d1a40db4788714a346364a87b7de0ff15b732e7367f085acf14f4a680c57c418.bundle/index.js +++ b/packages/@aws-cdk/aws-scheduler-targets-alpha/test/integ.kinesis-data-firehose-put-record.js.snapshot/asset.b98abee59e034ed29eeb601684dc34752baa86509a7d457d72305d4e19ecc80b.bundle/index.js @@ -786,7 +786,8 @@ var require_helpers_internal = __commonJS({ "../../aws-cdk-lib/assertions/lib/helpers-internal/index.js"(exports2) { "use strict"; var __createBinding2 = exports2 && exports2.__createBinding || (Object.create ? function(o, m, k, k2) { - if (k2 === void 0) k2 = k; + if (k2 === void 0) + k2 = k; var desc = Object.getOwnPropertyDescriptor(m, k); if (!desc || ("get" in desc ? !m.__esModule : desc.writable || desc.configurable)) { desc = { enumerable: true, get: function() { @@ -795,15 +796,23 @@ var require_helpers_internal = __commonJS({ } Object.defineProperty(o, k2, desc); } : function(o, m, k, k2) { - if (k2 === void 0) k2 = k; + if (k2 === void 0) + k2 = k; o[k2] = m[k]; }); var __exportStar2 = exports2 && exports2.__exportStar || function(m, exports3) { - for (var p in m) if (p !== "default" && !Object.prototype.hasOwnProperty.call(exports3, p)) __createBinding2(exports3, m, p); + for (var p in m) + if (p !== "default" && !Object.prototype.hasOwnProperty.call(exports3, p)) + __createBinding2(exports3, m, p); }; Object.defineProperty(exports2, "__esModule", { value: true }); - __exportStar2((init_match(), __toCommonJS(match_exports)), exports2); - __exportStar2((init_matcher(), __toCommonJS(matcher_exports)), exports2); + var _noFold; + exports2.Match = void 0; + Object.defineProperty(exports2, _noFold = "Match", { enumerable: true, configurable: true, get: () => (init_match(), __toCommonJS(match_exports)).Match }); + exports2.Matcher = void 0; + Object.defineProperty(exports2, _noFold = "Matcher", { enumerable: true, configurable: true, get: () => (init_matcher(), __toCommonJS(matcher_exports)).Matcher }); + exports2.MatchResult = void 0; + Object.defineProperty(exports2, _noFold = "MatchResult", { enumerable: true, configurable: true, get: () => (init_matcher(), __toCommonJS(matcher_exports)).MatchResult }); } }); @@ -2598,41 +2607,12 @@ var require_dist_cjs11 = __commonJS({ } }); -// ../../../node_modules/@smithy/core/node_modules/@smithy/util-middleware/dist-cjs/index.js -var require_dist_cjs12 = __commonJS({ - "../../../node_modules/@smithy/core/node_modules/@smithy/util-middleware/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); - } - return to; - }; - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - getSmithyContext: () => getSmithyContext4, - normalizeProvider: () => normalizeProvider2 - }); - module2.exports = __toCommonJS2(src_exports); - var import_types5 = require_dist_cjs(); - var getSmithyContext4 = /* @__PURE__ */ __name((context) => context[import_types5.SMITHY_CONTEXT_KEY] || (context[import_types5.SMITHY_CONTEXT_KEY] = {}), "getSmithyContext"); - var normalizeProvider2 = /* @__PURE__ */ __name((input) => { - if (typeof input === "function") - return input; - const promisified = Promise.resolve(input); - return () => promisified; - }, "normalizeProvider"); +// ../../../node_modules/@smithy/core/dist-es/getSmithyContext.js +var import_types, getSmithyContext; +var init_getSmithyContext = __esm({ + "../../../node_modules/@smithy/core/dist-es/getSmithyContext.js"() { + import_types = __toESM(require_dist_cjs()); + getSmithyContext = (context) => context[import_types.SMITHY_CONTEXT_KEY] || (context[import_types.SMITHY_CONTEXT_KEY] = {}); } }); @@ -2644,11 +2624,11 @@ function convertHttpAuthSchemesToMap(httpAuthSchemes) { } return map; } -var import_types, import_util_middleware, httpAuthSchemeMiddleware; +var import_types2, import_util_middleware, httpAuthSchemeMiddleware; var init_httpAuthSchemeMiddleware = __esm({ "../../../node_modules/@smithy/core/dist-es/middleware-http-auth-scheme/httpAuthSchemeMiddleware.js"() { - import_types = __toESM(require_dist_cjs()); - import_util_middleware = __toESM(require_dist_cjs12()); + import_types2 = __toESM(require_dist_cjs()); + import_util_middleware = __toESM(require_dist_cjs10()); httpAuthSchemeMiddleware = (config, mwOptions) => (next, context) => async (args) => { const options = config.httpAuthSchemeProvider(await mwOptions.httpAuthSchemeParametersProvider(config, context, args.input)); const authSchemes = convertHttpAuthSchemesToMap(config.httpAuthSchemes); @@ -2683,9 +2663,33 @@ var init_httpAuthSchemeMiddleware = __esm({ } }); -// ../../../node_modules/@smithy/core/node_modules/@smithy/property-provider/dist-cjs/index.js -var require_dist_cjs13 = __commonJS({ - "../../../node_modules/@smithy/core/node_modules/@smithy/property-provider/dist-cjs/index.js"(exports2, module2) { +// ../../../node_modules/@smithy/core/dist-es/middleware-http-auth-scheme/getHttpAuthSchemeEndpointRuleSetPlugin.js +var httpAuthSchemeEndpointRuleSetMiddlewareOptions, getHttpAuthSchemeEndpointRuleSetPlugin; +var init_getHttpAuthSchemeEndpointRuleSetPlugin = __esm({ + "../../../node_modules/@smithy/core/dist-es/middleware-http-auth-scheme/getHttpAuthSchemeEndpointRuleSetPlugin.js"() { + init_httpAuthSchemeMiddleware(); + httpAuthSchemeEndpointRuleSetMiddlewareOptions = { + step: "serialize", + tags: ["HTTP_AUTH_SCHEME"], + name: "httpAuthSchemeMiddleware", + override: true, + relation: "before", + toMiddleware: "endpointV2Middleware" + }; + getHttpAuthSchemeEndpointRuleSetPlugin = (config, { httpAuthSchemeParametersProvider, identityProviderConfigProvider }) => ({ + applyToStack: (clientStack) => { + clientStack.addRelativeTo(httpAuthSchemeMiddleware(config, { + httpAuthSchemeParametersProvider, + identityProviderConfigProvider + }), httpAuthSchemeEndpointRuleSetMiddlewareOptions); + } + }); + } +}); + +// ../../../node_modules/@smithy/middleware-serde/dist-cjs/index.js +var require_dist_cjs12 = __commonJS({ + "../../../node_modules/@smithy/middleware-serde/dist-cjs/index.js"(exports2, module2) { var __defProp2 = Object.defineProperty; var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; var __getOwnPropNames2 = Object.getOwnPropertyNames; @@ -2706,222 +2710,259 @@ var require_dist_cjs13 = __commonJS({ var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); var src_exports = {}; __export2(src_exports, { - CredentialsProviderError: () => CredentialsProviderError, - ProviderError: () => ProviderError2, - TokenProviderError: () => TokenProviderError, - chain: () => chain, - fromStatic: () => fromStatic, - memoize: () => memoize + deserializerMiddleware: () => deserializerMiddleware, + deserializerMiddlewareOption: () => deserializerMiddlewareOption, + getSerdePlugin: () => getSerdePlugin, + serializerMiddleware: () => serializerMiddleware, + serializerMiddlewareOption: () => serializerMiddlewareOption2 }); module2.exports = __toCommonJS2(src_exports); - var _ProviderError = class _ProviderError2 extends Error { - constructor(message, options = true) { - var _a; - let logger; - let tryNextLink = true; - if (typeof options === "boolean") { - logger = void 0; - tryNextLink = options; - } else if (options != null && typeof options === "object") { - logger = options.logger; - tryNextLink = options.tryNextLink ?? true; + var deserializerMiddleware = /* @__PURE__ */ __name((options, deserializer) => (next) => async (args) => { + const { response } = await next(args); + try { + const parsed = await deserializer(response, options); + return { + response, + output: parsed + }; + } catch (error) { + Object.defineProperty(error, "$response", { + value: response + }); + if (!("$metadata" in error)) { + const hint = `Deserialization error: to see the raw response, inspect the hidden field {error}.$response on this object.`; + error.message += "\n " + hint; + if (typeof error.$responseBodyText !== "undefined") { + if (error.$response) { + error.$response.body = error.$responseBodyText; + } + } } - super(message); - this.name = "ProviderError"; - this.tryNextLink = tryNextLink; - Object.setPrototypeOf(this, _ProviderError2.prototype); - (_a = logger == null ? void 0 : logger.debug) == null ? void 0 : _a.call(logger, `@smithy/property-provider ${tryNextLink ? "->" : "(!)"} ${message}`); - } - /** - * @deprecated use new operator. - */ - static from(error, options = true) { - return Object.assign(new this(error.message, options), error); + throw error; } - }; - __name(_ProviderError, "ProviderError"); - var ProviderError2 = _ProviderError; - var _CredentialsProviderError = class _CredentialsProviderError2 extends ProviderError2 { - /** - * @override - */ - constructor(message, options = true) { - super(message, options); - this.name = "CredentialsProviderError"; - Object.setPrototypeOf(this, _CredentialsProviderError2.prototype); + }, "deserializerMiddleware"); + var serializerMiddleware = /* @__PURE__ */ __name((options, serializer) => (next, context) => async (args) => { + var _a; + const endpoint = ((_a = context.endpointV2) == null ? void 0 : _a.url) && options.urlParser ? async () => options.urlParser(context.endpointV2.url) : options.endpoint; + if (!endpoint) { + throw new Error("No valid endpoint provider available."); } + const request2 = await serializer(args.input, { ...options, endpoint }); + return next({ + ...args, + request: request2 + }); + }, "serializerMiddleware"); + var deserializerMiddlewareOption = { + name: "deserializerMiddleware", + step: "deserialize", + tags: ["DESERIALIZER"], + override: true }; - __name(_CredentialsProviderError, "CredentialsProviderError"); - var CredentialsProviderError = _CredentialsProviderError; - var _TokenProviderError = class _TokenProviderError2 extends ProviderError2 { - /** - * @override - */ - constructor(message, options = true) { - super(message, options); - this.name = "TokenProviderError"; - Object.setPrototypeOf(this, _TokenProviderError2.prototype); - } + var serializerMiddlewareOption2 = { + name: "serializerMiddleware", + step: "serialize", + tags: ["SERIALIZER"], + override: true }; - __name(_TokenProviderError, "TokenProviderError"); - var TokenProviderError = _TokenProviderError; - var chain = /* @__PURE__ */ __name((...providers) => async () => { - if (providers.length === 0) { - throw new ProviderError2("No providers in chain"); - } - let lastProviderError; - for (const provider of providers) { - try { - const credentials = await provider(); - return credentials; - } catch (err) { - lastProviderError = err; - if (err == null ? void 0 : err.tryNextLink) { - continue; - } - throw err; - } - } - throw lastProviderError; - }, "chain"); - var fromStatic = /* @__PURE__ */ __name((staticValue) => () => Promise.resolve(staticValue), "fromStatic"); - var memoize = /* @__PURE__ */ __name((provider, isExpired, requiresRefresh) => { - let resolved; - let pending; - let hasResult; - let isConstant = false; - const coalesceProvider = /* @__PURE__ */ __name(async () => { - if (!pending) { - pending = provider(); - } - try { - resolved = await pending; - hasResult = true; - isConstant = false; - } finally { - pending = void 0; - } - return resolved; - }, "coalesceProvider"); - if (isExpired === void 0) { - return async (options) => { - if (!hasResult || (options == null ? void 0 : options.forceRefresh)) { - resolved = await coalesceProvider(); - } - return resolved; - }; - } - return async (options) => { - if (!hasResult || (options == null ? void 0 : options.forceRefresh)) { - resolved = await coalesceProvider(); - } - if (isConstant) { - return resolved; - } - if (requiresRefresh && !requiresRefresh(resolved)) { - isConstant = true; - return resolved; - } - if (isExpired(resolved)) { - await coalesceProvider(); - return resolved; + function getSerdePlugin(config, serializer, deserializer) { + return { + applyToStack: (commandStack) => { + commandStack.add(deserializerMiddleware(config, deserializer), deserializerMiddlewareOption); + commandStack.add(serializerMiddleware(config, serializer), serializerMiddlewareOption2); } - return resolved; }; - }, "memoize"); + } + __name(getSerdePlugin, "getSerdePlugin"); } }); -// ../../../node_modules/@smithy/core/node_modules/@smithy/shared-ini-file-loader/dist-cjs/getHomeDir.js -var require_getHomeDir = __commonJS({ - "../../../node_modules/@smithy/core/node_modules/@smithy/shared-ini-file-loader/dist-cjs/getHomeDir.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.getHomeDir = void 0; - var os_1 = require("os"); - var path_1 = require("path"); - var homeDirCache = {}; - var getHomeDirCacheKey = () => { - if (process && process.geteuid) { - return `${process.geteuid()}`; - } - return "DEFAULT"; - }; - var getHomeDir2 = () => { - const { HOME, USERPROFILE, HOMEPATH, HOMEDRIVE = `C:${path_1.sep}` } = process.env; - if (HOME) - return HOME; - if (USERPROFILE) - return USERPROFILE; - if (HOMEPATH) - return `${HOMEDRIVE}${HOMEPATH}`; - const homeDirCacheKey = getHomeDirCacheKey(); - if (!homeDirCache[homeDirCacheKey]) - homeDirCache[homeDirCacheKey] = (0, os_1.homedir)(); - return homeDirCache[homeDirCacheKey]; +// ../../../node_modules/@smithy/core/dist-es/middleware-http-auth-scheme/getHttpAuthSchemePlugin.js +var import_middleware_serde, httpAuthSchemeMiddlewareOptions, getHttpAuthSchemePlugin; +var init_getHttpAuthSchemePlugin = __esm({ + "../../../node_modules/@smithy/core/dist-es/middleware-http-auth-scheme/getHttpAuthSchemePlugin.js"() { + import_middleware_serde = __toESM(require_dist_cjs12()); + init_httpAuthSchemeMiddleware(); + httpAuthSchemeMiddlewareOptions = { + step: "serialize", + tags: ["HTTP_AUTH_SCHEME"], + name: "httpAuthSchemeMiddleware", + override: true, + relation: "before", + toMiddleware: import_middleware_serde.serializerMiddlewareOption.name }; - exports2.getHomeDir = getHomeDir2; + getHttpAuthSchemePlugin = (config, { httpAuthSchemeParametersProvider, identityProviderConfigProvider }) => ({ + applyToStack: (clientStack) => { + clientStack.addRelativeTo(httpAuthSchemeMiddleware(config, { + httpAuthSchemeParametersProvider, + identityProviderConfigProvider + }), httpAuthSchemeMiddlewareOptions); + } + }); } }); -// ../../../node_modules/@smithy/core/node_modules/@smithy/shared-ini-file-loader/dist-cjs/getSSOTokenFilepath.js -var require_getSSOTokenFilepath = __commonJS({ - "../../../node_modules/@smithy/core/node_modules/@smithy/shared-ini-file-loader/dist-cjs/getSSOTokenFilepath.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.getSSOTokenFilepath = void 0; - var crypto_1 = require("crypto"); - var path_1 = require("path"); - var getHomeDir_1 = require_getHomeDir(); - var getSSOTokenFilepath2 = (id) => { - const hasher = (0, crypto_1.createHash)("sha1"); - const cacheName = hasher.update(id).digest("hex"); - return (0, path_1.join)((0, getHomeDir_1.getHomeDir)(), ".aws", "sso", "cache", `${cacheName}.json`); +// ../../../node_modules/@smithy/core/dist-es/middleware-http-auth-scheme/index.js +var init_middleware_http_auth_scheme = __esm({ + "../../../node_modules/@smithy/core/dist-es/middleware-http-auth-scheme/index.js"() { + init_httpAuthSchemeMiddleware(); + init_getHttpAuthSchemeEndpointRuleSetPlugin(); + init_getHttpAuthSchemePlugin(); + } +}); + +// ../../../node_modules/@smithy/core/dist-es/middleware-http-signing/httpSigningMiddleware.js +var import_protocol_http, import_types3, import_util_middleware2, defaultErrorHandler, defaultSuccessHandler, httpSigningMiddleware; +var init_httpSigningMiddleware = __esm({ + "../../../node_modules/@smithy/core/dist-es/middleware-http-signing/httpSigningMiddleware.js"() { + import_protocol_http = __toESM(require_dist_cjs2()); + import_types3 = __toESM(require_dist_cjs()); + import_util_middleware2 = __toESM(require_dist_cjs10()); + defaultErrorHandler = (signingProperties) => (error) => { + throw error; + }; + defaultSuccessHandler = (httpResponse, signingProperties) => { + }; + httpSigningMiddleware = (config) => (next, context) => async (args) => { + if (!import_protocol_http.HttpRequest.isInstance(args.request)) { + return next(args); + } + const smithyContext = (0, import_util_middleware2.getSmithyContext)(context); + const scheme = smithyContext.selectedHttpAuthScheme; + if (!scheme) { + throw new Error(`No HttpAuthScheme was selected: unable to sign request`); + } + const { httpAuthOption: { signingProperties = {} }, identity, signer } = scheme; + const output = await next({ + ...args, + request: await signer.sign(args.request, identity, signingProperties) + }).catch((signer.errorHandler || defaultErrorHandler)(signingProperties)); + (signer.successHandler || defaultSuccessHandler)(output.response, signingProperties); + return output; }; - exports2.getSSOTokenFilepath = getSSOTokenFilepath2; } }); -// ../../../node_modules/@smithy/core/node_modules/@smithy/shared-ini-file-loader/dist-cjs/getSSOTokenFromFile.js -var require_getSSOTokenFromFile = __commonJS({ - "../../../node_modules/@smithy/core/node_modules/@smithy/shared-ini-file-loader/dist-cjs/getSSOTokenFromFile.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.getSSOTokenFromFile = void 0; - var fs_1 = require("fs"); - var getSSOTokenFilepath_1 = require_getSSOTokenFilepath(); - var { readFile } = fs_1.promises; - var getSSOTokenFromFile2 = async (id) => { - const ssoTokenFilepath = (0, getSSOTokenFilepath_1.getSSOTokenFilepath)(id); - const ssoTokenText = await readFile(ssoTokenFilepath, "utf8"); - return JSON.parse(ssoTokenText); +// ../../../node_modules/@smithy/core/dist-es/middleware-http-signing/getHttpSigningMiddleware.js +var httpSigningMiddlewareOptions, getHttpSigningPlugin; +var init_getHttpSigningMiddleware = __esm({ + "../../../node_modules/@smithy/core/dist-es/middleware-http-signing/getHttpSigningMiddleware.js"() { + init_httpSigningMiddleware(); + httpSigningMiddlewareOptions = { + step: "finalizeRequest", + tags: ["HTTP_SIGNING"], + name: "httpSigningMiddleware", + aliases: ["apiKeyMiddleware", "tokenMiddleware", "awsAuthMiddleware"], + override: true, + relation: "after", + toMiddleware: "retryMiddleware" }; - exports2.getSSOTokenFromFile = getSSOTokenFromFile2; + getHttpSigningPlugin = (config) => ({ + applyToStack: (clientStack) => { + clientStack.addRelativeTo(httpSigningMiddleware(config), httpSigningMiddlewareOptions); + } + }); } }); -// ../../../node_modules/@smithy/core/node_modules/@smithy/shared-ini-file-loader/dist-cjs/slurpFile.js -var require_slurpFile = __commonJS({ - "../../../node_modules/@smithy/core/node_modules/@smithy/shared-ini-file-loader/dist-cjs/slurpFile.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.slurpFile = void 0; - var fs_1 = require("fs"); - var { readFile } = fs_1.promises; - var filePromisesHash = {}; - var slurpFile = (path, options) => { - if (!filePromisesHash[path] || (options === null || options === void 0 ? void 0 : options.ignoreCache)) { - filePromisesHash[path] = readFile(path, "utf8"); +// ../../../node_modules/@smithy/core/dist-es/middleware-http-signing/index.js +var init_middleware_http_signing = __esm({ + "../../../node_modules/@smithy/core/dist-es/middleware-http-signing/index.js"() { + init_httpSigningMiddleware(); + init_getHttpSigningMiddleware(); + } +}); + +// ../../../node_modules/@smithy/core/dist-es/normalizeProvider.js +var normalizeProvider; +var init_normalizeProvider = __esm({ + "../../../node_modules/@smithy/core/dist-es/normalizeProvider.js"() { + normalizeProvider = (input) => { + if (typeof input === "function") + return input; + const promisified = Promise.resolve(input); + return () => promisified; + }; + } +}); + +// ../../../node_modules/@smithy/core/dist-es/pagination/createPaginator.js +function createPaginator(ClientCtor, CommandCtor, inputTokenName, outputTokenName, pageSizeTokenName) { + return async function* paginateOperation(config, input, ...additionalArguments) { + let token = config.startingToken || void 0; + let hasNext = true; + let page; + while (hasNext) { + input[inputTokenName] = token; + if (pageSizeTokenName) { + input[pageSizeTokenName] = input[pageSizeTokenName] ?? config.pageSize; } - return filePromisesHash[path]; + if (config.client instanceof ClientCtor) { + page = await makePagedClientRequest(CommandCtor, config.client, input, ...additionalArguments); + } else { + throw new Error(`Invalid client, expected instance of ${ClientCtor.name}`); + } + yield page; + const prevToken = token; + token = get(page, outputTokenName); + hasNext = !!(token && (!config.stopOnSameToken || token !== prevToken)); + } + return void 0; + }; +} +var makePagedClientRequest, get; +var init_createPaginator = __esm({ + "../../../node_modules/@smithy/core/dist-es/pagination/createPaginator.js"() { + makePagedClientRequest = async (CommandCtor, client, input, ...args) => { + return await client.send(new CommandCtor(input), ...args); }; - exports2.slurpFile = slurpFile; + get = (fromObject, path) => { + let cursor = fromObject; + const pathComponents = path.split("."); + for (const step of pathComponents) { + if (!cursor || typeof cursor !== "object") { + return void 0; + } + cursor = cursor[step]; + } + return cursor; + }; + } +}); + +// ../../../node_modules/@smithy/is-array-buffer/dist-cjs/index.js +var require_dist_cjs13 = __commonJS({ + "../../../node_modules/@smithy/is-array-buffer/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + isArrayBuffer: () => isArrayBuffer + }); + module2.exports = __toCommonJS2(src_exports); + var isArrayBuffer = /* @__PURE__ */ __name((arg) => typeof ArrayBuffer === "function" && arg instanceof ArrayBuffer || Object.prototype.toString.call(arg) === "[object ArrayBuffer]", "isArrayBuffer"); } }); -// ../../../node_modules/@smithy/core/node_modules/@smithy/shared-ini-file-loader/dist-cjs/index.js +// ../../../node_modules/@smithy/util-buffer-from/dist-cjs/index.js var require_dist_cjs14 = __commonJS({ - "../../../node_modules/@smithy/core/node_modules/@smithy/shared-ini-file-loader/dist-cjs/index.js"(exports2, module2) { + "../../../node_modules/@smithy/util-buffer-from/dist-cjs/index.js"(exports2, module2) { var __defProp2 = Object.defineProperty; var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; var __getOwnPropNames2 = Object.getOwnPropertyNames; @@ -2939,154 +2980,55 @@ var require_dist_cjs14 = __commonJS({ } return to; }; - var __reExport = (target, mod, secondTarget) => (__copyProps2(target, mod, "default"), secondTarget && __copyProps2(secondTarget, mod, "default")); var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); var src_exports = {}; __export2(src_exports, { - CONFIG_PREFIX_SEPARATOR: () => CONFIG_PREFIX_SEPARATOR, - DEFAULT_PROFILE: () => DEFAULT_PROFILE, - ENV_PROFILE: () => ENV_PROFILE, - getProfileName: () => getProfileName, - loadSharedConfigFiles: () => loadSharedConfigFiles, - loadSsoSessionData: () => loadSsoSessionData, - parseKnownFiles: () => parseKnownFiles + fromArrayBuffer: () => fromArrayBuffer, + fromString: () => fromString }); module2.exports = __toCommonJS2(src_exports); - __reExport(src_exports, require_getHomeDir(), module2.exports); - var ENV_PROFILE = "AWS_PROFILE"; - var DEFAULT_PROFILE = "default"; - var getProfileName = /* @__PURE__ */ __name((init) => init.profile || process.env[ENV_PROFILE] || DEFAULT_PROFILE, "getProfileName"); - __reExport(src_exports, require_getSSOTokenFilepath(), module2.exports); - __reExport(src_exports, require_getSSOTokenFromFile(), module2.exports); - var import_types5 = require_dist_cjs(); - var getConfigData = /* @__PURE__ */ __name((data) => Object.entries(data).filter(([key]) => { - const indexOfSeparator = key.indexOf(CONFIG_PREFIX_SEPARATOR); - if (indexOfSeparator === -1) { - return false; + var import_is_array_buffer = require_dist_cjs13(); + var import_buffer = require("buffer"); + var fromArrayBuffer = /* @__PURE__ */ __name((input, offset = 0, length = input.byteLength - offset) => { + if (!(0, import_is_array_buffer.isArrayBuffer)(input)) { + throw new TypeError(`The "input" argument must be ArrayBuffer. Received type ${typeof input} (${input})`); } - return Object.values(import_types5.IniSectionType).includes(key.substring(0, indexOfSeparator)); - }).reduce( - (acc, [key, value]) => { - const indexOfSeparator = key.indexOf(CONFIG_PREFIX_SEPARATOR); - const updatedKey = key.substring(0, indexOfSeparator) === import_types5.IniSectionType.PROFILE ? key.substring(indexOfSeparator + 1) : key; - acc[updatedKey] = value; - return acc; - }, - { - // Populate default profile, if present. - ...data.default && { default: data.default } + return import_buffer.Buffer.from(input, offset, length); + }, "fromArrayBuffer"); + var fromString = /* @__PURE__ */ __name((input, encoding) => { + if (typeof input !== "string") { + throw new TypeError(`The "input" argument must be of type string. Received type ${typeof input} (${input})`); } - ), "getConfigData"); - var import_path = require("path"); - var import_getHomeDir = require_getHomeDir(); - var ENV_CONFIG_PATH = "AWS_CONFIG_FILE"; - var getConfigFilepath = /* @__PURE__ */ __name(() => process.env[ENV_CONFIG_PATH] || (0, import_path.join)((0, import_getHomeDir.getHomeDir)(), ".aws", "config"), "getConfigFilepath"); - var import_getHomeDir2 = require_getHomeDir(); - var ENV_CREDENTIALS_PATH = "AWS_SHARED_CREDENTIALS_FILE"; - var getCredentialsFilepath = /* @__PURE__ */ __name(() => process.env[ENV_CREDENTIALS_PATH] || (0, import_path.join)((0, import_getHomeDir2.getHomeDir)(), ".aws", "credentials"), "getCredentialsFilepath"); - var import_getHomeDir3 = require_getHomeDir(); - var prefixKeyRegex = /^([\w-]+)\s(["'])?([\w-@\+\.%:/]+)\2$/; - var profileNameBlockList = ["__proto__", "profile __proto__"]; - var parseIni = /* @__PURE__ */ __name((iniData) => { - const map = {}; - let currentSection; - let currentSubSection; - for (const iniLine of iniData.split(/\r?\n/)) { - const trimmedLine = iniLine.split(/(^|\s)[;#]/)[0].trim(); - const isSection = trimmedLine[0] === "[" && trimmedLine[trimmedLine.length - 1] === "]"; - if (isSection) { - currentSection = void 0; - currentSubSection = void 0; - const sectionName = trimmedLine.substring(1, trimmedLine.length - 1); - const matches = prefixKeyRegex.exec(sectionName); - if (matches) { - const [, prefix, , name] = matches; - if (Object.values(import_types5.IniSectionType).includes(prefix)) { - currentSection = [prefix, name].join(CONFIG_PREFIX_SEPARATOR); - } - } else { - currentSection = sectionName; - } - if (profileNameBlockList.includes(sectionName)) { - throw new Error(`Found invalid profile name "${sectionName}"`); - } - } else if (currentSection) { - const indexOfEqualsSign = trimmedLine.indexOf("="); - if (![0, -1].includes(indexOfEqualsSign)) { - const [name, value] = [ - trimmedLine.substring(0, indexOfEqualsSign).trim(), - trimmedLine.substring(indexOfEqualsSign + 1).trim() - ]; - if (value === "") { - currentSubSection = name; - } else { - if (currentSubSection && iniLine.trimStart() === iniLine) { - currentSubSection = void 0; - } - map[currentSection] = map[currentSection] || {}; - const key = currentSubSection ? [currentSubSection, name].join(CONFIG_PREFIX_SEPARATOR) : name; - map[currentSection][key] = value; - } - } - } - } - return map; - }, "parseIni"); - var import_slurpFile = require_slurpFile(); - var swallowError = /* @__PURE__ */ __name(() => ({}), "swallowError"); - var CONFIG_PREFIX_SEPARATOR = "."; - var loadSharedConfigFiles = /* @__PURE__ */ __name(async (init = {}) => { - const { filepath = getCredentialsFilepath(), configFilepath = getConfigFilepath() } = init; - const homeDir = (0, import_getHomeDir3.getHomeDir)(); - const relativeHomeDirPrefix = "~/"; - let resolvedFilepath = filepath; - if (filepath.startsWith(relativeHomeDirPrefix)) { - resolvedFilepath = (0, import_path.join)(homeDir, filepath.slice(2)); - } - let resolvedConfigFilepath = configFilepath; - if (configFilepath.startsWith(relativeHomeDirPrefix)) { - resolvedConfigFilepath = (0, import_path.join)(homeDir, configFilepath.slice(2)); + return encoding ? import_buffer.Buffer.from(input, encoding) : import_buffer.Buffer.from(input); + }, "fromString"); + } +}); + +// ../../../node_modules/@smithy/util-base64/dist-cjs/fromBase64.js +var require_fromBase64 = __commonJS({ + "../../../node_modules/@smithy/util-base64/dist-cjs/fromBase64.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.fromBase64 = void 0; + var util_buffer_from_1 = require_dist_cjs14(); + var BASE64_REGEX = /^[A-Za-z0-9+/]*={0,2}$/; + var fromBase642 = (input) => { + if (input.length * 3 % 4 !== 0) { + throw new TypeError(`Incorrect padding on base64 string.`); } - const parsedFiles = await Promise.all([ - (0, import_slurpFile.slurpFile)(resolvedConfigFilepath, { - ignoreCache: init.ignoreCache - }).then(parseIni).then(getConfigData).catch(swallowError), - (0, import_slurpFile.slurpFile)(resolvedFilepath, { - ignoreCache: init.ignoreCache - }).then(parseIni).catch(swallowError) - ]); - return { - configFile: parsedFiles[0], - credentialsFile: parsedFiles[1] - }; - }, "loadSharedConfigFiles"); - var getSsoSessionData = /* @__PURE__ */ __name((data) => Object.entries(data).filter(([key]) => key.startsWith(import_types5.IniSectionType.SSO_SESSION + CONFIG_PREFIX_SEPARATOR)).reduce((acc, [key, value]) => ({ ...acc, [key.substring(key.indexOf(CONFIG_PREFIX_SEPARATOR) + 1)]: value }), {}), "getSsoSessionData"); - var import_slurpFile2 = require_slurpFile(); - var swallowError2 = /* @__PURE__ */ __name(() => ({}), "swallowError"); - var loadSsoSessionData = /* @__PURE__ */ __name(async (init = {}) => (0, import_slurpFile2.slurpFile)(init.configFilepath ?? getConfigFilepath()).then(parseIni).then(getSsoSessionData).catch(swallowError2), "loadSsoSessionData"); - var mergeConfigFiles = /* @__PURE__ */ __name((...files) => { - const merged = {}; - for (const file of files) { - for (const [key, values] of Object.entries(file)) { - if (merged[key] !== void 0) { - Object.assign(merged[key], values); - } else { - merged[key] = values; - } - } + if (!BASE64_REGEX.exec(input)) { + throw new TypeError(`Invalid base64 string.`); } - return merged; - }, "mergeConfigFiles"); - var parseKnownFiles = /* @__PURE__ */ __name(async (init) => { - const parsedFiles = await loadSharedConfigFiles(init); - return mergeConfigFiles(parsedFiles.configFile, parsedFiles.credentialsFile); - }, "parseKnownFiles"); + const buffer = (0, util_buffer_from_1.fromString)(input, "base64"); + return new Uint8Array(buffer.buffer, buffer.byteOffset, buffer.byteLength); + }; + exports2.fromBase64 = fromBase642; } }); -// ../../../node_modules/@smithy/core/node_modules/@smithy/node-config-provider/dist-cjs/index.js +// ../../../node_modules/@smithy/util-utf8/dist-cjs/index.js var require_dist_cjs15 = __commonJS({ - "../../../node_modules/@smithy/core/node_modules/@smithy/node-config-provider/dist-cjs/index.js"(exports2, module2) { + "../../../node_modules/@smithy/util-utf8/dist-cjs/index.js"(exports2, module2) { var __defProp2 = Object.defineProperty; var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; var __getOwnPropNames2 = Object.getOwnPropertyNames; @@ -3107,135 +3049,68 @@ var require_dist_cjs15 = __commonJS({ var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); var src_exports = {}; __export2(src_exports, { - loadConfig: () => loadConfig + fromUtf8: () => fromUtf8, + toUint8Array: () => toUint8Array, + toUtf8: () => toUtf8 }); module2.exports = __toCommonJS2(src_exports); - var import_property_provider2 = require_dist_cjs13(); - function getSelectorName(functionString) { - try { - const constants = new Set(Array.from(functionString.match(/([A-Z_]){3,}/g) ?? [])); - constants.delete("CONFIG"); - constants.delete("CONFIG_PREFIX_SEPARATOR"); - constants.delete("ENV"); - return [...constants].join(", "); - } catch (e) { - return functionString; + var import_util_buffer_from = require_dist_cjs14(); + var fromUtf8 = /* @__PURE__ */ __name((input) => { + const buf = (0, import_util_buffer_from.fromString)(input, "utf8"); + return new Uint8Array(buf.buffer, buf.byteOffset, buf.byteLength / Uint8Array.BYTES_PER_ELEMENT); + }, "fromUtf8"); + var toUint8Array = /* @__PURE__ */ __name((data) => { + if (typeof data === "string") { + return fromUtf8(data); } - } - __name(getSelectorName, "getSelectorName"); - var fromEnv = /* @__PURE__ */ __name((envVarSelector, logger) => async () => { - try { - const config = envVarSelector(process.env); - if (config === void 0) { - throw new Error(); - } - return config; - } catch (e) { - throw new import_property_provider2.CredentialsProviderError( - e.message || `Not found in ENV: ${getSelectorName(envVarSelector.toString())}`, - { logger } - ); + if (ArrayBuffer.isView(data)) { + return new Uint8Array(data.buffer, data.byteOffset, data.byteLength / Uint8Array.BYTES_PER_ELEMENT); } - }, "fromEnv"); - var import_shared_ini_file_loader = require_dist_cjs14(); - var fromSharedConfigFiles = /* @__PURE__ */ __name((configSelector, { preferredFile = "config", ...init } = {}) => async () => { - const profile = (0, import_shared_ini_file_loader.getProfileName)(init); - const { configFile, credentialsFile } = await (0, import_shared_ini_file_loader.loadSharedConfigFiles)(init); - const profileFromCredentials = credentialsFile[profile] || {}; - const profileFromConfig = configFile[profile] || {}; - const mergedProfile = preferredFile === "config" ? { ...profileFromCredentials, ...profileFromConfig } : { ...profileFromConfig, ...profileFromCredentials }; - try { - const cfgFile = preferredFile === "config" ? configFile : credentialsFile; - const configValue = configSelector(mergedProfile, cfgFile); - if (configValue === void 0) { - throw new Error(); - } - return configValue; - } catch (e) { - throw new import_property_provider2.CredentialsProviderError( - e.message || `Not found in config files w/ profile [${profile}]: ${getSelectorName(configSelector.toString())}`, - { logger: init.logger } - ); + return new Uint8Array(data); + }, "toUint8Array"); + var toUtf8 = /* @__PURE__ */ __name((input) => { + if (typeof input === "string") { + return input; } - }, "fromSharedConfigFiles"); - var isFunction = /* @__PURE__ */ __name((func) => typeof func === "function", "isFunction"); - var fromStatic = /* @__PURE__ */ __name((defaultValue) => isFunction(defaultValue) ? async () => await defaultValue() : (0, import_property_provider2.fromStatic)(defaultValue), "fromStatic"); - var loadConfig = /* @__PURE__ */ __name(({ environmentVariableSelector, configFileSelector, default: defaultValue }, configuration = {}) => (0, import_property_provider2.memoize)( - (0, import_property_provider2.chain)( - fromEnv(environmentVariableSelector), - fromSharedConfigFiles(configFileSelector, configuration), - fromStatic(defaultValue) - ) - ), "loadConfig"); - } -}); - -// ../../../node_modules/@smithy/core/node_modules/@smithy/middleware-endpoint/dist-cjs/adaptors/getEndpointUrlConfig.js -var require_getEndpointUrlConfig = __commonJS({ - "../../../node_modules/@smithy/core/node_modules/@smithy/middleware-endpoint/dist-cjs/adaptors/getEndpointUrlConfig.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.getEndpointUrlConfig = void 0; - var shared_ini_file_loader_1 = require_dist_cjs14(); - var ENV_ENDPOINT_URL = "AWS_ENDPOINT_URL"; - var CONFIG_ENDPOINT_URL = "endpoint_url"; - var getEndpointUrlConfig = (serviceId) => ({ - environmentVariableSelector: (env) => { - const serviceSuffixParts = serviceId.split(" ").map((w) => w.toUpperCase()); - const serviceEndpointUrl = env[[ENV_ENDPOINT_URL, ...serviceSuffixParts].join("_")]; - if (serviceEndpointUrl) - return serviceEndpointUrl; - const endpointUrl = env[ENV_ENDPOINT_URL]; - if (endpointUrl) - return endpointUrl; - return void 0; - }, - configFileSelector: (profile, config) => { - if (config && profile.services) { - const servicesSection = config[["services", profile.services].join(shared_ini_file_loader_1.CONFIG_PREFIX_SEPARATOR)]; - if (servicesSection) { - const servicePrefixParts = serviceId.split(" ").map((w) => w.toLowerCase()); - const endpointUrl2 = servicesSection[[servicePrefixParts.join("_"), CONFIG_ENDPOINT_URL].join(shared_ini_file_loader_1.CONFIG_PREFIX_SEPARATOR)]; - if (endpointUrl2) - return endpointUrl2; - } - } - const endpointUrl = profile[CONFIG_ENDPOINT_URL]; - if (endpointUrl) - return endpointUrl; - return void 0; - }, - default: void 0 - }); - exports2.getEndpointUrlConfig = getEndpointUrlConfig; + if (typeof input !== "object" || typeof input.byteOffset !== "number" || typeof input.byteLength !== "number") { + throw new Error("@smithy/util-utf8: toUtf8 encoder function only accepts string | Uint8Array."); + } + return (0, import_util_buffer_from.fromArrayBuffer)(input.buffer, input.byteOffset, input.byteLength).toString("utf8"); + }, "toUtf8"); } }); -// ../../../node_modules/@smithy/core/node_modules/@smithy/middleware-endpoint/dist-cjs/adaptors/getEndpointFromConfig.js -var require_getEndpointFromConfig = __commonJS({ - "../../../node_modules/@smithy/core/node_modules/@smithy/middleware-endpoint/dist-cjs/adaptors/getEndpointFromConfig.js"(exports2) { +// ../../../node_modules/@smithy/util-base64/dist-cjs/toBase64.js +var require_toBase64 = __commonJS({ + "../../../node_modules/@smithy/util-base64/dist-cjs/toBase64.js"(exports2) { "use strict"; Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.getEndpointFromConfig = void 0; - var node_config_provider_1 = require_dist_cjs15(); - var getEndpointUrlConfig_1 = require_getEndpointUrlConfig(); - var getEndpointFromConfig = async (serviceId) => (0, node_config_provider_1.loadConfig)((0, getEndpointUrlConfig_1.getEndpointUrlConfig)(serviceId !== null && serviceId !== void 0 ? serviceId : ""))(); - exports2.getEndpointFromConfig = getEndpointFromConfig; + exports2.toBase64 = void 0; + var util_buffer_from_1 = require_dist_cjs14(); + var util_utf8_1 = require_dist_cjs15(); + var toBase642 = (_input) => { + let input; + if (typeof _input === "string") { + input = (0, util_utf8_1.fromUtf8)(_input); + } else { + input = _input; + } + if (typeof input !== "object" || typeof input.byteOffset !== "number" || typeof input.byteLength !== "number") { + throw new Error("@smithy/util-base64: toBase64 encoder function only accepts string | Uint8Array."); + } + return (0, util_buffer_from_1.fromArrayBuffer)(input.buffer, input.byteOffset, input.byteLength).toString("base64"); + }; + exports2.toBase64 = toBase642; } }); -// ../../../node_modules/@smithy/core/node_modules/@smithy/querystring-parser/dist-cjs/index.js +// ../../../node_modules/@smithy/util-base64/dist-cjs/index.js var require_dist_cjs16 = __commonJS({ - "../../../node_modules/@smithy/core/node_modules/@smithy/querystring-parser/dist-cjs/index.js"(exports2, module2) { + "../../../node_modules/@smithy/util-base64/dist-cjs/index.js"(exports2, module2) { var __defProp2 = Object.defineProperty; var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; var __getOwnPropNames2 = Object.getOwnPropertyNames; var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; var __copyProps2 = (to, from, except, desc) => { if (from && typeof from === "object" || typeof from === "function") { for (let key of __getOwnPropNames2(from)) @@ -3244,40 +3119,56 @@ var require_dist_cjs16 = __commonJS({ } return to; }; + var __reExport = (target, mod, secondTarget) => (__copyProps2(target, mod, "default"), secondTarget && __copyProps2(secondTarget, mod, "default")); var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); var src_exports = {}; - __export2(src_exports, { - parseQueryString: () => parseQueryString - }); module2.exports = __toCommonJS2(src_exports); - function parseQueryString(querystring) { - const query = {}; - querystring = querystring.replace(/^\?/, ""); - if (querystring) { - for (const pair of querystring.split("&")) { - let [key, value = null] = pair.split("="); - key = decodeURIComponent(key); - if (value) { - value = decodeURIComponent(value); - } - if (!(key in query)) { - query[key] = value; - } else if (Array.isArray(query[key])) { - query[key].push(value); - } else { - query[key] = [query[key], value]; - } + __reExport(src_exports, require_fromBase64(), module2.exports); + __reExport(src_exports, require_toBase64(), module2.exports); + } +}); + +// ../../../node_modules/@smithy/util-stream/dist-cjs/getAwsChunkedEncodingStream.js +var require_getAwsChunkedEncodingStream = __commonJS({ + "../../../node_modules/@smithy/util-stream/dist-cjs/getAwsChunkedEncodingStream.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.getAwsChunkedEncodingStream = void 0; + var stream_1 = require("stream"); + var getAwsChunkedEncodingStream2 = (readableStream, options) => { + const { base64Encoder, bodyLengthChecker, checksumAlgorithmFn, checksumLocationName, streamHasher } = options; + const checksumRequired = base64Encoder !== void 0 && checksumAlgorithmFn !== void 0 && checksumLocationName !== void 0 && streamHasher !== void 0; + const digest = checksumRequired ? streamHasher(checksumAlgorithmFn, readableStream) : void 0; + const awsChunkedEncodingStream = new stream_1.Readable({ read: () => { + } }); + readableStream.on("data", (data) => { + const length = bodyLengthChecker(data) || 0; + awsChunkedEncodingStream.push(`${length.toString(16)}\r +`); + awsChunkedEncodingStream.push(data); + awsChunkedEncodingStream.push("\r\n"); + }); + readableStream.on("end", async () => { + awsChunkedEncodingStream.push(`0\r +`); + if (checksumRequired) { + const checksum = base64Encoder(await digest); + awsChunkedEncodingStream.push(`${checksumLocationName}:${checksum}\r +`); + awsChunkedEncodingStream.push(`\r +`); } - } - return query; - } - __name(parseQueryString, "parseQueryString"); + awsChunkedEncodingStream.push(null); + }); + return awsChunkedEncodingStream; + }; + exports2.getAwsChunkedEncodingStream = getAwsChunkedEncodingStream2; } }); -// ../../../node_modules/@smithy/core/node_modules/@smithy/url-parser/dist-cjs/index.js +// ../../../node_modules/@smithy/util-uri-escape/dist-cjs/index.js var require_dist_cjs17 = __commonJS({ - "../../../node_modules/@smithy/core/node_modules/@smithy/url-parser/dist-cjs/index.js"(exports2, module2) { + "../../../node_modules/@smithy/util-uri-escape/dist-cjs/index.js"(exports2, module2) { var __defProp2 = Object.defineProperty; var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; var __getOwnPropNames2 = Object.getOwnPropertyNames; @@ -3298,33 +3189,22 @@ var require_dist_cjs17 = __commonJS({ var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); var src_exports = {}; __export2(src_exports, { - parseUrl: () => parseUrl + escapeUri: () => escapeUri, + escapeUriPath: () => escapeUriPath }); module2.exports = __toCommonJS2(src_exports); - var import_querystring_parser = require_dist_cjs16(); - var parseUrl = /* @__PURE__ */ __name((url2) => { - if (typeof url2 === "string") { - return parseUrl(new URL(url2)); - } - const { hostname, pathname, port, protocol, search } = url2; - let query; - if (search) { - query = (0, import_querystring_parser.parseQueryString)(search); - } - return { - hostname, - port: port ? parseInt(port) : void 0, - protocol, - path: pathname, - query - }; - }, "parseUrl"); + var escapeUri = /* @__PURE__ */ __name((uri) => ( + // AWS percent-encodes some extra non-standard characters in a URI + encodeURIComponent(uri).replace(/[!'()*]/g, hexEncode) + ), "escapeUri"); + var hexEncode = /* @__PURE__ */ __name((c) => `%${c.charCodeAt(0).toString(16).toUpperCase()}`, "hexEncode"); + var escapeUriPath = /* @__PURE__ */ __name((uri) => uri.split("/").map(escapeUri).join("/"), "escapeUriPath"); } }); -// ../../../node_modules/@smithy/core/node_modules/@smithy/middleware-serde/dist-cjs/index.js +// ../../../node_modules/@smithy/querystring-builder/dist-cjs/index.js var require_dist_cjs18 = __commonJS({ - "../../../node_modules/@smithy/core/node_modules/@smithy/middleware-serde/dist-cjs/index.js"(exports2, module2) { + "../../../node_modules/@smithy/querystring-builder/dist-cjs/index.js"(exports2, module2) { var __defProp2 = Object.defineProperty; var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; var __getOwnPropNames2 = Object.getOwnPropertyNames; @@ -3345,79 +3225,41 @@ var require_dist_cjs18 = __commonJS({ var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); var src_exports = {}; __export2(src_exports, { - deserializerMiddleware: () => deserializerMiddleware, - deserializerMiddlewareOption: () => deserializerMiddlewareOption, - getSerdePlugin: () => getSerdePlugin, - serializerMiddleware: () => serializerMiddleware, - serializerMiddlewareOption: () => serializerMiddlewareOption2 + buildQueryString: () => buildQueryString }); module2.exports = __toCommonJS2(src_exports); - var deserializerMiddleware = /* @__PURE__ */ __name((options, deserializer) => (next) => async (args) => { - const { response } = await next(args); - try { - const parsed = await deserializer(response, options); - return { - response, - output: parsed - }; - } catch (error) { - Object.defineProperty(error, "$response", { - value: response - }); - if (!("$metadata" in error)) { - const hint = `Deserialization error: to see the raw response, inspect the hidden field {error}.$response on this object.`; - error.message += "\n " + hint; - if (typeof error.$responseBodyText !== "undefined") { - if (error.$response) { - error.$response.body = error.$responseBodyText; - } + var import_util_uri_escape = require_dist_cjs17(); + function buildQueryString(query) { + const parts = []; + for (let key of Object.keys(query).sort()) { + const value = query[key]; + key = (0, import_util_uri_escape.escapeUri)(key); + if (Array.isArray(value)) { + for (let i = 0, iLen = value.length; i < iLen; i++) { + parts.push(`${key}=${(0, import_util_uri_escape.escapeUri)(value[i])}`); + } + } else { + let qsEntry = key; + if (value || typeof value === "string") { + qsEntry += `=${(0, import_util_uri_escape.escapeUri)(value)}`; } + parts.push(qsEntry); } - throw error; } - }, "deserializerMiddleware"); - var serializerMiddleware = /* @__PURE__ */ __name((options, serializer) => (next, context) => async (args) => { - var _a; - const endpoint = ((_a = context.endpointV2) == null ? void 0 : _a.url) && options.urlParser ? async () => options.urlParser(context.endpointV2.url) : options.endpoint; - if (!endpoint) { - throw new Error("No valid endpoint provider available."); - } - const request2 = await serializer(args.input, { ...options, endpoint }); - return next({ - ...args, - request: request2 - }); - }, "serializerMiddleware"); - var deserializerMiddlewareOption = { - name: "deserializerMiddleware", - step: "deserialize", - tags: ["DESERIALIZER"], - override: true - }; - var serializerMiddlewareOption2 = { - name: "serializerMiddleware", - step: "serialize", - tags: ["SERIALIZER"], - override: true - }; - function getSerdePlugin(config, serializer, deserializer) { - return { - applyToStack: (commandStack) => { - commandStack.add(deserializerMiddleware(config, deserializer), deserializerMiddlewareOption); - commandStack.add(serializerMiddleware(config, serializer), serializerMiddlewareOption2); - } - }; + return parts.join("&"); } - __name(getSerdePlugin, "getSerdePlugin"); + __name(buildQueryString, "buildQueryString"); } }); -// ../../../node_modules/@smithy/core/node_modules/@smithy/middleware-endpoint/dist-cjs/index.js +// ../../../node_modules/@smithy/node-http-handler/dist-cjs/index.js var require_dist_cjs19 = __commonJS({ - "../../../node_modules/@smithy/core/node_modules/@smithy/middleware-endpoint/dist-cjs/index.js"(exports2, module2) { + "../../../node_modules/@smithy/node-http-handler/dist-cjs/index.js"(exports2, module2) { + var __create2 = Object.create; var __defProp2 = Object.defineProperty; var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __getProtoOf2 = Object.getPrototypeOf; var __hasOwnProp2 = Object.prototype.hasOwnProperty; var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); var __export2 = (target, all) => { @@ -3432,5854 +3274,955 @@ var require_dist_cjs19 = __commonJS({ } return to; }; + var __toESM2 = (mod, isNodeMode, target) => (target = mod != null ? __create2(__getProtoOf2(mod)) : {}, __copyProps2( + // If the importer is in node compatibility mode or this is not an ESM + // file that has been converted to a CommonJS file using a Babel- + // compatible transform (i.e. "__esModule" has not been set), then set + // "default" to the CommonJS "module.exports" for node compatibility. + isNodeMode || !mod || !mod.__esModule ? __defProp2(target, "default", { value: mod, enumerable: true }) : target, + mod + )); var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); var src_exports = {}; __export2(src_exports, { - endpointMiddleware: () => endpointMiddleware, - endpointMiddlewareOptions: () => endpointMiddlewareOptions2, - getEndpointFromInstructions: () => getEndpointFromInstructions, - getEndpointPlugin: () => getEndpointPlugin, - resolveEndpointConfig: () => resolveEndpointConfig, - resolveParams: () => resolveParams, - toEndpointV1: () => toEndpointV1 + DEFAULT_REQUEST_TIMEOUT: () => DEFAULT_REQUEST_TIMEOUT, + NodeHttp2Handler: () => NodeHttp2Handler, + NodeHttpHandler: () => NodeHttpHandler, + streamCollector: () => streamCollector }); module2.exports = __toCommonJS2(src_exports); - var resolveParamsForS3 = /* @__PURE__ */ __name(async (endpointParams) => { - const bucket = (endpointParams == null ? void 0 : endpointParams.Bucket) || ""; - if (typeof endpointParams.Bucket === "string") { - endpointParams.Bucket = bucket.replace(/#/g, encodeURIComponent("#")).replace(/\?/g, encodeURIComponent("?")); + var import_protocol_http8 = require_dist_cjs2(); + var import_querystring_builder = require_dist_cjs18(); + var import_http2 = require("http"); + var import_https = require("https"); + var NODEJS_TIMEOUT_ERROR_CODES = ["ECONNRESET", "EPIPE", "ETIMEDOUT"]; + var getTransformedHeaders = /* @__PURE__ */ __name((headers) => { + const transformedHeaders = {}; + for (const name of Object.keys(headers)) { + const headerValues = headers[name]; + transformedHeaders[name] = Array.isArray(headerValues) ? headerValues.join(",") : headerValues; } - if (isArnBucketName(bucket)) { - if (endpointParams.ForcePathStyle === true) { - throw new Error("Path-style addressing cannot be used with ARN buckets"); + return transformedHeaders; + }, "getTransformedHeaders"); + var DEFER_EVENT_LISTENER_TIME = 1e3; + var setConnectionTimeout = /* @__PURE__ */ __name((request2, reject, timeoutInMs = 0) => { + if (!timeoutInMs) { + return -1; + } + const registerTimeout = /* @__PURE__ */ __name((offset) => { + const timeoutId = setTimeout(() => { + request2.destroy(); + reject( + Object.assign(new Error(`Socket timed out without establishing a connection within ${timeoutInMs} ms`), { + name: "TimeoutError" + }) + ); + }, timeoutInMs - offset); + const doWithSocket = /* @__PURE__ */ __name((socket) => { + if (socket == null ? void 0 : socket.connecting) { + socket.on("connect", () => { + clearTimeout(timeoutId); + }); + } else { + clearTimeout(timeoutId); + } + }, "doWithSocket"); + if (request2.socket) { + doWithSocket(request2.socket); + } else { + request2.on("socket", doWithSocket); } - } else if (!isDnsCompatibleBucketName(bucket) || bucket.indexOf(".") !== -1 && !String(endpointParams.Endpoint).startsWith("http:") || bucket.toLowerCase() !== bucket || bucket.length < 3) { - endpointParams.ForcePathStyle = true; + }, "registerTimeout"); + if (timeoutInMs < 2e3) { + registerTimeout(0); + return 0; } - if (endpointParams.DisableMultiRegionAccessPoints) { - endpointParams.disableMultiRegionAccessPoints = true; - endpointParams.DisableMRAP = true; + return setTimeout(registerTimeout.bind(null, DEFER_EVENT_LISTENER_TIME), DEFER_EVENT_LISTENER_TIME); + }, "setConnectionTimeout"); + var DEFER_EVENT_LISTENER_TIME2 = 3e3; + var setSocketKeepAlive = /* @__PURE__ */ __name((request2, { keepAlive, keepAliveMsecs }, deferTimeMs = DEFER_EVENT_LISTENER_TIME2) => { + if (keepAlive !== true) { + return -1; } - return endpointParams; - }, "resolveParamsForS3"); - var DOMAIN_PATTERN = /^[a-z0-9][a-z0-9\.\-]{1,61}[a-z0-9]$/; - var IP_ADDRESS_PATTERN = /(\d+\.){3}\d+/; - var DOTS_PATTERN = /\.\./; - var isDnsCompatibleBucketName = /* @__PURE__ */ __name((bucketName) => DOMAIN_PATTERN.test(bucketName) && !IP_ADDRESS_PATTERN.test(bucketName) && !DOTS_PATTERN.test(bucketName), "isDnsCompatibleBucketName"); - var isArnBucketName = /* @__PURE__ */ __name((bucketName) => { - const [arn, partition, service, , , bucket] = bucketName.split(":"); - const isArn = arn === "arn" && bucketName.split(":").length >= 6; - const isValidArn = Boolean(isArn && partition && service && bucket); - if (isArn && !isValidArn) { - throw new Error(`Invalid ARN: ${bucketName} was an invalid ARN.`); - } - return isValidArn; - }, "isArnBucketName"); - var createConfigValueProvider = /* @__PURE__ */ __name((configKey, canonicalEndpointParamKey, config) => { - const configProvider = /* @__PURE__ */ __name(async () => { - const configValue = config[configKey] ?? config[canonicalEndpointParamKey]; - if (typeof configValue === "function") { - return configValue(); + const registerListener = /* @__PURE__ */ __name(() => { + if (request2.socket) { + request2.socket.setKeepAlive(keepAlive, keepAliveMsecs || 0); + } else { + request2.on("socket", (socket) => { + socket.setKeepAlive(keepAlive, keepAliveMsecs || 0); + }); } - return configValue; - }, "configProvider"); - if (configKey === "credentialScope" || canonicalEndpointParamKey === "CredentialScope") { - return async () => { - const credentials = typeof config.credentials === "function" ? await config.credentials() : config.credentials; - const configValue = (credentials == null ? void 0 : credentials.credentialScope) ?? (credentials == null ? void 0 : credentials.CredentialScope); - return configValue; - }; + }, "registerListener"); + if (deferTimeMs === 0) { + registerListener(); + return 0; } - if (configKey === "accountId" || canonicalEndpointParamKey === "AccountId") { - return async () => { - const credentials = typeof config.credentials === "function" ? await config.credentials() : config.credentials; - const configValue = (credentials == null ? void 0 : credentials.accountId) ?? (credentials == null ? void 0 : credentials.AccountId); - return configValue; - }; + return setTimeout(registerListener, deferTimeMs); + }, "setSocketKeepAlive"); + var DEFER_EVENT_LISTENER_TIME3 = 3e3; + var setSocketTimeout = /* @__PURE__ */ __name((request2, reject, timeoutInMs = 0) => { + const registerTimeout = /* @__PURE__ */ __name((offset) => { + request2.setTimeout(timeoutInMs - offset, () => { + request2.destroy(); + reject(Object.assign(new Error(`Connection timed out after ${timeoutInMs} ms`), { name: "TimeoutError" })); + }); + }, "registerTimeout"); + if (0 < timeoutInMs && timeoutInMs < 6e3) { + registerTimeout(0); + return 0; } - if (configKey === "endpoint" || canonicalEndpointParamKey === "endpoint") { - return async () => { - const endpoint = await configProvider(); - if (endpoint && typeof endpoint === "object") { - if ("url" in endpoint) { - return endpoint.url.href; - } - if ("hostname" in endpoint) { - const { protocol, hostname, port, path } = endpoint; - return `${protocol}//${hostname}${port ? ":" + port : ""}${path}`; - } - } - return endpoint; - }; + return setTimeout( + registerTimeout.bind(null, timeoutInMs === 0 ? 0 : DEFER_EVENT_LISTENER_TIME3), + DEFER_EVENT_LISTENER_TIME3 + ); + }, "setSocketTimeout"); + var import_stream = require("stream"); + var MIN_WAIT_TIME = 1e3; + async function writeRequestBody(httpRequest, request2, maxContinueTimeoutMs = MIN_WAIT_TIME) { + const headers = request2.headers ?? {}; + const expect = headers["Expect"] || headers["expect"]; + let timeoutId = -1; + let hasError = false; + if (expect === "100-continue") { + await Promise.race([ + new Promise((resolve) => { + timeoutId = Number(setTimeout(resolve, Math.max(MIN_WAIT_TIME, maxContinueTimeoutMs))); + }), + new Promise((resolve) => { + httpRequest.on("continue", () => { + clearTimeout(timeoutId); + resolve(); + }); + httpRequest.on("error", () => { + hasError = true; + clearTimeout(timeoutId); + resolve(); + }); + }) + ]); } - return configProvider; - }, "createConfigValueProvider"); - var import_getEndpointFromConfig = require_getEndpointFromConfig(); - var import_url_parser = require_dist_cjs17(); - var toEndpointV1 = /* @__PURE__ */ __name((endpoint) => { - if (typeof endpoint === "object") { - if ("url" in endpoint) { - return (0, import_url_parser.parseUrl)(endpoint.url); - } - return endpoint; + if (!hasError) { + writeBody(httpRequest, request2.body); } - return (0, import_url_parser.parseUrl)(endpoint); - }, "toEndpointV1"); - var getEndpointFromInstructions = /* @__PURE__ */ __name(async (commandInput, instructionsSupplier, clientConfig, context) => { - if (!clientConfig.endpoint) { - let endpointFromConfig; - if (clientConfig.serviceConfiguredEndpoint) { - endpointFromConfig = await clientConfig.serviceConfiguredEndpoint(); - } else { - endpointFromConfig = await (0, import_getEndpointFromConfig.getEndpointFromConfig)(clientConfig.serviceId); + } + __name(writeRequestBody, "writeRequestBody"); + function writeBody(httpRequest, body) { + if (body instanceof import_stream.Readable) { + body.pipe(httpRequest); + return; + } + if (body) { + if (Buffer.isBuffer(body) || typeof body === "string") { + httpRequest.end(body); + return; } - if (endpointFromConfig) { - clientConfig.endpoint = () => Promise.resolve(toEndpointV1(endpointFromConfig)); + const uint8 = body; + if (typeof uint8 === "object" && uint8.buffer && typeof uint8.byteOffset === "number" && typeof uint8.byteLength === "number") { + httpRequest.end(Buffer.from(uint8.buffer, uint8.byteOffset, uint8.byteLength)); + return; } + httpRequest.end(Buffer.from(body)); + return; } - const endpointParams = await resolveParams(commandInput, instructionsSupplier, clientConfig); - if (typeof clientConfig.endpointProvider !== "function") { - throw new Error("config.endpointProvider is not set."); + httpRequest.end(); + } + __name(writeBody, "writeBody"); + var DEFAULT_REQUEST_TIMEOUT = 0; + var _NodeHttpHandler = class _NodeHttpHandler2 { + constructor(options) { + this.socketWarningTimestamp = 0; + this.metadata = { handlerProtocol: "http/1.1" }; + this.configProvider = new Promise((resolve, reject) => { + if (typeof options === "function") { + options().then((_options) => { + resolve(this.resolveDefaultConfig(_options)); + }).catch(reject); + } else { + resolve(this.resolveDefaultConfig(options)); + } + }); } - const endpoint = clientConfig.endpointProvider(endpointParams, context); - return endpoint; - }, "getEndpointFromInstructions"); - var resolveParams = /* @__PURE__ */ __name(async (commandInput, instructionsSupplier, clientConfig) => { - var _a; - const endpointParams = {}; - const instructions = ((_a = instructionsSupplier == null ? void 0 : instructionsSupplier.getEndpointParameterInstructions) == null ? void 0 : _a.call(instructionsSupplier)) || {}; - for (const [name, instruction] of Object.entries(instructions)) { - switch (instruction.type) { - case "staticContextParams": - endpointParams[name] = instruction.value; - break; - case "contextParams": - endpointParams[name] = commandInput[instruction.name]; - break; - case "clientContextParams": - case "builtInParams": - endpointParams[name] = await createConfigValueProvider(instruction.name, name, clientConfig)(); - break; - default: - throw new Error("Unrecognized endpoint parameter instruction: " + JSON.stringify(instruction)); + /** + * @returns the input if it is an HttpHandler of any class, + * or instantiates a new instance of this handler. + */ + static create(instanceOrOptions) { + if (typeof (instanceOrOptions == null ? void 0 : instanceOrOptions.handle) === "function") { + return instanceOrOptions; } + return new _NodeHttpHandler2(instanceOrOptions); } - if (Object.keys(instructions).length === 0) { - Object.assign(endpointParams, clientConfig); - } - if (String(clientConfig.serviceId).toLowerCase() === "s3") { - await resolveParamsForS3(endpointParams); - } - return endpointParams; - }, "resolveParams"); - var import_util_middleware3 = require_dist_cjs12(); - var endpointMiddleware = /* @__PURE__ */ __name(({ - config, - instructions - }) => { - return (next, context) => async (args) => { + /** + * @internal + * + * @param agent - http(s) agent in use by the NodeHttpHandler instance. + * @param socketWarningTimestamp - last socket usage check timestamp. + * @param logger - channel for the warning. + * @returns timestamp of last emitted warning. + */ + static checkSocketUsage(agent, socketWarningTimestamp, logger = console) { var _a, _b, _c; - const endpoint = await getEndpointFromInstructions( - args.input, - { - getEndpointParameterInstructions() { - return instructions; - } - }, - { ...config }, - context - ); - context.endpointV2 = endpoint; - context.authSchemes = (_a = endpoint.properties) == null ? void 0 : _a.authSchemes; - const authScheme = (_b = context.authSchemes) == null ? void 0 : _b[0]; - if (authScheme) { - context["signing_region"] = authScheme.signingRegion; - context["signing_service"] = authScheme.signingName; - const smithyContext = (0, import_util_middleware3.getSmithyContext)(context); - const httpAuthOption = (_c = smithyContext == null ? void 0 : smithyContext.selectedHttpAuthScheme) == null ? void 0 : _c.httpAuthOption; - if (httpAuthOption) { - httpAuthOption.signingProperties = Object.assign( - httpAuthOption.signingProperties || {}, - { - signing_region: authScheme.signingRegion, - signingRegion: authScheme.signingRegion, - signing_service: authScheme.signingName, - signingName: authScheme.signingName, - signingRegionSet: authScheme.signingRegionSet - }, - authScheme.properties - ); - } + const { sockets, requests, maxSockets } = agent; + if (typeof maxSockets !== "number" || maxSockets === Infinity) { + return socketWarningTimestamp; } - return next({ - ...args - }); - }; - }, "endpointMiddleware"); - var import_middleware_serde2 = require_dist_cjs18(); - var endpointMiddlewareOptions2 = { - step: "serialize", - tags: ["ENDPOINT_PARAMETERS", "ENDPOINT_V2", "ENDPOINT"], - name: "endpointV2Middleware", - override: true, - relation: "before", - toMiddleware: import_middleware_serde2.serializerMiddlewareOption.name - }; - var getEndpointPlugin = /* @__PURE__ */ __name((config, instructions) => ({ - applyToStack: (clientStack) => { - clientStack.addRelativeTo( - endpointMiddleware({ - config, - instructions - }), - endpointMiddlewareOptions2 - ); - } - }), "getEndpointPlugin"); - var import_getEndpointFromConfig2 = require_getEndpointFromConfig(); - var resolveEndpointConfig = /* @__PURE__ */ __name((input) => { - const tls = input.tls ?? true; - const { endpoint } = input; - const customEndpointProvider = endpoint != null ? async () => toEndpointV1(await (0, import_util_middleware3.normalizeProvider)(endpoint)()) : void 0; - const isCustomEndpoint = !!endpoint; - const resolvedConfig = { - ...input, - endpoint: customEndpointProvider, - tls, - isCustomEndpoint, - useDualstackEndpoint: (0, import_util_middleware3.normalizeProvider)(input.useDualstackEndpoint ?? false), - useFipsEndpoint: (0, import_util_middleware3.normalizeProvider)(input.useFipsEndpoint ?? false) - }; - let configuredEndpointPromise = void 0; - resolvedConfig.serviceConfiguredEndpoint = async () => { - if (input.serviceId && !configuredEndpointPromise) { - configuredEndpointPromise = (0, import_getEndpointFromConfig2.getEndpointFromConfig)(input.serviceId); - } - return configuredEndpointPromise; - }; - return resolvedConfig; - }, "resolveEndpointConfig"); - } -}); - -// ../../../node_modules/@smithy/core/dist-es/middleware-http-auth-scheme/getHttpAuthSchemeEndpointRuleSetPlugin.js -var import_middleware_endpoint, httpAuthSchemeEndpointRuleSetMiddlewareOptions, getHttpAuthSchemeEndpointRuleSetPlugin; -var init_getHttpAuthSchemeEndpointRuleSetPlugin = __esm({ - "../../../node_modules/@smithy/core/dist-es/middleware-http-auth-scheme/getHttpAuthSchemeEndpointRuleSetPlugin.js"() { - import_middleware_endpoint = __toESM(require_dist_cjs19()); - init_httpAuthSchemeMiddleware(); - httpAuthSchemeEndpointRuleSetMiddlewareOptions = { - step: "serialize", - tags: ["HTTP_AUTH_SCHEME"], - name: "httpAuthSchemeMiddleware", - override: true, - relation: "before", - toMiddleware: import_middleware_endpoint.endpointMiddlewareOptions.name - }; - getHttpAuthSchemeEndpointRuleSetPlugin = (config, { httpAuthSchemeParametersProvider, identityProviderConfigProvider }) => ({ - applyToStack: (clientStack) => { - clientStack.addRelativeTo(httpAuthSchemeMiddleware(config, { - httpAuthSchemeParametersProvider, - identityProviderConfigProvider - }), httpAuthSchemeEndpointRuleSetMiddlewareOptions); - } - }); - } -}); - -// ../../../node_modules/@smithy/core/dist-es/middleware-http-auth-scheme/getHttpAuthSchemePlugin.js -var import_middleware_serde, httpAuthSchemeMiddlewareOptions, getHttpAuthSchemePlugin; -var init_getHttpAuthSchemePlugin = __esm({ - "../../../node_modules/@smithy/core/dist-es/middleware-http-auth-scheme/getHttpAuthSchemePlugin.js"() { - import_middleware_serde = __toESM(require_dist_cjs18()); - init_httpAuthSchemeMiddleware(); - httpAuthSchemeMiddlewareOptions = { - step: "serialize", - tags: ["HTTP_AUTH_SCHEME"], - name: "httpAuthSchemeMiddleware", - override: true, - relation: "before", - toMiddleware: import_middleware_serde.serializerMiddlewareOption.name - }; - getHttpAuthSchemePlugin = (config, { httpAuthSchemeParametersProvider, identityProviderConfigProvider }) => ({ - applyToStack: (clientStack) => { - clientStack.addRelativeTo(httpAuthSchemeMiddleware(config, { - httpAuthSchemeParametersProvider, - identityProviderConfigProvider - }), httpAuthSchemeMiddlewareOptions); - } - }); - } -}); - -// ../../../node_modules/@smithy/core/dist-es/middleware-http-auth-scheme/index.js -var init_middleware_http_auth_scheme = __esm({ - "../../../node_modules/@smithy/core/dist-es/middleware-http-auth-scheme/index.js"() { - init_httpAuthSchemeMiddleware(); - init_getHttpAuthSchemeEndpointRuleSetPlugin(); - init_getHttpAuthSchemePlugin(); - } -}); - -// ../../../node_modules/@smithy/core/node_modules/@smithy/protocol-http/dist-cjs/index.js -var require_dist_cjs20 = __commonJS({ - "../../../node_modules/@smithy/core/node_modules/@smithy/protocol-http/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); - } - return to; - }; - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - Field: () => Field, - Fields: () => Fields, - HttpRequest: () => HttpRequest7, - HttpResponse: () => HttpResponse2, - IHttpRequest: () => import_types5.HttpRequest, - getHttpHandlerExtensionConfiguration: () => getHttpHandlerExtensionConfiguration, - isValidHostname: () => isValidHostname, - resolveHttpHandlerRuntimeConfig: () => resolveHttpHandlerRuntimeConfig - }); - module2.exports = __toCommonJS2(src_exports); - var getHttpHandlerExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - let httpHandler = runtimeConfig.httpHandler; - return { - setHttpHandler(handler2) { - httpHandler = handler2; - }, - httpHandler() { - return httpHandler; - }, - updateHttpClientConfig(key, value) { - httpHandler.updateHttpClientConfig(key, value); - }, - httpHandlerConfigs() { - return httpHandler.httpHandlerConfigs(); - } - }; - }, "getHttpHandlerExtensionConfiguration"); - var resolveHttpHandlerRuntimeConfig = /* @__PURE__ */ __name((httpHandlerExtensionConfiguration) => { - return { - httpHandler: httpHandlerExtensionConfiguration.httpHandler() - }; - }, "resolveHttpHandlerRuntimeConfig"); - var import_types5 = require_dist_cjs(); - var _Field = class _Field { - constructor({ name, kind = import_types5.FieldPosition.HEADER, values = [] }) { - this.name = name; - this.kind = kind; - this.values = values; - } - /** - * Appends a value to the field. - * - * @param value The value to append. - */ - add(value) { - this.values.push(value); - } - /** - * Overwrite existing field values. - * - * @param values The new field values. - */ - set(values) { - this.values = values; - } - /** - * Remove all matching entries from list. - * - * @param value Value to remove. - */ - remove(value) { - this.values = this.values.filter((v) => v !== value); - } - /** - * Get comma-delimited string. - * - * @returns String representation of {@link Field}. - */ - toString() { - return this.values.map((v) => v.includes(",") || v.includes(" ") ? `"${v}"` : v).join(", "); - } - /** - * Get string values as a list - * - * @returns Values in {@link Field} as a list. - */ - get() { - return this.values; - } - }; - __name(_Field, "Field"); - var Field = _Field; - var _Fields = class _Fields { - constructor({ fields = [], encoding = "utf-8" }) { - this.entries = {}; - fields.forEach(this.setField.bind(this)); - this.encoding = encoding; - } - /** - * Set entry for a {@link Field} name. The `name` - * attribute will be used to key the collection. - * - * @param field The {@link Field} to set. - */ - setField(field) { - this.entries[field.name.toLowerCase()] = field; - } - /** - * Retrieve {@link Field} entry by name. - * - * @param name The name of the {@link Field} entry - * to retrieve - * @returns The {@link Field} if it exists. - */ - getField(name) { - return this.entries[name.toLowerCase()]; - } - /** - * Delete entry from collection. - * - * @param name Name of the entry to delete. - */ - removeField(name) { - delete this.entries[name.toLowerCase()]; - } - /** - * Helper function for retrieving specific types of fields. - * Used to grab all headers or all trailers. - * - * @param kind {@link FieldPosition} of entries to retrieve. - * @returns The {@link Field} entries with the specified - * {@link FieldPosition}. - */ - getByType(kind) { - return Object.values(this.entries).filter((field) => field.kind === kind); - } - }; - __name(_Fields, "Fields"); - var Fields = _Fields; - var _HttpRequest = class _HttpRequest2 { - constructor(options) { - this.method = options.method || "GET"; - this.hostname = options.hostname || "localhost"; - this.port = options.port; - this.query = options.query || {}; - this.headers = options.headers || {}; - this.body = options.body; - this.protocol = options.protocol ? options.protocol.slice(-1) !== ":" ? `${options.protocol}:` : options.protocol : "https:"; - this.path = options.path ? options.path.charAt(0) !== "/" ? `/${options.path}` : options.path : "/"; - this.username = options.username; - this.password = options.password; - this.fragment = options.fragment; - } - /** - * Note: this does not deep-clone the body. - */ - static clone(request2) { - const cloned = new _HttpRequest2({ - ...request2, - headers: { ...request2.headers } - }); - if (cloned.query) { - cloned.query = cloneQuery(cloned.query); - } - return cloned; - } - /** - * This method only actually asserts that request is the interface {@link IHttpRequest}, - * and not necessarily this concrete class. Left in place for API stability. - * - * Do not call instance methods on the input of this function, and - * do not assume it has the HttpRequest prototype. - */ - static isInstance(request2) { - if (!request2) { - return false; - } - const req = request2; - return "method" in req && "protocol" in req && "hostname" in req && "path" in req && typeof req["query"] === "object" && typeof req["headers"] === "object"; - } - /** - * @deprecated use static HttpRequest.clone(request) instead. It's not safe to call - * this method because {@link HttpRequest.isInstance} incorrectly - * asserts that IHttpRequest (interface) objects are of type HttpRequest (class). - */ - clone() { - return _HttpRequest2.clone(this); - } - }; - __name(_HttpRequest, "HttpRequest"); - var HttpRequest7 = _HttpRequest; - function cloneQuery(query) { - return Object.keys(query).reduce((carry, paramName) => { - const param = query[paramName]; - return { - ...carry, - [paramName]: Array.isArray(param) ? [...param] : param - }; - }, {}); - } - __name(cloneQuery, "cloneQuery"); - var _HttpResponse = class _HttpResponse { - constructor(options) { - this.statusCode = options.statusCode; - this.reason = options.reason; - this.headers = options.headers || {}; - this.body = options.body; - } - static isInstance(response) { - if (!response) - return false; - const resp = response; - return typeof resp.statusCode === "number" && typeof resp.headers === "object"; - } - }; - __name(_HttpResponse, "HttpResponse"); - var HttpResponse2 = _HttpResponse; - function isValidHostname(hostname) { - const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/; - return hostPattern.test(hostname); - } - __name(isValidHostname, "isValidHostname"); - } -}); - -// ../../../node_modules/@smithy/core/dist-es/middleware-http-signing/httpSigningMiddleware.js -var import_protocol_http, import_types2, import_util_middleware2, defaultErrorHandler, defaultSuccessHandler, httpSigningMiddleware; -var init_httpSigningMiddleware = __esm({ - "../../../node_modules/@smithy/core/dist-es/middleware-http-signing/httpSigningMiddleware.js"() { - import_protocol_http = __toESM(require_dist_cjs20()); - import_types2 = __toESM(require_dist_cjs()); - import_util_middleware2 = __toESM(require_dist_cjs12()); - defaultErrorHandler = (signingProperties) => (error) => { - throw error; - }; - defaultSuccessHandler = (httpResponse, signingProperties) => { - }; - httpSigningMiddleware = (config) => (next, context) => async (args) => { - if (!import_protocol_http.HttpRequest.isInstance(args.request)) { - return next(args); - } - const smithyContext = (0, import_util_middleware2.getSmithyContext)(context); - const scheme = smithyContext.selectedHttpAuthScheme; - if (!scheme) { - throw new Error(`No HttpAuthScheme was selected: unable to sign request`); - } - const { httpAuthOption: { signingProperties = {} }, identity, signer } = scheme; - const output = await next({ - ...args, - request: await signer.sign(args.request, identity, signingProperties) - }).catch((signer.errorHandler || defaultErrorHandler)(signingProperties)); - (signer.successHandler || defaultSuccessHandler)(output.response, signingProperties); - return output; - }; - } -}); - -// ../../../node_modules/@smithy/middleware-retry/node_modules/@smithy/protocol-http/dist-cjs/index.js -var require_dist_cjs21 = __commonJS({ - "../../../node_modules/@smithy/middleware-retry/node_modules/@smithy/protocol-http/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); - } - return to; - }; - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - Field: () => Field, - Fields: () => Fields, - HttpRequest: () => HttpRequest7, - HttpResponse: () => HttpResponse2, - IHttpRequest: () => import_types5.HttpRequest, - getHttpHandlerExtensionConfiguration: () => getHttpHandlerExtensionConfiguration, - isValidHostname: () => isValidHostname, - resolveHttpHandlerRuntimeConfig: () => resolveHttpHandlerRuntimeConfig - }); - module2.exports = __toCommonJS2(src_exports); - var getHttpHandlerExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - let httpHandler = runtimeConfig.httpHandler; - return { - setHttpHandler(handler2) { - httpHandler = handler2; - }, - httpHandler() { - return httpHandler; - }, - updateHttpClientConfig(key, value) { - httpHandler.updateHttpClientConfig(key, value); - }, - httpHandlerConfigs() { - return httpHandler.httpHandlerConfigs(); - } - }; - }, "getHttpHandlerExtensionConfiguration"); - var resolveHttpHandlerRuntimeConfig = /* @__PURE__ */ __name((httpHandlerExtensionConfiguration) => { - return { - httpHandler: httpHandlerExtensionConfiguration.httpHandler() - }; - }, "resolveHttpHandlerRuntimeConfig"); - var import_types5 = require_dist_cjs(); - var _Field = class _Field { - constructor({ name, kind = import_types5.FieldPosition.HEADER, values = [] }) { - this.name = name; - this.kind = kind; - this.values = values; - } - /** - * Appends a value to the field. - * - * @param value The value to append. - */ - add(value) { - this.values.push(value); - } - /** - * Overwrite existing field values. - * - * @param values The new field values. - */ - set(values) { - this.values = values; - } - /** - * Remove all matching entries from list. - * - * @param value Value to remove. - */ - remove(value) { - this.values = this.values.filter((v) => v !== value); - } - /** - * Get comma-delimited string. - * - * @returns String representation of {@link Field}. - */ - toString() { - return this.values.map((v) => v.includes(",") || v.includes(" ") ? `"${v}"` : v).join(", "); - } - /** - * Get string values as a list - * - * @returns Values in {@link Field} as a list. - */ - get() { - return this.values; - } - }; - __name(_Field, "Field"); - var Field = _Field; - var _Fields = class _Fields { - constructor({ fields = [], encoding = "utf-8" }) { - this.entries = {}; - fields.forEach(this.setField.bind(this)); - this.encoding = encoding; - } - /** - * Set entry for a {@link Field} name. The `name` - * attribute will be used to key the collection. - * - * @param field The {@link Field} to set. - */ - setField(field) { - this.entries[field.name.toLowerCase()] = field; - } - /** - * Retrieve {@link Field} entry by name. - * - * @param name The name of the {@link Field} entry - * to retrieve - * @returns The {@link Field} if it exists. - */ - getField(name) { - return this.entries[name.toLowerCase()]; - } - /** - * Delete entry from collection. - * - * @param name Name of the entry to delete. - */ - removeField(name) { - delete this.entries[name.toLowerCase()]; - } - /** - * Helper function for retrieving specific types of fields. - * Used to grab all headers or all trailers. - * - * @param kind {@link FieldPosition} of entries to retrieve. - * @returns The {@link Field} entries with the specified - * {@link FieldPosition}. - */ - getByType(kind) { - return Object.values(this.entries).filter((field) => field.kind === kind); - } - }; - __name(_Fields, "Fields"); - var Fields = _Fields; - var _HttpRequest = class _HttpRequest2 { - constructor(options) { - this.method = options.method || "GET"; - this.hostname = options.hostname || "localhost"; - this.port = options.port; - this.query = options.query || {}; - this.headers = options.headers || {}; - this.body = options.body; - this.protocol = options.protocol ? options.protocol.slice(-1) !== ":" ? `${options.protocol}:` : options.protocol : "https:"; - this.path = options.path ? options.path.charAt(0) !== "/" ? `/${options.path}` : options.path : "/"; - this.username = options.username; - this.password = options.password; - this.fragment = options.fragment; - } - /** - * Note: this does not deep-clone the body. - */ - static clone(request2) { - const cloned = new _HttpRequest2({ - ...request2, - headers: { ...request2.headers } - }); - if (cloned.query) { - cloned.query = cloneQuery(cloned.query); - } - return cloned; - } - /** - * This method only actually asserts that request is the interface {@link IHttpRequest}, - * and not necessarily this concrete class. Left in place for API stability. - * - * Do not call instance methods on the input of this function, and - * do not assume it has the HttpRequest prototype. - */ - static isInstance(request2) { - if (!request2) { - return false; - } - const req = request2; - return "method" in req && "protocol" in req && "hostname" in req && "path" in req && typeof req["query"] === "object" && typeof req["headers"] === "object"; - } - /** - * @deprecated use static HttpRequest.clone(request) instead. It's not safe to call - * this method because {@link HttpRequest.isInstance} incorrectly - * asserts that IHttpRequest (interface) objects are of type HttpRequest (class). - */ - clone() { - return _HttpRequest2.clone(this); - } - }; - __name(_HttpRequest, "HttpRequest"); - var HttpRequest7 = _HttpRequest; - function cloneQuery(query) { - return Object.keys(query).reduce((carry, paramName) => { - const param = query[paramName]; - return { - ...carry, - [paramName]: Array.isArray(param) ? [...param] : param - }; - }, {}); - } - __name(cloneQuery, "cloneQuery"); - var _HttpResponse = class _HttpResponse { - constructor(options) { - this.statusCode = options.statusCode; - this.reason = options.reason; - this.headers = options.headers || {}; - this.body = options.body; - } - static isInstance(response) { - if (!response) - return false; - const resp = response; - return typeof resp.statusCode === "number" && typeof resp.headers === "object"; - } - }; - __name(_HttpResponse, "HttpResponse"); - var HttpResponse2 = _HttpResponse; - function isValidHostname(hostname) { - const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/; - return hostPattern.test(hostname); - } - __name(isValidHostname, "isValidHostname"); - } -}); - -// ../../../node_modules/uuid/dist/esm-node/rng.js -function rng() { - if (poolPtr > rnds8Pool.length - 16) { - import_crypto.default.randomFillSync(rnds8Pool); - poolPtr = 0; - } - return rnds8Pool.slice(poolPtr, poolPtr += 16); -} -var import_crypto, rnds8Pool, poolPtr; -var init_rng = __esm({ - "../../../node_modules/uuid/dist/esm-node/rng.js"() { - import_crypto = __toESM(require("crypto")); - rnds8Pool = new Uint8Array(256); - poolPtr = rnds8Pool.length; - } -}); - -// ../../../node_modules/uuid/dist/esm-node/regex.js -var regex_default; -var init_regex = __esm({ - "../../../node_modules/uuid/dist/esm-node/regex.js"() { - regex_default = /^(?:[0-9a-f]{8}-[0-9a-f]{4}-[1-5][0-9a-f]{3}-[89ab][0-9a-f]{3}-[0-9a-f]{12}|00000000-0000-0000-0000-000000000000)$/i; - } -}); - -// ../../../node_modules/uuid/dist/esm-node/validate.js -function validate(uuid) { - return typeof uuid === "string" && regex_default.test(uuid); -} -var validate_default; -var init_validate = __esm({ - "../../../node_modules/uuid/dist/esm-node/validate.js"() { - init_regex(); - validate_default = validate; - } -}); - -// ../../../node_modules/uuid/dist/esm-node/stringify.js -function unsafeStringify(arr, offset = 0) { - return byteToHex[arr[offset + 0]] + byteToHex[arr[offset + 1]] + byteToHex[arr[offset + 2]] + byteToHex[arr[offset + 3]] + "-" + byteToHex[arr[offset + 4]] + byteToHex[arr[offset + 5]] + "-" + byteToHex[arr[offset + 6]] + byteToHex[arr[offset + 7]] + "-" + byteToHex[arr[offset + 8]] + byteToHex[arr[offset + 9]] + "-" + byteToHex[arr[offset + 10]] + byteToHex[arr[offset + 11]] + byteToHex[arr[offset + 12]] + byteToHex[arr[offset + 13]] + byteToHex[arr[offset + 14]] + byteToHex[arr[offset + 15]]; -} -function stringify(arr, offset = 0) { - const uuid = unsafeStringify(arr, offset); - if (!validate_default(uuid)) { - throw TypeError("Stringified UUID is invalid"); - } - return uuid; -} -var byteToHex, stringify_default; -var init_stringify = __esm({ - "../../../node_modules/uuid/dist/esm-node/stringify.js"() { - init_validate(); - byteToHex = []; - for (let i = 0; i < 256; ++i) { - byteToHex.push((i + 256).toString(16).slice(1)); - } - stringify_default = stringify; - } -}); - -// ../../../node_modules/uuid/dist/esm-node/v1.js -function v1(options, buf, offset) { - let i = buf && offset || 0; - const b = buf || new Array(16); - options = options || {}; - let node = options.node || _nodeId; - let clockseq = options.clockseq !== void 0 ? options.clockseq : _clockseq; - if (node == null || clockseq == null) { - const seedBytes = options.random || (options.rng || rng)(); - if (node == null) { - node = _nodeId = [seedBytes[0] | 1, seedBytes[1], seedBytes[2], seedBytes[3], seedBytes[4], seedBytes[5]]; - } - if (clockseq == null) { - clockseq = _clockseq = (seedBytes[6] << 8 | seedBytes[7]) & 16383; - } - } - let msecs = options.msecs !== void 0 ? options.msecs : Date.now(); - let nsecs = options.nsecs !== void 0 ? options.nsecs : _lastNSecs + 1; - const dt = msecs - _lastMSecs + (nsecs - _lastNSecs) / 1e4; - if (dt < 0 && options.clockseq === void 0) { - clockseq = clockseq + 1 & 16383; - } - if ((dt < 0 || msecs > _lastMSecs) && options.nsecs === void 0) { - nsecs = 0; - } - if (nsecs >= 1e4) { - throw new Error("uuid.v1(): Can't create more than 10M uuids/sec"); - } - _lastMSecs = msecs; - _lastNSecs = nsecs; - _clockseq = clockseq; - msecs += 122192928e5; - const tl = ((msecs & 268435455) * 1e4 + nsecs) % 4294967296; - b[i++] = tl >>> 24 & 255; - b[i++] = tl >>> 16 & 255; - b[i++] = tl >>> 8 & 255; - b[i++] = tl & 255; - const tmh = msecs / 4294967296 * 1e4 & 268435455; - b[i++] = tmh >>> 8 & 255; - b[i++] = tmh & 255; - b[i++] = tmh >>> 24 & 15 | 16; - b[i++] = tmh >>> 16 & 255; - b[i++] = clockseq >>> 8 | 128; - b[i++] = clockseq & 255; - for (let n = 0; n < 6; ++n) { - b[i + n] = node[n]; - } - return buf || unsafeStringify(b); -} -var _nodeId, _clockseq, _lastMSecs, _lastNSecs, v1_default; -var init_v1 = __esm({ - "../../../node_modules/uuid/dist/esm-node/v1.js"() { - init_rng(); - init_stringify(); - _lastMSecs = 0; - _lastNSecs = 0; - v1_default = v1; - } -}); - -// ../../../node_modules/uuid/dist/esm-node/parse.js -function parse(uuid) { - if (!validate_default(uuid)) { - throw TypeError("Invalid UUID"); - } - let v; - const arr = new Uint8Array(16); - arr[0] = (v = parseInt(uuid.slice(0, 8), 16)) >>> 24; - arr[1] = v >>> 16 & 255; - arr[2] = v >>> 8 & 255; - arr[3] = v & 255; - arr[4] = (v = parseInt(uuid.slice(9, 13), 16)) >>> 8; - arr[5] = v & 255; - arr[6] = (v = parseInt(uuid.slice(14, 18), 16)) >>> 8; - arr[7] = v & 255; - arr[8] = (v = parseInt(uuid.slice(19, 23), 16)) >>> 8; - arr[9] = v & 255; - arr[10] = (v = parseInt(uuid.slice(24, 36), 16)) / 1099511627776 & 255; - arr[11] = v / 4294967296 & 255; - arr[12] = v >>> 24 & 255; - arr[13] = v >>> 16 & 255; - arr[14] = v >>> 8 & 255; - arr[15] = v & 255; - return arr; -} -var parse_default; -var init_parse = __esm({ - "../../../node_modules/uuid/dist/esm-node/parse.js"() { - init_validate(); - parse_default = parse; - } -}); - -// ../../../node_modules/uuid/dist/esm-node/v35.js -function stringToBytes(str) { - str = unescape(encodeURIComponent(str)); - const bytes = []; - for (let i = 0; i < str.length; ++i) { - bytes.push(str.charCodeAt(i)); - } - return bytes; -} -function v35(name, version2, hashfunc) { - function generateUUID(value, namespace, buf, offset) { - var _namespace; - if (typeof value === "string") { - value = stringToBytes(value); - } - if (typeof namespace === "string") { - namespace = parse_default(namespace); - } - if (((_namespace = namespace) === null || _namespace === void 0 ? void 0 : _namespace.length) !== 16) { - throw TypeError("Namespace must be array-like (16 iterable integer values, 0-255)"); - } - let bytes = new Uint8Array(16 + value.length); - bytes.set(namespace); - bytes.set(value, namespace.length); - bytes = hashfunc(bytes); - bytes[6] = bytes[6] & 15 | version2; - bytes[8] = bytes[8] & 63 | 128; - if (buf) { - offset = offset || 0; - for (let i = 0; i < 16; ++i) { - buf[offset + i] = bytes[i]; - } - return buf; - } - return unsafeStringify(bytes); - } - try { - generateUUID.name = name; - } catch (err) { - } - generateUUID.DNS = DNS; - generateUUID.URL = URL2; - return generateUUID; -} -var DNS, URL2; -var init_v35 = __esm({ - "../../../node_modules/uuid/dist/esm-node/v35.js"() { - init_stringify(); - init_parse(); - DNS = "6ba7b810-9dad-11d1-80b4-00c04fd430c8"; - URL2 = "6ba7b811-9dad-11d1-80b4-00c04fd430c8"; - } -}); - -// ../../../node_modules/uuid/dist/esm-node/md5.js -function md5(bytes) { - if (Array.isArray(bytes)) { - bytes = Buffer.from(bytes); - } else if (typeof bytes === "string") { - bytes = Buffer.from(bytes, "utf8"); - } - return import_crypto2.default.createHash("md5").update(bytes).digest(); -} -var import_crypto2, md5_default; -var init_md5 = __esm({ - "../../../node_modules/uuid/dist/esm-node/md5.js"() { - import_crypto2 = __toESM(require("crypto")); - md5_default = md5; - } -}); - -// ../../../node_modules/uuid/dist/esm-node/v3.js -var v3, v3_default; -var init_v3 = __esm({ - "../../../node_modules/uuid/dist/esm-node/v3.js"() { - init_v35(); - init_md5(); - v3 = v35("v3", 48, md5_default); - v3_default = v3; - } -}); - -// ../../../node_modules/uuid/dist/esm-node/native.js -var import_crypto3, native_default; -var init_native = __esm({ - "../../../node_modules/uuid/dist/esm-node/native.js"() { - import_crypto3 = __toESM(require("crypto")); - native_default = { - randomUUID: import_crypto3.default.randomUUID - }; - } -}); - -// ../../../node_modules/uuid/dist/esm-node/v4.js -function v4(options, buf, offset) { - if (native_default.randomUUID && !buf && !options) { - return native_default.randomUUID(); - } - options = options || {}; - const rnds = options.random || (options.rng || rng)(); - rnds[6] = rnds[6] & 15 | 64; - rnds[8] = rnds[8] & 63 | 128; - if (buf) { - offset = offset || 0; - for (let i = 0; i < 16; ++i) { - buf[offset + i] = rnds[i]; - } - return buf; - } - return unsafeStringify(rnds); -} -var v4_default; -var init_v4 = __esm({ - "../../../node_modules/uuid/dist/esm-node/v4.js"() { - init_native(); - init_rng(); - init_stringify(); - v4_default = v4; - } -}); - -// ../../../node_modules/uuid/dist/esm-node/sha1.js -function sha1(bytes) { - if (Array.isArray(bytes)) { - bytes = Buffer.from(bytes); - } else if (typeof bytes === "string") { - bytes = Buffer.from(bytes, "utf8"); - } - return import_crypto4.default.createHash("sha1").update(bytes).digest(); -} -var import_crypto4, sha1_default; -var init_sha1 = __esm({ - "../../../node_modules/uuid/dist/esm-node/sha1.js"() { - import_crypto4 = __toESM(require("crypto")); - sha1_default = sha1; - } -}); - -// ../../../node_modules/uuid/dist/esm-node/v5.js -var v5, v5_default; -var init_v5 = __esm({ - "../../../node_modules/uuid/dist/esm-node/v5.js"() { - init_v35(); - init_sha1(); - v5 = v35("v5", 80, sha1_default); - v5_default = v5; - } -}); - -// ../../../node_modules/uuid/dist/esm-node/nil.js -var nil_default; -var init_nil = __esm({ - "../../../node_modules/uuid/dist/esm-node/nil.js"() { - nil_default = "00000000-0000-0000-0000-000000000000"; - } -}); - -// ../../../node_modules/uuid/dist/esm-node/version.js -function version(uuid) { - if (!validate_default(uuid)) { - throw TypeError("Invalid UUID"); - } - return parseInt(uuid.slice(14, 15), 16); -} -var version_default; -var init_version = __esm({ - "../../../node_modules/uuid/dist/esm-node/version.js"() { - init_validate(); - version_default = version; - } -}); - -// ../../../node_modules/uuid/dist/esm-node/index.js -var esm_node_exports = {}; -__export(esm_node_exports, { - NIL: () => nil_default, - parse: () => parse_default, - stringify: () => stringify_default, - v1: () => v1_default, - v3: () => v3_default, - v4: () => v4_default, - v5: () => v5_default, - validate: () => validate_default, - version: () => version_default -}); -var init_esm_node = __esm({ - "../../../node_modules/uuid/dist/esm-node/index.js"() { - init_v1(); - init_v3(); - init_v4(); - init_v5(); - init_nil(); - init_version(); - init_validate(); - init_stringify(); - init_parse(); - } -}); - -// ../../../node_modules/@smithy/service-error-classification/dist-cjs/index.js -var require_dist_cjs22 = __commonJS({ - "../../../node_modules/@smithy/service-error-classification/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); - } - return to; - }; - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - isClockSkewCorrectedError: () => isClockSkewCorrectedError, - isClockSkewError: () => isClockSkewError, - isRetryableByTrait: () => isRetryableByTrait, - isServerError: () => isServerError, - isThrottlingError: () => isThrottlingError, - isTransientError: () => isTransientError - }); - module2.exports = __toCommonJS2(src_exports); - var CLOCK_SKEW_ERROR_CODES = [ - "AuthFailure", - "InvalidSignatureException", - "RequestExpired", - "RequestInTheFuture", - "RequestTimeTooSkewed", - "SignatureDoesNotMatch" - ]; - var THROTTLING_ERROR_CODES = [ - "BandwidthLimitExceeded", - "EC2ThrottledException", - "LimitExceededException", - "PriorRequestNotComplete", - "ProvisionedThroughputExceededException", - "RequestLimitExceeded", - "RequestThrottled", - "RequestThrottledException", - "SlowDown", - "ThrottledException", - "Throttling", - "ThrottlingException", - "TooManyRequestsException", - "TransactionInProgressException" - // DynamoDB - ]; - var TRANSIENT_ERROR_CODES = ["TimeoutError", "RequestTimeout", "RequestTimeoutException"]; - var TRANSIENT_ERROR_STATUS_CODES = [500, 502, 503, 504]; - var NODEJS_TIMEOUT_ERROR_CODES = ["ECONNRESET", "ECONNREFUSED", "EPIPE", "ETIMEDOUT"]; - var isRetryableByTrait = /* @__PURE__ */ __name((error) => error.$retryable !== void 0, "isRetryableByTrait"); - var isClockSkewError = /* @__PURE__ */ __name((error) => CLOCK_SKEW_ERROR_CODES.includes(error.name), "isClockSkewError"); - var isClockSkewCorrectedError = /* @__PURE__ */ __name((error) => { - var _a; - return (_a = error.$metadata) == null ? void 0 : _a.clockSkewCorrected; - }, "isClockSkewCorrectedError"); - var isThrottlingError = /* @__PURE__ */ __name((error) => { - var _a, _b; - return ((_a = error.$metadata) == null ? void 0 : _a.httpStatusCode) === 429 || THROTTLING_ERROR_CODES.includes(error.name) || ((_b = error.$retryable) == null ? void 0 : _b.throttling) == true; - }, "isThrottlingError"); - var isTransientError = /* @__PURE__ */ __name((error) => { - var _a; - return isClockSkewCorrectedError(error) || TRANSIENT_ERROR_CODES.includes(error.name) || NODEJS_TIMEOUT_ERROR_CODES.includes((error == null ? void 0 : error.code) || "") || TRANSIENT_ERROR_STATUS_CODES.includes(((_a = error.$metadata) == null ? void 0 : _a.httpStatusCode) || 0); - }, "isTransientError"); - var isServerError = /* @__PURE__ */ __name((error) => { - var _a; - if (((_a = error.$metadata) == null ? void 0 : _a.httpStatusCode) !== void 0) { - const statusCode = error.$metadata.httpStatusCode; - if (500 <= statusCode && statusCode <= 599 && !isTransientError(error)) { - return true; - } - return false; - } - return false; - }, "isServerError"); - } -}); - -// ../../../node_modules/@smithy/middleware-retry/node_modules/@smithy/util-retry/dist-cjs/index.js -var require_dist_cjs23 = __commonJS({ - "../../../node_modules/@smithy/middleware-retry/node_modules/@smithy/util-retry/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); - } - return to; - }; - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - AdaptiveRetryStrategy: () => AdaptiveRetryStrategy, - ConfiguredRetryStrategy: () => ConfiguredRetryStrategy, - DEFAULT_MAX_ATTEMPTS: () => DEFAULT_MAX_ATTEMPTS, - DEFAULT_RETRY_DELAY_BASE: () => DEFAULT_RETRY_DELAY_BASE, - DEFAULT_RETRY_MODE: () => DEFAULT_RETRY_MODE, - DefaultRateLimiter: () => DefaultRateLimiter, - INITIAL_RETRY_TOKENS: () => INITIAL_RETRY_TOKENS, - INVOCATION_ID_HEADER: () => INVOCATION_ID_HEADER, - MAXIMUM_RETRY_DELAY: () => MAXIMUM_RETRY_DELAY, - NO_RETRY_INCREMENT: () => NO_RETRY_INCREMENT, - REQUEST_HEADER: () => REQUEST_HEADER, - RETRY_COST: () => RETRY_COST, - RETRY_MODES: () => RETRY_MODES, - StandardRetryStrategy: () => StandardRetryStrategy, - THROTTLING_RETRY_DELAY_BASE: () => THROTTLING_RETRY_DELAY_BASE, - TIMEOUT_RETRY_COST: () => TIMEOUT_RETRY_COST - }); - module2.exports = __toCommonJS2(src_exports); - var RETRY_MODES = /* @__PURE__ */ ((RETRY_MODES2) => { - RETRY_MODES2["STANDARD"] = "standard"; - RETRY_MODES2["ADAPTIVE"] = "adaptive"; - return RETRY_MODES2; - })(RETRY_MODES || {}); - var DEFAULT_MAX_ATTEMPTS = 3; - var DEFAULT_RETRY_MODE = "standard"; - var import_service_error_classification = require_dist_cjs22(); - var _DefaultRateLimiter = class _DefaultRateLimiter { - constructor(options) { - this.currentCapacity = 0; - this.enabled = false; - this.lastMaxRate = 0; - this.measuredTxRate = 0; - this.requestCount = 0; - this.lastTimestamp = 0; - this.timeWindow = 0; - this.beta = (options == null ? void 0 : options.beta) ?? 0.7; - this.minCapacity = (options == null ? void 0 : options.minCapacity) ?? 1; - this.minFillRate = (options == null ? void 0 : options.minFillRate) ?? 0.5; - this.scaleConstant = (options == null ? void 0 : options.scaleConstant) ?? 0.4; - this.smooth = (options == null ? void 0 : options.smooth) ?? 0.8; - const currentTimeInSeconds = this.getCurrentTimeInSeconds(); - this.lastThrottleTime = currentTimeInSeconds; - this.lastTxRateBucket = Math.floor(this.getCurrentTimeInSeconds()); - this.fillRate = this.minFillRate; - this.maxCapacity = this.minCapacity; - } - getCurrentTimeInSeconds() { - return Date.now() / 1e3; - } - async getSendToken() { - return this.acquireTokenBucket(1); - } - async acquireTokenBucket(amount) { - if (!this.enabled) { - return; - } - this.refillTokenBucket(); - if (amount > this.currentCapacity) { - const delay = (amount - this.currentCapacity) / this.fillRate * 1e3; - await new Promise((resolve) => setTimeout(resolve, delay)); - } - this.currentCapacity = this.currentCapacity - amount; - } - refillTokenBucket() { - const timestamp = this.getCurrentTimeInSeconds(); - if (!this.lastTimestamp) { - this.lastTimestamp = timestamp; - return; - } - const fillAmount = (timestamp - this.lastTimestamp) * this.fillRate; - this.currentCapacity = Math.min(this.maxCapacity, this.currentCapacity + fillAmount); - this.lastTimestamp = timestamp; - } - updateClientSendingRate(response) { - let calculatedRate; - this.updateMeasuredRate(); - if ((0, import_service_error_classification.isThrottlingError)(response)) { - const rateToUse = !this.enabled ? this.measuredTxRate : Math.min(this.measuredTxRate, this.fillRate); - this.lastMaxRate = rateToUse; - this.calculateTimeWindow(); - this.lastThrottleTime = this.getCurrentTimeInSeconds(); - calculatedRate = this.cubicThrottle(rateToUse); - this.enableTokenBucket(); - } else { - this.calculateTimeWindow(); - calculatedRate = this.cubicSuccess(this.getCurrentTimeInSeconds()); - } - const newRate = Math.min(calculatedRate, 2 * this.measuredTxRate); - this.updateTokenBucketRate(newRate); - } - calculateTimeWindow() { - this.timeWindow = this.getPrecise(Math.pow(this.lastMaxRate * (1 - this.beta) / this.scaleConstant, 1 / 3)); - } - cubicThrottle(rateToUse) { - return this.getPrecise(rateToUse * this.beta); - } - cubicSuccess(timestamp) { - return this.getPrecise( - this.scaleConstant * Math.pow(timestamp - this.lastThrottleTime - this.timeWindow, 3) + this.lastMaxRate - ); - } - enableTokenBucket() { - this.enabled = true; - } - updateTokenBucketRate(newRate) { - this.refillTokenBucket(); - this.fillRate = Math.max(newRate, this.minFillRate); - this.maxCapacity = Math.max(newRate, this.minCapacity); - this.currentCapacity = Math.min(this.currentCapacity, this.maxCapacity); - } - updateMeasuredRate() { - const t = this.getCurrentTimeInSeconds(); - const timeBucket = Math.floor(t * 2) / 2; - this.requestCount++; - if (timeBucket > this.lastTxRateBucket) { - const currentRate = this.requestCount / (timeBucket - this.lastTxRateBucket); - this.measuredTxRate = this.getPrecise(currentRate * this.smooth + this.measuredTxRate * (1 - this.smooth)); - this.requestCount = 0; - this.lastTxRateBucket = timeBucket; - } - } - getPrecise(num) { - return parseFloat(num.toFixed(8)); - } - }; - __name(_DefaultRateLimiter, "DefaultRateLimiter"); - var DefaultRateLimiter = _DefaultRateLimiter; - var DEFAULT_RETRY_DELAY_BASE = 100; - var MAXIMUM_RETRY_DELAY = 20 * 1e3; - var THROTTLING_RETRY_DELAY_BASE = 500; - var INITIAL_RETRY_TOKENS = 500; - var RETRY_COST = 5; - var TIMEOUT_RETRY_COST = 10; - var NO_RETRY_INCREMENT = 1; - var INVOCATION_ID_HEADER = "amz-sdk-invocation-id"; - var REQUEST_HEADER = "amz-sdk-request"; - var getDefaultRetryBackoffStrategy = /* @__PURE__ */ __name(() => { - let delayBase = DEFAULT_RETRY_DELAY_BASE; - const computeNextBackoffDelay = /* @__PURE__ */ __name((attempts) => { - return Math.floor(Math.min(MAXIMUM_RETRY_DELAY, Math.random() * 2 ** attempts * delayBase)); - }, "computeNextBackoffDelay"); - const setDelayBase = /* @__PURE__ */ __name((delay) => { - delayBase = delay; - }, "setDelayBase"); - return { - computeNextBackoffDelay, - setDelayBase - }; - }, "getDefaultRetryBackoffStrategy"); - var createDefaultRetryToken = /* @__PURE__ */ __name(({ - retryDelay, - retryCount, - retryCost - }) => { - const getRetryCount = /* @__PURE__ */ __name(() => retryCount, "getRetryCount"); - const getRetryDelay = /* @__PURE__ */ __name(() => Math.min(MAXIMUM_RETRY_DELAY, retryDelay), "getRetryDelay"); - const getRetryCost = /* @__PURE__ */ __name(() => retryCost, "getRetryCost"); - return { - getRetryCount, - getRetryDelay, - getRetryCost - }; - }, "createDefaultRetryToken"); - var _StandardRetryStrategy = class _StandardRetryStrategy { - constructor(maxAttempts) { - this.maxAttempts = maxAttempts; - this.mode = "standard"; - this.capacity = INITIAL_RETRY_TOKENS; - this.retryBackoffStrategy = getDefaultRetryBackoffStrategy(); - this.maxAttemptsProvider = typeof maxAttempts === "function" ? maxAttempts : async () => maxAttempts; - } - // eslint-disable-next-line @typescript-eslint/no-unused-vars - async acquireInitialRetryToken(retryTokenScope) { - return createDefaultRetryToken({ - retryDelay: DEFAULT_RETRY_DELAY_BASE, - retryCount: 0 - }); - } - async refreshRetryTokenForRetry(token, errorInfo) { - const maxAttempts = await this.getMaxAttempts(); - if (this.shouldRetry(token, errorInfo, maxAttempts)) { - const errorType = errorInfo.errorType; - this.retryBackoffStrategy.setDelayBase( - errorType === "THROTTLING" ? THROTTLING_RETRY_DELAY_BASE : DEFAULT_RETRY_DELAY_BASE - ); - const delayFromErrorType = this.retryBackoffStrategy.computeNextBackoffDelay(token.getRetryCount()); - const retryDelay = errorInfo.retryAfterHint ? Math.max(errorInfo.retryAfterHint.getTime() - Date.now() || 0, delayFromErrorType) : delayFromErrorType; - const capacityCost = this.getCapacityCost(errorType); - this.capacity -= capacityCost; - return createDefaultRetryToken({ - retryDelay, - retryCount: token.getRetryCount() + 1, - retryCost: capacityCost - }); - } - throw new Error("No retry token available"); - } - recordSuccess(token) { - this.capacity = Math.max(INITIAL_RETRY_TOKENS, this.capacity + (token.getRetryCost() ?? NO_RETRY_INCREMENT)); - } - /** - * @returns the current available retry capacity. - * - * This number decreases when retries are executed and refills when requests or retries succeed. - */ - getCapacity() { - return this.capacity; - } - async getMaxAttempts() { - try { - return await this.maxAttemptsProvider(); - } catch (error) { - console.warn(`Max attempts provider could not resolve. Using default of ${DEFAULT_MAX_ATTEMPTS}`); - return DEFAULT_MAX_ATTEMPTS; - } - } - shouldRetry(tokenToRenew, errorInfo, maxAttempts) { - const attempts = tokenToRenew.getRetryCount() + 1; - return attempts < maxAttempts && this.capacity >= this.getCapacityCost(errorInfo.errorType) && this.isRetryableError(errorInfo.errorType); - } - getCapacityCost(errorType) { - return errorType === "TRANSIENT" ? TIMEOUT_RETRY_COST : RETRY_COST; - } - isRetryableError(errorType) { - return errorType === "THROTTLING" || errorType === "TRANSIENT"; - } - }; - __name(_StandardRetryStrategy, "StandardRetryStrategy"); - var StandardRetryStrategy = _StandardRetryStrategy; - var _AdaptiveRetryStrategy = class _AdaptiveRetryStrategy { - constructor(maxAttemptsProvider, options) { - this.maxAttemptsProvider = maxAttemptsProvider; - this.mode = "adaptive"; - const { rateLimiter } = options ?? {}; - this.rateLimiter = rateLimiter ?? new DefaultRateLimiter(); - this.standardRetryStrategy = new StandardRetryStrategy(maxAttemptsProvider); - } - async acquireInitialRetryToken(retryTokenScope) { - await this.rateLimiter.getSendToken(); - return this.standardRetryStrategy.acquireInitialRetryToken(retryTokenScope); - } - async refreshRetryTokenForRetry(tokenToRenew, errorInfo) { - this.rateLimiter.updateClientSendingRate(errorInfo); - return this.standardRetryStrategy.refreshRetryTokenForRetry(tokenToRenew, errorInfo); - } - recordSuccess(token) { - this.rateLimiter.updateClientSendingRate({}); - this.standardRetryStrategy.recordSuccess(token); - } - }; - __name(_AdaptiveRetryStrategy, "AdaptiveRetryStrategy"); - var AdaptiveRetryStrategy = _AdaptiveRetryStrategy; - var _ConfiguredRetryStrategy = class _ConfiguredRetryStrategy extends StandardRetryStrategy { - /** - * @param maxAttempts - the maximum number of retry attempts allowed. - * e.g., if set to 3, then 4 total requests are possible. - * @param computeNextBackoffDelay - a millisecond delay for each retry or a function that takes the retry attempt - * and returns the delay. - * - * @example exponential backoff. - * ```js - * new Client({ - * retryStrategy: new ConfiguredRetryStrategy(3, (attempt) => attempt ** 2) - * }); - * ``` - * @example constant delay. - * ```js - * new Client({ - * retryStrategy: new ConfiguredRetryStrategy(3, 2000) - * }); - * ``` - */ - constructor(maxAttempts, computeNextBackoffDelay = DEFAULT_RETRY_DELAY_BASE) { - super(typeof maxAttempts === "function" ? maxAttempts : async () => maxAttempts); - if (typeof computeNextBackoffDelay === "number") { - this.computeNextBackoffDelay = () => computeNextBackoffDelay; - } else { - this.computeNextBackoffDelay = computeNextBackoffDelay; - } - } - async refreshRetryTokenForRetry(tokenToRenew, errorInfo) { - const token = await super.refreshRetryTokenForRetry(tokenToRenew, errorInfo); - token.getRetryDelay = () => this.computeNextBackoffDelay(token.getRetryCount()); - return token; - } - }; - __name(_ConfiguredRetryStrategy, "ConfiguredRetryStrategy"); - var ConfiguredRetryStrategy = _ConfiguredRetryStrategy; - } -}); - -// ../../../node_modules/@smithy/middleware-retry/node_modules/@smithy/util-middleware/dist-cjs/index.js -var require_dist_cjs24 = __commonJS({ - "../../../node_modules/@smithy/middleware-retry/node_modules/@smithy/util-middleware/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); - } - return to; - }; - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - getSmithyContext: () => getSmithyContext4, - normalizeProvider: () => normalizeProvider2 - }); - module2.exports = __toCommonJS2(src_exports); - var import_types5 = require_dist_cjs(); - var getSmithyContext4 = /* @__PURE__ */ __name((context) => context[import_types5.SMITHY_CONTEXT_KEY] || (context[import_types5.SMITHY_CONTEXT_KEY] = {}), "getSmithyContext"); - var normalizeProvider2 = /* @__PURE__ */ __name((input) => { - if (typeof input === "function") - return input; - const promisified = Promise.resolve(input); - return () => promisified; - }, "normalizeProvider"); - } -}); - -// ../../../node_modules/@smithy/smithy-client/node_modules/@smithy/middleware-stack/dist-cjs/index.js -var require_dist_cjs25 = __commonJS({ - "../../../node_modules/@smithy/smithy-client/node_modules/@smithy/middleware-stack/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); - } - return to; - }; - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - constructStack: () => constructStack - }); - module2.exports = __toCommonJS2(src_exports); - var getAllAliases = /* @__PURE__ */ __name((name, aliases) => { - const _aliases = []; - if (name) { - _aliases.push(name); - } - if (aliases) { - for (const alias of aliases) { - _aliases.push(alias); - } - } - return _aliases; - }, "getAllAliases"); - var getMiddlewareNameWithAliases = /* @__PURE__ */ __name((name, aliases) => { - return `${name || "anonymous"}${aliases && aliases.length > 0 ? ` (a.k.a. ${aliases.join(",")})` : ""}`; - }, "getMiddlewareNameWithAliases"); - var constructStack = /* @__PURE__ */ __name(() => { - let absoluteEntries = []; - let relativeEntries = []; - let identifyOnResolve = false; - const entriesNameSet = /* @__PURE__ */ new Set(); - const sort = /* @__PURE__ */ __name((entries) => entries.sort( - (a, b) => stepWeights[b.step] - stepWeights[a.step] || priorityWeights[b.priority || "normal"] - priorityWeights[a.priority || "normal"] - ), "sort"); - const removeByName = /* @__PURE__ */ __name((toRemove) => { - let isRemoved = false; - const filterCb = /* @__PURE__ */ __name((entry) => { - const aliases = getAllAliases(entry.name, entry.aliases); - if (aliases.includes(toRemove)) { - isRemoved = true; - for (const alias of aliases) { - entriesNameSet.delete(alias); - } - return false; - } - return true; - }, "filterCb"); - absoluteEntries = absoluteEntries.filter(filterCb); - relativeEntries = relativeEntries.filter(filterCb); - return isRemoved; - }, "removeByName"); - const removeByReference = /* @__PURE__ */ __name((toRemove) => { - let isRemoved = false; - const filterCb = /* @__PURE__ */ __name((entry) => { - if (entry.middleware === toRemove) { - isRemoved = true; - for (const alias of getAllAliases(entry.name, entry.aliases)) { - entriesNameSet.delete(alias); - } - return false; - } - return true; - }, "filterCb"); - absoluteEntries = absoluteEntries.filter(filterCb); - relativeEntries = relativeEntries.filter(filterCb); - return isRemoved; - }, "removeByReference"); - const cloneTo = /* @__PURE__ */ __name((toStack) => { - var _a; - absoluteEntries.forEach((entry) => { - toStack.add(entry.middleware, { ...entry }); - }); - relativeEntries.forEach((entry) => { - toStack.addRelativeTo(entry.middleware, { ...entry }); - }); - (_a = toStack.identifyOnResolve) == null ? void 0 : _a.call(toStack, stack.identifyOnResolve()); - return toStack; - }, "cloneTo"); - const expandRelativeMiddlewareList = /* @__PURE__ */ __name((from) => { - const expandedMiddlewareList = []; - from.before.forEach((entry) => { - if (entry.before.length === 0 && entry.after.length === 0) { - expandedMiddlewareList.push(entry); - } else { - expandedMiddlewareList.push(...expandRelativeMiddlewareList(entry)); - } - }); - expandedMiddlewareList.push(from); - from.after.reverse().forEach((entry) => { - if (entry.before.length === 0 && entry.after.length === 0) { - expandedMiddlewareList.push(entry); - } else { - expandedMiddlewareList.push(...expandRelativeMiddlewareList(entry)); - } - }); - return expandedMiddlewareList; - }, "expandRelativeMiddlewareList"); - const getMiddlewareList = /* @__PURE__ */ __name((debug = false) => { - const normalizedAbsoluteEntries = []; - const normalizedRelativeEntries = []; - const normalizedEntriesNameMap = {}; - absoluteEntries.forEach((entry) => { - const normalizedEntry = { - ...entry, - before: [], - after: [] - }; - for (const alias of getAllAliases(normalizedEntry.name, normalizedEntry.aliases)) { - normalizedEntriesNameMap[alias] = normalizedEntry; - } - normalizedAbsoluteEntries.push(normalizedEntry); - }); - relativeEntries.forEach((entry) => { - const normalizedEntry = { - ...entry, - before: [], - after: [] - }; - for (const alias of getAllAliases(normalizedEntry.name, normalizedEntry.aliases)) { - normalizedEntriesNameMap[alias] = normalizedEntry; - } - normalizedRelativeEntries.push(normalizedEntry); - }); - normalizedRelativeEntries.forEach((entry) => { - if (entry.toMiddleware) { - const toMiddleware = normalizedEntriesNameMap[entry.toMiddleware]; - if (toMiddleware === void 0) { - if (debug) { - return; - } - throw new Error( - `${entry.toMiddleware} is not found when adding ${getMiddlewareNameWithAliases(entry.name, entry.aliases)} middleware ${entry.relation} ${entry.toMiddleware}` - ); - } - if (entry.relation === "after") { - toMiddleware.after.push(entry); - } - if (entry.relation === "before") { - toMiddleware.before.push(entry); - } - } - }); - const mainChain = sort(normalizedAbsoluteEntries).map(expandRelativeMiddlewareList).reduce( - (wholeList, expandedMiddlewareList) => { - wholeList.push(...expandedMiddlewareList); - return wholeList; - }, - [] - ); - return mainChain; - }, "getMiddlewareList"); - const stack = { - add: (middleware, options = {}) => { - const { name, override, aliases: _aliases } = options; - const entry = { - step: "initialize", - priority: "normal", - middleware, - ...options - }; - const aliases = getAllAliases(name, _aliases); - if (aliases.length > 0) { - if (aliases.some((alias) => entriesNameSet.has(alias))) { - if (!override) - throw new Error(`Duplicate middleware name '${getMiddlewareNameWithAliases(name, _aliases)}'`); - for (const alias of aliases) { - const toOverrideIndex = absoluteEntries.findIndex( - (entry2) => { - var _a; - return entry2.name === alias || ((_a = entry2.aliases) == null ? void 0 : _a.some((a) => a === alias)); - } - ); - if (toOverrideIndex === -1) { - continue; - } - const toOverride = absoluteEntries[toOverrideIndex]; - if (toOverride.step !== entry.step || entry.priority !== toOverride.priority) { - throw new Error( - `"${getMiddlewareNameWithAliases(toOverride.name, toOverride.aliases)}" middleware with ${toOverride.priority} priority in ${toOverride.step} step cannot be overridden by "${getMiddlewareNameWithAliases(name, _aliases)}" middleware with ${entry.priority} priority in ${entry.step} step.` - ); - } - absoluteEntries.splice(toOverrideIndex, 1); - } - } - for (const alias of aliases) { - entriesNameSet.add(alias); - } - } - absoluteEntries.push(entry); - }, - addRelativeTo: (middleware, options) => { - const { name, override, aliases: _aliases } = options; - const entry = { - middleware, - ...options - }; - const aliases = getAllAliases(name, _aliases); - if (aliases.length > 0) { - if (aliases.some((alias) => entriesNameSet.has(alias))) { - if (!override) - throw new Error(`Duplicate middleware name '${getMiddlewareNameWithAliases(name, _aliases)}'`); - for (const alias of aliases) { - const toOverrideIndex = relativeEntries.findIndex( - (entry2) => { - var _a; - return entry2.name === alias || ((_a = entry2.aliases) == null ? void 0 : _a.some((a) => a === alias)); - } - ); - if (toOverrideIndex === -1) { - continue; - } - const toOverride = relativeEntries[toOverrideIndex]; - if (toOverride.toMiddleware !== entry.toMiddleware || toOverride.relation !== entry.relation) { - throw new Error( - `"${getMiddlewareNameWithAliases(toOverride.name, toOverride.aliases)}" middleware ${toOverride.relation} "${toOverride.toMiddleware}" middleware cannot be overridden by "${getMiddlewareNameWithAliases(name, _aliases)}" middleware ${entry.relation} "${entry.toMiddleware}" middleware.` - ); - } - relativeEntries.splice(toOverrideIndex, 1); - } - } - for (const alias of aliases) { - entriesNameSet.add(alias); - } - } - relativeEntries.push(entry); - }, - clone: () => cloneTo(constructStack()), - use: (plugin) => { - plugin.applyToStack(stack); - }, - remove: (toRemove) => { - if (typeof toRemove === "string") - return removeByName(toRemove); - else - return removeByReference(toRemove); - }, - removeByTag: (toRemove) => { - let isRemoved = false; - const filterCb = /* @__PURE__ */ __name((entry) => { - const { tags, name, aliases: _aliases } = entry; - if (tags && tags.includes(toRemove)) { - const aliases = getAllAliases(name, _aliases); - for (const alias of aliases) { - entriesNameSet.delete(alias); - } - isRemoved = true; - return false; - } - return true; - }, "filterCb"); - absoluteEntries = absoluteEntries.filter(filterCb); - relativeEntries = relativeEntries.filter(filterCb); - return isRemoved; - }, - concat: (from) => { - var _a; - const cloned = cloneTo(constructStack()); - cloned.use(from); - cloned.identifyOnResolve( - identifyOnResolve || cloned.identifyOnResolve() || (((_a = from.identifyOnResolve) == null ? void 0 : _a.call(from)) ?? false) - ); - return cloned; - }, - applyToStack: cloneTo, - identify: () => { - return getMiddlewareList(true).map((mw) => { - const step = mw.step ?? mw.relation + " " + mw.toMiddleware; - return getMiddlewareNameWithAliases(mw.name, mw.aliases) + " - " + step; - }); - }, - identifyOnResolve(toggle) { - if (typeof toggle === "boolean") - identifyOnResolve = toggle; - return identifyOnResolve; - }, - resolve: (handler2, context) => { - for (const middleware of getMiddlewareList().map((entry) => entry.middleware).reverse()) { - handler2 = middleware(handler2, context); - } - if (identifyOnResolve) { - console.log(stack.identify()); - } - return handler2; - } - }; - return stack; - }, "constructStack"); - var stepWeights = { - initialize: 5, - serialize: 4, - build: 3, - finalizeRequest: 2, - deserialize: 1 - }; - var priorityWeights = { - high: 3, - normal: 2, - low: 1 - }; - } -}); - -// ../../../node_modules/@smithy/is-array-buffer/dist-cjs/index.js -var require_dist_cjs26 = __commonJS({ - "../../../node_modules/@smithy/is-array-buffer/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); - } - return to; - }; - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - isArrayBuffer: () => isArrayBuffer - }); - module2.exports = __toCommonJS2(src_exports); - var isArrayBuffer = /* @__PURE__ */ __name((arg) => typeof ArrayBuffer === "function" && arg instanceof ArrayBuffer || Object.prototype.toString.call(arg) === "[object ArrayBuffer]", "isArrayBuffer"); - } -}); - -// ../../../node_modules/@smithy/util-buffer-from/dist-cjs/index.js -var require_dist_cjs27 = __commonJS({ - "../../../node_modules/@smithy/util-buffer-from/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); - } - return to; - }; - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - fromArrayBuffer: () => fromArrayBuffer, - fromString: () => fromString - }); - module2.exports = __toCommonJS2(src_exports); - var import_is_array_buffer = require_dist_cjs26(); - var import_buffer = require("buffer"); - var fromArrayBuffer = /* @__PURE__ */ __name((input, offset = 0, length = input.byteLength - offset) => { - if (!(0, import_is_array_buffer.isArrayBuffer)(input)) { - throw new TypeError(`The "input" argument must be ArrayBuffer. Received type ${typeof input} (${input})`); - } - return import_buffer.Buffer.from(input, offset, length); - }, "fromArrayBuffer"); - var fromString = /* @__PURE__ */ __name((input, encoding) => { - if (typeof input !== "string") { - throw new TypeError(`The "input" argument must be of type string. Received type ${typeof input} (${input})`); - } - return encoding ? import_buffer.Buffer.from(input, encoding) : import_buffer.Buffer.from(input); - }, "fromString"); - } -}); - -// ../../../node_modules/@smithy/util-base64/dist-cjs/fromBase64.js -var require_fromBase64 = __commonJS({ - "../../../node_modules/@smithy/util-base64/dist-cjs/fromBase64.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.fromBase64 = void 0; - var util_buffer_from_1 = require_dist_cjs27(); - var BASE64_REGEX = /^[A-Za-z0-9+/]*={0,2}$/; - var fromBase642 = (input) => { - if (input.length * 3 % 4 !== 0) { - throw new TypeError(`Incorrect padding on base64 string.`); - } - if (!BASE64_REGEX.exec(input)) { - throw new TypeError(`Invalid base64 string.`); - } - const buffer = (0, util_buffer_from_1.fromString)(input, "base64"); - return new Uint8Array(buffer.buffer, buffer.byteOffset, buffer.byteLength); - }; - exports2.fromBase64 = fromBase642; - } -}); - -// ../../../node_modules/@smithy/util-utf8/dist-cjs/index.js -var require_dist_cjs28 = __commonJS({ - "../../../node_modules/@smithy/util-utf8/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); - } - return to; - }; - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - fromUtf8: () => fromUtf8, - toUint8Array: () => toUint8Array, - toUtf8: () => toUtf8 - }); - module2.exports = __toCommonJS2(src_exports); - var import_util_buffer_from = require_dist_cjs27(); - var fromUtf8 = /* @__PURE__ */ __name((input) => { - const buf = (0, import_util_buffer_from.fromString)(input, "utf8"); - return new Uint8Array(buf.buffer, buf.byteOffset, buf.byteLength / Uint8Array.BYTES_PER_ELEMENT); - }, "fromUtf8"); - var toUint8Array = /* @__PURE__ */ __name((data) => { - if (typeof data === "string") { - return fromUtf8(data); - } - if (ArrayBuffer.isView(data)) { - return new Uint8Array(data.buffer, data.byteOffset, data.byteLength / Uint8Array.BYTES_PER_ELEMENT); - } - return new Uint8Array(data); - }, "toUint8Array"); - var toUtf8 = /* @__PURE__ */ __name((input) => { - if (typeof input === "string") { - return input; - } - if (typeof input !== "object" || typeof input.byteOffset !== "number" || typeof input.byteLength !== "number") { - throw new Error("@smithy/util-utf8: toUtf8 encoder function only accepts string | Uint8Array."); - } - return (0, import_util_buffer_from.fromArrayBuffer)(input.buffer, input.byteOffset, input.byteLength).toString("utf8"); - }, "toUtf8"); - } -}); - -// ../../../node_modules/@smithy/util-base64/dist-cjs/toBase64.js -var require_toBase64 = __commonJS({ - "../../../node_modules/@smithy/util-base64/dist-cjs/toBase64.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.toBase64 = void 0; - var util_buffer_from_1 = require_dist_cjs27(); - var util_utf8_1 = require_dist_cjs28(); - var toBase642 = (_input) => { - let input; - if (typeof _input === "string") { - input = (0, util_utf8_1.fromUtf8)(_input); - } else { - input = _input; - } - if (typeof input !== "object" || typeof input.byteOffset !== "number" || typeof input.byteLength !== "number") { - throw new Error("@smithy/util-base64: toBase64 encoder function only accepts string | Uint8Array."); - } - return (0, util_buffer_from_1.fromArrayBuffer)(input.buffer, input.byteOffset, input.byteLength).toString("base64"); - }; - exports2.toBase64 = toBase642; - } -}); - -// ../../../node_modules/@smithy/util-base64/dist-cjs/index.js -var require_dist_cjs29 = __commonJS({ - "../../../node_modules/@smithy/util-base64/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); - } - return to; - }; - var __reExport = (target, mod, secondTarget) => (__copyProps2(target, mod, "default"), secondTarget && __copyProps2(secondTarget, mod, "default")); - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - module2.exports = __toCommonJS2(src_exports); - __reExport(src_exports, require_fromBase64(), module2.exports); - __reExport(src_exports, require_toBase64(), module2.exports); - } -}); - -// ../../../node_modules/@smithy/smithy-client/node_modules/@smithy/util-stream/dist-cjs/getAwsChunkedEncodingStream.js -var require_getAwsChunkedEncodingStream = __commonJS({ - "../../../node_modules/@smithy/smithy-client/node_modules/@smithy/util-stream/dist-cjs/getAwsChunkedEncodingStream.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.getAwsChunkedEncodingStream = void 0; - var stream_1 = require("stream"); - var getAwsChunkedEncodingStream2 = (readableStream, options) => { - const { base64Encoder, bodyLengthChecker, checksumAlgorithmFn, checksumLocationName, streamHasher } = options; - const checksumRequired = base64Encoder !== void 0 && checksumAlgorithmFn !== void 0 && checksumLocationName !== void 0 && streamHasher !== void 0; - const digest = checksumRequired ? streamHasher(checksumAlgorithmFn, readableStream) : void 0; - const awsChunkedEncodingStream = new stream_1.Readable({ read: () => { - } }); - readableStream.on("data", (data) => { - const length = bodyLengthChecker(data) || 0; - awsChunkedEncodingStream.push(`${length.toString(16)}\r -`); - awsChunkedEncodingStream.push(data); - awsChunkedEncodingStream.push("\r\n"); - }); - readableStream.on("end", async () => { - awsChunkedEncodingStream.push(`0\r -`); - if (checksumRequired) { - const checksum = base64Encoder(await digest); - awsChunkedEncodingStream.push(`${checksumLocationName}:${checksum}\r -`); - awsChunkedEncodingStream.push(`\r -`); - } - awsChunkedEncodingStream.push(null); - }); - return awsChunkedEncodingStream; - }; - exports2.getAwsChunkedEncodingStream = getAwsChunkedEncodingStream2; - } -}); - -// ../../../node_modules/@smithy/smithy-client/node_modules/@smithy/protocol-http/dist-cjs/index.js -var require_dist_cjs30 = __commonJS({ - "../../../node_modules/@smithy/smithy-client/node_modules/@smithy/protocol-http/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); - } - return to; - }; - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - Field: () => Field, - Fields: () => Fields, - HttpRequest: () => HttpRequest7, - HttpResponse: () => HttpResponse2, - IHttpRequest: () => import_types5.HttpRequest, - getHttpHandlerExtensionConfiguration: () => getHttpHandlerExtensionConfiguration, - isValidHostname: () => isValidHostname, - resolveHttpHandlerRuntimeConfig: () => resolveHttpHandlerRuntimeConfig - }); - module2.exports = __toCommonJS2(src_exports); - var getHttpHandlerExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - let httpHandler = runtimeConfig.httpHandler; - return { - setHttpHandler(handler2) { - httpHandler = handler2; - }, - httpHandler() { - return httpHandler; - }, - updateHttpClientConfig(key, value) { - httpHandler.updateHttpClientConfig(key, value); - }, - httpHandlerConfigs() { - return httpHandler.httpHandlerConfigs(); - } - }; - }, "getHttpHandlerExtensionConfiguration"); - var resolveHttpHandlerRuntimeConfig = /* @__PURE__ */ __name((httpHandlerExtensionConfiguration) => { - return { - httpHandler: httpHandlerExtensionConfiguration.httpHandler() - }; - }, "resolveHttpHandlerRuntimeConfig"); - var import_types5 = require_dist_cjs(); - var _Field = class _Field { - constructor({ name, kind = import_types5.FieldPosition.HEADER, values = [] }) { - this.name = name; - this.kind = kind; - this.values = values; - } - /** - * Appends a value to the field. - * - * @param value The value to append. - */ - add(value) { - this.values.push(value); - } - /** - * Overwrite existing field values. - * - * @param values The new field values. - */ - set(values) { - this.values = values; - } - /** - * Remove all matching entries from list. - * - * @param value Value to remove. - */ - remove(value) { - this.values = this.values.filter((v) => v !== value); - } - /** - * Get comma-delimited string. - * - * @returns String representation of {@link Field}. - */ - toString() { - return this.values.map((v) => v.includes(",") || v.includes(" ") ? `"${v}"` : v).join(", "); - } - /** - * Get string values as a list - * - * @returns Values in {@link Field} as a list. - */ - get() { - return this.values; - } - }; - __name(_Field, "Field"); - var Field = _Field; - var _Fields = class _Fields { - constructor({ fields = [], encoding = "utf-8" }) { - this.entries = {}; - fields.forEach(this.setField.bind(this)); - this.encoding = encoding; - } - /** - * Set entry for a {@link Field} name. The `name` - * attribute will be used to key the collection. - * - * @param field The {@link Field} to set. - */ - setField(field) { - this.entries[field.name.toLowerCase()] = field; - } - /** - * Retrieve {@link Field} entry by name. - * - * @param name The name of the {@link Field} entry - * to retrieve - * @returns The {@link Field} if it exists. - */ - getField(name) { - return this.entries[name.toLowerCase()]; - } - /** - * Delete entry from collection. - * - * @param name Name of the entry to delete. - */ - removeField(name) { - delete this.entries[name.toLowerCase()]; - } - /** - * Helper function for retrieving specific types of fields. - * Used to grab all headers or all trailers. - * - * @param kind {@link FieldPosition} of entries to retrieve. - * @returns The {@link Field} entries with the specified - * {@link FieldPosition}. - */ - getByType(kind) { - return Object.values(this.entries).filter((field) => field.kind === kind); - } - }; - __name(_Fields, "Fields"); - var Fields = _Fields; - var _HttpRequest = class _HttpRequest2 { - constructor(options) { - this.method = options.method || "GET"; - this.hostname = options.hostname || "localhost"; - this.port = options.port; - this.query = options.query || {}; - this.headers = options.headers || {}; - this.body = options.body; - this.protocol = options.protocol ? options.protocol.slice(-1) !== ":" ? `${options.protocol}:` : options.protocol : "https:"; - this.path = options.path ? options.path.charAt(0) !== "/" ? `/${options.path}` : options.path : "/"; - this.username = options.username; - this.password = options.password; - this.fragment = options.fragment; - } - /** - * Note: this does not deep-clone the body. - */ - static clone(request2) { - const cloned = new _HttpRequest2({ - ...request2, - headers: { ...request2.headers } - }); - if (cloned.query) { - cloned.query = cloneQuery(cloned.query); - } - return cloned; - } - /** - * This method only actually asserts that request is the interface {@link IHttpRequest}, - * and not necessarily this concrete class. Left in place for API stability. - * - * Do not call instance methods on the input of this function, and - * do not assume it has the HttpRequest prototype. - */ - static isInstance(request2) { - if (!request2) { - return false; - } - const req = request2; - return "method" in req && "protocol" in req && "hostname" in req && "path" in req && typeof req["query"] === "object" && typeof req["headers"] === "object"; - } - /** - * @deprecated use static HttpRequest.clone(request) instead. It's not safe to call - * this method because {@link HttpRequest.isInstance} incorrectly - * asserts that IHttpRequest (interface) objects are of type HttpRequest (class). - */ - clone() { - return _HttpRequest2.clone(this); - } - }; - __name(_HttpRequest, "HttpRequest"); - var HttpRequest7 = _HttpRequest; - function cloneQuery(query) { - return Object.keys(query).reduce((carry, paramName) => { - const param = query[paramName]; - return { - ...carry, - [paramName]: Array.isArray(param) ? [...param] : param - }; - }, {}); - } - __name(cloneQuery, "cloneQuery"); - var _HttpResponse = class _HttpResponse { - constructor(options) { - this.statusCode = options.statusCode; - this.reason = options.reason; - this.headers = options.headers || {}; - this.body = options.body; - } - static isInstance(response) { - if (!response) - return false; - const resp = response; - return typeof resp.statusCode === "number" && typeof resp.headers === "object"; - } - }; - __name(_HttpResponse, "HttpResponse"); - var HttpResponse2 = _HttpResponse; - function isValidHostname(hostname) { - const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/; - return hostPattern.test(hostname); - } - __name(isValidHostname, "isValidHostname"); - } -}); - -// ../../../node_modules/@smithy/util-uri-escape/dist-cjs/index.js -var require_dist_cjs31 = __commonJS({ - "../../../node_modules/@smithy/util-uri-escape/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); - } - return to; - }; - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - escapeUri: () => escapeUri, - escapeUriPath: () => escapeUriPath - }); - module2.exports = __toCommonJS2(src_exports); - var escapeUri = /* @__PURE__ */ __name((uri) => ( - // AWS percent-encodes some extra non-standard characters in a URI - encodeURIComponent(uri).replace(/[!'()*]/g, hexEncode) - ), "escapeUri"); - var hexEncode = /* @__PURE__ */ __name((c) => `%${c.charCodeAt(0).toString(16).toUpperCase()}`, "hexEncode"); - var escapeUriPath = /* @__PURE__ */ __name((uri) => uri.split("/").map(escapeUri).join("/"), "escapeUriPath"); - } -}); - -// ../../../node_modules/@smithy/querystring-builder/dist-cjs/index.js -var require_dist_cjs32 = __commonJS({ - "../../../node_modules/@smithy/querystring-builder/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); - } - return to; - }; - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - buildQueryString: () => buildQueryString - }); - module2.exports = __toCommonJS2(src_exports); - var import_util_uri_escape = require_dist_cjs31(); - function buildQueryString(query) { - const parts = []; - for (let key of Object.keys(query).sort()) { - const value = query[key]; - key = (0, import_util_uri_escape.escapeUri)(key); - if (Array.isArray(value)) { - for (let i = 0, iLen = value.length; i < iLen; i++) { - parts.push(`${key}=${(0, import_util_uri_escape.escapeUri)(value[i])}`); - } - } else { - let qsEntry = key; - if (value || typeof value === "string") { - qsEntry += `=${(0, import_util_uri_escape.escapeUri)(value)}`; - } - parts.push(qsEntry); - } - } - return parts.join("&"); - } - __name(buildQueryString, "buildQueryString"); - } -}); - -// ../../../node_modules/@smithy/smithy-client/node_modules/@smithy/node-http-handler/dist-cjs/index.js -var require_dist_cjs33 = __commonJS({ - "../../../node_modules/@smithy/smithy-client/node_modules/@smithy/node-http-handler/dist-cjs/index.js"(exports2, module2) { - var __create2 = Object.create; - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __getProtoOf2 = Object.getPrototypeOf; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); - } - return to; - }; - var __toESM2 = (mod, isNodeMode, target) => (target = mod != null ? __create2(__getProtoOf2(mod)) : {}, __copyProps2( - // If the importer is in node compatibility mode or this is not an ESM - // file that has been converted to a CommonJS file using a Babel- - // compatible transform (i.e. "__esModule" has not been set), then set - // "default" to the CommonJS "module.exports" for node compatibility. - isNodeMode || !mod || !mod.__esModule ? __defProp2(target, "default", { value: mod, enumerable: true }) : target, - mod - )); - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - DEFAULT_REQUEST_TIMEOUT: () => DEFAULT_REQUEST_TIMEOUT, - NodeHttp2Handler: () => NodeHttp2Handler, - NodeHttpHandler: () => NodeHttpHandler, - streamCollector: () => streamCollector - }); - module2.exports = __toCommonJS2(src_exports); - var import_protocol_http8 = require_dist_cjs30(); - var import_querystring_builder = require_dist_cjs32(); - var import_http2 = require("http"); - var import_https = require("https"); - var NODEJS_TIMEOUT_ERROR_CODES = ["ECONNRESET", "EPIPE", "ETIMEDOUT"]; - var getTransformedHeaders = /* @__PURE__ */ __name((headers) => { - const transformedHeaders = {}; - for (const name of Object.keys(headers)) { - const headerValues = headers[name]; - transformedHeaders[name] = Array.isArray(headerValues) ? headerValues.join(",") : headerValues; - } - return transformedHeaders; - }, "getTransformedHeaders"); - var DEFER_EVENT_LISTENER_TIME = 1e3; - var setConnectionTimeout = /* @__PURE__ */ __name((request2, reject, timeoutInMs = 0) => { - if (!timeoutInMs) { - return -1; - } - const registerTimeout = /* @__PURE__ */ __name((offset) => { - const timeoutId = setTimeout(() => { - request2.destroy(); - reject( - Object.assign(new Error(`Socket timed out without establishing a connection within ${timeoutInMs} ms`), { - name: "TimeoutError" - }) - ); - }, timeoutInMs - offset); - const doWithSocket = /* @__PURE__ */ __name((socket) => { - if (socket == null ? void 0 : socket.connecting) { - socket.on("connect", () => { - clearTimeout(timeoutId); - }); - } else { - clearTimeout(timeoutId); - } - }, "doWithSocket"); - if (request2.socket) { - doWithSocket(request2.socket); - } else { - request2.on("socket", doWithSocket); - } - }, "registerTimeout"); - if (timeoutInMs < 2e3) { - registerTimeout(0); - return 0; - } - return setTimeout(registerTimeout.bind(null, DEFER_EVENT_LISTENER_TIME), DEFER_EVENT_LISTENER_TIME); - }, "setConnectionTimeout"); - var DEFER_EVENT_LISTENER_TIME2 = 3e3; - var setSocketKeepAlive = /* @__PURE__ */ __name((request2, { keepAlive, keepAliveMsecs }, deferTimeMs = DEFER_EVENT_LISTENER_TIME2) => { - if (keepAlive !== true) { - return -1; - } - const registerListener = /* @__PURE__ */ __name(() => { - if (request2.socket) { - request2.socket.setKeepAlive(keepAlive, keepAliveMsecs || 0); - } else { - request2.on("socket", (socket) => { - socket.setKeepAlive(keepAlive, keepAliveMsecs || 0); - }); - } - }, "registerListener"); - if (deferTimeMs === 0) { - registerListener(); - return 0; - } - return setTimeout(registerListener, deferTimeMs); - }, "setSocketKeepAlive"); - var DEFER_EVENT_LISTENER_TIME3 = 3e3; - var setSocketTimeout = /* @__PURE__ */ __name((request2, reject, timeoutInMs = 0) => { - const registerTimeout = /* @__PURE__ */ __name((offset) => { - request2.setTimeout(timeoutInMs - offset, () => { - request2.destroy(); - reject(Object.assign(new Error(`Connection timed out after ${timeoutInMs} ms`), { name: "TimeoutError" })); - }); - }, "registerTimeout"); - if (0 < timeoutInMs && timeoutInMs < 6e3) { - registerTimeout(0); - return 0; - } - return setTimeout( - registerTimeout.bind(null, timeoutInMs === 0 ? 0 : DEFER_EVENT_LISTENER_TIME3), - DEFER_EVENT_LISTENER_TIME3 - ); - }, "setSocketTimeout"); - var import_stream = require("stream"); - var MIN_WAIT_TIME = 1e3; - async function writeRequestBody(httpRequest, request2, maxContinueTimeoutMs = MIN_WAIT_TIME) { - const headers = request2.headers ?? {}; - const expect = headers["Expect"] || headers["expect"]; - let timeoutId = -1; - let hasError = false; - if (expect === "100-continue") { - await Promise.race([ - new Promise((resolve) => { - timeoutId = Number(setTimeout(resolve, Math.max(MIN_WAIT_TIME, maxContinueTimeoutMs))); - }), - new Promise((resolve) => { - httpRequest.on("continue", () => { - clearTimeout(timeoutId); - resolve(); - }); - httpRequest.on("error", () => { - hasError = true; - clearTimeout(timeoutId); - resolve(); - }); - }) - ]); - } - if (!hasError) { - writeBody(httpRequest, request2.body); - } - } - __name(writeRequestBody, "writeRequestBody"); - function writeBody(httpRequest, body) { - if (body instanceof import_stream.Readable) { - body.pipe(httpRequest); - return; - } - if (body) { - if (Buffer.isBuffer(body) || typeof body === "string") { - httpRequest.end(body); - return; - } - const uint8 = body; - if (typeof uint8 === "object" && uint8.buffer && typeof uint8.byteOffset === "number" && typeof uint8.byteLength === "number") { - httpRequest.end(Buffer.from(uint8.buffer, uint8.byteOffset, uint8.byteLength)); - return; - } - httpRequest.end(Buffer.from(body)); - return; - } - httpRequest.end(); - } - __name(writeBody, "writeBody"); - var DEFAULT_REQUEST_TIMEOUT = 0; - var _NodeHttpHandler = class _NodeHttpHandler2 { - constructor(options) { - this.socketWarningTimestamp = 0; - this.metadata = { handlerProtocol: "http/1.1" }; - this.configProvider = new Promise((resolve, reject) => { - if (typeof options === "function") { - options().then((_options) => { - resolve(this.resolveDefaultConfig(_options)); - }).catch(reject); - } else { - resolve(this.resolveDefaultConfig(options)); - } - }); - } - /** - * @returns the input if it is an HttpHandler of any class, - * or instantiates a new instance of this handler. - */ - static create(instanceOrOptions) { - if (typeof (instanceOrOptions == null ? void 0 : instanceOrOptions.handle) === "function") { - return instanceOrOptions; - } - return new _NodeHttpHandler2(instanceOrOptions); - } - /** - * @internal - * - * @param agent - http(s) agent in use by the NodeHttpHandler instance. - * @param socketWarningTimestamp - last socket usage check timestamp. - * @param logger - channel for the warning. - * @returns timestamp of last emitted warning. - */ - static checkSocketUsage(agent, socketWarningTimestamp, logger = console) { - var _a, _b, _c; - const { sockets, requests, maxSockets } = agent; - if (typeof maxSockets !== "number" || maxSockets === Infinity) { - return socketWarningTimestamp; - } - const interval = 15e3; - if (Date.now() - interval < socketWarningTimestamp) { - return socketWarningTimestamp; - } - if (sockets && requests) { - for (const origin in sockets) { - const socketsInUse = ((_a = sockets[origin]) == null ? void 0 : _a.length) ?? 0; - const requestsEnqueued = ((_b = requests[origin]) == null ? void 0 : _b.length) ?? 0; - if (socketsInUse >= maxSockets && requestsEnqueued >= 2 * maxSockets) { - (_c = logger == null ? void 0 : logger.warn) == null ? void 0 : _c.call( - logger, - `@smithy/node-http-handler:WARN - socket usage at capacity=${socketsInUse} and ${requestsEnqueued} additional requests are enqueued. -See https://docs.aws.amazon.com/sdk-for-javascript/v3/developer-guide/node-configuring-maxsockets.html -or increase socketAcquisitionWarningTimeout=(millis) in the NodeHttpHandler config.` - ); - return Date.now(); - } - } - } - return socketWarningTimestamp; - } - resolveDefaultConfig(options) { - const { requestTimeout, connectionTimeout, socketTimeout, httpAgent, httpsAgent } = options || {}; - const keepAlive = true; - const maxSockets = 50; - return { - connectionTimeout, - requestTimeout: requestTimeout ?? socketTimeout, - httpAgent: (() => { - if (httpAgent instanceof import_http2.Agent || typeof (httpAgent == null ? void 0 : httpAgent.destroy) === "function") { - return httpAgent; - } - return new import_http2.Agent({ keepAlive, maxSockets, ...httpAgent }); - })(), - httpsAgent: (() => { - if (httpsAgent instanceof import_https.Agent || typeof (httpsAgent == null ? void 0 : httpsAgent.destroy) === "function") { - return httpsAgent; - } - return new import_https.Agent({ keepAlive, maxSockets, ...httpsAgent }); - })(), - logger: console - }; - } - destroy() { - var _a, _b, _c, _d; - (_b = (_a = this.config) == null ? void 0 : _a.httpAgent) == null ? void 0 : _b.destroy(); - (_d = (_c = this.config) == null ? void 0 : _c.httpsAgent) == null ? void 0 : _d.destroy(); - } - async handle(request2, { abortSignal } = {}) { - if (!this.config) { - this.config = await this.configProvider; - } - return new Promise((_resolve, _reject) => { - let writeRequestBodyPromise = void 0; - const timeouts = []; - const resolve = /* @__PURE__ */ __name(async (arg) => { - await writeRequestBodyPromise; - timeouts.forEach(clearTimeout); - _resolve(arg); - }, "resolve"); - const reject = /* @__PURE__ */ __name(async (arg) => { - await writeRequestBodyPromise; - timeouts.forEach(clearTimeout); - _reject(arg); - }, "reject"); - if (!this.config) { - throw new Error("Node HTTP request handler config is not resolved"); - } - if (abortSignal == null ? void 0 : abortSignal.aborted) { - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - reject(abortError); - return; - } - const isSSL = request2.protocol === "https:"; - const agent = isSSL ? this.config.httpsAgent : this.config.httpAgent; - timeouts.push( - setTimeout( - () => { - this.socketWarningTimestamp = _NodeHttpHandler2.checkSocketUsage( - agent, - this.socketWarningTimestamp, - this.config.logger - ); - }, - this.config.socketAcquisitionWarningTimeout ?? (this.config.requestTimeout ?? 2e3) + (this.config.connectionTimeout ?? 1e3) - ) - ); - const queryString = (0, import_querystring_builder.buildQueryString)(request2.query || {}); - let auth = void 0; - if (request2.username != null || request2.password != null) { - const username = request2.username ?? ""; - const password = request2.password ?? ""; - auth = `${username}:${password}`; - } - let path = request2.path; - if (queryString) { - path += `?${queryString}`; - } - if (request2.fragment) { - path += `#${request2.fragment}`; - } - let hostname = request2.hostname ?? ""; - if (hostname[0] === "[" && hostname.endsWith("]")) { - hostname = request2.hostname.slice(1, -1); - } else { - hostname = request2.hostname; - } - const nodeHttpsOptions = { - headers: request2.headers, - host: hostname, - method: request2.method, - path, - port: request2.port, - agent, - auth - }; - const requestFunc = isSSL ? import_https.request : import_http2.request; - const req = requestFunc(nodeHttpsOptions, (res) => { - const httpResponse = new import_protocol_http8.HttpResponse({ - statusCode: res.statusCode || -1, - reason: res.statusMessage, - headers: getTransformedHeaders(res.headers), - body: res - }); - resolve({ response: httpResponse }); - }); - req.on("error", (err) => { - if (NODEJS_TIMEOUT_ERROR_CODES.includes(err.code)) { - reject(Object.assign(err, { name: "TimeoutError" })); - } else { - reject(err); - } - }); - if (abortSignal) { - const onAbort = /* @__PURE__ */ __name(() => { - req.destroy(); - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - reject(abortError); - }, "onAbort"); - if (typeof abortSignal.addEventListener === "function") { - const signal = abortSignal; - signal.addEventListener("abort", onAbort, { once: true }); - req.once("close", () => signal.removeEventListener("abort", onAbort)); - } else { - abortSignal.onabort = onAbort; - } - } - timeouts.push(setConnectionTimeout(req, reject, this.config.connectionTimeout)); - timeouts.push(setSocketTimeout(req, reject, this.config.requestTimeout)); - const httpAgent = nodeHttpsOptions.agent; - if (typeof httpAgent === "object" && "keepAlive" in httpAgent) { - timeouts.push( - setSocketKeepAlive(req, { - // @ts-expect-error keepAlive is not public on httpAgent. - keepAlive: httpAgent.keepAlive, - // @ts-expect-error keepAliveMsecs is not public on httpAgent. - keepAliveMsecs: httpAgent.keepAliveMsecs - }) - ); - } - writeRequestBodyPromise = writeRequestBody(req, request2, this.config.requestTimeout).catch((e) => { - timeouts.forEach(clearTimeout); - return _reject(e); - }); - }); - } - updateHttpClientConfig(key, value) { - this.config = void 0; - this.configProvider = this.configProvider.then((config) => { - return { - ...config, - [key]: value - }; - }); - } - httpHandlerConfigs() { - return this.config ?? {}; - } - }; - __name(_NodeHttpHandler, "NodeHttpHandler"); - var NodeHttpHandler = _NodeHttpHandler; - var import_http22 = require("http2"); - var import_http23 = __toESM2(require("http2")); - var _NodeHttp2ConnectionPool = class _NodeHttp2ConnectionPool { - constructor(sessions) { - this.sessions = []; - this.sessions = sessions ?? []; - } - poll() { - if (this.sessions.length > 0) { - return this.sessions.shift(); - } - } - offerLast(session) { - this.sessions.push(session); - } - contains(session) { - return this.sessions.includes(session); - } - remove(session) { - this.sessions = this.sessions.filter((s) => s !== session); - } - [Symbol.iterator]() { - return this.sessions[Symbol.iterator](); - } - destroy(connection) { - for (const session of this.sessions) { - if (session === connection) { - if (!session.destroyed) { - session.destroy(); - } - } - } - } - }; - __name(_NodeHttp2ConnectionPool, "NodeHttp2ConnectionPool"); - var NodeHttp2ConnectionPool = _NodeHttp2ConnectionPool; - var _NodeHttp2ConnectionManager = class _NodeHttp2ConnectionManager { - constructor(config) { - this.sessionCache = /* @__PURE__ */ new Map(); - this.config = config; - if (this.config.maxConcurrency && this.config.maxConcurrency <= 0) { - throw new RangeError("maxConcurrency must be greater than zero."); - } - } - lease(requestContext, connectionConfiguration) { - const url2 = this.getUrlString(requestContext); - const existingPool = this.sessionCache.get(url2); - if (existingPool) { - const existingSession = existingPool.poll(); - if (existingSession && !this.config.disableConcurrency) { - return existingSession; - } - } - const session = import_http23.default.connect(url2); - if (this.config.maxConcurrency) { - session.settings({ maxConcurrentStreams: this.config.maxConcurrency }, (err) => { - if (err) { - throw new Error( - "Fail to set maxConcurrentStreams to " + this.config.maxConcurrency + "when creating new session for " + requestContext.destination.toString() - ); - } - }); - } - session.unref(); - const destroySessionCb = /* @__PURE__ */ __name(() => { - session.destroy(); - this.deleteSession(url2, session); - }, "destroySessionCb"); - session.on("goaway", destroySessionCb); - session.on("error", destroySessionCb); - session.on("frameError", destroySessionCb); - session.on("close", () => this.deleteSession(url2, session)); - if (connectionConfiguration.requestTimeout) { - session.setTimeout(connectionConfiguration.requestTimeout, destroySessionCb); - } - const connectionPool = this.sessionCache.get(url2) || new NodeHttp2ConnectionPool(); - connectionPool.offerLast(session); - this.sessionCache.set(url2, connectionPool); - return session; - } - /** - * Delete a session from the connection pool. - * @param authority The authority of the session to delete. - * @param session The session to delete. - */ - deleteSession(authority, session) { - const existingConnectionPool = this.sessionCache.get(authority); - if (!existingConnectionPool) { - return; - } - if (!existingConnectionPool.contains(session)) { - return; - } - existingConnectionPool.remove(session); - this.sessionCache.set(authority, existingConnectionPool); - } - release(requestContext, session) { - var _a; - const cacheKey = this.getUrlString(requestContext); - (_a = this.sessionCache.get(cacheKey)) == null ? void 0 : _a.offerLast(session); - } - destroy() { - for (const [key, connectionPool] of this.sessionCache) { - for (const session of connectionPool) { - if (!session.destroyed) { - session.destroy(); - } - connectionPool.remove(session); - } - this.sessionCache.delete(key); - } - } - setMaxConcurrentStreams(maxConcurrentStreams) { - if (this.config.maxConcurrency && this.config.maxConcurrency <= 0) { - throw new RangeError("maxConcurrentStreams must be greater than zero."); - } - this.config.maxConcurrency = maxConcurrentStreams; - } - setDisableConcurrentStreams(disableConcurrentStreams) { - this.config.disableConcurrency = disableConcurrentStreams; - } - getUrlString(request2) { - return request2.destination.toString(); - } - }; - __name(_NodeHttp2ConnectionManager, "NodeHttp2ConnectionManager"); - var NodeHttp2ConnectionManager = _NodeHttp2ConnectionManager; - var _NodeHttp2Handler = class _NodeHttp2Handler2 { - constructor(options) { - this.metadata = { handlerProtocol: "h2" }; - this.connectionManager = new NodeHttp2ConnectionManager({}); - this.configProvider = new Promise((resolve, reject) => { - if (typeof options === "function") { - options().then((opts) => { - resolve(opts || {}); - }).catch(reject); - } else { - resolve(options || {}); - } - }); - } - /** - * @returns the input if it is an HttpHandler of any class, - * or instantiates a new instance of this handler. - */ - static create(instanceOrOptions) { - if (typeof (instanceOrOptions == null ? void 0 : instanceOrOptions.handle) === "function") { - return instanceOrOptions; - } - return new _NodeHttp2Handler2(instanceOrOptions); - } - destroy() { - this.connectionManager.destroy(); - } - async handle(request2, { abortSignal } = {}) { - if (!this.config) { - this.config = await this.configProvider; - this.connectionManager.setDisableConcurrentStreams(this.config.disableConcurrentStreams || false); - if (this.config.maxConcurrentStreams) { - this.connectionManager.setMaxConcurrentStreams(this.config.maxConcurrentStreams); - } - } - const { requestTimeout, disableConcurrentStreams } = this.config; - return new Promise((_resolve, _reject) => { - var _a; - let fulfilled = false; - let writeRequestBodyPromise = void 0; - const resolve = /* @__PURE__ */ __name(async (arg) => { - await writeRequestBodyPromise; - _resolve(arg); - }, "resolve"); - const reject = /* @__PURE__ */ __name(async (arg) => { - await writeRequestBodyPromise; - _reject(arg); - }, "reject"); - if (abortSignal == null ? void 0 : abortSignal.aborted) { - fulfilled = true; - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - reject(abortError); - return; - } - const { hostname, method, port, protocol, query } = request2; - let auth = ""; - if (request2.username != null || request2.password != null) { - const username = request2.username ?? ""; - const password = request2.password ?? ""; - auth = `${username}:${password}@`; - } - const authority = `${protocol}//${auth}${hostname}${port ? `:${port}` : ""}`; - const requestContext = { destination: new URL(authority) }; - const session = this.connectionManager.lease(requestContext, { - requestTimeout: (_a = this.config) == null ? void 0 : _a.sessionTimeout, - disableConcurrentStreams: disableConcurrentStreams || false - }); - const rejectWithDestroy = /* @__PURE__ */ __name((err) => { - if (disableConcurrentStreams) { - this.destroySession(session); - } - fulfilled = true; - reject(err); - }, "rejectWithDestroy"); - const queryString = (0, import_querystring_builder.buildQueryString)(query || {}); - let path = request2.path; - if (queryString) { - path += `?${queryString}`; - } - if (request2.fragment) { - path += `#${request2.fragment}`; - } - const req = session.request({ - ...request2.headers, - [import_http22.constants.HTTP2_HEADER_PATH]: path, - [import_http22.constants.HTTP2_HEADER_METHOD]: method - }); - session.ref(); - req.on("response", (headers) => { - const httpResponse = new import_protocol_http8.HttpResponse({ - statusCode: headers[":status"] || -1, - headers: getTransformedHeaders(headers), - body: req - }); - fulfilled = true; - resolve({ response: httpResponse }); - if (disableConcurrentStreams) { - session.close(); - this.connectionManager.deleteSession(authority, session); - } - }); - if (requestTimeout) { - req.setTimeout(requestTimeout, () => { - req.close(); - const timeoutError = new Error(`Stream timed out because of no activity for ${requestTimeout} ms`); - timeoutError.name = "TimeoutError"; - rejectWithDestroy(timeoutError); - }); - } - if (abortSignal) { - const onAbort = /* @__PURE__ */ __name(() => { - req.close(); - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - rejectWithDestroy(abortError); - }, "onAbort"); - if (typeof abortSignal.addEventListener === "function") { - const signal = abortSignal; - signal.addEventListener("abort", onAbort, { once: true }); - req.once("close", () => signal.removeEventListener("abort", onAbort)); - } else { - abortSignal.onabort = onAbort; - } - } - req.on("frameError", (type, code, id) => { - rejectWithDestroy(new Error(`Frame type id ${type} in stream id ${id} has failed with code ${code}.`)); - }); - req.on("error", rejectWithDestroy); - req.on("aborted", () => { - rejectWithDestroy( - new Error(`HTTP/2 stream is abnormally aborted in mid-communication with result code ${req.rstCode}.`) - ); - }); - req.on("close", () => { - session.unref(); - if (disableConcurrentStreams) { - session.destroy(); - } - if (!fulfilled) { - rejectWithDestroy(new Error("Unexpected error: http2 request did not get a response")); - } - }); - writeRequestBodyPromise = writeRequestBody(req, request2, requestTimeout); - }); - } - updateHttpClientConfig(key, value) { - this.config = void 0; - this.configProvider = this.configProvider.then((config) => { - return { - ...config, - [key]: value - }; - }); - } - httpHandlerConfigs() { - return this.config ?? {}; - } - /** - * Destroys a session. - * @param session The session to destroy. - */ - destroySession(session) { - if (!session.destroyed) { - session.destroy(); - } - } - }; - __name(_NodeHttp2Handler, "NodeHttp2Handler"); - var NodeHttp2Handler = _NodeHttp2Handler; - var _Collector = class _Collector extends import_stream.Writable { - constructor() { - super(...arguments); - this.bufferedBytes = []; - } - _write(chunk, encoding, callback) { - this.bufferedBytes.push(chunk); - callback(); - } - }; - __name(_Collector, "Collector"); - var Collector = _Collector; - var streamCollector = /* @__PURE__ */ __name((stream) => { - if (isReadableStreamInstance(stream)) { - return collectReadableStream(stream); - } - return new Promise((resolve, reject) => { - const collector = new Collector(); - stream.pipe(collector); - stream.on("error", (err) => { - collector.end(); - reject(err); - }); - collector.on("error", reject); - collector.on("finish", function() { - const bytes = new Uint8Array(Buffer.concat(this.bufferedBytes)); - resolve(bytes); - }); - }); - }, "streamCollector"); - var isReadableStreamInstance = /* @__PURE__ */ __name((stream) => typeof ReadableStream === "function" && stream instanceof ReadableStream, "isReadableStreamInstance"); - async function collectReadableStream(stream) { - const chunks = []; - const reader = stream.getReader(); - let isDone = false; - let length = 0; - while (!isDone) { - const { done, value } = await reader.read(); - if (value) { - chunks.push(value); - length += value.length; - } - isDone = done; - } - const collected = new Uint8Array(length); - let offset = 0; - for (const chunk of chunks) { - collected.set(chunk, offset); - offset += chunk.length; - } - return collected; - } - __name(collectReadableStream, "collectReadableStream"); - } -}); - -// ../../../node_modules/@smithy/smithy-client/node_modules/@smithy/fetch-http-handler/dist-cjs/index.js -var require_dist_cjs34 = __commonJS({ - "../../../node_modules/@smithy/smithy-client/node_modules/@smithy/fetch-http-handler/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); - } - return to; - }; - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - FetchHttpHandler: () => FetchHttpHandler, - keepAliveSupport: () => keepAliveSupport, - streamCollector: () => streamCollector - }); - module2.exports = __toCommonJS2(src_exports); - var import_protocol_http8 = require_dist_cjs30(); - var import_querystring_builder = require_dist_cjs32(); - function requestTimeout(timeoutInMs = 0) { - return new Promise((resolve, reject) => { - if (timeoutInMs) { - setTimeout(() => { - const timeoutError = new Error(`Request did not complete within ${timeoutInMs} ms`); - timeoutError.name = "TimeoutError"; - reject(timeoutError); - }, timeoutInMs); - } - }); - } - __name(requestTimeout, "requestTimeout"); - var keepAliveSupport = { - supported: void 0 - }; - var _FetchHttpHandler = class _FetchHttpHandler2 { - /** - * @returns the input if it is an HttpHandler of any class, - * or instantiates a new instance of this handler. - */ - static create(instanceOrOptions) { - if (typeof (instanceOrOptions == null ? void 0 : instanceOrOptions.handle) === "function") { - return instanceOrOptions; - } - return new _FetchHttpHandler2(instanceOrOptions); - } - constructor(options) { - if (typeof options === "function") { - this.configProvider = options().then((opts) => opts || {}); - } else { - this.config = options ?? {}; - this.configProvider = Promise.resolve(this.config); - } - if (keepAliveSupport.supported === void 0) { - keepAliveSupport.supported = Boolean( - typeof Request !== "undefined" && "keepalive" in new Request("https://[::1]") - ); - } - } - destroy() { - } - async handle(request2, { abortSignal } = {}) { - var _a; - if (!this.config) { - this.config = await this.configProvider; - } - const requestTimeoutInMs = this.config.requestTimeout; - const keepAlive = this.config.keepAlive === true; - const credentials = this.config.credentials; - if (abortSignal == null ? void 0 : abortSignal.aborted) { - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - return Promise.reject(abortError); - } - let path = request2.path; - const queryString = (0, import_querystring_builder.buildQueryString)(request2.query || {}); - if (queryString) { - path += `?${queryString}`; - } - if (request2.fragment) { - path += `#${request2.fragment}`; - } - let auth = ""; - if (request2.username != null || request2.password != null) { - const username = request2.username ?? ""; - const password = request2.password ?? ""; - auth = `${username}:${password}@`; - } - const { port, method } = request2; - const url2 = `${request2.protocol}//${auth}${request2.hostname}${port ? `:${port}` : ""}${path}`; - const body = method === "GET" || method === "HEAD" ? void 0 : request2.body; - const requestOptions = { - body, - headers: new Headers(request2.headers), - method, - credentials - }; - if ((_a = this.config) == null ? void 0 : _a.cache) { - requestOptions.cache = this.config.cache; - } - if (body) { - requestOptions.duplex = "half"; - } - if (typeof AbortController !== "undefined") { - requestOptions.signal = abortSignal; - } - if (keepAliveSupport.supported) { - requestOptions.keepalive = keepAlive; - } - if (typeof this.config.requestInit === "function") { - Object.assign(requestOptions, this.config.requestInit(request2)); - } - let removeSignalEventListener = /* @__PURE__ */ __name(() => { - }, "removeSignalEventListener"); - const fetchRequest = new Request(url2, requestOptions); - const raceOfPromises = [ - fetch(fetchRequest).then((response) => { - const fetchHeaders = response.headers; - const transformedHeaders = {}; - for (const pair of fetchHeaders.entries()) { - transformedHeaders[pair[0]] = pair[1]; - } - const hasReadableStream = response.body != void 0; - if (!hasReadableStream) { - return response.blob().then((body2) => ({ - response: new import_protocol_http8.HttpResponse({ - headers: transformedHeaders, - reason: response.statusText, - statusCode: response.status, - body: body2 - }) - })); - } - return { - response: new import_protocol_http8.HttpResponse({ - headers: transformedHeaders, - reason: response.statusText, - statusCode: response.status, - body: response.body - }) - }; - }), - requestTimeout(requestTimeoutInMs) - ]; - if (abortSignal) { - raceOfPromises.push( - new Promise((resolve, reject) => { - const onAbort = /* @__PURE__ */ __name(() => { - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - reject(abortError); - }, "onAbort"); - if (typeof abortSignal.addEventListener === "function") { - const signal = abortSignal; - signal.addEventListener("abort", onAbort, { once: true }); - removeSignalEventListener = /* @__PURE__ */ __name(() => signal.removeEventListener("abort", onAbort), "removeSignalEventListener"); - } else { - abortSignal.onabort = onAbort; - } - }) - ); - } - return Promise.race(raceOfPromises).finally(removeSignalEventListener); - } - updateHttpClientConfig(key, value) { - this.config = void 0; - this.configProvider = this.configProvider.then((config) => { - config[key] = value; - return config; - }); - } - httpHandlerConfigs() { - return this.config ?? {}; - } - }; - __name(_FetchHttpHandler, "FetchHttpHandler"); - var FetchHttpHandler = _FetchHttpHandler; - var import_util_base64 = require_dist_cjs29(); - var streamCollector = /* @__PURE__ */ __name((stream) => { - if (typeof Blob === "function" && stream instanceof Blob) { - return collectBlob(stream); - } - return collectStream(stream); - }, "streamCollector"); - async function collectBlob(blob) { - const base64 = await readToBase64(blob); - const arrayBuffer = (0, import_util_base64.fromBase64)(base64); - return new Uint8Array(arrayBuffer); - } - __name(collectBlob, "collectBlob"); - async function collectStream(stream) { - const chunks = []; - const reader = stream.getReader(); - let isDone = false; - let length = 0; - while (!isDone) { - const { done, value } = await reader.read(); - if (value) { - chunks.push(value); - length += value.length; - } - isDone = done; - } - const collected = new Uint8Array(length); - let offset = 0; - for (const chunk of chunks) { - collected.set(chunk, offset); - offset += chunk.length; - } - return collected; - } - __name(collectStream, "collectStream"); - function readToBase64(blob) { - return new Promise((resolve, reject) => { - const reader = new FileReader(); - reader.onloadend = () => { - if (reader.readyState !== 2) { - return reject(new Error("Reader aborted too early")); - } - const result = reader.result ?? ""; - const commaIndex = result.indexOf(","); - const dataOffset = commaIndex > -1 ? commaIndex + 1 : result.length; - resolve(result.substring(dataOffset)); - }; - reader.onabort = () => reject(new Error("Read aborted")); - reader.onerror = () => reject(reader.error); - reader.readAsDataURL(blob); - }); - } - __name(readToBase64, "readToBase64"); - } -}); - -// ../../../node_modules/@smithy/util-hex-encoding/dist-cjs/index.js -var require_dist_cjs35 = __commonJS({ - "../../../node_modules/@smithy/util-hex-encoding/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); - } - return to; - }; - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - fromHex: () => fromHex, - toHex: () => toHex - }); - module2.exports = __toCommonJS2(src_exports); - var SHORT_TO_HEX = {}; - var HEX_TO_SHORT = {}; - for (let i = 0; i < 256; i++) { - let encodedByte = i.toString(16).toLowerCase(); - if (encodedByte.length === 1) { - encodedByte = `0${encodedByte}`; - } - SHORT_TO_HEX[i] = encodedByte; - HEX_TO_SHORT[encodedByte] = i; - } - function fromHex(encoded) { - if (encoded.length % 2 !== 0) { - throw new Error("Hex encoded strings must have an even number length"); - } - const out = new Uint8Array(encoded.length / 2); - for (let i = 0; i < encoded.length; i += 2) { - const encodedByte = encoded.slice(i, i + 2).toLowerCase(); - if (encodedByte in HEX_TO_SHORT) { - out[i / 2] = HEX_TO_SHORT[encodedByte]; - } else { - throw new Error(`Cannot decode unrecognized sequence ${encodedByte} as hexadecimal`); - } - } - return out; - } - __name(fromHex, "fromHex"); - function toHex(bytes) { - let out = ""; - for (let i = 0; i < bytes.byteLength; i++) { - out += SHORT_TO_HEX[bytes[i]]; - } - return out; - } - __name(toHex, "toHex"); - } -}); - -// ../../../node_modules/@smithy/smithy-client/node_modules/@smithy/util-stream/dist-cjs/stream-type-check.js -var require_stream_type_check = __commonJS({ - "../../../node_modules/@smithy/smithy-client/node_modules/@smithy/util-stream/dist-cjs/stream-type-check.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.isReadableStream = void 0; - var isReadableStream2 = (stream) => { - var _a; - return typeof ReadableStream === "function" && (((_a = stream === null || stream === void 0 ? void 0 : stream.constructor) === null || _a === void 0 ? void 0 : _a.name) === ReadableStream.name || stream instanceof ReadableStream); - }; - exports2.isReadableStream = isReadableStream2; - } -}); - -// ../../../node_modules/@smithy/smithy-client/node_modules/@smithy/util-stream/dist-cjs/sdk-stream-mixin.browser.js -var require_sdk_stream_mixin_browser = __commonJS({ - "../../../node_modules/@smithy/smithy-client/node_modules/@smithy/util-stream/dist-cjs/sdk-stream-mixin.browser.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.sdkStreamMixin = void 0; - var fetch_http_handler_1 = require_dist_cjs34(); - var util_base64_1 = require_dist_cjs29(); - var util_hex_encoding_1 = require_dist_cjs35(); - var util_utf8_1 = require_dist_cjs28(); - var stream_type_check_1 = require_stream_type_check(); - var ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED = "The stream has already been transformed."; - var sdkStreamMixin2 = (stream) => { - var _a, _b; - if (!isBlobInstance(stream) && !(0, stream_type_check_1.isReadableStream)(stream)) { - const name = ((_b = (_a = stream === null || stream === void 0 ? void 0 : stream.__proto__) === null || _a === void 0 ? void 0 : _a.constructor) === null || _b === void 0 ? void 0 : _b.name) || stream; - throw new Error(`Unexpected stream implementation, expect Blob or ReadableStream, got ${name}`); - } - let transformed = false; - const transformToByteArray = async () => { - if (transformed) { - throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED); - } - transformed = true; - return await (0, fetch_http_handler_1.streamCollector)(stream); - }; - const blobToWebStream = (blob) => { - if (typeof blob.stream !== "function") { - throw new Error("Cannot transform payload Blob to web stream. Please make sure the Blob.stream() is polyfilled.\nIf you are using React Native, this API is not yet supported, see: https://react-native.canny.io/feature-requests/p/fetch-streaming-body"); - } - return blob.stream(); - }; - return Object.assign(stream, { - transformToByteArray, - transformToString: async (encoding) => { - const buf = await transformToByteArray(); - if (encoding === "base64") { - return (0, util_base64_1.toBase64)(buf); - } else if (encoding === "hex") { - return (0, util_hex_encoding_1.toHex)(buf); - } else if (encoding === void 0 || encoding === "utf8" || encoding === "utf-8") { - return (0, util_utf8_1.toUtf8)(buf); - } else if (typeof TextDecoder === "function") { - return new TextDecoder(encoding).decode(buf); - } else { - throw new Error("TextDecoder is not available, please make sure polyfill is provided."); - } - }, - transformToWebStream: () => { - if (transformed) { - throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED); - } - transformed = true; - if (isBlobInstance(stream)) { - return blobToWebStream(stream); - } else if ((0, stream_type_check_1.isReadableStream)(stream)) { - return stream; - } else { - throw new Error(`Cannot transform payload to web stream, got ${stream}`); - } - } - }); - }; - exports2.sdkStreamMixin = sdkStreamMixin2; - var isBlobInstance = (stream) => typeof Blob === "function" && stream instanceof Blob; - } -}); - -// ../../../node_modules/@smithy/smithy-client/node_modules/@smithy/util-stream/dist-cjs/sdk-stream-mixin.js -var require_sdk_stream_mixin = __commonJS({ - "../../../node_modules/@smithy/smithy-client/node_modules/@smithy/util-stream/dist-cjs/sdk-stream-mixin.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.sdkStreamMixin = void 0; - var node_http_handler_1 = require_dist_cjs33(); - var util_buffer_from_1 = require_dist_cjs27(); - var stream_1 = require("stream"); - var util_1 = require("util"); - var sdk_stream_mixin_browser_1 = require_sdk_stream_mixin_browser(); - var ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED = "The stream has already been transformed."; - var sdkStreamMixin2 = (stream) => { - var _a, _b; - if (!(stream instanceof stream_1.Readable)) { - try { - return (0, sdk_stream_mixin_browser_1.sdkStreamMixin)(stream); - } catch (e) { - const name = ((_b = (_a = stream === null || stream === void 0 ? void 0 : stream.__proto__) === null || _a === void 0 ? void 0 : _a.constructor) === null || _b === void 0 ? void 0 : _b.name) || stream; - throw new Error(`Unexpected stream implementation, expect Stream.Readable instance, got ${name}`); - } - } - let transformed = false; - const transformToByteArray = async () => { - if (transformed) { - throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED); - } - transformed = true; - return await (0, node_http_handler_1.streamCollector)(stream); - }; - return Object.assign(stream, { - transformToByteArray, - transformToString: async (encoding) => { - const buf = await transformToByteArray(); - if (encoding === void 0 || Buffer.isEncoding(encoding)) { - return (0, util_buffer_from_1.fromArrayBuffer)(buf.buffer, buf.byteOffset, buf.byteLength).toString(encoding); - } else { - const decoder2 = new util_1.TextDecoder(encoding); - return decoder2.decode(buf); - } - }, - transformToWebStream: () => { - if (transformed) { - throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED); - } - if (stream.readableFlowing !== null) { - throw new Error("The stream has been consumed by other callbacks."); - } - if (typeof stream_1.Readable.toWeb !== "function") { - throw new Error("Readable.toWeb() is not supported. Please make sure you are using Node.js >= 17.0.0, or polyfill is available."); - } - transformed = true; - return stream_1.Readable.toWeb(stream); - } - }); - }; - exports2.sdkStreamMixin = sdkStreamMixin2; - } -}); - -// ../../../node_modules/@smithy/smithy-client/node_modules/@smithy/util-stream/dist-cjs/splitStream.browser.js -var require_splitStream_browser = __commonJS({ - "../../../node_modules/@smithy/smithy-client/node_modules/@smithy/util-stream/dist-cjs/splitStream.browser.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.splitStream = void 0; - async function splitStream2(stream) { - if (typeof stream.stream === "function") { - stream = stream.stream(); - } - const readableStream = stream; - return readableStream.tee(); - } - exports2.splitStream = splitStream2; - } -}); - -// ../../../node_modules/@smithy/smithy-client/node_modules/@smithy/util-stream/dist-cjs/splitStream.js -var require_splitStream = __commonJS({ - "../../../node_modules/@smithy/smithy-client/node_modules/@smithy/util-stream/dist-cjs/splitStream.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.splitStream = void 0; - var stream_1 = require("stream"); - var splitStream_browser_1 = require_splitStream_browser(); - var stream_type_check_1 = require_stream_type_check(); - async function splitStream2(stream) { - if ((0, stream_type_check_1.isReadableStream)(stream)) { - return (0, splitStream_browser_1.splitStream)(stream); - } - const stream1 = new stream_1.PassThrough(); - const stream2 = new stream_1.PassThrough(); - stream.pipe(stream1); - stream.pipe(stream2); - return [stream1, stream2]; - } - exports2.splitStream = splitStream2; - } -}); - -// ../../../node_modules/@smithy/smithy-client/node_modules/@smithy/util-stream/dist-cjs/headStream.browser.js -var require_headStream_browser = __commonJS({ - "../../../node_modules/@smithy/smithy-client/node_modules/@smithy/util-stream/dist-cjs/headStream.browser.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.headStream = void 0; - async function headStream2(stream, bytes) { - var _a; - let byteLengthCounter = 0; - const chunks = []; - const reader = stream.getReader(); - let isDone = false; - while (!isDone) { - const { done, value } = await reader.read(); - if (value) { - chunks.push(value); - byteLengthCounter += (_a = value === null || value === void 0 ? void 0 : value.byteLength) !== null && _a !== void 0 ? _a : 0; - } - if (byteLengthCounter >= bytes) { - break; - } - isDone = done; - } - reader.releaseLock(); - const collected = new Uint8Array(Math.min(bytes, byteLengthCounter)); - let offset = 0; - for (const chunk of chunks) { - if (chunk.byteLength > collected.byteLength - offset) { - collected.set(chunk.subarray(0, collected.byteLength - offset), offset); - break; - } else { - collected.set(chunk, offset); - } - offset += chunk.length; - } - return collected; - } - exports2.headStream = headStream2; - } -}); - -// ../../../node_modules/@smithy/smithy-client/node_modules/@smithy/util-stream/dist-cjs/headStream.js -var require_headStream = __commonJS({ - "../../../node_modules/@smithy/smithy-client/node_modules/@smithy/util-stream/dist-cjs/headStream.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.headStream = void 0; - var stream_1 = require("stream"); - var headStream_browser_1 = require_headStream_browser(); - var stream_type_check_1 = require_stream_type_check(); - var headStream2 = (stream, bytes) => { - if ((0, stream_type_check_1.isReadableStream)(stream)) { - return (0, headStream_browser_1.headStream)(stream, bytes); - } - return new Promise((resolve, reject) => { - const collector = new Collector(); - collector.limit = bytes; - stream.pipe(collector); - stream.on("error", (err) => { - collector.end(); - reject(err); - }); - collector.on("error", reject); - collector.on("finish", function() { - const bytes2 = new Uint8Array(Buffer.concat(this.buffers)); - resolve(bytes2); - }); - }); - }; - exports2.headStream = headStream2; - var Collector = class extends stream_1.Writable { - constructor() { - super(...arguments); - this.buffers = []; - this.limit = Infinity; - this.bytesBuffered = 0; - } - _write(chunk, encoding, callback) { - var _a; - this.buffers.push(chunk); - this.bytesBuffered += (_a = chunk.byteLength) !== null && _a !== void 0 ? _a : 0; - if (this.bytesBuffered >= this.limit) { - const excess = this.bytesBuffered - this.limit; - const tailBuffer = this.buffers[this.buffers.length - 1]; - this.buffers[this.buffers.length - 1] = tailBuffer.subarray(0, tailBuffer.byteLength - excess); - this.emit("finish"); - } - callback(); - } - }; - } -}); - -// ../../../node_modules/@smithy/smithy-client/node_modules/@smithy/util-stream/dist-cjs/index.js -var require_dist_cjs36 = __commonJS({ - "../../../node_modules/@smithy/smithy-client/node_modules/@smithy/util-stream/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); - } - return to; - }; - var __reExport = (target, mod, secondTarget) => (__copyProps2(target, mod, "default"), secondTarget && __copyProps2(secondTarget, mod, "default")); - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - Uint8ArrayBlobAdapter: () => Uint8ArrayBlobAdapter - }); - module2.exports = __toCommonJS2(src_exports); - var import_util_base64 = require_dist_cjs29(); - var import_util_utf8 = require_dist_cjs28(); - function transformToString(payload, encoding = "utf-8") { - if (encoding === "base64") { - return (0, import_util_base64.toBase64)(payload); - } - return (0, import_util_utf8.toUtf8)(payload); - } - __name(transformToString, "transformToString"); - function transformFromString(str, encoding) { - if (encoding === "base64") { - return Uint8ArrayBlobAdapter.mutate((0, import_util_base64.fromBase64)(str)); - } - return Uint8ArrayBlobAdapter.mutate((0, import_util_utf8.fromUtf8)(str)); - } - __name(transformFromString, "transformFromString"); - var _Uint8ArrayBlobAdapter = class _Uint8ArrayBlobAdapter2 extends Uint8Array { - /** - * @param source - such as a string or Stream. - * @returns a new Uint8ArrayBlobAdapter extending Uint8Array. - */ - static fromString(source, encoding = "utf-8") { - switch (typeof source) { - case "string": - return transformFromString(source, encoding); - default: - throw new Error(`Unsupported conversion from ${typeof source} to Uint8ArrayBlobAdapter.`); - } - } - /** - * @param source - Uint8Array to be mutated. - * @returns the same Uint8Array but with prototype switched to Uint8ArrayBlobAdapter. - */ - static mutate(source) { - Object.setPrototypeOf(source, _Uint8ArrayBlobAdapter2.prototype); - return source; - } - /** - * @param encoding - default 'utf-8'. - * @returns the blob as string. - */ - transformToString(encoding = "utf-8") { - return transformToString(this, encoding); - } - }; - __name(_Uint8ArrayBlobAdapter, "Uint8ArrayBlobAdapter"); - var Uint8ArrayBlobAdapter = _Uint8ArrayBlobAdapter; - __reExport(src_exports, require_getAwsChunkedEncodingStream(), module2.exports); - __reExport(src_exports, require_sdk_stream_mixin(), module2.exports); - __reExport(src_exports, require_splitStream(), module2.exports); - __reExport(src_exports, require_headStream(), module2.exports); - __reExport(src_exports, require_stream_type_check(), module2.exports); - } -}); - -// ../../../node_modules/@smithy/smithy-client/dist-cjs/index.js -var require_dist_cjs37 = __commonJS({ - "../../../node_modules/@smithy/smithy-client/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); - } - return to; - }; - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - Client: () => Client, - Command: () => Command, - LazyJsonString: () => LazyJsonString, - NoOpLogger: () => NoOpLogger, - SENSITIVE_STRING: () => SENSITIVE_STRING, - ServiceException: () => ServiceException, - StringWrapper: () => StringWrapper, - _json: () => _json, - collectBody: () => collectBody2, - convertMap: () => convertMap, - createAggregatedClient: () => createAggregatedClient, - dateToUtcString: () => dateToUtcString, - decorateServiceException: () => decorateServiceException, - emitWarningIfUnsupportedVersion: () => emitWarningIfUnsupportedVersion2, - expectBoolean: () => expectBoolean, - expectByte: () => expectByte, - expectFloat32: () => expectFloat32, - expectInt: () => expectInt, - expectInt32: () => expectInt32, - expectLong: () => expectLong, - expectNonNull: () => expectNonNull, - expectNumber: () => expectNumber, - expectObject: () => expectObject, - expectShort: () => expectShort, - expectString: () => expectString, - expectUnion: () => expectUnion2, - extendedEncodeURIComponent: () => extendedEncodeURIComponent, - getArrayIfSingleItem: () => getArrayIfSingleItem, - getDefaultClientConfiguration: () => getDefaultClientConfiguration, - getDefaultExtensionConfiguration: () => getDefaultExtensionConfiguration, - getValueFromTextNode: () => getValueFromTextNode2, - handleFloat: () => handleFloat, - isSerializableHeaderValue: () => isSerializableHeaderValue, - limitedParseDouble: () => limitedParseDouble, - limitedParseFloat: () => limitedParseFloat, - limitedParseFloat32: () => limitedParseFloat32, - loadConfigsForDefaultMode: () => loadConfigsForDefaultMode, - logger: () => logger, - map: () => map, - parseBoolean: () => parseBoolean, - parseEpochTimestamp: () => parseEpochTimestamp, - parseRfc3339DateTime: () => parseRfc3339DateTime, - parseRfc3339DateTimeWithOffset: () => parseRfc3339DateTimeWithOffset, - parseRfc7231DateTime: () => parseRfc7231DateTime, - quoteHeader: () => quoteHeader, - resolveDefaultRuntimeConfig: () => resolveDefaultRuntimeConfig, - resolvedPath: () => resolvedPath2, - serializeDateTime: () => serializeDateTime, - serializeFloat: () => serializeFloat, - splitEvery: () => splitEvery, - splitHeader: () => splitHeader, - strictParseByte: () => strictParseByte, - strictParseDouble: () => strictParseDouble, - strictParseFloat: () => strictParseFloat, - strictParseFloat32: () => strictParseFloat32, - strictParseInt: () => strictParseInt, - strictParseInt32: () => strictParseInt32, - strictParseLong: () => strictParseLong, - strictParseShort: () => strictParseShort, - take: () => take, - throwDefaultError: () => throwDefaultError, - withBaseException: () => withBaseException - }); - module2.exports = __toCommonJS2(src_exports); - var import_middleware_stack = require_dist_cjs25(); - var _Client = class _Client { - constructor(config) { - this.config = config; - this.middlewareStack = (0, import_middleware_stack.constructStack)(); - } - send(command, optionsOrCb, cb) { - const options = typeof optionsOrCb !== "function" ? optionsOrCb : void 0; - const callback = typeof optionsOrCb === "function" ? optionsOrCb : cb; - const useHandlerCache = options === void 0 && this.config.cacheMiddleware === true; - let handler2; - if (useHandlerCache) { - if (!this.handlers) { - this.handlers = /* @__PURE__ */ new WeakMap(); - } - const handlers = this.handlers; - if (handlers.has(command.constructor)) { - handler2 = handlers.get(command.constructor); - } else { - handler2 = command.resolveMiddleware(this.middlewareStack, this.config, options); - handlers.set(command.constructor, handler2); - } - } else { - delete this.handlers; - handler2 = command.resolveMiddleware(this.middlewareStack, this.config, options); - } - if (callback) { - handler2(command).then( - (result) => callback(null, result.output), - (err) => callback(err) - ).catch( - // prevent any errors thrown in the callback from triggering an - // unhandled promise rejection - () => { - } - ); - } else { - return handler2(command).then((result) => result.output); - } - } - destroy() { - var _a, _b, _c; - (_c = (_b = (_a = this.config) == null ? void 0 : _a.requestHandler) == null ? void 0 : _b.destroy) == null ? void 0 : _c.call(_b); - delete this.handlers; - } - }; - __name(_Client, "Client"); - var Client = _Client; - var import_util_stream = require_dist_cjs36(); - var collectBody2 = /* @__PURE__ */ __name(async (streamBody = new Uint8Array(), context) => { - if (streamBody instanceof Uint8Array) { - return import_util_stream.Uint8ArrayBlobAdapter.mutate(streamBody); - } - if (!streamBody) { - return import_util_stream.Uint8ArrayBlobAdapter.mutate(new Uint8Array()); - } - const fromContext = context.streamCollector(streamBody); - return import_util_stream.Uint8ArrayBlobAdapter.mutate(await fromContext); - }, "collectBody"); - var import_types5 = require_dist_cjs(); - var _Command = class _Command { - constructor() { - this.middlewareStack = (0, import_middleware_stack.constructStack)(); - } - /** - * Factory for Command ClassBuilder. - * @internal - */ - static classBuilder() { - return new ClassBuilder(); - } - /** - * @internal - */ - resolveMiddlewareWithContext(clientStack, configuration, options, { - middlewareFn, - clientName, - commandName, - inputFilterSensitiveLog, - outputFilterSensitiveLog, - smithyContext, - additionalContext, - CommandCtor - }) { - for (const mw of middlewareFn.bind(this)(CommandCtor, clientStack, configuration, options)) { - this.middlewareStack.use(mw); - } - const stack = clientStack.concat(this.middlewareStack); - const { logger: logger2 } = configuration; - const handlerExecutionContext = { - logger: logger2, - clientName, - commandName, - inputFilterSensitiveLog, - outputFilterSensitiveLog, - [import_types5.SMITHY_CONTEXT_KEY]: { - commandInstance: this, - ...smithyContext - }, - ...additionalContext - }; - const { requestHandler } = configuration; - return stack.resolve( - (request2) => requestHandler.handle(request2.request, options || {}), - handlerExecutionContext - ); - } - }; - __name(_Command, "Command"); - var Command = _Command; - var _ClassBuilder = class _ClassBuilder { - constructor() { - this._init = () => { - }; - this._ep = {}; - this._middlewareFn = () => []; - this._commandName = ""; - this._clientName = ""; - this._additionalContext = {}; - this._smithyContext = {}; - this._inputFilterSensitiveLog = (_) => _; - this._outputFilterSensitiveLog = (_) => _; - this._serializer = null; - this._deserializer = null; - } - /** - * Optional init callback. - */ - init(cb) { - this._init = cb; - } - /** - * Set the endpoint parameter instructions. - */ - ep(endpointParameterInstructions) { - this._ep = endpointParameterInstructions; - return this; - } - /** - * Add any number of middleware. - */ - m(middlewareSupplier) { - this._middlewareFn = middlewareSupplier; - return this; - } - /** - * Set the initial handler execution context Smithy field. - */ - s(service, operation, smithyContext = {}) { - this._smithyContext = { - service, - operation, - ...smithyContext - }; - return this; - } - /** - * Set the initial handler execution context. - */ - c(additionalContext = {}) { - this._additionalContext = additionalContext; - return this; - } - /** - * Set constant string identifiers for the operation. - */ - n(clientName, commandName) { - this._clientName = clientName; - this._commandName = commandName; - return this; - } - /** - * Set the input and output sensistive log filters. - */ - f(inputFilter = (_) => _, outputFilter = (_) => _) { - this._inputFilterSensitiveLog = inputFilter; - this._outputFilterSensitiveLog = outputFilter; - return this; - } - /** - * Sets the serializer. - */ - ser(serializer) { - this._serializer = serializer; - return this; - } - /** - * Sets the deserializer. - */ - de(deserializer) { - this._deserializer = deserializer; - return this; - } - /** - * @returns a Command class with the classBuilder properties. - */ - build() { - var _a; - const closure = this; - let CommandRef; - return CommandRef = (_a = class extends Command { - /** - * @public - */ - constructor(...[input]) { - super(); - this.serialize = closure._serializer; - this.deserialize = closure._deserializer; - this.input = input ?? {}; - closure._init(this); - } - /** - * @public - */ - static getEndpointParameterInstructions() { - return closure._ep; - } - /** - * @internal - */ - resolveMiddleware(stack, configuration, options) { - return this.resolveMiddlewareWithContext(stack, configuration, options, { - CommandCtor: CommandRef, - middlewareFn: closure._middlewareFn, - clientName: closure._clientName, - commandName: closure._commandName, - inputFilterSensitiveLog: closure._inputFilterSensitiveLog, - outputFilterSensitiveLog: closure._outputFilterSensitiveLog, - smithyContext: closure._smithyContext, - additionalContext: closure._additionalContext - }); - } - }, __name(_a, "CommandRef"), _a); - } - }; - __name(_ClassBuilder, "ClassBuilder"); - var ClassBuilder = _ClassBuilder; - var SENSITIVE_STRING = "***SensitiveInformation***"; - var createAggregatedClient = /* @__PURE__ */ __name((commands, Client2) => { - for (const command of Object.keys(commands)) { - const CommandCtor = commands[command]; - const methodImpl = /* @__PURE__ */ __name(async function(args, optionsOrCb, cb) { - const command2 = new CommandCtor(args); - if (typeof optionsOrCb === "function") { - this.send(command2, optionsOrCb); - } else if (typeof cb === "function") { - if (typeof optionsOrCb !== "object") - throw new Error(`Expected http options but got ${typeof optionsOrCb}`); - this.send(command2, optionsOrCb || {}, cb); - } else { - return this.send(command2, optionsOrCb); - } - }, "methodImpl"); - const methodName = (command[0].toLowerCase() + command.slice(1)).replace(/Command$/, ""); - Client2.prototype[methodName] = methodImpl; - } - }, "createAggregatedClient"); - var parseBoolean = /* @__PURE__ */ __name((value) => { - switch (value) { - case "true": - return true; - case "false": - return false; - default: - throw new Error(`Unable to parse boolean value "${value}"`); - } - }, "parseBoolean"); - var expectBoolean = /* @__PURE__ */ __name((value) => { - if (value === null || value === void 0) { - return void 0; - } - if (typeof value === "number") { - if (value === 0 || value === 1) { - logger.warn(stackTraceWarning(`Expected boolean, got ${typeof value}: ${value}`)); - } - if (value === 0) { - return false; - } - if (value === 1) { - return true; - } - } - if (typeof value === "string") { - const lower = value.toLowerCase(); - if (lower === "false" || lower === "true") { - logger.warn(stackTraceWarning(`Expected boolean, got ${typeof value}: ${value}`)); - } - if (lower === "false") { - return false; - } - if (lower === "true") { - return true; - } - } - if (typeof value === "boolean") { - return value; - } - throw new TypeError(`Expected boolean, got ${typeof value}: ${value}`); - }, "expectBoolean"); - var expectNumber = /* @__PURE__ */ __name((value) => { - if (value === null || value === void 0) { - return void 0; - } - if (typeof value === "string") { - const parsed = parseFloat(value); - if (!Number.isNaN(parsed)) { - if (String(parsed) !== String(value)) { - logger.warn(stackTraceWarning(`Expected number but observed string: ${value}`)); - } - return parsed; - } - } - if (typeof value === "number") { - return value; - } - throw new TypeError(`Expected number, got ${typeof value}: ${value}`); - }, "expectNumber"); - var MAX_FLOAT = Math.ceil(2 ** 127 * (2 - 2 ** -23)); - var expectFloat32 = /* @__PURE__ */ __name((value) => { - const expected = expectNumber(value); - if (expected !== void 0 && !Number.isNaN(expected) && expected !== Infinity && expected !== -Infinity) { - if (Math.abs(expected) > MAX_FLOAT) { - throw new TypeError(`Expected 32-bit float, got ${value}`); - } - } - return expected; - }, "expectFloat32"); - var expectLong = /* @__PURE__ */ __name((value) => { - if (value === null || value === void 0) { - return void 0; - } - if (Number.isInteger(value) && !Number.isNaN(value)) { - return value; - } - throw new TypeError(`Expected integer, got ${typeof value}: ${value}`); - }, "expectLong"); - var expectInt = expectLong; - var expectInt32 = /* @__PURE__ */ __name((value) => expectSizedInt(value, 32), "expectInt32"); - var expectShort = /* @__PURE__ */ __name((value) => expectSizedInt(value, 16), "expectShort"); - var expectByte = /* @__PURE__ */ __name((value) => expectSizedInt(value, 8), "expectByte"); - var expectSizedInt = /* @__PURE__ */ __name((value, size) => { - const expected = expectLong(value); - if (expected !== void 0 && castInt(expected, size) !== expected) { - throw new TypeError(`Expected ${size}-bit integer, got ${value}`); - } - return expected; - }, "expectSizedInt"); - var castInt = /* @__PURE__ */ __name((value, size) => { - switch (size) { - case 32: - return Int32Array.of(value)[0]; - case 16: - return Int16Array.of(value)[0]; - case 8: - return Int8Array.of(value)[0]; - } - }, "castInt"); - var expectNonNull = /* @__PURE__ */ __name((value, location) => { - if (value === null || value === void 0) { - if (location) { - throw new TypeError(`Expected a non-null value for ${location}`); - } - throw new TypeError("Expected a non-null value"); - } - return value; - }, "expectNonNull"); - var expectObject = /* @__PURE__ */ __name((value) => { - if (value === null || value === void 0) { - return void 0; - } - if (typeof value === "object" && !Array.isArray(value)) { - return value; - } - const receivedType = Array.isArray(value) ? "array" : typeof value; - throw new TypeError(`Expected object, got ${receivedType}: ${value}`); - }, "expectObject"); - var expectString = /* @__PURE__ */ __name((value) => { - if (value === null || value === void 0) { - return void 0; - } - if (typeof value === "string") { - return value; - } - if (["boolean", "number", "bigint"].includes(typeof value)) { - logger.warn(stackTraceWarning(`Expected string, got ${typeof value}: ${value}`)); - return String(value); - } - throw new TypeError(`Expected string, got ${typeof value}: ${value}`); - }, "expectString"); - var expectUnion2 = /* @__PURE__ */ __name((value) => { - if (value === null || value === void 0) { - return void 0; - } - const asObject = expectObject(value); - const setKeys = Object.entries(asObject).filter(([, v]) => v != null).map(([k]) => k); - if (setKeys.length === 0) { - throw new TypeError(`Unions must have exactly one non-null member. None were found.`); - } - if (setKeys.length > 1) { - throw new TypeError(`Unions must have exactly one non-null member. Keys ${setKeys} were not null.`); - } - return asObject; - }, "expectUnion"); - var strictParseDouble = /* @__PURE__ */ __name((value) => { - if (typeof value == "string") { - return expectNumber(parseNumber(value)); - } - return expectNumber(value); - }, "strictParseDouble"); - var strictParseFloat = strictParseDouble; - var strictParseFloat32 = /* @__PURE__ */ __name((value) => { - if (typeof value == "string") { - return expectFloat32(parseNumber(value)); - } - return expectFloat32(value); - }, "strictParseFloat32"); - var NUMBER_REGEX = /(-?(?:0|[1-9]\d*)(?:\.\d+)?(?:[eE][+-]?\d+)?)|(-?Infinity)|(NaN)/g; - var parseNumber = /* @__PURE__ */ __name((value) => { - const matches = value.match(NUMBER_REGEX); - if (matches === null || matches[0].length !== value.length) { - throw new TypeError(`Expected real number, got implicit NaN`); - } - return parseFloat(value); - }, "parseNumber"); - var limitedParseDouble = /* @__PURE__ */ __name((value) => { - if (typeof value == "string") { - return parseFloatString(value); - } - return expectNumber(value); - }, "limitedParseDouble"); - var handleFloat = limitedParseDouble; - var limitedParseFloat = limitedParseDouble; - var limitedParseFloat32 = /* @__PURE__ */ __name((value) => { - if (typeof value == "string") { - return parseFloatString(value); - } - return expectFloat32(value); - }, "limitedParseFloat32"); - var parseFloatString = /* @__PURE__ */ __name((value) => { - switch (value) { - case "NaN": - return NaN; - case "Infinity": - return Infinity; - case "-Infinity": - return -Infinity; - default: - throw new Error(`Unable to parse float value: ${value}`); - } - }, "parseFloatString"); - var strictParseLong = /* @__PURE__ */ __name((value) => { - if (typeof value === "string") { - return expectLong(parseNumber(value)); - } - return expectLong(value); - }, "strictParseLong"); - var strictParseInt = strictParseLong; - var strictParseInt32 = /* @__PURE__ */ __name((value) => { - if (typeof value === "string") { - return expectInt32(parseNumber(value)); - } - return expectInt32(value); - }, "strictParseInt32"); - var strictParseShort = /* @__PURE__ */ __name((value) => { - if (typeof value === "string") { - return expectShort(parseNumber(value)); - } - return expectShort(value); - }, "strictParseShort"); - var strictParseByte = /* @__PURE__ */ __name((value) => { - if (typeof value === "string") { - return expectByte(parseNumber(value)); - } - return expectByte(value); - }, "strictParseByte"); - var stackTraceWarning = /* @__PURE__ */ __name((message) => { - return String(new TypeError(message).stack || message).split("\n").slice(0, 5).filter((s) => !s.includes("stackTraceWarning")).join("\n"); - }, "stackTraceWarning"); - var logger = { - warn: console.warn - }; - var DAYS = ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"]; - var MONTHS = ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"]; - function dateToUtcString(date) { - const year = date.getUTCFullYear(); - const month = date.getUTCMonth(); - const dayOfWeek = date.getUTCDay(); - const dayOfMonthInt = date.getUTCDate(); - const hoursInt = date.getUTCHours(); - const minutesInt = date.getUTCMinutes(); - const secondsInt = date.getUTCSeconds(); - const dayOfMonthString = dayOfMonthInt < 10 ? `0${dayOfMonthInt}` : `${dayOfMonthInt}`; - const hoursString = hoursInt < 10 ? `0${hoursInt}` : `${hoursInt}`; - const minutesString = minutesInt < 10 ? `0${minutesInt}` : `${minutesInt}`; - const secondsString = secondsInt < 10 ? `0${secondsInt}` : `${secondsInt}`; - return `${DAYS[dayOfWeek]}, ${dayOfMonthString} ${MONTHS[month]} ${year} ${hoursString}:${minutesString}:${secondsString} GMT`; - } - __name(dateToUtcString, "dateToUtcString"); - var RFC3339 = new RegExp(/^(\d{4})-(\d{2})-(\d{2})[tT](\d{2}):(\d{2}):(\d{2})(?:\.(\d+))?[zZ]$/); - var parseRfc3339DateTime = /* @__PURE__ */ __name((value) => { - if (value === null || value === void 0) { - return void 0; - } - if (typeof value !== "string") { - throw new TypeError("RFC-3339 date-times must be expressed as strings"); - } - const match = RFC3339.exec(value); - if (!match) { - throw new TypeError("Invalid RFC-3339 date-time value"); - } - const [_, yearStr, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds] = match; - const year = strictParseShort(stripLeadingZeroes(yearStr)); - const month = parseDateValue(monthStr, "month", 1, 12); - const day = parseDateValue(dayStr, "day", 1, 31); - return buildDate(year, month, day, { hours, minutes, seconds, fractionalMilliseconds }); - }, "parseRfc3339DateTime"); - var RFC3339_WITH_OFFSET = new RegExp( - /^(\d{4})-(\d{2})-(\d{2})[tT](\d{2}):(\d{2}):(\d{2})(?:\.(\d+))?(([-+]\d{2}\:\d{2})|[zZ])$/ - ); - var parseRfc3339DateTimeWithOffset = /* @__PURE__ */ __name((value) => { - if (value === null || value === void 0) { - return void 0; - } - if (typeof value !== "string") { - throw new TypeError("RFC-3339 date-times must be expressed as strings"); - } - const match = RFC3339_WITH_OFFSET.exec(value); - if (!match) { - throw new TypeError("Invalid RFC-3339 date-time value"); - } - const [_, yearStr, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds, offsetStr] = match; - const year = strictParseShort(stripLeadingZeroes(yearStr)); - const month = parseDateValue(monthStr, "month", 1, 12); - const day = parseDateValue(dayStr, "day", 1, 31); - const date = buildDate(year, month, day, { hours, minutes, seconds, fractionalMilliseconds }); - if (offsetStr.toUpperCase() != "Z") { - date.setTime(date.getTime() - parseOffsetToMilliseconds(offsetStr)); - } - return date; - }, "parseRfc3339DateTimeWithOffset"); - var IMF_FIXDATE = new RegExp( - /^(?:Mon|Tue|Wed|Thu|Fri|Sat|Sun), (\d{2}) (Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec) (\d{4}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? GMT$/ - ); - var RFC_850_DATE = new RegExp( - /^(?:Monday|Tuesday|Wednesday|Thursday|Friday|Saturday|Sunday), (\d{2})-(Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec)-(\d{2}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? GMT$/ - ); - var ASC_TIME = new RegExp( - /^(?:Mon|Tue|Wed|Thu|Fri|Sat|Sun) (Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec) ( [1-9]|\d{2}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? (\d{4})$/ - ); - var parseRfc7231DateTime = /* @__PURE__ */ __name((value) => { - if (value === null || value === void 0) { - return void 0; - } - if (typeof value !== "string") { - throw new TypeError("RFC-7231 date-times must be expressed as strings"); - } - let match = IMF_FIXDATE.exec(value); - if (match) { - const [_, dayStr, monthStr, yearStr, hours, minutes, seconds, fractionalMilliseconds] = match; - return buildDate( - strictParseShort(stripLeadingZeroes(yearStr)), - parseMonthByShortName(monthStr), - parseDateValue(dayStr, "day", 1, 31), - { hours, minutes, seconds, fractionalMilliseconds } - ); - } - match = RFC_850_DATE.exec(value); - if (match) { - const [_, dayStr, monthStr, yearStr, hours, minutes, seconds, fractionalMilliseconds] = match; - return adjustRfc850Year( - buildDate(parseTwoDigitYear(yearStr), parseMonthByShortName(monthStr), parseDateValue(dayStr, "day", 1, 31), { - hours, - minutes, - seconds, - fractionalMilliseconds - }) - ); - } - match = ASC_TIME.exec(value); - if (match) { - const [_, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds, yearStr] = match; - return buildDate( - strictParseShort(stripLeadingZeroes(yearStr)), - parseMonthByShortName(monthStr), - parseDateValue(dayStr.trimLeft(), "day", 1, 31), - { hours, minutes, seconds, fractionalMilliseconds } - ); - } - throw new TypeError("Invalid RFC-7231 date-time value"); - }, "parseRfc7231DateTime"); - var parseEpochTimestamp = /* @__PURE__ */ __name((value) => { - if (value === null || value === void 0) { - return void 0; - } - let valueAsDouble; - if (typeof value === "number") { - valueAsDouble = value; - } else if (typeof value === "string") { - valueAsDouble = strictParseDouble(value); - } else if (typeof value === "object" && value.tag === 1) { - valueAsDouble = value.value; - } else { - throw new TypeError("Epoch timestamps must be expressed as floating point numbers or their string representation"); - } - if (Number.isNaN(valueAsDouble) || valueAsDouble === Infinity || valueAsDouble === -Infinity) { - throw new TypeError("Epoch timestamps must be valid, non-Infinite, non-NaN numerics"); - } - return new Date(Math.round(valueAsDouble * 1e3)); - }, "parseEpochTimestamp"); - var buildDate = /* @__PURE__ */ __name((year, month, day, time) => { - const adjustedMonth = month - 1; - validateDayOfMonth(year, adjustedMonth, day); - return new Date( - Date.UTC( - year, - adjustedMonth, - day, - parseDateValue(time.hours, "hour", 0, 23), - parseDateValue(time.minutes, "minute", 0, 59), - // seconds can go up to 60 for leap seconds - parseDateValue(time.seconds, "seconds", 0, 60), - parseMilliseconds(time.fractionalMilliseconds) - ) - ); - }, "buildDate"); - var parseTwoDigitYear = /* @__PURE__ */ __name((value) => { - const thisYear = (/* @__PURE__ */ new Date()).getUTCFullYear(); - const valueInThisCentury = Math.floor(thisYear / 100) * 100 + strictParseShort(stripLeadingZeroes(value)); - if (valueInThisCentury < thisYear) { - return valueInThisCentury + 100; - } - return valueInThisCentury; - }, "parseTwoDigitYear"); - var FIFTY_YEARS_IN_MILLIS = 50 * 365 * 24 * 60 * 60 * 1e3; - var adjustRfc850Year = /* @__PURE__ */ __name((input) => { - if (input.getTime() - (/* @__PURE__ */ new Date()).getTime() > FIFTY_YEARS_IN_MILLIS) { - return new Date( - Date.UTC( - input.getUTCFullYear() - 100, - input.getUTCMonth(), - input.getUTCDate(), - input.getUTCHours(), - input.getUTCMinutes(), - input.getUTCSeconds(), - input.getUTCMilliseconds() - ) - ); - } - return input; - }, "adjustRfc850Year"); - var parseMonthByShortName = /* @__PURE__ */ __name((value) => { - const monthIdx = MONTHS.indexOf(value); - if (monthIdx < 0) { - throw new TypeError(`Invalid month: ${value}`); - } - return monthIdx + 1; - }, "parseMonthByShortName"); - var DAYS_IN_MONTH = [31, 28, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31]; - var validateDayOfMonth = /* @__PURE__ */ __name((year, month, day) => { - let maxDays = DAYS_IN_MONTH[month]; - if (month === 1 && isLeapYear(year)) { - maxDays = 29; - } - if (day > maxDays) { - throw new TypeError(`Invalid day for ${MONTHS[month]} in ${year}: ${day}`); - } - }, "validateDayOfMonth"); - var isLeapYear = /* @__PURE__ */ __name((year) => { - return year % 4 === 0 && (year % 100 !== 0 || year % 400 === 0); - }, "isLeapYear"); - var parseDateValue = /* @__PURE__ */ __name((value, type, lower, upper) => { - const dateVal = strictParseByte(stripLeadingZeroes(value)); - if (dateVal < lower || dateVal > upper) { - throw new TypeError(`${type} must be between ${lower} and ${upper}, inclusive`); - } - return dateVal; - }, "parseDateValue"); - var parseMilliseconds = /* @__PURE__ */ __name((value) => { - if (value === null || value === void 0) { - return 0; - } - return strictParseFloat32("0." + value) * 1e3; - }, "parseMilliseconds"); - var parseOffsetToMilliseconds = /* @__PURE__ */ __name((value) => { - const directionStr = value[0]; - let direction = 1; - if (directionStr == "+") { - direction = 1; - } else if (directionStr == "-") { - direction = -1; - } else { - throw new TypeError(`Offset direction, ${directionStr}, must be "+" or "-"`); - } - const hour = Number(value.substring(1, 3)); - const minute = Number(value.substring(4, 6)); - return direction * (hour * 60 + minute) * 60 * 1e3; - }, "parseOffsetToMilliseconds"); - var stripLeadingZeroes = /* @__PURE__ */ __name((value) => { - let idx = 0; - while (idx < value.length - 1 && value.charAt(idx) === "0") { - idx++; - } - if (idx === 0) { - return value; - } - return value.slice(idx); - }, "stripLeadingZeroes"); - var _ServiceException = class _ServiceException2 extends Error { - constructor(options) { - super(options.message); - Object.setPrototypeOf(this, _ServiceException2.prototype); - this.name = options.name; - this.$fault = options.$fault; - this.$metadata = options.$metadata; - } - }; - __name(_ServiceException, "ServiceException"); - var ServiceException = _ServiceException; - var decorateServiceException = /* @__PURE__ */ __name((exception, additions = {}) => { - Object.entries(additions).filter(([, v]) => v !== void 0).forEach(([k, v]) => { - if (exception[k] == void 0 || exception[k] === "") { - exception[k] = v; - } - }); - const message = exception.message || exception.Message || "UnknownError"; - exception.message = message; - delete exception.Message; - return exception; - }, "decorateServiceException"); - var throwDefaultError = /* @__PURE__ */ __name(({ output, parsedBody, exceptionCtor, errorCode }) => { - const $metadata = deserializeMetadata(output); - const statusCode = $metadata.httpStatusCode ? $metadata.httpStatusCode + "" : void 0; - const response = new exceptionCtor({ - name: (parsedBody == null ? void 0 : parsedBody.code) || (parsedBody == null ? void 0 : parsedBody.Code) || errorCode || statusCode || "UnknownError", - $fault: "client", - $metadata - }); - throw decorateServiceException(response, parsedBody); - }, "throwDefaultError"); - var withBaseException = /* @__PURE__ */ __name((ExceptionCtor) => { - return ({ output, parsedBody, errorCode }) => { - throwDefaultError({ output, parsedBody, exceptionCtor: ExceptionCtor, errorCode }); - }; - }, "withBaseException"); - var deserializeMetadata = /* @__PURE__ */ __name((output) => ({ - httpStatusCode: output.statusCode, - requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], - extendedRequestId: output.headers["x-amz-id-2"], - cfId: output.headers["x-amz-cf-id"] - }), "deserializeMetadata"); - var loadConfigsForDefaultMode = /* @__PURE__ */ __name((mode) => { - switch (mode) { - case "standard": - return { - retryMode: "standard", - connectionTimeout: 3100 - }; - case "in-region": - return { - retryMode: "standard", - connectionTimeout: 1100 - }; - case "cross-region": - return { - retryMode: "standard", - connectionTimeout: 3100 - }; - case "mobile": - return { - retryMode: "standard", - connectionTimeout: 3e4 - }; - default: - return {}; - } - }, "loadConfigsForDefaultMode"); - var warningEmitted2 = false; - var emitWarningIfUnsupportedVersion2 = /* @__PURE__ */ __name((version2) => { - if (version2 && !warningEmitted2 && parseInt(version2.substring(1, version2.indexOf("."))) < 16) { - warningEmitted2 = true; - } - }, "emitWarningIfUnsupportedVersion"); - function extendedEncodeURIComponent(str) { - return encodeURIComponent(str).replace(/[!'()*]/g, function(c) { - return "%" + c.charCodeAt(0).toString(16).toUpperCase(); - }); - } - __name(extendedEncodeURIComponent, "extendedEncodeURIComponent"); - var getChecksumConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - const checksumAlgorithms = []; - for (const id in import_types5.AlgorithmId) { - const algorithmId = import_types5.AlgorithmId[id]; - if (runtimeConfig[algorithmId] === void 0) { - continue; - } - checksumAlgorithms.push({ - algorithmId: () => algorithmId, - checksumConstructor: () => runtimeConfig[algorithmId] - }); - } - return { - _checksumAlgorithms: checksumAlgorithms, - addChecksumAlgorithm(algo) { - this._checksumAlgorithms.push(algo); - }, - checksumAlgorithms() { - return this._checksumAlgorithms; - } - }; - }, "getChecksumConfiguration"); - var resolveChecksumRuntimeConfig = /* @__PURE__ */ __name((clientConfig) => { - const runtimeConfig = {}; - clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => { - runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor(); - }); - return runtimeConfig; - }, "resolveChecksumRuntimeConfig"); - var getRetryConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - let _retryStrategy = runtimeConfig.retryStrategy; - return { - setRetryStrategy(retryStrategy) { - _retryStrategy = retryStrategy; - }, - retryStrategy() { - return _retryStrategy; - } - }; - }, "getRetryConfiguration"); - var resolveRetryRuntimeConfig = /* @__PURE__ */ __name((retryStrategyConfiguration) => { - const runtimeConfig = {}; - runtimeConfig.retryStrategy = retryStrategyConfiguration.retryStrategy(); - return runtimeConfig; - }, "resolveRetryRuntimeConfig"); - var getDefaultExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - return { - ...getChecksumConfiguration(runtimeConfig), - ...getRetryConfiguration(runtimeConfig) - }; - }, "getDefaultExtensionConfiguration"); - var getDefaultClientConfiguration = getDefaultExtensionConfiguration; - var resolveDefaultRuntimeConfig = /* @__PURE__ */ __name((config) => { - return { - ...resolveChecksumRuntimeConfig(config), - ...resolveRetryRuntimeConfig(config) - }; - }, "resolveDefaultRuntimeConfig"); - var getArrayIfSingleItem = /* @__PURE__ */ __name((mayBeArray) => Array.isArray(mayBeArray) ? mayBeArray : [mayBeArray], "getArrayIfSingleItem"); - var getValueFromTextNode2 = /* @__PURE__ */ __name((obj) => { - const textNodeName = "#text"; - for (const key in obj) { - if (obj.hasOwnProperty(key) && obj[key][textNodeName] !== void 0) { - obj[key] = obj[key][textNodeName]; - } else if (typeof obj[key] === "object" && obj[key] !== null) { - obj[key] = getValueFromTextNode2(obj[key]); + const interval = 15e3; + if (Date.now() - interval < socketWarningTimestamp) { + return socketWarningTimestamp; } - } - return obj; - }, "getValueFromTextNode"); - var isSerializableHeaderValue = /* @__PURE__ */ __name((value) => { - return value != null; - }, "isSerializableHeaderValue"); - var StringWrapper = /* @__PURE__ */ __name(function() { - const Class = Object.getPrototypeOf(this).constructor; - const Constructor = Function.bind.apply(String, [null, ...arguments]); - const instance = new Constructor(); - Object.setPrototypeOf(instance, Class.prototype); - return instance; - }, "StringWrapper"); - StringWrapper.prototype = Object.create(String.prototype, { - constructor: { - value: StringWrapper, - enumerable: false, - writable: true, - configurable: true - } - }); - Object.setPrototypeOf(StringWrapper, String); - var _LazyJsonString = class _LazyJsonString2 extends StringWrapper { - deserializeJSON() { - return JSON.parse(super.toString()); - } - toJSON() { - return super.toString(); - } - static fromObject(object) { - if (object instanceof _LazyJsonString2) { - return object; - } else if (object instanceof String || typeof object === "string") { - return new _LazyJsonString2(object); + if (sockets && requests) { + for (const origin in sockets) { + const socketsInUse = ((_a = sockets[origin]) == null ? void 0 : _a.length) ?? 0; + const requestsEnqueued = ((_b = requests[origin]) == null ? void 0 : _b.length) ?? 0; + if (socketsInUse >= maxSockets && requestsEnqueued >= 2 * maxSockets) { + (_c = logger == null ? void 0 : logger.warn) == null ? void 0 : _c.call( + logger, + `@smithy/node-http-handler:WARN - socket usage at capacity=${socketsInUse} and ${requestsEnqueued} additional requests are enqueued. +See https://docs.aws.amazon.com/sdk-for-javascript/v3/developer-guide/node-configuring-maxsockets.html +or increase socketAcquisitionWarningTimeout=(millis) in the NodeHttpHandler config.` + ); + return Date.now(); + } + } } - return new _LazyJsonString2(JSON.stringify(object)); - } - }; - __name(_LazyJsonString, "LazyJsonString"); - var LazyJsonString = _LazyJsonString; - var _NoOpLogger = class _NoOpLogger { - trace() { - } - debug() { - } - info() { - } - warn() { + return socketWarningTimestamp; } - error() { + resolveDefaultConfig(options) { + const { requestTimeout, connectionTimeout, socketTimeout, httpAgent, httpsAgent } = options || {}; + const keepAlive = true; + const maxSockets = 50; + return { + connectionTimeout, + requestTimeout: requestTimeout ?? socketTimeout, + httpAgent: (() => { + if (httpAgent instanceof import_http2.Agent || typeof (httpAgent == null ? void 0 : httpAgent.destroy) === "function") { + return httpAgent; + } + return new import_http2.Agent({ keepAlive, maxSockets, ...httpAgent }); + })(), + httpsAgent: (() => { + if (httpsAgent instanceof import_https.Agent || typeof (httpsAgent == null ? void 0 : httpsAgent.destroy) === "function") { + return httpsAgent; + } + return new import_https.Agent({ keepAlive, maxSockets, ...httpsAgent }); + })(), + logger: console + }; } - }; - __name(_NoOpLogger, "NoOpLogger"); - var NoOpLogger = _NoOpLogger; - function map(arg0, arg1, arg2) { - let target; - let filter; - let instructions; - if (typeof arg1 === "undefined" && typeof arg2 === "undefined") { - target = {}; - instructions = arg0; - } else { - target = arg0; - if (typeof arg1 === "function") { - filter = arg1; - instructions = arg2; - return mapWithFilter(target, filter, instructions); - } else { - instructions = arg1; - } + destroy() { + var _a, _b, _c, _d; + (_b = (_a = this.config) == null ? void 0 : _a.httpAgent) == null ? void 0 : _b.destroy(); + (_d = (_c = this.config) == null ? void 0 : _c.httpsAgent) == null ? void 0 : _d.destroy(); } - for (const key of Object.keys(instructions)) { - if (!Array.isArray(instructions[key])) { - target[key] = instructions[key]; - continue; + async handle(request2, { abortSignal } = {}) { + if (!this.config) { + this.config = await this.configProvider; } - applyInstruction(target, null, instructions, key); - } - return target; - } - __name(map, "map"); - var convertMap = /* @__PURE__ */ __name((target) => { - const output = {}; - for (const [k, v] of Object.entries(target || {})) { - output[k] = [, v]; - } - return output; - }, "convertMap"); - var take = /* @__PURE__ */ __name((source, instructions) => { - const out = {}; - for (const key in instructions) { - applyInstruction(out, source, instructions, key); - } - return out; - }, "take"); - var mapWithFilter = /* @__PURE__ */ __name((target, filter, instructions) => { - return map( - target, - Object.entries(instructions).reduce( - (_instructions, [key, value]) => { - if (Array.isArray(value)) { - _instructions[key] = value; + return new Promise((_resolve, _reject) => { + let writeRequestBodyPromise = void 0; + const timeouts = []; + const resolve = /* @__PURE__ */ __name(async (arg) => { + await writeRequestBodyPromise; + timeouts.forEach(clearTimeout); + _resolve(arg); + }, "resolve"); + const reject = /* @__PURE__ */ __name(async (arg) => { + await writeRequestBodyPromise; + timeouts.forEach(clearTimeout); + _reject(arg); + }, "reject"); + if (!this.config) { + throw new Error("Node HTTP request handler config is not resolved"); + } + if (abortSignal == null ? void 0 : abortSignal.aborted) { + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + return; + } + const isSSL = request2.protocol === "https:"; + const agent = isSSL ? this.config.httpsAgent : this.config.httpAgent; + timeouts.push( + setTimeout( + () => { + this.socketWarningTimestamp = _NodeHttpHandler2.checkSocketUsage( + agent, + this.socketWarningTimestamp, + this.config.logger + ); + }, + this.config.socketAcquisitionWarningTimeout ?? (this.config.requestTimeout ?? 2e3) + (this.config.connectionTimeout ?? 1e3) + ) + ); + const queryString = (0, import_querystring_builder.buildQueryString)(request2.query || {}); + let auth = void 0; + if (request2.username != null || request2.password != null) { + const username = request2.username ?? ""; + const password = request2.password ?? ""; + auth = `${username}:${password}`; + } + let path = request2.path; + if (queryString) { + path += `?${queryString}`; + } + if (request2.fragment) { + path += `#${request2.fragment}`; + } + let hostname = request2.hostname ?? ""; + if (hostname[0] === "[" && hostname.endsWith("]")) { + hostname = request2.hostname.slice(1, -1); + } else { + hostname = request2.hostname; + } + const nodeHttpsOptions = { + headers: request2.headers, + host: hostname, + method: request2.method, + path, + port: request2.port, + agent, + auth + }; + const requestFunc = isSSL ? import_https.request : import_http2.request; + const req = requestFunc(nodeHttpsOptions, (res) => { + const httpResponse = new import_protocol_http8.HttpResponse({ + statusCode: res.statusCode || -1, + reason: res.statusMessage, + headers: getTransformedHeaders(res.headers), + body: res + }); + resolve({ response: httpResponse }); + }); + req.on("error", (err) => { + if (NODEJS_TIMEOUT_ERROR_CODES.includes(err.code)) { + reject(Object.assign(err, { name: "TimeoutError" })); } else { - if (typeof value === "function") { - _instructions[key] = [filter, value()]; - } else { - _instructions[key] = [filter, value]; - } + reject(err); + } + }); + if (abortSignal) { + const onAbort = /* @__PURE__ */ __name(() => { + req.destroy(); + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + }, "onAbort"); + if (typeof abortSignal.addEventListener === "function") { + const signal = abortSignal; + signal.addEventListener("abort", onAbort, { once: true }); + req.once("close", () => signal.removeEventListener("abort", onAbort)); + } else { + abortSignal.onabort = onAbort; } - return _instructions; - }, - {} - ) - ); - }, "mapWithFilter"); - var applyInstruction = /* @__PURE__ */ __name((target, source, instructions, targetKey) => { - if (source !== null) { - let instruction = instructions[targetKey]; - if (typeof instruction === "function") { - instruction = [, instruction]; - } - const [filter2 = nonNullish, valueFn = pass, sourceKey = targetKey] = instruction; - if (typeof filter2 === "function" && filter2(source[sourceKey]) || typeof filter2 !== "function" && !!filter2) { - target[targetKey] = valueFn(source[sourceKey]); - } - return; + } + timeouts.push(setConnectionTimeout(req, reject, this.config.connectionTimeout)); + timeouts.push(setSocketTimeout(req, reject, this.config.requestTimeout)); + const httpAgent = nodeHttpsOptions.agent; + if (typeof httpAgent === "object" && "keepAlive" in httpAgent) { + timeouts.push( + setSocketKeepAlive(req, { + // @ts-expect-error keepAlive is not public on httpAgent. + keepAlive: httpAgent.keepAlive, + // @ts-expect-error keepAliveMsecs is not public on httpAgent. + keepAliveMsecs: httpAgent.keepAliveMsecs + }) + ); + } + writeRequestBodyPromise = writeRequestBody(req, request2, this.config.requestTimeout).catch((e) => { + timeouts.forEach(clearTimeout); + return _reject(e); + }); + }); } - let [filter, value] = instructions[targetKey]; - if (typeof value === "function") { - let _value; - const defaultFilterPassed = filter === void 0 && (_value = value()) != null; - const customFilterPassed = typeof filter === "function" && !!filter(void 0) || typeof filter !== "function" && !!filter; - if (defaultFilterPassed) { - target[targetKey] = _value; - } else if (customFilterPassed) { - target[targetKey] = value(); - } - } else { - const defaultFilterPassed = filter === void 0 && value != null; - const customFilterPassed = typeof filter === "function" && !!filter(value) || typeof filter !== "function" && !!filter; - if (defaultFilterPassed || customFilterPassed) { - target[targetKey] = value; - } + updateHttpClientConfig(key, value) { + this.config = void 0; + this.configProvider = this.configProvider.then((config) => { + return { + ...config, + [key]: value + }; + }); } - }, "applyInstruction"); - var nonNullish = /* @__PURE__ */ __name((_) => _ != null, "nonNullish"); - var pass = /* @__PURE__ */ __name((_) => _, "pass"); - function quoteHeader(part) { - if (part.includes(",") || part.includes('"')) { - part = `"${part.replace(/"/g, '\\"')}"`; + httpHandlerConfigs() { + return this.config ?? {}; } - return part; - } - __name(quoteHeader, "quoteHeader"); - var resolvedPath2 = /* @__PURE__ */ __name((resolvedPath22, input, memberName, labelValueProvider, uriLabel, isGreedyLabel) => { - if (input != null && input[memberName] !== void 0) { - const labelValue = labelValueProvider(); - if (labelValue.length <= 0) { - throw new Error("Empty value provided for input HTTP label: " + memberName + "."); + }; + __name(_NodeHttpHandler, "NodeHttpHandler"); + var NodeHttpHandler = _NodeHttpHandler; + var import_http22 = require("http2"); + var import_http23 = __toESM2(require("http2")); + var _NodeHttp2ConnectionPool = class _NodeHttp2ConnectionPool { + constructor(sessions) { + this.sessions = []; + this.sessions = sessions ?? []; + } + poll() { + if (this.sessions.length > 0) { + return this.sessions.shift(); } - resolvedPath22 = resolvedPath22.replace( - uriLabel, - isGreedyLabel ? labelValue.split("/").map((segment) => extendedEncodeURIComponent(segment)).join("/") : extendedEncodeURIComponent(labelValue) - ); - } else { - throw new Error("No value provided for input HTTP label: " + memberName + "."); } - return resolvedPath22; - }, "resolvedPath"); - var serializeFloat = /* @__PURE__ */ __name((value) => { - if (value !== value) { - return "NaN"; + offerLast(session) { + this.sessions.push(session); } - switch (value) { - case Infinity: - return "Infinity"; - case -Infinity: - return "-Infinity"; - default: - return value; + contains(session) { + return this.sessions.includes(session); } - }, "serializeFloat"); - var serializeDateTime = /* @__PURE__ */ __name((date) => date.toISOString().replace(".000Z", "Z"), "serializeDateTime"); - var _json = /* @__PURE__ */ __name((obj) => { - if (obj == null) { - return {}; + remove(session) { + this.sessions = this.sessions.filter((s) => s !== session); } - if (Array.isArray(obj)) { - return obj.filter((_) => _ != null).map(_json); + [Symbol.iterator]() { + return this.sessions[Symbol.iterator](); } - if (typeof obj === "object") { - const target = {}; - for (const key of Object.keys(obj)) { - if (obj[key] == null) { - continue; + destroy(connection) { + for (const session of this.sessions) { + if (session === connection) { + if (!session.destroyed) { + session.destroy(); + } } - target[key] = _json(obj[key]); } - return target; - } - return obj; - }, "_json"); - function splitEvery(value, delimiter, numDelimiters) { - if (numDelimiters <= 0 || !Number.isInteger(numDelimiters)) { - throw new Error("Invalid number of delimiters (" + numDelimiters + ") for splitEvery."); - } - const segments = value.split(delimiter); - if (numDelimiters === 1) { - return segments; } - const compoundSegments = []; - let currentSegment = ""; - for (let i = 0; i < segments.length; i++) { - if (currentSegment === "") { - currentSegment = segments[i]; - } else { - currentSegment += delimiter + segments[i]; - } - if ((i + 1) % numDelimiters === 0) { - compoundSegments.push(currentSegment); - currentSegment = ""; + }; + __name(_NodeHttp2ConnectionPool, "NodeHttp2ConnectionPool"); + var NodeHttp2ConnectionPool = _NodeHttp2ConnectionPool; + var _NodeHttp2ConnectionManager = class _NodeHttp2ConnectionManager { + constructor(config) { + this.sessionCache = /* @__PURE__ */ new Map(); + this.config = config; + if (this.config.maxConcurrency && this.config.maxConcurrency <= 0) { + throw new RangeError("maxConcurrency must be greater than zero."); } } - if (currentSegment !== "") { - compoundSegments.push(currentSegment); - } - return compoundSegments; - } - __name(splitEvery, "splitEvery"); - var splitHeader = /* @__PURE__ */ __name((value) => { - const z = value.length; - const values = []; - let withinQuotes = false; - let prevChar = void 0; - let anchor = 0; - for (let i = 0; i < z; ++i) { - const char = value[i]; - switch (char) { - case `"`: - if (prevChar !== "\\") { - withinQuotes = !withinQuotes; - } - break; - case ",": - if (!withinQuotes) { - values.push(value.slice(anchor, i)); - anchor = i + 1; + lease(requestContext, connectionConfiguration) { + const url2 = this.getUrlString(requestContext); + const existingPool = this.sessionCache.get(url2); + if (existingPool) { + const existingSession = existingPool.poll(); + if (existingSession && !this.config.disableConcurrency) { + return existingSession; + } + } + const session = import_http23.default.connect(url2); + if (this.config.maxConcurrency) { + session.settings({ maxConcurrentStreams: this.config.maxConcurrency }, (err) => { + if (err) { + throw new Error( + "Fail to set maxConcurrentStreams to " + this.config.maxConcurrency + "when creating new session for " + requestContext.destination.toString() + ); } - break; - default: + }); } - prevChar = char; + session.unref(); + const destroySessionCb = /* @__PURE__ */ __name(() => { + session.destroy(); + this.deleteSession(url2, session); + }, "destroySessionCb"); + session.on("goaway", destroySessionCb); + session.on("error", destroySessionCb); + session.on("frameError", destroySessionCb); + session.on("close", () => this.deleteSession(url2, session)); + if (connectionConfiguration.requestTimeout) { + session.setTimeout(connectionConfiguration.requestTimeout, destroySessionCb); + } + const connectionPool = this.sessionCache.get(url2) || new NodeHttp2ConnectionPool(); + connectionPool.offerLast(session); + this.sessionCache.set(url2, connectionPool); + return session; } - values.push(value.slice(anchor)); - return values.map((v) => { - v = v.trim(); - const z2 = v.length; - if (z2 < 2) { - return v; + /** + * Delete a session from the connection pool. + * @param authority The authority of the session to delete. + * @param session The session to delete. + */ + deleteSession(authority, session) { + const existingConnectionPool = this.sessionCache.get(authority); + if (!existingConnectionPool) { + return; } - if (v[0] === `"` && v[z2 - 1] === `"`) { - v = v.slice(1, z2 - 1); + if (!existingConnectionPool.contains(session)) { + return; + } + existingConnectionPool.remove(session); + this.sessionCache.set(authority, existingConnectionPool); + } + release(requestContext, session) { + var _a; + const cacheKey = this.getUrlString(requestContext); + (_a = this.sessionCache.get(cacheKey)) == null ? void 0 : _a.offerLast(session); + } + destroy() { + for (const [key, connectionPool] of this.sessionCache) { + for (const session of connectionPool) { + if (!session.destroyed) { + session.destroy(); + } + connectionPool.remove(session); + } + this.sessionCache.delete(key); } - return v.replace(/\\"/g, '"'); - }); - }, "splitHeader"); - } -}); - -// ../../../node_modules/@smithy/middleware-retry/dist-cjs/isStreamingPayload/isStreamingPayload.js -var require_isStreamingPayload = __commonJS({ - "../../../node_modules/@smithy/middleware-retry/dist-cjs/isStreamingPayload/isStreamingPayload.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.isStreamingPayload = void 0; - var stream_1 = require("stream"); - var isStreamingPayload = (request2) => (request2 === null || request2 === void 0 ? void 0 : request2.body) instanceof stream_1.Readable || typeof ReadableStream !== "undefined" && (request2 === null || request2 === void 0 ? void 0 : request2.body) instanceof ReadableStream; - exports2.isStreamingPayload = isStreamingPayload; - } -}); - -// ../../../node_modules/@smithy/middleware-retry/dist-cjs/index.js -var require_dist_cjs38 = __commonJS({ - "../../../node_modules/@smithy/middleware-retry/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); } - return to; - }; - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - AdaptiveRetryStrategy: () => AdaptiveRetryStrategy, - CONFIG_MAX_ATTEMPTS: () => CONFIG_MAX_ATTEMPTS, - CONFIG_RETRY_MODE: () => CONFIG_RETRY_MODE, - ENV_MAX_ATTEMPTS: () => ENV_MAX_ATTEMPTS, - ENV_RETRY_MODE: () => ENV_RETRY_MODE, - NODE_MAX_ATTEMPT_CONFIG_OPTIONS: () => NODE_MAX_ATTEMPT_CONFIG_OPTIONS, - NODE_RETRY_MODE_CONFIG_OPTIONS: () => NODE_RETRY_MODE_CONFIG_OPTIONS, - StandardRetryStrategy: () => StandardRetryStrategy, - defaultDelayDecider: () => defaultDelayDecider, - defaultRetryDecider: () => defaultRetryDecider, - getOmitRetryHeadersPlugin: () => getOmitRetryHeadersPlugin, - getRetryAfterHint: () => getRetryAfterHint, - getRetryPlugin: () => getRetryPlugin, - omitRetryHeadersMiddleware: () => omitRetryHeadersMiddleware, - omitRetryHeadersMiddlewareOptions: () => omitRetryHeadersMiddlewareOptions, - resolveRetryConfig: () => resolveRetryConfig, - retryMiddleware: () => retryMiddleware, - retryMiddlewareOptions: () => retryMiddlewareOptions2 - }); - module2.exports = __toCommonJS2(src_exports); - var import_protocol_http8 = require_dist_cjs21(); - var import_uuid = (init_esm_node(), __toCommonJS(esm_node_exports)); - var import_util_retry = require_dist_cjs23(); - var getDefaultRetryQuota = /* @__PURE__ */ __name((initialRetryTokens, options) => { - const MAX_CAPACITY = initialRetryTokens; - const noRetryIncrement = (options == null ? void 0 : options.noRetryIncrement) ?? import_util_retry.NO_RETRY_INCREMENT; - const retryCost = (options == null ? void 0 : options.retryCost) ?? import_util_retry.RETRY_COST; - const timeoutRetryCost = (options == null ? void 0 : options.timeoutRetryCost) ?? import_util_retry.TIMEOUT_RETRY_COST; - let availableCapacity = initialRetryTokens; - const getCapacityAmount = /* @__PURE__ */ __name((error) => error.name === "TimeoutError" ? timeoutRetryCost : retryCost, "getCapacityAmount"); - const hasRetryTokens = /* @__PURE__ */ __name((error) => getCapacityAmount(error) <= availableCapacity, "hasRetryTokens"); - const retrieveRetryTokens = /* @__PURE__ */ __name((error) => { - if (!hasRetryTokens(error)) { - throw new Error("No retry token available"); + setMaxConcurrentStreams(maxConcurrentStreams) { + if (this.config.maxConcurrency && this.config.maxConcurrency <= 0) { + throw new RangeError("maxConcurrentStreams must be greater than zero."); } - const capacityAmount = getCapacityAmount(error); - availableCapacity -= capacityAmount; - return capacityAmount; - }, "retrieveRetryTokens"); - const releaseRetryTokens = /* @__PURE__ */ __name((capacityReleaseAmount) => { - availableCapacity += capacityReleaseAmount ?? noRetryIncrement; - availableCapacity = Math.min(availableCapacity, MAX_CAPACITY); - }, "releaseRetryTokens"); - return Object.freeze({ - hasRetryTokens, - retrieveRetryTokens, - releaseRetryTokens - }); - }, "getDefaultRetryQuota"); - var defaultDelayDecider = /* @__PURE__ */ __name((delayBase, attempts) => Math.floor(Math.min(import_util_retry.MAXIMUM_RETRY_DELAY, Math.random() * 2 ** attempts * delayBase)), "defaultDelayDecider"); - var import_service_error_classification = require_dist_cjs22(); - var defaultRetryDecider = /* @__PURE__ */ __name((error) => { - if (!error) { - return false; + this.config.maxConcurrency = maxConcurrentStreams; } - return (0, import_service_error_classification.isRetryableByTrait)(error) || (0, import_service_error_classification.isClockSkewError)(error) || (0, import_service_error_classification.isThrottlingError)(error) || (0, import_service_error_classification.isTransientError)(error); - }, "defaultRetryDecider"); - var asSdkError = /* @__PURE__ */ __name((error) => { - if (error instanceof Error) - return error; - if (error instanceof Object) - return Object.assign(new Error(), error); - if (typeof error === "string") - return new Error(error); - return new Error(`AWS SDK error wrapper for ${error}`); - }, "asSdkError"); - var _StandardRetryStrategy = class _StandardRetryStrategy { - constructor(maxAttemptsProvider, options) { - this.maxAttemptsProvider = maxAttemptsProvider; - this.mode = import_util_retry.RETRY_MODES.STANDARD; - this.retryDecider = (options == null ? void 0 : options.retryDecider) ?? defaultRetryDecider; - this.delayDecider = (options == null ? void 0 : options.delayDecider) ?? defaultDelayDecider; - this.retryQuota = (options == null ? void 0 : options.retryQuota) ?? getDefaultRetryQuota(import_util_retry.INITIAL_RETRY_TOKENS); + setDisableConcurrentStreams(disableConcurrentStreams) { + this.config.disableConcurrency = disableConcurrentStreams; } - shouldRetry(error, attempts, maxAttempts) { - return attempts < maxAttempts && this.retryDecider(error) && this.retryQuota.hasRetryTokens(error); + getUrlString(request2) { + return request2.destination.toString(); } - async getMaxAttempts() { - let maxAttempts; - try { - maxAttempts = await this.maxAttemptsProvider(); - } catch (error) { - maxAttempts = import_util_retry.DEFAULT_MAX_ATTEMPTS; + }; + __name(_NodeHttp2ConnectionManager, "NodeHttp2ConnectionManager"); + var NodeHttp2ConnectionManager = _NodeHttp2ConnectionManager; + var _NodeHttp2Handler = class _NodeHttp2Handler2 { + constructor(options) { + this.metadata = { handlerProtocol: "h2" }; + this.connectionManager = new NodeHttp2ConnectionManager({}); + this.configProvider = new Promise((resolve, reject) => { + if (typeof options === "function") { + options().then((opts) => { + resolve(opts || {}); + }).catch(reject); + } else { + resolve(options || {}); + } + }); + } + /** + * @returns the input if it is an HttpHandler of any class, + * or instantiates a new instance of this handler. + */ + static create(instanceOrOptions) { + if (typeof (instanceOrOptions == null ? void 0 : instanceOrOptions.handle) === "function") { + return instanceOrOptions; } - return maxAttempts; + return new _NodeHttp2Handler2(instanceOrOptions); } - async retry(next, args, options) { - let retryTokenAmount; - let attempts = 0; - let totalDelay = 0; - const maxAttempts = await this.getMaxAttempts(); - const { request: request2 } = args; - if (import_protocol_http8.HttpRequest.isInstance(request2)) { - request2.headers[import_util_retry.INVOCATION_ID_HEADER] = (0, import_uuid.v4)(); + destroy() { + this.connectionManager.destroy(); + } + async handle(request2, { abortSignal } = {}) { + if (!this.config) { + this.config = await this.configProvider; + this.connectionManager.setDisableConcurrentStreams(this.config.disableConcurrentStreams || false); + if (this.config.maxConcurrentStreams) { + this.connectionManager.setMaxConcurrentStreams(this.config.maxConcurrentStreams); + } } - while (true) { - try { - if (import_protocol_http8.HttpRequest.isInstance(request2)) { - request2.headers[import_util_retry.REQUEST_HEADER] = `attempt=${attempts + 1}; max=${maxAttempts}`; - } - if (options == null ? void 0 : options.beforeRequest) { - await options.beforeRequest(); - } - const { response, output } = await next(args); - if (options == null ? void 0 : options.afterRequest) { - options.afterRequest(response); + const { requestTimeout, disableConcurrentStreams } = this.config; + return new Promise((_resolve, _reject) => { + var _a; + let fulfilled = false; + let writeRequestBodyPromise = void 0; + const resolve = /* @__PURE__ */ __name(async (arg) => { + await writeRequestBodyPromise; + _resolve(arg); + }, "resolve"); + const reject = /* @__PURE__ */ __name(async (arg) => { + await writeRequestBodyPromise; + _reject(arg); + }, "reject"); + if (abortSignal == null ? void 0 : abortSignal.aborted) { + fulfilled = true; + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + return; + } + const { hostname, method, port, protocol, query } = request2; + let auth = ""; + if (request2.username != null || request2.password != null) { + const username = request2.username ?? ""; + const password = request2.password ?? ""; + auth = `${username}:${password}@`; + } + const authority = `${protocol}//${auth}${hostname}${port ? `:${port}` : ""}`; + const requestContext = { destination: new URL(authority) }; + const session = this.connectionManager.lease(requestContext, { + requestTimeout: (_a = this.config) == null ? void 0 : _a.sessionTimeout, + disableConcurrentStreams: disableConcurrentStreams || false + }); + const rejectWithDestroy = /* @__PURE__ */ __name((err) => { + if (disableConcurrentStreams) { + this.destroySession(session); } - this.retryQuota.releaseRetryTokens(retryTokenAmount); - output.$metadata.attempts = attempts + 1; - output.$metadata.totalRetryDelay = totalDelay; - return { response, output }; - } catch (e) { - const err = asSdkError(e); - attempts++; - if (this.shouldRetry(err, attempts, maxAttempts)) { - retryTokenAmount = this.retryQuota.retrieveRetryTokens(err); - const delayFromDecider = this.delayDecider( - (0, import_service_error_classification.isThrottlingError)(err) ? import_util_retry.THROTTLING_RETRY_DELAY_BASE : import_util_retry.DEFAULT_RETRY_DELAY_BASE, - attempts - ); - const delayFromResponse = getDelayFromRetryAfterHeader(err.$response); - const delay = Math.max(delayFromResponse || 0, delayFromDecider); - totalDelay += delay; - await new Promise((resolve) => setTimeout(resolve, delay)); - continue; + fulfilled = true; + reject(err); + }, "rejectWithDestroy"); + const queryString = (0, import_querystring_builder.buildQueryString)(query || {}); + let path = request2.path; + if (queryString) { + path += `?${queryString}`; + } + if (request2.fragment) { + path += `#${request2.fragment}`; + } + const req = session.request({ + ...request2.headers, + [import_http22.constants.HTTP2_HEADER_PATH]: path, + [import_http22.constants.HTTP2_HEADER_METHOD]: method + }); + session.ref(); + req.on("response", (headers) => { + const httpResponse = new import_protocol_http8.HttpResponse({ + statusCode: headers[":status"] || -1, + headers: getTransformedHeaders(headers), + body: req + }); + fulfilled = true; + resolve({ response: httpResponse }); + if (disableConcurrentStreams) { + session.close(); + this.connectionManager.deleteSession(authority, session); } - if (!err.$metadata) { - err.$metadata = {}; + }); + if (requestTimeout) { + req.setTimeout(requestTimeout, () => { + req.close(); + const timeoutError = new Error(`Stream timed out because of no activity for ${requestTimeout} ms`); + timeoutError.name = "TimeoutError"; + rejectWithDestroy(timeoutError); + }); + } + if (abortSignal) { + const onAbort = /* @__PURE__ */ __name(() => { + req.close(); + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + rejectWithDestroy(abortError); + }, "onAbort"); + if (typeof abortSignal.addEventListener === "function") { + const signal = abortSignal; + signal.addEventListener("abort", onAbort, { once: true }); + req.once("close", () => signal.removeEventListener("abort", onAbort)); + } else { + abortSignal.onabort = onAbort; } - err.$metadata.attempts = attempts; - err.$metadata.totalRetryDelay = totalDelay; - throw err; } - } - } - }; - __name(_StandardRetryStrategy, "StandardRetryStrategy"); - var StandardRetryStrategy = _StandardRetryStrategy; - var getDelayFromRetryAfterHeader = /* @__PURE__ */ __name((response) => { - if (!import_protocol_http8.HttpResponse.isInstance(response)) - return; - const retryAfterHeaderName = Object.keys(response.headers).find((key) => key.toLowerCase() === "retry-after"); - if (!retryAfterHeaderName) - return; - const retryAfter = response.headers[retryAfterHeaderName]; - const retryAfterSeconds = Number(retryAfter); - if (!Number.isNaN(retryAfterSeconds)) - return retryAfterSeconds * 1e3; - const retryAfterDate = new Date(retryAfter); - return retryAfterDate.getTime() - Date.now(); - }, "getDelayFromRetryAfterHeader"); - var _AdaptiveRetryStrategy = class _AdaptiveRetryStrategy extends StandardRetryStrategy { - constructor(maxAttemptsProvider, options) { - const { rateLimiter, ...superOptions } = options ?? {}; - super(maxAttemptsProvider, superOptions); - this.rateLimiter = rateLimiter ?? new import_util_retry.DefaultRateLimiter(); - this.mode = import_util_retry.RETRY_MODES.ADAPTIVE; + req.on("frameError", (type, code, id) => { + rejectWithDestroy(new Error(`Frame type id ${type} in stream id ${id} has failed with code ${code}.`)); + }); + req.on("error", rejectWithDestroy); + req.on("aborted", () => { + rejectWithDestroy( + new Error(`HTTP/2 stream is abnormally aborted in mid-communication with result code ${req.rstCode}.`) + ); + }); + req.on("close", () => { + session.unref(); + if (disableConcurrentStreams) { + session.destroy(); + } + if (!fulfilled) { + rejectWithDestroy(new Error("Unexpected error: http2 request did not get a response")); + } + }); + writeRequestBodyPromise = writeRequestBody(req, request2, requestTimeout); + }); } - async retry(next, args) { - return super.retry(next, args, { - beforeRequest: async () => { - return this.rateLimiter.getSendToken(); - }, - afterRequest: (response) => { - this.rateLimiter.updateClientSendingRate(response); - } + updateHttpClientConfig(key, value) { + this.config = void 0; + this.configProvider = this.configProvider.then((config) => { + return { + ...config, + [key]: value + }; }); } - }; - __name(_AdaptiveRetryStrategy, "AdaptiveRetryStrategy"); - var AdaptiveRetryStrategy = _AdaptiveRetryStrategy; - var import_util_middleware3 = require_dist_cjs24(); - var ENV_MAX_ATTEMPTS = "AWS_MAX_ATTEMPTS"; - var CONFIG_MAX_ATTEMPTS = "max_attempts"; - var NODE_MAX_ATTEMPT_CONFIG_OPTIONS = { - environmentVariableSelector: (env) => { - const value = env[ENV_MAX_ATTEMPTS]; - if (!value) - return void 0; - const maxAttempt = parseInt(value); - if (Number.isNaN(maxAttempt)) { - throw new Error(`Environment variable ${ENV_MAX_ATTEMPTS} mast be a number, got "${value}"`); - } - return maxAttempt; - }, - configFileSelector: (profile) => { - const value = profile[CONFIG_MAX_ATTEMPTS]; - if (!value) - return void 0; - const maxAttempt = parseInt(value); - if (Number.isNaN(maxAttempt)) { - throw new Error(`Shared config file entry ${CONFIG_MAX_ATTEMPTS} mast be a number, got "${value}"`); - } - return maxAttempt; - }, - default: import_util_retry.DEFAULT_MAX_ATTEMPTS - }; - var resolveRetryConfig = /* @__PURE__ */ __name((input) => { - const { retryStrategy } = input; - const maxAttempts = (0, import_util_middleware3.normalizeProvider)(input.maxAttempts ?? import_util_retry.DEFAULT_MAX_ATTEMPTS); - return { - ...input, - maxAttempts, - retryStrategy: async () => { - if (retryStrategy) { - return retryStrategy; - } - const retryMode = await (0, import_util_middleware3.normalizeProvider)(input.retryMode)(); - if (retryMode === import_util_retry.RETRY_MODES.ADAPTIVE) { - return new import_util_retry.AdaptiveRetryStrategy(maxAttempts); - } - return new import_util_retry.StandardRetryStrategy(maxAttempts); + httpHandlerConfigs() { + return this.config ?? {}; + } + /** + * Destroys a session. + * @param session The session to destroy. + */ + destroySession(session) { + if (!session.destroyed) { + session.destroy(); } - }; - }, "resolveRetryConfig"); - var ENV_RETRY_MODE = "AWS_RETRY_MODE"; - var CONFIG_RETRY_MODE = "retry_mode"; - var NODE_RETRY_MODE_CONFIG_OPTIONS = { - environmentVariableSelector: (env) => env[ENV_RETRY_MODE], - configFileSelector: (profile) => profile[CONFIG_RETRY_MODE], - default: import_util_retry.DEFAULT_RETRY_MODE + } }; - var omitRetryHeadersMiddleware = /* @__PURE__ */ __name(() => (next) => async (args) => { - const { request: request2 } = args; - if (import_protocol_http8.HttpRequest.isInstance(request2)) { - delete request2.headers[import_util_retry.INVOCATION_ID_HEADER]; - delete request2.headers[import_util_retry.REQUEST_HEADER]; + __name(_NodeHttp2Handler, "NodeHttp2Handler"); + var NodeHttp2Handler = _NodeHttp2Handler; + var _Collector = class _Collector extends import_stream.Writable { + constructor() { + super(...arguments); + this.bufferedBytes = []; + } + _write(chunk, encoding, callback) { + this.bufferedBytes.push(chunk); + callback(); } - return next(args); - }, "omitRetryHeadersMiddleware"); - var omitRetryHeadersMiddlewareOptions = { - name: "omitRetryHeadersMiddleware", - tags: ["RETRY", "HEADERS", "OMIT_RETRY_HEADERS"], - relation: "before", - toMiddleware: "awsAuthMiddleware", - override: true }; - var getOmitRetryHeadersPlugin = /* @__PURE__ */ __name((options) => ({ - applyToStack: (clientStack) => { - clientStack.addRelativeTo(omitRetryHeadersMiddleware(), omitRetryHeadersMiddlewareOptions); + __name(_Collector, "Collector"); + var Collector = _Collector; + var streamCollector = /* @__PURE__ */ __name((stream) => { + if (isReadableStreamInstance(stream)) { + return collectReadableStream(stream); } - }), "getOmitRetryHeadersPlugin"); - var import_smithy_client5 = require_dist_cjs37(); - var import_isStreamingPayload = require_isStreamingPayload(); - var retryMiddleware = /* @__PURE__ */ __name((options) => (next, context) => async (args) => { - var _a; - let retryStrategy = await options.retryStrategy(); - const maxAttempts = await options.maxAttempts(); - if (isRetryStrategyV2(retryStrategy)) { - retryStrategy = retryStrategy; - let retryToken = await retryStrategy.acquireInitialRetryToken(context["partition_id"]); - let lastError = new Error(); - let attempts = 0; - let totalRetryDelay = 0; - const { request: request2 } = args; - const isRequest = import_protocol_http8.HttpRequest.isInstance(request2); - if (isRequest) { - request2.headers[import_util_retry.INVOCATION_ID_HEADER] = (0, import_uuid.v4)(); - } - while (true) { - try { - if (isRequest) { - request2.headers[import_util_retry.REQUEST_HEADER] = `attempt=${attempts + 1}; max=${maxAttempts}`; - } - const { response, output } = await next(args); - retryStrategy.recordSuccess(retryToken); - output.$metadata.attempts = attempts + 1; - output.$metadata.totalRetryDelay = totalRetryDelay; - return { response, output }; - } catch (e) { - const retryErrorInfo = getRetryErrorInfo(e); - lastError = asSdkError(e); - if (isRequest && (0, import_isStreamingPayload.isStreamingPayload)(request2)) { - (_a = context.logger instanceof import_smithy_client5.NoOpLogger ? console : context.logger) == null ? void 0 : _a.warn( - "An error was encountered in a non-retryable streaming request." - ); - throw lastError; - } - try { - retryToken = await retryStrategy.refreshRetryTokenForRetry(retryToken, retryErrorInfo); - } catch (refreshError) { - if (!lastError.$metadata) { - lastError.$metadata = {}; - } - lastError.$metadata.attempts = attempts + 1; - lastError.$metadata.totalRetryDelay = totalRetryDelay; - throw lastError; - } - attempts = retryToken.getRetryCount(); - const delay = retryToken.getRetryDelay(); - totalRetryDelay += delay; - await new Promise((resolve) => setTimeout(resolve, delay)); - } + return new Promise((resolve, reject) => { + const collector = new Collector(); + stream.pipe(collector); + stream.on("error", (err) => { + collector.end(); + reject(err); + }); + collector.on("error", reject); + collector.on("finish", function() { + const bytes = new Uint8Array(Buffer.concat(this.bufferedBytes)); + resolve(bytes); + }); + }); + }, "streamCollector"); + var isReadableStreamInstance = /* @__PURE__ */ __name((stream) => typeof ReadableStream === "function" && stream instanceof ReadableStream, "isReadableStreamInstance"); + async function collectReadableStream(stream) { + const chunks = []; + const reader = stream.getReader(); + let isDone = false; + let length = 0; + while (!isDone) { + const { done, value } = await reader.read(); + if (value) { + chunks.push(value); + length += value.length; } - } else { - retryStrategy = retryStrategy; - if (retryStrategy == null ? void 0 : retryStrategy.mode) - context.userAgent = [...context.userAgent || [], ["cfg/retry-mode", retryStrategy.mode]]; - return retryStrategy.retry(next, args); - } - }, "retryMiddleware"); - var isRetryStrategyV2 = /* @__PURE__ */ __name((retryStrategy) => typeof retryStrategy.acquireInitialRetryToken !== "undefined" && typeof retryStrategy.refreshRetryTokenForRetry !== "undefined" && typeof retryStrategy.recordSuccess !== "undefined", "isRetryStrategyV2"); - var getRetryErrorInfo = /* @__PURE__ */ __name((error) => { - const errorInfo = { - error, - errorType: getRetryErrorType(error) - }; - const retryAfterHint = getRetryAfterHint(error.$response); - if (retryAfterHint) { - errorInfo.retryAfterHint = retryAfterHint; + isDone = done; } - return errorInfo; - }, "getRetryErrorInfo"); - var getRetryErrorType = /* @__PURE__ */ __name((error) => { - if ((0, import_service_error_classification.isThrottlingError)(error)) - return "THROTTLING"; - if ((0, import_service_error_classification.isTransientError)(error)) - return "TRANSIENT"; - if ((0, import_service_error_classification.isServerError)(error)) - return "SERVER_ERROR"; - return "CLIENT_ERROR"; - }, "getRetryErrorType"); - var retryMiddlewareOptions2 = { - name: "retryMiddleware", - tags: ["RETRY"], - step: "finalizeRequest", - priority: "high", - override: true - }; - var getRetryPlugin = /* @__PURE__ */ __name((options) => ({ - applyToStack: (clientStack) => { - clientStack.add(retryMiddleware(options), retryMiddlewareOptions2); + const collected = new Uint8Array(length); + let offset = 0; + for (const chunk of chunks) { + collected.set(chunk, offset); + offset += chunk.length; } - }), "getRetryPlugin"); - var getRetryAfterHint = /* @__PURE__ */ __name((response) => { - if (!import_protocol_http8.HttpResponse.isInstance(response)) - return; - const retryAfterHeaderName = Object.keys(response.headers).find((key) => key.toLowerCase() === "retry-after"); - if (!retryAfterHeaderName) - return; - const retryAfter = response.headers[retryAfterHeaderName]; - const retryAfterSeconds = Number(retryAfter); - if (!Number.isNaN(retryAfterSeconds)) - return new Date(retryAfterSeconds * 1e3); - const retryAfterDate = new Date(retryAfter); - return retryAfterDate; - }, "getRetryAfterHint"); + return collected; + } + __name(collectReadableStream, "collectReadableStream"); } }); -// ../../../node_modules/@smithy/core/dist-es/middleware-http-signing/getHttpSigningMiddleware.js -var import_middleware_retry, httpSigningMiddlewareOptions, getHttpSigningPlugin; -var init_getHttpSigningMiddleware = __esm({ - "../../../node_modules/@smithy/core/dist-es/middleware-http-signing/getHttpSigningMiddleware.js"() { - import_middleware_retry = __toESM(require_dist_cjs38()); - init_httpSigningMiddleware(); - httpSigningMiddlewareOptions = { - step: "finalizeRequest", - tags: ["HTTP_SIGNING"], - name: "httpSigningMiddleware", - aliases: ["apiKeyMiddleware", "tokenMiddleware", "awsAuthMiddleware"], - override: true, - relation: "after", - toMiddleware: import_middleware_retry.retryMiddlewareOptions.name +// ../../../node_modules/@smithy/util-stream/node_modules/@smithy/fetch-http-handler/dist-cjs/index.js +var require_dist_cjs20 = __commonJS({ + "../../../node_modules/@smithy/util-stream/node_modules/@smithy/fetch-http-handler/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); }; - getHttpSigningPlugin = (config) => ({ - applyToStack: (clientStack) => { - clientStack.addRelativeTo(httpSigningMiddleware(config), httpSigningMiddlewareOptions); + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + FetchHttpHandler: () => FetchHttpHandler, + keepAliveSupport: () => keepAliveSupport, + streamCollector: () => streamCollector }); - } -}); - -// ../../../node_modules/@smithy/core/dist-es/middleware-http-signing/index.js -var init_middleware_http_signing = __esm({ - "../../../node_modules/@smithy/core/dist-es/middleware-http-signing/index.js"() { - init_httpSigningMiddleware(); - init_getHttpSigningMiddleware(); - } -}); - -// ../../../node_modules/@smithy/core/dist-es/util-identity-and-auth/DefaultIdentityProviderConfig.js -var DefaultIdentityProviderConfig; -var init_DefaultIdentityProviderConfig = __esm({ - "../../../node_modules/@smithy/core/dist-es/util-identity-and-auth/DefaultIdentityProviderConfig.js"() { - DefaultIdentityProviderConfig = class { - constructor(config) { - this.authSchemes = /* @__PURE__ */ new Map(); - for (const [key, value] of Object.entries(config)) { - if (value !== void 0) { - this.authSchemes.set(key, value); - } + module2.exports = __toCommonJS2(src_exports); + var import_protocol_http8 = require_dist_cjs2(); + var import_querystring_builder = require_dist_cjs18(); + function requestTimeout(timeoutInMs = 0) { + return new Promise((resolve, reject) => { + if (timeoutInMs) { + setTimeout(() => { + const timeoutError = new Error(`Request did not complete within ${timeoutInMs} ms`); + timeoutError.name = "TimeoutError"; + reject(timeoutError); + }, timeoutInMs); } - } - getIdentityProvider(schemeId) { - return this.authSchemes.get(schemeId); - } + }); + } + __name(requestTimeout, "requestTimeout"); + var keepAliveSupport = { + supported: void 0 }; - } -}); - -// ../../../node_modules/@smithy/core/dist-es/util-identity-and-auth/httpAuthSchemes/httpApiKeyAuth.js -var import_protocol_http2, import_types3, HttpApiKeyAuthSigner; -var init_httpApiKeyAuth = __esm({ - "../../../node_modules/@smithy/core/dist-es/util-identity-and-auth/httpAuthSchemes/httpApiKeyAuth.js"() { - import_protocol_http2 = __toESM(require_dist_cjs20()); - import_types3 = __toESM(require_dist_cjs()); - HttpApiKeyAuthSigner = class { - async sign(httpRequest, identity, signingProperties) { - if (!signingProperties) { - throw new Error("request could not be signed with `apiKey` since the `name` and `in` signer properties are missing"); - } - if (!signingProperties.name) { - throw new Error("request could not be signed with `apiKey` since the `name` signer property is missing"); - } - if (!signingProperties.in) { - throw new Error("request could not be signed with `apiKey` since the `in` signer property is missing"); - } - if (!identity.apiKey) { - throw new Error("request could not be signed with `apiKey` since the `apiKey` is not defined"); + var _FetchHttpHandler = class _FetchHttpHandler2 { + /** + * @returns the input if it is an HttpHandler of any class, + * or instantiates a new instance of this handler. + */ + static create(instanceOrOptions) { + if (typeof (instanceOrOptions == null ? void 0 : instanceOrOptions.handle) === "function") { + return instanceOrOptions; } - const clonedRequest = import_protocol_http2.HttpRequest.clone(httpRequest); - if (signingProperties.in === import_types3.HttpApiKeyAuthLocation.QUERY) { - clonedRequest.query[signingProperties.name] = identity.apiKey; - } else if (signingProperties.in === import_types3.HttpApiKeyAuthLocation.HEADER) { - clonedRequest.headers[signingProperties.name] = signingProperties.scheme ? `${signingProperties.scheme} ${identity.apiKey}` : identity.apiKey; + return new _FetchHttpHandler2(instanceOrOptions); + } + constructor(options) { + if (typeof options === "function") { + this.configProvider = options().then((opts) => opts || {}); } else { - throw new Error("request can only be signed with `apiKey` locations `query` or `header`, but found: `" + signingProperties.in + "`"); + this.config = options ?? {}; + this.configProvider = Promise.resolve(this.config); } - return clonedRequest; - } - }; - } -}); - -// ../../../node_modules/@smithy/core/dist-es/util-identity-and-auth/httpAuthSchemes/httpBearerAuth.js -var import_protocol_http3, HttpBearerAuthSigner; -var init_httpBearerAuth = __esm({ - "../../../node_modules/@smithy/core/dist-es/util-identity-and-auth/httpAuthSchemes/httpBearerAuth.js"() { - import_protocol_http3 = __toESM(require_dist_cjs20()); - HttpBearerAuthSigner = class { - async sign(httpRequest, identity, signingProperties) { - const clonedRequest = import_protocol_http3.HttpRequest.clone(httpRequest); - if (!identity.token) { - throw new Error("request could not be signed with `token` since the `token` is not defined"); + if (keepAliveSupport.supported === void 0) { + keepAliveSupport.supported = Boolean( + typeof Request !== "undefined" && "keepalive" in new Request("https://[::1]") + ); } - clonedRequest.headers["Authorization"] = `Bearer ${identity.token}`; - return clonedRequest; - } - }; - } -}); - -// ../../../node_modules/@smithy/core/dist-es/util-identity-and-auth/httpAuthSchemes/noAuth.js -var NoAuthSigner; -var init_noAuth = __esm({ - "../../../node_modules/@smithy/core/dist-es/util-identity-and-auth/httpAuthSchemes/noAuth.js"() { - NoAuthSigner = class { - async sign(httpRequest, identity, signingProperties) { - return httpRequest; } - }; - } -}); - -// ../../../node_modules/@smithy/core/dist-es/util-identity-and-auth/httpAuthSchemes/index.js -var init_httpAuthSchemes = __esm({ - "../../../node_modules/@smithy/core/dist-es/util-identity-and-auth/httpAuthSchemes/index.js"() { - init_httpApiKeyAuth(); - init_httpBearerAuth(); - init_noAuth(); - } -}); - -// ../../../node_modules/@smithy/core/dist-es/util-identity-and-auth/memoizeIdentityProvider.js -var createIsIdentityExpiredFunction, EXPIRATION_MS, isIdentityExpired, doesIdentityRequireRefresh, memoizeIdentityProvider; -var init_memoizeIdentityProvider = __esm({ - "../../../node_modules/@smithy/core/dist-es/util-identity-and-auth/memoizeIdentityProvider.js"() { - createIsIdentityExpiredFunction = (expirationMs) => (identity) => doesIdentityRequireRefresh(identity) && identity.expiration.getTime() - Date.now() < expirationMs; - EXPIRATION_MS = 3e5; - isIdentityExpired = createIsIdentityExpiredFunction(EXPIRATION_MS); - doesIdentityRequireRefresh = (identity) => identity.expiration !== void 0; - memoizeIdentityProvider = (provider, isExpired, requiresRefresh) => { - if (provider === void 0) { - return void 0; + destroy() { } - const normalizedProvider = typeof provider !== "function" ? async () => Promise.resolve(provider) : provider; - let resolved; - let pending; - let hasResult; - let isConstant = false; - const coalesceProvider = async (options) => { - if (!pending) { - pending = normalizedProvider(options); + async handle(request2, { abortSignal } = {}) { + var _a; + if (!this.config) { + this.config = await this.configProvider; + } + const requestTimeoutInMs = this.config.requestTimeout; + const keepAlive = this.config.keepAlive === true; + const credentials = this.config.credentials; + if (abortSignal == null ? void 0 : abortSignal.aborted) { + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + return Promise.reject(abortError); } - try { - resolved = await pending; - hasResult = true; - isConstant = false; - } finally { - pending = void 0; + let path = request2.path; + const queryString = (0, import_querystring_builder.buildQueryString)(request2.query || {}); + if (queryString) { + path += `?${queryString}`; } - return resolved; - }; - if (isExpired === void 0) { - return async (options) => { - if (!hasResult || options?.forceRefresh) { - resolved = await coalesceProvider(options); - } - return resolved; + if (request2.fragment) { + path += `#${request2.fragment}`; + } + let auth = ""; + if (request2.username != null || request2.password != null) { + const username = request2.username ?? ""; + const password = request2.password ?? ""; + auth = `${username}:${password}@`; + } + const { port, method } = request2; + const url2 = `${request2.protocol}//${auth}${request2.hostname}${port ? `:${port}` : ""}${path}`; + const body = method === "GET" || method === "HEAD" ? void 0 : request2.body; + const requestOptions = { + body, + headers: new Headers(request2.headers), + method, + credentials }; - } - return async (options) => { - if (!hasResult || options?.forceRefresh) { - resolved = await coalesceProvider(options); + if ((_a = this.config) == null ? void 0 : _a.cache) { + requestOptions.cache = this.config.cache; } - if (isConstant) { - return resolved; + if (body) { + requestOptions.duplex = "half"; } - if (!requiresRefresh(resolved)) { - isConstant = true; - return resolved; + if (typeof AbortController !== "undefined") { + requestOptions.signal = abortSignal; } - if (isExpired(resolved)) { - await coalesceProvider(options); - return resolved; + if (keepAliveSupport.supported) { + requestOptions.keepalive = keepAlive; } - return resolved; - }; - }; - } -}); - -// ../../../node_modules/@smithy/core/dist-es/util-identity-and-auth/index.js -var init_util_identity_and_auth = __esm({ - "../../../node_modules/@smithy/core/dist-es/util-identity-and-auth/index.js"() { - init_DefaultIdentityProviderConfig(); - init_httpAuthSchemes(); - init_memoizeIdentityProvider(); - } -}); - -// ../../../node_modules/@smithy/core/dist-es/getSmithyContext.js -var import_types4, getSmithyContext3; -var init_getSmithyContext = __esm({ - "../../../node_modules/@smithy/core/dist-es/getSmithyContext.js"() { - import_types4 = __toESM(require_dist_cjs()); - getSmithyContext3 = (context) => context[import_types4.SMITHY_CONTEXT_KEY] || (context[import_types4.SMITHY_CONTEXT_KEY] = {}); - } -}); - -// ../../../node_modules/@smithy/core/dist-es/normalizeProvider.js -var normalizeProvider; -var init_normalizeProvider = __esm({ - "../../../node_modules/@smithy/core/dist-es/normalizeProvider.js"() { - normalizeProvider = (input) => { - if (typeof input === "function") - return input; - const promisified = Promise.resolve(input); - return () => promisified; - }; - } -}); - -// ../../../node_modules/@smithy/core/dist-es/protocols/requestBuilder.js -function requestBuilder(input, context) { - return new RequestBuilder(input, context); -} -var import_protocol_http4, import_smithy_client, RequestBuilder; -var init_requestBuilder = __esm({ - "../../../node_modules/@smithy/core/dist-es/protocols/requestBuilder.js"() { - import_protocol_http4 = __toESM(require_dist_cjs20()); - import_smithy_client = __toESM(require_dist_cjs37()); - RequestBuilder = class { - constructor(input, context) { - this.input = input; - this.context = context; - this.query = {}; - this.method = ""; - this.headers = {}; - this.path = ""; - this.body = null; - this.hostname = ""; - this.resolvePathStack = []; - } - async build() { - const { hostname, protocol = "https", port, path: basePath } = await this.context.endpoint(); - this.path = basePath; - for (const resolvePath of this.resolvePathStack) { - resolvePath(this.path); + if (typeof this.config.requestInit === "function") { + Object.assign(requestOptions, this.config.requestInit(request2)); } - return new import_protocol_http4.HttpRequest({ - protocol, - hostname: this.hostname || hostname, - port, - method: this.method, - path: this.path, - query: this.query, - body: this.body, - headers: this.headers - }); - } - hn(hostname) { - this.hostname = hostname; - return this; - } - bp(uriLabel) { - this.resolvePathStack.push((basePath) => { - this.path = `${basePath?.endsWith("/") ? basePath.slice(0, -1) : basePath || ""}` + uriLabel; - }); - return this; + let removeSignalEventListener = /* @__PURE__ */ __name(() => { + }, "removeSignalEventListener"); + const fetchRequest = new Request(url2, requestOptions); + const raceOfPromises = [ + fetch(fetchRequest).then((response) => { + const fetchHeaders = response.headers; + const transformedHeaders = {}; + for (const pair of fetchHeaders.entries()) { + transformedHeaders[pair[0]] = pair[1]; + } + const hasReadableStream = response.body != void 0; + if (!hasReadableStream) { + return response.blob().then((body2) => ({ + response: new import_protocol_http8.HttpResponse({ + headers: transformedHeaders, + reason: response.statusText, + statusCode: response.status, + body: body2 + }) + })); + } + return { + response: new import_protocol_http8.HttpResponse({ + headers: transformedHeaders, + reason: response.statusText, + statusCode: response.status, + body: response.body + }) + }; + }), + requestTimeout(requestTimeoutInMs) + ]; + if (abortSignal) { + raceOfPromises.push( + new Promise((resolve, reject) => { + const onAbort = /* @__PURE__ */ __name(() => { + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + }, "onAbort"); + if (typeof abortSignal.addEventListener === "function") { + const signal = abortSignal; + signal.addEventListener("abort", onAbort, { once: true }); + removeSignalEventListener = /* @__PURE__ */ __name(() => signal.removeEventListener("abort", onAbort), "removeSignalEventListener"); + } else { + abortSignal.onabort = onAbort; + } + }) + ); + } + return Promise.race(raceOfPromises).finally(removeSignalEventListener); } - p(memberName, labelValueProvider, uriLabel, isGreedyLabel) { - this.resolvePathStack.push((path) => { - this.path = (0, import_smithy_client.resolvedPath)(path, this.input, memberName, labelValueProvider, uriLabel, isGreedyLabel); + updateHttpClientConfig(key, value) { + this.config = void 0; + this.configProvider = this.configProvider.then((config) => { + config[key] = value; + return config; }); - return this; - } - h(headers) { - this.headers = headers; - return this; - } - q(query) { - this.query = query; - return this; - } - b(body) { - this.body = body; - return this; } - m(method) { - this.method = method; - return this; + httpHandlerConfigs() { + return this.config ?? {}; } }; - } -}); - -// ../../../node_modules/@smithy/core/dist-es/pagination/createPaginator.js -function createPaginator(ClientCtor, CommandCtor, inputTokenName, outputTokenName, pageSizeTokenName) { - return async function* paginateOperation(config, input, ...additionalArguments) { - let token = config.startingToken || void 0; - let hasNext = true; - let page; - while (hasNext) { - input[inputTokenName] = token; - if (pageSizeTokenName) { - input[pageSizeTokenName] = input[pageSizeTokenName] ?? config.pageSize; - } - if (config.client instanceof ClientCtor) { - page = await makePagedClientRequest(CommandCtor, config.client, input, ...additionalArguments); - } else { - throw new Error(`Invalid client, expected instance of ${ClientCtor.name}`); + __name(_FetchHttpHandler, "FetchHttpHandler"); + var FetchHttpHandler = _FetchHttpHandler; + var streamCollector = /* @__PURE__ */ __name(async (stream) => { + if (typeof Blob === "function" && stream instanceof Blob) { + return new Uint8Array(await stream.arrayBuffer()); } - yield page; - const prevToken = token; - token = get(page, outputTokenName); - hasNext = !!(token && (!config.stopOnSameToken || token !== prevToken)); - } - return void 0; - }; -} -var makePagedClientRequest, get; -var init_createPaginator = __esm({ - "../../../node_modules/@smithy/core/dist-es/pagination/createPaginator.js"() { - makePagedClientRequest = async (CommandCtor, client, input, ...args) => { - return await client.send(new CommandCtor(input), ...args); - }; - get = (fromObject, path) => { - let cursor = fromObject; - const pathComponents = path.split("."); - for (const step of pathComponents) { - if (!cursor || typeof cursor !== "object") { - return void 0; + return collectStream(stream); + }, "streamCollector"); + async function collectStream(stream) { + const chunks = []; + const reader = stream.getReader(); + let isDone = false; + let length = 0; + while (!isDone) { + const { done, value } = await reader.read(); + if (value) { + chunks.push(value); + length += value.length; } - cursor = cursor[step]; + isDone = done; } - return cursor; - }; - } -}); - -// ../../../node_modules/@smithy/core/dist-es/index.js -var dist_es_exports = {}; -__export(dist_es_exports, { - DefaultIdentityProviderConfig: () => DefaultIdentityProviderConfig, - EXPIRATION_MS: () => EXPIRATION_MS, - HttpApiKeyAuthSigner: () => HttpApiKeyAuthSigner, - HttpBearerAuthSigner: () => HttpBearerAuthSigner, - NoAuthSigner: () => NoAuthSigner, - RequestBuilder: () => RequestBuilder, - createIsIdentityExpiredFunction: () => createIsIdentityExpiredFunction, - createPaginator: () => createPaginator, - doesIdentityRequireRefresh: () => doesIdentityRequireRefresh, - getHttpAuthSchemeEndpointRuleSetPlugin: () => getHttpAuthSchemeEndpointRuleSetPlugin, - getHttpAuthSchemePlugin: () => getHttpAuthSchemePlugin, - getHttpSigningPlugin: () => getHttpSigningPlugin, - getSmithyContext: () => getSmithyContext3, - httpAuthSchemeEndpointRuleSetMiddlewareOptions: () => httpAuthSchemeEndpointRuleSetMiddlewareOptions, - httpAuthSchemeMiddleware: () => httpAuthSchemeMiddleware, - httpAuthSchemeMiddlewareOptions: () => httpAuthSchemeMiddlewareOptions, - httpSigningMiddleware: () => httpSigningMiddleware, - httpSigningMiddlewareOptions: () => httpSigningMiddlewareOptions, - isIdentityExpired: () => isIdentityExpired, - memoizeIdentityProvider: () => memoizeIdentityProvider, - normalizeProvider: () => normalizeProvider, - requestBuilder: () => requestBuilder -}); -var init_dist_es = __esm({ - "../../../node_modules/@smithy/core/dist-es/index.js"() { - init_middleware_http_auth_scheme(); - init_middleware_http_signing(); - init_util_identity_and_auth(); - init_getSmithyContext(); - init_normalizeProvider(); - init_requestBuilder(); - init_createPaginator(); + const collected = new Uint8Array(length); + let offset = 0; + for (const chunk of chunks) { + collected.set(chunk, offset); + offset += chunk.length; + } + return collected; + } + __name(collectStream, "collectStream"); } }); -// ../../../node_modules/@smithy/middleware-content-length/dist-cjs/index.js -var require_dist_cjs39 = __commonJS({ - "../../../node_modules/@smithy/middleware-content-length/dist-cjs/index.js"(exports2, module2) { +// ../../../node_modules/@smithy/util-hex-encoding/dist-cjs/index.js +var require_dist_cjs21 = __commonJS({ + "../../../node_modules/@smithy/util-hex-encoding/dist-cjs/index.js"(exports2, module2) { var __defProp2 = Object.defineProperty; var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; var __getOwnPropNames2 = Object.getOwnPropertyNames; @@ -9300,454 +4243,455 @@ var require_dist_cjs39 = __commonJS({ var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); var src_exports = {}; __export2(src_exports, { - contentLengthMiddleware: () => contentLengthMiddleware, - contentLengthMiddlewareOptions: () => contentLengthMiddlewareOptions, - getContentLengthPlugin: () => getContentLengthPlugin + fromHex: () => fromHex, + toHex: () => toHex }); module2.exports = __toCommonJS2(src_exports); - var import_protocol_http8 = require_dist_cjs2(); - var CONTENT_LENGTH_HEADER = "content-length"; - function contentLengthMiddleware(bodyLengthChecker) { - return (next) => async (args) => { - const request2 = args.request; - if (import_protocol_http8.HttpRequest.isInstance(request2)) { - const { body, headers } = request2; - if (body && Object.keys(headers).map((str) => str.toLowerCase()).indexOf(CONTENT_LENGTH_HEADER) === -1) { - try { - const length = bodyLengthChecker(body); - request2.headers = { - ...request2.headers, - [CONTENT_LENGTH_HEADER]: String(length) - }; - } catch (error) { - } + var SHORT_TO_HEX = {}; + var HEX_TO_SHORT = {}; + for (let i = 0; i < 256; i++) { + let encodedByte = i.toString(16).toLowerCase(); + if (encodedByte.length === 1) { + encodedByte = `0${encodedByte}`; + } + SHORT_TO_HEX[i] = encodedByte; + HEX_TO_SHORT[encodedByte] = i; + } + function fromHex(encoded) { + if (encoded.length % 2 !== 0) { + throw new Error("Hex encoded strings must have an even number length"); + } + const out = new Uint8Array(encoded.length / 2); + for (let i = 0; i < encoded.length; i += 2) { + const encodedByte = encoded.slice(i, i + 2).toLowerCase(); + if (encodedByte in HEX_TO_SHORT) { + out[i / 2] = HEX_TO_SHORT[encodedByte]; + } else { + throw new Error(`Cannot decode unrecognized sequence ${encodedByte} as hexadecimal`); + } + } + return out; + } + __name(fromHex, "fromHex"); + function toHex(bytes) { + let out = ""; + for (let i = 0; i < bytes.byteLength; i++) { + out += SHORT_TO_HEX[bytes[i]]; + } + return out; + } + __name(toHex, "toHex"); + } +}); + +// ../../../node_modules/@smithy/util-stream/dist-cjs/stream-type-check.js +var require_stream_type_check = __commonJS({ + "../../../node_modules/@smithy/util-stream/dist-cjs/stream-type-check.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.isReadableStream = void 0; + var isReadableStream2 = (stream) => { + var _a; + return typeof ReadableStream === "function" && (((_a = stream === null || stream === void 0 ? void 0 : stream.constructor) === null || _a === void 0 ? void 0 : _a.name) === ReadableStream.name || stream instanceof ReadableStream); + }; + exports2.isReadableStream = isReadableStream2; + } +}); + +// ../../../node_modules/@smithy/util-stream/dist-cjs/sdk-stream-mixin.browser.js +var require_sdk_stream_mixin_browser = __commonJS({ + "../../../node_modules/@smithy/util-stream/dist-cjs/sdk-stream-mixin.browser.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.sdkStreamMixin = void 0; + var fetch_http_handler_1 = require_dist_cjs20(); + var util_base64_1 = require_dist_cjs16(); + var util_hex_encoding_1 = require_dist_cjs21(); + var util_utf8_1 = require_dist_cjs15(); + var stream_type_check_1 = require_stream_type_check(); + var ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED = "The stream has already been transformed."; + var sdkStreamMixin2 = (stream) => { + var _a, _b; + if (!isBlobInstance(stream) && !(0, stream_type_check_1.isReadableStream)(stream)) { + const name = ((_b = (_a = stream === null || stream === void 0 ? void 0 : stream.__proto__) === null || _a === void 0 ? void 0 : _a.constructor) === null || _b === void 0 ? void 0 : _b.name) || stream; + throw new Error(`Unexpected stream implementation, expect Blob or ReadableStream, got ${name}`); + } + let transformed = false; + const transformToByteArray = async () => { + if (transformed) { + throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED); + } + transformed = true; + return await (0, fetch_http_handler_1.streamCollector)(stream); + }; + const blobToWebStream = (blob) => { + if (typeof blob.stream !== "function") { + throw new Error("Cannot transform payload Blob to web stream. Please make sure the Blob.stream() is polyfilled.\nIf you are using React Native, this API is not yet supported, see: https://react-native.canny.io/feature-requests/p/fetch-streaming-body"); + } + return blob.stream(); + }; + return Object.assign(stream, { + transformToByteArray, + transformToString: async (encoding) => { + const buf = await transformToByteArray(); + if (encoding === "base64") { + return (0, util_base64_1.toBase64)(buf); + } else if (encoding === "hex") { + return (0, util_hex_encoding_1.toHex)(buf); + } else if (encoding === void 0 || encoding === "utf8" || encoding === "utf-8") { + return (0, util_utf8_1.toUtf8)(buf); + } else if (typeof TextDecoder === "function") { + return new TextDecoder(encoding).decode(buf); + } else { + throw new Error("TextDecoder is not available, please make sure polyfill is provided."); + } + }, + transformToWebStream: () => { + if (transformed) { + throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED); + } + transformed = true; + if (isBlobInstance(stream)) { + return blobToWebStream(stream); + } else if ((0, stream_type_check_1.isReadableStream)(stream)) { + return stream; + } else { + throw new Error(`Cannot transform payload to web stream, got ${stream}`); } } - return next({ - ...args, - request: request2 - }); + }); + }; + exports2.sdkStreamMixin = sdkStreamMixin2; + var isBlobInstance = (stream) => typeof Blob === "function" && stream instanceof Blob; + } +}); + +// ../../../node_modules/@smithy/util-stream/dist-cjs/sdk-stream-mixin.js +var require_sdk_stream_mixin = __commonJS({ + "../../../node_modules/@smithy/util-stream/dist-cjs/sdk-stream-mixin.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.sdkStreamMixin = void 0; + var node_http_handler_1 = require_dist_cjs19(); + var util_buffer_from_1 = require_dist_cjs14(); + var stream_1 = require("stream"); + var util_1 = require("util"); + var sdk_stream_mixin_browser_1 = require_sdk_stream_mixin_browser(); + var ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED = "The stream has already been transformed."; + var sdkStreamMixin2 = (stream) => { + var _a, _b; + if (!(stream instanceof stream_1.Readable)) { + try { + return (0, sdk_stream_mixin_browser_1.sdkStreamMixin)(stream); + } catch (e) { + const name = ((_b = (_a = stream === null || stream === void 0 ? void 0 : stream.__proto__) === null || _a === void 0 ? void 0 : _a.constructor) === null || _b === void 0 ? void 0 : _b.name) || stream; + throw new Error(`Unexpected stream implementation, expect Stream.Readable instance, got ${name}`); + } + } + let transformed = false; + const transformToByteArray = async () => { + if (transformed) { + throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED); + } + transformed = true; + return await (0, node_http_handler_1.streamCollector)(stream); }; - } - __name(contentLengthMiddleware, "contentLengthMiddleware"); - var contentLengthMiddlewareOptions = { - step: "build", - tags: ["SET_CONTENT_LENGTH", "CONTENT_LENGTH"], - name: "contentLengthMiddleware", - override: true + return Object.assign(stream, { + transformToByteArray, + transformToString: async (encoding) => { + const buf = await transformToByteArray(); + if (encoding === void 0 || Buffer.isEncoding(encoding)) { + return (0, util_buffer_from_1.fromArrayBuffer)(buf.buffer, buf.byteOffset, buf.byteLength).toString(encoding); + } else { + const decoder2 = new util_1.TextDecoder(encoding); + return decoder2.decode(buf); + } + }, + transformToWebStream: () => { + if (transformed) { + throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED); + } + if (stream.readableFlowing !== null) { + throw new Error("The stream has been consumed by other callbacks."); + } + if (typeof stream_1.Readable.toWeb !== "function") { + throw new Error("Readable.toWeb() is not supported. Please make sure you are using Node.js >= 17.0.0, or polyfill is available."); + } + transformed = true; + return stream_1.Readable.toWeb(stream); + } + }); }; - var getContentLengthPlugin = /* @__PURE__ */ __name((options) => ({ - applyToStack: (clientStack) => { - clientStack.add(contentLengthMiddleware(options.bodyLengthChecker), contentLengthMiddlewareOptions); + exports2.sdkStreamMixin = sdkStreamMixin2; + } +}); + +// ../../../node_modules/@smithy/util-stream/dist-cjs/splitStream.browser.js +var require_splitStream_browser = __commonJS({ + "../../../node_modules/@smithy/util-stream/dist-cjs/splitStream.browser.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.splitStream = void 0; + async function splitStream2(stream) { + if (typeof stream.stream === "function") { + stream = stream.stream(); } - }), "getContentLengthPlugin"); + const readableStream = stream; + return readableStream.tee(); + } + exports2.splitStream = splitStream2; } }); -// ../../../node_modules/@smithy/property-provider/dist-cjs/index.js -var require_dist_cjs40 = __commonJS({ - "../../../node_modules/@smithy/property-provider/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); +// ../../../node_modules/@smithy/util-stream/dist-cjs/splitStream.js +var require_splitStream = __commonJS({ + "../../../node_modules/@smithy/util-stream/dist-cjs/splitStream.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.splitStream = void 0; + var stream_1 = require("stream"); + var splitStream_browser_1 = require_splitStream_browser(); + var stream_type_check_1 = require_stream_type_check(); + async function splitStream2(stream) { + if ((0, stream_type_check_1.isReadableStream)(stream)) { + return (0, splitStream_browser_1.splitStream)(stream); } - return to; - }; - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - CredentialsProviderError: () => CredentialsProviderError, - ProviderError: () => ProviderError2, - TokenProviderError: () => TokenProviderError, - chain: () => chain, - fromStatic: () => fromStatic, - memoize: () => memoize - }); - module2.exports = __toCommonJS2(src_exports); - var _ProviderError = class _ProviderError2 extends Error { - constructor(message, options = true) { - var _a; - let logger; - let tryNextLink = true; - if (typeof options === "boolean") { - logger = void 0; - tryNextLink = options; - } else if (options != null && typeof options === "object") { - logger = options.logger; - tryNextLink = options.tryNextLink ?? true; + const stream1 = new stream_1.PassThrough(); + const stream2 = new stream_1.PassThrough(); + stream.pipe(stream1); + stream.pipe(stream2); + return [stream1, stream2]; + } + exports2.splitStream = splitStream2; + } +}); + +// ../../../node_modules/@smithy/util-stream/dist-cjs/headStream.browser.js +var require_headStream_browser = __commonJS({ + "../../../node_modules/@smithy/util-stream/dist-cjs/headStream.browser.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.headStream = void 0; + async function headStream2(stream, bytes) { + var _a; + let byteLengthCounter = 0; + const chunks = []; + const reader = stream.getReader(); + let isDone = false; + while (!isDone) { + const { done, value } = await reader.read(); + if (value) { + chunks.push(value); + byteLengthCounter += (_a = value === null || value === void 0 ? void 0 : value.byteLength) !== null && _a !== void 0 ? _a : 0; } - super(message); - this.name = "ProviderError"; - this.tryNextLink = tryNextLink; - Object.setPrototypeOf(this, _ProviderError2.prototype); - (_a = logger == null ? void 0 : logger.debug) == null ? void 0 : _a.call(logger, `@smithy/property-provider ${tryNextLink ? "->" : "(!)"} ${message}`); - } - /** - * @deprecated use new operator. - */ - static from(error, options = true) { - return Object.assign(new this(error.message, options), error); + if (byteLengthCounter >= bytes) { + break; + } + isDone = done; } - }; - __name(_ProviderError, "ProviderError"); - var ProviderError2 = _ProviderError; - var _CredentialsProviderError = class _CredentialsProviderError2 extends ProviderError2 { - /** - * @override - */ - constructor(message, options = true) { - super(message, options); - this.name = "CredentialsProviderError"; - Object.setPrototypeOf(this, _CredentialsProviderError2.prototype); + reader.releaseLock(); + const collected = new Uint8Array(Math.min(bytes, byteLengthCounter)); + let offset = 0; + for (const chunk of chunks) { + if (chunk.byteLength > collected.byteLength - offset) { + collected.set(chunk.subarray(0, collected.byteLength - offset), offset); + break; + } else { + collected.set(chunk, offset); + } + offset += chunk.length; } - }; - __name(_CredentialsProviderError, "CredentialsProviderError"); - var CredentialsProviderError = _CredentialsProviderError; - var _TokenProviderError = class _TokenProviderError2 extends ProviderError2 { - /** - * @override - */ - constructor(message, options = true) { - super(message, options); - this.name = "TokenProviderError"; - Object.setPrototypeOf(this, _TokenProviderError2.prototype); + return collected; + } + exports2.headStream = headStream2; + } +}); + +// ../../../node_modules/@smithy/util-stream/dist-cjs/headStream.js +var require_headStream = __commonJS({ + "../../../node_modules/@smithy/util-stream/dist-cjs/headStream.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.headStream = void 0; + var stream_1 = require("stream"); + var headStream_browser_1 = require_headStream_browser(); + var stream_type_check_1 = require_stream_type_check(); + var headStream2 = (stream, bytes) => { + if ((0, stream_type_check_1.isReadableStream)(stream)) { + return (0, headStream_browser_1.headStream)(stream, bytes); } + return new Promise((resolve, reject) => { + const collector = new Collector(); + collector.limit = bytes; + stream.pipe(collector); + stream.on("error", (err) => { + collector.end(); + reject(err); + }); + collector.on("error", reject); + collector.on("finish", function() { + const bytes2 = new Uint8Array(Buffer.concat(this.buffers)); + resolve(bytes2); + }); + }); }; - __name(_TokenProviderError, "TokenProviderError"); - var TokenProviderError = _TokenProviderError; - var chain = /* @__PURE__ */ __name((...providers) => async () => { - if (providers.length === 0) { - throw new ProviderError2("No providers in chain"); - } - let lastProviderError; - for (const provider of providers) { - try { - const credentials = await provider(); - return credentials; - } catch (err) { - lastProviderError = err; - if (err == null ? void 0 : err.tryNextLink) { - continue; - } - throw err; - } - } - throw lastProviderError; - }, "chain"); - var fromStatic = /* @__PURE__ */ __name((staticValue) => () => Promise.resolve(staticValue), "fromStatic"); - var memoize = /* @__PURE__ */ __name((provider, isExpired, requiresRefresh) => { - let resolved; - let pending; - let hasResult; - let isConstant = false; - const coalesceProvider = /* @__PURE__ */ __name(async () => { - if (!pending) { - pending = provider(); - } - try { - resolved = await pending; - hasResult = true; - isConstant = false; - } finally { - pending = void 0; - } - return resolved; - }, "coalesceProvider"); - if (isExpired === void 0) { - return async (options) => { - if (!hasResult || (options == null ? void 0 : options.forceRefresh)) { - resolved = await coalesceProvider(); - } - return resolved; - }; + exports2.headStream = headStream2; + var Collector = class extends stream_1.Writable { + constructor() { + super(...arguments); + this.buffers = []; + this.limit = Infinity; + this.bytesBuffered = 0; } - return async (options) => { - if (!hasResult || (options == null ? void 0 : options.forceRefresh)) { - resolved = await coalesceProvider(); - } - if (isConstant) { - return resolved; - } - if (requiresRefresh && !requiresRefresh(resolved)) { - isConstant = true; - return resolved; - } - if (isExpired(resolved)) { - await coalesceProvider(); - return resolved; + _write(chunk, encoding, callback) { + var _a; + this.buffers.push(chunk); + this.bytesBuffered += (_a = chunk.byteLength) !== null && _a !== void 0 ? _a : 0; + if (this.bytesBuffered >= this.limit) { + const excess = this.bytesBuffered - this.limit; + const tailBuffer = this.buffers[this.buffers.length - 1]; + this.buffers[this.buffers.length - 1] = tailBuffer.subarray(0, tailBuffer.byteLength - excess); + this.emit("finish"); } - return resolved; - }; - }, "memoize"); - } -}); - -// ../../../node_modules/@smithy/shared-ini-file-loader/dist-cjs/getHomeDir.js -var require_getHomeDir2 = __commonJS({ - "../../../node_modules/@smithy/shared-ini-file-loader/dist-cjs/getHomeDir.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.getHomeDir = void 0; - var os_1 = require("os"); - var path_1 = require("path"); - var homeDirCache = {}; - var getHomeDirCacheKey = () => { - if (process && process.geteuid) { - return `${process.geteuid()}`; + callback(); } - return "DEFAULT"; - }; - var getHomeDir2 = () => { - const { HOME, USERPROFILE, HOMEPATH, HOMEDRIVE = `C:${path_1.sep}` } = process.env; - if (HOME) - return HOME; - if (USERPROFILE) - return USERPROFILE; - if (HOMEPATH) - return `${HOMEDRIVE}${HOMEPATH}`; - const homeDirCacheKey = getHomeDirCacheKey(); - if (!homeDirCache[homeDirCacheKey]) - homeDirCache[homeDirCacheKey] = (0, os_1.homedir)(); - return homeDirCache[homeDirCacheKey]; }; - exports2.getHomeDir = getHomeDir2; } }); -// ../../../node_modules/@smithy/shared-ini-file-loader/dist-cjs/getSSOTokenFilepath.js -var require_getSSOTokenFilepath2 = __commonJS({ - "../../../node_modules/@smithy/shared-ini-file-loader/dist-cjs/getSSOTokenFilepath.js"(exports2) { +// ../../../node_modules/@smithy/util-stream/dist-cjs/checksum/ChecksumStream.js +var require_ChecksumStream = __commonJS({ + "../../../node_modules/@smithy/util-stream/dist-cjs/checksum/ChecksumStream.js"(exports2) { "use strict"; Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.getSSOTokenFilepath = void 0; - var crypto_1 = require("crypto"); - var path_1 = require("path"); - var getHomeDir_1 = require_getHomeDir2(); - var getSSOTokenFilepath2 = (id) => { - const hasher = (0, crypto_1.createHash)("sha1"); - const cacheName = hasher.update(id).digest("hex"); - return (0, path_1.join)((0, getHomeDir_1.getHomeDir)(), ".aws", "sso", "cache", `${cacheName}.json`); + exports2.ChecksumStream = void 0; + var util_base64_1 = require_dist_cjs16(); + var stream_1 = require("stream"); + var ChecksumStream2 = class extends stream_1.Duplex { + constructor({ expectedChecksum, checksum, source, checksumSourceLocation, base64Encoder }) { + var _a, _b; + super(); + if (typeof source.pipe === "function") { + this.source = source; + } else { + throw new Error(`@smithy/util-stream: unsupported source type ${(_b = (_a = source === null || source === void 0 ? void 0 : source.constructor) === null || _a === void 0 ? void 0 : _a.name) !== null && _b !== void 0 ? _b : source} in ChecksumStream.`); + } + this.base64Encoder = base64Encoder !== null && base64Encoder !== void 0 ? base64Encoder : util_base64_1.toBase64; + this.expectedChecksum = expectedChecksum; + this.checksum = checksum; + this.checksumSourceLocation = checksumSourceLocation; + this.source.pipe(this); + } + _read(size) { + } + _write(chunk, encoding, callback) { + try { + this.checksum.update(chunk); + this.push(chunk); + } catch (e) { + return callback(e); + } + return callback(); + } + async _final(callback) { + try { + const digest = await this.checksum.digest(); + const received = this.base64Encoder(digest); + if (this.expectedChecksum !== received) { + return callback(new Error(`Checksum mismatch: expected "${this.expectedChecksum}" but received "${received}" in response header "${this.checksumSourceLocation}".`)); + } + } catch (e) { + return callback(e); + } + this.push(null); + return callback(); + } }; - exports2.getSSOTokenFilepath = getSSOTokenFilepath2; + exports2.ChecksumStream = ChecksumStream2; } }); -// ../../../node_modules/@smithy/shared-ini-file-loader/dist-cjs/getSSOTokenFromFile.js -var require_getSSOTokenFromFile2 = __commonJS({ - "../../../node_modules/@smithy/shared-ini-file-loader/dist-cjs/getSSOTokenFromFile.js"(exports2) { +// ../../../node_modules/@smithy/util-stream/dist-cjs/checksum/ChecksumStream.browser.js +var require_ChecksumStream_browser = __commonJS({ + "../../../node_modules/@smithy/util-stream/dist-cjs/checksum/ChecksumStream.browser.js"(exports2) { "use strict"; Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.getSSOTokenFromFile = void 0; - var fs_1 = require("fs"); - var getSSOTokenFilepath_1 = require_getSSOTokenFilepath2(); - var { readFile } = fs_1.promises; - var getSSOTokenFromFile2 = async (id) => { - const ssoTokenFilepath = (0, getSSOTokenFilepath_1.getSSOTokenFilepath)(id); - const ssoTokenText = await readFile(ssoTokenFilepath, "utf8"); - return JSON.parse(ssoTokenText); + exports2.ChecksumStream = void 0; + var ReadableStreamRef = typeof ReadableStream === "function" ? ReadableStream : function() { }; - exports2.getSSOTokenFromFile = getSSOTokenFromFile2; + var ChecksumStream2 = class extends ReadableStreamRef { + }; + exports2.ChecksumStream = ChecksumStream2; } }); -// ../../../node_modules/@smithy/shared-ini-file-loader/dist-cjs/slurpFile.js -var require_slurpFile2 = __commonJS({ - "../../../node_modules/@smithy/shared-ini-file-loader/dist-cjs/slurpFile.js"(exports2) { +// ../../../node_modules/@smithy/util-stream/dist-cjs/checksum/createChecksumStream.browser.js +var require_createChecksumStream_browser = __commonJS({ + "../../../node_modules/@smithy/util-stream/dist-cjs/checksum/createChecksumStream.browser.js"(exports2) { "use strict"; Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.slurpFile = void 0; - var fs_1 = require("fs"); - var { readFile } = fs_1.promises; - var filePromisesHash = {}; - var slurpFile = (path, options) => { - if (!filePromisesHash[path] || (options === null || options === void 0 ? void 0 : options.ignoreCache)) { - filePromisesHash[path] = readFile(path, "utf8"); - } - return filePromisesHash[path]; - }; - exports2.slurpFile = slurpFile; - } -}); - -// ../../../node_modules/@smithy/shared-ini-file-loader/dist-cjs/index.js -var require_dist_cjs41 = __commonJS({ - "../../../node_modules/@smithy/shared-ini-file-loader/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); - } - return to; - }; - var __reExport = (target, mod, secondTarget) => (__copyProps2(target, mod, "default"), secondTarget && __copyProps2(secondTarget, mod, "default")); - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - CONFIG_PREFIX_SEPARATOR: () => CONFIG_PREFIX_SEPARATOR, - DEFAULT_PROFILE: () => DEFAULT_PROFILE, - ENV_PROFILE: () => ENV_PROFILE, - getProfileName: () => getProfileName, - loadSharedConfigFiles: () => loadSharedConfigFiles, - loadSsoSessionData: () => loadSsoSessionData, - parseKnownFiles: () => parseKnownFiles - }); - module2.exports = __toCommonJS2(src_exports); - __reExport(src_exports, require_getHomeDir2(), module2.exports); - var ENV_PROFILE = "AWS_PROFILE"; - var DEFAULT_PROFILE = "default"; - var getProfileName = /* @__PURE__ */ __name((init) => init.profile || process.env[ENV_PROFILE] || DEFAULT_PROFILE, "getProfileName"); - __reExport(src_exports, require_getSSOTokenFilepath2(), module2.exports); - __reExport(src_exports, require_getSSOTokenFromFile2(), module2.exports); - var import_types5 = require_dist_cjs(); - var getConfigData = /* @__PURE__ */ __name((data) => Object.entries(data).filter(([key]) => { - const indexOfSeparator = key.indexOf(CONFIG_PREFIX_SEPARATOR); - if (indexOfSeparator === -1) { - return false; - } - return Object.values(import_types5.IniSectionType).includes(key.substring(0, indexOfSeparator)); - }).reduce( - (acc, [key, value]) => { - const indexOfSeparator = key.indexOf(CONFIG_PREFIX_SEPARATOR); - const updatedKey = key.substring(0, indexOfSeparator) === import_types5.IniSectionType.PROFILE ? key.substring(indexOfSeparator + 1) : key; - acc[updatedKey] = value; - return acc; - }, - { - // Populate default profile, if present. - ...data.default && { default: data.default } - } - ), "getConfigData"); - var import_path = require("path"); - var import_getHomeDir = require_getHomeDir2(); - var ENV_CONFIG_PATH = "AWS_CONFIG_FILE"; - var getConfigFilepath = /* @__PURE__ */ __name(() => process.env[ENV_CONFIG_PATH] || (0, import_path.join)((0, import_getHomeDir.getHomeDir)(), ".aws", "config"), "getConfigFilepath"); - var import_getHomeDir2 = require_getHomeDir2(); - var ENV_CREDENTIALS_PATH = "AWS_SHARED_CREDENTIALS_FILE"; - var getCredentialsFilepath = /* @__PURE__ */ __name(() => process.env[ENV_CREDENTIALS_PATH] || (0, import_path.join)((0, import_getHomeDir2.getHomeDir)(), ".aws", "credentials"), "getCredentialsFilepath"); - var import_getHomeDir3 = require_getHomeDir2(); - var prefixKeyRegex = /^([\w-]+)\s(["'])?([\w-@\+\.%:/]+)\2$/; - var profileNameBlockList = ["__proto__", "profile __proto__"]; - var parseIni = /* @__PURE__ */ __name((iniData) => { - const map = {}; - let currentSection; - let currentSubSection; - for (const iniLine of iniData.split(/\r?\n/)) { - const trimmedLine = iniLine.split(/(^|\s)[;#]/)[0].trim(); - const isSection = trimmedLine[0] === "[" && trimmedLine[trimmedLine.length - 1] === "]"; - if (isSection) { - currentSection = void 0; - currentSubSection = void 0; - const sectionName = trimmedLine.substring(1, trimmedLine.length - 1); - const matches = prefixKeyRegex.exec(sectionName); - if (matches) { - const [, prefix, , name] = matches; - if (Object.values(import_types5.IniSectionType).includes(prefix)) { - currentSection = [prefix, name].join(CONFIG_PREFIX_SEPARATOR); - } - } else { - currentSection = sectionName; - } - if (profileNameBlockList.includes(sectionName)) { - throw new Error(`Found invalid profile name "${sectionName}"`); - } - } else if (currentSection) { - const indexOfEqualsSign = trimmedLine.indexOf("="); - if (![0, -1].includes(indexOfEqualsSign)) { - const [name, value] = [ - trimmedLine.substring(0, indexOfEqualsSign).trim(), - trimmedLine.substring(indexOfEqualsSign + 1).trim() - ]; - if (value === "") { - currentSubSection = name; - } else { - if (currentSubSection && iniLine.trimStart() === iniLine) { - currentSubSection = void 0; - } - map[currentSection] = map[currentSection] || {}; - const key = currentSubSection ? [currentSubSection, name].join(CONFIG_PREFIX_SEPARATOR) : name; - map[currentSection][key] = value; - } - } - } - } - return map; - }, "parseIni"); - var import_slurpFile = require_slurpFile2(); - var swallowError = /* @__PURE__ */ __name(() => ({}), "swallowError"); - var CONFIG_PREFIX_SEPARATOR = "."; - var loadSharedConfigFiles = /* @__PURE__ */ __name(async (init = {}) => { - const { filepath = getCredentialsFilepath(), configFilepath = getConfigFilepath() } = init; - const homeDir = (0, import_getHomeDir3.getHomeDir)(); - const relativeHomeDirPrefix = "~/"; - let resolvedFilepath = filepath; - if (filepath.startsWith(relativeHomeDirPrefix)) { - resolvedFilepath = (0, import_path.join)(homeDir, filepath.slice(2)); + exports2.createChecksumStream = void 0; + var util_base64_1 = require_dist_cjs16(); + var stream_type_check_1 = require_stream_type_check(); + var ChecksumStream_browser_1 = require_ChecksumStream_browser(); + var createChecksumStream2 = ({ expectedChecksum, checksum, source, checksumSourceLocation, base64Encoder }) => { + var _a, _b; + if (!(0, stream_type_check_1.isReadableStream)(source)) { + throw new Error(`@smithy/util-stream: unsupported source type ${(_b = (_a = source === null || source === void 0 ? void 0 : source.constructor) === null || _a === void 0 ? void 0 : _a.name) !== null && _b !== void 0 ? _b : source} in ChecksumStream.`); } - let resolvedConfigFilepath = configFilepath; - if (configFilepath.startsWith(relativeHomeDirPrefix)) { - resolvedConfigFilepath = (0, import_path.join)(homeDir, configFilepath.slice(2)); + const encoder = base64Encoder !== null && base64Encoder !== void 0 ? base64Encoder : util_base64_1.toBase64; + if (typeof TransformStream !== "function") { + throw new Error("@smithy/util-stream: unable to instantiate ChecksumStream because API unavailable: ReadableStream/TransformStream."); } - const parsedFiles = await Promise.all([ - (0, import_slurpFile.slurpFile)(resolvedConfigFilepath, { - ignoreCache: init.ignoreCache - }).then(parseIni).then(getConfigData).catch(swallowError), - (0, import_slurpFile.slurpFile)(resolvedFilepath, { - ignoreCache: init.ignoreCache - }).then(parseIni).catch(swallowError) - ]); - return { - configFile: parsedFiles[0], - credentialsFile: parsedFiles[1] - }; - }, "loadSharedConfigFiles"); - var getSsoSessionData = /* @__PURE__ */ __name((data) => Object.entries(data).filter(([key]) => key.startsWith(import_types5.IniSectionType.SSO_SESSION + CONFIG_PREFIX_SEPARATOR)).reduce((acc, [key, value]) => ({ ...acc, [key.substring(key.indexOf(CONFIG_PREFIX_SEPARATOR) + 1)]: value }), {}), "getSsoSessionData"); - var import_slurpFile2 = require_slurpFile2(); - var swallowError2 = /* @__PURE__ */ __name(() => ({}), "swallowError"); - var loadSsoSessionData = /* @__PURE__ */ __name(async (init = {}) => (0, import_slurpFile2.slurpFile)(init.configFilepath ?? getConfigFilepath()).then(parseIni).then(getSsoSessionData).catch(swallowError2), "loadSsoSessionData"); - var mergeConfigFiles = /* @__PURE__ */ __name((...files) => { - const merged = {}; - for (const file of files) { - for (const [key, values] of Object.entries(file)) { - if (merged[key] !== void 0) { - Object.assign(merged[key], values); + const transform = new TransformStream({ + start() { + }, + async transform(chunk, controller) { + checksum.update(chunk); + controller.enqueue(chunk); + }, + async flush(controller) { + const digest = await checksum.digest(); + const received = encoder(digest); + if (expectedChecksum !== received) { + const error = new Error(`Checksum mismatch: expected "${expectedChecksum}" but received "${received}" in response header "${checksumSourceLocation}".`); + controller.error(error); } else { - merged[key] = values; + controller.terminate(); } } + }); + source.pipeThrough(transform); + const readable = transform.readable; + Object.setPrototypeOf(readable, ChecksumStream_browser_1.ChecksumStream.prototype); + return readable; + }; + exports2.createChecksumStream = createChecksumStream2; + } +}); + +// ../../../node_modules/@smithy/util-stream/dist-cjs/checksum/createChecksumStream.js +var require_createChecksumStream = __commonJS({ + "../../../node_modules/@smithy/util-stream/dist-cjs/checksum/createChecksumStream.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.createChecksumStream = void 0; + var stream_type_check_1 = require_stream_type_check(); + var ChecksumStream_1 = require_ChecksumStream(); + var createChecksumStream_browser_1 = require_createChecksumStream_browser(); + function createChecksumStream2(init) { + if (typeof ReadableStream === "function" && (0, stream_type_check_1.isReadableStream)(init.source)) { + return (0, createChecksumStream_browser_1.createChecksumStream)(init); } - return merged; - }, "mergeConfigFiles"); - var parseKnownFiles = /* @__PURE__ */ __name(async (init) => { - const parsedFiles = await loadSharedConfigFiles(init); - return mergeConfigFiles(parsedFiles.configFile, parsedFiles.credentialsFile); - }, "parseKnownFiles"); + return new ChecksumStream_1.ChecksumStream(init); + } + exports2.createChecksumStream = createChecksumStream2; } }); -// ../../../node_modules/@smithy/node-config-provider/dist-cjs/index.js -var require_dist_cjs42 = __commonJS({ - "../../../node_modules/@smithy/node-config-provider/dist-cjs/index.js"(exports2, module2) { +// ../../../node_modules/@smithy/util-stream/dist-cjs/index.js +var require_dist_cjs22 = __commonJS({ + "../../../node_modules/@smithy/util-stream/dist-cjs/index.js"(exports2, module2) { var __defProp2 = Object.defineProperty; var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; var __getOwnPropNames2 = Object.getOwnPropertyNames; @@ -9765,317 +4709,437 @@ var require_dist_cjs42 = __commonJS({ } return to; }; + var __reExport = (target, mod, secondTarget) => (__copyProps2(target, mod, "default"), secondTarget && __copyProps2(secondTarget, mod, "default")); var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); var src_exports = {}; __export2(src_exports, { - loadConfig: () => loadConfig + Uint8ArrayBlobAdapter: () => Uint8ArrayBlobAdapter2 }); module2.exports = __toCommonJS2(src_exports); - var import_property_provider2 = require_dist_cjs40(); - function getSelectorName(functionString) { - try { - const constants = new Set(Array.from(functionString.match(/([A-Z_]){3,}/g) ?? [])); - constants.delete("CONFIG"); - constants.delete("CONFIG_PREFIX_SEPARATOR"); - constants.delete("ENV"); - return [...constants].join(", "); - } catch (e) { - return functionString; + var import_util_base64 = require_dist_cjs16(); + var import_util_utf8 = require_dist_cjs15(); + function transformToString(payload, encoding = "utf-8") { + if (encoding === "base64") { + return (0, import_util_base64.toBase64)(payload); } + return (0, import_util_utf8.toUtf8)(payload); } - __name(getSelectorName, "getSelectorName"); - var fromEnv = /* @__PURE__ */ __name((envVarSelector, logger) => async () => { - try { - const config = envVarSelector(process.env); - if (config === void 0) { - throw new Error(); + __name(transformToString, "transformToString"); + function transformFromString(str, encoding) { + if (encoding === "base64") { + return Uint8ArrayBlobAdapter2.mutate((0, import_util_base64.fromBase64)(str)); + } + return Uint8ArrayBlobAdapter2.mutate((0, import_util_utf8.fromUtf8)(str)); + } + __name(transformFromString, "transformFromString"); + var _Uint8ArrayBlobAdapter = class _Uint8ArrayBlobAdapter2 extends Uint8Array { + /** + * @param source - such as a string or Stream. + * @returns a new Uint8ArrayBlobAdapter extending Uint8Array. + */ + static fromString(source, encoding = "utf-8") { + switch (typeof source) { + case "string": + return transformFromString(source, encoding); + default: + throw new Error(`Unsupported conversion from ${typeof source} to Uint8ArrayBlobAdapter.`); } - return config; - } catch (e) { - throw new import_property_provider2.CredentialsProviderError( - e.message || `Not found in ENV: ${getSelectorName(envVarSelector.toString())}`, - { logger } - ); } - }, "fromEnv"); - var import_shared_ini_file_loader = require_dist_cjs41(); - var fromSharedConfigFiles = /* @__PURE__ */ __name((configSelector, { preferredFile = "config", ...init } = {}) => async () => { - const profile = (0, import_shared_ini_file_loader.getProfileName)(init); - const { configFile, credentialsFile } = await (0, import_shared_ini_file_loader.loadSharedConfigFiles)(init); - const profileFromCredentials = credentialsFile[profile] || {}; - const profileFromConfig = configFile[profile] || {}; - const mergedProfile = preferredFile === "config" ? { ...profileFromCredentials, ...profileFromConfig } : { ...profileFromConfig, ...profileFromCredentials }; - try { - const cfgFile = preferredFile === "config" ? configFile : credentialsFile; - const configValue = configSelector(mergedProfile, cfgFile); - if (configValue === void 0) { - throw new Error(); + /** + * @param source - Uint8Array to be mutated. + * @returns the same Uint8Array but with prototype switched to Uint8ArrayBlobAdapter. + */ + static mutate(source) { + Object.setPrototypeOf(source, _Uint8ArrayBlobAdapter2.prototype); + return source; + } + /** + * @param encoding - default 'utf-8'. + * @returns the blob as string. + */ + transformToString(encoding = "utf-8") { + return transformToString(this, encoding); + } + }; + __name(_Uint8ArrayBlobAdapter, "Uint8ArrayBlobAdapter"); + var Uint8ArrayBlobAdapter2 = _Uint8ArrayBlobAdapter; + __reExport(src_exports, require_getAwsChunkedEncodingStream(), module2.exports); + __reExport(src_exports, require_sdk_stream_mixin(), module2.exports); + __reExport(src_exports, require_splitStream(), module2.exports); + __reExport(src_exports, require_headStream(), module2.exports); + __reExport(src_exports, require_stream_type_check(), module2.exports); + __reExport(src_exports, require_createChecksumStream(), module2.exports); + __reExport(src_exports, require_ChecksumStream(), module2.exports); + } +}); + +// ../../../node_modules/@smithy/core/dist-es/submodules/protocols/collect-stream-body.js +var import_util_stream, collectBody2; +var init_collect_stream_body = __esm({ + "../../../node_modules/@smithy/core/dist-es/submodules/protocols/collect-stream-body.js"() { + import_util_stream = __toESM(require_dist_cjs22()); + collectBody2 = async (streamBody = new Uint8Array(), context) => { + if (streamBody instanceof Uint8Array) { + return import_util_stream.Uint8ArrayBlobAdapter.mutate(streamBody); + } + if (!streamBody) { + return import_util_stream.Uint8ArrayBlobAdapter.mutate(new Uint8Array()); + } + const fromContext = context.streamCollector(streamBody); + return import_util_stream.Uint8ArrayBlobAdapter.mutate(await fromContext); + }; + } +}); + +// ../../../node_modules/@smithy/core/dist-es/submodules/protocols/extended-encode-uri-component.js +function extendedEncodeURIComponent2(str) { + return encodeURIComponent(str).replace(/[!'()*]/g, function(c) { + return "%" + c.charCodeAt(0).toString(16).toUpperCase(); + }); +} +var init_extended_encode_uri_component = __esm({ + "../../../node_modules/@smithy/core/dist-es/submodules/protocols/extended-encode-uri-component.js"() { + } +}); + +// ../../../node_modules/@smithy/core/dist-es/submodules/protocols/requestBuilder.js +function requestBuilder(input, context) { + return new RequestBuilder(input, context); +} +var import_protocol_http2, RequestBuilder; +var init_requestBuilder = __esm({ + "../../../node_modules/@smithy/core/dist-es/submodules/protocols/requestBuilder.js"() { + init_protocols(); + import_protocol_http2 = __toESM(require_dist_cjs2()); + RequestBuilder = class { + constructor(input, context) { + this.input = input; + this.context = context; + this.query = {}; + this.method = ""; + this.headers = {}; + this.path = ""; + this.body = null; + this.hostname = ""; + this.resolvePathStack = []; + } + async build() { + const { hostname, protocol = "https", port, path: basePath } = await this.context.endpoint(); + this.path = basePath; + for (const resolvePath of this.resolvePathStack) { + resolvePath(this.path); } - return configValue; - } catch (e) { - throw new import_property_provider2.CredentialsProviderError( - e.message || `Not found in config files w/ profile [${profile}]: ${getSelectorName(configSelector.toString())}`, - { logger: init.logger } - ); + return new import_protocol_http2.HttpRequest({ + protocol, + hostname: this.hostname || hostname, + port, + method: this.method, + path: this.path, + query: this.query, + body: this.body, + headers: this.headers + }); } - }, "fromSharedConfigFiles"); - var isFunction = /* @__PURE__ */ __name((func) => typeof func === "function", "isFunction"); - var fromStatic = /* @__PURE__ */ __name((defaultValue) => isFunction(defaultValue) ? async () => await defaultValue() : (0, import_property_provider2.fromStatic)(defaultValue), "fromStatic"); - var loadConfig = /* @__PURE__ */ __name(({ environmentVariableSelector, configFileSelector, default: defaultValue }, configuration = {}) => (0, import_property_provider2.memoize)( - (0, import_property_provider2.chain)( - fromEnv(environmentVariableSelector), - fromSharedConfigFiles(configFileSelector, configuration), - fromStatic(defaultValue) - ) - ), "loadConfig"); + hn(hostname) { + this.hostname = hostname; + return this; + } + bp(uriLabel) { + this.resolvePathStack.push((basePath) => { + this.path = `${basePath?.endsWith("/") ? basePath.slice(0, -1) : basePath || ""}` + uriLabel; + }); + return this; + } + p(memberName, labelValueProvider, uriLabel, isGreedyLabel) { + this.resolvePathStack.push((path) => { + this.path = resolvedPath2(path, this.input, memberName, labelValueProvider, uriLabel, isGreedyLabel); + }); + return this; + } + h(headers) { + this.headers = headers; + return this; + } + q(query) { + this.query = query; + return this; + } + b(body) { + this.body = body; + return this; + } + m(method) { + this.method = method; + return this; + } + }; } }); -// ../../../node_modules/@smithy/middleware-endpoint/dist-cjs/adaptors/getEndpointUrlConfig.js -var require_getEndpointUrlConfig2 = __commonJS({ - "../../../node_modules/@smithy/middleware-endpoint/dist-cjs/adaptors/getEndpointUrlConfig.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.getEndpointUrlConfig = void 0; - var shared_ini_file_loader_1 = require_dist_cjs41(); - var ENV_ENDPOINT_URL = "AWS_ENDPOINT_URL"; - var CONFIG_ENDPOINT_URL = "endpoint_url"; - var getEndpointUrlConfig = (serviceId) => ({ - environmentVariableSelector: (env) => { - const serviceSuffixParts = serviceId.split(" ").map((w) => w.toUpperCase()); - const serviceEndpointUrl = env[[ENV_ENDPOINT_URL, ...serviceSuffixParts].join("_")]; - if (serviceEndpointUrl) - return serviceEndpointUrl; - const endpointUrl = env[ENV_ENDPOINT_URL]; - if (endpointUrl) - return endpointUrl; - return void 0; - }, - configFileSelector: (profile, config) => { - if (config && profile.services) { - const servicesSection = config[["services", profile.services].join(shared_ini_file_loader_1.CONFIG_PREFIX_SEPARATOR)]; - if (servicesSection) { - const servicePrefixParts = serviceId.split(" ").map((w) => w.toLowerCase()); - const endpointUrl2 = servicesSection[[servicePrefixParts.join("_"), CONFIG_ENDPOINT_URL].join(shared_ini_file_loader_1.CONFIG_PREFIX_SEPARATOR)]; - if (endpointUrl2) - return endpointUrl2; +// ../../../node_modules/@smithy/core/dist-es/submodules/protocols/resolve-path.js +var resolvedPath2; +var init_resolve_path = __esm({ + "../../../node_modules/@smithy/core/dist-es/submodules/protocols/resolve-path.js"() { + init_extended_encode_uri_component(); + resolvedPath2 = (resolvedPath3, input, memberName, labelValueProvider, uriLabel, isGreedyLabel) => { + if (input != null && input[memberName] !== void 0) { + const labelValue = labelValueProvider(); + if (labelValue.length <= 0) { + throw new Error("Empty value provided for input HTTP label: " + memberName + "."); + } + resolvedPath3 = resolvedPath3.replace(uriLabel, isGreedyLabel ? labelValue.split("/").map((segment) => extendedEncodeURIComponent2(segment)).join("/") : extendedEncodeURIComponent2(labelValue)); + } else { + throw new Error("No value provided for input HTTP label: " + memberName + "."); + } + return resolvedPath3; + }; + } +}); + +// ../../../node_modules/@smithy/core/dist-es/submodules/protocols/index.js +var protocols_exports = {}; +__export(protocols_exports, { + RequestBuilder: () => RequestBuilder, + collectBody: () => collectBody2, + extendedEncodeURIComponent: () => extendedEncodeURIComponent2, + requestBuilder: () => requestBuilder, + resolvedPath: () => resolvedPath2 +}); +var init_protocols = __esm({ + "../../../node_modules/@smithy/core/dist-es/submodules/protocols/index.js"() { + init_collect_stream_body(); + init_extended_encode_uri_component(); + init_requestBuilder(); + init_resolve_path(); + } +}); + +// ../../../node_modules/@smithy/core/dist-es/protocols/requestBuilder.js +var init_requestBuilder2 = __esm({ + "../../../node_modules/@smithy/core/dist-es/protocols/requestBuilder.js"() { + init_protocols(); + } +}); + +// ../../../node_modules/@smithy/core/dist-es/setFeature.js +function setFeature(context, feature, value) { + if (!context.__smithy_context) { + context.__smithy_context = { + features: {} + }; + } else if (!context.__smithy_context.features) { + context.__smithy_context.features = {}; + } + context.__smithy_context.features[feature] = value; +} +var init_setFeature = __esm({ + "../../../node_modules/@smithy/core/dist-es/setFeature.js"() { + } +}); + +// ../../../node_modules/@smithy/core/dist-es/util-identity-and-auth/DefaultIdentityProviderConfig.js +var DefaultIdentityProviderConfig; +var init_DefaultIdentityProviderConfig = __esm({ + "../../../node_modules/@smithy/core/dist-es/util-identity-and-auth/DefaultIdentityProviderConfig.js"() { + DefaultIdentityProviderConfig = class { + constructor(config) { + this.authSchemes = /* @__PURE__ */ new Map(); + for (const [key, value] of Object.entries(config)) { + if (value !== void 0) { + this.authSchemes.set(key, value); } } - const endpointUrl = profile[CONFIG_ENDPOINT_URL]; - if (endpointUrl) - return endpointUrl; - return void 0; - }, - default: void 0 - }); - exports2.getEndpointUrlConfig = getEndpointUrlConfig; + } + getIdentityProvider(schemeId) { + return this.authSchemes.get(schemeId); + } + }; } }); -// ../../../node_modules/@smithy/middleware-endpoint/dist-cjs/adaptors/getEndpointFromConfig.js -var require_getEndpointFromConfig2 = __commonJS({ - "../../../node_modules/@smithy/middleware-endpoint/dist-cjs/adaptors/getEndpointFromConfig.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.getEndpointFromConfig = void 0; - var node_config_provider_1 = require_dist_cjs42(); - var getEndpointUrlConfig_1 = require_getEndpointUrlConfig2(); - var getEndpointFromConfig = async (serviceId) => (0, node_config_provider_1.loadConfig)((0, getEndpointUrlConfig_1.getEndpointUrlConfig)(serviceId !== null && serviceId !== void 0 ? serviceId : ""))(); - exports2.getEndpointFromConfig = getEndpointFromConfig; +// ../../../node_modules/@smithy/core/dist-es/util-identity-and-auth/httpAuthSchemes/httpApiKeyAuth.js +var import_protocol_http3, import_types4, HttpApiKeyAuthSigner; +var init_httpApiKeyAuth = __esm({ + "../../../node_modules/@smithy/core/dist-es/util-identity-and-auth/httpAuthSchemes/httpApiKeyAuth.js"() { + import_protocol_http3 = __toESM(require_dist_cjs2()); + import_types4 = __toESM(require_dist_cjs()); + HttpApiKeyAuthSigner = class { + async sign(httpRequest, identity, signingProperties) { + if (!signingProperties) { + throw new Error("request could not be signed with `apiKey` since the `name` and `in` signer properties are missing"); + } + if (!signingProperties.name) { + throw new Error("request could not be signed with `apiKey` since the `name` signer property is missing"); + } + if (!signingProperties.in) { + throw new Error("request could not be signed with `apiKey` since the `in` signer property is missing"); + } + if (!identity.apiKey) { + throw new Error("request could not be signed with `apiKey` since the `apiKey` is not defined"); + } + const clonedRequest = import_protocol_http3.HttpRequest.clone(httpRequest); + if (signingProperties.in === import_types4.HttpApiKeyAuthLocation.QUERY) { + clonedRequest.query[signingProperties.name] = identity.apiKey; + } else if (signingProperties.in === import_types4.HttpApiKeyAuthLocation.HEADER) { + clonedRequest.headers[signingProperties.name] = signingProperties.scheme ? `${signingProperties.scheme} ${identity.apiKey}` : identity.apiKey; + } else { + throw new Error("request can only be signed with `apiKey` locations `query` or `header`, but found: `" + signingProperties.in + "`"); + } + return clonedRequest; + } + }; } }); -// ../../../node_modules/@smithy/querystring-parser/dist-cjs/index.js -var require_dist_cjs43 = __commonJS({ - "../../../node_modules/@smithy/querystring-parser/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); - } - return to; - }; - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - parseQueryString: () => parseQueryString - }); - module2.exports = __toCommonJS2(src_exports); - function parseQueryString(querystring) { - const query = {}; - querystring = querystring.replace(/^\?/, ""); - if (querystring) { - for (const pair of querystring.split("&")) { - let [key, value = null] = pair.split("="); - key = decodeURIComponent(key); - if (value) { - value = decodeURIComponent(value); - } - if (!(key in query)) { - query[key] = value; - } else if (Array.isArray(query[key])) { - query[key].push(value); - } else { - query[key] = [query[key], value]; - } +// ../../../node_modules/@smithy/core/dist-es/util-identity-and-auth/httpAuthSchemes/httpBearerAuth.js +var import_protocol_http4, HttpBearerAuthSigner; +var init_httpBearerAuth = __esm({ + "../../../node_modules/@smithy/core/dist-es/util-identity-and-auth/httpAuthSchemes/httpBearerAuth.js"() { + import_protocol_http4 = __toESM(require_dist_cjs2()); + HttpBearerAuthSigner = class { + async sign(httpRequest, identity, signingProperties) { + const clonedRequest = import_protocol_http4.HttpRequest.clone(httpRequest); + if (!identity.token) { + throw new Error("request could not be signed with `token` since the `token` is not defined"); } + clonedRequest.headers["Authorization"] = `Bearer ${identity.token}`; + return clonedRequest; } - return query; - } - __name(parseQueryString, "parseQueryString"); + }; } }); -// ../../../node_modules/@smithy/url-parser/dist-cjs/index.js -var require_dist_cjs44 = __commonJS({ - "../../../node_modules/@smithy/url-parser/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); +// ../../../node_modules/@smithy/core/dist-es/util-identity-and-auth/httpAuthSchemes/noAuth.js +var NoAuthSigner; +var init_noAuth = __esm({ + "../../../node_modules/@smithy/core/dist-es/util-identity-and-auth/httpAuthSchemes/noAuth.js"() { + NoAuthSigner = class { + async sign(httpRequest, identity, signingProperties) { + return httpRequest; } - return to; }; - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - parseUrl: () => parseUrl - }); - module2.exports = __toCommonJS2(src_exports); - var import_querystring_parser = require_dist_cjs43(); - var parseUrl = /* @__PURE__ */ __name((url2) => { - if (typeof url2 === "string") { - return parseUrl(new URL(url2)); - } - const { hostname, pathname, port, protocol, search } = url2; - let query; - if (search) { - query = (0, import_querystring_parser.parseQueryString)(search); - } - return { - hostname, - port: port ? parseInt(port) : void 0, - protocol, - path: pathname, - query - }; - }, "parseUrl"); } }); -// ../../../node_modules/@smithy/middleware-serde/dist-cjs/index.js -var require_dist_cjs45 = __commonJS({ - "../../../node_modules/@smithy/middleware-serde/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); +// ../../../node_modules/@smithy/core/dist-es/util-identity-and-auth/httpAuthSchemes/index.js +var init_httpAuthSchemes = __esm({ + "../../../node_modules/@smithy/core/dist-es/util-identity-and-auth/httpAuthSchemes/index.js"() { + init_httpApiKeyAuth(); + init_httpBearerAuth(); + init_noAuth(); + } +}); + +// ../../../node_modules/@smithy/core/dist-es/util-identity-and-auth/memoizeIdentityProvider.js +var createIsIdentityExpiredFunction, EXPIRATION_MS, isIdentityExpired, doesIdentityRequireRefresh, memoizeIdentityProvider; +var init_memoizeIdentityProvider = __esm({ + "../../../node_modules/@smithy/core/dist-es/util-identity-and-auth/memoizeIdentityProvider.js"() { + createIsIdentityExpiredFunction = (expirationMs) => (identity) => doesIdentityRequireRefresh(identity) && identity.expiration.getTime() - Date.now() < expirationMs; + EXPIRATION_MS = 3e5; + isIdentityExpired = createIsIdentityExpiredFunction(EXPIRATION_MS); + doesIdentityRequireRefresh = (identity) => identity.expiration !== void 0; + memoizeIdentityProvider = (provider, isExpired, requiresRefresh) => { + if (provider === void 0) { + return void 0; } - return to; - }; - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - deserializerMiddleware: () => deserializerMiddleware, - deserializerMiddlewareOption: () => deserializerMiddlewareOption, - getSerdePlugin: () => getSerdePlugin, - serializerMiddleware: () => serializerMiddleware, - serializerMiddlewareOption: () => serializerMiddlewareOption2 - }); - module2.exports = __toCommonJS2(src_exports); - var deserializerMiddleware = /* @__PURE__ */ __name((options, deserializer) => (next) => async (args) => { - const { response } = await next(args); - try { - const parsed = await deserializer(response, options); - return { - response, - output: parsed - }; - } catch (error) { - Object.defineProperty(error, "$response", { - value: response - }); - if (!("$metadata" in error)) { - const hint = `Deserialization error: to see the raw response, inspect the hidden field {error}.$response on this object.`; - error.message += "\n " + hint; - if (typeof error.$responseBodyText !== "undefined") { - if (error.$response) { - error.$response.body = error.$responseBodyText; - } - } + const normalizedProvider = typeof provider !== "function" ? async () => Promise.resolve(provider) : provider; + let resolved; + let pending; + let hasResult; + let isConstant = false; + const coalesceProvider = async (options) => { + if (!pending) { + pending = normalizedProvider(options); } - throw error; - } - }, "deserializerMiddleware"); - var serializerMiddleware = /* @__PURE__ */ __name((options, serializer) => (next, context) => async (args) => { - var _a; - const endpoint = ((_a = context.endpointV2) == null ? void 0 : _a.url) && options.urlParser ? async () => options.urlParser(context.endpointV2.url) : options.endpoint; - if (!endpoint) { - throw new Error("No valid endpoint provider available."); - } - const request2 = await serializer(args.input, { ...options, endpoint }); - return next({ - ...args, - request: request2 - }); - }, "serializerMiddleware"); - var deserializerMiddlewareOption = { - name: "deserializerMiddleware", - step: "deserialize", - tags: ["DESERIALIZER"], - override: true - }; - var serializerMiddlewareOption2 = { - name: "serializerMiddleware", - step: "serialize", - tags: ["SERIALIZER"], - override: true - }; - function getSerdePlugin(config, serializer, deserializer) { - return { - applyToStack: (commandStack) => { - commandStack.add(deserializerMiddleware(config, deserializer), deserializerMiddlewareOption); - commandStack.add(serializerMiddleware(config, serializer), serializerMiddlewareOption2); + try { + resolved = await pending; + hasResult = true; + isConstant = false; + } finally { + pending = void 0; } + return resolved; }; - } - __name(getSerdePlugin, "getSerdePlugin"); + if (isExpired === void 0) { + return async (options) => { + if (!hasResult || options?.forceRefresh) { + resolved = await coalesceProvider(options); + } + return resolved; + }; + } + return async (options) => { + if (!hasResult || options?.forceRefresh) { + resolved = await coalesceProvider(options); + } + if (isConstant) { + return resolved; + } + if (!requiresRefresh(resolved)) { + isConstant = true; + return resolved; + } + if (isExpired(resolved)) { + await coalesceProvider(options); + return resolved; + } + return resolved; + }; + }; } }); -// ../../../node_modules/@smithy/middleware-endpoint/dist-cjs/index.js -var require_dist_cjs46 = __commonJS({ - "../../../node_modules/@smithy/middleware-endpoint/dist-cjs/index.js"(exports2, module2) { +// ../../../node_modules/@smithy/core/dist-es/util-identity-and-auth/index.js +var init_util_identity_and_auth = __esm({ + "../../../node_modules/@smithy/core/dist-es/util-identity-and-auth/index.js"() { + init_DefaultIdentityProviderConfig(); + init_httpAuthSchemes(); + init_memoizeIdentityProvider(); + } +}); + +// ../../../node_modules/@smithy/core/dist-es/index.js +var dist_es_exports = {}; +__export(dist_es_exports, { + DefaultIdentityProviderConfig: () => DefaultIdentityProviderConfig, + EXPIRATION_MS: () => EXPIRATION_MS, + HttpApiKeyAuthSigner: () => HttpApiKeyAuthSigner, + HttpBearerAuthSigner: () => HttpBearerAuthSigner, + NoAuthSigner: () => NoAuthSigner, + createIsIdentityExpiredFunction: () => createIsIdentityExpiredFunction, + createPaginator: () => createPaginator, + doesIdentityRequireRefresh: () => doesIdentityRequireRefresh, + getHttpAuthSchemeEndpointRuleSetPlugin: () => getHttpAuthSchemeEndpointRuleSetPlugin, + getHttpAuthSchemePlugin: () => getHttpAuthSchemePlugin, + getHttpSigningPlugin: () => getHttpSigningPlugin, + getSmithyContext: () => getSmithyContext, + httpAuthSchemeEndpointRuleSetMiddlewareOptions: () => httpAuthSchemeEndpointRuleSetMiddlewareOptions, + httpAuthSchemeMiddleware: () => httpAuthSchemeMiddleware, + httpAuthSchemeMiddlewareOptions: () => httpAuthSchemeMiddlewareOptions, + httpSigningMiddleware: () => httpSigningMiddleware, + httpSigningMiddlewareOptions: () => httpSigningMiddlewareOptions, + isIdentityExpired: () => isIdentityExpired, + memoizeIdentityProvider: () => memoizeIdentityProvider, + normalizeProvider: () => normalizeProvider, + requestBuilder: () => requestBuilder, + setFeature: () => setFeature +}); +var init_dist_es = __esm({ + "../../../node_modules/@smithy/core/dist-es/index.js"() { + init_getSmithyContext(); + init_middleware_http_auth_scheme(); + init_middleware_http_signing(); + init_normalizeProvider(); + init_createPaginator(); + init_requestBuilder2(); + init_setFeature(); + init_util_identity_and_auth(); + } +}); + +// ../../../node_modules/@smithy/middleware-content-length/dist-cjs/index.js +var require_dist_cjs23 = __commonJS({ + "../../../node_modules/@smithy/middleware-content-length/dist-cjs/index.js"(exports2, module2) { var __defProp2 = Object.defineProperty; var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; var __getOwnPropNames2 = Object.getOwnPropertyNames; @@ -10096,450 +5160,645 @@ var require_dist_cjs46 = __commonJS({ var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); var src_exports = {}; __export2(src_exports, { - endpointMiddleware: () => endpointMiddleware, - endpointMiddlewareOptions: () => endpointMiddlewareOptions2, - getEndpointFromInstructions: () => getEndpointFromInstructions, - getEndpointPlugin: () => getEndpointPlugin, - resolveEndpointConfig: () => resolveEndpointConfig, - resolveParams: () => resolveParams, - toEndpointV1: () => toEndpointV1 + contentLengthMiddleware: () => contentLengthMiddleware, + contentLengthMiddlewareOptions: () => contentLengthMiddlewareOptions, + getContentLengthPlugin: () => getContentLengthPlugin }); module2.exports = __toCommonJS2(src_exports); - var resolveParamsForS3 = /* @__PURE__ */ __name(async (endpointParams) => { - const bucket = (endpointParams == null ? void 0 : endpointParams.Bucket) || ""; - if (typeof endpointParams.Bucket === "string") { - endpointParams.Bucket = bucket.replace(/#/g, encodeURIComponent("#")).replace(/\?/g, encodeURIComponent("?")); - } - if (isArnBucketName(bucket)) { - if (endpointParams.ForcePathStyle === true) { - throw new Error("Path-style addressing cannot be used with ARN buckets"); - } - } else if (!isDnsCompatibleBucketName(bucket) || bucket.indexOf(".") !== -1 && !String(endpointParams.Endpoint).startsWith("http:") || bucket.toLowerCase() !== bucket || bucket.length < 3) { - endpointParams.ForcePathStyle = true; - } - if (endpointParams.DisableMultiRegionAccessPoints) { - endpointParams.disableMultiRegionAccessPoints = true; - endpointParams.DisableMRAP = true; - } - return endpointParams; - }, "resolveParamsForS3"); - var DOMAIN_PATTERN = /^[a-z0-9][a-z0-9\.\-]{1,61}[a-z0-9]$/; - var IP_ADDRESS_PATTERN = /(\d+\.){3}\d+/; - var DOTS_PATTERN = /\.\./; - var isDnsCompatibleBucketName = /* @__PURE__ */ __name((bucketName) => DOMAIN_PATTERN.test(bucketName) && !IP_ADDRESS_PATTERN.test(bucketName) && !DOTS_PATTERN.test(bucketName), "isDnsCompatibleBucketName"); - var isArnBucketName = /* @__PURE__ */ __name((bucketName) => { - const [arn, partition, service, , , bucket] = bucketName.split(":"); - const isArn = arn === "arn" && bucketName.split(":").length >= 6; - const isValidArn = Boolean(isArn && partition && service && bucket); - if (isArn && !isValidArn) { - throw new Error(`Invalid ARN: ${bucketName} was an invalid ARN.`); - } - return isValidArn; - }, "isArnBucketName"); - var createConfigValueProvider = /* @__PURE__ */ __name((configKey, canonicalEndpointParamKey, config) => { - const configProvider = /* @__PURE__ */ __name(async () => { - const configValue = config[configKey] ?? config[canonicalEndpointParamKey]; - if (typeof configValue === "function") { - return configValue(); - } - return configValue; - }, "configProvider"); - if (configKey === "credentialScope" || canonicalEndpointParamKey === "CredentialScope") { - return async () => { - const credentials = typeof config.credentials === "function" ? await config.credentials() : config.credentials; - const configValue = (credentials == null ? void 0 : credentials.credentialScope) ?? (credentials == null ? void 0 : credentials.CredentialScope); - return configValue; - }; - } - if (configKey === "accountId" || canonicalEndpointParamKey === "AccountId") { - return async () => { - const credentials = typeof config.credentials === "function" ? await config.credentials() : config.credentials; - const configValue = (credentials == null ? void 0 : credentials.accountId) ?? (credentials == null ? void 0 : credentials.AccountId); - return configValue; - }; - } - if (configKey === "endpoint" || canonicalEndpointParamKey === "endpoint") { - return async () => { - const endpoint = await configProvider(); - if (endpoint && typeof endpoint === "object") { - if ("url" in endpoint) { - return endpoint.url.href; - } - if ("hostname" in endpoint) { - const { protocol, hostname, port, path } = endpoint; - return `${protocol}//${hostname}${port ? ":" + port : ""}${path}`; - } - } - return endpoint; - }; - } - return configProvider; - }, "createConfigValueProvider"); - var import_getEndpointFromConfig = require_getEndpointFromConfig2(); - var import_url_parser = require_dist_cjs44(); - var toEndpointV1 = /* @__PURE__ */ __name((endpoint) => { - if (typeof endpoint === "object") { - if ("url" in endpoint) { - return (0, import_url_parser.parseUrl)(endpoint.url); - } - return endpoint; - } - return (0, import_url_parser.parseUrl)(endpoint); - }, "toEndpointV1"); - var getEndpointFromInstructions = /* @__PURE__ */ __name(async (commandInput, instructionsSupplier, clientConfig, context) => { - if (!clientConfig.endpoint) { - let endpointFromConfig; - if (clientConfig.serviceConfiguredEndpoint) { - endpointFromConfig = await clientConfig.serviceConfiguredEndpoint(); - } else { - endpointFromConfig = await (0, import_getEndpointFromConfig.getEndpointFromConfig)(clientConfig.serviceId); - } - if (endpointFromConfig) { - clientConfig.endpoint = () => Promise.resolve(toEndpointV1(endpointFromConfig)); - } - } - const endpointParams = await resolveParams(commandInput, instructionsSupplier, clientConfig); - if (typeof clientConfig.endpointProvider !== "function") { - throw new Error("config.endpointProvider is not set."); - } - const endpoint = clientConfig.endpointProvider(endpointParams, context); - return endpoint; - }, "getEndpointFromInstructions"); - var resolveParams = /* @__PURE__ */ __name(async (commandInput, instructionsSupplier, clientConfig) => { - var _a; - const endpointParams = {}; - const instructions = ((_a = instructionsSupplier == null ? void 0 : instructionsSupplier.getEndpointParameterInstructions) == null ? void 0 : _a.call(instructionsSupplier)) || {}; - for (const [name, instruction] of Object.entries(instructions)) { - switch (instruction.type) { - case "staticContextParams": - endpointParams[name] = instruction.value; - break; - case "contextParams": - endpointParams[name] = commandInput[instruction.name]; - break; - case "clientContextParams": - case "builtInParams": - endpointParams[name] = await createConfigValueProvider(instruction.name, name, clientConfig)(); - break; - default: - throw new Error("Unrecognized endpoint parameter instruction: " + JSON.stringify(instruction)); - } - } - if (Object.keys(instructions).length === 0) { - Object.assign(endpointParams, clientConfig); - } - if (String(clientConfig.serviceId).toLowerCase() === "s3") { - await resolveParamsForS3(endpointParams); - } - return endpointParams; - }, "resolveParams"); - var import_util_middleware3 = require_dist_cjs10(); - var endpointMiddleware = /* @__PURE__ */ __name(({ - config, - instructions - }) => { - return (next, context) => async (args) => { - var _a, _b, _c; - const endpoint = await getEndpointFromInstructions( - args.input, - { - getEndpointParameterInstructions() { - return instructions; - } - }, - { ...config }, - context - ); - context.endpointV2 = endpoint; - context.authSchemes = (_a = endpoint.properties) == null ? void 0 : _a.authSchemes; - const authScheme = (_b = context.authSchemes) == null ? void 0 : _b[0]; - if (authScheme) { - context["signing_region"] = authScheme.signingRegion; - context["signing_service"] = authScheme.signingName; - const smithyContext = (0, import_util_middleware3.getSmithyContext)(context); - const httpAuthOption = (_c = smithyContext == null ? void 0 : smithyContext.selectedHttpAuthScheme) == null ? void 0 : _c.httpAuthOption; - if (httpAuthOption) { - httpAuthOption.signingProperties = Object.assign( - httpAuthOption.signingProperties || {}, - { - signing_region: authScheme.signingRegion, - signingRegion: authScheme.signingRegion, - signing_service: authScheme.signingName, - signingName: authScheme.signingName, - signingRegionSet: authScheme.signingRegionSet - }, - authScheme.properties - ); + var import_protocol_http8 = require_dist_cjs2(); + var CONTENT_LENGTH_HEADER = "content-length"; + function contentLengthMiddleware(bodyLengthChecker) { + return (next) => async (args) => { + const request2 = args.request; + if (import_protocol_http8.HttpRequest.isInstance(request2)) { + const { body, headers } = request2; + if (body && Object.keys(headers).map((str) => str.toLowerCase()).indexOf(CONTENT_LENGTH_HEADER) === -1) { + try { + const length = bodyLengthChecker(body); + request2.headers = { + ...request2.headers, + [CONTENT_LENGTH_HEADER]: String(length) + }; + } catch (error) { + } } } return next({ - ...args + ...args, + request: request2 }); }; - }, "endpointMiddleware"); - var import_middleware_serde2 = require_dist_cjs45(); - var endpointMiddlewareOptions2 = { - step: "serialize", - tags: ["ENDPOINT_PARAMETERS", "ENDPOINT_V2", "ENDPOINT"], - name: "endpointV2Middleware", - override: true, - relation: "before", - toMiddleware: import_middleware_serde2.serializerMiddlewareOption.name + } + __name(contentLengthMiddleware, "contentLengthMiddleware"); + var contentLengthMiddlewareOptions = { + step: "build", + tags: ["SET_CONTENT_LENGTH", "CONTENT_LENGTH"], + name: "contentLengthMiddleware", + override: true }; - var getEndpointPlugin = /* @__PURE__ */ __name((config, instructions) => ({ + var getContentLengthPlugin = /* @__PURE__ */ __name((options) => ({ applyToStack: (clientStack) => { - clientStack.addRelativeTo( - endpointMiddleware({ - config, - instructions - }), - endpointMiddlewareOptions2 - ); + clientStack.add(contentLengthMiddleware(options.bodyLengthChecker), contentLengthMiddlewareOptions); } - }), "getEndpointPlugin"); - var import_getEndpointFromConfig2 = require_getEndpointFromConfig2(); - var resolveEndpointConfig = /* @__PURE__ */ __name((input) => { - const tls = input.tls ?? true; - const { endpoint } = input; - const customEndpointProvider = endpoint != null ? async () => toEndpointV1(await (0, import_util_middleware3.normalizeProvider)(endpoint)()) : void 0; - const isCustomEndpoint = !!endpoint; - const resolvedConfig = { - ...input, - endpoint: customEndpointProvider, - tls, - isCustomEndpoint, - useDualstackEndpoint: (0, import_util_middleware3.normalizeProvider)(input.useDualstackEndpoint ?? false), - useFipsEndpoint: (0, import_util_middleware3.normalizeProvider)(input.useFipsEndpoint ?? false) - }; - let configuredEndpointPromise = void 0; - resolvedConfig.serviceConfiguredEndpoint = async () => { - if (input.serviceId && !configuredEndpointPromise) { - configuredEndpointPromise = (0, import_getEndpointFromConfig2.getEndpointFromConfig)(input.serviceId); - } - return configuredEndpointPromise; - }; - return resolvedConfig; - }, "resolveEndpointConfig"); + }), "getContentLengthPlugin"); } }); -// ../../../node_modules/@aws-sdk/core/dist-es/submodules/client/emitWarningIfUnsupportedVersion.js -var warningEmitted, emitWarningIfUnsupportedVersion; -var init_emitWarningIfUnsupportedVersion = __esm({ - "../../../node_modules/@aws-sdk/core/dist-es/submodules/client/emitWarningIfUnsupportedVersion.js"() { - warningEmitted = false; - emitWarningIfUnsupportedVersion = (version2) => { - if (version2 && !warningEmitted && parseInt(version2.substring(1, version2.indexOf("."))) < 18) { - warningEmitted = true; - process.emitWarning(`NodeDeprecationWarning: The AWS SDK for JavaScript (v3) will -no longer support Node.js 16.x on January 6, 2025. - -To continue receiving updates to AWS services, bug fixes, and security -updates please upgrade to a supported Node.js LTS version. - -More information can be found at: https://a.co/74kJMmI`); +// ../../../node_modules/@smithy/property-provider/dist-cjs/index.js +var require_dist_cjs24 = __commonJS({ + "../../../node_modules/@smithy/property-provider/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); } + return to; }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + CredentialsProviderError: () => CredentialsProviderError, + ProviderError: () => ProviderError2, + TokenProviderError: () => TokenProviderError, + chain: () => chain, + fromStatic: () => fromStatic, + memoize: () => memoize + }); + module2.exports = __toCommonJS2(src_exports); + var _ProviderError = class _ProviderError2 extends Error { + constructor(message, options = true) { + var _a; + let logger; + let tryNextLink = true; + if (typeof options === "boolean") { + logger = void 0; + tryNextLink = options; + } else if (options != null && typeof options === "object") { + logger = options.logger; + tryNextLink = options.tryNextLink ?? true; + } + super(message); + this.name = "ProviderError"; + this.tryNextLink = tryNextLink; + Object.setPrototypeOf(this, _ProviderError2.prototype); + (_a = logger == null ? void 0 : logger.debug) == null ? void 0 : _a.call(logger, `@smithy/property-provider ${tryNextLink ? "->" : "(!)"} ${message}`); + } + /** + * @deprecated use new operator. + */ + static from(error, options = true) { + return Object.assign(new this(error.message, options), error); + } + }; + __name(_ProviderError, "ProviderError"); + var ProviderError2 = _ProviderError; + var _CredentialsProviderError = class _CredentialsProviderError2 extends ProviderError2 { + /** + * @override + */ + constructor(message, options = true) { + super(message, options); + this.name = "CredentialsProviderError"; + Object.setPrototypeOf(this, _CredentialsProviderError2.prototype); + } + }; + __name(_CredentialsProviderError, "CredentialsProviderError"); + var CredentialsProviderError = _CredentialsProviderError; + var _TokenProviderError = class _TokenProviderError2 extends ProviderError2 { + /** + * @override + */ + constructor(message, options = true) { + super(message, options); + this.name = "TokenProviderError"; + Object.setPrototypeOf(this, _TokenProviderError2.prototype); + } + }; + __name(_TokenProviderError, "TokenProviderError"); + var TokenProviderError = _TokenProviderError; + var chain = /* @__PURE__ */ __name((...providers) => async () => { + if (providers.length === 0) { + throw new ProviderError2("No providers in chain"); + } + let lastProviderError; + for (const provider of providers) { + try { + const credentials = await provider(); + return credentials; + } catch (err) { + lastProviderError = err; + if (err == null ? void 0 : err.tryNextLink) { + continue; + } + throw err; + } + } + throw lastProviderError; + }, "chain"); + var fromStatic = /* @__PURE__ */ __name((staticValue) => () => Promise.resolve(staticValue), "fromStatic"); + var memoize = /* @__PURE__ */ __name((provider, isExpired, requiresRefresh) => { + let resolved; + let pending; + let hasResult; + let isConstant = false; + const coalesceProvider = /* @__PURE__ */ __name(async () => { + if (!pending) { + pending = provider(); + } + try { + resolved = await pending; + hasResult = true; + isConstant = false; + } finally { + pending = void 0; + } + return resolved; + }, "coalesceProvider"); + if (isExpired === void 0) { + return async (options) => { + if (!hasResult || (options == null ? void 0 : options.forceRefresh)) { + resolved = await coalesceProvider(); + } + return resolved; + }; + } + return async (options) => { + if (!hasResult || (options == null ? void 0 : options.forceRefresh)) { + resolved = await coalesceProvider(); + } + if (isConstant) { + return resolved; + } + if (requiresRefresh && !requiresRefresh(resolved)) { + isConstant = true; + return resolved; + } + if (isExpired(resolved)) { + await coalesceProvider(); + return resolved; + } + return resolved; + }; + }, "memoize"); } }); -// ../../../node_modules/@aws-sdk/core/dist-es/submodules/client/index.js -var init_client = __esm({ - "../../../node_modules/@aws-sdk/core/dist-es/submodules/client/index.js"() { - init_emitWarningIfUnsupportedVersion(); - } -}); - -// ../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/utils/getDateHeader.js -var import_protocol_http5, getDateHeader; -var init_getDateHeader = __esm({ - "../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/utils/getDateHeader.js"() { - import_protocol_http5 = __toESM(require_dist_cjs2()); - getDateHeader = (response) => import_protocol_http5.HttpResponse.isInstance(response) ? response.headers?.date ?? response.headers?.Date : void 0; +// ../../../node_modules/@smithy/shared-ini-file-loader/dist-cjs/getHomeDir.js +var require_getHomeDir = __commonJS({ + "../../../node_modules/@smithy/shared-ini-file-loader/dist-cjs/getHomeDir.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.getHomeDir = void 0; + var os_1 = require("os"); + var path_1 = require("path"); + var homeDirCache = {}; + var getHomeDirCacheKey = () => { + if (process && process.geteuid) { + return `${process.geteuid()}`; + } + return "DEFAULT"; + }; + var getHomeDir2 = () => { + const { HOME, USERPROFILE, HOMEPATH, HOMEDRIVE = `C:${path_1.sep}` } = process.env; + if (HOME) + return HOME; + if (USERPROFILE) + return USERPROFILE; + if (HOMEPATH) + return `${HOMEDRIVE}${HOMEPATH}`; + const homeDirCacheKey = getHomeDirCacheKey(); + if (!homeDirCache[homeDirCacheKey]) + homeDirCache[homeDirCacheKey] = (0, os_1.homedir)(); + return homeDirCache[homeDirCacheKey]; + }; + exports2.getHomeDir = getHomeDir2; } }); -// ../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/utils/getSkewCorrectedDate.js -var getSkewCorrectedDate; -var init_getSkewCorrectedDate = __esm({ - "../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/utils/getSkewCorrectedDate.js"() { - getSkewCorrectedDate = (systemClockOffset) => new Date(Date.now() + systemClockOffset); +// ../../../node_modules/@smithy/shared-ini-file-loader/dist-cjs/getSSOTokenFilepath.js +var require_getSSOTokenFilepath = __commonJS({ + "../../../node_modules/@smithy/shared-ini-file-loader/dist-cjs/getSSOTokenFilepath.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.getSSOTokenFilepath = void 0; + var crypto_1 = require("crypto"); + var path_1 = require("path"); + var getHomeDir_1 = require_getHomeDir(); + var getSSOTokenFilepath2 = (id) => { + const hasher = (0, crypto_1.createHash)("sha1"); + const cacheName = hasher.update(id).digest("hex"); + return (0, path_1.join)((0, getHomeDir_1.getHomeDir)(), ".aws", "sso", "cache", `${cacheName}.json`); + }; + exports2.getSSOTokenFilepath = getSSOTokenFilepath2; } }); -// ../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/utils/isClockSkewed.js -var isClockSkewed; -var init_isClockSkewed = __esm({ - "../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/utils/isClockSkewed.js"() { - init_getSkewCorrectedDate(); - isClockSkewed = (clockTime, systemClockOffset) => Math.abs(getSkewCorrectedDate(systemClockOffset).getTime() - clockTime) >= 3e5; +// ../../../node_modules/@smithy/shared-ini-file-loader/dist-cjs/getSSOTokenFromFile.js +var require_getSSOTokenFromFile = __commonJS({ + "../../../node_modules/@smithy/shared-ini-file-loader/dist-cjs/getSSOTokenFromFile.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.getSSOTokenFromFile = void 0; + var fs_1 = require("fs"); + var getSSOTokenFilepath_1 = require_getSSOTokenFilepath(); + var { readFile } = fs_1.promises; + var getSSOTokenFromFile2 = async (id) => { + const ssoTokenFilepath = (0, getSSOTokenFilepath_1.getSSOTokenFilepath)(id); + const ssoTokenText = await readFile(ssoTokenFilepath, "utf8"); + return JSON.parse(ssoTokenText); + }; + exports2.getSSOTokenFromFile = getSSOTokenFromFile2; } }); -// ../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/utils/getUpdatedSystemClockOffset.js -var getUpdatedSystemClockOffset; -var init_getUpdatedSystemClockOffset = __esm({ - "../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/utils/getUpdatedSystemClockOffset.js"() { - init_isClockSkewed(); - getUpdatedSystemClockOffset = (clockTime, currentSystemClockOffset) => { - const clockTimeInMs = Date.parse(clockTime); - if (isClockSkewed(clockTimeInMs, currentSystemClockOffset)) { - return clockTimeInMs - Date.now(); +// ../../../node_modules/@smithy/shared-ini-file-loader/dist-cjs/slurpFile.js +var require_slurpFile = __commonJS({ + "../../../node_modules/@smithy/shared-ini-file-loader/dist-cjs/slurpFile.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.slurpFile = void 0; + var fs_1 = require("fs"); + var { readFile } = fs_1.promises; + var filePromisesHash = {}; + var slurpFile = (path, options) => { + if (!filePromisesHash[path] || (options === null || options === void 0 ? void 0 : options.ignoreCache)) { + filePromisesHash[path] = readFile(path, "utf8"); } - return currentSystemClockOffset; + return filePromisesHash[path]; }; + exports2.slurpFile = slurpFile; } }); -// ../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/utils/index.js -var init_utils = __esm({ - "../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/utils/index.js"() { - init_getDateHeader(); - init_getSkewCorrectedDate(); - init_getUpdatedSystemClockOffset(); - } -}); - -// ../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/aws_sdk/AwsSdkSigV4Signer.js -var import_protocol_http6, throwSigningPropertyError, validateSigningProperties, AwsSdkSigV4Signer, AWSSDKSigV4Signer; -var init_AwsSdkSigV4Signer = __esm({ - "../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/aws_sdk/AwsSdkSigV4Signer.js"() { - import_protocol_http6 = __toESM(require_dist_cjs2()); - init_utils(); - throwSigningPropertyError = (name, property) => { - if (!property) { - throw new Error(`Property \`${name}\` is not resolved for AWS SDK SigV4Auth`); - } - return property; +// ../../../node_modules/@smithy/shared-ini-file-loader/dist-cjs/index.js +var require_dist_cjs25 = __commonJS({ + "../../../node_modules/@smithy/shared-ini-file-loader/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); }; - validateSigningProperties = async (signingProperties) => { - const context = throwSigningPropertyError("context", signingProperties.context); - const config = throwSigningPropertyError("config", signingProperties.config); - const authScheme = context.endpointV2?.properties?.authSchemes?.[0]; - const signerFunction = throwSigningPropertyError("signer", config.signer); - const signer = await signerFunction(authScheme); - const signingRegion = signingProperties?.signingRegion; - const signingRegionSet = signingProperties?.signingRegionSet; - const signingName = signingProperties?.signingName; - return { - config, - signer, - signingRegion, - signingRegionSet, - signingName - }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; }; - AwsSdkSigV4Signer = class { - async sign(httpRequest, identity, signingProperties) { - if (!import_protocol_http6.HttpRequest.isInstance(httpRequest)) { - throw new Error("The request is not an instance of `HttpRequest` and cannot be signed"); - } - const validatedProps = await validateSigningProperties(signingProperties); - const { config, signer } = validatedProps; - let { signingRegion, signingName } = validatedProps; - const handlerExecutionContext = signingProperties.context; - if (handlerExecutionContext?.authSchemes?.length ?? 0 > 1) { - const [first, second] = handlerExecutionContext.authSchemes; - if (first?.name === "sigv4a" && second?.name === "sigv4") { - signingRegion = second?.signingRegion ?? signingRegion; - signingName = second?.signingName ?? signingName; - } - } - const signedRequest = await signer.sign(httpRequest, { - signingDate: getSkewCorrectedDate(config.systemClockOffset), - signingRegion, - signingService: signingName - }); - return signedRequest; + var __reExport = (target, mod, secondTarget) => (__copyProps2(target, mod, "default"), secondTarget && __copyProps2(secondTarget, mod, "default")); + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + CONFIG_PREFIX_SEPARATOR: () => CONFIG_PREFIX_SEPARATOR, + DEFAULT_PROFILE: () => DEFAULT_PROFILE, + ENV_PROFILE: () => ENV_PROFILE, + getProfileName: () => getProfileName, + loadSharedConfigFiles: () => loadSharedConfigFiles, + loadSsoSessionData: () => loadSsoSessionData, + parseKnownFiles: () => parseKnownFiles + }); + module2.exports = __toCommonJS2(src_exports); + __reExport(src_exports, require_getHomeDir(), module2.exports); + var ENV_PROFILE = "AWS_PROFILE"; + var DEFAULT_PROFILE = "default"; + var getProfileName = /* @__PURE__ */ __name((init) => init.profile || process.env[ENV_PROFILE] || DEFAULT_PROFILE, "getProfileName"); + __reExport(src_exports, require_getSSOTokenFilepath(), module2.exports); + __reExport(src_exports, require_getSSOTokenFromFile(), module2.exports); + var import_types5 = require_dist_cjs(); + var getConfigData = /* @__PURE__ */ __name((data) => Object.entries(data).filter(([key]) => { + const indexOfSeparator = key.indexOf(CONFIG_PREFIX_SEPARATOR); + if (indexOfSeparator === -1) { + return false; } - errorHandler(signingProperties) { - return (error) => { - const serverTime = error.ServerTime ?? getDateHeader(error.$response); - if (serverTime) { - const config = throwSigningPropertyError("config", signingProperties.config); - const initialSystemClockOffset = config.systemClockOffset; - config.systemClockOffset = getUpdatedSystemClockOffset(serverTime, config.systemClockOffset); - const clockSkewCorrected = config.systemClockOffset !== initialSystemClockOffset; - if (clockSkewCorrected && error.$metadata) { - error.$metadata.clockSkewCorrected = true; + return Object.values(import_types5.IniSectionType).includes(key.substring(0, indexOfSeparator)); + }).reduce( + (acc, [key, value]) => { + const indexOfSeparator = key.indexOf(CONFIG_PREFIX_SEPARATOR); + const updatedKey = key.substring(0, indexOfSeparator) === import_types5.IniSectionType.PROFILE ? key.substring(indexOfSeparator + 1) : key; + acc[updatedKey] = value; + return acc; + }, + { + // Populate default profile, if present. + ...data.default && { default: data.default } + } + ), "getConfigData"); + var import_path = require("path"); + var import_getHomeDir = require_getHomeDir(); + var ENV_CONFIG_PATH = "AWS_CONFIG_FILE"; + var getConfigFilepath = /* @__PURE__ */ __name(() => process.env[ENV_CONFIG_PATH] || (0, import_path.join)((0, import_getHomeDir.getHomeDir)(), ".aws", "config"), "getConfigFilepath"); + var import_getHomeDir2 = require_getHomeDir(); + var ENV_CREDENTIALS_PATH = "AWS_SHARED_CREDENTIALS_FILE"; + var getCredentialsFilepath = /* @__PURE__ */ __name(() => process.env[ENV_CREDENTIALS_PATH] || (0, import_path.join)((0, import_getHomeDir2.getHomeDir)(), ".aws", "credentials"), "getCredentialsFilepath"); + var import_getHomeDir3 = require_getHomeDir(); + var prefixKeyRegex = /^([\w-]+)\s(["'])?([\w-@\+\.%:/]+)\2$/; + var profileNameBlockList = ["__proto__", "profile __proto__"]; + var parseIni = /* @__PURE__ */ __name((iniData) => { + const map = {}; + let currentSection; + let currentSubSection; + for (const iniLine of iniData.split(/\r?\n/)) { + const trimmedLine = iniLine.split(/(^|\s)[;#]/)[0].trim(); + const isSection = trimmedLine[0] === "[" && trimmedLine[trimmedLine.length - 1] === "]"; + if (isSection) { + currentSection = void 0; + currentSubSection = void 0; + const sectionName = trimmedLine.substring(1, trimmedLine.length - 1); + const matches = prefixKeyRegex.exec(sectionName); + if (matches) { + const [, prefix, , name] = matches; + if (Object.values(import_types5.IniSectionType).includes(prefix)) { + currentSection = [prefix, name].join(CONFIG_PREFIX_SEPARATOR); } + } else { + currentSection = sectionName; } - throw error; - }; + if (profileNameBlockList.includes(sectionName)) { + throw new Error(`Found invalid profile name "${sectionName}"`); + } + } else if (currentSection) { + const indexOfEqualsSign = trimmedLine.indexOf("="); + if (![0, -1].includes(indexOfEqualsSign)) { + const [name, value] = [ + trimmedLine.substring(0, indexOfEqualsSign).trim(), + trimmedLine.substring(indexOfEqualsSign + 1).trim() + ]; + if (value === "") { + currentSubSection = name; + } else { + if (currentSubSection && iniLine.trimStart() === iniLine) { + currentSubSection = void 0; + } + map[currentSection] = map[currentSection] || {}; + const key = currentSubSection ? [currentSubSection, name].join(CONFIG_PREFIX_SEPARATOR) : name; + map[currentSection][key] = value; + } + } + } + } + return map; + }, "parseIni"); + var import_slurpFile = require_slurpFile(); + var swallowError = /* @__PURE__ */ __name(() => ({}), "swallowError"); + var CONFIG_PREFIX_SEPARATOR = "."; + var loadSharedConfigFiles = /* @__PURE__ */ __name(async (init = {}) => { + const { filepath = getCredentialsFilepath(), configFilepath = getConfigFilepath() } = init; + const homeDir = (0, import_getHomeDir3.getHomeDir)(); + const relativeHomeDirPrefix = "~/"; + let resolvedFilepath = filepath; + if (filepath.startsWith(relativeHomeDirPrefix)) { + resolvedFilepath = (0, import_path.join)(homeDir, filepath.slice(2)); } - successHandler(httpResponse, signingProperties) { - const dateHeader = getDateHeader(httpResponse); - if (dateHeader) { - const config = throwSigningPropertyError("config", signingProperties.config); - config.systemClockOffset = getUpdatedSystemClockOffset(dateHeader, config.systemClockOffset); + let resolvedConfigFilepath = configFilepath; + if (configFilepath.startsWith(relativeHomeDirPrefix)) { + resolvedConfigFilepath = (0, import_path.join)(homeDir, configFilepath.slice(2)); + } + const parsedFiles = await Promise.all([ + (0, import_slurpFile.slurpFile)(resolvedConfigFilepath, { + ignoreCache: init.ignoreCache + }).then(parseIni).then(getConfigData).catch(swallowError), + (0, import_slurpFile.slurpFile)(resolvedFilepath, { + ignoreCache: init.ignoreCache + }).then(parseIni).catch(swallowError) + ]); + return { + configFile: parsedFiles[0], + credentialsFile: parsedFiles[1] + }; + }, "loadSharedConfigFiles"); + var getSsoSessionData = /* @__PURE__ */ __name((data) => Object.entries(data).filter(([key]) => key.startsWith(import_types5.IniSectionType.SSO_SESSION + CONFIG_PREFIX_SEPARATOR)).reduce((acc, [key, value]) => ({ ...acc, [key.substring(key.indexOf(CONFIG_PREFIX_SEPARATOR) + 1)]: value }), {}), "getSsoSessionData"); + var import_slurpFile2 = require_slurpFile(); + var swallowError2 = /* @__PURE__ */ __name(() => ({}), "swallowError"); + var loadSsoSessionData = /* @__PURE__ */ __name(async (init = {}) => (0, import_slurpFile2.slurpFile)(init.configFilepath ?? getConfigFilepath()).then(parseIni).then(getSsoSessionData).catch(swallowError2), "loadSsoSessionData"); + var mergeConfigFiles = /* @__PURE__ */ __name((...files) => { + const merged = {}; + for (const file of files) { + for (const [key, values] of Object.entries(file)) { + if (merged[key] !== void 0) { + Object.assign(merged[key], values); + } else { + merged[key] = values; + } } } - }; - AWSSDKSigV4Signer = AwsSdkSigV4Signer; + return merged; + }, "mergeConfigFiles"); + var parseKnownFiles = /* @__PURE__ */ __name(async (init) => { + const parsedFiles = await loadSharedConfigFiles(init); + return mergeConfigFiles(parsedFiles.configFile, parsedFiles.credentialsFile); + }, "parseKnownFiles"); } }); -// ../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/aws_sdk/AwsSdkSigV4ASigner.js -var import_protocol_http7, AwsSdkSigV4ASigner; -var init_AwsSdkSigV4ASigner = __esm({ - "../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/aws_sdk/AwsSdkSigV4ASigner.js"() { - import_protocol_http7 = __toESM(require_dist_cjs2()); - init_utils(); - init_AwsSdkSigV4Signer(); - AwsSdkSigV4ASigner = class extends AwsSdkSigV4Signer { - async sign(httpRequest, identity, signingProperties) { - if (!import_protocol_http7.HttpRequest.isInstance(httpRequest)) { - throw new Error("The request is not an instance of `HttpRequest` and cannot be signed"); - } - const { config, signer, signingRegion, signingRegionSet, signingName } = await validateSigningProperties(signingProperties); - const configResolvedSigningRegionSet = await config.sigv4aSigningRegionSet?.(); - const multiRegionOverride = (configResolvedSigningRegionSet ?? signingRegionSet ?? [signingRegion]).join(","); - const signedRequest = await signer.sign(httpRequest, { - signingDate: getSkewCorrectedDate(config.systemClockOffset), - signingRegion: multiRegionOverride, - signingService: signingName - }); - return signedRequest; +// ../../../node_modules/@smithy/node-config-provider/dist-cjs/index.js +var require_dist_cjs26 = __commonJS({ + "../../../node_modules/@smithy/node-config-provider/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); } + return to; }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + loadConfig: () => loadConfig + }); + module2.exports = __toCommonJS2(src_exports); + var import_property_provider2 = require_dist_cjs24(); + function getSelectorName(functionString) { + try { + const constants = new Set(Array.from(functionString.match(/([A-Z_]){3,}/g) ?? [])); + constants.delete("CONFIG"); + constants.delete("CONFIG_PREFIX_SEPARATOR"); + constants.delete("ENV"); + return [...constants].join(", "); + } catch (e) { + return functionString; + } + } + __name(getSelectorName, "getSelectorName"); + var fromEnv = /* @__PURE__ */ __name((envVarSelector, logger) => async () => { + try { + const config = envVarSelector(process.env); + if (config === void 0) { + throw new Error(); + } + return config; + } catch (e) { + throw new import_property_provider2.CredentialsProviderError( + e.message || `Not found in ENV: ${getSelectorName(envVarSelector.toString())}`, + { logger } + ); + } + }, "fromEnv"); + var import_shared_ini_file_loader = require_dist_cjs25(); + var fromSharedConfigFiles = /* @__PURE__ */ __name((configSelector, { preferredFile = "config", ...init } = {}) => async () => { + const profile = (0, import_shared_ini_file_loader.getProfileName)(init); + const { configFile, credentialsFile } = await (0, import_shared_ini_file_loader.loadSharedConfigFiles)(init); + const profileFromCredentials = credentialsFile[profile] || {}; + const profileFromConfig = configFile[profile] || {}; + const mergedProfile = preferredFile === "config" ? { ...profileFromCredentials, ...profileFromConfig } : { ...profileFromConfig, ...profileFromCredentials }; + try { + const cfgFile = preferredFile === "config" ? configFile : credentialsFile; + const configValue = configSelector(mergedProfile, cfgFile); + if (configValue === void 0) { + throw new Error(); + } + return configValue; + } catch (e) { + throw new import_property_provider2.CredentialsProviderError( + e.message || `Not found in config files w/ profile [${profile}]: ${getSelectorName(configSelector.toString())}`, + { logger: init.logger } + ); + } + }, "fromSharedConfigFiles"); + var isFunction = /* @__PURE__ */ __name((func) => typeof func === "function", "isFunction"); + var fromStatic = /* @__PURE__ */ __name((defaultValue) => isFunction(defaultValue) ? async () => await defaultValue() : (0, import_property_provider2.fromStatic)(defaultValue), "fromStatic"); + var loadConfig = /* @__PURE__ */ __name(({ environmentVariableSelector, configFileSelector, default: defaultValue }, configuration = {}) => (0, import_property_provider2.memoize)( + (0, import_property_provider2.chain)( + fromEnv(environmentVariableSelector), + fromSharedConfigFiles(configFileSelector, configuration), + fromStatic(defaultValue) + ) + ), "loadConfig"); } }); -// ../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/aws_sdk/resolveAwsSdkSigV4AConfig.js -var import_property_provider, resolveAwsSdkSigV4AConfig, NODE_SIGV4A_CONFIG_OPTIONS; -var init_resolveAwsSdkSigV4AConfig = __esm({ - "../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/aws_sdk/resolveAwsSdkSigV4AConfig.js"() { - init_dist_es(); - import_property_provider = __toESM(require_dist_cjs40()); - resolveAwsSdkSigV4AConfig = (config) => { - config.sigv4aSigningRegionSet = normalizeProvider(config.sigv4aSigningRegionSet); - return config; - }; - NODE_SIGV4A_CONFIG_OPTIONS = { - environmentVariableSelector(env) { - if (env.AWS_SIGV4A_SIGNING_REGION_SET) { - return env.AWS_SIGV4A_SIGNING_REGION_SET.split(",").map((_) => _.trim()); - } - throw new import_property_provider.ProviderError("AWS_SIGV4A_SIGNING_REGION_SET not set in env.", { - tryNextLink: true - }); +// ../../../node_modules/@smithy/middleware-endpoint/dist-cjs/adaptors/getEndpointUrlConfig.js +var require_getEndpointUrlConfig = __commonJS({ + "../../../node_modules/@smithy/middleware-endpoint/dist-cjs/adaptors/getEndpointUrlConfig.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.getEndpointUrlConfig = void 0; + var shared_ini_file_loader_1 = require_dist_cjs25(); + var ENV_ENDPOINT_URL = "AWS_ENDPOINT_URL"; + var CONFIG_ENDPOINT_URL = "endpoint_url"; + var getEndpointUrlConfig = (serviceId) => ({ + environmentVariableSelector: (env) => { + const serviceSuffixParts = serviceId.split(" ").map((w) => w.toUpperCase()); + const serviceEndpointUrl = env[[ENV_ENDPOINT_URL, ...serviceSuffixParts].join("_")]; + if (serviceEndpointUrl) + return serviceEndpointUrl; + const endpointUrl = env[ENV_ENDPOINT_URL]; + if (endpointUrl) + return endpointUrl; + return void 0; }, - configFileSelector(profile) { - if (profile.sigv4a_signing_region_set) { - return (profile.sigv4a_signing_region_set ?? "").split(",").map((_) => _.trim()); + configFileSelector: (profile, config) => { + if (config && profile.services) { + const servicesSection = config[["services", profile.services].join(shared_ini_file_loader_1.CONFIG_PREFIX_SEPARATOR)]; + if (servicesSection) { + const servicePrefixParts = serviceId.split(" ").map((w) => w.toLowerCase()); + const endpointUrl2 = servicesSection[[servicePrefixParts.join("_"), CONFIG_ENDPOINT_URL].join(shared_ini_file_loader_1.CONFIG_PREFIX_SEPARATOR)]; + if (endpointUrl2) + return endpointUrl2; + } } - throw new import_property_provider.ProviderError("sigv4a_signing_region_set not set in profile.", { - tryNextLink: true - }); + const endpointUrl = profile[CONFIG_ENDPOINT_URL]; + if (endpointUrl) + return endpointUrl; + return void 0; }, default: void 0 + }); + exports2.getEndpointUrlConfig = getEndpointUrlConfig; + } +}); + +// ../../../node_modules/@smithy/middleware-endpoint/dist-cjs/adaptors/getEndpointFromConfig.js +var require_getEndpointFromConfig = __commonJS({ + "../../../node_modules/@smithy/middleware-endpoint/dist-cjs/adaptors/getEndpointFromConfig.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.getEndpointFromConfig = void 0; + var node_config_provider_1 = require_dist_cjs26(); + var getEndpointUrlConfig_1 = require_getEndpointUrlConfig(); + var getEndpointFromConfig = async (serviceId) => (0, node_config_provider_1.loadConfig)((0, getEndpointUrlConfig_1.getEndpointUrlConfig)(serviceId !== null && serviceId !== void 0 ? serviceId : ""))(); + exports2.getEndpointFromConfig = getEndpointFromConfig; + } +}); + +// ../../../node_modules/@smithy/querystring-parser/dist-cjs/index.js +var require_dist_cjs27 = __commonJS({ + "../../../node_modules/@smithy/querystring-parser/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + parseQueryString: () => parseQueryString + }); + module2.exports = __toCommonJS2(src_exports); + function parseQueryString(querystring) { + const query = {}; + querystring = querystring.replace(/^\?/, ""); + if (querystring) { + for (const pair of querystring.split("&")) { + let [key, value = null] = pair.split("="); + key = decodeURIComponent(key); + if (value) { + value = decodeURIComponent(value); + } + if (!(key in query)) { + query[key] = value; + } else if (Array.isArray(query[key])) { + query[key].push(value); + } else { + query[key] = [query[key], value]; + } + } + } + return query; + } + __name(parseQueryString, "parseQueryString"); } }); -// ../../../node_modules/@smithy/signature-v4/dist-cjs/index.js -var require_dist_cjs47 = __commonJS({ - "../../../node_modules/@smithy/signature-v4/dist-cjs/index.js"(exports2, module2) { +// ../../../node_modules/@smithy/url-parser/dist-cjs/index.js +var require_dist_cjs28 = __commonJS({ + "../../../node_modules/@smithy/url-parser/dist-cjs/index.js"(exports2, module2) { var __defProp2 = Object.defineProperty; var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; var __getOwnPropNames2 = Object.getOwnPropertyNames; @@ -10560,3263 +5819,3136 @@ var require_dist_cjs47 = __commonJS({ var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); var src_exports = {}; __export2(src_exports, { - SignatureV4: () => SignatureV42, - clearCredentialCache: () => clearCredentialCache, - createScope: () => createScope, - getCanonicalHeaders: () => getCanonicalHeaders, - getCanonicalQuery: () => getCanonicalQuery, - getPayloadHash: () => getPayloadHash, - getSigningKey: () => getSigningKey, - moveHeadersToQuery: () => moveHeadersToQuery, - prepareRequest: () => prepareRequest + parseUrl: () => parseUrl }); module2.exports = __toCommonJS2(src_exports); - var import_util_middleware3 = require_dist_cjs10(); - var import_util_utf84 = require_dist_cjs28(); - var ALGORITHM_QUERY_PARAM = "X-Amz-Algorithm"; - var CREDENTIAL_QUERY_PARAM = "X-Amz-Credential"; - var AMZ_DATE_QUERY_PARAM = "X-Amz-Date"; - var SIGNED_HEADERS_QUERY_PARAM = "X-Amz-SignedHeaders"; - var EXPIRES_QUERY_PARAM = "X-Amz-Expires"; - var SIGNATURE_QUERY_PARAM = "X-Amz-Signature"; - var TOKEN_QUERY_PARAM = "X-Amz-Security-Token"; - var AUTH_HEADER = "authorization"; - var AMZ_DATE_HEADER = AMZ_DATE_QUERY_PARAM.toLowerCase(); - var DATE_HEADER = "date"; - var GENERATED_HEADERS = [AUTH_HEADER, AMZ_DATE_HEADER, DATE_HEADER]; - var SIGNATURE_HEADER = SIGNATURE_QUERY_PARAM.toLowerCase(); - var SHA256_HEADER = "x-amz-content-sha256"; - var TOKEN_HEADER = TOKEN_QUERY_PARAM.toLowerCase(); - var ALWAYS_UNSIGNABLE_HEADERS = { - authorization: true, - "cache-control": true, - connection: true, - expect: true, - from: true, - "keep-alive": true, - "max-forwards": true, - pragma: true, - referer: true, - te: true, - trailer: true, - "transfer-encoding": true, - upgrade: true, - "user-agent": true, - "x-amzn-trace-id": true - }; - var PROXY_HEADER_PATTERN = /^proxy-/; - var SEC_HEADER_PATTERN = /^sec-/; - var ALGORITHM_IDENTIFIER = "AWS4-HMAC-SHA256"; - var EVENT_ALGORITHM_IDENTIFIER = "AWS4-HMAC-SHA256-PAYLOAD"; - var UNSIGNED_PAYLOAD = "UNSIGNED-PAYLOAD"; - var MAX_CACHE_SIZE = 50; - var KEY_TYPE_IDENTIFIER = "aws4_request"; - var MAX_PRESIGNED_TTL = 60 * 60 * 24 * 7; - var import_util_hex_encoding = require_dist_cjs35(); - var import_util_utf8 = require_dist_cjs28(); - var signingKeyCache = {}; - var cacheQueue = []; - var createScope = /* @__PURE__ */ __name((shortDate, region, service) => `${shortDate}/${region}/${service}/${KEY_TYPE_IDENTIFIER}`, "createScope"); - var getSigningKey = /* @__PURE__ */ __name(async (sha256Constructor, credentials, shortDate, region, service) => { - const credsHash = await hmac(sha256Constructor, credentials.secretAccessKey, credentials.accessKeyId); - const cacheKey = `${shortDate}:${region}:${service}:${(0, import_util_hex_encoding.toHex)(credsHash)}:${credentials.sessionToken}`; - if (cacheKey in signingKeyCache) { - return signingKeyCache[cacheKey]; - } - cacheQueue.push(cacheKey); - while (cacheQueue.length > MAX_CACHE_SIZE) { - delete signingKeyCache[cacheQueue.shift()]; - } - let key = `AWS4${credentials.secretAccessKey}`; - for (const signable of [shortDate, region, service, KEY_TYPE_IDENTIFIER]) { - key = await hmac(sha256Constructor, key, signable); - } - return signingKeyCache[cacheKey] = key; - }, "getSigningKey"); - var clearCredentialCache = /* @__PURE__ */ __name(() => { - cacheQueue.length = 0; - Object.keys(signingKeyCache).forEach((cacheKey) => { - delete signingKeyCache[cacheKey]; - }); - }, "clearCredentialCache"); - var hmac = /* @__PURE__ */ __name((ctor, secret, data) => { - const hash = new ctor(secret); - hash.update((0, import_util_utf8.toUint8Array)(data)); - return hash.digest(); - }, "hmac"); - var getCanonicalHeaders = /* @__PURE__ */ __name(({ headers }, unsignableHeaders, signableHeaders) => { - const canonical = {}; - for (const headerName of Object.keys(headers).sort()) { - if (headers[headerName] == void 0) { - continue; - } - const canonicalHeaderName = headerName.toLowerCase(); - if (canonicalHeaderName in ALWAYS_UNSIGNABLE_HEADERS || (unsignableHeaders == null ? void 0 : unsignableHeaders.has(canonicalHeaderName)) || PROXY_HEADER_PATTERN.test(canonicalHeaderName) || SEC_HEADER_PATTERN.test(canonicalHeaderName)) { - if (!signableHeaders || signableHeaders && !signableHeaders.has(canonicalHeaderName)) { - continue; - } - } - canonical[canonicalHeaderName] = headers[headerName].trim().replace(/\s+/g, " "); - } - return canonical; - }, "getCanonicalHeaders"); - var import_util_uri_escape = require_dist_cjs31(); - var getCanonicalQuery = /* @__PURE__ */ __name(({ query = {} }) => { - const keys = []; - const serialized = {}; - for (const key of Object.keys(query).sort()) { - if (key.toLowerCase() === SIGNATURE_HEADER) { - continue; - } - keys.push(key); - const value = query[key]; - if (typeof value === "string") { - serialized[key] = `${(0, import_util_uri_escape.escapeUri)(key)}=${(0, import_util_uri_escape.escapeUri)(value)}`; - } else if (Array.isArray(value)) { - serialized[key] = value.slice(0).reduce( - (encoded, value2) => encoded.concat([`${(0, import_util_uri_escape.escapeUri)(key)}=${(0, import_util_uri_escape.escapeUri)(value2)}`]), - [] - ).sort().join("&"); - } - } - return keys.map((key) => serialized[key]).filter((serialized2) => serialized2).join("&"); - }, "getCanonicalQuery"); - var import_is_array_buffer = require_dist_cjs26(); - var import_util_utf82 = require_dist_cjs28(); - var getPayloadHash = /* @__PURE__ */ __name(async ({ headers, body }, hashConstructor) => { - for (const headerName of Object.keys(headers)) { - if (headerName.toLowerCase() === SHA256_HEADER) { - return headers[headerName]; - } - } - if (body == void 0) { - return "e3b0c44298fc1c149afbf4c8996fb92427ae41e4649b934ca495991b7852b855"; - } else if (typeof body === "string" || ArrayBuffer.isView(body) || (0, import_is_array_buffer.isArrayBuffer)(body)) { - const hashCtor = new hashConstructor(); - hashCtor.update((0, import_util_utf82.toUint8Array)(body)); - return (0, import_util_hex_encoding.toHex)(await hashCtor.digest()); - } - return UNSIGNED_PAYLOAD; - }, "getPayloadHash"); - var import_util_utf83 = require_dist_cjs28(); - var _HeaderFormatter = class _HeaderFormatter { - format(headers) { - const chunks = []; - for (const headerName of Object.keys(headers)) { - const bytes = (0, import_util_utf83.fromUtf8)(headerName); - chunks.push(Uint8Array.from([bytes.byteLength]), bytes, this.formatHeaderValue(headers[headerName])); - } - const out = new Uint8Array(chunks.reduce((carry, bytes) => carry + bytes.byteLength, 0)); - let position = 0; - for (const chunk of chunks) { - out.set(chunk, position); - position += chunk.byteLength; - } - return out; - } - formatHeaderValue(header) { - switch (header.type) { - case "boolean": - return Uint8Array.from([ - header.value ? 0 : 1 - /* boolFalse */ - ]); - case "byte": - return Uint8Array.from([2, header.value]); - case "short": - const shortView = new DataView(new ArrayBuffer(3)); - shortView.setUint8( - 0, - 3 - /* short */ - ); - shortView.setInt16(1, header.value, false); - return new Uint8Array(shortView.buffer); - case "integer": - const intView = new DataView(new ArrayBuffer(5)); - intView.setUint8( - 0, - 4 - /* integer */ - ); - intView.setInt32(1, header.value, false); - return new Uint8Array(intView.buffer); - case "long": - const longBytes = new Uint8Array(9); - longBytes[0] = 5; - longBytes.set(header.value.bytes, 1); - return longBytes; - case "binary": - const binView = new DataView(new ArrayBuffer(3 + header.value.byteLength)); - binView.setUint8( - 0, - 6 - /* byteArray */ - ); - binView.setUint16(1, header.value.byteLength, false); - const binBytes = new Uint8Array(binView.buffer); - binBytes.set(header.value, 3); - return binBytes; - case "string": - const utf8Bytes = (0, import_util_utf83.fromUtf8)(header.value); - const strView = new DataView(new ArrayBuffer(3 + utf8Bytes.byteLength)); - strView.setUint8( - 0, - 7 - /* string */ - ); - strView.setUint16(1, utf8Bytes.byteLength, false); - const strBytes = new Uint8Array(strView.buffer); - strBytes.set(utf8Bytes, 3); - return strBytes; - case "timestamp": - const tsBytes = new Uint8Array(9); - tsBytes[0] = 8; - tsBytes.set(Int64.fromNumber(header.value.valueOf()).bytes, 1); - return tsBytes; - case "uuid": - if (!UUID_PATTERN.test(header.value)) { - throw new Error(`Invalid UUID received: ${header.value}`); - } - const uuidBytes = new Uint8Array(17); - uuidBytes[0] = 9; - uuidBytes.set((0, import_util_hex_encoding.fromHex)(header.value.replace(/\-/g, "")), 1); - return uuidBytes; - } - } - }; - __name(_HeaderFormatter, "HeaderFormatter"); - var HeaderFormatter = _HeaderFormatter; - var UUID_PATTERN = /^[a-f0-9]{8}-[a-f0-9]{4}-[a-f0-9]{4}-[a-f0-9]{4}-[a-f0-9]{12}$/; - var _Int64 = class _Int642 { - constructor(bytes) { - this.bytes = bytes; - if (bytes.byteLength !== 8) { - throw new Error("Int64 buffers must be exactly 8 bytes"); - } - } - static fromNumber(number) { - if (number > 9223372036854776e3 || number < -9223372036854776e3) { - throw new Error(`${number} is too large (or, if negative, too small) to represent as an Int64`); - } - const bytes = new Uint8Array(8); - for (let i = 7, remaining = Math.abs(Math.round(number)); i > -1 && remaining > 0; i--, remaining /= 256) { - bytes[i] = remaining; - } - if (number < 0) { - negate(bytes); - } - return new _Int642(bytes); - } - /** - * Called implicitly by infix arithmetic operators. - */ - valueOf() { - const bytes = this.bytes.slice(0); - const negative = bytes[0] & 128; - if (negative) { - negate(bytes); - } - return parseInt((0, import_util_hex_encoding.toHex)(bytes), 16) * (negative ? -1 : 1); + var import_querystring_parser = require_dist_cjs27(); + var parseUrl = /* @__PURE__ */ __name((url2) => { + if (typeof url2 === "string") { + return parseUrl(new URL(url2)); } - toString() { - return String(this.valueOf()); + const { hostname, pathname, port, protocol, search } = url2; + let query; + if (search) { + query = (0, import_querystring_parser.parseQueryString)(search); } + return { + hostname, + port: port ? parseInt(port) : void 0, + protocol, + path: pathname, + query + }; + }, "parseUrl"); + } +}); + +// ../../../node_modules/@smithy/middleware-endpoint/dist-cjs/index.js +var require_dist_cjs29 = __commonJS({ + "../../../node_modules/@smithy/middleware-endpoint/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); }; - __name(_Int64, "Int64"); - var Int64 = _Int64; - function negate(bytes) { - for (let i = 0; i < 8; i++) { - bytes[i] ^= 255; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); } - for (let i = 7; i > -1; i--) { - bytes[i]++; - if (bytes[i] !== 0) - break; + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + endpointMiddleware: () => endpointMiddleware, + endpointMiddlewareOptions: () => endpointMiddlewareOptions, + getEndpointFromInstructions: () => getEndpointFromInstructions, + getEndpointPlugin: () => getEndpointPlugin, + resolveEndpointConfig: () => resolveEndpointConfig, + resolveParams: () => resolveParams, + toEndpointV1: () => toEndpointV1 + }); + module2.exports = __toCommonJS2(src_exports); + var resolveParamsForS3 = /* @__PURE__ */ __name(async (endpointParams) => { + const bucket = (endpointParams == null ? void 0 : endpointParams.Bucket) || ""; + if (typeof endpointParams.Bucket === "string") { + endpointParams.Bucket = bucket.replace(/#/g, encodeURIComponent("#")).replace(/\?/g, encodeURIComponent("?")); } - } - __name(negate, "negate"); - var hasHeader = /* @__PURE__ */ __name((soughtHeader, headers) => { - soughtHeader = soughtHeader.toLowerCase(); - for (const headerName of Object.keys(headers)) { - if (soughtHeader === headerName.toLowerCase()) { - return true; + if (isArnBucketName(bucket)) { + if (endpointParams.ForcePathStyle === true) { + throw new Error("Path-style addressing cannot be used with ARN buckets"); } + } else if (!isDnsCompatibleBucketName(bucket) || bucket.indexOf(".") !== -1 && !String(endpointParams.Endpoint).startsWith("http:") || bucket.toLowerCase() !== bucket || bucket.length < 3) { + endpointParams.ForcePathStyle = true; } - return false; - }, "hasHeader"); - var import_protocol_http8 = require_dist_cjs2(); - var moveHeadersToQuery = /* @__PURE__ */ __name((request2, options = {}) => { - var _a; - const { headers, query = {} } = import_protocol_http8.HttpRequest.clone(request2); - for (const name of Object.keys(headers)) { - const lname = name.toLowerCase(); - if (lname.slice(0, 6) === "x-amz-" && !((_a = options.unhoistableHeaders) == null ? void 0 : _a.has(lname))) { - query[name] = headers[name]; - delete headers[name]; - } + if (endpointParams.DisableMultiRegionAccessPoints) { + endpointParams.disableMultiRegionAccessPoints = true; + endpointParams.DisableMRAP = true; } - return { - ...request2, - headers, - query - }; - }, "moveHeadersToQuery"); - var prepareRequest = /* @__PURE__ */ __name((request2) => { - request2 = import_protocol_http8.HttpRequest.clone(request2); - for (const headerName of Object.keys(request2.headers)) { - if (GENERATED_HEADERS.indexOf(headerName.toLowerCase()) > -1) { - delete request2.headers[headerName]; + return endpointParams; + }, "resolveParamsForS3"); + var DOMAIN_PATTERN = /^[a-z0-9][a-z0-9\.\-]{1,61}[a-z0-9]$/; + var IP_ADDRESS_PATTERN = /(\d+\.){3}\d+/; + var DOTS_PATTERN = /\.\./; + var isDnsCompatibleBucketName = /* @__PURE__ */ __name((bucketName) => DOMAIN_PATTERN.test(bucketName) && !IP_ADDRESS_PATTERN.test(bucketName) && !DOTS_PATTERN.test(bucketName), "isDnsCompatibleBucketName"); + var isArnBucketName = /* @__PURE__ */ __name((bucketName) => { + const [arn, partition, service, , , bucket] = bucketName.split(":"); + const isArn = arn === "arn" && bucketName.split(":").length >= 6; + const isValidArn = Boolean(isArn && partition && service && bucket); + if (isArn && !isValidArn) { + throw new Error(`Invalid ARN: ${bucketName} was an invalid ARN.`); + } + return isValidArn; + }, "isArnBucketName"); + var createConfigValueProvider = /* @__PURE__ */ __name((configKey, canonicalEndpointParamKey, config) => { + const configProvider = /* @__PURE__ */ __name(async () => { + const configValue = config[configKey] ?? config[canonicalEndpointParamKey]; + if (typeof configValue === "function") { + return configValue(); } + return configValue; + }, "configProvider"); + if (configKey === "credentialScope" || canonicalEndpointParamKey === "CredentialScope") { + return async () => { + const credentials = typeof config.credentials === "function" ? await config.credentials() : config.credentials; + const configValue = (credentials == null ? void 0 : credentials.credentialScope) ?? (credentials == null ? void 0 : credentials.CredentialScope); + return configValue; + }; } - return request2; - }, "prepareRequest"); - var iso8601 = /* @__PURE__ */ __name((time) => toDate(time).toISOString().replace(/\.\d{3}Z$/, "Z"), "iso8601"); - var toDate = /* @__PURE__ */ __name((time) => { - if (typeof time === "number") { - return new Date(time * 1e3); + if (configKey === "accountId" || canonicalEndpointParamKey === "AccountId") { + return async () => { + const credentials = typeof config.credentials === "function" ? await config.credentials() : config.credentials; + const configValue = (credentials == null ? void 0 : credentials.accountId) ?? (credentials == null ? void 0 : credentials.AccountId); + return configValue; + }; } - if (typeof time === "string") { - if (Number(time)) { - return new Date(Number(time) * 1e3); - } - return new Date(time); + if (configKey === "endpoint" || canonicalEndpointParamKey === "endpoint") { + return async () => { + const endpoint = await configProvider(); + if (endpoint && typeof endpoint === "object") { + if ("url" in endpoint) { + return endpoint.url.href; + } + if ("hostname" in endpoint) { + const { protocol, hostname, port, path } = endpoint; + return `${protocol}//${hostname}${port ? ":" + port : ""}${path}`; + } + } + return endpoint; + }; } - return time; - }, "toDate"); - var _SignatureV4 = class _SignatureV4 { - constructor({ - applyChecksum, - credentials, - region, - service, - sha256, - uriEscapePath = true - }) { - this.headerFormatter = new HeaderFormatter(); - this.service = service; - this.sha256 = sha256; - this.uriEscapePath = uriEscapePath; - this.applyChecksum = typeof applyChecksum === "boolean" ? applyChecksum : true; - this.regionProvider = (0, import_util_middleware3.normalizeProvider)(region); - this.credentialProvider = (0, import_util_middleware3.normalizeProvider)(credentials); + return configProvider; + }, "createConfigValueProvider"); + var import_getEndpointFromConfig = require_getEndpointFromConfig(); + var import_url_parser = require_dist_cjs28(); + var toEndpointV1 = /* @__PURE__ */ __name((endpoint) => { + if (typeof endpoint === "object") { + if ("url" in endpoint) { + return (0, import_url_parser.parseUrl)(endpoint.url); + } + return endpoint; } - async presign(originalRequest, options = {}) { - const { - signingDate = /* @__PURE__ */ new Date(), - expiresIn = 3600, - unsignableHeaders, - unhoistableHeaders, - signableHeaders, - signingRegion, - signingService - } = options; - const credentials = await this.credentialProvider(); - this.validateResolvedCredentials(credentials); - const region = signingRegion ?? await this.regionProvider(); - const { longDate, shortDate } = formatDate(signingDate); - if (expiresIn > MAX_PRESIGNED_TTL) { - return Promise.reject( - "Signature version 4 presigned URLs must have an expiration date less than one week in the future" - ); + return (0, import_url_parser.parseUrl)(endpoint); + }, "toEndpointV1"); + var getEndpointFromInstructions = /* @__PURE__ */ __name(async (commandInput, instructionsSupplier, clientConfig, context) => { + if (!clientConfig.endpoint) { + let endpointFromConfig; + if (clientConfig.serviceConfiguredEndpoint) { + endpointFromConfig = await clientConfig.serviceConfiguredEndpoint(); + } else { + endpointFromConfig = await (0, import_getEndpointFromConfig.getEndpointFromConfig)(clientConfig.serviceId); } - const scope = createScope(shortDate, region, signingService ?? this.service); - const request2 = moveHeadersToQuery(prepareRequest(originalRequest), { unhoistableHeaders }); - if (credentials.sessionToken) { - request2.query[TOKEN_QUERY_PARAM] = credentials.sessionToken; + if (endpointFromConfig) { + clientConfig.endpoint = () => Promise.resolve(toEndpointV1(endpointFromConfig)); } - request2.query[ALGORITHM_QUERY_PARAM] = ALGORITHM_IDENTIFIER; - request2.query[CREDENTIAL_QUERY_PARAM] = `${credentials.accessKeyId}/${scope}`; - request2.query[AMZ_DATE_QUERY_PARAM] = longDate; - request2.query[EXPIRES_QUERY_PARAM] = expiresIn.toString(10); - const canonicalHeaders = getCanonicalHeaders(request2, unsignableHeaders, signableHeaders); - request2.query[SIGNED_HEADERS_QUERY_PARAM] = getCanonicalHeaderList(canonicalHeaders); - request2.query[SIGNATURE_QUERY_PARAM] = await this.getSignature( - longDate, - scope, - this.getSigningKey(credentials, region, shortDate, signingService), - this.createCanonicalRequest(request2, canonicalHeaders, await getPayloadHash(originalRequest, this.sha256)) - ); - return request2; } - async sign(toSign, options) { - if (typeof toSign === "string") { - return this.signString(toSign, options); - } else if (toSign.headers && toSign.payload) { - return this.signEvent(toSign, options); - } else if (toSign.message) { - return this.signMessage(toSign, options); - } else { - return this.signRequest(toSign, options); + const endpointParams = await resolveParams(commandInput, instructionsSupplier, clientConfig); + if (typeof clientConfig.endpointProvider !== "function") { + throw new Error("config.endpointProvider is not set."); + } + const endpoint = clientConfig.endpointProvider(endpointParams, context); + return endpoint; + }, "getEndpointFromInstructions"); + var resolveParams = /* @__PURE__ */ __name(async (commandInput, instructionsSupplier, clientConfig) => { + var _a; + const endpointParams = {}; + const instructions = ((_a = instructionsSupplier == null ? void 0 : instructionsSupplier.getEndpointParameterInstructions) == null ? void 0 : _a.call(instructionsSupplier)) || {}; + for (const [name, instruction] of Object.entries(instructions)) { + switch (instruction.type) { + case "staticContextParams": + endpointParams[name] = instruction.value; + break; + case "contextParams": + endpointParams[name] = commandInput[instruction.name]; + break; + case "clientContextParams": + case "builtInParams": + endpointParams[name] = await createConfigValueProvider(instruction.name, name, clientConfig)(); + break; + default: + throw new Error("Unrecognized endpoint parameter instruction: " + JSON.stringify(instruction)); } } - async signEvent({ headers, payload }, { signingDate = /* @__PURE__ */ new Date(), priorSignature, signingRegion, signingService }) { - const region = signingRegion ?? await this.regionProvider(); - const { shortDate, longDate } = formatDate(signingDate); - const scope = createScope(shortDate, region, signingService ?? this.service); - const hashedPayload = await getPayloadHash({ headers: {}, body: payload }, this.sha256); - const hash = new this.sha256(); - hash.update(headers); - const hashedHeaders = (0, import_util_hex_encoding.toHex)(await hash.digest()); - const stringToSign = [ - EVENT_ALGORITHM_IDENTIFIER, - longDate, - scope, - priorSignature, - hashedHeaders, - hashedPayload - ].join("\n"); - return this.signString(stringToSign, { signingDate, signingRegion: region, signingService }); + if (Object.keys(instructions).length === 0) { + Object.assign(endpointParams, clientConfig); } - async signMessage(signableMessage, { signingDate = /* @__PURE__ */ new Date(), signingRegion, signingService }) { - const promise = this.signEvent( + if (String(clientConfig.serviceId).toLowerCase() === "s3") { + await resolveParamsForS3(endpointParams); + } + return endpointParams; + }, "resolveParams"); + var import_core3 = (init_dist_es(), __toCommonJS(dist_es_exports)); + var import_util_middleware3 = require_dist_cjs10(); + var endpointMiddleware = /* @__PURE__ */ __name(({ + config, + instructions + }) => { + return (next, context) => async (args) => { + var _a, _b, _c; + if (config.endpoint) { + (0, import_core3.setFeature)(context, "ENDPOINT_OVERRIDE", "N"); + } + const endpoint = await getEndpointFromInstructions( + args.input, { - headers: this.headerFormatter.format(signableMessage.message.headers), - payload: signableMessage.message.body + getEndpointParameterInstructions() { + return instructions; + } }, - { - signingDate, - signingRegion, - signingService, - priorSignature: signableMessage.priorSignature - } + { ...config }, + context ); - return promise.then((signature) => { - return { message: signableMessage.message, signature }; - }); - } - async signString(stringToSign, { signingDate = /* @__PURE__ */ new Date(), signingRegion, signingService } = {}) { - const credentials = await this.credentialProvider(); - this.validateResolvedCredentials(credentials); - const region = signingRegion ?? await this.regionProvider(); - const { shortDate } = formatDate(signingDate); - const hash = new this.sha256(await this.getSigningKey(credentials, region, shortDate, signingService)); - hash.update((0, import_util_utf84.toUint8Array)(stringToSign)); - return (0, import_util_hex_encoding.toHex)(await hash.digest()); - } - async signRequest(requestToSign, { - signingDate = /* @__PURE__ */ new Date(), - signableHeaders, - unsignableHeaders, - signingRegion, - signingService - } = {}) { - const credentials = await this.credentialProvider(); - this.validateResolvedCredentials(credentials); - const region = signingRegion ?? await this.regionProvider(); - const request2 = prepareRequest(requestToSign); - const { longDate, shortDate } = formatDate(signingDate); - const scope = createScope(shortDate, region, signingService ?? this.service); - request2.headers[AMZ_DATE_HEADER] = longDate; - if (credentials.sessionToken) { - request2.headers[TOKEN_HEADER] = credentials.sessionToken; - } - const payloadHash = await getPayloadHash(request2, this.sha256); - if (!hasHeader(SHA256_HEADER, request2.headers) && this.applyChecksum) { - request2.headers[SHA256_HEADER] = payloadHash; + context.endpointV2 = endpoint; + context.authSchemes = (_a = endpoint.properties) == null ? void 0 : _a.authSchemes; + const authScheme = (_b = context.authSchemes) == null ? void 0 : _b[0]; + if (authScheme) { + context["signing_region"] = authScheme.signingRegion; + context["signing_service"] = authScheme.signingName; + const smithyContext = (0, import_util_middleware3.getSmithyContext)(context); + const httpAuthOption = (_c = smithyContext == null ? void 0 : smithyContext.selectedHttpAuthScheme) == null ? void 0 : _c.httpAuthOption; + if (httpAuthOption) { + httpAuthOption.signingProperties = Object.assign( + httpAuthOption.signingProperties || {}, + { + signing_region: authScheme.signingRegion, + signingRegion: authScheme.signingRegion, + signing_service: authScheme.signingName, + signingName: authScheme.signingName, + signingRegionSet: authScheme.signingRegionSet + }, + authScheme.properties + ); + } } - const canonicalHeaders = getCanonicalHeaders(request2, unsignableHeaders, signableHeaders); - const signature = await this.getSignature( - longDate, - scope, - this.getSigningKey(credentials, region, shortDate, signingService), - this.createCanonicalRequest(request2, canonicalHeaders, payloadHash) + return next({ + ...args + }); + }; + }, "endpointMiddleware"); + var import_middleware_serde2 = require_dist_cjs12(); + var endpointMiddlewareOptions = { + step: "serialize", + tags: ["ENDPOINT_PARAMETERS", "ENDPOINT_V2", "ENDPOINT"], + name: "endpointV2Middleware", + override: true, + relation: "before", + toMiddleware: import_middleware_serde2.serializerMiddlewareOption.name + }; + var getEndpointPlugin = /* @__PURE__ */ __name((config, instructions) => ({ + applyToStack: (clientStack) => { + clientStack.addRelativeTo( + endpointMiddleware({ + config, + instructions + }), + endpointMiddlewareOptions ); - request2.headers[AUTH_HEADER] = `${ALGORITHM_IDENTIFIER} Credential=${credentials.accessKeyId}/${scope}, SignedHeaders=${getCanonicalHeaderList(canonicalHeaders)}, Signature=${signature}`; - return request2; } - createCanonicalRequest(request2, canonicalHeaders, payloadHash) { - const sortedHeaders = Object.keys(canonicalHeaders).sort(); - return `${request2.method} -${this.getCanonicalPath(request2)} -${getCanonicalQuery(request2)} -${sortedHeaders.map((name) => `${name}:${canonicalHeaders[name]}`).join("\n")} + }), "getEndpointPlugin"); + var import_getEndpointFromConfig2 = require_getEndpointFromConfig(); + var resolveEndpointConfig = /* @__PURE__ */ __name((input) => { + const tls = input.tls ?? true; + const { endpoint } = input; + const customEndpointProvider = endpoint != null ? async () => toEndpointV1(await (0, import_util_middleware3.normalizeProvider)(endpoint)()) : void 0; + const isCustomEndpoint = !!endpoint; + const resolvedConfig = { + ...input, + endpoint: customEndpointProvider, + tls, + isCustomEndpoint, + useDualstackEndpoint: (0, import_util_middleware3.normalizeProvider)(input.useDualstackEndpoint ?? false), + useFipsEndpoint: (0, import_util_middleware3.normalizeProvider)(input.useFipsEndpoint ?? false) + }; + let configuredEndpointPromise = void 0; + resolvedConfig.serviceConfiguredEndpoint = async () => { + if (input.serviceId && !configuredEndpointPromise) { + configuredEndpointPromise = (0, import_getEndpointFromConfig2.getEndpointFromConfig)(input.serviceId); + } + return configuredEndpointPromise; + }; + return resolvedConfig; + }, "resolveEndpointConfig"); + } +}); + +// ../../../node_modules/uuid/dist/esm-node/rng.js +function rng() { + if (poolPtr > rnds8Pool.length - 16) { + import_crypto.default.randomFillSync(rnds8Pool); + poolPtr = 0; + } + return rnds8Pool.slice(poolPtr, poolPtr += 16); +} +var import_crypto, rnds8Pool, poolPtr; +var init_rng = __esm({ + "../../../node_modules/uuid/dist/esm-node/rng.js"() { + import_crypto = __toESM(require("crypto")); + rnds8Pool = new Uint8Array(256); + poolPtr = rnds8Pool.length; + } +}); + +// ../../../node_modules/uuid/dist/esm-node/regex.js +var regex_default; +var init_regex = __esm({ + "../../../node_modules/uuid/dist/esm-node/regex.js"() { + regex_default = /^(?:[0-9a-f]{8}-[0-9a-f]{4}-[1-5][0-9a-f]{3}-[89ab][0-9a-f]{3}-[0-9a-f]{12}|00000000-0000-0000-0000-000000000000)$/i; + } +}); + +// ../../../node_modules/uuid/dist/esm-node/validate.js +function validate(uuid) { + return typeof uuid === "string" && regex_default.test(uuid); +} +var validate_default; +var init_validate = __esm({ + "../../../node_modules/uuid/dist/esm-node/validate.js"() { + init_regex(); + validate_default = validate; + } +}); + +// ../../../node_modules/uuid/dist/esm-node/stringify.js +function unsafeStringify(arr, offset = 0) { + return byteToHex[arr[offset + 0]] + byteToHex[arr[offset + 1]] + byteToHex[arr[offset + 2]] + byteToHex[arr[offset + 3]] + "-" + byteToHex[arr[offset + 4]] + byteToHex[arr[offset + 5]] + "-" + byteToHex[arr[offset + 6]] + byteToHex[arr[offset + 7]] + "-" + byteToHex[arr[offset + 8]] + byteToHex[arr[offset + 9]] + "-" + byteToHex[arr[offset + 10]] + byteToHex[arr[offset + 11]] + byteToHex[arr[offset + 12]] + byteToHex[arr[offset + 13]] + byteToHex[arr[offset + 14]] + byteToHex[arr[offset + 15]]; +} +function stringify(arr, offset = 0) { + const uuid = unsafeStringify(arr, offset); + if (!validate_default(uuid)) { + throw TypeError("Stringified UUID is invalid"); + } + return uuid; +} +var byteToHex, stringify_default; +var init_stringify = __esm({ + "../../../node_modules/uuid/dist/esm-node/stringify.js"() { + init_validate(); + byteToHex = []; + for (let i = 0; i < 256; ++i) { + byteToHex.push((i + 256).toString(16).slice(1)); + } + stringify_default = stringify; + } +}); + +// ../../../node_modules/uuid/dist/esm-node/v1.js +function v1(options, buf, offset) { + let i = buf && offset || 0; + const b = buf || new Array(16); + options = options || {}; + let node = options.node || _nodeId; + let clockseq = options.clockseq !== void 0 ? options.clockseq : _clockseq; + if (node == null || clockseq == null) { + const seedBytes = options.random || (options.rng || rng)(); + if (node == null) { + node = _nodeId = [seedBytes[0] | 1, seedBytes[1], seedBytes[2], seedBytes[3], seedBytes[4], seedBytes[5]]; + } + if (clockseq == null) { + clockseq = _clockseq = (seedBytes[6] << 8 | seedBytes[7]) & 16383; + } + } + let msecs = options.msecs !== void 0 ? options.msecs : Date.now(); + let nsecs = options.nsecs !== void 0 ? options.nsecs : _lastNSecs + 1; + const dt = msecs - _lastMSecs + (nsecs - _lastNSecs) / 1e4; + if (dt < 0 && options.clockseq === void 0) { + clockseq = clockseq + 1 & 16383; + } + if ((dt < 0 || msecs > _lastMSecs) && options.nsecs === void 0) { + nsecs = 0; + } + if (nsecs >= 1e4) { + throw new Error("uuid.v1(): Can't create more than 10M uuids/sec"); + } + _lastMSecs = msecs; + _lastNSecs = nsecs; + _clockseq = clockseq; + msecs += 122192928e5; + const tl = ((msecs & 268435455) * 1e4 + nsecs) % 4294967296; + b[i++] = tl >>> 24 & 255; + b[i++] = tl >>> 16 & 255; + b[i++] = tl >>> 8 & 255; + b[i++] = tl & 255; + const tmh = msecs / 4294967296 * 1e4 & 268435455; + b[i++] = tmh >>> 8 & 255; + b[i++] = tmh & 255; + b[i++] = tmh >>> 24 & 15 | 16; + b[i++] = tmh >>> 16 & 255; + b[i++] = clockseq >>> 8 | 128; + b[i++] = clockseq & 255; + for (let n = 0; n < 6; ++n) { + b[i + n] = node[n]; + } + return buf || unsafeStringify(b); +} +var _nodeId, _clockseq, _lastMSecs, _lastNSecs, v1_default; +var init_v1 = __esm({ + "../../../node_modules/uuid/dist/esm-node/v1.js"() { + init_rng(); + init_stringify(); + _lastMSecs = 0; + _lastNSecs = 0; + v1_default = v1; + } +}); -${sortedHeaders.join(";")} -${payloadHash}`; - } - async createStringToSign(longDate, credentialScope, canonicalRequest) { - const hash = new this.sha256(); - hash.update((0, import_util_utf84.toUint8Array)(canonicalRequest)); - const hashedRequest = await hash.digest(); - return `${ALGORITHM_IDENTIFIER} -${longDate} -${credentialScope} -${(0, import_util_hex_encoding.toHex)(hashedRequest)}`; - } - getCanonicalPath({ path }) { - if (this.uriEscapePath) { - const normalizedPathSegments = []; - for (const pathSegment of path.split("/")) { - if ((pathSegment == null ? void 0 : pathSegment.length) === 0) - continue; - if (pathSegment === ".") - continue; - if (pathSegment === "..") { - normalizedPathSegments.pop(); - } else { - normalizedPathSegments.push(pathSegment); - } - } - const normalizedPath = `${(path == null ? void 0 : path.startsWith("/")) ? "/" : ""}${normalizedPathSegments.join("/")}${normalizedPathSegments.length > 0 && (path == null ? void 0 : path.endsWith("/")) ? "/" : ""}`; - const doubleEncoded = (0, import_util_uri_escape.escapeUri)(normalizedPath); - return doubleEncoded.replace(/%2F/g, "/"); - } - return path; - } - async getSignature(longDate, credentialScope, keyPromise, canonicalRequest) { - const stringToSign = await this.createStringToSign(longDate, credentialScope, canonicalRequest); - const hash = new this.sha256(await keyPromise); - hash.update((0, import_util_utf84.toUint8Array)(stringToSign)); - return (0, import_util_hex_encoding.toHex)(await hash.digest()); - } - getSigningKey(credentials, region, shortDate, service) { - return getSigningKey(this.sha256, credentials, shortDate, region, service || this.service); - } - validateResolvedCredentials(credentials) { - if (typeof credentials !== "object" || // @ts-expect-error: Property 'accessKeyId' does not exist on type 'object'.ts(2339) - typeof credentials.accessKeyId !== "string" || // @ts-expect-error: Property 'secretAccessKey' does not exist on type 'object'.ts(2339) - typeof credentials.secretAccessKey !== "string") { - throw new Error("Resolved credential object is not valid"); - } - } - }; - __name(_SignatureV4, "SignatureV4"); - var SignatureV42 = _SignatureV4; - var formatDate = /* @__PURE__ */ __name((now) => { - const longDate = iso8601(now).replace(/[\-:]/g, ""); - return { - longDate, - shortDate: longDate.slice(0, 8) - }; - }, "formatDate"); - var getCanonicalHeaderList = /* @__PURE__ */ __name((headers) => Object.keys(headers).sort().join(";"), "getCanonicalHeaderList"); +// ../../../node_modules/uuid/dist/esm-node/parse.js +function parse(uuid) { + if (!validate_default(uuid)) { + throw TypeError("Invalid UUID"); + } + let v; + const arr = new Uint8Array(16); + arr[0] = (v = parseInt(uuid.slice(0, 8), 16)) >>> 24; + arr[1] = v >>> 16 & 255; + arr[2] = v >>> 8 & 255; + arr[3] = v & 255; + arr[4] = (v = parseInt(uuid.slice(9, 13), 16)) >>> 8; + arr[5] = v & 255; + arr[6] = (v = parseInt(uuid.slice(14, 18), 16)) >>> 8; + arr[7] = v & 255; + arr[8] = (v = parseInt(uuid.slice(19, 23), 16)) >>> 8; + arr[9] = v & 255; + arr[10] = (v = parseInt(uuid.slice(24, 36), 16)) / 1099511627776 & 255; + arr[11] = v / 4294967296 & 255; + arr[12] = v >>> 24 & 255; + arr[13] = v >>> 16 & 255; + arr[14] = v >>> 8 & 255; + arr[15] = v & 255; + return arr; +} +var parse_default; +var init_parse = __esm({ + "../../../node_modules/uuid/dist/esm-node/parse.js"() { + init_validate(); + parse_default = parse; } }); -// ../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/aws_sdk/resolveAwsSdkSigV4Config.js -var import_signature_v4, resolveAwsSdkSigV4Config, resolveAWSSDKSigV4Config; -var init_resolveAwsSdkSigV4Config = __esm({ - "../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/aws_sdk/resolveAwsSdkSigV4Config.js"() { - init_dist_es(); - import_signature_v4 = __toESM(require_dist_cjs47()); - resolveAwsSdkSigV4Config = (config) => { - let normalizedCreds; - if (config.credentials) { - normalizedCreds = memoizeIdentityProvider(config.credentials, isIdentityExpired, doesIdentityRequireRefresh); - } - if (!normalizedCreds) { - if (config.credentialDefaultProvider) { - normalizedCreds = normalizeProvider(config.credentialDefaultProvider(Object.assign({}, config, { - parentClientConfig: config - }))); - } else { - normalizedCreds = async () => { - throw new Error("`credentials` is missing"); - }; - } - } - const { signingEscapePath = true, systemClockOffset = config.systemClockOffset || 0, sha256 } = config; - let signer; - if (config.signer) { - signer = normalizeProvider(config.signer); - } else if (config.regionInfoProvider) { - signer = () => normalizeProvider(config.region)().then(async (region) => [ - await config.regionInfoProvider(region, { - useFipsEndpoint: await config.useFipsEndpoint(), - useDualstackEndpoint: await config.useDualstackEndpoint() - }) || {}, - region - ]).then(([regionInfo, region]) => { - const { signingRegion, signingService } = regionInfo; - config.signingRegion = config.signingRegion || signingRegion || region; - config.signingName = config.signingName || signingService || config.serviceId; - const params = { - ...config, - credentials: normalizedCreds, - region: config.signingRegion, - service: config.signingName, - sha256, - uriEscapePath: signingEscapePath - }; - const SignerCtor = config.signerConstructor || import_signature_v4.SignatureV4; - return new SignerCtor(params); - }); - } else { - signer = async (authScheme) => { - authScheme = Object.assign({}, { - name: "sigv4", - signingName: config.signingName || config.defaultSigningName, - signingRegion: await normalizeProvider(config.region)(), - properties: {} - }, authScheme); - const signingRegion = authScheme.signingRegion; - const signingService = authScheme.signingName; - config.signingRegion = config.signingRegion || signingRegion; - config.signingName = config.signingName || signingService || config.serviceId; - const params = { - ...config, - credentials: normalizedCreds, - region: config.signingRegion, - service: config.signingName, - sha256, - uriEscapePath: signingEscapePath - }; - const SignerCtor = config.signerConstructor || import_signature_v4.SignatureV4; - return new SignerCtor(params); - }; +// ../../../node_modules/uuid/dist/esm-node/v35.js +function stringToBytes(str) { + str = unescape(encodeURIComponent(str)); + const bytes = []; + for (let i = 0; i < str.length; ++i) { + bytes.push(str.charCodeAt(i)); + } + return bytes; +} +function v35(name, version2, hashfunc) { + function generateUUID(value, namespace, buf, offset) { + var _namespace; + if (typeof value === "string") { + value = stringToBytes(value); + } + if (typeof namespace === "string") { + namespace = parse_default(namespace); + } + if (((_namespace = namespace) === null || _namespace === void 0 ? void 0 : _namespace.length) !== 16) { + throw TypeError("Namespace must be array-like (16 iterable integer values, 0-255)"); + } + let bytes = new Uint8Array(16 + value.length); + bytes.set(namespace); + bytes.set(value, namespace.length); + bytes = hashfunc(bytes); + bytes[6] = bytes[6] & 15 | version2; + bytes[8] = bytes[8] & 63 | 128; + if (buf) { + offset = offset || 0; + for (let i = 0; i < 16; ++i) { + buf[offset + i] = bytes[i]; } - return { - ...config, - systemClockOffset, - signingEscapePath, - credentials: normalizedCreds, - signer - }; + return buf; + } + return unsafeStringify(bytes); + } + try { + generateUUID.name = name; + } catch (err) { + } + generateUUID.DNS = DNS; + generateUUID.URL = URL2; + return generateUUID; +} +var DNS, URL2; +var init_v35 = __esm({ + "../../../node_modules/uuid/dist/esm-node/v35.js"() { + init_stringify(); + init_parse(); + DNS = "6ba7b810-9dad-11d1-80b4-00c04fd430c8"; + URL2 = "6ba7b811-9dad-11d1-80b4-00c04fd430c8"; + } +}); + +// ../../../node_modules/uuid/dist/esm-node/md5.js +function md5(bytes) { + if (Array.isArray(bytes)) { + bytes = Buffer.from(bytes); + } else if (typeof bytes === "string") { + bytes = Buffer.from(bytes, "utf8"); + } + return import_crypto2.default.createHash("md5").update(bytes).digest(); +} +var import_crypto2, md5_default; +var init_md5 = __esm({ + "../../../node_modules/uuid/dist/esm-node/md5.js"() { + import_crypto2 = __toESM(require("crypto")); + md5_default = md5; + } +}); + +// ../../../node_modules/uuid/dist/esm-node/v3.js +var v3, v3_default; +var init_v3 = __esm({ + "../../../node_modules/uuid/dist/esm-node/v3.js"() { + init_v35(); + init_md5(); + v3 = v35("v3", 48, md5_default); + v3_default = v3; + } +}); + +// ../../../node_modules/uuid/dist/esm-node/native.js +var import_crypto3, native_default; +var init_native = __esm({ + "../../../node_modules/uuid/dist/esm-node/native.js"() { + import_crypto3 = __toESM(require("crypto")); + native_default = { + randomUUID: import_crypto3.default.randomUUID }; - resolveAWSSDKSigV4Config = resolveAwsSdkSigV4Config; } }); -// ../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/aws_sdk/index.js -var init_aws_sdk = __esm({ - "../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/aws_sdk/index.js"() { - init_AwsSdkSigV4Signer(); - init_AwsSdkSigV4ASigner(); - init_resolveAwsSdkSigV4AConfig(); - init_resolveAwsSdkSigV4Config(); +// ../../../node_modules/uuid/dist/esm-node/v4.js +function v4(options, buf, offset) { + if (native_default.randomUUID && !buf && !options) { + return native_default.randomUUID(); + } + options = options || {}; + const rnds = options.random || (options.rng || rng)(); + rnds[6] = rnds[6] & 15 | 64; + rnds[8] = rnds[8] & 63 | 128; + if (buf) { + offset = offset || 0; + for (let i = 0; i < 16; ++i) { + buf[offset + i] = rnds[i]; + } + return buf; + } + return unsafeStringify(rnds); +} +var v4_default; +var init_v4 = __esm({ + "../../../node_modules/uuid/dist/esm-node/v4.js"() { + init_native(); + init_rng(); + init_stringify(); + v4_default = v4; } }); -// ../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/index.js -var init_httpAuthSchemes2 = __esm({ - "../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/index.js"() { - init_aws_sdk(); +// ../../../node_modules/uuid/dist/esm-node/sha1.js +function sha1(bytes) { + if (Array.isArray(bytes)) { + bytes = Buffer.from(bytes); + } else if (typeof bytes === "string") { + bytes = Buffer.from(bytes, "utf8"); + } + return import_crypto4.default.createHash("sha1").update(bytes).digest(); +} +var import_crypto4, sha1_default; +var init_sha1 = __esm({ + "../../../node_modules/uuid/dist/esm-node/sha1.js"() { + import_crypto4 = __toESM(require("crypto")); + sha1_default = sha1; } }); -// ../../../node_modules/@aws-sdk/core/dist-es/submodules/protocols/coercing-serializers.js -var _toStr, _toBool, _toNum; -var init_coercing_serializers = __esm({ - "../../../node_modules/@aws-sdk/core/dist-es/submodules/protocols/coercing-serializers.js"() { - _toStr = (val2) => { - if (val2 == null) { - return val2; - } - if (typeof val2 === "number" || typeof val2 === "bigint") { - const warning = new Error(`Received number ${val2} where a string was expected.`); - warning.name = "Warning"; - console.warn(warning); - return String(val2); - } - if (typeof val2 === "boolean") { - const warning = new Error(`Received boolean ${val2} where a string was expected.`); - warning.name = "Warning"; - console.warn(warning); - return String(val2); - } - return val2; - }; - _toBool = (val2) => { - if (val2 == null) { - return val2; - } - if (typeof val2 === "number") { - } - if (typeof val2 === "string") { - const lowercase = val2.toLowerCase(); - if (val2 !== "" && lowercase !== "false" && lowercase !== "true") { - const warning = new Error(`Received string "${val2}" where a boolean was expected.`); - warning.name = "Warning"; - console.warn(warning); - } - return val2 !== "" && lowercase !== "false"; - } - return val2; - }; - _toNum = (val2) => { - if (val2 == null) { - return val2; - } - if (typeof val2 === "boolean") { - } - if (typeof val2 === "string") { - const num = Number(val2); - if (num.toString() !== val2) { - const warning = new Error(`Received string "${val2}" where a number was expected.`); - warning.name = "Warning"; - console.warn(warning); - return val2; - } - return num; - } - return val2; - }; +// ../../../node_modules/uuid/dist/esm-node/v5.js +var v5, v5_default; +var init_v5 = __esm({ + "../../../node_modules/uuid/dist/esm-node/v5.js"() { + init_v35(); + init_sha1(); + v5 = v35("v5", 80, sha1_default); + v5_default = v5; } }); -// ../../../node_modules/@aws-sdk/core/dist-es/submodules/protocols/json/awsExpectUnion.js -var import_smithy_client2, awsExpectUnion; -var init_awsExpectUnion = __esm({ - "../../../node_modules/@aws-sdk/core/dist-es/submodules/protocols/json/awsExpectUnion.js"() { - import_smithy_client2 = __toESM(require_dist_cjs37()); - awsExpectUnion = (value) => { - if (value == null) { - return void 0; - } - if (typeof value === "object" && "__type" in value) { - delete value.__type; - } - return (0, import_smithy_client2.expectUnion)(value); - }; +// ../../../node_modules/uuid/dist/esm-node/nil.js +var nil_default; +var init_nil = __esm({ + "../../../node_modules/uuid/dist/esm-node/nil.js"() { + nil_default = "00000000-0000-0000-0000-000000000000"; } }); -// ../../../node_modules/@aws-sdk/core/dist-es/submodules/protocols/common.js -var import_smithy_client3, collectBodyString; -var init_common = __esm({ - "../../../node_modules/@aws-sdk/core/dist-es/submodules/protocols/common.js"() { - import_smithy_client3 = __toESM(require_dist_cjs37()); - collectBodyString = (streamBody, context) => (0, import_smithy_client3.collectBody)(streamBody, context).then((body) => context.utf8Encoder(body)); +// ../../../node_modules/uuid/dist/esm-node/version.js +function version(uuid) { + if (!validate_default(uuid)) { + throw TypeError("Invalid UUID"); + } + return parseInt(uuid.slice(14, 15), 16); +} +var version_default; +var init_version = __esm({ + "../../../node_modules/uuid/dist/esm-node/version.js"() { + init_validate(); + version_default = version; } }); -// ../../../node_modules/@aws-sdk/core/dist-es/submodules/protocols/json/parseJsonBody.js -var parseJsonBody, parseJsonErrorBody, loadRestJsonErrorCode; -var init_parseJsonBody = __esm({ - "../../../node_modules/@aws-sdk/core/dist-es/submodules/protocols/json/parseJsonBody.js"() { - init_common(); - parseJsonBody = (streamBody, context) => collectBodyString(streamBody, context).then((encoded) => { - if (encoded.length) { - try { - return JSON.parse(encoded); - } catch (e) { - if (e?.name === "SyntaxError") { - Object.defineProperty(e, "$responseBodyText", { - value: encoded - }); - } - throw e; - } - } - return {}; - }); - parseJsonErrorBody = async (errorBody, context) => { - const value = await parseJsonBody(errorBody, context); - value.message = value.message ?? value.Message; - return value; - }; - loadRestJsonErrorCode = (output, data) => { - const findKey = (object, key) => Object.keys(object).find((k) => k.toLowerCase() === key.toLowerCase()); - const sanitizeErrorCode = (rawValue) => { - let cleanValue = rawValue; - if (typeof cleanValue === "number") { - cleanValue = cleanValue.toString(); - } - if (cleanValue.indexOf(",") >= 0) { - cleanValue = cleanValue.split(",")[0]; - } - if (cleanValue.indexOf(":") >= 0) { - cleanValue = cleanValue.split(":")[0]; - } - if (cleanValue.indexOf("#") >= 0) { - cleanValue = cleanValue.split("#")[1]; - } - return cleanValue; - }; - const headerKey = findKey(output.headers, "x-amzn-errortype"); - if (headerKey !== void 0) { - return sanitizeErrorCode(output.headers[headerKey]); - } - if (data.code !== void 0) { - return sanitizeErrorCode(data.code); - } - if (data["__type"] !== void 0) { - return sanitizeErrorCode(data["__type"]); - } - }; +// ../../../node_modules/uuid/dist/esm-node/index.js +var esm_node_exports = {}; +__export(esm_node_exports, { + NIL: () => nil_default, + parse: () => parse_default, + stringify: () => stringify_default, + v1: () => v1_default, + v3: () => v3_default, + v4: () => v4_default, + v5: () => v5_default, + validate: () => validate_default, + version: () => version_default +}); +var init_esm_node = __esm({ + "../../../node_modules/uuid/dist/esm-node/index.js"() { + init_v1(); + init_v3(); + init_v4(); + init_v5(); + init_nil(); + init_version(); + init_validate(); + init_stringify(); + init_parse(); } }); -// ../../../node_modules/fast-xml-parser/src/util.js -var require_util = __commonJS({ - "../../../node_modules/fast-xml-parser/src/util.js"(exports2) { - "use strict"; - var nameStartChar = ":A-Za-z_\\u00C0-\\u00D6\\u00D8-\\u00F6\\u00F8-\\u02FF\\u0370-\\u037D\\u037F-\\u1FFF\\u200C-\\u200D\\u2070-\\u218F\\u2C00-\\u2FEF\\u3001-\\uD7FF\\uF900-\\uFDCF\\uFDF0-\\uFFFD"; - var nameChar = nameStartChar + "\\-.\\d\\u00B7\\u0300-\\u036F\\u203F-\\u2040"; - var nameRegexp = "[" + nameStartChar + "][" + nameChar + "]*"; - var regexName = new RegExp("^" + nameRegexp + "$"); - var getAllMatches = function(string, regex) { - const matches = []; - let match = regex.exec(string); - while (match) { - const allmatches = []; - allmatches.startIndex = regex.lastIndex - match[0].length; - const len = match.length; - for (let index = 0; index < len; index++) { - allmatches.push(match[index]); - } - matches.push(allmatches); - match = regex.exec(string); - } - return matches; - }; - var isName = function(string) { - const match = regexName.exec(string); - return !(match === null || typeof match === "undefined"); - }; - exports2.isExist = function(v) { - return typeof v !== "undefined"; - }; - exports2.isEmptyObject = function(obj) { - return Object.keys(obj).length === 0; - }; - exports2.merge = function(target, a, arrayMode) { - if (a) { - const keys = Object.keys(a); - const len = keys.length; - for (let i = 0; i < len; i++) { - if (arrayMode === "strict") { - target[keys[i]] = [a[keys[i]]]; - } else { - target[keys[i]] = a[keys[i]]; - } - } - } +// ../../../node_modules/@smithy/service-error-classification/dist-cjs/index.js +var require_dist_cjs30 = __commonJS({ + "../../../node_modules/@smithy/service-error-classification/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); }; - exports2.getValue = function(v) { - if (exports2.isExist(v)) { - return v; - } else { - return ""; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); } + return to; }; - exports2.isName = isName; - exports2.getAllMatches = getAllMatches; - exports2.nameRegexp = nameRegexp; - } -}); - -// ../../../node_modules/fast-xml-parser/src/validator.js -var require_validator = __commonJS({ - "../../../node_modules/fast-xml-parser/src/validator.js"(exports2) { - "use strict"; - var util = require_util(); - var defaultOptions = { - allowBooleanAttributes: false, - //A tag can have attributes without any value - unpairedTags: [] - }; - exports2.validate = function(xmlData, options) { - options = Object.assign({}, defaultOptions, options); - const tags = []; - let tagFound = false; - let reachedRoot = false; - if (xmlData[0] === "\uFEFF") { - xmlData = xmlData.substr(1); - } - for (let i = 0; i < xmlData.length; i++) { - if (xmlData[i] === "<" && xmlData[i + 1] === "?") { - i += 2; - i = readPI(xmlData, i); - if (i.err) return i; - } else if (xmlData[i] === "<") { - let tagStartPos = i; - i++; - if (xmlData[i] === "!") { - i = readCommentAndCDATA(xmlData, i); - continue; - } else { - let closingTag = false; - if (xmlData[i] === "/") { - closingTag = true; - i++; - } - let tagName = ""; - for (; i < xmlData.length && xmlData[i] !== ">" && xmlData[i] !== " " && xmlData[i] !== " " && xmlData[i] !== "\n" && xmlData[i] !== "\r"; i++) { - tagName += xmlData[i]; - } - tagName = tagName.trim(); - if (tagName[tagName.length - 1] === "/") { - tagName = tagName.substring(0, tagName.length - 1); - i--; - } - if (!validateTagName(tagName)) { - let msg; - if (tagName.trim().length === 0) { - msg = "Invalid space after '<'."; - } else { - msg = "Tag '" + tagName + "' is an invalid name."; - } - return getErrorObject("InvalidTag", msg, getLineNumberForPosition(xmlData, i)); - } - const result = readAttributeStr(xmlData, i); - if (result === false) { - return getErrorObject("InvalidAttr", "Attributes for '" + tagName + "' have open quote.", getLineNumberForPosition(xmlData, i)); - } - let attrStr = result.value; - i = result.index; - if (attrStr[attrStr.length - 1] === "/") { - const attrStrStart = i - attrStr.length; - attrStr = attrStr.substring(0, attrStr.length - 1); - const isValid = validateAttributeString(attrStr, options); - if (isValid === true) { - tagFound = true; - } else { - return getErrorObject(isValid.err.code, isValid.err.msg, getLineNumberForPosition(xmlData, attrStrStart + isValid.err.line)); - } - } else if (closingTag) { - if (!result.tagClosed) { - return getErrorObject("InvalidTag", "Closing tag '" + tagName + "' doesn't have proper closing.", getLineNumberForPosition(xmlData, i)); - } else if (attrStr.trim().length > 0) { - return getErrorObject("InvalidTag", "Closing tag '" + tagName + "' can't have attributes or invalid starting.", getLineNumberForPosition(xmlData, tagStartPos)); - } else if (tags.length === 0) { - return getErrorObject("InvalidTag", "Closing tag '" + tagName + "' has not been opened.", getLineNumberForPosition(xmlData, tagStartPos)); - } else { - const otg = tags.pop(); - if (tagName !== otg.tagName) { - let openPos = getLineNumberForPosition(xmlData, otg.tagStartPos); - return getErrorObject( - "InvalidTag", - "Expected closing tag '" + otg.tagName + "' (opened in line " + openPos.line + ", col " + openPos.col + ") instead of closing tag '" + tagName + "'.", - getLineNumberForPosition(xmlData, tagStartPos) - ); - } - if (tags.length == 0) { - reachedRoot = true; - } - } - } else { - const isValid = validateAttributeString(attrStr, options); - if (isValid !== true) { - return getErrorObject(isValid.err.code, isValid.err.msg, getLineNumberForPosition(xmlData, i - attrStr.length + isValid.err.line)); - } - if (reachedRoot === true) { - return getErrorObject("InvalidXml", "Multiple possible root nodes found.", getLineNumberForPosition(xmlData, i)); - } else if (options.unpairedTags.indexOf(tagName) !== -1) { - } else { - tags.push({ tagName, tagStartPos }); - } - tagFound = true; - } - for (i++; i < xmlData.length; i++) { - if (xmlData[i] === "<") { - if (xmlData[i + 1] === "!") { - i++; - i = readCommentAndCDATA(xmlData, i); - continue; - } else if (xmlData[i + 1] === "?") { - i = readPI(xmlData, ++i); - if (i.err) return i; - } else { - break; - } - } else if (xmlData[i] === "&") { - const afterAmp = validateAmpersand(xmlData, i); - if (afterAmp == -1) - return getErrorObject("InvalidChar", "char '&' is not expected.", getLineNumberForPosition(xmlData, i)); - i = afterAmp; - } else { - if (reachedRoot === true && !isWhiteSpace(xmlData[i])) { - return getErrorObject("InvalidXml", "Extra text at the end", getLineNumberForPosition(xmlData, i)); - } - } - } - if (xmlData[i] === "<") { - i--; - } - } - } else { - if (isWhiteSpace(xmlData[i])) { - continue; - } - return getErrorObject("InvalidChar", "char '" + xmlData[i] + "' is not expected.", getLineNumberForPosition(xmlData, i)); + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + isClockSkewCorrectedError: () => isClockSkewCorrectedError, + isClockSkewError: () => isClockSkewError, + isRetryableByTrait: () => isRetryableByTrait, + isServerError: () => isServerError, + isThrottlingError: () => isThrottlingError, + isTransientError: () => isTransientError + }); + module2.exports = __toCommonJS2(src_exports); + var CLOCK_SKEW_ERROR_CODES = [ + "AuthFailure", + "InvalidSignatureException", + "RequestExpired", + "RequestInTheFuture", + "RequestTimeTooSkewed", + "SignatureDoesNotMatch" + ]; + var THROTTLING_ERROR_CODES = [ + "BandwidthLimitExceeded", + "EC2ThrottledException", + "LimitExceededException", + "PriorRequestNotComplete", + "ProvisionedThroughputExceededException", + "RequestLimitExceeded", + "RequestThrottled", + "RequestThrottledException", + "SlowDown", + "ThrottledException", + "Throttling", + "ThrottlingException", + "TooManyRequestsException", + "TransactionInProgressException" + // DynamoDB + ]; + var TRANSIENT_ERROR_CODES = ["TimeoutError", "RequestTimeout", "RequestTimeoutException"]; + var TRANSIENT_ERROR_STATUS_CODES = [500, 502, 503, 504]; + var NODEJS_TIMEOUT_ERROR_CODES = ["ECONNRESET", "ECONNREFUSED", "EPIPE", "ETIMEDOUT"]; + var isRetryableByTrait = /* @__PURE__ */ __name((error) => error.$retryable !== void 0, "isRetryableByTrait"); + var isClockSkewError = /* @__PURE__ */ __name((error) => CLOCK_SKEW_ERROR_CODES.includes(error.name), "isClockSkewError"); + var isClockSkewCorrectedError = /* @__PURE__ */ __name((error) => { + var _a; + return (_a = error.$metadata) == null ? void 0 : _a.clockSkewCorrected; + }, "isClockSkewCorrectedError"); + var isThrottlingError = /* @__PURE__ */ __name((error) => { + var _a, _b; + return ((_a = error.$metadata) == null ? void 0 : _a.httpStatusCode) === 429 || THROTTLING_ERROR_CODES.includes(error.name) || ((_b = error.$retryable) == null ? void 0 : _b.throttling) == true; + }, "isThrottlingError"); + var isTransientError = /* @__PURE__ */ __name((error) => { + var _a; + return isClockSkewCorrectedError(error) || TRANSIENT_ERROR_CODES.includes(error.name) || NODEJS_TIMEOUT_ERROR_CODES.includes((error == null ? void 0 : error.code) || "") || TRANSIENT_ERROR_STATUS_CODES.includes(((_a = error.$metadata) == null ? void 0 : _a.httpStatusCode) || 0); + }, "isTransientError"); + var isServerError = /* @__PURE__ */ __name((error) => { + var _a; + if (((_a = error.$metadata) == null ? void 0 : _a.httpStatusCode) !== void 0) { + const statusCode = error.$metadata.httpStatusCode; + if (500 <= statusCode && statusCode <= 599 && !isTransientError(error)) { + return true; } + return false; } - if (!tagFound) { - return getErrorObject("InvalidXml", "Start tag expected.", 1); - } else if (tags.length == 1) { - return getErrorObject("InvalidTag", "Unclosed tag '" + tags[0].tagName + "'.", getLineNumberForPosition(xmlData, tags[0].tagStartPos)); - } else if (tags.length > 0) { - return getErrorObject("InvalidXml", "Invalid '" + JSON.stringify(tags.map((t) => t.tagName), null, 4).replace(/\r?\n/g, "") + "' found.", { line: 1, col: 1 }); + return false; + }, "isServerError"); + } +}); + +// ../../../node_modules/@smithy/util-retry/dist-cjs/index.js +var require_dist_cjs31 = __commonJS({ + "../../../node_modules/@smithy/util-retry/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); } - return true; + return to; }; - function isWhiteSpace(char) { - return char === " " || char === " " || char === "\n" || char === "\r"; - } - function readPI(xmlData, i) { - const start = i; - for (; i < xmlData.length; i++) { - if (xmlData[i] == "?" || xmlData[i] == " ") { - const tagname = xmlData.substr(start, i - start); - if (i > 5 && tagname === "xml") { - return getErrorObject("InvalidXml", "XML declaration allowed only at the start of the document.", getLineNumberForPosition(xmlData, i)); - } else if (xmlData[i] == "?" && xmlData[i + 1] == ">") { - i++; - break; - } else { - continue; - } - } + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + AdaptiveRetryStrategy: () => AdaptiveRetryStrategy, + ConfiguredRetryStrategy: () => ConfiguredRetryStrategy, + DEFAULT_MAX_ATTEMPTS: () => DEFAULT_MAX_ATTEMPTS, + DEFAULT_RETRY_DELAY_BASE: () => DEFAULT_RETRY_DELAY_BASE, + DEFAULT_RETRY_MODE: () => DEFAULT_RETRY_MODE, + DefaultRateLimiter: () => DefaultRateLimiter, + INITIAL_RETRY_TOKENS: () => INITIAL_RETRY_TOKENS, + INVOCATION_ID_HEADER: () => INVOCATION_ID_HEADER, + MAXIMUM_RETRY_DELAY: () => MAXIMUM_RETRY_DELAY, + NO_RETRY_INCREMENT: () => NO_RETRY_INCREMENT, + REQUEST_HEADER: () => REQUEST_HEADER, + RETRY_COST: () => RETRY_COST, + RETRY_MODES: () => RETRY_MODES, + StandardRetryStrategy: () => StandardRetryStrategy, + THROTTLING_RETRY_DELAY_BASE: () => THROTTLING_RETRY_DELAY_BASE, + TIMEOUT_RETRY_COST: () => TIMEOUT_RETRY_COST + }); + module2.exports = __toCommonJS2(src_exports); + var RETRY_MODES = /* @__PURE__ */ ((RETRY_MODES2) => { + RETRY_MODES2["STANDARD"] = "standard"; + RETRY_MODES2["ADAPTIVE"] = "adaptive"; + return RETRY_MODES2; + })(RETRY_MODES || {}); + var DEFAULT_MAX_ATTEMPTS = 3; + var DEFAULT_RETRY_MODE = "standard"; + var import_service_error_classification = require_dist_cjs30(); + var _DefaultRateLimiter = class _DefaultRateLimiter { + constructor(options) { + this.currentCapacity = 0; + this.enabled = false; + this.lastMaxRate = 0; + this.measuredTxRate = 0; + this.requestCount = 0; + this.lastTimestamp = 0; + this.timeWindow = 0; + this.beta = (options == null ? void 0 : options.beta) ?? 0.7; + this.minCapacity = (options == null ? void 0 : options.minCapacity) ?? 1; + this.minFillRate = (options == null ? void 0 : options.minFillRate) ?? 0.5; + this.scaleConstant = (options == null ? void 0 : options.scaleConstant) ?? 0.4; + this.smooth = (options == null ? void 0 : options.smooth) ?? 0.8; + const currentTimeInSeconds = this.getCurrentTimeInSeconds(); + this.lastThrottleTime = currentTimeInSeconds; + this.lastTxRateBucket = Math.floor(this.getCurrentTimeInSeconds()); + this.fillRate = this.minFillRate; + this.maxCapacity = this.minCapacity; } - return i; - } - function readCommentAndCDATA(xmlData, i) { - if (xmlData.length > i + 5 && xmlData[i + 1] === "-" && xmlData[i + 2] === "-") { - for (i += 3; i < xmlData.length; i++) { - if (xmlData[i] === "-" && xmlData[i + 1] === "-" && xmlData[i + 2] === ">") { - i += 2; - break; - } - } - } else if (xmlData.length > i + 8 && xmlData[i + 1] === "D" && xmlData[i + 2] === "O" && xmlData[i + 3] === "C" && xmlData[i + 4] === "T" && xmlData[i + 5] === "Y" && xmlData[i + 6] === "P" && xmlData[i + 7] === "E") { - let angleBracketsCount = 1; - for (i += 8; i < xmlData.length; i++) { - if (xmlData[i] === "<") { - angleBracketsCount++; - } else if (xmlData[i] === ">") { - angleBracketsCount--; - if (angleBracketsCount === 0) { - break; - } - } + getCurrentTimeInSeconds() { + return Date.now() / 1e3; + } + async getSendToken() { + return this.acquireTokenBucket(1); + } + async acquireTokenBucket(amount) { + if (!this.enabled) { + return; } - } else if (xmlData.length > i + 9 && xmlData[i + 1] === "[" && xmlData[i + 2] === "C" && xmlData[i + 3] === "D" && xmlData[i + 4] === "A" && xmlData[i + 5] === "T" && xmlData[i + 6] === "A" && xmlData[i + 7] === "[") { - for (i += 8; i < xmlData.length; i++) { - if (xmlData[i] === "]" && xmlData[i + 1] === "]" && xmlData[i + 2] === ">") { - i += 2; - break; - } + this.refillTokenBucket(); + if (amount > this.currentCapacity) { + const delay = (amount - this.currentCapacity) / this.fillRate * 1e3; + await new Promise((resolve) => setTimeout(resolve, delay)); } + this.currentCapacity = this.currentCapacity - amount; } - return i; - } - var doubleQuote = '"'; - var singleQuote = "'"; - function readAttributeStr(xmlData, i) { - let attrStr = ""; - let startChar = ""; - let tagClosed = false; - for (; i < xmlData.length; i++) { - if (xmlData[i] === doubleQuote || xmlData[i] === singleQuote) { - if (startChar === "") { - startChar = xmlData[i]; - } else if (startChar !== xmlData[i]) { - } else { - startChar = ""; - } - } else if (xmlData[i] === ">") { - if (startChar === "") { - tagClosed = true; - break; - } + refillTokenBucket() { + const timestamp = this.getCurrentTimeInSeconds(); + if (!this.lastTimestamp) { + this.lastTimestamp = timestamp; + return; } - attrStr += xmlData[i]; - } - if (startChar !== "") { - return false; + const fillAmount = (timestamp - this.lastTimestamp) * this.fillRate; + this.currentCapacity = Math.min(this.maxCapacity, this.currentCapacity + fillAmount); + this.lastTimestamp = timestamp; } - return { - value: attrStr, - index: i, - tagClosed - }; - } - var validAttrStrRegxp = new RegExp(`(\\s*)([^\\s=]+)(\\s*=)?(\\s*(['"])(([\\s\\S])*?)\\5)?`, "g"); - function validateAttributeString(attrStr, options) { - const matches = util.getAllMatches(attrStr, validAttrStrRegxp); - const attrNames = {}; - for (let i = 0; i < matches.length; i++) { - if (matches[i][1].length === 0) { - return getErrorObject("InvalidAttr", "Attribute '" + matches[i][2] + "' has no space in starting.", getPositionFromMatch(matches[i])); - } else if (matches[i][3] !== void 0 && matches[i][4] === void 0) { - return getErrorObject("InvalidAttr", "Attribute '" + matches[i][2] + "' is without value.", getPositionFromMatch(matches[i])); - } else if (matches[i][3] === void 0 && !options.allowBooleanAttributes) { - return getErrorObject("InvalidAttr", "boolean attribute '" + matches[i][2] + "' is not allowed.", getPositionFromMatch(matches[i])); - } - const attrName = matches[i][2]; - if (!validateAttrName(attrName)) { - return getErrorObject("InvalidAttr", "Attribute '" + attrName + "' is an invalid name.", getPositionFromMatch(matches[i])); - } - if (!attrNames.hasOwnProperty(attrName)) { - attrNames[attrName] = 1; + updateClientSendingRate(response) { + let calculatedRate; + this.updateMeasuredRate(); + if ((0, import_service_error_classification.isThrottlingError)(response)) { + const rateToUse = !this.enabled ? this.measuredTxRate : Math.min(this.measuredTxRate, this.fillRate); + this.lastMaxRate = rateToUse; + this.calculateTimeWindow(); + this.lastThrottleTime = this.getCurrentTimeInSeconds(); + calculatedRate = this.cubicThrottle(rateToUse); + this.enableTokenBucket(); } else { - return getErrorObject("InvalidAttr", "Attribute '" + attrName + "' is repeated.", getPositionFromMatch(matches[i])); + this.calculateTimeWindow(); + calculatedRate = this.cubicSuccess(this.getCurrentTimeInSeconds()); } + const newRate = Math.min(calculatedRate, 2 * this.measuredTxRate); + this.updateTokenBucketRate(newRate); } - return true; - } - function validateNumberAmpersand(xmlData, i) { - let re = /\d/; - if (xmlData[i] === "x") { - i++; - re = /[\da-fA-F]/; + calculateTimeWindow() { + this.timeWindow = this.getPrecise(Math.pow(this.lastMaxRate * (1 - this.beta) / this.scaleConstant, 1 / 3)); } - for (; i < xmlData.length; i++) { - if (xmlData[i] === ";") - return i; - if (!xmlData[i].match(re)) - break; + cubicThrottle(rateToUse) { + return this.getPrecise(rateToUse * this.beta); } - return -1; - } - function validateAmpersand(xmlData, i) { - i++; - if (xmlData[i] === ";") - return -1; - if (xmlData[i] === "#") { - i++; - return validateNumberAmpersand(xmlData, i); + cubicSuccess(timestamp) { + return this.getPrecise( + this.scaleConstant * Math.pow(timestamp - this.lastThrottleTime - this.timeWindow, 3) + this.lastMaxRate + ); + } + enableTokenBucket() { + this.enabled = true; + } + updateTokenBucketRate(newRate) { + this.refillTokenBucket(); + this.fillRate = Math.max(newRate, this.minFillRate); + this.maxCapacity = Math.max(newRate, this.minCapacity); + this.currentCapacity = Math.min(this.currentCapacity, this.maxCapacity); } - let count = 0; - for (; i < xmlData.length; i++, count++) { - if (xmlData[i].match(/\w/) && count < 20) - continue; - if (xmlData[i] === ";") - break; - return -1; + updateMeasuredRate() { + const t = this.getCurrentTimeInSeconds(); + const timeBucket = Math.floor(t * 2) / 2; + this.requestCount++; + if (timeBucket > this.lastTxRateBucket) { + const currentRate = this.requestCount / (timeBucket - this.lastTxRateBucket); + this.measuredTxRate = this.getPrecise(currentRate * this.smooth + this.measuredTxRate * (1 - this.smooth)); + this.requestCount = 0; + this.lastTxRateBucket = timeBucket; + } } - return i; - } - function getErrorObject(code, message, lineNumber) { + getPrecise(num) { + return parseFloat(num.toFixed(8)); + } + }; + __name(_DefaultRateLimiter, "DefaultRateLimiter"); + var DefaultRateLimiter = _DefaultRateLimiter; + var DEFAULT_RETRY_DELAY_BASE = 100; + var MAXIMUM_RETRY_DELAY = 20 * 1e3; + var THROTTLING_RETRY_DELAY_BASE = 500; + var INITIAL_RETRY_TOKENS = 500; + var RETRY_COST = 5; + var TIMEOUT_RETRY_COST = 10; + var NO_RETRY_INCREMENT = 1; + var INVOCATION_ID_HEADER = "amz-sdk-invocation-id"; + var REQUEST_HEADER = "amz-sdk-request"; + var getDefaultRetryBackoffStrategy = /* @__PURE__ */ __name(() => { + let delayBase = DEFAULT_RETRY_DELAY_BASE; + const computeNextBackoffDelay = /* @__PURE__ */ __name((attempts) => { + return Math.floor(Math.min(MAXIMUM_RETRY_DELAY, Math.random() * 2 ** attempts * delayBase)); + }, "computeNextBackoffDelay"); + const setDelayBase = /* @__PURE__ */ __name((delay) => { + delayBase = delay; + }, "setDelayBase"); return { - err: { - code, - msg: message, - line: lineNumber.line || lineNumber, - col: lineNumber.col - } + computeNextBackoffDelay, + setDelayBase }; - } - function validateAttrName(attrName) { - return util.isName(attrName); - } - function validateTagName(tagname) { - return util.isName(tagname); - } - function getLineNumberForPosition(xmlData, index) { - const lines = xmlData.substring(0, index).split(/\r?\n/); + }, "getDefaultRetryBackoffStrategy"); + var createDefaultRetryToken = /* @__PURE__ */ __name(({ + retryDelay, + retryCount, + retryCost + }) => { + const getRetryCount = /* @__PURE__ */ __name(() => retryCount, "getRetryCount"); + const getRetryDelay = /* @__PURE__ */ __name(() => Math.min(MAXIMUM_RETRY_DELAY, retryDelay), "getRetryDelay"); + const getRetryCost = /* @__PURE__ */ __name(() => retryCost, "getRetryCost"); return { - line: lines.length, - // column number is last line's length + 1, because column numbering starts at 1: - col: lines[lines.length - 1].length + 1 + getRetryCount, + getRetryDelay, + getRetryCost }; - } - function getPositionFromMatch(match) { - return match.startIndex + match[1].length; - } - } -}); - -// ../../../node_modules/fast-xml-parser/src/xmlparser/OptionsBuilder.js -var require_OptionsBuilder = __commonJS({ - "../../../node_modules/fast-xml-parser/src/xmlparser/OptionsBuilder.js"(exports2) { - var defaultOptions = { - preserveOrder: false, - attributeNamePrefix: "@_", - attributesGroupName: false, - textNodeName: "#text", - ignoreAttributes: true, - removeNSPrefix: false, - // remove NS from tag name or attribute name if true - allowBooleanAttributes: false, - //a tag can have attributes without any value - //ignoreRootElement : false, - parseTagValue: true, - parseAttributeValue: false, - trimValues: true, - //Trim string values of tag and attributes - cdataPropName: false, - numberParseOptions: { - hex: true, - leadingZeros: true, - eNotation: true - }, - tagValueProcessor: function(tagName, val2) { - return val2; - }, - attributeValueProcessor: function(attrName, val2) { - return val2; - }, - stopNodes: [], - //nested tags will not be parsed even for errors - alwaysCreateTextNode: false, - isArray: () => false, - commentPropName: false, - unpairedTags: [], - processEntities: true, - htmlEntities: false, - ignoreDeclaration: false, - ignorePiTags: false, - transformTagName: false, - transformAttributeName: false, - updateTag: function(tagName, jPath, attrs) { - return tagName; - } - // skipEmptyListItem: false - }; - var buildOptions = function(options) { - return Object.assign({}, defaultOptions, options); - }; - exports2.buildOptions = buildOptions; - exports2.defaultOptions = defaultOptions; - } -}); - -// ../../../node_modules/fast-xml-parser/src/xmlparser/xmlNode.js -var require_xmlNode = __commonJS({ - "../../../node_modules/fast-xml-parser/src/xmlparser/xmlNode.js"(exports2, module2) { - "use strict"; - var XmlNode = class { - constructor(tagname) { - this.tagname = tagname; - this.child = []; - this[":@"] = {}; + }, "createDefaultRetryToken"); + var _StandardRetryStrategy = class _StandardRetryStrategy { + constructor(maxAttempts) { + this.maxAttempts = maxAttempts; + this.mode = "standard"; + this.capacity = INITIAL_RETRY_TOKENS; + this.retryBackoffStrategy = getDefaultRetryBackoffStrategy(); + this.maxAttemptsProvider = typeof maxAttempts === "function" ? maxAttempts : async () => maxAttempts; } - add(key, val2) { - if (key === "__proto__") key = "#__proto__"; - this.child.push({ [key]: val2 }); + // eslint-disable-next-line @typescript-eslint/no-unused-vars + async acquireInitialRetryToken(retryTokenScope) { + return createDefaultRetryToken({ + retryDelay: DEFAULT_RETRY_DELAY_BASE, + retryCount: 0 + }); } - addChild(node) { - if (node.tagname === "__proto__") node.tagname = "#__proto__"; - if (node[":@"] && Object.keys(node[":@"]).length > 0) { - this.child.push({ [node.tagname]: node.child, [":@"]: node[":@"] }); - } else { - this.child.push({ [node.tagname]: node.child }); + async refreshRetryTokenForRetry(token, errorInfo) { + const maxAttempts = await this.getMaxAttempts(); + if (this.shouldRetry(token, errorInfo, maxAttempts)) { + const errorType = errorInfo.errorType; + this.retryBackoffStrategy.setDelayBase( + errorType === "THROTTLING" ? THROTTLING_RETRY_DELAY_BASE : DEFAULT_RETRY_DELAY_BASE + ); + const delayFromErrorType = this.retryBackoffStrategy.computeNextBackoffDelay(token.getRetryCount()); + const retryDelay = errorInfo.retryAfterHint ? Math.max(errorInfo.retryAfterHint.getTime() - Date.now() || 0, delayFromErrorType) : delayFromErrorType; + const capacityCost = this.getCapacityCost(errorType); + this.capacity -= capacityCost; + return createDefaultRetryToken({ + retryDelay, + retryCount: token.getRetryCount() + 1, + retryCost: capacityCost + }); } + throw new Error("No retry token available"); } - }; - module2.exports = XmlNode; - } -}); - -// ../../../node_modules/fast-xml-parser/src/xmlparser/DocTypeReader.js -var require_DocTypeReader = __commonJS({ - "../../../node_modules/fast-xml-parser/src/xmlparser/DocTypeReader.js"(exports2, module2) { - var util = require_util(); - function readDocType(xmlData, i) { - const entities = {}; - if (xmlData[i + 3] === "O" && xmlData[i + 4] === "C" && xmlData[i + 5] === "T" && xmlData[i + 6] === "Y" && xmlData[i + 7] === "P" && xmlData[i + 8] === "E") { - i = i + 9; - let angleBracketsCount = 1; - let hasBody = false, comment = false; - let exp = ""; - for (; i < xmlData.length; i++) { - if (xmlData[i] === "<" && !comment) { - if (hasBody && isEntity(xmlData, i)) { - i += 7; - [entityName, val, i] = readEntityExp(xmlData, i + 1); - if (val.indexOf("&") === -1) - entities[validateEntityName(entityName)] = { - regx: RegExp(`&${entityName};`, "g"), - val - }; - } else if (hasBody && isElement(xmlData, i)) i += 8; - else if (hasBody && isAttlist(xmlData, i)) i += 8; - else if (hasBody && isNotation(xmlData, i)) i += 9; - else if (isComment) comment = true; - else throw new Error("Invalid DOCTYPE"); - angleBracketsCount++; - exp = ""; - } else if (xmlData[i] === ">") { - if (comment) { - if (xmlData[i - 1] === "-" && xmlData[i - 2] === "-") { - comment = false; - angleBracketsCount--; - } - } else { - angleBracketsCount--; - } - if (angleBracketsCount === 0) { - break; - } - } else if (xmlData[i] === "[") { - hasBody = true; - } else { - exp += xmlData[i]; - } - } - if (angleBracketsCount !== 0) { - throw new Error(`Unclosed DOCTYPE`); + recordSuccess(token) { + this.capacity = Math.max(INITIAL_RETRY_TOKENS, this.capacity + (token.getRetryCost() ?? NO_RETRY_INCREMENT)); + } + /** + * @returns the current available retry capacity. + * + * This number decreases when retries are executed and refills when requests or retries succeed. + */ + getCapacity() { + return this.capacity; + } + async getMaxAttempts() { + try { + return await this.maxAttemptsProvider(); + } catch (error) { + console.warn(`Max attempts provider could not resolve. Using default of ${DEFAULT_MAX_ATTEMPTS}`); + return DEFAULT_MAX_ATTEMPTS; } - } else { - throw new Error(`Invalid Tag instead of DOCTYPE`); } - return { entities, i }; - } - function readEntityExp(xmlData, i) { - let entityName2 = ""; - for (; i < xmlData.length && (xmlData[i] !== "'" && xmlData[i] !== '"'); i++) { - entityName2 += xmlData[i]; + shouldRetry(tokenToRenew, errorInfo, maxAttempts) { + const attempts = tokenToRenew.getRetryCount() + 1; + return attempts < maxAttempts && this.capacity >= this.getCapacityCost(errorInfo.errorType) && this.isRetryableError(errorInfo.errorType); } - entityName2 = entityName2.trim(); - if (entityName2.indexOf(" ") !== -1) throw new Error("External entites are not supported"); - const startChar = xmlData[i++]; - let val2 = ""; - for (; i < xmlData.length && xmlData[i] !== startChar; i++) { - val2 += xmlData[i]; + getCapacityCost(errorType) { + return errorType === "TRANSIENT" ? TIMEOUT_RETRY_COST : RETRY_COST; + } + isRetryableError(errorType) { + return errorType === "THROTTLING" || errorType === "TRANSIENT"; } - return [entityName2, val2, i]; - } - function isComment(xmlData, i) { - if (xmlData[i + 1] === "!" && xmlData[i + 2] === "-" && xmlData[i + 3] === "-") return true; - return false; - } - function isEntity(xmlData, i) { - if (xmlData[i + 1] === "!" && xmlData[i + 2] === "E" && xmlData[i + 3] === "N" && xmlData[i + 4] === "T" && xmlData[i + 5] === "I" && xmlData[i + 6] === "T" && xmlData[i + 7] === "Y") return true; - return false; - } - function isElement(xmlData, i) { - if (xmlData[i + 1] === "!" && xmlData[i + 2] === "E" && xmlData[i + 3] === "L" && xmlData[i + 4] === "E" && xmlData[i + 5] === "M" && xmlData[i + 6] === "E" && xmlData[i + 7] === "N" && xmlData[i + 8] === "T") return true; - return false; - } - function isAttlist(xmlData, i) { - if (xmlData[i + 1] === "!" && xmlData[i + 2] === "A" && xmlData[i + 3] === "T" && xmlData[i + 4] === "T" && xmlData[i + 5] === "L" && xmlData[i + 6] === "I" && xmlData[i + 7] === "S" && xmlData[i + 8] === "T") return true; - return false; - } - function isNotation(xmlData, i) { - if (xmlData[i + 1] === "!" && xmlData[i + 2] === "N" && xmlData[i + 3] === "O" && xmlData[i + 4] === "T" && xmlData[i + 5] === "A" && xmlData[i + 6] === "T" && xmlData[i + 7] === "I" && xmlData[i + 8] === "O" && xmlData[i + 9] === "N") return true; - return false; - } - function validateEntityName(name) { - if (util.isName(name)) - return name; - else - throw new Error(`Invalid entity name ${name}`); - } - module2.exports = readDocType; - } -}); - -// ../../../node_modules/strnum/strnum.js -var require_strnum = __commonJS({ - "../../../node_modules/strnum/strnum.js"(exports2, module2) { - var hexRegex = /^[-+]?0x[a-fA-F0-9]+$/; - var numRegex = /^([\-\+])?(0*)(\.[0-9]+([eE]\-?[0-9]+)?|[0-9]+(\.[0-9]+([eE]\-?[0-9]+)?)?)$/; - if (!Number.parseInt && window.parseInt) { - Number.parseInt = window.parseInt; - } - if (!Number.parseFloat && window.parseFloat) { - Number.parseFloat = window.parseFloat; - } - var consider = { - hex: true, - leadingZeros: true, - decimalPoint: ".", - eNotation: true - //skipLike: /regex/ }; - function toNumber(str, options = {}) { - options = Object.assign({}, consider, options); - if (!str || typeof str !== "string") return str; - let trimmedStr = str.trim(); - if (options.skipLike !== void 0 && options.skipLike.test(trimmedStr)) return str; - else if (options.hex && hexRegex.test(trimmedStr)) { - return Number.parseInt(trimmedStr, 16); - } else { - const match = numRegex.exec(trimmedStr); - if (match) { - const sign = match[1]; - const leadingZeros = match[2]; - let numTrimmedByZeros = trimZeros(match[3]); - const eNotation = match[4] || match[6]; - if (!options.leadingZeros && leadingZeros.length > 0 && sign && trimmedStr[2] !== ".") return str; - else if (!options.leadingZeros && leadingZeros.length > 0 && !sign && trimmedStr[1] !== ".") return str; - else { - const num = Number(trimmedStr); - const numStr = "" + num; - if (numStr.search(/[eE]/) !== -1) { - if (options.eNotation) return num; - else return str; - } else if (eNotation) { - if (options.eNotation) return num; - else return str; - } else if (trimmedStr.indexOf(".") !== -1) { - if (numStr === "0" && numTrimmedByZeros === "") return num; - else if (numStr === numTrimmedByZeros) return num; - else if (sign && numStr === "-" + numTrimmedByZeros) return num; - else return str; - } - if (leadingZeros) { - if (numTrimmedByZeros === numStr) return num; - else if (sign + numTrimmedByZeros === numStr) return num; - else return str; - } - if (trimmedStr === numStr) return num; - else if (trimmedStr === sign + numStr) return num; - return str; - } + __name(_StandardRetryStrategy, "StandardRetryStrategy"); + var StandardRetryStrategy = _StandardRetryStrategy; + var _AdaptiveRetryStrategy = class _AdaptiveRetryStrategy { + constructor(maxAttemptsProvider, options) { + this.maxAttemptsProvider = maxAttemptsProvider; + this.mode = "adaptive"; + const { rateLimiter } = options ?? {}; + this.rateLimiter = rateLimiter ?? new DefaultRateLimiter(); + this.standardRetryStrategy = new StandardRetryStrategy(maxAttemptsProvider); + } + async acquireInitialRetryToken(retryTokenScope) { + await this.rateLimiter.getSendToken(); + return this.standardRetryStrategy.acquireInitialRetryToken(retryTokenScope); + } + async refreshRetryTokenForRetry(tokenToRenew, errorInfo) { + this.rateLimiter.updateClientSendingRate(errorInfo); + return this.standardRetryStrategy.refreshRetryTokenForRetry(tokenToRenew, errorInfo); + } + recordSuccess(token) { + this.rateLimiter.updateClientSendingRate({}); + this.standardRetryStrategy.recordSuccess(token); + } + }; + __name(_AdaptiveRetryStrategy, "AdaptiveRetryStrategy"); + var AdaptiveRetryStrategy = _AdaptiveRetryStrategy; + var _ConfiguredRetryStrategy = class _ConfiguredRetryStrategy extends StandardRetryStrategy { + /** + * @param maxAttempts - the maximum number of retry attempts allowed. + * e.g., if set to 3, then 4 total requests are possible. + * @param computeNextBackoffDelay - a millisecond delay for each retry or a function that takes the retry attempt + * and returns the delay. + * + * @example exponential backoff. + * ```js + * new Client({ + * retryStrategy: new ConfiguredRetryStrategy(3, (attempt) => attempt ** 2) + * }); + * ``` + * @example constant delay. + * ```js + * new Client({ + * retryStrategy: new ConfiguredRetryStrategy(3, 2000) + * }); + * ``` + */ + constructor(maxAttempts, computeNextBackoffDelay = DEFAULT_RETRY_DELAY_BASE) { + super(typeof maxAttempts === "function" ? maxAttempts : async () => maxAttempts); + if (typeof computeNextBackoffDelay === "number") { + this.computeNextBackoffDelay = () => computeNextBackoffDelay; } else { - return str; + this.computeNextBackoffDelay = computeNextBackoffDelay; } } - } - function trimZeros(numStr) { - if (numStr && numStr.indexOf(".") !== -1) { - numStr = numStr.replace(/0+$/, ""); - if (numStr === ".") numStr = "0"; - else if (numStr[0] === ".") numStr = "0" + numStr; - else if (numStr[numStr.length - 1] === ".") numStr = numStr.substr(0, numStr.length - 1); - return numStr; + async refreshRetryTokenForRetry(tokenToRenew, errorInfo) { + const token = await super.refreshRetryTokenForRetry(tokenToRenew, errorInfo); + token.getRetryDelay = () => this.computeNextBackoffDelay(token.getRetryCount()); + return token; } - return numStr; - } - module2.exports = toNumber; + }; + __name(_ConfiguredRetryStrategy, "ConfiguredRetryStrategy"); + var ConfiguredRetryStrategy = _ConfiguredRetryStrategy; } }); -// ../../../node_modules/fast-xml-parser/src/xmlparser/OrderedObjParser.js -var require_OrderedObjParser = __commonJS({ - "../../../node_modules/fast-xml-parser/src/xmlparser/OrderedObjParser.js"(exports2, module2) { - "use strict"; - var util = require_util(); - var xmlNode = require_xmlNode(); - var readDocType = require_DocTypeReader(); - var toNumber = require_strnum(); - var OrderedObjParser = class { - constructor(options) { - this.options = options; - this.currentNode = null; - this.tagsNodeStack = []; - this.docTypeEntities = {}; - this.lastEntities = { - "apos": { regex: /&(apos|#39|#x27);/g, val: "'" }, - "gt": { regex: /&(gt|#62|#x3E);/g, val: ">" }, - "lt": { regex: /&(lt|#60|#x3C);/g, val: "<" }, - "quot": { regex: /&(quot|#34|#x22);/g, val: '"' } - }; - this.ampEntity = { regex: /&(amp|#38|#x26);/g, val: "&" }; - this.htmlEntities = { - "space": { regex: /&(nbsp|#160);/g, val: " " }, - // "lt" : { regex: /&(lt|#60);/g, val: "<" }, - // "gt" : { regex: /&(gt|#62);/g, val: ">" }, - // "amp" : { regex: /&(amp|#38);/g, val: "&" }, - // "quot" : { regex: /&(quot|#34);/g, val: "\"" }, - // "apos" : { regex: /&(apos|#39);/g, val: "'" }, - "cent": { regex: /&(cent|#162);/g, val: "\xA2" }, - "pound": { regex: /&(pound|#163);/g, val: "\xA3" }, - "yen": { regex: /&(yen|#165);/g, val: "\xA5" }, - "euro": { regex: /&(euro|#8364);/g, val: "\u20AC" }, - "copyright": { regex: /&(copy|#169);/g, val: "\xA9" }, - "reg": { regex: /&(reg|#174);/g, val: "\xAE" }, - "inr": { regex: /&(inr|#8377);/g, val: "\u20B9" }, - "num_dec": { regex: /&#([0-9]{1,7});/g, val: (_, str) => String.fromCharCode(Number.parseInt(str, 10)) }, - "num_hex": { regex: /&#x([0-9a-fA-F]{1,6});/g, val: (_, str) => String.fromCharCode(Number.parseInt(str, 16)) } - }; - this.addExternalEntities = addExternalEntities; - this.parseXml = parseXml; - this.parseTextData = parseTextData; - this.resolveNameSpace = resolveNameSpace; - this.buildAttributesMap = buildAttributesMap; - this.isItStopNode = isItStopNode; - this.replaceEntitiesValue = replaceEntitiesValue; - this.readStopNodeData = readStopNodeData; - this.saveTextToParentTag = saveTextToParentTag; - this.addChild = addChild; +// ../../../node_modules/@smithy/middleware-stack/dist-cjs/index.js +var require_dist_cjs32 = __commonJS({ + "../../../node_modules/@smithy/middleware-stack/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); } + return to; }; - function addExternalEntities(externalEntities) { - const entKeys = Object.keys(externalEntities); - for (let i = 0; i < entKeys.length; i++) { - const ent = entKeys[i]; - this.lastEntities[ent] = { - regex: new RegExp("&" + ent + ";", "g"), - val: externalEntities[ent] - }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + constructStack: () => constructStack + }); + module2.exports = __toCommonJS2(src_exports); + var getAllAliases = /* @__PURE__ */ __name((name, aliases) => { + const _aliases = []; + if (name) { + _aliases.push(name); } - } - function parseTextData(val2, tagName, jPath, dontTrim, hasAttributes, isLeafNode, escapeEntities) { - if (val2 !== void 0) { - if (this.options.trimValues && !dontTrim) { - val2 = val2.trim(); + if (aliases) { + for (const alias of aliases) { + _aliases.push(alias); } - if (val2.length > 0) { - if (!escapeEntities) val2 = this.replaceEntitiesValue(val2); - const newval = this.options.tagValueProcessor(tagName, val2, jPath, hasAttributes, isLeafNode); - if (newval === null || newval === void 0) { - return val2; - } else if (typeof newval !== typeof val2 || newval !== val2) { - return newval; - } else if (this.options.trimValues) { - return parseValue(val2, this.options.parseTagValue, this.options.numberParseOptions); - } else { - const trimmedVal = val2.trim(); - if (trimmedVal === val2) { - return parseValue(val2, this.options.parseTagValue, this.options.numberParseOptions); - } else { - return val2; + } + return _aliases; + }, "getAllAliases"); + var getMiddlewareNameWithAliases = /* @__PURE__ */ __name((name, aliases) => { + return `${name || "anonymous"}${aliases && aliases.length > 0 ? ` (a.k.a. ${aliases.join(",")})` : ""}`; + }, "getMiddlewareNameWithAliases"); + var constructStack = /* @__PURE__ */ __name(() => { + let absoluteEntries = []; + let relativeEntries = []; + let identifyOnResolve = false; + const entriesNameSet = /* @__PURE__ */ new Set(); + const sort = /* @__PURE__ */ __name((entries) => entries.sort( + (a, b) => stepWeights[b.step] - stepWeights[a.step] || priorityWeights[b.priority || "normal"] - priorityWeights[a.priority || "normal"] + ), "sort"); + const removeByName = /* @__PURE__ */ __name((toRemove) => { + let isRemoved = false; + const filterCb = /* @__PURE__ */ __name((entry) => { + const aliases = getAllAliases(entry.name, entry.aliases); + if (aliases.includes(toRemove)) { + isRemoved = true; + for (const alias of aliases) { + entriesNameSet.delete(alias); } + return false; } - } - } - } - function resolveNameSpace(tagname) { - if (this.options.removeNSPrefix) { - const tags = tagname.split(":"); - const prefix = tagname.charAt(0) === "/" ? "/" : ""; - if (tags[0] === "xmlns") { - return ""; - } - if (tags.length === 2) { - tagname = prefix + tags[1]; - } - } - return tagname; - } - var attrsRegx = new RegExp(`([^\\s=]+)\\s*(=\\s*(['"])([\\s\\S]*?)\\3)?`, "gm"); - function buildAttributesMap(attrStr, jPath, tagName) { - if (!this.options.ignoreAttributes && typeof attrStr === "string") { - const matches = util.getAllMatches(attrStr, attrsRegx); - const len = matches.length; - const attrs = {}; - for (let i = 0; i < len; i++) { - const attrName = this.resolveNameSpace(matches[i][1]); - let oldVal = matches[i][4]; - let aName = this.options.attributeNamePrefix + attrName; - if (attrName.length) { - if (this.options.transformAttributeName) { - aName = this.options.transformAttributeName(aName); + return true; + }, "filterCb"); + absoluteEntries = absoluteEntries.filter(filterCb); + relativeEntries = relativeEntries.filter(filterCb); + return isRemoved; + }, "removeByName"); + const removeByReference = /* @__PURE__ */ __name((toRemove) => { + let isRemoved = false; + const filterCb = /* @__PURE__ */ __name((entry) => { + if (entry.middleware === toRemove) { + isRemoved = true; + for (const alias of getAllAliases(entry.name, entry.aliases)) { + entriesNameSet.delete(alias); } - if (aName === "__proto__") aName = "#__proto__"; - if (oldVal !== void 0) { - if (this.options.trimValues) { - oldVal = oldVal.trim(); - } - oldVal = this.replaceEntitiesValue(oldVal); - const newVal = this.options.attributeValueProcessor(attrName, oldVal, jPath); - if (newVal === null || newVal === void 0) { - attrs[aName] = oldVal; - } else if (typeof newVal !== typeof oldVal || newVal !== oldVal) { - attrs[aName] = newVal; - } else { - attrs[aName] = parseValue( - oldVal, - this.options.parseAttributeValue, - this.options.numberParseOptions - ); + return false; + } + return true; + }, "filterCb"); + absoluteEntries = absoluteEntries.filter(filterCb); + relativeEntries = relativeEntries.filter(filterCb); + return isRemoved; + }, "removeByReference"); + const cloneTo = /* @__PURE__ */ __name((toStack) => { + var _a; + absoluteEntries.forEach((entry) => { + toStack.add(entry.middleware, { ...entry }); + }); + relativeEntries.forEach((entry) => { + toStack.addRelativeTo(entry.middleware, { ...entry }); + }); + (_a = toStack.identifyOnResolve) == null ? void 0 : _a.call(toStack, stack.identifyOnResolve()); + return toStack; + }, "cloneTo"); + const expandRelativeMiddlewareList = /* @__PURE__ */ __name((from) => { + const expandedMiddlewareList = []; + from.before.forEach((entry) => { + if (entry.before.length === 0 && entry.after.length === 0) { + expandedMiddlewareList.push(entry); + } else { + expandedMiddlewareList.push(...expandRelativeMiddlewareList(entry)); + } + }); + expandedMiddlewareList.push(from); + from.after.reverse().forEach((entry) => { + if (entry.before.length === 0 && entry.after.length === 0) { + expandedMiddlewareList.push(entry); + } else { + expandedMiddlewareList.push(...expandRelativeMiddlewareList(entry)); + } + }); + return expandedMiddlewareList; + }, "expandRelativeMiddlewareList"); + const getMiddlewareList = /* @__PURE__ */ __name((debug = false) => { + const normalizedAbsoluteEntries = []; + const normalizedRelativeEntries = []; + const normalizedEntriesNameMap = {}; + absoluteEntries.forEach((entry) => { + const normalizedEntry = { + ...entry, + before: [], + after: [] + }; + for (const alias of getAllAliases(normalizedEntry.name, normalizedEntry.aliases)) { + normalizedEntriesNameMap[alias] = normalizedEntry; + } + normalizedAbsoluteEntries.push(normalizedEntry); + }); + relativeEntries.forEach((entry) => { + const normalizedEntry = { + ...entry, + before: [], + after: [] + }; + for (const alias of getAllAliases(normalizedEntry.name, normalizedEntry.aliases)) { + normalizedEntriesNameMap[alias] = normalizedEntry; + } + normalizedRelativeEntries.push(normalizedEntry); + }); + normalizedRelativeEntries.forEach((entry) => { + if (entry.toMiddleware) { + const toMiddleware = normalizedEntriesNameMap[entry.toMiddleware]; + if (toMiddleware === void 0) { + if (debug) { + return; } - } else if (this.options.allowBooleanAttributes) { - attrs[aName] = true; + throw new Error( + `${entry.toMiddleware} is not found when adding ${getMiddlewareNameWithAliases(entry.name, entry.aliases)} middleware ${entry.relation} ${entry.toMiddleware}` + ); + } + if (entry.relation === "after") { + toMiddleware.after.push(entry); + } + if (entry.relation === "before") { + toMiddleware.before.push(entry); } } - } - if (!Object.keys(attrs).length) { - return; - } - if (this.options.attributesGroupName) { - const attrCollection = {}; - attrCollection[this.options.attributesGroupName] = attrs; - return attrCollection; - } - return attrs; - } - } - var parseXml = function(xmlData) { - xmlData = xmlData.replace(/\r\n?/g, "\n"); - const xmlObj = new xmlNode("!xml"); - let currentNode = xmlObj; - let textData = ""; - let jPath = ""; - for (let i = 0; i < xmlData.length; i++) { - const ch = xmlData[i]; - if (ch === "<") { - if (xmlData[i + 1] === "/") { - const closeIndex = findClosingIndex(xmlData, ">", i, "Closing Tag is not closed."); - let tagName = xmlData.substring(i + 2, closeIndex).trim(); - if (this.options.removeNSPrefix) { - const colonIndex = tagName.indexOf(":"); - if (colonIndex !== -1) { - tagName = tagName.substr(colonIndex + 1); + }); + const mainChain = sort(normalizedAbsoluteEntries).map(expandRelativeMiddlewareList).reduce( + (wholeList, expandedMiddlewareList) => { + wholeList.push(...expandedMiddlewareList); + return wholeList; + }, + [] + ); + return mainChain; + }, "getMiddlewareList"); + const stack = { + add: (middleware, options = {}) => { + const { name, override, aliases: _aliases } = options; + const entry = { + step: "initialize", + priority: "normal", + middleware, + ...options + }; + const aliases = getAllAliases(name, _aliases); + if (aliases.length > 0) { + if (aliases.some((alias) => entriesNameSet.has(alias))) { + if (!override) + throw new Error(`Duplicate middleware name '${getMiddlewareNameWithAliases(name, _aliases)}'`); + for (const alias of aliases) { + const toOverrideIndex = absoluteEntries.findIndex( + (entry2) => { + var _a; + return entry2.name === alias || ((_a = entry2.aliases) == null ? void 0 : _a.some((a) => a === alias)); + } + ); + if (toOverrideIndex === -1) { + continue; + } + const toOverride = absoluteEntries[toOverrideIndex]; + if (toOverride.step !== entry.step || entry.priority !== toOverride.priority) { + throw new Error( + `"${getMiddlewareNameWithAliases(toOverride.name, toOverride.aliases)}" middleware with ${toOverride.priority} priority in ${toOverride.step} step cannot be overridden by "${getMiddlewareNameWithAliases(name, _aliases)}" middleware with ${entry.priority} priority in ${entry.step} step.` + ); + } + absoluteEntries.splice(toOverrideIndex, 1); } } - if (this.options.transformTagName) { - tagName = this.options.transformTagName(tagName); - } - if (currentNode) { - textData = this.saveTextToParentTag(textData, currentNode, jPath); - } - const lastTagName = jPath.substring(jPath.lastIndexOf(".") + 1); - if (tagName && this.options.unpairedTags.indexOf(tagName) !== -1) { - throw new Error(`Unpaired tag can not be used as closing tag: `); - } - let propIndex = 0; - if (lastTagName && this.options.unpairedTags.indexOf(lastTagName) !== -1) { - propIndex = jPath.lastIndexOf(".", jPath.lastIndexOf(".") - 1); - this.tagsNodeStack.pop(); - } else { - propIndex = jPath.lastIndexOf("."); + for (const alias of aliases) { + entriesNameSet.add(alias); } - jPath = jPath.substring(0, propIndex); - currentNode = this.tagsNodeStack.pop(); - textData = ""; - i = closeIndex; - } else if (xmlData[i + 1] === "?") { - let tagData = readTagExp(xmlData, i, false, "?>"); - if (!tagData) throw new Error("Pi Tag is not closed."); - textData = this.saveTextToParentTag(textData, currentNode, jPath); - if (this.options.ignoreDeclaration && tagData.tagName === "?xml" || this.options.ignorePiTags) { - } else { - const childNode = new xmlNode(tagData.tagName); - childNode.add(this.options.textNodeName, ""); - if (tagData.tagName !== tagData.tagExp && tagData.attrExpPresent) { - childNode[":@"] = this.buildAttributesMap(tagData.tagExp, jPath, tagData.tagName); + } + absoluteEntries.push(entry); + }, + addRelativeTo: (middleware, options) => { + const { name, override, aliases: _aliases } = options; + const entry = { + middleware, + ...options + }; + const aliases = getAllAliases(name, _aliases); + if (aliases.length > 0) { + if (aliases.some((alias) => entriesNameSet.has(alias))) { + if (!override) + throw new Error(`Duplicate middleware name '${getMiddlewareNameWithAliases(name, _aliases)}'`); + for (const alias of aliases) { + const toOverrideIndex = relativeEntries.findIndex( + (entry2) => { + var _a; + return entry2.name === alias || ((_a = entry2.aliases) == null ? void 0 : _a.some((a) => a === alias)); + } + ); + if (toOverrideIndex === -1) { + continue; + } + const toOverride = relativeEntries[toOverrideIndex]; + if (toOverride.toMiddleware !== entry.toMiddleware || toOverride.relation !== entry.relation) { + throw new Error( + `"${getMiddlewareNameWithAliases(toOverride.name, toOverride.aliases)}" middleware ${toOverride.relation} "${toOverride.toMiddleware}" middleware cannot be overridden by "${getMiddlewareNameWithAliases(name, _aliases)}" middleware ${entry.relation} "${entry.toMiddleware}" middleware.` + ); + } + relativeEntries.splice(toOverrideIndex, 1); } - this.addChild(currentNode, childNode, jPath); } - i = tagData.closeIndex + 1; - } else if (xmlData.substr(i + 1, 3) === "!--") { - const endIndex = findClosingIndex(xmlData, "-->", i + 4, "Comment is not closed."); - if (this.options.commentPropName) { - const comment = xmlData.substring(i + 4, endIndex - 2); - textData = this.saveTextToParentTag(textData, currentNode, jPath); - currentNode.add(this.options.commentPropName, [{ [this.options.textNodeName]: comment }]); + for (const alias of aliases) { + entriesNameSet.add(alias); } - i = endIndex; - } else if (xmlData.substr(i + 1, 2) === "!D") { - const result = readDocType(xmlData, i); - this.docTypeEntities = result.entities; - i = result.i; - } else if (xmlData.substr(i + 1, 2) === "![") { - const closeIndex = findClosingIndex(xmlData, "]]>", i, "CDATA is not closed.") - 2; - const tagExp = xmlData.substring(i + 9, closeIndex); - textData = this.saveTextToParentTag(textData, currentNode, jPath); - let val2 = this.parseTextData(tagExp, currentNode.tagname, jPath, true, false, true, true); - if (val2 == void 0) val2 = ""; - if (this.options.cdataPropName) { - currentNode.add(this.options.cdataPropName, [{ [this.options.textNodeName]: tagExp }]); - } else { - currentNode.add(this.options.textNodeName, val2); + } + relativeEntries.push(entry); + }, + clone: () => cloneTo(constructStack()), + use: (plugin) => { + plugin.applyToStack(stack); + }, + remove: (toRemove) => { + if (typeof toRemove === "string") + return removeByName(toRemove); + else + return removeByReference(toRemove); + }, + removeByTag: (toRemove) => { + let isRemoved = false; + const filterCb = /* @__PURE__ */ __name((entry) => { + const { tags, name, aliases: _aliases } = entry; + if (tags && tags.includes(toRemove)) { + const aliases = getAllAliases(name, _aliases); + for (const alias of aliases) { + entriesNameSet.delete(alias); + } + isRemoved = true; + return false; } - i = closeIndex + 2; + return true; + }, "filterCb"); + absoluteEntries = absoluteEntries.filter(filterCb); + relativeEntries = relativeEntries.filter(filterCb); + return isRemoved; + }, + concat: (from) => { + var _a; + const cloned = cloneTo(constructStack()); + cloned.use(from); + cloned.identifyOnResolve( + identifyOnResolve || cloned.identifyOnResolve() || (((_a = from.identifyOnResolve) == null ? void 0 : _a.call(from)) ?? false) + ); + return cloned; + }, + applyToStack: cloneTo, + identify: () => { + return getMiddlewareList(true).map((mw) => { + const step = mw.step ?? mw.relation + " " + mw.toMiddleware; + return getMiddlewareNameWithAliases(mw.name, mw.aliases) + " - " + step; + }); + }, + identifyOnResolve(toggle) { + if (typeof toggle === "boolean") + identifyOnResolve = toggle; + return identifyOnResolve; + }, + resolve: (handler2, context) => { + for (const middleware of getMiddlewareList().map((entry) => entry.middleware).reverse()) { + handler2 = middleware(handler2, context); + } + if (identifyOnResolve) { + console.log(stack.identify()); + } + return handler2; + } + }; + return stack; + }, "constructStack"); + var stepWeights = { + initialize: 5, + serialize: 4, + build: 3, + finalizeRequest: 2, + deserialize: 1 + }; + var priorityWeights = { + high: 3, + normal: 2, + low: 1 + }; + } +}); + +// ../../../node_modules/@smithy/smithy-client/dist-cjs/index.js +var require_dist_cjs33 = __commonJS({ + "../../../node_modules/@smithy/smithy-client/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + Client: () => Client, + Command: () => Command, + LazyJsonString: () => LazyJsonString, + NoOpLogger: () => NoOpLogger, + SENSITIVE_STRING: () => SENSITIVE_STRING, + ServiceException: () => ServiceException, + StringWrapper: () => StringWrapper, + _json: () => _json, + collectBody: () => import_protocols3.collectBody, + convertMap: () => convertMap, + createAggregatedClient: () => createAggregatedClient, + dateToUtcString: () => dateToUtcString, + decorateServiceException: () => decorateServiceException, + emitWarningIfUnsupportedVersion: () => emitWarningIfUnsupportedVersion2, + expectBoolean: () => expectBoolean, + expectByte: () => expectByte, + expectFloat32: () => expectFloat32, + expectInt: () => expectInt, + expectInt32: () => expectInt32, + expectLong: () => expectLong, + expectNonNull: () => expectNonNull, + expectNumber: () => expectNumber, + expectObject: () => expectObject, + expectShort: () => expectShort, + expectString: () => expectString, + expectUnion: () => expectUnion2, + extendedEncodeURIComponent: () => import_protocols3.extendedEncodeURIComponent, + getArrayIfSingleItem: () => getArrayIfSingleItem, + getDefaultClientConfiguration: () => getDefaultClientConfiguration, + getDefaultExtensionConfiguration: () => getDefaultExtensionConfiguration, + getValueFromTextNode: () => getValueFromTextNode2, + handleFloat: () => handleFloat, + isSerializableHeaderValue: () => isSerializableHeaderValue, + limitedParseDouble: () => limitedParseDouble, + limitedParseFloat: () => limitedParseFloat, + limitedParseFloat32: () => limitedParseFloat32, + loadConfigsForDefaultMode: () => loadConfigsForDefaultMode, + logger: () => logger, + map: () => map, + parseBoolean: () => parseBoolean, + parseEpochTimestamp: () => parseEpochTimestamp, + parseRfc3339DateTime: () => parseRfc3339DateTime, + parseRfc3339DateTimeWithOffset: () => parseRfc3339DateTimeWithOffset, + parseRfc7231DateTime: () => parseRfc7231DateTime, + quoteHeader: () => quoteHeader, + resolveDefaultRuntimeConfig: () => resolveDefaultRuntimeConfig, + resolvedPath: () => import_protocols3.resolvedPath, + serializeDateTime: () => serializeDateTime, + serializeFloat: () => serializeFloat, + splitEvery: () => splitEvery, + splitHeader: () => splitHeader, + strictParseByte: () => strictParseByte, + strictParseDouble: () => strictParseDouble, + strictParseFloat: () => strictParseFloat, + strictParseFloat32: () => strictParseFloat32, + strictParseInt: () => strictParseInt, + strictParseInt32: () => strictParseInt32, + strictParseLong: () => strictParseLong, + strictParseShort: () => strictParseShort, + take: () => take, + throwDefaultError: () => throwDefaultError, + withBaseException: () => withBaseException + }); + module2.exports = __toCommonJS2(src_exports); + var import_middleware_stack = require_dist_cjs32(); + var _Client = class _Client { + constructor(config) { + this.config = config; + this.middlewareStack = (0, import_middleware_stack.constructStack)(); + } + send(command, optionsOrCb, cb) { + const options = typeof optionsOrCb !== "function" ? optionsOrCb : void 0; + const callback = typeof optionsOrCb === "function" ? optionsOrCb : cb; + const useHandlerCache = options === void 0 && this.config.cacheMiddleware === true; + let handler2; + if (useHandlerCache) { + if (!this.handlers) { + this.handlers = /* @__PURE__ */ new WeakMap(); + } + const handlers = this.handlers; + if (handlers.has(command.constructor)) { + handler2 = handlers.get(command.constructor); } else { - let result = readTagExp(xmlData, i, this.options.removeNSPrefix); - let tagName = result.tagName; - const rawTagName = result.rawTagName; - let tagExp = result.tagExp; - let attrExpPresent = result.attrExpPresent; - let closeIndex = result.closeIndex; - if (this.options.transformTagName) { - tagName = this.options.transformTagName(tagName); - } - if (currentNode && textData) { - if (currentNode.tagname !== "!xml") { - textData = this.saveTextToParentTag(textData, currentNode, jPath, false); - } - } - const lastTag = currentNode; - if (lastTag && this.options.unpairedTags.indexOf(lastTag.tagname) !== -1) { - currentNode = this.tagsNodeStack.pop(); - jPath = jPath.substring(0, jPath.lastIndexOf(".")); - } - if (tagName !== xmlObj.tagname) { - jPath += jPath ? "." + tagName : tagName; - } - if (this.isItStopNode(this.options.stopNodes, jPath, tagName)) { - let tagContent = ""; - if (tagExp.length > 0 && tagExp.lastIndexOf("/") === tagExp.length - 1) { - if (tagName[tagName.length - 1] === "/") { - tagName = tagName.substr(0, tagName.length - 1); - jPath = jPath.substr(0, jPath.length - 1); - tagExp = tagName; - } else { - tagExp = tagExp.substr(0, tagExp.length - 1); - } - i = result.closeIndex; - } else if (this.options.unpairedTags.indexOf(tagName) !== -1) { - i = result.closeIndex; - } else { - const result2 = this.readStopNodeData(xmlData, rawTagName, closeIndex + 1); - if (!result2) throw new Error(`Unexpected end of ${rawTagName}`); - i = result2.i; - tagContent = result2.tagContent; - } - const childNode = new xmlNode(tagName); - if (tagName !== tagExp && attrExpPresent) { - childNode[":@"] = this.buildAttributesMap(tagExp, jPath, tagName); - } - if (tagContent) { - tagContent = this.parseTextData(tagContent, tagName, jPath, true, attrExpPresent, true, true); - } - jPath = jPath.substr(0, jPath.lastIndexOf(".")); - childNode.add(this.options.textNodeName, tagContent); - this.addChild(currentNode, childNode, jPath); - } else { - if (tagExp.length > 0 && tagExp.lastIndexOf("/") === tagExp.length - 1) { - if (tagName[tagName.length - 1] === "/") { - tagName = tagName.substr(0, tagName.length - 1); - jPath = jPath.substr(0, jPath.length - 1); - tagExp = tagName; - } else { - tagExp = tagExp.substr(0, tagExp.length - 1); - } - if (this.options.transformTagName) { - tagName = this.options.transformTagName(tagName); - } - const childNode = new xmlNode(tagName); - if (tagName !== tagExp && attrExpPresent) { - childNode[":@"] = this.buildAttributesMap(tagExp, jPath, tagName); - } - this.addChild(currentNode, childNode, jPath); - jPath = jPath.substr(0, jPath.lastIndexOf(".")); - } else { - const childNode = new xmlNode(tagName); - this.tagsNodeStack.push(currentNode); - if (tagName !== tagExp && attrExpPresent) { - childNode[":@"] = this.buildAttributesMap(tagExp, jPath, tagName); - } - this.addChild(currentNode, childNode, jPath); - currentNode = childNode; - } - textData = ""; - i = closeIndex; - } + handler2 = command.resolveMiddleware(this.middlewareStack, this.config, options); + handlers.set(command.constructor, handler2); } } else { - textData += xmlData[i]; + delete this.handlers; + handler2 = command.resolveMiddleware(this.middlewareStack, this.config, options); + } + if (callback) { + handler2(command).then( + (result) => callback(null, result.output), + (err) => callback(err) + ).catch( + // prevent any errors thrown in the callback from triggering an + // unhandled promise rejection + () => { + } + ); + } else { + return handler2(command).then((result) => result.output); } } - return xmlObj.child; + destroy() { + var _a, _b, _c; + (_c = (_b = (_a = this.config) == null ? void 0 : _a.requestHandler) == null ? void 0 : _b.destroy) == null ? void 0 : _c.call(_b); + delete this.handlers; + } }; - function addChild(currentNode, childNode, jPath) { - const result = this.options.updateTag(childNode.tagname, jPath, childNode[":@"]); - if (result === false) { - } else if (typeof result === "string") { - childNode.tagname = result; - currentNode.addChild(childNode); - } else { - currentNode.addChild(childNode); + __name(_Client, "Client"); + var Client = _Client; + var import_protocols3 = (init_protocols(), __toCommonJS(protocols_exports)); + var import_types5 = require_dist_cjs(); + var _Command = class _Command { + constructor() { + this.middlewareStack = (0, import_middleware_stack.constructStack)(); } - } - var replaceEntitiesValue = function(val2) { - if (this.options.processEntities) { - for (let entityName2 in this.docTypeEntities) { - const entity = this.docTypeEntities[entityName2]; - val2 = val2.replace(entity.regx, entity.val); - } - for (let entityName2 in this.lastEntities) { - const entity = this.lastEntities[entityName2]; - val2 = val2.replace(entity.regex, entity.val); - } - if (this.options.htmlEntities) { - for (let entityName2 in this.htmlEntities) { - const entity = this.htmlEntities[entityName2]; - val2 = val2.replace(entity.regex, entity.val); - } + /** + * Factory for Command ClassBuilder. + * @internal + */ + static classBuilder() { + return new ClassBuilder(); + } + /** + * @internal + */ + resolveMiddlewareWithContext(clientStack, configuration, options, { + middlewareFn, + clientName, + commandName, + inputFilterSensitiveLog, + outputFilterSensitiveLog, + smithyContext, + additionalContext, + CommandCtor + }) { + for (const mw of middlewareFn.bind(this)(CommandCtor, clientStack, configuration, options)) { + this.middlewareStack.use(mw); } - val2 = val2.replace(this.ampEntity.regex, this.ampEntity.val); + const stack = clientStack.concat(this.middlewareStack); + const { logger: logger2 } = configuration; + const handlerExecutionContext = { + logger: logger2, + clientName, + commandName, + inputFilterSensitiveLog, + outputFilterSensitiveLog, + [import_types5.SMITHY_CONTEXT_KEY]: { + commandInstance: this, + ...smithyContext + }, + ...additionalContext + }; + const { requestHandler } = configuration; + return stack.resolve( + (request2) => requestHandler.handle(request2.request, options || {}), + handlerExecutionContext + ); } - return val2; }; - function saveTextToParentTag(textData, currentNode, jPath, isLeafNode) { - if (textData) { - if (isLeafNode === void 0) isLeafNode = Object.keys(currentNode.child).length === 0; - textData = this.parseTextData( - textData, - currentNode.tagname, - jPath, - false, - currentNode[":@"] ? Object.keys(currentNode[":@"]).length !== 0 : false, - isLeafNode - ); - if (textData !== void 0 && textData !== "") - currentNode.add(this.options.textNodeName, textData); - textData = ""; + __name(_Command, "Command"); + var Command = _Command; + var _ClassBuilder = class _ClassBuilder { + constructor() { + this._init = () => { + }; + this._ep = {}; + this._middlewareFn = () => []; + this._commandName = ""; + this._clientName = ""; + this._additionalContext = {}; + this._smithyContext = {}; + this._inputFilterSensitiveLog = (_) => _; + this._outputFilterSensitiveLog = (_) => _; + this._serializer = null; + this._deserializer = null; + } + /** + * Optional init callback. + */ + init(cb) { + this._init = cb; + } + /** + * Set the endpoint parameter instructions. + */ + ep(endpointParameterInstructions) { + this._ep = endpointParameterInstructions; + return this; + } + /** + * Add any number of middleware. + */ + m(middlewareSupplier) { + this._middlewareFn = middlewareSupplier; + return this; + } + /** + * Set the initial handler execution context Smithy field. + */ + s(service, operation, smithyContext = {}) { + this._smithyContext = { + service, + operation, + ...smithyContext + }; + return this; } - return textData; - } - function isItStopNode(stopNodes, jPath, currentTagName) { - const allNodesExp = "*." + currentTagName; - for (const stopNodePath in stopNodes) { - const stopNodeExp = stopNodes[stopNodePath]; - if (allNodesExp === stopNodeExp || jPath === stopNodeExp) return true; + /** + * Set the initial handler execution context. + */ + c(additionalContext = {}) { + this._additionalContext = additionalContext; + return this; } - return false; - } - function tagExpWithClosingIndex(xmlData, i, closingChar = ">") { - let attrBoundary; - let tagExp = ""; - for (let index = i; index < xmlData.length; index++) { - let ch = xmlData[index]; - if (attrBoundary) { - if (ch === attrBoundary) attrBoundary = ""; - } else if (ch === '"' || ch === "'") { - attrBoundary = ch; - } else if (ch === closingChar[0]) { - if (closingChar[1]) { - if (xmlData[index + 1] === closingChar[1]) { - return { - data: tagExp, - index - }; - } - } else { - return { - data: tagExp, - index - }; - } - } else if (ch === " ") { - ch = " "; - } - tagExp += ch; + /** + * Set constant string identifiers for the operation. + */ + n(clientName, commandName) { + this._clientName = clientName; + this._commandName = commandName; + return this; } - } - function findClosingIndex(xmlData, str, i, errMsg) { - const closingIndex = xmlData.indexOf(str, i); - if (closingIndex === -1) { - throw new Error(errMsg); - } else { - return closingIndex + str.length - 1; + /** + * Set the input and output sensistive log filters. + */ + f(inputFilter = (_) => _, outputFilter = (_) => _) { + this._inputFilterSensitiveLog = inputFilter; + this._outputFilterSensitiveLog = outputFilter; + return this; } - } - function readTagExp(xmlData, i, removeNSPrefix, closingChar = ">") { - const result = tagExpWithClosingIndex(xmlData, i + 1, closingChar); - if (!result) return; - let tagExp = result.data; - const closeIndex = result.index; - const separatorIndex = tagExp.search(/\s/); - let tagName = tagExp; - let attrExpPresent = true; - if (separatorIndex !== -1) { - tagName = tagExp.substring(0, separatorIndex); - tagExp = tagExp.substring(separatorIndex + 1).trimStart(); + /** + * Sets the serializer. + */ + ser(serializer) { + this._serializer = serializer; + return this; } - const rawTagName = tagName; - if (removeNSPrefix) { - const colonIndex = tagName.indexOf(":"); - if (colonIndex !== -1) { - tagName = tagName.substr(colonIndex + 1); - attrExpPresent = tagName !== result.data.substr(colonIndex + 1); - } + /** + * Sets the deserializer. + */ + de(deserializer) { + this._deserializer = deserializer; + return this; } - return { - tagName, - tagExp, - closeIndex, - attrExpPresent, - rawTagName - }; - } - function readStopNodeData(xmlData, tagName, i) { - const startIndex = i; - let openTagCount = 1; - for (; i < xmlData.length; i++) { - if (xmlData[i] === "<") { - if (xmlData[i + 1] === "/") { - const closeIndex = findClosingIndex(xmlData, ">", i, `${tagName} is not closed`); - let closeTagName = xmlData.substring(i + 2, closeIndex).trim(); - if (closeTagName === tagName) { - openTagCount--; - if (openTagCount === 0) { - return { - tagContent: xmlData.substring(startIndex, i), - i: closeIndex - }; - } - } - i = closeIndex; - } else if (xmlData[i + 1] === "?") { - const closeIndex = findClosingIndex(xmlData, "?>", i + 1, "StopNode is not closed."); - i = closeIndex; - } else if (xmlData.substr(i + 1, 3) === "!--") { - const closeIndex = findClosingIndex(xmlData, "-->", i + 3, "StopNode is not closed."); - i = closeIndex; - } else if (xmlData.substr(i + 1, 2) === "![") { - const closeIndex = findClosingIndex(xmlData, "]]>", i, "StopNode is not closed.") - 2; - i = closeIndex; - } else { - const tagData = readTagExp(xmlData, i, ">"); - if (tagData) { - const openTagName = tagData && tagData.tagName; - if (openTagName === tagName && tagData.tagExp[tagData.tagExp.length - 1] !== "/") { - openTagCount++; - } - i = tagData.closeIndex; - } + /** + * @returns a Command class with the classBuilder properties. + */ + build() { + var _a; + const closure = this; + let CommandRef; + return CommandRef = (_a = class extends Command { + /** + * @public + */ + constructor(...[input]) { + super(); + this.serialize = closure._serializer; + this.deserialize = closure._deserializer; + this.input = input ?? {}; + closure._init(this); } - } - } - } - function parseValue(val2, shouldParse, options) { - if (shouldParse && typeof val2 === "string") { - const newval = val2.trim(); - if (newval === "true") return true; - else if (newval === "false") return false; - else return toNumber(val2, options); - } else { - if (util.isExist(val2)) { - return val2; - } else { - return ""; - } - } - } - module2.exports = OrderedObjParser; - } -}); - -// ../../../node_modules/fast-xml-parser/src/xmlparser/node2json.js -var require_node2json = __commonJS({ - "../../../node_modules/fast-xml-parser/src/xmlparser/node2json.js"(exports2) { - "use strict"; - function prettify(node, options) { - return compress(node, options); - } - function compress(arr, options, jPath) { - let text; - const compressedObj = {}; - for (let i = 0; i < arr.length; i++) { - const tagObj = arr[i]; - const property = propName(tagObj); - let newJpath = ""; - if (jPath === void 0) newJpath = property; - else newJpath = jPath + "." + property; - if (property === options.textNodeName) { - if (text === void 0) text = tagObj[property]; - else text += "" + tagObj[property]; - } else if (property === void 0) { - continue; - } else if (tagObj[property]) { - let val2 = compress(tagObj[property], options, newJpath); - const isLeaf = isLeafTag(val2, options); - if (tagObj[":@"]) { - assignAttributes(val2, tagObj[":@"], newJpath, options); - } else if (Object.keys(val2).length === 1 && val2[options.textNodeName] !== void 0 && !options.alwaysCreateTextNode) { - val2 = val2[options.textNodeName]; - } else if (Object.keys(val2).length === 0) { - if (options.alwaysCreateTextNode) val2[options.textNodeName] = ""; - else val2 = ""; + /** + * @public + */ + static getEndpointParameterInstructions() { + return closure._ep; } - if (compressedObj[property] !== void 0 && compressedObj.hasOwnProperty(property)) { - if (!Array.isArray(compressedObj[property])) { - compressedObj[property] = [compressedObj[property]]; - } - compressedObj[property].push(val2); - } else { - if (options.isArray(property, newJpath, isLeaf)) { - compressedObj[property] = [val2]; - } else { - compressedObj[property] = val2; - } + /** + * @internal + */ + resolveMiddleware(stack, configuration, options) { + return this.resolveMiddlewareWithContext(stack, configuration, options, { + CommandCtor: CommandRef, + middlewareFn: closure._middlewareFn, + clientName: closure._clientName, + commandName: closure._commandName, + inputFilterSensitiveLog: closure._inputFilterSensitiveLog, + outputFilterSensitiveLog: closure._outputFilterSensitiveLog, + smithyContext: closure._smithyContext, + additionalContext: closure._additionalContext + }); + } + }, __name(_a, "CommandRef"), _a); + } + }; + __name(_ClassBuilder, "ClassBuilder"); + var ClassBuilder = _ClassBuilder; + var SENSITIVE_STRING = "***SensitiveInformation***"; + var createAggregatedClient = /* @__PURE__ */ __name((commands, Client2) => { + for (const command of Object.keys(commands)) { + const CommandCtor = commands[command]; + const methodImpl = /* @__PURE__ */ __name(async function(args, optionsOrCb, cb) { + const command2 = new CommandCtor(args); + if (typeof optionsOrCb === "function") { + this.send(command2, optionsOrCb); + } else if (typeof cb === "function") { + if (typeof optionsOrCb !== "object") + throw new Error(`Expected http options but got ${typeof optionsOrCb}`); + this.send(command2, optionsOrCb || {}, cb); + } else { + return this.send(command2, optionsOrCb); } + }, "methodImpl"); + const methodName = (command[0].toLowerCase() + command.slice(1)).replace(/Command$/, ""); + Client2.prototype[methodName] = methodImpl; + } + }, "createAggregatedClient"); + var parseBoolean = /* @__PURE__ */ __name((value) => { + switch (value) { + case "true": + return true; + case "false": + return false; + default: + throw new Error(`Unable to parse boolean value "${value}"`); + } + }, "parseBoolean"); + var expectBoolean = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; + } + if (typeof value === "number") { + if (value === 0 || value === 1) { + logger.warn(stackTraceWarning(`Expected boolean, got ${typeof value}: ${value}`)); + } + if (value === 0) { + return false; + } + if (value === 1) { + return true; } } - if (typeof text === "string") { - if (text.length > 0) compressedObj[options.textNodeName] = text; - } else if (text !== void 0) compressedObj[options.textNodeName] = text; - return compressedObj; - } - function propName(obj) { - const keys = Object.keys(obj); - for (let i = 0; i < keys.length; i++) { - const key = keys[i]; - if (key !== ":@") return key; + if (typeof value === "string") { + const lower = value.toLowerCase(); + if (lower === "false" || lower === "true") { + logger.warn(stackTraceWarning(`Expected boolean, got ${typeof value}: ${value}`)); + } + if (lower === "false") { + return false; + } + if (lower === "true") { + return true; + } } - } - function assignAttributes(obj, attrMap, jpath, options) { - if (attrMap) { - const keys = Object.keys(attrMap); - const len = keys.length; - for (let i = 0; i < len; i++) { - const atrrName = keys[i]; - if (options.isArray(atrrName, jpath + "." + atrrName, true, true)) { - obj[atrrName] = [attrMap[atrrName]]; - } else { - obj[atrrName] = attrMap[atrrName]; + if (typeof value === "boolean") { + return value; + } + throw new TypeError(`Expected boolean, got ${typeof value}: ${value}`); + }, "expectBoolean"); + var expectNumber = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; + } + if (typeof value === "string") { + const parsed = parseFloat(value); + if (!Number.isNaN(parsed)) { + if (String(parsed) !== String(value)) { + logger.warn(stackTraceWarning(`Expected number but observed string: ${value}`)); } + return parsed; } } - } - function isLeafTag(obj, options) { - const { textNodeName } = options; - const propCount = Object.keys(obj).length; - if (propCount === 0) { - return true; + if (typeof value === "number") { + return value; } - if (propCount === 1 && (obj[textNodeName] || typeof obj[textNodeName] === "boolean" || obj[textNodeName] === 0)) { - return true; + throw new TypeError(`Expected number, got ${typeof value}: ${value}`); + }, "expectNumber"); + var MAX_FLOAT = Math.ceil(2 ** 127 * (2 - 2 ** -23)); + var expectFloat32 = /* @__PURE__ */ __name((value) => { + const expected = expectNumber(value); + if (expected !== void 0 && !Number.isNaN(expected) && expected !== Infinity && expected !== -Infinity) { + if (Math.abs(expected) > MAX_FLOAT) { + throw new TypeError(`Expected 32-bit float, got ${value}`); + } } - return false; - } - exports2.prettify = prettify; - } -}); - -// ../../../node_modules/fast-xml-parser/src/xmlparser/XMLParser.js -var require_XMLParser = __commonJS({ - "../../../node_modules/fast-xml-parser/src/xmlparser/XMLParser.js"(exports2, module2) { - var { buildOptions } = require_OptionsBuilder(); - var OrderedObjParser = require_OrderedObjParser(); - var { prettify } = require_node2json(); - var validator = require_validator(); - var XMLParser2 = class { - constructor(options) { - this.externalEntities = {}; - this.options = buildOptions(options); + return expected; + }, "expectFloat32"); + var expectLong = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; } - /** - * Parse XML dats to JS object - * @param {string|Buffer} xmlData - * @param {boolean|Object} validationOption - */ - parse(xmlData, validationOption) { - if (typeof xmlData === "string") { - } else if (xmlData.toString) { - xmlData = xmlData.toString(); - } else { - throw new Error("XML data is accepted in String or Bytes[] form."); - } - if (validationOption) { - if (validationOption === true) validationOption = {}; - const result = validator.validate(xmlData, validationOption); - if (result !== true) { - throw Error(`${result.err.msg}:${result.err.line}:${result.err.col}`); - } + if (Number.isInteger(value) && !Number.isNaN(value)) { + return value; + } + throw new TypeError(`Expected integer, got ${typeof value}: ${value}`); + }, "expectLong"); + var expectInt = expectLong; + var expectInt32 = /* @__PURE__ */ __name((value) => expectSizedInt(value, 32), "expectInt32"); + var expectShort = /* @__PURE__ */ __name((value) => expectSizedInt(value, 16), "expectShort"); + var expectByte = /* @__PURE__ */ __name((value) => expectSizedInt(value, 8), "expectByte"); + var expectSizedInt = /* @__PURE__ */ __name((value, size) => { + const expected = expectLong(value); + if (expected !== void 0 && castInt(expected, size) !== expected) { + throw new TypeError(`Expected ${size}-bit integer, got ${value}`); + } + return expected; + }, "expectSizedInt"); + var castInt = /* @__PURE__ */ __name((value, size) => { + switch (size) { + case 32: + return Int32Array.of(value)[0]; + case 16: + return Int16Array.of(value)[0]; + case 8: + return Int8Array.of(value)[0]; + } + }, "castInt"); + var expectNonNull = /* @__PURE__ */ __name((value, location) => { + if (value === null || value === void 0) { + if (location) { + throw new TypeError(`Expected a non-null value for ${location}`); } - const orderedObjParser = new OrderedObjParser(this.options); - orderedObjParser.addExternalEntities(this.externalEntities); - const orderedResult = orderedObjParser.parseXml(xmlData); - if (this.options.preserveOrder || orderedResult === void 0) return orderedResult; - else return prettify(orderedResult, this.options); + throw new TypeError("Expected a non-null value"); + } + return value; + }, "expectNonNull"); + var expectObject = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; + } + if (typeof value === "object" && !Array.isArray(value)) { + return value; + } + const receivedType = Array.isArray(value) ? "array" : typeof value; + throw new TypeError(`Expected object, got ${receivedType}: ${value}`); + }, "expectObject"); + var expectString = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; + } + if (typeof value === "string") { + return value; + } + if (["boolean", "number", "bigint"].includes(typeof value)) { + logger.warn(stackTraceWarning(`Expected string, got ${typeof value}: ${value}`)); + return String(value); + } + throw new TypeError(`Expected string, got ${typeof value}: ${value}`); + }, "expectString"); + var expectUnion2 = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; + } + const asObject = expectObject(value); + const setKeys = Object.entries(asObject).filter(([, v]) => v != null).map(([k]) => k); + if (setKeys.length === 0) { + throw new TypeError(`Unions must have exactly one non-null member. None were found.`); + } + if (setKeys.length > 1) { + throw new TypeError(`Unions must have exactly one non-null member. Keys ${setKeys} were not null.`); + } + return asObject; + }, "expectUnion"); + var strictParseDouble = /* @__PURE__ */ __name((value) => { + if (typeof value == "string") { + return expectNumber(parseNumber(value)); + } + return expectNumber(value); + }, "strictParseDouble"); + var strictParseFloat = strictParseDouble; + var strictParseFloat32 = /* @__PURE__ */ __name((value) => { + if (typeof value == "string") { + return expectFloat32(parseNumber(value)); + } + return expectFloat32(value); + }, "strictParseFloat32"); + var NUMBER_REGEX = /(-?(?:0|[1-9]\d*)(?:\.\d+)?(?:[eE][+-]?\d+)?)|(-?Infinity)|(NaN)/g; + var parseNumber = /* @__PURE__ */ __name((value) => { + const matches = value.match(NUMBER_REGEX); + if (matches === null || matches[0].length !== value.length) { + throw new TypeError(`Expected real number, got implicit NaN`); + } + return parseFloat(value); + }, "parseNumber"); + var limitedParseDouble = /* @__PURE__ */ __name((value) => { + if (typeof value == "string") { + return parseFloatString(value); + } + return expectNumber(value); + }, "limitedParseDouble"); + var handleFloat = limitedParseDouble; + var limitedParseFloat = limitedParseDouble; + var limitedParseFloat32 = /* @__PURE__ */ __name((value) => { + if (typeof value == "string") { + return parseFloatString(value); + } + return expectFloat32(value); + }, "limitedParseFloat32"); + var parseFloatString = /* @__PURE__ */ __name((value) => { + switch (value) { + case "NaN": + return NaN; + case "Infinity": + return Infinity; + case "-Infinity": + return -Infinity; + default: + throw new Error(`Unable to parse float value: ${value}`); } - /** - * Add Entity which is not by default supported by this library - * @param {string} key - * @param {string} value - */ - addEntity(key, value) { - if (value.indexOf("&") !== -1) { - throw new Error("Entity value can't have '&'"); - } else if (key.indexOf("&") !== -1 || key.indexOf(";") !== -1) { - throw new Error("An entity must be set without '&' and ';'. Eg. use '#xD' for ' '"); - } else if (value === "&") { - throw new Error("An entity with value '&' is not permitted"); - } else { - this.externalEntities[key] = value; - } + }, "parseFloatString"); + var strictParseLong = /* @__PURE__ */ __name((value) => { + if (typeof value === "string") { + return expectLong(parseNumber(value)); } - }; - module2.exports = XMLParser2; - } -}); - -// ../../../node_modules/fast-xml-parser/src/xmlbuilder/orderedJs2Xml.js -var require_orderedJs2Xml = __commonJS({ - "../../../node_modules/fast-xml-parser/src/xmlbuilder/orderedJs2Xml.js"(exports2, module2) { - var EOL = "\n"; - function toXml(jArray, options) { - let indentation = ""; - if (options.format && options.indentBy.length > 0) { - indentation = EOL; + return expectLong(value); + }, "strictParseLong"); + var strictParseInt = strictParseLong; + var strictParseInt32 = /* @__PURE__ */ __name((value) => { + if (typeof value === "string") { + return expectInt32(parseNumber(value)); } - return arrToStr(jArray, options, "", indentation); - } - function arrToStr(arr, options, jPath, indentation) { - let xmlStr = ""; - let isPreviousElementTag = false; - for (let i = 0; i < arr.length; i++) { - const tagObj = arr[i]; - const tagName = propName(tagObj); - if (tagName === void 0) continue; - let newJPath = ""; - if (jPath.length === 0) newJPath = tagName; - else newJPath = `${jPath}.${tagName}`; - if (tagName === options.textNodeName) { - let tagText = tagObj[tagName]; - if (!isStopNode(newJPath, options)) { - tagText = options.tagValueProcessor(tagName, tagText); - tagText = replaceEntitiesValue(tagText, options); - } - if (isPreviousElementTag) { - xmlStr += indentation; - } - xmlStr += tagText; - isPreviousElementTag = false; - continue; - } else if (tagName === options.cdataPropName) { - if (isPreviousElementTag) { - xmlStr += indentation; - } - xmlStr += ``; - isPreviousElementTag = false; - continue; - } else if (tagName === options.commentPropName) { - xmlStr += indentation + ``; - isPreviousElementTag = true; - continue; - } else if (tagName[0] === "?") { - const attStr2 = attr_to_str(tagObj[":@"], options); - const tempInd = tagName === "?xml" ? "" : indentation; - let piTextNodeName = tagObj[tagName][0][options.textNodeName]; - piTextNodeName = piTextNodeName.length !== 0 ? " " + piTextNodeName : ""; - xmlStr += tempInd + `<${tagName}${piTextNodeName}${attStr2}?>`; - isPreviousElementTag = true; - continue; - } - let newIdentation = indentation; - if (newIdentation !== "") { - newIdentation += options.indentBy; - } - const attStr = attr_to_str(tagObj[":@"], options); - const tagStart = indentation + `<${tagName}${attStr}`; - const tagValue = arrToStr(tagObj[tagName], options, newJPath, newIdentation); - if (options.unpairedTags.indexOf(tagName) !== -1) { - if (options.suppressUnpairedNode) xmlStr += tagStart + ">"; - else xmlStr += tagStart + "/>"; - } else if ((!tagValue || tagValue.length === 0) && options.suppressEmptyNode) { - xmlStr += tagStart + "/>"; - } else if (tagValue && tagValue.endsWith(">")) { - xmlStr += tagStart + `>${tagValue}${indentation}`; - } else { - xmlStr += tagStart + ">"; - if (tagValue && indentation !== "" && (tagValue.includes("/>") || tagValue.includes("`; - } - isPreviousElementTag = true; + return expectInt32(value); + }, "strictParseInt32"); + var strictParseShort = /* @__PURE__ */ __name((value) => { + if (typeof value === "string") { + return expectShort(parseNumber(value)); } - return xmlStr; - } - function propName(obj) { - const keys = Object.keys(obj); - for (let i = 0; i < keys.length; i++) { - const key = keys[i]; - if (!obj.hasOwnProperty(key)) continue; - if (key !== ":@") return key; + return expectShort(value); + }, "strictParseShort"); + var strictParseByte = /* @__PURE__ */ __name((value) => { + if (typeof value === "string") { + return expectByte(parseNumber(value)); } + return expectByte(value); + }, "strictParseByte"); + var stackTraceWarning = /* @__PURE__ */ __name((message) => { + return String(new TypeError(message).stack || message).split("\n").slice(0, 5).filter((s) => !s.includes("stackTraceWarning")).join("\n"); + }, "stackTraceWarning"); + var logger = { + warn: console.warn + }; + var DAYS = ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"]; + var MONTHS = ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"]; + function dateToUtcString(date) { + const year = date.getUTCFullYear(); + const month = date.getUTCMonth(); + const dayOfWeek = date.getUTCDay(); + const dayOfMonthInt = date.getUTCDate(); + const hoursInt = date.getUTCHours(); + const minutesInt = date.getUTCMinutes(); + const secondsInt = date.getUTCSeconds(); + const dayOfMonthString = dayOfMonthInt < 10 ? `0${dayOfMonthInt}` : `${dayOfMonthInt}`; + const hoursString = hoursInt < 10 ? `0${hoursInt}` : `${hoursInt}`; + const minutesString = minutesInt < 10 ? `0${minutesInt}` : `${minutesInt}`; + const secondsString = secondsInt < 10 ? `0${secondsInt}` : `${secondsInt}`; + return `${DAYS[dayOfWeek]}, ${dayOfMonthString} ${MONTHS[month]} ${year} ${hoursString}:${minutesString}:${secondsString} GMT`; } - function attr_to_str(attrMap, options) { - let attrStr = ""; - if (attrMap && !options.ignoreAttributes) { - for (let attr in attrMap) { - if (!attrMap.hasOwnProperty(attr)) continue; - let attrVal = options.attributeValueProcessor(attr, attrMap[attr]); - attrVal = replaceEntitiesValue(attrVal, options); - if (attrVal === true && options.suppressBooleanAttributes) { - attrStr += ` ${attr.substr(options.attributeNamePrefix.length)}`; - } else { - attrStr += ` ${attr.substr(options.attributeNamePrefix.length)}="${attrVal}"`; - } - } + __name(dateToUtcString, "dateToUtcString"); + var RFC3339 = new RegExp(/^(\d{4})-(\d{2})-(\d{2})[tT](\d{2}):(\d{2}):(\d{2})(?:\.(\d+))?[zZ]$/); + var parseRfc3339DateTime = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; } - return attrStr; - } - function isStopNode(jPath, options) { - jPath = jPath.substr(0, jPath.length - options.textNodeName.length - 1); - let tagName = jPath.substr(jPath.lastIndexOf(".") + 1); - for (let index in options.stopNodes) { - if (options.stopNodes[index] === jPath || options.stopNodes[index] === "*." + tagName) return true; + if (typeof value !== "string") { + throw new TypeError("RFC-3339 date-times must be expressed as strings"); } - return false; - } - function replaceEntitiesValue(textValue, options) { - if (textValue && textValue.length > 0 && options.processEntities) { - for (let i = 0; i < options.entities.length; i++) { - const entity = options.entities[i]; - textValue = textValue.replace(entity.regex, entity.val); - } + const match = RFC3339.exec(value); + if (!match) { + throw new TypeError("Invalid RFC-3339 date-time value"); } - return textValue; - } - module2.exports = toXml; - } -}); - -// ../../../node_modules/fast-xml-parser/src/xmlbuilder/json2xml.js -var require_json2xml = __commonJS({ - "../../../node_modules/fast-xml-parser/src/xmlbuilder/json2xml.js"(exports2, module2) { - "use strict"; - var buildFromOrderedJs = require_orderedJs2Xml(); - var defaultOptions = { - attributeNamePrefix: "@_", - attributesGroupName: false, - textNodeName: "#text", - ignoreAttributes: true, - cdataPropName: false, - format: false, - indentBy: " ", - suppressEmptyNode: false, - suppressUnpairedNode: true, - suppressBooleanAttributes: true, - tagValueProcessor: function(key, a) { - return a; - }, - attributeValueProcessor: function(attrName, a) { - return a; - }, - preserveOrder: false, - commentPropName: false, - unpairedTags: [], - entities: [ - { regex: new RegExp("&", "g"), val: "&" }, - //it must be on top - { regex: new RegExp(">", "g"), val: ">" }, - { regex: new RegExp("<", "g"), val: "<" }, - { regex: new RegExp("'", "g"), val: "'" }, - { regex: new RegExp('"', "g"), val: """ } - ], - processEntities: true, - stopNodes: [], - // transformTagName: false, - // transformAttributeName: false, - oneListGroup: false - }; - function Builder(options) { - this.options = Object.assign({}, defaultOptions, options); - if (this.options.ignoreAttributes || this.options.attributesGroupName) { - this.isAttribute = function() { - return false; - }; - } else { - this.attrPrefixLen = this.options.attributeNamePrefix.length; - this.isAttribute = isAttribute; + const [_, yearStr, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds] = match; + const year = strictParseShort(stripLeadingZeroes(yearStr)); + const month = parseDateValue(monthStr, "month", 1, 12); + const day = parseDateValue(dayStr, "day", 1, 31); + return buildDate(year, month, day, { hours, minutes, seconds, fractionalMilliseconds }); + }, "parseRfc3339DateTime"); + var RFC3339_WITH_OFFSET = new RegExp( + /^(\d{4})-(\d{2})-(\d{2})[tT](\d{2}):(\d{2}):(\d{2})(?:\.(\d+))?(([-+]\d{2}\:\d{2})|[zZ])$/ + ); + var parseRfc3339DateTimeWithOffset = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; + } + if (typeof value !== "string") { + throw new TypeError("RFC-3339 date-times must be expressed as strings"); } - this.processTextOrObjNode = processTextOrObjNode; - if (this.options.format) { - this.indentate = indentate; - this.tagEndChar = ">\n"; - this.newLine = "\n"; - } else { - this.indentate = function() { - return ""; - }; - this.tagEndChar = ">"; - this.newLine = ""; + const match = RFC3339_WITH_OFFSET.exec(value); + if (!match) { + throw new TypeError("Invalid RFC-3339 date-time value"); } - } - Builder.prototype.build = function(jObj) { - if (this.options.preserveOrder) { - return buildFromOrderedJs(jObj, this.options); - } else { - if (Array.isArray(jObj) && this.options.arrayNodeName && this.options.arrayNodeName.length > 1) { - jObj = { - [this.options.arrayNodeName]: jObj - }; - } - return this.j2x(jObj, 0).val; + const [_, yearStr, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds, offsetStr] = match; + const year = strictParseShort(stripLeadingZeroes(yearStr)); + const month = parseDateValue(monthStr, "month", 1, 12); + const day = parseDateValue(dayStr, "day", 1, 31); + const date = buildDate(year, month, day, { hours, minutes, seconds, fractionalMilliseconds }); + if (offsetStr.toUpperCase() != "Z") { + date.setTime(date.getTime() - parseOffsetToMilliseconds(offsetStr)); } - }; - Builder.prototype.j2x = function(jObj, level) { - let attrStr = ""; - let val2 = ""; - for (let key in jObj) { - if (!Object.prototype.hasOwnProperty.call(jObj, key)) continue; - if (typeof jObj[key] === "undefined") { - if (this.isAttribute(key)) { - val2 += ""; - } - } else if (jObj[key] === null) { - if (this.isAttribute(key)) { - val2 += ""; - } else if (key[0] === "?") { - val2 += this.indentate(level) + "<" + key + "?" + this.tagEndChar; - } else { - val2 += this.indentate(level) + "<" + key + "/" + this.tagEndChar; - } - } else if (jObj[key] instanceof Date) { - val2 += this.buildTextValNode(jObj[key], key, "", level); - } else if (typeof jObj[key] !== "object") { - const attr = this.isAttribute(key); - if (attr) { - attrStr += this.buildAttrPairStr(attr, "" + jObj[key]); - } else { - if (key === this.options.textNodeName) { - let newval = this.options.tagValueProcessor(key, "" + jObj[key]); - val2 += this.replaceEntitiesValue(newval); - } else { - val2 += this.buildTextValNode(jObj[key], key, "", level); - } - } - } else if (Array.isArray(jObj[key])) { - const arrLen = jObj[key].length; - let listTagVal = ""; - let listTagAttr = ""; - for (let j = 0; j < arrLen; j++) { - const item = jObj[key][j]; - if (typeof item === "undefined") { - } else if (item === null) { - if (key[0] === "?") val2 += this.indentate(level) + "<" + key + "?" + this.tagEndChar; - else val2 += this.indentate(level) + "<" + key + "/" + this.tagEndChar; - } else if (typeof item === "object") { - if (this.options.oneListGroup) { - const result = this.j2x(item, level + 1); - listTagVal += result.val; - if (this.options.attributesGroupName && item.hasOwnProperty(this.options.attributesGroupName)) { - listTagAttr += result.attrStr; - } - } else { - listTagVal += this.processTextOrObjNode(item, key, level); - } - } else { - if (this.options.oneListGroup) { - let textValue = this.options.tagValueProcessor(key, item); - textValue = this.replaceEntitiesValue(textValue); - listTagVal += textValue; - } else { - listTagVal += this.buildTextValNode(item, key, "", level); - } - } - } - if (this.options.oneListGroup) { - listTagVal = this.buildObjectNode(listTagVal, key, listTagAttr, level); - } - val2 += listTagVal; - } else { - if (this.options.attributesGroupName && key === this.options.attributesGroupName) { - const Ks = Object.keys(jObj[key]); - const L = Ks.length; - for (let j = 0; j < L; j++) { - attrStr += this.buildAttrPairStr(Ks[j], "" + jObj[key][Ks[j]]); - } - } else { - val2 += this.processTextOrObjNode(jObj[key], key, level); - } - } + return date; + }, "parseRfc3339DateTimeWithOffset"); + var IMF_FIXDATE = new RegExp( + /^(?:Mon|Tue|Wed|Thu|Fri|Sat|Sun), (\d{2}) (Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec) (\d{4}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? GMT$/ + ); + var RFC_850_DATE = new RegExp( + /^(?:Monday|Tuesday|Wednesday|Thursday|Friday|Saturday|Sunday), (\d{2})-(Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec)-(\d{2}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? GMT$/ + ); + var ASC_TIME = new RegExp( + /^(?:Mon|Tue|Wed|Thu|Fri|Sat|Sun) (Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec) ( [1-9]|\d{2}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? (\d{4})$/ + ); + var parseRfc7231DateTime = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; } - return { attrStr, val: val2 }; - }; - Builder.prototype.buildAttrPairStr = function(attrName, val2) { - val2 = this.options.attributeValueProcessor(attrName, "" + val2); - val2 = this.replaceEntitiesValue(val2); - if (this.options.suppressBooleanAttributes && val2 === "true") { - return " " + attrName; - } else return " " + attrName + '="' + val2 + '"'; - }; - function processTextOrObjNode(object, key, level) { - const result = this.j2x(object, level + 1); - if (object[this.options.textNodeName] !== void 0 && Object.keys(object).length === 1) { - return this.buildTextValNode(object[this.options.textNodeName], key, result.attrStr, level); - } else { - return this.buildObjectNode(result.val, key, result.attrStr, level); + if (typeof value !== "string") { + throw new TypeError("RFC-7231 date-times must be expressed as strings"); } - } - Builder.prototype.buildObjectNode = function(val2, key, attrStr, level) { - if (val2 === "") { - if (key[0] === "?") return this.indentate(level) + "<" + key + attrStr + "?" + this.tagEndChar; - else { - return this.indentate(level) + "<" + key + attrStr + this.closeTag(key) + this.tagEndChar; - } - } else { - let tagEndExp = "" + val2 + tagEndExp; - } else if (this.options.commentPropName !== false && key === this.options.commentPropName && piClosingChar.length === 0) { - return this.indentate(level) + `` + this.newLine; - } else { - return this.indentate(level) + "<" + key + attrStr + piClosingChar + this.tagEndChar + val2 + this.indentate(level) + tagEndExp; - } + let match = IMF_FIXDATE.exec(value); + if (match) { + const [_, dayStr, monthStr, yearStr, hours, minutes, seconds, fractionalMilliseconds] = match; + return buildDate( + strictParseShort(stripLeadingZeroes(yearStr)), + parseMonthByShortName(monthStr), + parseDateValue(dayStr, "day", 1, 31), + { hours, minutes, seconds, fractionalMilliseconds } + ); } - }; - Builder.prototype.closeTag = function(key) { - let closeTag = ""; - if (this.options.unpairedTags.indexOf(key) !== -1) { - if (!this.options.suppressUnpairedNode) closeTag = "/"; - } else if (this.options.suppressEmptyNode) { - closeTag = "/"; + match = RFC_850_DATE.exec(value); + if (match) { + const [_, dayStr, monthStr, yearStr, hours, minutes, seconds, fractionalMilliseconds] = match; + return adjustRfc850Year( + buildDate(parseTwoDigitYear(yearStr), parseMonthByShortName(monthStr), parseDateValue(dayStr, "day", 1, 31), { + hours, + minutes, + seconds, + fractionalMilliseconds + }) + ); + } + match = ASC_TIME.exec(value); + if (match) { + const [_, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds, yearStr] = match; + return buildDate( + strictParseShort(stripLeadingZeroes(yearStr)), + parseMonthByShortName(monthStr), + parseDateValue(dayStr.trimLeft(), "day", 1, 31), + { hours, minutes, seconds, fractionalMilliseconds } + ); + } + throw new TypeError("Invalid RFC-7231 date-time value"); + }, "parseRfc7231DateTime"); + var parseEpochTimestamp = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; + } + let valueAsDouble; + if (typeof value === "number") { + valueAsDouble = value; + } else if (typeof value === "string") { + valueAsDouble = strictParseDouble(value); + } else if (typeof value === "object" && value.tag === 1) { + valueAsDouble = value.value; } else { - closeTag = `> { + const adjustedMonth = month - 1; + validateDayOfMonth(year, adjustedMonth, day); + return new Date( + Date.UTC( + year, + adjustedMonth, + day, + parseDateValue(time.hours, "hour", 0, 23), + parseDateValue(time.minutes, "minute", 0, 59), + // seconds can go up to 60 for leap seconds + parseDateValue(time.seconds, "seconds", 0, 60), + parseMilliseconds(time.fractionalMilliseconds) + ) + ); + }, "buildDate"); + var parseTwoDigitYear = /* @__PURE__ */ __name((value) => { + const thisYear = (/* @__PURE__ */ new Date()).getUTCFullYear(); + const valueInThisCentury = Math.floor(thisYear / 100) * 100 + strictParseShort(stripLeadingZeroes(value)); + if (valueInThisCentury < thisYear) { + return valueInThisCentury + 100; + } + return valueInThisCentury; + }, "parseTwoDigitYear"); + var FIFTY_YEARS_IN_MILLIS = 50 * 365 * 24 * 60 * 60 * 1e3; + var adjustRfc850Year = /* @__PURE__ */ __name((input) => { + if (input.getTime() - (/* @__PURE__ */ new Date()).getTime() > FIFTY_YEARS_IN_MILLIS) { + return new Date( + Date.UTC( + input.getUTCFullYear() - 100, + input.getUTCMonth(), + input.getUTCDate(), + input.getUTCHours(), + input.getUTCMinutes(), + input.getUTCSeconds(), + input.getUTCMilliseconds() + ) + ); } - return closeTag; - }; - Builder.prototype.buildTextValNode = function(val2, key, attrStr, level) { - if (this.options.cdataPropName !== false && key === this.options.cdataPropName) { - return this.indentate(level) + `` + this.newLine; - } else if (this.options.commentPropName !== false && key === this.options.commentPropName) { - return this.indentate(level) + `` + this.newLine; - } else if (key[0] === "?") { - return this.indentate(level) + "<" + key + attrStr + "?" + this.tagEndChar; - } else { - let textValue = this.options.tagValueProcessor(key, val2); - textValue = this.replaceEntitiesValue(textValue); - if (textValue === "") { - return this.indentate(level) + "<" + key + attrStr + this.closeTag(key) + this.tagEndChar; - } else { - return this.indentate(level) + "<" + key + attrStr + ">" + textValue + " { + const monthIdx = MONTHS.indexOf(value); + if (monthIdx < 0) { + throw new TypeError(`Invalid month: ${value}`); } - }; - Builder.prototype.replaceEntitiesValue = function(textValue) { - if (textValue && textValue.length > 0 && this.options.processEntities) { - for (let i = 0; i < this.options.entities.length; i++) { - const entity = this.options.entities[i]; - textValue = textValue.replace(entity.regex, entity.val); - } + return monthIdx + 1; + }, "parseMonthByShortName"); + var DAYS_IN_MONTH = [31, 28, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31]; + var validateDayOfMonth = /* @__PURE__ */ __name((year, month, day) => { + let maxDays = DAYS_IN_MONTH[month]; + if (month === 1 && isLeapYear(year)) { + maxDays = 29; } - return textValue; - }; - function indentate(level) { - return this.options.indentBy.repeat(level); - } - function isAttribute(name) { - if (name.startsWith(this.options.attributeNamePrefix) && name !== this.options.textNodeName) { - return name.substr(this.attrPrefixLen); - } else { - return false; + if (day > maxDays) { + throw new TypeError(`Invalid day for ${MONTHS[month]} in ${year}: ${day}`); } - } - module2.exports = Builder; - } -}); - -// ../../../node_modules/fast-xml-parser/src/fxp.js -var require_fxp = __commonJS({ - "../../../node_modules/fast-xml-parser/src/fxp.js"(exports2, module2) { - "use strict"; - var validator = require_validator(); - var XMLParser2 = require_XMLParser(); - var XMLBuilder = require_json2xml(); - module2.exports = { - XMLParser: XMLParser2, - XMLValidator: validator, - XMLBuilder - }; - } -}); - -// ../../../node_modules/@aws-sdk/core/dist-es/submodules/protocols/xml/parseXmlBody.js -var import_smithy_client4, import_fast_xml_parser, parseXmlBody, parseXmlErrorBody, loadRestXmlErrorCode; -var init_parseXmlBody = __esm({ - "../../../node_modules/@aws-sdk/core/dist-es/submodules/protocols/xml/parseXmlBody.js"() { - import_smithy_client4 = __toESM(require_dist_cjs37()); - import_fast_xml_parser = __toESM(require_fxp()); - init_common(); - parseXmlBody = (streamBody, context) => collectBodyString(streamBody, context).then((encoded) => { - if (encoded.length) { - const parser = new import_fast_xml_parser.XMLParser({ - attributeNamePrefix: "", - htmlEntities: true, - ignoreAttributes: false, - ignoreDeclaration: true, - parseTagValue: false, - trimValues: false, - tagValueProcessor: (_, val2) => val2.trim() === "" && val2.includes("\n") ? "" : void 0 - }); - parser.addEntity("#xD", "\r"); - parser.addEntity("#10", "\n"); - let parsedObj; - try { - parsedObj = parser.parse(encoded, true); - } catch (e) { - if (e && typeof e === "object") { - Object.defineProperty(e, "$responseBodyText", { - value: encoded - }); - } - throw e; - } - const textNodeName = "#text"; - const key = Object.keys(parsedObj)[0]; - const parsedObjToReturn = parsedObj[key]; - if (parsedObjToReturn[textNodeName]) { - parsedObjToReturn[key] = parsedObjToReturn[textNodeName]; - delete parsedObjToReturn[textNodeName]; - } - return (0, import_smithy_client4.getValueFromTextNode)(parsedObjToReturn); + }, "validateDayOfMonth"); + var isLeapYear = /* @__PURE__ */ __name((year) => { + return year % 4 === 0 && (year % 100 !== 0 || year % 400 === 0); + }, "isLeapYear"); + var parseDateValue = /* @__PURE__ */ __name((value, type, lower, upper) => { + const dateVal = strictParseByte(stripLeadingZeroes(value)); + if (dateVal < lower || dateVal > upper) { + throw new TypeError(`${type} must be between ${lower} and ${upper}, inclusive`); } - return {}; - }); - parseXmlErrorBody = async (errorBody, context) => { - const value = await parseXmlBody(errorBody, context); - if (value.Error) { - value.Error.message = value.Error.message ?? value.Error.Message; + return dateVal; + }, "parseDateValue"); + var parseMilliseconds = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return 0; } - return value; - }; - loadRestXmlErrorCode = (output, data) => { - if (data?.Error?.Code !== void 0) { - return data.Error.Code; + return strictParseFloat32("0." + value) * 1e3; + }, "parseMilliseconds"); + var parseOffsetToMilliseconds = /* @__PURE__ */ __name((value) => { + const directionStr = value[0]; + let direction = 1; + if (directionStr == "+") { + direction = 1; + } else if (directionStr == "-") { + direction = -1; + } else { + throw new TypeError(`Offset direction, ${directionStr}, must be "+" or "-"`); } - if (data?.Code !== void 0) { - return data.Code; + const hour = Number(value.substring(1, 3)); + const minute = Number(value.substring(4, 6)); + return direction * (hour * 60 + minute) * 60 * 1e3; + }, "parseOffsetToMilliseconds"); + var stripLeadingZeroes = /* @__PURE__ */ __name((value) => { + let idx = 0; + while (idx < value.length - 1 && value.charAt(idx) === "0") { + idx++; } - if (output.statusCode == 404) { - return "NotFound"; + if (idx === 0) { + return value; + } + return value.slice(idx); + }, "stripLeadingZeroes"); + var _ServiceException = class _ServiceException2 extends Error { + constructor(options) { + super(options.message); + Object.setPrototypeOf(this, _ServiceException2.prototype); + this.name = options.name; + this.$fault = options.$fault; + this.$metadata = options.$metadata; } }; - } -}); - -// ../../../node_modules/@aws-sdk/core/dist-es/submodules/protocols/index.js -var init_protocols = __esm({ - "../../../node_modules/@aws-sdk/core/dist-es/submodules/protocols/index.js"() { - init_coercing_serializers(); - init_awsExpectUnion(); - init_parseJsonBody(); - init_parseXmlBody(); - } -}); - -// ../../../node_modules/@aws-sdk/core/dist-es/index.js -var dist_es_exports2 = {}; -__export(dist_es_exports2, { - AWSSDKSigV4Signer: () => AWSSDKSigV4Signer, - AwsSdkSigV4ASigner: () => AwsSdkSigV4ASigner, - AwsSdkSigV4Signer: () => AwsSdkSigV4Signer, - NODE_SIGV4A_CONFIG_OPTIONS: () => NODE_SIGV4A_CONFIG_OPTIONS, - _toBool: () => _toBool, - _toNum: () => _toNum, - _toStr: () => _toStr, - awsExpectUnion: () => awsExpectUnion, - emitWarningIfUnsupportedVersion: () => emitWarningIfUnsupportedVersion, - loadRestJsonErrorCode: () => loadRestJsonErrorCode, - loadRestXmlErrorCode: () => loadRestXmlErrorCode, - parseJsonBody: () => parseJsonBody, - parseJsonErrorBody: () => parseJsonErrorBody, - parseXmlBody: () => parseXmlBody, - parseXmlErrorBody: () => parseXmlErrorBody, - resolveAWSSDKSigV4Config: () => resolveAWSSDKSigV4Config, - resolveAwsSdkSigV4AConfig: () => resolveAwsSdkSigV4AConfig, - resolveAwsSdkSigV4Config: () => resolveAwsSdkSigV4Config, - validateSigningProperties: () => validateSigningProperties -}); -var init_dist_es2 = __esm({ - "../../../node_modules/@aws-sdk/core/dist-es/index.js"() { - init_client(); - init_httpAuthSchemes2(); - init_protocols(); - } -}); - -// ../../../node_modules/@aws-sdk/client-sfn/dist-cjs/auth/httpAuthSchemeProvider.js -var require_httpAuthSchemeProvider = __commonJS({ - "../../../node_modules/@aws-sdk/client-sfn/dist-cjs/auth/httpAuthSchemeProvider.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.resolveHttpAuthSchemeConfig = exports2.defaultSFNHttpAuthSchemeProvider = exports2.defaultSFNHttpAuthSchemeParametersProvider = void 0; - var core_1 = (init_dist_es2(), __toCommonJS(dist_es_exports2)); - var util_middleware_1 = require_dist_cjs10(); - var defaultSFNHttpAuthSchemeParametersProvider = async (config, context, input) => { + __name(_ServiceException, "ServiceException"); + var ServiceException = _ServiceException; + var decorateServiceException = /* @__PURE__ */ __name((exception, additions = {}) => { + Object.entries(additions).filter(([, v]) => v !== void 0).forEach(([k, v]) => { + if (exception[k] == void 0 || exception[k] === "") { + exception[k] = v; + } + }); + const message = exception.message || exception.Message || "UnknownError"; + exception.message = message; + delete exception.Message; + return exception; + }, "decorateServiceException"); + var throwDefaultError = /* @__PURE__ */ __name(({ output, parsedBody, exceptionCtor, errorCode }) => { + const $metadata = deserializeMetadata(output); + const statusCode = $metadata.httpStatusCode ? $metadata.httpStatusCode + "" : void 0; + const response = new exceptionCtor({ + name: (parsedBody == null ? void 0 : parsedBody.code) || (parsedBody == null ? void 0 : parsedBody.Code) || errorCode || statusCode || "UnknownError", + $fault: "client", + $metadata + }); + throw decorateServiceException(response, parsedBody); + }, "throwDefaultError"); + var withBaseException = /* @__PURE__ */ __name((ExceptionCtor) => { + return ({ output, parsedBody, errorCode }) => { + throwDefaultError({ output, parsedBody, exceptionCtor: ExceptionCtor, errorCode }); + }; + }, "withBaseException"); + var deserializeMetadata = /* @__PURE__ */ __name((output) => ({ + httpStatusCode: output.statusCode, + requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], + extendedRequestId: output.headers["x-amz-id-2"], + cfId: output.headers["x-amz-cf-id"] + }), "deserializeMetadata"); + var loadConfigsForDefaultMode = /* @__PURE__ */ __name((mode) => { + switch (mode) { + case "standard": + return { + retryMode: "standard", + connectionTimeout: 3100 + }; + case "in-region": + return { + retryMode: "standard", + connectionTimeout: 1100 + }; + case "cross-region": + return { + retryMode: "standard", + connectionTimeout: 3100 + }; + case "mobile": + return { + retryMode: "standard", + connectionTimeout: 3e4 + }; + default: + return {}; + } + }, "loadConfigsForDefaultMode"); + var warningEmitted2 = false; + var emitWarningIfUnsupportedVersion2 = /* @__PURE__ */ __name((version2) => { + if (version2 && !warningEmitted2 && parseInt(version2.substring(1, version2.indexOf("."))) < 16) { + warningEmitted2 = true; + } + }, "emitWarningIfUnsupportedVersion"); + var getChecksumConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + const checksumAlgorithms = []; + for (const id in import_types5.AlgorithmId) { + const algorithmId = import_types5.AlgorithmId[id]; + if (runtimeConfig[algorithmId] === void 0) { + continue; + } + checksumAlgorithms.push({ + algorithmId: () => algorithmId, + checksumConstructor: () => runtimeConfig[algorithmId] + }); + } return { - operation: (0, util_middleware_1.getSmithyContext)(context).operation, - region: await (0, util_middleware_1.normalizeProvider)(config.region)() || (() => { - throw new Error("expected `region` to be configured for `aws.auth#sigv4`"); - })() + _checksumAlgorithms: checksumAlgorithms, + addChecksumAlgorithm(algo) { + this._checksumAlgorithms.push(algo); + }, + checksumAlgorithms() { + return this._checksumAlgorithms; + } }; - }; - exports2.defaultSFNHttpAuthSchemeParametersProvider = defaultSFNHttpAuthSchemeParametersProvider; - function createAwsAuthSigv4HttpAuthOption(authParameters) { + }, "getChecksumConfiguration"); + var resolveChecksumRuntimeConfig = /* @__PURE__ */ __name((clientConfig) => { + const runtimeConfig = {}; + clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => { + runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor(); + }); + return runtimeConfig; + }, "resolveChecksumRuntimeConfig"); + var getRetryConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + let _retryStrategy = runtimeConfig.retryStrategy; return { - schemeId: "aws.auth#sigv4", - signingProperties: { - name: "states", - region: authParameters.region + setRetryStrategy(retryStrategy) { + _retryStrategy = retryStrategy; }, - propertiesExtractor: (config, context) => ({ - signingProperties: { - config, - context - } - }) - }; - } - var defaultSFNHttpAuthSchemeProvider = (authParameters) => { - const options = []; - switch (authParameters.operation) { - default: { - options.push(createAwsAuthSigv4HttpAuthOption(authParameters)); + retryStrategy() { + return _retryStrategy; } - } - return options; - }; - exports2.defaultSFNHttpAuthSchemeProvider = defaultSFNHttpAuthSchemeProvider; - var resolveHttpAuthSchemeConfig = (config) => { - const config_0 = (0, core_1.resolveAwsSdkSigV4Config)(config); + }; + }, "getRetryConfiguration"); + var resolveRetryRuntimeConfig = /* @__PURE__ */ __name((retryStrategyConfiguration) => { + const runtimeConfig = {}; + runtimeConfig.retryStrategy = retryStrategyConfiguration.retryStrategy(); + return runtimeConfig; + }, "resolveRetryRuntimeConfig"); + var getDefaultExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { return { - ...config_0 + ...getChecksumConfiguration(runtimeConfig), + ...getRetryConfiguration(runtimeConfig) }; - }; - exports2.resolveHttpAuthSchemeConfig = resolveHttpAuthSchemeConfig; - } -}); - -// ../../../node_modules/tslib/tslib.es6.mjs -var tslib_es6_exports = {}; -__export(tslib_es6_exports, { - __addDisposableResource: () => __addDisposableResource, - __assign: () => __assign, - __asyncDelegator: () => __asyncDelegator, - __asyncGenerator: () => __asyncGenerator, - __asyncValues: () => __asyncValues, - __await: () => __await, - __awaiter: () => __awaiter, - __classPrivateFieldGet: () => __classPrivateFieldGet, - __classPrivateFieldIn: () => __classPrivateFieldIn, - __classPrivateFieldSet: () => __classPrivateFieldSet, - __createBinding: () => __createBinding, - __decorate: () => __decorate, - __disposeResources: () => __disposeResources, - __esDecorate: () => __esDecorate, - __exportStar: () => __exportStar, - __extends: () => __extends, - __generator: () => __generator, - __importDefault: () => __importDefault, - __importStar: () => __importStar, - __makeTemplateObject: () => __makeTemplateObject, - __metadata: () => __metadata, - __param: () => __param, - __propKey: () => __propKey, - __read: () => __read, - __rest: () => __rest, - __runInitializers: () => __runInitializers, - __setFunctionName: () => __setFunctionName, - __spread: () => __spread, - __spreadArray: () => __spreadArray, - __spreadArrays: () => __spreadArrays, - __values: () => __values, - default: () => tslib_es6_default -}); -function __extends(d, b) { - if (typeof b !== "function" && b !== null) - throw new TypeError("Class extends value " + String(b) + " is not a constructor or null"); - extendStatics(d, b); - function __() { - this.constructor = d; - } - d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __()); -} -function __rest(s, e) { - var t = {}; - for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0) - t[p] = s[p]; - if (s != null && typeof Object.getOwnPropertySymbols === "function") - for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++) { - if (e.indexOf(p[i]) < 0 && Object.prototype.propertyIsEnumerable.call(s, p[i])) - t[p[i]] = s[p[i]]; - } - return t; -} -function __decorate(decorators, target, key, desc) { - var c = arguments.length, r = c < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d; - if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r = Reflect.decorate(decorators, target, key, desc); - else for (var i = decorators.length - 1; i >= 0; i--) if (d = decorators[i]) r = (c < 3 ? d(r) : c > 3 ? d(target, key, r) : d(target, key)) || r; - return c > 3 && r && Object.defineProperty(target, key, r), r; -} -function __param(paramIndex, decorator) { - return function(target, key) { - decorator(target, key, paramIndex); - }; -} -function __esDecorate(ctor, descriptorIn, decorators, contextIn, initializers, extraInitializers) { - function accept(f) { - if (f !== void 0 && typeof f !== "function") throw new TypeError("Function expected"); - return f; - } - var kind = contextIn.kind, key = kind === "getter" ? "get" : kind === "setter" ? "set" : "value"; - var target = !descriptorIn && ctor ? contextIn["static"] ? ctor : ctor.prototype : null; - var descriptor = descriptorIn || (target ? Object.getOwnPropertyDescriptor(target, contextIn.name) : {}); - var _, done = false; - for (var i = decorators.length - 1; i >= 0; i--) { - var context = {}; - for (var p in contextIn) context[p] = p === "access" ? {} : contextIn[p]; - for (var p in contextIn.access) context.access[p] = contextIn.access[p]; - context.addInitializer = function(f) { - if (done) throw new TypeError("Cannot add initializers after decoration has completed"); - extraInitializers.push(accept(f || null)); - }; - var result = (0, decorators[i])(kind === "accessor" ? { get: descriptor.get, set: descriptor.set } : descriptor[key], context); - if (kind === "accessor") { - if (result === void 0) continue; - if (result === null || typeof result !== "object") throw new TypeError("Object expected"); - if (_ = accept(result.get)) descriptor.get = _; - if (_ = accept(result.set)) descriptor.set = _; - if (_ = accept(result.init)) initializers.unshift(_); - } else if (_ = accept(result)) { - if (kind === "field") initializers.unshift(_); - else descriptor[key] = _; - } - } - if (target) Object.defineProperty(target, contextIn.name, descriptor); - done = true; -} -function __runInitializers(thisArg, initializers, value) { - var useValue = arguments.length > 2; - for (var i = 0; i < initializers.length; i++) { - value = useValue ? initializers[i].call(thisArg, value) : initializers[i].call(thisArg); - } - return useValue ? value : void 0; -} -function __propKey(x) { - return typeof x === "symbol" ? x : "".concat(x); -} -function __setFunctionName(f, name, prefix) { - if (typeof name === "symbol") name = name.description ? "[".concat(name.description, "]") : ""; - return Object.defineProperty(f, "name", { configurable: true, value: prefix ? "".concat(prefix, " ", name) : name }); -} -function __metadata(metadataKey, metadataValue) { - if (typeof Reflect === "object" && typeof Reflect.metadata === "function") return Reflect.metadata(metadataKey, metadataValue); -} -function __awaiter(thisArg, _arguments, P, generator) { - function adopt(value) { - return value instanceof P ? value : new P(function(resolve) { - resolve(value); + }, "getDefaultExtensionConfiguration"); + var getDefaultClientConfiguration = getDefaultExtensionConfiguration; + var resolveDefaultRuntimeConfig = /* @__PURE__ */ __name((config) => { + return { + ...resolveChecksumRuntimeConfig(config), + ...resolveRetryRuntimeConfig(config) + }; + }, "resolveDefaultRuntimeConfig"); + var getArrayIfSingleItem = /* @__PURE__ */ __name((mayBeArray) => Array.isArray(mayBeArray) ? mayBeArray : [mayBeArray], "getArrayIfSingleItem"); + var getValueFromTextNode2 = /* @__PURE__ */ __name((obj) => { + const textNodeName = "#text"; + for (const key in obj) { + if (obj.hasOwnProperty(key) && obj[key][textNodeName] !== void 0) { + obj[key] = obj[key][textNodeName]; + } else if (typeof obj[key] === "object" && obj[key] !== null) { + obj[key] = getValueFromTextNode2(obj[key]); + } + } + return obj; + }, "getValueFromTextNode"); + var isSerializableHeaderValue = /* @__PURE__ */ __name((value) => { + return value != null; + }, "isSerializableHeaderValue"); + var StringWrapper = /* @__PURE__ */ __name(function() { + const Class = Object.getPrototypeOf(this).constructor; + const Constructor = Function.bind.apply(String, [null, ...arguments]); + const instance = new Constructor(); + Object.setPrototypeOf(instance, Class.prototype); + return instance; + }, "StringWrapper"); + StringWrapper.prototype = Object.create(String.prototype, { + constructor: { + value: StringWrapper, + enumerable: false, + writable: true, + configurable: true + } }); - } - return new (P || (P = Promise))(function(resolve, reject) { - function fulfilled(value) { - try { - step(generator.next(value)); - } catch (e) { - reject(e); + Object.setPrototypeOf(StringWrapper, String); + var _LazyJsonString = class _LazyJsonString2 extends StringWrapper { + deserializeJSON() { + return JSON.parse(super.toString()); } - } - function rejected(value) { - try { - step(generator["throw"](value)); - } catch (e) { - reject(e); + toJSON() { + return super.toString(); + } + static fromObject(object) { + if (object instanceof _LazyJsonString2) { + return object; + } else if (object instanceof String || typeof object === "string") { + return new _LazyJsonString2(object); + } + return new _LazyJsonString2(JSON.stringify(object)); } - } - function step(result) { - result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); - } - step((generator = generator.apply(thisArg, _arguments || [])).next()); - }); -} -function __generator(thisArg, body) { - var _ = { label: 0, sent: function() { - if (t[0] & 1) throw t[1]; - return t[1]; - }, trys: [], ops: [] }, f, y, t, g = Object.create((typeof Iterator === "function" ? Iterator : Object).prototype); - return g.next = verb(0), g["throw"] = verb(1), g["return"] = verb(2), typeof Symbol === "function" && (g[Symbol.iterator] = function() { - return this; - }), g; - function verb(n) { - return function(v) { - return step([n, v]); }; - } - function step(op) { - if (f) throw new TypeError("Generator is already executing."); - while (g && (g = 0, op[0] && (_ = 0)), _) try { - if (f = 1, y && (t = op[0] & 2 ? y["return"] : op[0] ? y["throw"] || ((t = y["return"]) && t.call(y), 0) : y.next) && !(t = t.call(y, op[1])).done) return t; - if (y = 0, t) op = [op[0] & 2, t.value]; - switch (op[0]) { - case 0: - case 1: - t = op; - break; - case 4: - _.label++; - return { value: op[1], done: false }; - case 5: - _.label++; - y = op[1]; - op = [0]; - continue; - case 7: - op = _.ops.pop(); - _.trys.pop(); + __name(_LazyJsonString, "LazyJsonString"); + var LazyJsonString = _LazyJsonString; + var _NoOpLogger = class _NoOpLogger { + trace() { + } + debug() { + } + info() { + } + warn() { + } + error() { + } + }; + __name(_NoOpLogger, "NoOpLogger"); + var NoOpLogger = _NoOpLogger; + function map(arg0, arg1, arg2) { + let target; + let filter; + let instructions; + if (typeof arg1 === "undefined" && typeof arg2 === "undefined") { + target = {}; + instructions = arg0; + } else { + target = arg0; + if (typeof arg1 === "function") { + filter = arg1; + instructions = arg2; + return mapWithFilter(target, filter, instructions); + } else { + instructions = arg1; + } + } + for (const key of Object.keys(instructions)) { + if (!Array.isArray(instructions[key])) { + target[key] = instructions[key]; continue; + } + applyInstruction(target, null, instructions, key); + } + return target; + } + __name(map, "map"); + var convertMap = /* @__PURE__ */ __name((target) => { + const output = {}; + for (const [k, v] of Object.entries(target || {})) { + output[k] = [, v]; + } + return output; + }, "convertMap"); + var take = /* @__PURE__ */ __name((source, instructions) => { + const out = {}; + for (const key in instructions) { + applyInstruction(out, source, instructions, key); + } + return out; + }, "take"); + var mapWithFilter = /* @__PURE__ */ __name((target, filter, instructions) => { + return map( + target, + Object.entries(instructions).reduce( + (_instructions, [key, value]) => { + if (Array.isArray(value)) { + _instructions[key] = value; + } else { + if (typeof value === "function") { + _instructions[key] = [filter, value()]; + } else { + _instructions[key] = [filter, value]; + } + } + return _instructions; + }, + {} + ) + ); + }, "mapWithFilter"); + var applyInstruction = /* @__PURE__ */ __name((target, source, instructions, targetKey) => { + if (source !== null) { + let instruction = instructions[targetKey]; + if (typeof instruction === "function") { + instruction = [, instruction]; + } + const [filter2 = nonNullish, valueFn = pass, sourceKey = targetKey] = instruction; + if (typeof filter2 === "function" && filter2(source[sourceKey]) || typeof filter2 !== "function" && !!filter2) { + target[targetKey] = valueFn(source[sourceKey]); + } + return; + } + let [filter, value] = instructions[targetKey]; + if (typeof value === "function") { + let _value; + const defaultFilterPassed = filter === void 0 && (_value = value()) != null; + const customFilterPassed = typeof filter === "function" && !!filter(void 0) || typeof filter !== "function" && !!filter; + if (defaultFilterPassed) { + target[targetKey] = _value; + } else if (customFilterPassed) { + target[targetKey] = value(); + } + } else { + const defaultFilterPassed = filter === void 0 && value != null; + const customFilterPassed = typeof filter === "function" && !!filter(value) || typeof filter !== "function" && !!filter; + if (defaultFilterPassed || customFilterPassed) { + target[targetKey] = value; + } + } + }, "applyInstruction"); + var nonNullish = /* @__PURE__ */ __name((_) => _ != null, "nonNullish"); + var pass = /* @__PURE__ */ __name((_) => _, "pass"); + function quoteHeader(part) { + if (part.includes(",") || part.includes('"')) { + part = `"${part.replace(/"/g, '\\"')}"`; + } + return part; + } + __name(quoteHeader, "quoteHeader"); + var serializeFloat = /* @__PURE__ */ __name((value) => { + if (value !== value) { + return "NaN"; + } + switch (value) { + case Infinity: + return "Infinity"; + case -Infinity: + return "-Infinity"; default: - if (!(t = _.trys, t = t.length > 0 && t[t.length - 1]) && (op[0] === 6 || op[0] === 2)) { - _ = 0; + return value; + } + }, "serializeFloat"); + var serializeDateTime = /* @__PURE__ */ __name((date) => date.toISOString().replace(".000Z", "Z"), "serializeDateTime"); + var _json = /* @__PURE__ */ __name((obj) => { + if (obj == null) { + return {}; + } + if (Array.isArray(obj)) { + return obj.filter((_) => _ != null).map(_json); + } + if (typeof obj === "object") { + const target = {}; + for (const key of Object.keys(obj)) { + if (obj[key] == null) { continue; } - if (op[0] === 3 && (!t || op[1] > t[0] && op[1] < t[3])) { - _.label = op[1]; - break; - } - if (op[0] === 6 && _.label < t[1]) { - _.label = t[1]; - t = op; + target[key] = _json(obj[key]); + } + return target; + } + return obj; + }, "_json"); + function splitEvery(value, delimiter, numDelimiters) { + if (numDelimiters <= 0 || !Number.isInteger(numDelimiters)) { + throw new Error("Invalid number of delimiters (" + numDelimiters + ") for splitEvery."); + } + const segments = value.split(delimiter); + if (numDelimiters === 1) { + return segments; + } + const compoundSegments = []; + let currentSegment = ""; + for (let i = 0; i < segments.length; i++) { + if (currentSegment === "") { + currentSegment = segments[i]; + } else { + currentSegment += delimiter + segments[i]; + } + if ((i + 1) % numDelimiters === 0) { + compoundSegments.push(currentSegment); + currentSegment = ""; + } + } + if (currentSegment !== "") { + compoundSegments.push(currentSegment); + } + return compoundSegments; + } + __name(splitEvery, "splitEvery"); + var splitHeader = /* @__PURE__ */ __name((value) => { + const z = value.length; + const values = []; + let withinQuotes = false; + let prevChar = void 0; + let anchor = 0; + for (let i = 0; i < z; ++i) { + const char = value[i]; + switch (char) { + case `"`: + if (prevChar !== "\\") { + withinQuotes = !withinQuotes; + } break; - } - if (t && _.label < t[2]) { - _.label = t[2]; - _.ops.push(op); + case ",": + if (!withinQuotes) { + values.push(value.slice(anchor, i)); + anchor = i + 1; + } break; - } - if (t[2]) _.ops.pop(); - _.trys.pop(); - continue; + default: + } + prevChar = char; } - op = body.call(thisArg, _); - } catch (e) { - op = [6, e]; - y = 0; - } finally { - f = t = 0; - } - if (op[0] & 5) throw op[1]; - return { value: op[0] ? op[1] : void 0, done: true }; - } -} -function __exportStar(m, o) { - for (var p in m) if (p !== "default" && !Object.prototype.hasOwnProperty.call(o, p)) __createBinding(o, m, p); -} -function __values(o) { - var s = typeof Symbol === "function" && Symbol.iterator, m = s && o[s], i = 0; - if (m) return m.call(o); - if (o && typeof o.length === "number") return { - next: function() { - if (o && i >= o.length) o = void 0; - return { value: o && o[i++], done: !o }; - } - }; - throw new TypeError(s ? "Object is not iterable." : "Symbol.iterator is not defined."); -} -function __read(o, n) { - var m = typeof Symbol === "function" && o[Symbol.iterator]; - if (!m) return o; - var i = m.call(o), r, ar = [], e; - try { - while ((n === void 0 || n-- > 0) && !(r = i.next()).done) ar.push(r.value); - } catch (error) { - e = { error }; - } finally { - try { - if (r && !r.done && (m = i["return"])) m.call(i); - } finally { - if (e) throw e.error; - } + values.push(value.slice(anchor)); + return values.map((v) => { + v = v.trim(); + const z2 = v.length; + if (z2 < 2) { + return v; + } + if (v[0] === `"` && v[z2 - 1] === `"`) { + v = v.slice(1, z2 - 1); + } + return v.replace(/\\"/g, '"'); + }); + }, "splitHeader"); } - return ar; -} -function __spread() { - for (var ar = [], i = 0; i < arguments.length; i++) - ar = ar.concat(__read(arguments[i])); - return ar; -} -function __spreadArrays() { - for (var s = 0, i = 0, il = arguments.length; i < il; i++) s += arguments[i].length; - for (var r = Array(s), k = 0, i = 0; i < il; i++) - for (var a = arguments[i], j = 0, jl = a.length; j < jl; j++, k++) - r[k] = a[j]; - return r; -} -function __spreadArray(to, from, pack) { - if (pack || arguments.length === 2) for (var i = 0, l = from.length, ar; i < l; i++) { - if (ar || !(i in from)) { - if (!ar) ar = Array.prototype.slice.call(from, 0, i); - ar[i] = from[i]; - } +}); + +// ../../../node_modules/@smithy/middleware-retry/dist-cjs/isStreamingPayload/isStreamingPayload.js +var require_isStreamingPayload = __commonJS({ + "../../../node_modules/@smithy/middleware-retry/dist-cjs/isStreamingPayload/isStreamingPayload.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.isStreamingPayload = void 0; + var stream_1 = require("stream"); + var isStreamingPayload = (request2) => (request2 === null || request2 === void 0 ? void 0 : request2.body) instanceof stream_1.Readable || typeof ReadableStream !== "undefined" && (request2 === null || request2 === void 0 ? void 0 : request2.body) instanceof ReadableStream; + exports2.isStreamingPayload = isStreamingPayload; } - return to.concat(ar || Array.prototype.slice.call(from)); -} -function __await(v) { - return this instanceof __await ? (this.v = v, this) : new __await(v); -} -function __asyncGenerator(thisArg, _arguments, generator) { - if (!Symbol.asyncIterator) throw new TypeError("Symbol.asyncIterator is not defined."); - var g = generator.apply(thisArg, _arguments || []), i, q = []; - return i = Object.create((typeof AsyncIterator === "function" ? AsyncIterator : Object).prototype), verb("next"), verb("throw"), verb("return", awaitReturn), i[Symbol.asyncIterator] = function() { - return this; - }, i; - function awaitReturn(f) { - return function(v) { - return Promise.resolve(v).then(f, reject); +}); + +// ../../../node_modules/@smithy/middleware-retry/dist-cjs/index.js +var require_dist_cjs34 = __commonJS({ + "../../../node_modules/@smithy/middleware-retry/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + AdaptiveRetryStrategy: () => AdaptiveRetryStrategy, + CONFIG_MAX_ATTEMPTS: () => CONFIG_MAX_ATTEMPTS, + CONFIG_RETRY_MODE: () => CONFIG_RETRY_MODE, + ENV_MAX_ATTEMPTS: () => ENV_MAX_ATTEMPTS, + ENV_RETRY_MODE: () => ENV_RETRY_MODE, + NODE_MAX_ATTEMPT_CONFIG_OPTIONS: () => NODE_MAX_ATTEMPT_CONFIG_OPTIONS, + NODE_RETRY_MODE_CONFIG_OPTIONS: () => NODE_RETRY_MODE_CONFIG_OPTIONS, + StandardRetryStrategy: () => StandardRetryStrategy, + defaultDelayDecider: () => defaultDelayDecider, + defaultRetryDecider: () => defaultRetryDecider, + getOmitRetryHeadersPlugin: () => getOmitRetryHeadersPlugin, + getRetryAfterHint: () => getRetryAfterHint, + getRetryPlugin: () => getRetryPlugin, + omitRetryHeadersMiddleware: () => omitRetryHeadersMiddleware, + omitRetryHeadersMiddlewareOptions: () => omitRetryHeadersMiddlewareOptions, + resolveRetryConfig: () => resolveRetryConfig, + retryMiddleware: () => retryMiddleware, + retryMiddlewareOptions: () => retryMiddlewareOptions + }); + module2.exports = __toCommonJS2(src_exports); + var import_protocol_http8 = require_dist_cjs2(); + var import_uuid = (init_esm_node(), __toCommonJS(esm_node_exports)); + var import_util_retry = require_dist_cjs31(); + var getDefaultRetryQuota = /* @__PURE__ */ __name((initialRetryTokens, options) => { + const MAX_CAPACITY = initialRetryTokens; + const noRetryIncrement = (options == null ? void 0 : options.noRetryIncrement) ?? import_util_retry.NO_RETRY_INCREMENT; + const retryCost = (options == null ? void 0 : options.retryCost) ?? import_util_retry.RETRY_COST; + const timeoutRetryCost = (options == null ? void 0 : options.timeoutRetryCost) ?? import_util_retry.TIMEOUT_RETRY_COST; + let availableCapacity = initialRetryTokens; + const getCapacityAmount = /* @__PURE__ */ __name((error) => error.name === "TimeoutError" ? timeoutRetryCost : retryCost, "getCapacityAmount"); + const hasRetryTokens = /* @__PURE__ */ __name((error) => getCapacityAmount(error) <= availableCapacity, "hasRetryTokens"); + const retrieveRetryTokens = /* @__PURE__ */ __name((error) => { + if (!hasRetryTokens(error)) { + throw new Error("No retry token available"); + } + const capacityAmount = getCapacityAmount(error); + availableCapacity -= capacityAmount; + return capacityAmount; + }, "retrieveRetryTokens"); + const releaseRetryTokens = /* @__PURE__ */ __name((capacityReleaseAmount) => { + availableCapacity += capacityReleaseAmount ?? noRetryIncrement; + availableCapacity = Math.min(availableCapacity, MAX_CAPACITY); + }, "releaseRetryTokens"); + return Object.freeze({ + hasRetryTokens, + retrieveRetryTokens, + releaseRetryTokens + }); + }, "getDefaultRetryQuota"); + var defaultDelayDecider = /* @__PURE__ */ __name((delayBase, attempts) => Math.floor(Math.min(import_util_retry.MAXIMUM_RETRY_DELAY, Math.random() * 2 ** attempts * delayBase)), "defaultDelayDecider"); + var import_service_error_classification = require_dist_cjs30(); + var defaultRetryDecider = /* @__PURE__ */ __name((error) => { + if (!error) { + return false; + } + return (0, import_service_error_classification.isRetryableByTrait)(error) || (0, import_service_error_classification.isClockSkewError)(error) || (0, import_service_error_classification.isThrottlingError)(error) || (0, import_service_error_classification.isTransientError)(error); + }, "defaultRetryDecider"); + var asSdkError = /* @__PURE__ */ __name((error) => { + if (error instanceof Error) + return error; + if (error instanceof Object) + return Object.assign(new Error(), error); + if (typeof error === "string") + return new Error(error); + return new Error(`AWS SDK error wrapper for ${error}`); + }, "asSdkError"); + var _StandardRetryStrategy = class _StandardRetryStrategy { + constructor(maxAttemptsProvider, options) { + this.maxAttemptsProvider = maxAttemptsProvider; + this.mode = import_util_retry.RETRY_MODES.STANDARD; + this.retryDecider = (options == null ? void 0 : options.retryDecider) ?? defaultRetryDecider; + this.delayDecider = (options == null ? void 0 : options.delayDecider) ?? defaultDelayDecider; + this.retryQuota = (options == null ? void 0 : options.retryQuota) ?? getDefaultRetryQuota(import_util_retry.INITIAL_RETRY_TOKENS); + } + shouldRetry(error, attempts, maxAttempts) { + return attempts < maxAttempts && this.retryDecider(error) && this.retryQuota.hasRetryTokens(error); + } + async getMaxAttempts() { + let maxAttempts; + try { + maxAttempts = await this.maxAttemptsProvider(); + } catch (error) { + maxAttempts = import_util_retry.DEFAULT_MAX_ATTEMPTS; + } + return maxAttempts; + } + async retry(next, args, options) { + let retryTokenAmount; + let attempts = 0; + let totalDelay = 0; + const maxAttempts = await this.getMaxAttempts(); + const { request: request2 } = args; + if (import_protocol_http8.HttpRequest.isInstance(request2)) { + request2.headers[import_util_retry.INVOCATION_ID_HEADER] = (0, import_uuid.v4)(); + } + while (true) { + try { + if (import_protocol_http8.HttpRequest.isInstance(request2)) { + request2.headers[import_util_retry.REQUEST_HEADER] = `attempt=${attempts + 1}; max=${maxAttempts}`; + } + if (options == null ? void 0 : options.beforeRequest) { + await options.beforeRequest(); + } + const { response, output } = await next(args); + if (options == null ? void 0 : options.afterRequest) { + options.afterRequest(response); + } + this.retryQuota.releaseRetryTokens(retryTokenAmount); + output.$metadata.attempts = attempts + 1; + output.$metadata.totalRetryDelay = totalDelay; + return { response, output }; + } catch (e) { + const err = asSdkError(e); + attempts++; + if (this.shouldRetry(err, attempts, maxAttempts)) { + retryTokenAmount = this.retryQuota.retrieveRetryTokens(err); + const delayFromDecider = this.delayDecider( + (0, import_service_error_classification.isThrottlingError)(err) ? import_util_retry.THROTTLING_RETRY_DELAY_BASE : import_util_retry.DEFAULT_RETRY_DELAY_BASE, + attempts + ); + const delayFromResponse = getDelayFromRetryAfterHeader(err.$response); + const delay = Math.max(delayFromResponse || 0, delayFromDecider); + totalDelay += delay; + await new Promise((resolve) => setTimeout(resolve, delay)); + continue; + } + if (!err.$metadata) { + err.$metadata = {}; + } + err.$metadata.attempts = attempts; + err.$metadata.totalRetryDelay = totalDelay; + throw err; + } + } + } }; - } - function verb(n, f) { - if (g[n]) { - i[n] = function(v) { - return new Promise(function(a, b) { - q.push([n, v, a, b]) > 1 || resume(n, v); + __name(_StandardRetryStrategy, "StandardRetryStrategy"); + var StandardRetryStrategy = _StandardRetryStrategy; + var getDelayFromRetryAfterHeader = /* @__PURE__ */ __name((response) => { + if (!import_protocol_http8.HttpResponse.isInstance(response)) + return; + const retryAfterHeaderName = Object.keys(response.headers).find((key) => key.toLowerCase() === "retry-after"); + if (!retryAfterHeaderName) + return; + const retryAfter = response.headers[retryAfterHeaderName]; + const retryAfterSeconds = Number(retryAfter); + if (!Number.isNaN(retryAfterSeconds)) + return retryAfterSeconds * 1e3; + const retryAfterDate = new Date(retryAfter); + return retryAfterDate.getTime() - Date.now(); + }, "getDelayFromRetryAfterHeader"); + var _AdaptiveRetryStrategy = class _AdaptiveRetryStrategy extends StandardRetryStrategy { + constructor(maxAttemptsProvider, options) { + const { rateLimiter, ...superOptions } = options ?? {}; + super(maxAttemptsProvider, superOptions); + this.rateLimiter = rateLimiter ?? new import_util_retry.DefaultRateLimiter(); + this.mode = import_util_retry.RETRY_MODES.ADAPTIVE; + } + async retry(next, args) { + return super.retry(next, args, { + beforeRequest: async () => { + return this.rateLimiter.getSendToken(); + }, + afterRequest: (response) => { + this.rateLimiter.updateClientSendingRate(response); + } }); - }; - if (f) i[n] = f(i[n]); - } - } - function resume(n, v) { - try { - step(g[n](v)); - } catch (e) { - settle(q[0][3], e); - } - } - function step(r) { - r.value instanceof __await ? Promise.resolve(r.value.v).then(fulfill, reject) : settle(q[0][2], r); - } - function fulfill(value) { - resume("next", value); - } - function reject(value) { - resume("throw", value); - } - function settle(f, v) { - if (f(v), q.shift(), q.length) resume(q[0][0], q[0][1]); - } -} -function __asyncDelegator(o) { - var i, p; - return i = {}, verb("next"), verb("throw", function(e) { - throw e; - }), verb("return"), i[Symbol.iterator] = function() { - return this; - }, i; - function verb(n, f) { - i[n] = o[n] ? function(v) { - return (p = !p) ? { value: __await(o[n](v)), done: false } : f ? f(v) : v; - } : f; - } -} -function __asyncValues(o) { - if (!Symbol.asyncIterator) throw new TypeError("Symbol.asyncIterator is not defined."); - var m = o[Symbol.asyncIterator], i; - return m ? m.call(o) : (o = typeof __values === "function" ? __values(o) : o[Symbol.iterator](), i = {}, verb("next"), verb("throw"), verb("return"), i[Symbol.asyncIterator] = function() { - return this; - }, i); - function verb(n) { - i[n] = o[n] && function(v) { - return new Promise(function(resolve, reject) { - v = o[n](v), settle(resolve, reject, v.done, v.value); - }); - }; - } - function settle(resolve, reject, d, v) { - Promise.resolve(v).then(function(v2) { - resolve({ value: v2, done: d }); - }, reject); - } -} -function __makeTemplateObject(cooked, raw) { - if (Object.defineProperty) { - Object.defineProperty(cooked, "raw", { value: raw }); - } else { - cooked.raw = raw; - } - return cooked; -} -function __importStar(mod) { - if (mod && mod.__esModule) return mod; - var result = {}; - if (mod != null) { - for (var k in mod) if (k !== "default" && Object.prototype.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k); - } - __setModuleDefault(result, mod); - return result; -} -function __importDefault(mod) { - return mod && mod.__esModule ? mod : { default: mod }; -} -function __classPrivateFieldGet(receiver, state, kind, f) { - if (kind === "a" && !f) throw new TypeError("Private accessor was defined without a getter"); - if (typeof state === "function" ? receiver !== state || !f : !state.has(receiver)) throw new TypeError("Cannot read private member from an object whose class did not declare it"); - return kind === "m" ? f : kind === "a" ? f.call(receiver) : f ? f.value : state.get(receiver); -} -function __classPrivateFieldSet(receiver, state, value, kind, f) { - if (kind === "m") throw new TypeError("Private method is not writable"); - if (kind === "a" && !f) throw new TypeError("Private accessor was defined without a setter"); - if (typeof state === "function" ? receiver !== state || !f : !state.has(receiver)) throw new TypeError("Cannot write private member to an object whose class did not declare it"); - return kind === "a" ? f.call(receiver, value) : f ? f.value = value : state.set(receiver, value), value; -} -function __classPrivateFieldIn(state, receiver) { - if (receiver === null || typeof receiver !== "object" && typeof receiver !== "function") throw new TypeError("Cannot use 'in' operator on non-object"); - return typeof state === "function" ? receiver === state : state.has(receiver); -} -function __addDisposableResource(env, value, async) { - if (value !== null && value !== void 0) { - if (typeof value !== "object" && typeof value !== "function") throw new TypeError("Object expected."); - var dispose, inner; - if (async) { - if (!Symbol.asyncDispose) throw new TypeError("Symbol.asyncDispose is not defined."); - dispose = value[Symbol.asyncDispose]; - } - if (dispose === void 0) { - if (!Symbol.dispose) throw new TypeError("Symbol.dispose is not defined."); - dispose = value[Symbol.dispose]; - if (async) inner = dispose; - } - if (typeof dispose !== "function") throw new TypeError("Object not disposable."); - if (inner) dispose = function() { - try { - inner.call(this); - } catch (e) { - return Promise.reject(e); } }; - env.stack.push({ value, dispose, async }); - } else if (async) { - env.stack.push({ async: true }); - } - return value; -} -function __disposeResources(env) { - function fail(e) { - env.error = env.hasError ? new _SuppressedError(e, env.error, "An error was suppressed during disposal.") : e; - env.hasError = true; - } - var r, s = 0; - function next() { - while (r = env.stack.pop()) { - try { - if (!r.async && s === 1) return s = 0, env.stack.push(r), Promise.resolve().then(next); - if (r.dispose) { - var result = r.dispose.call(r.value); - if (r.async) return s |= 2, Promise.resolve(result).then(next, function(e) { - fail(e); - return next(); - }); - } else s |= 1; - } catch (e) { - fail(e); - } - } - if (s === 1) return env.hasError ? Promise.reject(env.error) : Promise.resolve(); - if (env.hasError) throw env.error; - } - return next(); -} -var extendStatics, __assign, __createBinding, __setModuleDefault, _SuppressedError, tslib_es6_default; -var init_tslib_es6 = __esm({ - "../../../node_modules/tslib/tslib.es6.mjs"() { - extendStatics = function(d, b) { - extendStatics = Object.setPrototypeOf || { __proto__: [] } instanceof Array && function(d2, b2) { - d2.__proto__ = b2; - } || function(d2, b2) { - for (var p in b2) if (Object.prototype.hasOwnProperty.call(b2, p)) d2[p] = b2[p]; - }; - return extendStatics(d, b); + __name(_AdaptiveRetryStrategy, "AdaptiveRetryStrategy"); + var AdaptiveRetryStrategy = _AdaptiveRetryStrategy; + var import_util_middleware3 = require_dist_cjs10(); + var ENV_MAX_ATTEMPTS = "AWS_MAX_ATTEMPTS"; + var CONFIG_MAX_ATTEMPTS = "max_attempts"; + var NODE_MAX_ATTEMPT_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => { + const value = env[ENV_MAX_ATTEMPTS]; + if (!value) + return void 0; + const maxAttempt = parseInt(value); + if (Number.isNaN(maxAttempt)) { + throw new Error(`Environment variable ${ENV_MAX_ATTEMPTS} mast be a number, got "${value}"`); + } + return maxAttempt; + }, + configFileSelector: (profile) => { + const value = profile[CONFIG_MAX_ATTEMPTS]; + if (!value) + return void 0; + const maxAttempt = parseInt(value); + if (Number.isNaN(maxAttempt)) { + throw new Error(`Shared config file entry ${CONFIG_MAX_ATTEMPTS} mast be a number, got "${value}"`); + } + return maxAttempt; + }, + default: import_util_retry.DEFAULT_MAX_ATTEMPTS }; - __assign = function() { - __assign = Object.assign || function __assign2(t) { - for (var s, i = 1, n = arguments.length; i < n; i++) { - s = arguments[i]; - for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p)) t[p] = s[p]; + var resolveRetryConfig = /* @__PURE__ */ __name((input) => { + const { retryStrategy } = input; + const maxAttempts = (0, import_util_middleware3.normalizeProvider)(input.maxAttempts ?? import_util_retry.DEFAULT_MAX_ATTEMPTS); + return { + ...input, + maxAttempts, + retryStrategy: async () => { + if (retryStrategy) { + return retryStrategy; + } + const retryMode = await (0, import_util_middleware3.normalizeProvider)(input.retryMode)(); + if (retryMode === import_util_retry.RETRY_MODES.ADAPTIVE) { + return new import_util_retry.AdaptiveRetryStrategy(maxAttempts); + } + return new import_util_retry.StandardRetryStrategy(maxAttempts); } - return t; }; - return __assign.apply(this, arguments); + }, "resolveRetryConfig"); + var ENV_RETRY_MODE = "AWS_RETRY_MODE"; + var CONFIG_RETRY_MODE = "retry_mode"; + var NODE_RETRY_MODE_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => env[ENV_RETRY_MODE], + configFileSelector: (profile) => profile[CONFIG_RETRY_MODE], + default: import_util_retry.DEFAULT_RETRY_MODE }; - __createBinding = Object.create ? function(o, m, k, k2) { - if (k2 === void 0) k2 = k; - var desc = Object.getOwnPropertyDescriptor(m, k); - if (!desc || ("get" in desc ? !m.__esModule : desc.writable || desc.configurable)) { - desc = { enumerable: true, get: function() { - return m[k]; - } }; + var omitRetryHeadersMiddleware = /* @__PURE__ */ __name(() => (next) => async (args) => { + const { request: request2 } = args; + if (import_protocol_http8.HttpRequest.isInstance(request2)) { + delete request2.headers[import_util_retry.INVOCATION_ID_HEADER]; + delete request2.headers[import_util_retry.REQUEST_HEADER]; } - Object.defineProperty(o, k2, desc); - } : function(o, m, k, k2) { - if (k2 === void 0) k2 = k; - o[k2] = m[k]; - }; - __setModuleDefault = Object.create ? function(o, v) { - Object.defineProperty(o, "default", { enumerable: true, value: v }); - } : function(o, v) { - o["default"] = v; - }; - _SuppressedError = typeof SuppressedError === "function" ? SuppressedError : function(error, suppressed, message) { - var e = new Error(message); - return e.name = "SuppressedError", e.error = error, e.suppressed = suppressed, e; - }; - tslib_es6_default = { - __extends, - __assign, - __rest, - __decorate, - __param, - __metadata, - __awaiter, - __generator, - __createBinding, - __exportStar, - __values, - __read, - __spread, - __spreadArrays, - __spreadArray, - __await, - __asyncGenerator, - __asyncDelegator, - __asyncValues, - __makeTemplateObject, - __importStar, - __importDefault, - __classPrivateFieldGet, - __classPrivateFieldSet, - __classPrivateFieldIn, - __addDisposableResource, - __disposeResources + return next(args); + }, "omitRetryHeadersMiddleware"); + var omitRetryHeadersMiddlewareOptions = { + name: "omitRetryHeadersMiddleware", + tags: ["RETRY", "HEADERS", "OMIT_RETRY_HEADERS"], + relation: "before", + toMiddleware: "awsAuthMiddleware", + override: true }; - } -}); - -// ../../../node_modules/@aws-sdk/client-sfn/package.json -var require_package = __commonJS({ - "../../../node_modules/@aws-sdk/client-sfn/package.json"(exports2, module2) { - module2.exports = { - name: "@aws-sdk/client-sfn", - description: "AWS SDK for JavaScript Sfn Client for Node.js, Browser and React Native", - version: "3.632.0", - scripts: { - build: "concurrently 'yarn:build:cjs' 'yarn:build:es' 'yarn:build:types'", - "build:cjs": "node ../../scripts/compilation/inline client-sfn", - "build:es": "tsc -p tsconfig.es.json", - "build:include:deps": "lerna run --scope $npm_package_name --include-dependencies build", - "build:types": "tsc -p tsconfig.types.json", - "build:types:downlevel": "downlevel-dts dist-types dist-types/ts3.4", - clean: "rimraf ./dist-* && rimraf *.tsbuildinfo", - "extract:docs": "api-extractor run --local", - "generate:client": "node ../../scripts/generate-clients/single-service --solo sfn" - }, - main: "./dist-cjs/index.js", - types: "./dist-types/index.d.ts", - module: "./dist-es/index.js", - sideEffects: false, - dependencies: { - "@aws-crypto/sha256-browser": "5.2.0", - "@aws-crypto/sha256-js": "5.2.0", - "@aws-sdk/client-sso-oidc": "3.632.0", - "@aws-sdk/client-sts": "3.632.0", - "@aws-sdk/core": "3.629.0", - "@aws-sdk/credential-provider-node": "3.632.0", - "@aws-sdk/middleware-host-header": "3.620.0", - "@aws-sdk/middleware-logger": "3.609.0", - "@aws-sdk/middleware-recursion-detection": "3.620.0", - "@aws-sdk/middleware-user-agent": "3.632.0", - "@aws-sdk/region-config-resolver": "3.614.0", - "@aws-sdk/types": "3.609.0", - "@aws-sdk/util-endpoints": "3.632.0", - "@aws-sdk/util-user-agent-browser": "3.609.0", - "@aws-sdk/util-user-agent-node": "3.614.0", - "@smithy/config-resolver": "^3.0.5", - "@smithy/core": "^2.3.2", - "@smithy/fetch-http-handler": "^3.2.4", - "@smithy/hash-node": "^3.0.3", - "@smithy/invalid-dependency": "^3.0.3", - "@smithy/middleware-content-length": "^3.0.5", - "@smithy/middleware-endpoint": "^3.1.0", - "@smithy/middleware-retry": "^3.0.14", - "@smithy/middleware-serde": "^3.0.3", - "@smithy/middleware-stack": "^3.0.3", - "@smithy/node-config-provider": "^3.1.4", - "@smithy/node-http-handler": "^3.1.4", - "@smithy/protocol-http": "^4.1.0", - "@smithy/smithy-client": "^3.1.12", - "@smithy/types": "^3.3.0", - "@smithy/url-parser": "^3.0.3", - "@smithy/util-base64": "^3.0.0", - "@smithy/util-body-length-browser": "^3.0.0", - "@smithy/util-body-length-node": "^3.0.0", - "@smithy/util-defaults-mode-browser": "^3.0.14", - "@smithy/util-defaults-mode-node": "^3.0.14", - "@smithy/util-endpoints": "^2.0.5", - "@smithy/util-middleware": "^3.0.3", - "@smithy/util-retry": "^3.0.3", - "@smithy/util-utf8": "^3.0.0", - tslib: "^2.6.2", - uuid: "^9.0.1" - }, - devDependencies: { - "@tsconfig/node16": "16.1.3", - "@types/node": "^16.18.96", - "@types/uuid": "^9.0.4", - concurrently: "7.0.0", - "downlevel-dts": "0.10.1", - rimraf: "3.0.2", - typescript: "~4.9.5" - }, - engines: { - node: ">=16.0.0" - }, - typesVersions: { - "<4.0": { - "dist-types/*": [ - "dist-types/ts3.4/*" - ] + var getOmitRetryHeadersPlugin = /* @__PURE__ */ __name((options) => ({ + applyToStack: (clientStack) => { + clientStack.addRelativeTo(omitRetryHeadersMiddleware(), omitRetryHeadersMiddlewareOptions); + } + }), "getOmitRetryHeadersPlugin"); + var import_smithy_client4 = require_dist_cjs33(); + var import_isStreamingPayload = require_isStreamingPayload(); + var retryMiddleware = /* @__PURE__ */ __name((options) => (next, context) => async (args) => { + var _a; + let retryStrategy = await options.retryStrategy(); + const maxAttempts = await options.maxAttempts(); + if (isRetryStrategyV2(retryStrategy)) { + retryStrategy = retryStrategy; + let retryToken = await retryStrategy.acquireInitialRetryToken(context["partition_id"]); + let lastError = new Error(); + let attempts = 0; + let totalRetryDelay = 0; + const { request: request2 } = args; + const isRequest = import_protocol_http8.HttpRequest.isInstance(request2); + if (isRequest) { + request2.headers[import_util_retry.INVOCATION_ID_HEADER] = (0, import_uuid.v4)(); } - }, - files: [ - "dist-*/**" - ], - author: { - name: "AWS SDK for JavaScript Team", - url: "https://aws.amazon.com/javascript/" - }, - license: "Apache-2.0", - browser: { - "./dist-es/runtimeConfig": "./dist-es/runtimeConfig.browser" - }, - "react-native": { - "./dist-es/runtimeConfig": "./dist-es/runtimeConfig.native" - }, - homepage: "https://github.com/aws/aws-sdk-js-v3/tree/main/clients/client-sfn", - repository: { - type: "git", - url: "https://github.com/aws/aws-sdk-js-v3.git", - directory: "clients/client-sfn" + while (true) { + try { + if (isRequest) { + request2.headers[import_util_retry.REQUEST_HEADER] = `attempt=${attempts + 1}; max=${maxAttempts}`; + } + const { response, output } = await next(args); + retryStrategy.recordSuccess(retryToken); + output.$metadata.attempts = attempts + 1; + output.$metadata.totalRetryDelay = totalRetryDelay; + return { response, output }; + } catch (e) { + const retryErrorInfo = getRetryErrorInfo(e); + lastError = asSdkError(e); + if (isRequest && (0, import_isStreamingPayload.isStreamingPayload)(request2)) { + (_a = context.logger instanceof import_smithy_client4.NoOpLogger ? console : context.logger) == null ? void 0 : _a.warn( + "An error was encountered in a non-retryable streaming request." + ); + throw lastError; + } + try { + retryToken = await retryStrategy.refreshRetryTokenForRetry(retryToken, retryErrorInfo); + } catch (refreshError) { + if (!lastError.$metadata) { + lastError.$metadata = {}; + } + lastError.$metadata.attempts = attempts + 1; + lastError.$metadata.totalRetryDelay = totalRetryDelay; + throw lastError; + } + attempts = retryToken.getRetryCount(); + const delay = retryToken.getRetryDelay(); + totalRetryDelay += delay; + await new Promise((resolve) => setTimeout(resolve, delay)); + } + } + } else { + retryStrategy = retryStrategy; + if (retryStrategy == null ? void 0 : retryStrategy.mode) + context.userAgent = [...context.userAgent || [], ["cfg/retry-mode", retryStrategy.mode]]; + return retryStrategy.retry(next, args); + } + }, "retryMiddleware"); + var isRetryStrategyV2 = /* @__PURE__ */ __name((retryStrategy) => typeof retryStrategy.acquireInitialRetryToken !== "undefined" && typeof retryStrategy.refreshRetryTokenForRetry !== "undefined" && typeof retryStrategy.recordSuccess !== "undefined", "isRetryStrategyV2"); + var getRetryErrorInfo = /* @__PURE__ */ __name((error) => { + const errorInfo = { + error, + errorType: getRetryErrorType(error) + }; + const retryAfterHint = getRetryAfterHint(error.$response); + if (retryAfterHint) { + errorInfo.retryAfterHint = retryAfterHint; + } + return errorInfo; + }, "getRetryErrorInfo"); + var getRetryErrorType = /* @__PURE__ */ __name((error) => { + if ((0, import_service_error_classification.isThrottlingError)(error)) + return "THROTTLING"; + if ((0, import_service_error_classification.isTransientError)(error)) + return "TRANSIENT"; + if ((0, import_service_error_classification.isServerError)(error)) + return "SERVER_ERROR"; + return "CLIENT_ERROR"; + }, "getRetryErrorType"); + var retryMiddlewareOptions = { + name: "retryMiddleware", + tags: ["RETRY"], + step: "finalizeRequest", + priority: "high", + override: true + }; + var getRetryPlugin = /* @__PURE__ */ __name((options) => ({ + applyToStack: (clientStack) => { + clientStack.add(retryMiddleware(options), retryMiddlewareOptions); + } + }), "getRetryPlugin"); + var getRetryAfterHint = /* @__PURE__ */ __name((response) => { + if (!import_protocol_http8.HttpResponse.isInstance(response)) + return; + const retryAfterHeaderName = Object.keys(response.headers).find((key) => key.toLowerCase() === "retry-after"); + if (!retryAfterHeaderName) + return; + const retryAfter = response.headers[retryAfterHeaderName]; + const retryAfterSeconds = Number(retryAfter); + if (!Number.isNaN(retryAfterSeconds)) + return new Date(retryAfterSeconds * 1e3); + const retryAfterDate = new Date(retryAfter); + return retryAfterDate; + }, "getRetryAfterHint"); + } +}); + +// ../../../node_modules/@aws-sdk/core/dist-es/submodules/client/emitWarningIfUnsupportedVersion.js +var warningEmitted, emitWarningIfUnsupportedVersion; +var init_emitWarningIfUnsupportedVersion = __esm({ + "../../../node_modules/@aws-sdk/core/dist-es/submodules/client/emitWarningIfUnsupportedVersion.js"() { + warningEmitted = false; + emitWarningIfUnsupportedVersion = (version2) => { + if (version2 && !warningEmitted && parseInt(version2.substring(1, version2.indexOf("."))) < 18) { + warningEmitted = true; + process.emitWarning(`NodeDeprecationWarning: The AWS SDK for JavaScript (v3) will +no longer support Node.js 16.x on January 6, 2025. + +To continue receiving updates to AWS services, bug fixes, and security +updates please upgrade to a supported Node.js LTS version. + +More information can be found at: https://a.co/74kJMmI`); } }; } }); -// ../../../node_modules/@aws-sdk/credential-provider-env/dist-cjs/index.js -var require_dist_cjs48 = __commonJS({ - "../../../node_modules/@aws-sdk/credential-provider-env/dist-cjs/index.js"(exports2, module2) { - "use strict"; - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); +// ../../../node_modules/@aws-sdk/core/dist-es/submodules/client/index.js +var init_client = __esm({ + "../../../node_modules/@aws-sdk/core/dist-es/submodules/client/index.js"() { + init_emitWarningIfUnsupportedVersion(); + } +}); + +// ../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/utils/getDateHeader.js +var import_protocol_http5, getDateHeader; +var init_getDateHeader = __esm({ + "../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/utils/getDateHeader.js"() { + import_protocol_http5 = __toESM(require_dist_cjs2()); + getDateHeader = (response) => import_protocol_http5.HttpResponse.isInstance(response) ? response.headers?.date ?? response.headers?.Date : void 0; + } +}); + +// ../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/utils/getSkewCorrectedDate.js +var getSkewCorrectedDate; +var init_getSkewCorrectedDate = __esm({ + "../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/utils/getSkewCorrectedDate.js"() { + getSkewCorrectedDate = (systemClockOffset) => new Date(Date.now() + systemClockOffset); + } +}); + +// ../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/utils/isClockSkewed.js +var isClockSkewed; +var init_isClockSkewed = __esm({ + "../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/utils/isClockSkewed.js"() { + init_getSkewCorrectedDate(); + isClockSkewed = (clockTime, systemClockOffset) => Math.abs(getSkewCorrectedDate(systemClockOffset).getTime() - clockTime) >= 3e5; + } +}); + +// ../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/utils/getUpdatedSystemClockOffset.js +var getUpdatedSystemClockOffset; +var init_getUpdatedSystemClockOffset = __esm({ + "../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/utils/getUpdatedSystemClockOffset.js"() { + init_isClockSkewed(); + getUpdatedSystemClockOffset = (clockTime, currentSystemClockOffset) => { + const clockTimeInMs = Date.parse(clockTime); + if (isClockSkewed(clockTimeInMs, currentSystemClockOffset)) { + return clockTimeInMs - Date.now(); + } + return currentSystemClockOffset; }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } +}); + +// ../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/utils/index.js +var init_utils = __esm({ + "../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/utils/index.js"() { + init_getDateHeader(); + init_getSkewCorrectedDate(); + init_getUpdatedSystemClockOffset(); + } +}); + +// ../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/aws_sdk/AwsSdkSigV4Signer.js +var import_protocol_http6, throwSigningPropertyError, validateSigningProperties, AwsSdkSigV4Signer, AWSSDKSigV4Signer; +var init_AwsSdkSigV4Signer = __esm({ + "../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/aws_sdk/AwsSdkSigV4Signer.js"() { + import_protocol_http6 = __toESM(require_dist_cjs2()); + init_utils(); + throwSigningPropertyError = (name, property) => { + if (!property) { + throw new Error(`Property \`${name}\` is not resolved for AWS SDK SigV4Auth`); } - return to; + return property; }; - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - ENV_ACCOUNT_ID: () => ENV_ACCOUNT_ID, - ENV_CREDENTIAL_SCOPE: () => ENV_CREDENTIAL_SCOPE, - ENV_EXPIRATION: () => ENV_EXPIRATION, - ENV_KEY: () => ENV_KEY, - ENV_SECRET: () => ENV_SECRET, - ENV_SESSION: () => ENV_SESSION, - fromEnv: () => fromEnv - }); - module2.exports = __toCommonJS2(src_exports); - var import_property_provider2 = require_dist_cjs40(); - var ENV_KEY = "AWS_ACCESS_KEY_ID"; - var ENV_SECRET = "AWS_SECRET_ACCESS_KEY"; - var ENV_SESSION = "AWS_SESSION_TOKEN"; - var ENV_EXPIRATION = "AWS_CREDENTIAL_EXPIRATION"; - var ENV_CREDENTIAL_SCOPE = "AWS_CREDENTIAL_SCOPE"; - var ENV_ACCOUNT_ID = "AWS_ACCOUNT_ID"; - var fromEnv = /* @__PURE__ */ __name((init) => async () => { - var _a; - (_a = init == null ? void 0 : init.logger) == null ? void 0 : _a.debug("@aws-sdk/credential-provider-env - fromEnv"); - const accessKeyId = process.env[ENV_KEY]; - const secretAccessKey = process.env[ENV_SECRET]; - const sessionToken = process.env[ENV_SESSION]; - const expiry = process.env[ENV_EXPIRATION]; - const credentialScope = process.env[ENV_CREDENTIAL_SCOPE]; - const accountId = process.env[ENV_ACCOUNT_ID]; - if (accessKeyId && secretAccessKey) { - return { - accessKeyId, - secretAccessKey, - ...sessionToken && { sessionToken }, - ...expiry && { expiration: new Date(expiry) }, - ...credentialScope && { credentialScope }, - ...accountId && { accountId } + validateSigningProperties = async (signingProperties) => { + const context = throwSigningPropertyError("context", signingProperties.context); + const config = throwSigningPropertyError("config", signingProperties.config); + const authScheme = context.endpointV2?.properties?.authSchemes?.[0]; + const signerFunction = throwSigningPropertyError("signer", config.signer); + const signer = await signerFunction(authScheme); + const signingRegion = signingProperties?.signingRegion; + const signingRegionSet = signingProperties?.signingRegionSet; + const signingName = signingProperties?.signingName; + return { + config, + signer, + signingRegion, + signingRegionSet, + signingName + }; + }; + AwsSdkSigV4Signer = class { + async sign(httpRequest, identity, signingProperties) { + if (!import_protocol_http6.HttpRequest.isInstance(httpRequest)) { + throw new Error("The request is not an instance of `HttpRequest` and cannot be signed"); + } + const validatedProps = await validateSigningProperties(signingProperties); + const { config, signer } = validatedProps; + let { signingRegion, signingName } = validatedProps; + const handlerExecutionContext = signingProperties.context; + if (handlerExecutionContext?.authSchemes?.length ?? 0 > 1) { + const [first, second] = handlerExecutionContext.authSchemes; + if (first?.name === "sigv4a" && second?.name === "sigv4") { + signingRegion = second?.signingRegion ?? signingRegion; + signingName = second?.signingName ?? signingName; + } + } + const signedRequest = await signer.sign(httpRequest, { + signingDate: getSkewCorrectedDate(config.systemClockOffset), + signingRegion, + signingService: signingName + }); + return signedRequest; + } + errorHandler(signingProperties) { + return (error) => { + const serverTime = error.ServerTime ?? getDateHeader(error.$response); + if (serverTime) { + const config = throwSigningPropertyError("config", signingProperties.config); + const initialSystemClockOffset = config.systemClockOffset; + config.systemClockOffset = getUpdatedSystemClockOffset(serverTime, config.systemClockOffset); + const clockSkewCorrected = config.systemClockOffset !== initialSystemClockOffset; + if (clockSkewCorrected && error.$metadata) { + error.$metadata.clockSkewCorrected = true; + } + } + throw error; }; } - throw new import_property_provider2.CredentialsProviderError("Unable to find environment variable credentials.", { logger: init == null ? void 0 : init.logger }); - }, "fromEnv"); + successHandler(httpResponse, signingProperties) { + const dateHeader = getDateHeader(httpResponse); + if (dateHeader) { + const config = throwSigningPropertyError("config", signingProperties.config); + config.systemClockOffset = getUpdatedSystemClockOffset(dateHeader, config.systemClockOffset); + } + } + }; + AWSSDKSigV4Signer = AwsSdkSigV4Signer; + } +}); + +// ../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/aws_sdk/AwsSdkSigV4ASigner.js +var import_protocol_http7, AwsSdkSigV4ASigner; +var init_AwsSdkSigV4ASigner = __esm({ + "../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/aws_sdk/AwsSdkSigV4ASigner.js"() { + import_protocol_http7 = __toESM(require_dist_cjs2()); + init_utils(); + init_AwsSdkSigV4Signer(); + AwsSdkSigV4ASigner = class extends AwsSdkSigV4Signer { + async sign(httpRequest, identity, signingProperties) { + if (!import_protocol_http7.HttpRequest.isInstance(httpRequest)) { + throw new Error("The request is not an instance of `HttpRequest` and cannot be signed"); + } + const { config, signer, signingRegion, signingRegionSet, signingName } = await validateSigningProperties(signingProperties); + const configResolvedSigningRegionSet = await config.sigv4aSigningRegionSet?.(); + const multiRegionOverride = (configResolvedSigningRegionSet ?? signingRegionSet ?? [signingRegion]).join(","); + const signedRequest = await signer.sign(httpRequest, { + signingDate: getSkewCorrectedDate(config.systemClockOffset), + signingRegion: multiRegionOverride, + signingService: signingName + }); + return signedRequest; + } + }; } }); -// ../../../node_modules/@smithy/credential-provider-imds/dist-cjs/index.js -var require_dist_cjs49 = __commonJS({ - "../../../node_modules/@smithy/credential-provider-imds/dist-cjs/index.js"(exports2, module2) { +// ../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/aws_sdk/resolveAwsSdkSigV4AConfig.js +var import_property_provider, resolveAwsSdkSigV4AConfig, NODE_SIGV4A_CONFIG_OPTIONS; +var init_resolveAwsSdkSigV4AConfig = __esm({ + "../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/aws_sdk/resolveAwsSdkSigV4AConfig.js"() { + init_dist_es(); + import_property_provider = __toESM(require_dist_cjs24()); + resolveAwsSdkSigV4AConfig = (config) => { + config.sigv4aSigningRegionSet = normalizeProvider(config.sigv4aSigningRegionSet); + return config; + }; + NODE_SIGV4A_CONFIG_OPTIONS = { + environmentVariableSelector(env) { + if (env.AWS_SIGV4A_SIGNING_REGION_SET) { + return env.AWS_SIGV4A_SIGNING_REGION_SET.split(",").map((_) => _.trim()); + } + throw new import_property_provider.ProviderError("AWS_SIGV4A_SIGNING_REGION_SET not set in env.", { + tryNextLink: true + }); + }, + configFileSelector(profile) { + if (profile.sigv4a_signing_region_set) { + return (profile.sigv4a_signing_region_set ?? "").split(",").map((_) => _.trim()); + } + throw new import_property_provider.ProviderError("sigv4a_signing_region_set not set in profile.", { + tryNextLink: true + }); + }, + default: void 0 + }; + } +}); + +// ../../../node_modules/@smithy/signature-v4/dist-cjs/index.js +var require_dist_cjs35 = __commonJS({ + "../../../node_modules/@smithy/signature-v4/dist-cjs/index.js"(exports2, module2) { var __defProp2 = Object.defineProperty; var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; var __getOwnPropNames2 = Object.getOwnPropertyNames; @@ -13837,4140 +8969,4348 @@ var require_dist_cjs49 = __commonJS({ var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); var src_exports = {}; __export2(src_exports, { - DEFAULT_MAX_RETRIES: () => DEFAULT_MAX_RETRIES, - DEFAULT_TIMEOUT: () => DEFAULT_TIMEOUT, - ENV_CMDS_AUTH_TOKEN: () => ENV_CMDS_AUTH_TOKEN, - ENV_CMDS_FULL_URI: () => ENV_CMDS_FULL_URI, - ENV_CMDS_RELATIVE_URI: () => ENV_CMDS_RELATIVE_URI, - Endpoint: () => Endpoint, - fromContainerMetadata: () => fromContainerMetadata, - fromInstanceMetadata: () => fromInstanceMetadata, - getInstanceMetadataEndpoint: () => getInstanceMetadataEndpoint, - httpRequest: () => httpRequest, - providerConfigFromInit: () => providerConfigFromInit + SignatureV4: () => SignatureV42, + clearCredentialCache: () => clearCredentialCache, + createScope: () => createScope, + getCanonicalHeaders: () => getCanonicalHeaders, + getCanonicalQuery: () => getCanonicalQuery, + getPayloadHash: () => getPayloadHash, + getSigningKey: () => getSigningKey, + moveHeadersToQuery: () => moveHeadersToQuery, + prepareRequest: () => prepareRequest }); module2.exports = __toCommonJS2(src_exports); - var import_url = require("url"); - var import_property_provider2 = require_dist_cjs40(); - var import_buffer = require("buffer"); - var import_http2 = require("http"); - function httpRequest(options) { - return new Promise((resolve, reject) => { - var _a; - const req = (0, import_http2.request)({ - method: "GET", - ...options, - // Node.js http module doesn't accept hostname with square brackets - // Refs: https://github.com/nodejs/node/issues/39738 - hostname: (_a = options.hostname) == null ? void 0 : _a.replace(/^\[(.+)\]$/, "$1") - }); - req.on("error", (err) => { - reject(Object.assign(new import_property_provider2.ProviderError("Unable to connect to instance metadata service"), err)); - req.destroy(); - }); - req.on("timeout", () => { - reject(new import_property_provider2.ProviderError("TimeoutError from instance metadata service")); - req.destroy(); - }); - req.on("response", (res) => { - const { statusCode = 400 } = res; - if (statusCode < 200 || 300 <= statusCode) { - reject( - Object.assign(new import_property_provider2.ProviderError("Error response received from instance metadata service"), { statusCode }) - ); - req.destroy(); - } - const chunks = []; - res.on("data", (chunk) => { - chunks.push(chunk); - }); - res.on("end", () => { - resolve(import_buffer.Buffer.concat(chunks)); - req.destroy(); - }); - }); - req.end(); - }); - } - __name(httpRequest, "httpRequest"); - var isImdsCredentials = /* @__PURE__ */ __name((arg) => Boolean(arg) && typeof arg === "object" && typeof arg.AccessKeyId === "string" && typeof arg.SecretAccessKey === "string" && typeof arg.Token === "string" && typeof arg.Expiration === "string", "isImdsCredentials"); - var fromImdsCredentials = /* @__PURE__ */ __name((creds) => ({ - accessKeyId: creds.AccessKeyId, - secretAccessKey: creds.SecretAccessKey, - sessionToken: creds.Token, - expiration: new Date(creds.Expiration), - ...creds.AccountId && { accountId: creds.AccountId } - }), "fromImdsCredentials"); - var DEFAULT_TIMEOUT = 1e3; - var DEFAULT_MAX_RETRIES = 0; - var providerConfigFromInit = /* @__PURE__ */ __name(({ - maxRetries = DEFAULT_MAX_RETRIES, - timeout = DEFAULT_TIMEOUT - }) => ({ maxRetries, timeout }), "providerConfigFromInit"); - var retry = /* @__PURE__ */ __name((toRetry, maxRetries) => { - let promise = toRetry(); - for (let i = 0; i < maxRetries; i++) { - promise = promise.catch(toRetry); + var import_util_middleware3 = require_dist_cjs10(); + var import_util_utf84 = require_dist_cjs15(); + var ALGORITHM_QUERY_PARAM = "X-Amz-Algorithm"; + var CREDENTIAL_QUERY_PARAM = "X-Amz-Credential"; + var AMZ_DATE_QUERY_PARAM = "X-Amz-Date"; + var SIGNED_HEADERS_QUERY_PARAM = "X-Amz-SignedHeaders"; + var EXPIRES_QUERY_PARAM = "X-Amz-Expires"; + var SIGNATURE_QUERY_PARAM = "X-Amz-Signature"; + var TOKEN_QUERY_PARAM = "X-Amz-Security-Token"; + var AUTH_HEADER = "authorization"; + var AMZ_DATE_HEADER = AMZ_DATE_QUERY_PARAM.toLowerCase(); + var DATE_HEADER = "date"; + var GENERATED_HEADERS = [AUTH_HEADER, AMZ_DATE_HEADER, DATE_HEADER]; + var SIGNATURE_HEADER = SIGNATURE_QUERY_PARAM.toLowerCase(); + var SHA256_HEADER = "x-amz-content-sha256"; + var TOKEN_HEADER = TOKEN_QUERY_PARAM.toLowerCase(); + var ALWAYS_UNSIGNABLE_HEADERS = { + authorization: true, + "cache-control": true, + connection: true, + expect: true, + from: true, + "keep-alive": true, + "max-forwards": true, + pragma: true, + referer: true, + te: true, + trailer: true, + "transfer-encoding": true, + upgrade: true, + "user-agent": true, + "x-amzn-trace-id": true + }; + var PROXY_HEADER_PATTERN = /^proxy-/; + var SEC_HEADER_PATTERN = /^sec-/; + var ALGORITHM_IDENTIFIER = "AWS4-HMAC-SHA256"; + var EVENT_ALGORITHM_IDENTIFIER = "AWS4-HMAC-SHA256-PAYLOAD"; + var UNSIGNED_PAYLOAD = "UNSIGNED-PAYLOAD"; + var MAX_CACHE_SIZE = 50; + var KEY_TYPE_IDENTIFIER = "aws4_request"; + var MAX_PRESIGNED_TTL = 60 * 60 * 24 * 7; + var import_util_hex_encoding = require_dist_cjs21(); + var import_util_utf8 = require_dist_cjs15(); + var signingKeyCache = {}; + var cacheQueue = []; + var createScope = /* @__PURE__ */ __name((shortDate, region, service) => `${shortDate}/${region}/${service}/${KEY_TYPE_IDENTIFIER}`, "createScope"); + var getSigningKey = /* @__PURE__ */ __name(async (sha256Constructor, credentials, shortDate, region, service) => { + const credsHash = await hmac(sha256Constructor, credentials.secretAccessKey, credentials.accessKeyId); + const cacheKey = `${shortDate}:${region}:${service}:${(0, import_util_hex_encoding.toHex)(credsHash)}:${credentials.sessionToken}`; + if (cacheKey in signingKeyCache) { + return signingKeyCache[cacheKey]; } - return promise; - }, "retry"); - var ENV_CMDS_FULL_URI = "AWS_CONTAINER_CREDENTIALS_FULL_URI"; - var ENV_CMDS_RELATIVE_URI = "AWS_CONTAINER_CREDENTIALS_RELATIVE_URI"; - var ENV_CMDS_AUTH_TOKEN = "AWS_CONTAINER_AUTHORIZATION_TOKEN"; - var fromContainerMetadata = /* @__PURE__ */ __name((init = {}) => { - const { timeout, maxRetries } = providerConfigFromInit(init); - return () => retry(async () => { - const requestOptions = await getCmdsUri({ logger: init.logger }); - const credsResponse = JSON.parse(await requestFromEcsImds(timeout, requestOptions)); - if (!isImdsCredentials(credsResponse)) { - throw new import_property_provider2.CredentialsProviderError("Invalid response received from instance metadata service.", { - logger: init.logger - }); - } - return fromImdsCredentials(credsResponse); - }, maxRetries); - }, "fromContainerMetadata"); - var requestFromEcsImds = /* @__PURE__ */ __name(async (timeout, options) => { - if (process.env[ENV_CMDS_AUTH_TOKEN]) { - options.headers = { - ...options.headers, - Authorization: process.env[ENV_CMDS_AUTH_TOKEN] - }; + cacheQueue.push(cacheKey); + while (cacheQueue.length > MAX_CACHE_SIZE) { + delete signingKeyCache[cacheQueue.shift()]; } - const buffer = await httpRequest({ - ...options, - timeout + let key = `AWS4${credentials.secretAccessKey}`; + for (const signable of [shortDate, region, service, KEY_TYPE_IDENTIFIER]) { + key = await hmac(sha256Constructor, key, signable); + } + return signingKeyCache[cacheKey] = key; + }, "getSigningKey"); + var clearCredentialCache = /* @__PURE__ */ __name(() => { + cacheQueue.length = 0; + Object.keys(signingKeyCache).forEach((cacheKey) => { + delete signingKeyCache[cacheKey]; }); - return buffer.toString(); - }, "requestFromEcsImds"); - var CMDS_IP = "169.254.170.2"; - var GREENGRASS_HOSTS = { - localhost: true, - "127.0.0.1": true - }; - var GREENGRASS_PROTOCOLS = { - "http:": true, - "https:": true - }; - var getCmdsUri = /* @__PURE__ */ __name(async ({ logger }) => { - if (process.env[ENV_CMDS_RELATIVE_URI]) { - return { - hostname: CMDS_IP, - path: process.env[ENV_CMDS_RELATIVE_URI] - }; + }, "clearCredentialCache"); + var hmac = /* @__PURE__ */ __name((ctor, secret, data) => { + const hash = new ctor(secret); + hash.update((0, import_util_utf8.toUint8Array)(data)); + return hash.digest(); + }, "hmac"); + var getCanonicalHeaders = /* @__PURE__ */ __name(({ headers }, unsignableHeaders, signableHeaders) => { + const canonical = {}; + for (const headerName of Object.keys(headers).sort()) { + if (headers[headerName] == void 0) { + continue; + } + const canonicalHeaderName = headerName.toLowerCase(); + if (canonicalHeaderName in ALWAYS_UNSIGNABLE_HEADERS || (unsignableHeaders == null ? void 0 : unsignableHeaders.has(canonicalHeaderName)) || PROXY_HEADER_PATTERN.test(canonicalHeaderName) || SEC_HEADER_PATTERN.test(canonicalHeaderName)) { + if (!signableHeaders || signableHeaders && !signableHeaders.has(canonicalHeaderName)) { + continue; + } + } + canonical[canonicalHeaderName] = headers[headerName].trim().replace(/\s+/g, " "); } - if (process.env[ENV_CMDS_FULL_URI]) { - const parsed = (0, import_url.parse)(process.env[ENV_CMDS_FULL_URI]); - if (!parsed.hostname || !(parsed.hostname in GREENGRASS_HOSTS)) { - throw new import_property_provider2.CredentialsProviderError(`${parsed.hostname} is not a valid container metadata service hostname`, { - tryNextLink: false, - logger - }); + return canonical; + }, "getCanonicalHeaders"); + var import_util_uri_escape = require_dist_cjs17(); + var getCanonicalQuery = /* @__PURE__ */ __name(({ query = {} }) => { + const keys = []; + const serialized = {}; + for (const key of Object.keys(query)) { + if (key.toLowerCase() === SIGNATURE_HEADER) { + continue; } - if (!parsed.protocol || !(parsed.protocol in GREENGRASS_PROTOCOLS)) { - throw new import_property_provider2.CredentialsProviderError(`${parsed.protocol} is not a valid container metadata service protocol`, { - tryNextLink: false, - logger - }); + const encodedKey = (0, import_util_uri_escape.escapeUri)(key); + keys.push(encodedKey); + const value = query[key]; + if (typeof value === "string") { + serialized[encodedKey] = `${encodedKey}=${(0, import_util_uri_escape.escapeUri)(value)}`; + } else if (Array.isArray(value)) { + serialized[encodedKey] = value.slice(0).reduce((encoded, value2) => encoded.concat([`${encodedKey}=${(0, import_util_uri_escape.escapeUri)(value2)}`]), []).sort().join("&"); } - return { - ...parsed, - port: parsed.port ? parseInt(parsed.port, 10) : void 0 - }; } - throw new import_property_provider2.CredentialsProviderError( - `The container metadata credential provider cannot be used unless the ${ENV_CMDS_RELATIVE_URI} or ${ENV_CMDS_FULL_URI} environment variable is set`, - { - tryNextLink: false, - logger + return keys.sort().map((key) => serialized[key]).filter((serialized2) => serialized2).join("&"); + }, "getCanonicalQuery"); + var import_is_array_buffer = require_dist_cjs13(); + var import_util_utf82 = require_dist_cjs15(); + var getPayloadHash = /* @__PURE__ */ __name(async ({ headers, body }, hashConstructor) => { + for (const headerName of Object.keys(headers)) { + if (headerName.toLowerCase() === SHA256_HEADER) { + return headers[headerName]; } - ); - }, "getCmdsUri"); - var _InstanceMetadataV1FallbackError = class _InstanceMetadataV1FallbackError2 extends import_property_provider2.CredentialsProviderError { - constructor(message, tryNextLink = true) { - super(message, tryNextLink); - this.tryNextLink = tryNextLink; - this.name = "InstanceMetadataV1FallbackError"; - Object.setPrototypeOf(this, _InstanceMetadataV1FallbackError2.prototype); } - }; - __name(_InstanceMetadataV1FallbackError, "InstanceMetadataV1FallbackError"); - var InstanceMetadataV1FallbackError = _InstanceMetadataV1FallbackError; - var import_node_config_provider = require_dist_cjs42(); - var import_url_parser = require_dist_cjs44(); - var Endpoint = /* @__PURE__ */ ((Endpoint2) => { - Endpoint2["IPv4"] = "http://169.254.169.254"; - Endpoint2["IPv6"] = "http://[fd00:ec2::254]"; - return Endpoint2; - })(Endpoint || {}); - var ENV_ENDPOINT_NAME = "AWS_EC2_METADATA_SERVICE_ENDPOINT"; - var CONFIG_ENDPOINT_NAME = "ec2_metadata_service_endpoint"; - var ENDPOINT_CONFIG_OPTIONS = { - environmentVariableSelector: (env) => env[ENV_ENDPOINT_NAME], - configFileSelector: (profile) => profile[CONFIG_ENDPOINT_NAME], - default: void 0 - }; - var EndpointMode = /* @__PURE__ */ ((EndpointMode2) => { - EndpointMode2["IPv4"] = "IPv4"; - EndpointMode2["IPv6"] = "IPv6"; - return EndpointMode2; - })(EndpointMode || {}); - var ENV_ENDPOINT_MODE_NAME = "AWS_EC2_METADATA_SERVICE_ENDPOINT_MODE"; - var CONFIG_ENDPOINT_MODE_NAME = "ec2_metadata_service_endpoint_mode"; - var ENDPOINT_MODE_CONFIG_OPTIONS = { - environmentVariableSelector: (env) => env[ENV_ENDPOINT_MODE_NAME], - configFileSelector: (profile) => profile[CONFIG_ENDPOINT_MODE_NAME], - default: "IPv4" - /* IPv4 */ - }; - var getInstanceMetadataEndpoint = /* @__PURE__ */ __name(async () => (0, import_url_parser.parseUrl)(await getFromEndpointConfig() || await getFromEndpointModeConfig()), "getInstanceMetadataEndpoint"); - var getFromEndpointConfig = /* @__PURE__ */ __name(async () => (0, import_node_config_provider.loadConfig)(ENDPOINT_CONFIG_OPTIONS)(), "getFromEndpointConfig"); - var getFromEndpointModeConfig = /* @__PURE__ */ __name(async () => { - const endpointMode = await (0, import_node_config_provider.loadConfig)(ENDPOINT_MODE_CONFIG_OPTIONS)(); - switch (endpointMode) { - case "IPv4": - return "http://169.254.169.254"; - case "IPv6": - return "http://[fd00:ec2::254]"; - default: - throw new Error(`Unsupported endpoint mode: ${endpointMode}. Select from ${Object.values(EndpointMode)}`); + if (body == void 0) { + return "e3b0c44298fc1c149afbf4c8996fb92427ae41e4649b934ca495991b7852b855"; + } else if (typeof body === "string" || ArrayBuffer.isView(body) || (0, import_is_array_buffer.isArrayBuffer)(body)) { + const hashCtor = new hashConstructor(); + hashCtor.update((0, import_util_utf82.toUint8Array)(body)); + return (0, import_util_hex_encoding.toHex)(await hashCtor.digest()); } - }, "getFromEndpointModeConfig"); - var STATIC_STABILITY_REFRESH_INTERVAL_SECONDS = 5 * 60; - var STATIC_STABILITY_REFRESH_INTERVAL_JITTER_WINDOW_SECONDS = 5 * 60; - var STATIC_STABILITY_DOC_URL = "https://docs.aws.amazon.com/sdkref/latest/guide/feature-static-credentials.html"; - var getExtendedInstanceMetadataCredentials = /* @__PURE__ */ __name((credentials, logger) => { - const refreshInterval = STATIC_STABILITY_REFRESH_INTERVAL_SECONDS + Math.floor(Math.random() * STATIC_STABILITY_REFRESH_INTERVAL_JITTER_WINDOW_SECONDS); - const newExpiration = new Date(Date.now() + refreshInterval * 1e3); - logger.warn( - `Attempting credential expiration extension due to a credential service availability issue. A refresh of these credentials will be attempted after ${new Date(newExpiration)}. -For more information, please visit: ` + STATIC_STABILITY_DOC_URL - ); - const originalExpiration = credentials.originalExpiration ?? credentials.expiration; - return { - ...credentials, - ...originalExpiration ? { originalExpiration } : {}, - expiration: newExpiration - }; - }, "getExtendedInstanceMetadataCredentials"); - var staticStabilityProvider = /* @__PURE__ */ __name((provider, options = {}) => { - const logger = (options == null ? void 0 : options.logger) || console; - let pastCredentials; - return async () => { - let credentials; - try { - credentials = await provider(); - if (credentials.expiration && credentials.expiration.getTime() < Date.now()) { - credentials = getExtendedInstanceMetadataCredentials(credentials, logger); - } - } catch (e) { - if (pastCredentials) { - logger.warn("Credential renew failed: ", e); - credentials = getExtendedInstanceMetadataCredentials(pastCredentials, logger); - } else { - throw e; - } + return UNSIGNED_PAYLOAD; + }, "getPayloadHash"); + var import_util_utf83 = require_dist_cjs15(); + var _HeaderFormatter = class _HeaderFormatter { + format(headers) { + const chunks = []; + for (const headerName of Object.keys(headers)) { + const bytes = (0, import_util_utf83.fromUtf8)(headerName); + chunks.push(Uint8Array.from([bytes.byteLength]), bytes, this.formatHeaderValue(headers[headerName])); } - pastCredentials = credentials; - return credentials; - }; - }, "staticStabilityProvider"); - var IMDS_PATH = "/latest/meta-data/iam/security-credentials/"; - var IMDS_TOKEN_PATH = "/latest/api/token"; - var AWS_EC2_METADATA_V1_DISABLED = "AWS_EC2_METADATA_V1_DISABLED"; - var PROFILE_AWS_EC2_METADATA_V1_DISABLED = "ec2_metadata_v1_disabled"; - var X_AWS_EC2_METADATA_TOKEN = "x-aws-ec2-metadata-token"; - var fromInstanceMetadata = /* @__PURE__ */ __name((init = {}) => staticStabilityProvider(getInstanceMetadataProvider(init), { logger: init.logger }), "fromInstanceMetadata"); - var getInstanceMetadataProvider = /* @__PURE__ */ __name((init = {}) => { - let disableFetchToken = false; - const { logger, profile } = init; - const { timeout, maxRetries } = providerConfigFromInit(init); - const getCredentials = /* @__PURE__ */ __name(async (maxRetries2, options) => { - var _a; - const isImdsV1Fallback = disableFetchToken || ((_a = options.headers) == null ? void 0 : _a[X_AWS_EC2_METADATA_TOKEN]) == null; - if (isImdsV1Fallback) { - let fallbackBlockedFromProfile = false; - let fallbackBlockedFromProcessEnv = false; - const configValue = await (0, import_node_config_provider.loadConfig)( - { - environmentVariableSelector: (env) => { - const envValue = env[AWS_EC2_METADATA_V1_DISABLED]; - fallbackBlockedFromProcessEnv = !!envValue && envValue !== "false"; - if (envValue === void 0) { - throw new import_property_provider2.CredentialsProviderError( - `${AWS_EC2_METADATA_V1_DISABLED} not set in env, checking config file next.`, - { logger: init.logger } - ); - } - return fallbackBlockedFromProcessEnv; - }, - configFileSelector: (profile2) => { - const profileValue = profile2[PROFILE_AWS_EC2_METADATA_V1_DISABLED]; - fallbackBlockedFromProfile = !!profileValue && profileValue !== "false"; - return fallbackBlockedFromProfile; - }, - default: false - }, - { - profile - } - )(); - if (init.ec2MetadataV1Disabled || configValue) { - const causes = []; - if (init.ec2MetadataV1Disabled) - causes.push("credential provider initialization (runtime option ec2MetadataV1Disabled)"); - if (fallbackBlockedFromProfile) - causes.push(`config file profile (${PROFILE_AWS_EC2_METADATA_V1_DISABLED})`); - if (fallbackBlockedFromProcessEnv) - causes.push(`process environment variable (${AWS_EC2_METADATA_V1_DISABLED})`); - throw new InstanceMetadataV1FallbackError( - `AWS EC2 Metadata v1 fallback has been blocked by AWS SDK configuration in the following: [${causes.join( - ", " - )}].` - ); - } + const out = new Uint8Array(chunks.reduce((carry, bytes) => carry + bytes.byteLength, 0)); + let position = 0; + for (const chunk of chunks) { + out.set(chunk, position); + position += chunk.byteLength; } - const imdsProfile = (await retry(async () => { - let profile2; - try { - profile2 = await getProfile(options); - } catch (err) { - if (err.statusCode === 401) { - disableFetchToken = false; - } - throw err; - } - return profile2; - }, maxRetries2)).trim(); - return retry(async () => { - let creds; - try { - creds = await getCredentialsFromProfile(imdsProfile, options, init); - } catch (err) { - if (err.statusCode === 401) { - disableFetchToken = false; - } - throw err; - } - return creds; - }, maxRetries2); - }, "getCredentials"); - return async () => { - const endpoint = await getInstanceMetadataEndpoint(); - if (disableFetchToken) { - logger == null ? void 0 : logger.debug("AWS SDK Instance Metadata", "using v1 fallback (no token fetch)"); - return getCredentials(maxRetries, { ...endpoint, timeout }); - } else { - let token; - try { - token = (await getMetadataToken({ ...endpoint, timeout })).toString(); - } catch (error) { - if ((error == null ? void 0 : error.statusCode) === 400) { - throw Object.assign(error, { - message: "EC2 Metadata token request returned error" - }); - } else if (error.message === "TimeoutError" || [403, 404, 405].includes(error.statusCode)) { - disableFetchToken = true; + return out; + } + formatHeaderValue(header) { + switch (header.type) { + case "boolean": + return Uint8Array.from([ + header.value ? 0 : 1 + /* boolFalse */ + ]); + case "byte": + return Uint8Array.from([2, header.value]); + case "short": + const shortView = new DataView(new ArrayBuffer(3)); + shortView.setUint8( + 0, + 3 + /* short */ + ); + shortView.setInt16(1, header.value, false); + return new Uint8Array(shortView.buffer); + case "integer": + const intView = new DataView(new ArrayBuffer(5)); + intView.setUint8( + 0, + 4 + /* integer */ + ); + intView.setInt32(1, header.value, false); + return new Uint8Array(intView.buffer); + case "long": + const longBytes = new Uint8Array(9); + longBytes[0] = 5; + longBytes.set(header.value.bytes, 1); + return longBytes; + case "binary": + const binView = new DataView(new ArrayBuffer(3 + header.value.byteLength)); + binView.setUint8( + 0, + 6 + /* byteArray */ + ); + binView.setUint16(1, header.value.byteLength, false); + const binBytes = new Uint8Array(binView.buffer); + binBytes.set(header.value, 3); + return binBytes; + case "string": + const utf8Bytes = (0, import_util_utf83.fromUtf8)(header.value); + const strView = new DataView(new ArrayBuffer(3 + utf8Bytes.byteLength)); + strView.setUint8( + 0, + 7 + /* string */ + ); + strView.setUint16(1, utf8Bytes.byteLength, false); + const strBytes = new Uint8Array(strView.buffer); + strBytes.set(utf8Bytes, 3); + return strBytes; + case "timestamp": + const tsBytes = new Uint8Array(9); + tsBytes[0] = 8; + tsBytes.set(Int64.fromNumber(header.value.valueOf()).bytes, 1); + return tsBytes; + case "uuid": + if (!UUID_PATTERN.test(header.value)) { + throw new Error(`Invalid UUID received: ${header.value}`); } - logger == null ? void 0 : logger.debug("AWS SDK Instance Metadata", "using v1 fallback (initial)"); - return getCredentials(maxRetries, { ...endpoint, timeout }); - } - return getCredentials(maxRetries, { - ...endpoint, - headers: { - [X_AWS_EC2_METADATA_TOKEN]: token - }, - timeout - }); + const uuidBytes = new Uint8Array(17); + uuidBytes[0] = 9; + uuidBytes.set((0, import_util_hex_encoding.fromHex)(header.value.replace(/\-/g, "")), 1); + return uuidBytes; } - }; - }, "getInstanceMetadataProvider"); - var getMetadataToken = /* @__PURE__ */ __name(async (options) => httpRequest({ - ...options, - path: IMDS_TOKEN_PATH, - method: "PUT", - headers: { - "x-aws-ec2-metadata-token-ttl-seconds": "21600" - } - }), "getMetadataToken"); - var getProfile = /* @__PURE__ */ __name(async (options) => (await httpRequest({ ...options, path: IMDS_PATH })).toString(), "getProfile"); - var getCredentialsFromProfile = /* @__PURE__ */ __name(async (profile, options, init) => { - const credentialsResponse = JSON.parse( - (await httpRequest({ - ...options, - path: IMDS_PATH + profile - })).toString() - ); - if (!isImdsCredentials(credentialsResponse)) { - throw new import_property_provider2.CredentialsProviderError("Invalid response received from instance metadata service.", { - logger: init.logger - }); - } - return fromImdsCredentials(credentialsResponse); - }, "getCredentialsFromProfile"); - } -}); - -// ../../../node_modules/@smithy/node-http-handler/node_modules/@smithy/querystring-builder/dist-cjs/index.js -var require_dist_cjs50 = __commonJS({ - "../../../node_modules/@smithy/node-http-handler/node_modules/@smithy/querystring-builder/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); } - return to; }; - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - buildQueryString: () => buildQueryString - }); - module2.exports = __toCommonJS2(src_exports); - var import_util_uri_escape = require_dist_cjs31(); - function buildQueryString(query) { - const parts = []; - for (let key of Object.keys(query).sort()) { - const value = query[key]; - key = (0, import_util_uri_escape.escapeUri)(key); - if (Array.isArray(value)) { - for (let i = 0, iLen = value.length; i < iLen; i++) { - parts.push(`${key}=${(0, import_util_uri_escape.escapeUri)(value[i])}`); - } - } else { - let qsEntry = key; - if (value || typeof value === "string") { - qsEntry += `=${(0, import_util_uri_escape.escapeUri)(value)}`; - } - parts.push(qsEntry); + __name(_HeaderFormatter, "HeaderFormatter"); + var HeaderFormatter = _HeaderFormatter; + var UUID_PATTERN = /^[a-f0-9]{8}-[a-f0-9]{4}-[a-f0-9]{4}-[a-f0-9]{4}-[a-f0-9]{12}$/; + var _Int64 = class _Int642 { + constructor(bytes) { + this.bytes = bytes; + if (bytes.byteLength !== 8) { + throw new Error("Int64 buffers must be exactly 8 bytes"); } } - return parts.join("&"); - } - __name(buildQueryString, "buildQueryString"); - } -}); - -// ../../../node_modules/@smithy/node-http-handler/dist-cjs/index.js -var require_dist_cjs51 = __commonJS({ - "../../../node_modules/@smithy/node-http-handler/dist-cjs/index.js"(exports2, module2) { - var __create2 = Object.create; - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __getProtoOf2 = Object.getPrototypeOf; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + static fromNumber(number) { + if (number > 9223372036854776e3 || number < -9223372036854776e3) { + throw new Error(`${number} is too large (or, if negative, too small) to represent as an Int64`); + } + const bytes = new Uint8Array(8); + for (let i = 7, remaining = Math.abs(Math.round(number)); i > -1 && remaining > 0; i--, remaining /= 256) { + bytes[i] = remaining; + } + if (number < 0) { + negate(bytes); + } + return new _Int642(bytes); } - return to; - }; - var __toESM2 = (mod, isNodeMode, target) => (target = mod != null ? __create2(__getProtoOf2(mod)) : {}, __copyProps2( - // If the importer is in node compatibility mode or this is not an ESM - // file that has been converted to a CommonJS file using a Babel- - // compatible transform (i.e. "__esModule" has not been set), then set - // "default" to the CommonJS "module.exports" for node compatibility. - isNodeMode || !mod || !mod.__esModule ? __defProp2(target, "default", { value: mod, enumerable: true }) : target, - mod - )); - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - DEFAULT_REQUEST_TIMEOUT: () => DEFAULT_REQUEST_TIMEOUT, - NodeHttp2Handler: () => NodeHttp2Handler, - NodeHttpHandler: () => NodeHttpHandler, - streamCollector: () => streamCollector - }); - module2.exports = __toCommonJS2(src_exports); - var import_protocol_http8 = require_dist_cjs2(); - var import_querystring_builder = require_dist_cjs50(); - var import_http2 = require("http"); - var import_https = require("https"); - var NODEJS_TIMEOUT_ERROR_CODES = ["ECONNRESET", "EPIPE", "ETIMEDOUT"]; - var getTransformedHeaders = /* @__PURE__ */ __name((headers) => { - const transformedHeaders = {}; - for (const name of Object.keys(headers)) { - const headerValues = headers[name]; - transformedHeaders[name] = Array.isArray(headerValues) ? headerValues.join(",") : headerValues; + /** + * Called implicitly by infix arithmetic operators. + */ + valueOf() { + const bytes = this.bytes.slice(0); + const negative = bytes[0] & 128; + if (negative) { + negate(bytes); + } + return parseInt((0, import_util_hex_encoding.toHex)(bytes), 16) * (negative ? -1 : 1); } - return transformedHeaders; - }, "getTransformedHeaders"); - var DEFER_EVENT_LISTENER_TIME = 1e3; - var setConnectionTimeout = /* @__PURE__ */ __name((request2, reject, timeoutInMs = 0) => { - if (!timeoutInMs) { - return -1; + toString() { + return String(this.valueOf()); } - const registerTimeout = /* @__PURE__ */ __name((offset) => { - const timeoutId = setTimeout(() => { - request2.destroy(); - reject( - Object.assign(new Error(`Socket timed out without establishing a connection within ${timeoutInMs} ms`), { - name: "TimeoutError" - }) - ); - }, timeoutInMs - offset); - const doWithSocket = /* @__PURE__ */ __name((socket) => { - if (socket == null ? void 0 : socket.connecting) { - socket.on("connect", () => { - clearTimeout(timeoutId); - }); - } else { - clearTimeout(timeoutId); - } - }, "doWithSocket"); - if (request2.socket) { - doWithSocket(request2.socket); - } else { - request2.on("socket", doWithSocket); - } - }, "registerTimeout"); - if (timeoutInMs < 2e3) { - registerTimeout(0); - return 0; + }; + __name(_Int64, "Int64"); + var Int64 = _Int64; + function negate(bytes) { + for (let i = 0; i < 8; i++) { + bytes[i] ^= 255; } - return setTimeout(registerTimeout.bind(null, DEFER_EVENT_LISTENER_TIME), DEFER_EVENT_LISTENER_TIME); - }, "setConnectionTimeout"); - var DEFER_EVENT_LISTENER_TIME2 = 3e3; - var setSocketKeepAlive = /* @__PURE__ */ __name((request2, { keepAlive, keepAliveMsecs }, deferTimeMs = DEFER_EVENT_LISTENER_TIME2) => { - if (keepAlive !== true) { - return -1; + for (let i = 7; i > -1; i--) { + bytes[i]++; + if (bytes[i] !== 0) + break; } - const registerListener = /* @__PURE__ */ __name(() => { - if (request2.socket) { - request2.socket.setKeepAlive(keepAlive, keepAliveMsecs || 0); - } else { - request2.on("socket", (socket) => { - socket.setKeepAlive(keepAlive, keepAliveMsecs || 0); - }); + } + __name(negate, "negate"); + var hasHeader = /* @__PURE__ */ __name((soughtHeader, headers) => { + soughtHeader = soughtHeader.toLowerCase(); + for (const headerName of Object.keys(headers)) { + if (soughtHeader === headerName.toLowerCase()) { + return true; } - }, "registerListener"); - if (deferTimeMs === 0) { - registerListener(); - return 0; } - return setTimeout(registerListener, deferTimeMs); - }, "setSocketKeepAlive"); - var DEFER_EVENT_LISTENER_TIME3 = 3e3; - var setSocketTimeout = /* @__PURE__ */ __name((request2, reject, timeoutInMs = 0) => { - const registerTimeout = /* @__PURE__ */ __name((offset) => { - request2.setTimeout(timeoutInMs - offset, () => { - request2.destroy(); - reject(Object.assign(new Error(`Connection timed out after ${timeoutInMs} ms`), { name: "TimeoutError" })); - }); - }, "registerTimeout"); - if (0 < timeoutInMs && timeoutInMs < 6e3) { - registerTimeout(0); - return 0; + return false; + }, "hasHeader"); + var import_protocol_http8 = require_dist_cjs2(); + var moveHeadersToQuery = /* @__PURE__ */ __name((request2, options = {}) => { + var _a, _b; + const { headers, query = {} } = import_protocol_http8.HttpRequest.clone(request2); + for (const name of Object.keys(headers)) { + const lname = name.toLowerCase(); + if (lname.slice(0, 6) === "x-amz-" && !((_a = options.unhoistableHeaders) == null ? void 0 : _a.has(lname)) || ((_b = options.hoistableHeaders) == null ? void 0 : _b.has(lname))) { + query[name] = headers[name]; + delete headers[name]; + } } - return setTimeout( - registerTimeout.bind(null, timeoutInMs === 0 ? 0 : DEFER_EVENT_LISTENER_TIME3), - DEFER_EVENT_LISTENER_TIME3 - ); - }, "setSocketTimeout"); - var import_stream = require("stream"); - var MIN_WAIT_TIME = 1e3; - async function writeRequestBody(httpRequest, request2, maxContinueTimeoutMs = MIN_WAIT_TIME) { - const headers = request2.headers ?? {}; - const expect = headers["Expect"] || headers["expect"]; - let timeoutId = -1; - let hasError = false; - if (expect === "100-continue") { - await Promise.race([ - new Promise((resolve) => { - timeoutId = Number(setTimeout(resolve, Math.max(MIN_WAIT_TIME, maxContinueTimeoutMs))); - }), - new Promise((resolve) => { - httpRequest.on("continue", () => { - clearTimeout(timeoutId); - resolve(); - }); - httpRequest.on("error", () => { - hasError = true; - clearTimeout(timeoutId); - resolve(); - }); - }) - ]); + return { + ...request2, + headers, + query + }; + }, "moveHeadersToQuery"); + var prepareRequest = /* @__PURE__ */ __name((request2) => { + request2 = import_protocol_http8.HttpRequest.clone(request2); + for (const headerName of Object.keys(request2.headers)) { + if (GENERATED_HEADERS.indexOf(headerName.toLowerCase()) > -1) { + delete request2.headers[headerName]; + } } - if (!hasError) { - writeBody(httpRequest, request2.body); + return request2; + }, "prepareRequest"); + var iso8601 = /* @__PURE__ */ __name((time) => toDate(time).toISOString().replace(/\.\d{3}Z$/, "Z"), "iso8601"); + var toDate = /* @__PURE__ */ __name((time) => { + if (typeof time === "number") { + return new Date(time * 1e3); } - } - __name(writeRequestBody, "writeRequestBody"); - function writeBody(httpRequest, body) { - if (body instanceof import_stream.Readable) { - body.pipe(httpRequest); - return; + if (typeof time === "string") { + if (Number(time)) { + return new Date(Number(time) * 1e3); + } + return new Date(time); } - if (body) { - if (Buffer.isBuffer(body) || typeof body === "string") { - httpRequest.end(body); - return; + return time; + }, "toDate"); + var _SignatureV4 = class _SignatureV4 { + constructor({ + applyChecksum, + credentials, + region, + service, + sha256, + uriEscapePath = true + }) { + this.headerFormatter = new HeaderFormatter(); + this.service = service; + this.sha256 = sha256; + this.uriEscapePath = uriEscapePath; + this.applyChecksum = typeof applyChecksum === "boolean" ? applyChecksum : true; + this.regionProvider = (0, import_util_middleware3.normalizeProvider)(region); + this.credentialProvider = (0, import_util_middleware3.normalizeProvider)(credentials); + } + async presign(originalRequest, options = {}) { + const { + signingDate = /* @__PURE__ */ new Date(), + expiresIn = 3600, + unsignableHeaders, + unhoistableHeaders, + signableHeaders, + hoistableHeaders, + signingRegion, + signingService + } = options; + const credentials = await this.credentialProvider(); + this.validateResolvedCredentials(credentials); + const region = signingRegion ?? await this.regionProvider(); + const { longDate, shortDate } = formatDate(signingDate); + if (expiresIn > MAX_PRESIGNED_TTL) { + return Promise.reject( + "Signature version 4 presigned URLs must have an expiration date less than one week in the future" + ); } - const uint8 = body; - if (typeof uint8 === "object" && uint8.buffer && typeof uint8.byteOffset === "number" && typeof uint8.byteLength === "number") { - httpRequest.end(Buffer.from(uint8.buffer, uint8.byteOffset, uint8.byteLength)); - return; + const scope = createScope(shortDate, region, signingService ?? this.service); + const request2 = moveHeadersToQuery(prepareRequest(originalRequest), { unhoistableHeaders, hoistableHeaders }); + if (credentials.sessionToken) { + request2.query[TOKEN_QUERY_PARAM] = credentials.sessionToken; } - httpRequest.end(Buffer.from(body)); - return; + request2.query[ALGORITHM_QUERY_PARAM] = ALGORITHM_IDENTIFIER; + request2.query[CREDENTIAL_QUERY_PARAM] = `${credentials.accessKeyId}/${scope}`; + request2.query[AMZ_DATE_QUERY_PARAM] = longDate; + request2.query[EXPIRES_QUERY_PARAM] = expiresIn.toString(10); + const canonicalHeaders = getCanonicalHeaders(request2, unsignableHeaders, signableHeaders); + request2.query[SIGNED_HEADERS_QUERY_PARAM] = getCanonicalHeaderList(canonicalHeaders); + request2.query[SIGNATURE_QUERY_PARAM] = await this.getSignature( + longDate, + scope, + this.getSigningKey(credentials, region, shortDate, signingService), + this.createCanonicalRequest(request2, canonicalHeaders, await getPayloadHash(originalRequest, this.sha256)) + ); + return request2; } - httpRequest.end(); - } - __name(writeBody, "writeBody"); - var DEFAULT_REQUEST_TIMEOUT = 0; - var _NodeHttpHandler = class _NodeHttpHandler2 { - constructor(options) { - this.socketWarningTimestamp = 0; - this.metadata = { handlerProtocol: "http/1.1" }; - this.configProvider = new Promise((resolve, reject) => { - if (typeof options === "function") { - options().then((_options) => { - resolve(this.resolveDefaultConfig(_options)); - }).catch(reject); - } else { - resolve(this.resolveDefaultConfig(options)); + async sign(toSign, options) { + if (typeof toSign === "string") { + return this.signString(toSign, options); + } else if (toSign.headers && toSign.payload) { + return this.signEvent(toSign, options); + } else if (toSign.message) { + return this.signMessage(toSign, options); + } else { + return this.signRequest(toSign, options); + } + } + async signEvent({ headers, payload }, { signingDate = /* @__PURE__ */ new Date(), priorSignature, signingRegion, signingService }) { + const region = signingRegion ?? await this.regionProvider(); + const { shortDate, longDate } = formatDate(signingDate); + const scope = createScope(shortDate, region, signingService ?? this.service); + const hashedPayload = await getPayloadHash({ headers: {}, body: payload }, this.sha256); + const hash = new this.sha256(); + hash.update(headers); + const hashedHeaders = (0, import_util_hex_encoding.toHex)(await hash.digest()); + const stringToSign = [ + EVENT_ALGORITHM_IDENTIFIER, + longDate, + scope, + priorSignature, + hashedHeaders, + hashedPayload + ].join("\n"); + return this.signString(stringToSign, { signingDate, signingRegion: region, signingService }); + } + async signMessage(signableMessage, { signingDate = /* @__PURE__ */ new Date(), signingRegion, signingService }) { + const promise = this.signEvent( + { + headers: this.headerFormatter.format(signableMessage.message.headers), + payload: signableMessage.message.body + }, + { + signingDate, + signingRegion, + signingService, + priorSignature: signableMessage.priorSignature } + ); + return promise.then((signature) => { + return { message: signableMessage.message, signature }; }); } - /** - * @returns the input if it is an HttpHandler of any class, - * or instantiates a new instance of this handler. - */ - static create(instanceOrOptions) { - if (typeof (instanceOrOptions == null ? void 0 : instanceOrOptions.handle) === "function") { - return instanceOrOptions; - } - return new _NodeHttpHandler2(instanceOrOptions); + async signString(stringToSign, { signingDate = /* @__PURE__ */ new Date(), signingRegion, signingService } = {}) { + const credentials = await this.credentialProvider(); + this.validateResolvedCredentials(credentials); + const region = signingRegion ?? await this.regionProvider(); + const { shortDate } = formatDate(signingDate); + const hash = new this.sha256(await this.getSigningKey(credentials, region, shortDate, signingService)); + hash.update((0, import_util_utf84.toUint8Array)(stringToSign)); + return (0, import_util_hex_encoding.toHex)(await hash.digest()); } - /** - * @internal - * - * @param agent - http(s) agent in use by the NodeHttpHandler instance. - * @param socketWarningTimestamp - last socket usage check timestamp. - * @param logger - channel for the warning. - * @returns timestamp of last emitted warning. - */ - static checkSocketUsage(agent, socketWarningTimestamp, logger = console) { - var _a, _b, _c; - const { sockets, requests, maxSockets } = agent; - if (typeof maxSockets !== "number" || maxSockets === Infinity) { - return socketWarningTimestamp; + async signRequest(requestToSign, { + signingDate = /* @__PURE__ */ new Date(), + signableHeaders, + unsignableHeaders, + signingRegion, + signingService + } = {}) { + const credentials = await this.credentialProvider(); + this.validateResolvedCredentials(credentials); + const region = signingRegion ?? await this.regionProvider(); + const request2 = prepareRequest(requestToSign); + const { longDate, shortDate } = formatDate(signingDate); + const scope = createScope(shortDate, region, signingService ?? this.service); + request2.headers[AMZ_DATE_HEADER] = longDate; + if (credentials.sessionToken) { + request2.headers[TOKEN_HEADER] = credentials.sessionToken; } - const interval = 15e3; - if (Date.now() - interval < socketWarningTimestamp) { - return socketWarningTimestamp; + const payloadHash = await getPayloadHash(request2, this.sha256); + if (!hasHeader(SHA256_HEADER, request2.headers) && this.applyChecksum) { + request2.headers[SHA256_HEADER] = payloadHash; } - if (sockets && requests) { - for (const origin in sockets) { - const socketsInUse = ((_a = sockets[origin]) == null ? void 0 : _a.length) ?? 0; - const requestsEnqueued = ((_b = requests[origin]) == null ? void 0 : _b.length) ?? 0; - if (socketsInUse >= maxSockets && requestsEnqueued >= 2 * maxSockets) { - (_c = logger == null ? void 0 : logger.warn) == null ? void 0 : _c.call( - logger, - `@smithy/node-http-handler:WARN - socket usage at capacity=${socketsInUse} and ${requestsEnqueued} additional requests are enqueued. -See https://docs.aws.amazon.com/sdk-for-javascript/v3/developer-guide/node-configuring-maxsockets.html -or increase socketAcquisitionWarningTimeout=(millis) in the NodeHttpHandler config.` - ); - return Date.now(); + const canonicalHeaders = getCanonicalHeaders(request2, unsignableHeaders, signableHeaders); + const signature = await this.getSignature( + longDate, + scope, + this.getSigningKey(credentials, region, shortDate, signingService), + this.createCanonicalRequest(request2, canonicalHeaders, payloadHash) + ); + request2.headers[AUTH_HEADER] = `${ALGORITHM_IDENTIFIER} Credential=${credentials.accessKeyId}/${scope}, SignedHeaders=${getCanonicalHeaderList(canonicalHeaders)}, Signature=${signature}`; + return request2; + } + createCanonicalRequest(request2, canonicalHeaders, payloadHash) { + const sortedHeaders = Object.keys(canonicalHeaders).sort(); + return `${request2.method} +${this.getCanonicalPath(request2)} +${getCanonicalQuery(request2)} +${sortedHeaders.map((name) => `${name}:${canonicalHeaders[name]}`).join("\n")} + +${sortedHeaders.join(";")} +${payloadHash}`; + } + async createStringToSign(longDate, credentialScope, canonicalRequest) { + const hash = new this.sha256(); + hash.update((0, import_util_utf84.toUint8Array)(canonicalRequest)); + const hashedRequest = await hash.digest(); + return `${ALGORITHM_IDENTIFIER} +${longDate} +${credentialScope} +${(0, import_util_hex_encoding.toHex)(hashedRequest)}`; + } + getCanonicalPath({ path }) { + if (this.uriEscapePath) { + const normalizedPathSegments = []; + for (const pathSegment of path.split("/")) { + if ((pathSegment == null ? void 0 : pathSegment.length) === 0) + continue; + if (pathSegment === ".") + continue; + if (pathSegment === "..") { + normalizedPathSegments.pop(); + } else { + normalizedPathSegments.push(pathSegment); } } + const normalizedPath = `${(path == null ? void 0 : path.startsWith("/")) ? "/" : ""}${normalizedPathSegments.join("/")}${normalizedPathSegments.length > 0 && (path == null ? void 0 : path.endsWith("/")) ? "/" : ""}`; + const doubleEncoded = (0, import_util_uri_escape.escapeUri)(normalizedPath); + return doubleEncoded.replace(/%2F/g, "/"); } - return socketWarningTimestamp; + return path; } - resolveDefaultConfig(options) { - const { requestTimeout, connectionTimeout, socketTimeout, httpAgent, httpsAgent } = options || {}; - const keepAlive = true; - const maxSockets = 50; - return { - connectionTimeout, - requestTimeout: requestTimeout ?? socketTimeout, - httpAgent: (() => { - if (httpAgent instanceof import_http2.Agent || typeof (httpAgent == null ? void 0 : httpAgent.destroy) === "function") { - return httpAgent; - } - return new import_http2.Agent({ keepAlive, maxSockets, ...httpAgent }); - })(), - httpsAgent: (() => { - if (httpsAgent instanceof import_https.Agent || typeof (httpsAgent == null ? void 0 : httpsAgent.destroy) === "function") { - return httpsAgent; - } - return new import_https.Agent({ keepAlive, maxSockets, ...httpsAgent }); - })(), - logger: console - }; + async getSignature(longDate, credentialScope, keyPromise, canonicalRequest) { + const stringToSign = await this.createStringToSign(longDate, credentialScope, canonicalRequest); + const hash = new this.sha256(await keyPromise); + hash.update((0, import_util_utf84.toUint8Array)(stringToSign)); + return (0, import_util_hex_encoding.toHex)(await hash.digest()); } - destroy() { - var _a, _b, _c, _d; - (_b = (_a = this.config) == null ? void 0 : _a.httpAgent) == null ? void 0 : _b.destroy(); - (_d = (_c = this.config) == null ? void 0 : _c.httpsAgent) == null ? void 0 : _d.destroy(); + getSigningKey(credentials, region, shortDate, service) { + return getSigningKey(this.sha256, credentials, shortDate, region, service || this.service); } - async handle(request2, { abortSignal } = {}) { - if (!this.config) { - this.config = await this.configProvider; + validateResolvedCredentials(credentials) { + if (typeof credentials !== "object" || // @ts-expect-error: Property 'accessKeyId' does not exist on type 'object'.ts(2339) + typeof credentials.accessKeyId !== "string" || // @ts-expect-error: Property 'secretAccessKey' does not exist on type 'object'.ts(2339) + typeof credentials.secretAccessKey !== "string") { + throw new Error("Resolved credential object is not valid"); } - return new Promise((_resolve, _reject) => { - let writeRequestBodyPromise = void 0; - const timeouts = []; - const resolve = /* @__PURE__ */ __name(async (arg) => { - await writeRequestBodyPromise; - timeouts.forEach(clearTimeout); - _resolve(arg); - }, "resolve"); - const reject = /* @__PURE__ */ __name(async (arg) => { - await writeRequestBodyPromise; - timeouts.forEach(clearTimeout); - _reject(arg); - }, "reject"); - if (!this.config) { - throw new Error("Node HTTP request handler config is not resolved"); - } - if (abortSignal == null ? void 0 : abortSignal.aborted) { - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - reject(abortError); - return; - } - const isSSL = request2.protocol === "https:"; - const agent = isSSL ? this.config.httpsAgent : this.config.httpAgent; - timeouts.push( - setTimeout( - () => { - this.socketWarningTimestamp = _NodeHttpHandler2.checkSocketUsage( - agent, - this.socketWarningTimestamp, - this.config.logger - ); - }, - this.config.socketAcquisitionWarningTimeout ?? (this.config.requestTimeout ?? 2e3) + (this.config.connectionTimeout ?? 1e3) - ) - ); - const queryString = (0, import_querystring_builder.buildQueryString)(request2.query || {}); - let auth = void 0; - if (request2.username != null || request2.password != null) { - const username = request2.username ?? ""; - const password = request2.password ?? ""; - auth = `${username}:${password}`; - } - let path = request2.path; - if (queryString) { - path += `?${queryString}`; - } - if (request2.fragment) { - path += `#${request2.fragment}`; - } - const nodeHttpsOptions = { - headers: request2.headers, - host: request2.hostname, - method: request2.method, - path, - port: request2.port, - agent, - auth + } + }; + __name(_SignatureV4, "SignatureV4"); + var SignatureV42 = _SignatureV4; + var formatDate = /* @__PURE__ */ __name((now) => { + const longDate = iso8601(now).replace(/[\-:]/g, ""); + return { + longDate, + shortDate: longDate.slice(0, 8) + }; + }, "formatDate"); + var getCanonicalHeaderList = /* @__PURE__ */ __name((headers) => Object.keys(headers).sort().join(";"), "getCanonicalHeaderList"); + } +}); + +// ../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/aws_sdk/resolveAwsSdkSigV4Config.js +var import_signature_v4, resolveAwsSdkSigV4Config, resolveAWSSDKSigV4Config; +var init_resolveAwsSdkSigV4Config = __esm({ + "../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/aws_sdk/resolveAwsSdkSigV4Config.js"() { + init_dist_es(); + import_signature_v4 = __toESM(require_dist_cjs35()); + resolveAwsSdkSigV4Config = (config) => { + let normalizedCreds; + if (config.credentials) { + normalizedCreds = memoizeIdentityProvider(config.credentials, isIdentityExpired, doesIdentityRequireRefresh); + } + if (!normalizedCreds) { + if (config.credentialDefaultProvider) { + normalizedCreds = normalizeProvider(config.credentialDefaultProvider(Object.assign({}, config, { + parentClientConfig: config + }))); + } else { + normalizedCreds = async () => { + throw new Error("`credentials` is missing"); }; - const requestFunc = isSSL ? import_https.request : import_http2.request; - const req = requestFunc(nodeHttpsOptions, (res) => { - const httpResponse = new import_protocol_http8.HttpResponse({ - statusCode: res.statusCode || -1, - reason: res.statusMessage, - headers: getTransformedHeaders(res.headers), - body: res - }); - resolve({ response: httpResponse }); - }); - req.on("error", (err) => { - if (NODEJS_TIMEOUT_ERROR_CODES.includes(err.code)) { - reject(Object.assign(err, { name: "TimeoutError" })); - } else { - reject(err); - } - }); - if (abortSignal) { - const onAbort = /* @__PURE__ */ __name(() => { - req.destroy(); - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - reject(abortError); - }, "onAbort"); - if (typeof abortSignal.addEventListener === "function") { - const signal = abortSignal; - signal.addEventListener("abort", onAbort, { once: true }); - req.once("close", () => signal.removeEventListener("abort", onAbort)); - } else { - abortSignal.onabort = onAbort; - } - } - timeouts.push(setConnectionTimeout(req, reject, this.config.connectionTimeout)); - timeouts.push(setSocketTimeout(req, reject, this.config.requestTimeout)); - const httpAgent = nodeHttpsOptions.agent; - if (typeof httpAgent === "object" && "keepAlive" in httpAgent) { - timeouts.push( - setSocketKeepAlive(req, { - // @ts-expect-error keepAlive is not public on httpAgent. - keepAlive: httpAgent.keepAlive, - // @ts-expect-error keepAliveMsecs is not public on httpAgent. - keepAliveMsecs: httpAgent.keepAliveMsecs - }) - ); - } - writeRequestBodyPromise = writeRequestBody(req, request2, this.config.requestTimeout).catch((e) => { - timeouts.forEach(clearTimeout); - return _reject(e); - }); - }); + } } - updateHttpClientConfig(key, value) { - this.config = void 0; - this.configProvider = this.configProvider.then((config) => { - return { + const { signingEscapePath = true, systemClockOffset = config.systemClockOffset || 0, sha256 } = config; + let signer; + if (config.signer) { + signer = normalizeProvider(config.signer); + } else if (config.regionInfoProvider) { + signer = () => normalizeProvider(config.region)().then(async (region) => [ + await config.regionInfoProvider(region, { + useFipsEndpoint: await config.useFipsEndpoint(), + useDualstackEndpoint: await config.useDualstackEndpoint() + }) || {}, + region + ]).then(([regionInfo, region]) => { + const { signingRegion, signingService } = regionInfo; + config.signingRegion = config.signingRegion || signingRegion || region; + config.signingName = config.signingName || signingService || config.serviceId; + const params = { ...config, - [key]: value + credentials: normalizedCreds, + region: config.signingRegion, + service: config.signingName, + sha256, + uriEscapePath: signingEscapePath }; + const SignerCtor = config.signerConstructor || import_signature_v4.SignatureV4; + return new SignerCtor(params); }); + } else { + signer = async (authScheme) => { + authScheme = Object.assign({}, { + name: "sigv4", + signingName: config.signingName || config.defaultSigningName, + signingRegion: await normalizeProvider(config.region)(), + properties: {} + }, authScheme); + const signingRegion = authScheme.signingRegion; + const signingService = authScheme.signingName; + config.signingRegion = config.signingRegion || signingRegion; + config.signingName = config.signingName || signingService || config.serviceId; + const params = { + ...config, + credentials: normalizedCreds, + region: config.signingRegion, + service: config.signingName, + sha256, + uriEscapePath: signingEscapePath + }; + const SignerCtor = config.signerConstructor || import_signature_v4.SignatureV4; + return new SignerCtor(params); + }; } - httpHandlerConfigs() { - return this.config ?? {}; - } + return { + ...config, + systemClockOffset, + signingEscapePath, + credentials: normalizedCreds, + signer + }; }; - __name(_NodeHttpHandler, "NodeHttpHandler"); - var NodeHttpHandler = _NodeHttpHandler; - var import_http22 = require("http2"); - var import_http23 = __toESM2(require("http2")); - var _NodeHttp2ConnectionPool = class _NodeHttp2ConnectionPool { - constructor(sessions) { - this.sessions = []; - this.sessions = sessions ?? []; - } - poll() { - if (this.sessions.length > 0) { - return this.sessions.shift(); - } + resolveAWSSDKSigV4Config = resolveAwsSdkSigV4Config; + } +}); + +// ../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/aws_sdk/index.js +var init_aws_sdk = __esm({ + "../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/aws_sdk/index.js"() { + init_AwsSdkSigV4Signer(); + init_AwsSdkSigV4ASigner(); + init_resolveAwsSdkSigV4AConfig(); + init_resolveAwsSdkSigV4Config(); + } +}); + +// ../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/index.js +var init_httpAuthSchemes2 = __esm({ + "../../../node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/index.js"() { + init_aws_sdk(); + } +}); + +// ../../../node_modules/@aws-sdk/core/dist-es/submodules/protocols/coercing-serializers.js +var _toStr, _toBool, _toNum; +var init_coercing_serializers = __esm({ + "../../../node_modules/@aws-sdk/core/dist-es/submodules/protocols/coercing-serializers.js"() { + _toStr = (val2) => { + if (val2 == null) { + return val2; } - offerLast(session) { - this.sessions.push(session); + if (typeof val2 === "number" || typeof val2 === "bigint") { + const warning = new Error(`Received number ${val2} where a string was expected.`); + warning.name = "Warning"; + console.warn(warning); + return String(val2); } - contains(session) { - return this.sessions.includes(session); + if (typeof val2 === "boolean") { + const warning = new Error(`Received boolean ${val2} where a string was expected.`); + warning.name = "Warning"; + console.warn(warning); + return String(val2); } - remove(session) { - this.sessions = this.sessions.filter((s) => s !== session); + return val2; + }; + _toBool = (val2) => { + if (val2 == null) { + return val2; } - [Symbol.iterator]() { - return this.sessions[Symbol.iterator](); + if (typeof val2 === "number") { } - destroy(connection) { - for (const session of this.sessions) { - if (session === connection) { - if (!session.destroyed) { - session.destroy(); - } - } + if (typeof val2 === "string") { + const lowercase = val2.toLowerCase(); + if (val2 !== "" && lowercase !== "false" && lowercase !== "true") { + const warning = new Error(`Received string "${val2}" where a boolean was expected.`); + warning.name = "Warning"; + console.warn(warning); } + return val2 !== "" && lowercase !== "false"; } + return val2; }; - __name(_NodeHttp2ConnectionPool, "NodeHttp2ConnectionPool"); - var NodeHttp2ConnectionPool = _NodeHttp2ConnectionPool; - var _NodeHttp2ConnectionManager = class _NodeHttp2ConnectionManager { - constructor(config) { - this.sessionCache = /* @__PURE__ */ new Map(); - this.config = config; - if (this.config.maxConcurrency && this.config.maxConcurrency <= 0) { - throw new RangeError("maxConcurrency must be greater than zero."); + _toNum = (val2) => { + if (val2 == null) { + return val2; + } + if (typeof val2 === "boolean") { + } + if (typeof val2 === "string") { + const num = Number(val2); + if (num.toString() !== val2) { + const warning = new Error(`Received string "${val2}" where a number was expected.`); + warning.name = "Warning"; + console.warn(warning); + return val2; } + return num; } - lease(requestContext, connectionConfiguration) { - const url2 = this.getUrlString(requestContext); - const existingPool = this.sessionCache.get(url2); - if (existingPool) { - const existingSession = existingPool.poll(); - if (existingSession && !this.config.disableConcurrency) { - return existingSession; + return val2; + }; + } +}); + +// ../../../node_modules/@aws-sdk/core/dist-es/submodules/protocols/json/awsExpectUnion.js +var import_smithy_client, awsExpectUnion; +var init_awsExpectUnion = __esm({ + "../../../node_modules/@aws-sdk/core/dist-es/submodules/protocols/json/awsExpectUnion.js"() { + import_smithy_client = __toESM(require_dist_cjs33()); + awsExpectUnion = (value) => { + if (value == null) { + return void 0; + } + if (typeof value === "object" && "__type" in value) { + delete value.__type; + } + return (0, import_smithy_client.expectUnion)(value); + }; + } +}); + +// ../../../node_modules/@aws-sdk/core/dist-es/submodules/protocols/common.js +var import_smithy_client2, collectBodyString; +var init_common = __esm({ + "../../../node_modules/@aws-sdk/core/dist-es/submodules/protocols/common.js"() { + import_smithy_client2 = __toESM(require_dist_cjs33()); + collectBodyString = (streamBody, context) => (0, import_smithy_client2.collectBody)(streamBody, context).then((body) => context.utf8Encoder(body)); + } +}); + +// ../../../node_modules/@aws-sdk/core/dist-es/submodules/protocols/json/parseJsonBody.js +var parseJsonBody, parseJsonErrorBody, loadRestJsonErrorCode; +var init_parseJsonBody = __esm({ + "../../../node_modules/@aws-sdk/core/dist-es/submodules/protocols/json/parseJsonBody.js"() { + init_common(); + parseJsonBody = (streamBody, context) => collectBodyString(streamBody, context).then((encoded) => { + if (encoded.length) { + try { + return JSON.parse(encoded); + } catch (e) { + if (e?.name === "SyntaxError") { + Object.defineProperty(e, "$responseBodyText", { + value: encoded + }); } + throw e; } - const session = import_http23.default.connect(url2); - if (this.config.maxConcurrency) { - session.settings({ maxConcurrentStreams: this.config.maxConcurrency }, (err) => { - if (err) { - throw new Error( - "Fail to set maxConcurrentStreams to " + this.config.maxConcurrency + "when creating new session for " + requestContext.destination.toString() - ); - } - }); + } + return {}; + }); + parseJsonErrorBody = async (errorBody, context) => { + const value = await parseJsonBody(errorBody, context); + value.message = value.message ?? value.Message; + return value; + }; + loadRestJsonErrorCode = (output, data) => { + const findKey = (object, key) => Object.keys(object).find((k) => k.toLowerCase() === key.toLowerCase()); + const sanitizeErrorCode = (rawValue) => { + let cleanValue = rawValue; + if (typeof cleanValue === "number") { + cleanValue = cleanValue.toString(); } - session.unref(); - const destroySessionCb = /* @__PURE__ */ __name(() => { - session.destroy(); - this.deleteSession(url2, session); - }, "destroySessionCb"); - session.on("goaway", destroySessionCb); - session.on("error", destroySessionCb); - session.on("frameError", destroySessionCb); - session.on("close", () => this.deleteSession(url2, session)); - if (connectionConfiguration.requestTimeout) { - session.setTimeout(connectionConfiguration.requestTimeout, destroySessionCb); + if (cleanValue.indexOf(",") >= 0) { + cleanValue = cleanValue.split(",")[0]; } - const connectionPool = this.sessionCache.get(url2) || new NodeHttp2ConnectionPool(); - connectionPool.offerLast(session); - this.sessionCache.set(url2, connectionPool); - return session; - } - /** - * Delete a session from the connection pool. - * @param authority The authority of the session to delete. - * @param session The session to delete. - */ - deleteSession(authority, session) { - const existingConnectionPool = this.sessionCache.get(authority); - if (!existingConnectionPool) { - return; + if (cleanValue.indexOf(":") >= 0) { + cleanValue = cleanValue.split(":")[0]; } - if (!existingConnectionPool.contains(session)) { - return; + if (cleanValue.indexOf("#") >= 0) { + cleanValue = cleanValue.split("#")[1]; } - existingConnectionPool.remove(session); - this.sessionCache.set(authority, existingConnectionPool); + return cleanValue; + }; + const headerKey = findKey(output.headers, "x-amzn-errortype"); + if (headerKey !== void 0) { + return sanitizeErrorCode(output.headers[headerKey]); } - release(requestContext, session) { - var _a; - const cacheKey = this.getUrlString(requestContext); - (_a = this.sessionCache.get(cacheKey)) == null ? void 0 : _a.offerLast(session); + if (data.code !== void 0) { + return sanitizeErrorCode(data.code); } - destroy() { - for (const [key, connectionPool] of this.sessionCache) { - for (const session of connectionPool) { - if (!session.destroyed) { - session.destroy(); - } - connectionPool.remove(session); - } - this.sessionCache.delete(key); - } + if (data["__type"] !== void 0) { + return sanitizeErrorCode(data["__type"]); } - setMaxConcurrentStreams(maxConcurrentStreams) { - if (this.config.maxConcurrency && this.config.maxConcurrency <= 0) { - throw new RangeError("maxConcurrentStreams must be greater than zero."); + }; + } +}); + +// ../../../node_modules/fast-xml-parser/src/util.js +var require_util = __commonJS({ + "../../../node_modules/fast-xml-parser/src/util.js"(exports2) { + "use strict"; + var nameStartChar = ":A-Za-z_\\u00C0-\\u00D6\\u00D8-\\u00F6\\u00F8-\\u02FF\\u0370-\\u037D\\u037F-\\u1FFF\\u200C-\\u200D\\u2070-\\u218F\\u2C00-\\u2FEF\\u3001-\\uD7FF\\uF900-\\uFDCF\\uFDF0-\\uFFFD"; + var nameChar = nameStartChar + "\\-.\\d\\u00B7\\u0300-\\u036F\\u203F-\\u2040"; + var nameRegexp = "[" + nameStartChar + "][" + nameChar + "]*"; + var regexName = new RegExp("^" + nameRegexp + "$"); + var getAllMatches = function(string, regex) { + const matches = []; + let match = regex.exec(string); + while (match) { + const allmatches = []; + allmatches.startIndex = regex.lastIndex - match[0].length; + const len = match.length; + for (let index = 0; index < len; index++) { + allmatches.push(match[index]); } - this.config.maxConcurrency = maxConcurrentStreams; - } - setDisableConcurrentStreams(disableConcurrentStreams) { - this.config.disableConcurrency = disableConcurrentStreams; - } - getUrlString(request2) { - return request2.destination.toString(); + matches.push(allmatches); + match = regex.exec(string); } + return matches; }; - __name(_NodeHttp2ConnectionManager, "NodeHttp2ConnectionManager"); - var NodeHttp2ConnectionManager = _NodeHttp2ConnectionManager; - var _NodeHttp2Handler = class _NodeHttp2Handler2 { - constructor(options) { - this.metadata = { handlerProtocol: "h2" }; - this.connectionManager = new NodeHttp2ConnectionManager({}); - this.configProvider = new Promise((resolve, reject) => { - if (typeof options === "function") { - options().then((opts) => { - resolve(opts || {}); - }).catch(reject); + var isName = function(string) { + const match = regexName.exec(string); + return !(match === null || typeof match === "undefined"); + }; + exports2.isExist = function(v) { + return typeof v !== "undefined"; + }; + exports2.isEmptyObject = function(obj) { + return Object.keys(obj).length === 0; + }; + exports2.merge = function(target, a, arrayMode) { + if (a) { + const keys = Object.keys(a); + const len = keys.length; + for (let i = 0; i < len; i++) { + if (arrayMode === "strict") { + target[keys[i]] = [a[keys[i]]]; } else { - resolve(options || {}); + target[keys[i]] = a[keys[i]]; } - }); - } - /** - * @returns the input if it is an HttpHandler of any class, - * or instantiates a new instance of this handler. - */ - static create(instanceOrOptions) { - if (typeof (instanceOrOptions == null ? void 0 : instanceOrOptions.handle) === "function") { - return instanceOrOptions; } - return new _NodeHttp2Handler2(instanceOrOptions); } - destroy() { - this.connectionManager.destroy(); + }; + exports2.getValue = function(v) { + if (exports2.isExist(v)) { + return v; + } else { + return ""; } - async handle(request2, { abortSignal } = {}) { - if (!this.config) { - this.config = await this.configProvider; - this.connectionManager.setDisableConcurrentStreams(this.config.disableConcurrentStreams || false); - if (this.config.maxConcurrentStreams) { - this.connectionManager.setMaxConcurrentStreams(this.config.maxConcurrentStreams); - } - } - const { requestTimeout, disableConcurrentStreams } = this.config; - return new Promise((_resolve, _reject) => { - var _a; - let fulfilled = false; - let writeRequestBodyPromise = void 0; - const resolve = /* @__PURE__ */ __name(async (arg) => { - await writeRequestBodyPromise; - _resolve(arg); - }, "resolve"); - const reject = /* @__PURE__ */ __name(async (arg) => { - await writeRequestBodyPromise; - _reject(arg); - }, "reject"); - if (abortSignal == null ? void 0 : abortSignal.aborted) { - fulfilled = true; - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - reject(abortError); - return; - } - const { hostname, method, port, protocol, query } = request2; - let auth = ""; - if (request2.username != null || request2.password != null) { - const username = request2.username ?? ""; - const password = request2.password ?? ""; - auth = `${username}:${password}@`; - } - const authority = `${protocol}//${auth}${hostname}${port ? `:${port}` : ""}`; - const requestContext = { destination: new URL(authority) }; - const session = this.connectionManager.lease(requestContext, { - requestTimeout: (_a = this.config) == null ? void 0 : _a.sessionTimeout, - disableConcurrentStreams: disableConcurrentStreams || false - }); - const rejectWithDestroy = /* @__PURE__ */ __name((err) => { - if (disableConcurrentStreams) { - this.destroySession(session); + }; + exports2.isName = isName; + exports2.getAllMatches = getAllMatches; + exports2.nameRegexp = nameRegexp; + } +}); + +// ../../../node_modules/fast-xml-parser/src/validator.js +var require_validator = __commonJS({ + "../../../node_modules/fast-xml-parser/src/validator.js"(exports2) { + "use strict"; + var util = require_util(); + var defaultOptions = { + allowBooleanAttributes: false, + //A tag can have attributes without any value + unpairedTags: [] + }; + exports2.validate = function(xmlData, options) { + options = Object.assign({}, defaultOptions, options); + const tags = []; + let tagFound = false; + let reachedRoot = false; + if (xmlData[0] === "\uFEFF") { + xmlData = xmlData.substr(1); + } + for (let i = 0; i < xmlData.length; i++) { + if (xmlData[i] === "<" && xmlData[i + 1] === "?") { + i += 2; + i = readPI(xmlData, i); + if (i.err) return i; + } else if (xmlData[i] === "<") { + let tagStartPos = i; + i++; + if (xmlData[i] === "!") { + i = readCommentAndCDATA(xmlData, i); + continue; + } else { + let closingTag = false; + if (xmlData[i] === "/") { + closingTag = true; + i++; } - fulfilled = true; - reject(err); - }, "rejectWithDestroy"); - const queryString = (0, import_querystring_builder.buildQueryString)(query || {}); - let path = request2.path; - if (queryString) { - path += `?${queryString}`; - } - if (request2.fragment) { - path += `#${request2.fragment}`; - } - const req = session.request({ - ...request2.headers, - [import_http22.constants.HTTP2_HEADER_PATH]: path, - [import_http22.constants.HTTP2_HEADER_METHOD]: method - }); - session.ref(); - req.on("response", (headers) => { - const httpResponse = new import_protocol_http8.HttpResponse({ - statusCode: headers[":status"] || -1, - headers: getTransformedHeaders(headers), - body: req - }); - fulfilled = true; - resolve({ response: httpResponse }); - if (disableConcurrentStreams) { - session.close(); - this.connectionManager.deleteSession(authority, session); + let tagName = ""; + for (; i < xmlData.length && xmlData[i] !== ">" && xmlData[i] !== " " && xmlData[i] !== " " && xmlData[i] !== "\n" && xmlData[i] !== "\r"; i++) { + tagName += xmlData[i]; } - }); - if (requestTimeout) { - req.setTimeout(requestTimeout, () => { - req.close(); - const timeoutError = new Error(`Stream timed out because of no activity for ${requestTimeout} ms`); - timeoutError.name = "TimeoutError"; - rejectWithDestroy(timeoutError); - }); - } - if (abortSignal) { - const onAbort = /* @__PURE__ */ __name(() => { - req.close(); - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - rejectWithDestroy(abortError); - }, "onAbort"); - if (typeof abortSignal.addEventListener === "function") { - const signal = abortSignal; - signal.addEventListener("abort", onAbort, { once: true }); - req.once("close", () => signal.removeEventListener("abort", onAbort)); + tagName = tagName.trim(); + if (tagName[tagName.length - 1] === "/") { + tagName = tagName.substring(0, tagName.length - 1); + i--; + } + if (!validateTagName(tagName)) { + let msg; + if (tagName.trim().length === 0) { + msg = "Invalid space after '<'."; + } else { + msg = "Tag '" + tagName + "' is an invalid name."; + } + return getErrorObject("InvalidTag", msg, getLineNumberForPosition(xmlData, i)); + } + const result = readAttributeStr(xmlData, i); + if (result === false) { + return getErrorObject("InvalidAttr", "Attributes for '" + tagName + "' have open quote.", getLineNumberForPosition(xmlData, i)); + } + let attrStr = result.value; + i = result.index; + if (attrStr[attrStr.length - 1] === "/") { + const attrStrStart = i - attrStr.length; + attrStr = attrStr.substring(0, attrStr.length - 1); + const isValid = validateAttributeString(attrStr, options); + if (isValid === true) { + tagFound = true; + } else { + return getErrorObject(isValid.err.code, isValid.err.msg, getLineNumberForPosition(xmlData, attrStrStart + isValid.err.line)); + } + } else if (closingTag) { + if (!result.tagClosed) { + return getErrorObject("InvalidTag", "Closing tag '" + tagName + "' doesn't have proper closing.", getLineNumberForPosition(xmlData, i)); + } else if (attrStr.trim().length > 0) { + return getErrorObject("InvalidTag", "Closing tag '" + tagName + "' can't have attributes or invalid starting.", getLineNumberForPosition(xmlData, tagStartPos)); + } else if (tags.length === 0) { + return getErrorObject("InvalidTag", "Closing tag '" + tagName + "' has not been opened.", getLineNumberForPosition(xmlData, tagStartPos)); + } else { + const otg = tags.pop(); + if (tagName !== otg.tagName) { + let openPos = getLineNumberForPosition(xmlData, otg.tagStartPos); + return getErrorObject( + "InvalidTag", + "Expected closing tag '" + otg.tagName + "' (opened in line " + openPos.line + ", col " + openPos.col + ") instead of closing tag '" + tagName + "'.", + getLineNumberForPosition(xmlData, tagStartPos) + ); + } + if (tags.length == 0) { + reachedRoot = true; + } + } } else { - abortSignal.onabort = onAbort; + const isValid = validateAttributeString(attrStr, options); + if (isValid !== true) { + return getErrorObject(isValid.err.code, isValid.err.msg, getLineNumberForPosition(xmlData, i - attrStr.length + isValid.err.line)); + } + if (reachedRoot === true) { + return getErrorObject("InvalidXml", "Multiple possible root nodes found.", getLineNumberForPosition(xmlData, i)); + } else if (options.unpairedTags.indexOf(tagName) !== -1) { + } else { + tags.push({ tagName, tagStartPos }); + } + tagFound = true; } - } - req.on("frameError", (type, code, id) => { - rejectWithDestroy(new Error(`Frame type id ${type} in stream id ${id} has failed with code ${code}.`)); - }); - req.on("error", rejectWithDestroy); - req.on("aborted", () => { - rejectWithDestroy( - new Error(`HTTP/2 stream is abnormally aborted in mid-communication with result code ${req.rstCode}.`) - ); - }); - req.on("close", () => { - session.unref(); - if (disableConcurrentStreams) { - session.destroy(); + for (i++; i < xmlData.length; i++) { + if (xmlData[i] === "<") { + if (xmlData[i + 1] === "!") { + i++; + i = readCommentAndCDATA(xmlData, i); + continue; + } else if (xmlData[i + 1] === "?") { + i = readPI(xmlData, ++i); + if (i.err) return i; + } else { + break; + } + } else if (xmlData[i] === "&") { + const afterAmp = validateAmpersand(xmlData, i); + if (afterAmp == -1) + return getErrorObject("InvalidChar", "char '&' is not expected.", getLineNumberForPosition(xmlData, i)); + i = afterAmp; + } else { + if (reachedRoot === true && !isWhiteSpace(xmlData[i])) { + return getErrorObject("InvalidXml", "Extra text at the end", getLineNumberForPosition(xmlData, i)); + } + } } - if (!fulfilled) { - rejectWithDestroy(new Error("Unexpected error: http2 request did not get a response")); + if (xmlData[i] === "<") { + i--; } - }); - writeRequestBodyPromise = writeRequestBody(req, request2, requestTimeout); - }); - } - updateHttpClientConfig(key, value) { - this.config = void 0; - this.configProvider = this.configProvider.then((config) => { - return { - ...config, - [key]: value - }; - }); - } - httpHandlerConfigs() { - return this.config ?? {}; - } - /** - * Destroys a session. - * @param session The session to destroy. - */ - destroySession(session) { - if (!session.destroyed) { - session.destroy(); + } + } else { + if (isWhiteSpace(xmlData[i])) { + continue; + } + return getErrorObject("InvalidChar", "char '" + xmlData[i] + "' is not expected.", getLineNumberForPosition(xmlData, i)); } } - }; - __name(_NodeHttp2Handler, "NodeHttp2Handler"); - var NodeHttp2Handler = _NodeHttp2Handler; - var _Collector = class _Collector extends import_stream.Writable { - constructor() { - super(...arguments); - this.bufferedBytes = []; - } - _write(chunk, encoding, callback) { - this.bufferedBytes.push(chunk); - callback(); + if (!tagFound) { + return getErrorObject("InvalidXml", "Start tag expected.", 1); + } else if (tags.length == 1) { + return getErrorObject("InvalidTag", "Unclosed tag '" + tags[0].tagName + "'.", getLineNumberForPosition(xmlData, tags[0].tagStartPos)); + } else if (tags.length > 0) { + return getErrorObject("InvalidXml", "Invalid '" + JSON.stringify(tags.map((t) => t.tagName), null, 4).replace(/\r?\n/g, "") + "' found.", { line: 1, col: 1 }); } + return true; }; - __name(_Collector, "Collector"); - var Collector = _Collector; - var streamCollector = /* @__PURE__ */ __name((stream) => { - if (isReadableStreamInstance(stream)) { - return collectReadableStream(stream); - } - return new Promise((resolve, reject) => { - const collector = new Collector(); - stream.pipe(collector); - stream.on("error", (err) => { - collector.end(); - reject(err); - }); - collector.on("error", reject); - collector.on("finish", function() { - const bytes = new Uint8Array(Buffer.concat(this.bufferedBytes)); - resolve(bytes); - }); - }); - }, "streamCollector"); - var isReadableStreamInstance = /* @__PURE__ */ __name((stream) => typeof ReadableStream === "function" && stream instanceof ReadableStream, "isReadableStreamInstance"); - async function collectReadableStream(stream) { - const chunks = []; - const reader = stream.getReader(); - let isDone = false; - let length = 0; - while (!isDone) { - const { done, value } = await reader.read(); - if (value) { - chunks.push(value); - length += value.length; + function isWhiteSpace(char) { + return char === " " || char === " " || char === "\n" || char === "\r"; + } + function readPI(xmlData, i) { + const start = i; + for (; i < xmlData.length; i++) { + if (xmlData[i] == "?" || xmlData[i] == " ") { + const tagname = xmlData.substr(start, i - start); + if (i > 5 && tagname === "xml") { + return getErrorObject("InvalidXml", "XML declaration allowed only at the start of the document.", getLineNumberForPosition(xmlData, i)); + } else if (xmlData[i] == "?" && xmlData[i + 1] == ">") { + i++; + break; + } else { + continue; + } } - isDone = done; } - const collected = new Uint8Array(length); - let offset = 0; - for (const chunk of chunks) { - collected.set(chunk, offset); - offset += chunk.length; + return i; + } + function readCommentAndCDATA(xmlData, i) { + if (xmlData.length > i + 5 && xmlData[i + 1] === "-" && xmlData[i + 2] === "-") { + for (i += 3; i < xmlData.length; i++) { + if (xmlData[i] === "-" && xmlData[i + 1] === "-" && xmlData[i + 2] === ">") { + i += 2; + break; + } + } + } else if (xmlData.length > i + 8 && xmlData[i + 1] === "D" && xmlData[i + 2] === "O" && xmlData[i + 3] === "C" && xmlData[i + 4] === "T" && xmlData[i + 5] === "Y" && xmlData[i + 6] === "P" && xmlData[i + 7] === "E") { + let angleBracketsCount = 1; + for (i += 8; i < xmlData.length; i++) { + if (xmlData[i] === "<") { + angleBracketsCount++; + } else if (xmlData[i] === ">") { + angleBracketsCount--; + if (angleBracketsCount === 0) { + break; + } + } + } + } else if (xmlData.length > i + 9 && xmlData[i + 1] === "[" && xmlData[i + 2] === "C" && xmlData[i + 3] === "D" && xmlData[i + 4] === "A" && xmlData[i + 5] === "T" && xmlData[i + 6] === "A" && xmlData[i + 7] === "[") { + for (i += 8; i < xmlData.length; i++) { + if (xmlData[i] === "]" && xmlData[i + 1] === "]" && xmlData[i + 2] === ">") { + i += 2; + break; + } + } } - return collected; + return i; } - __name(collectReadableStream, "collectReadableStream"); - } -}); - -// ../../../node_modules/@aws-sdk/credential-provider-http/dist-cjs/fromHttp/checkUrl.js -var require_checkUrl = __commonJS({ - "../../../node_modules/@aws-sdk/credential-provider-http/dist-cjs/fromHttp/checkUrl.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.checkUrl = void 0; - var property_provider_1 = require_dist_cjs40(); - var ECS_CONTAINER_HOST = "169.254.170.2"; - var EKS_CONTAINER_HOST_IPv4 = "169.254.170.23"; - var EKS_CONTAINER_HOST_IPv6 = "[fd00:ec2::23]"; - var checkUrl = (url2, logger) => { - if (url2.protocol === "https:") { - return; + var doubleQuote = '"'; + var singleQuote = "'"; + function readAttributeStr(xmlData, i) { + let attrStr = ""; + let startChar = ""; + let tagClosed = false; + for (; i < xmlData.length; i++) { + if (xmlData[i] === doubleQuote || xmlData[i] === singleQuote) { + if (startChar === "") { + startChar = xmlData[i]; + } else if (startChar !== xmlData[i]) { + } else { + startChar = ""; + } + } else if (xmlData[i] === ">") { + if (startChar === "") { + tagClosed = true; + break; + } + } + attrStr += xmlData[i]; } - if (url2.hostname === ECS_CONTAINER_HOST || url2.hostname === EKS_CONTAINER_HOST_IPv4 || url2.hostname === EKS_CONTAINER_HOST_IPv6) { - return; + if (startChar !== "") { + return false; } - if (url2.hostname.includes("[")) { - if (url2.hostname === "[::1]" || url2.hostname === "[0000:0000:0000:0000:0000:0000:0000:0001]") { - return; + return { + value: attrStr, + index: i, + tagClosed + }; + } + var validAttrStrRegxp = new RegExp(`(\\s*)([^\\s=]+)(\\s*=)?(\\s*(['"])(([\\s\\S])*?)\\5)?`, "g"); + function validateAttributeString(attrStr, options) { + const matches = util.getAllMatches(attrStr, validAttrStrRegxp); + const attrNames = {}; + for (let i = 0; i < matches.length; i++) { + if (matches[i][1].length === 0) { + return getErrorObject("InvalidAttr", "Attribute '" + matches[i][2] + "' has no space in starting.", getPositionFromMatch(matches[i])); + } else if (matches[i][3] !== void 0 && matches[i][4] === void 0) { + return getErrorObject("InvalidAttr", "Attribute '" + matches[i][2] + "' is without value.", getPositionFromMatch(matches[i])); + } else if (matches[i][3] === void 0 && !options.allowBooleanAttributes) { + return getErrorObject("InvalidAttr", "boolean attribute '" + matches[i][2] + "' is not allowed.", getPositionFromMatch(matches[i])); } - } else { - if (url2.hostname === "localhost") { - return; + const attrName = matches[i][2]; + if (!validateAttrName(attrName)) { + return getErrorObject("InvalidAttr", "Attribute '" + attrName + "' is an invalid name.", getPositionFromMatch(matches[i])); } - const ipComponents = url2.hostname.split("."); - const inRange = (component) => { - const num = parseInt(component, 10); - return 0 <= num && num <= 255; - }; - if (ipComponents[0] === "127" && inRange(ipComponents[1]) && inRange(ipComponents[2]) && inRange(ipComponents[3]) && ipComponents.length === 4) { - return; + if (!attrNames.hasOwnProperty(attrName)) { + attrNames[attrName] = 1; + } else { + return getErrorObject("InvalidAttr", "Attribute '" + attrName + "' is repeated.", getPositionFromMatch(matches[i])); } } - throw new property_provider_1.CredentialsProviderError(`URL not accepted. It must either be HTTPS or match one of the following: - - loopback CIDR 127.0.0.0/8 or [::1/128] - - ECS container host 169.254.170.2 - - EKS container host 169.254.170.23 or [fd00:ec2::23]`, { logger }); - }; - exports2.checkUrl = checkUrl; - } -}); - -// ../../../node_modules/@smithy/util-stream/dist-cjs/getAwsChunkedEncodingStream.js -var require_getAwsChunkedEncodingStream2 = __commonJS({ - "../../../node_modules/@smithy/util-stream/dist-cjs/getAwsChunkedEncodingStream.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.getAwsChunkedEncodingStream = void 0; - var stream_1 = require("stream"); - var getAwsChunkedEncodingStream2 = (readableStream, options) => { - const { base64Encoder, bodyLengthChecker, checksumAlgorithmFn, checksumLocationName, streamHasher } = options; - const checksumRequired = base64Encoder !== void 0 && checksumAlgorithmFn !== void 0 && checksumLocationName !== void 0 && streamHasher !== void 0; - const digest = checksumRequired ? streamHasher(checksumAlgorithmFn, readableStream) : void 0; - const awsChunkedEncodingStream = new stream_1.Readable({ read: () => { - } }); - readableStream.on("data", (data) => { - const length = bodyLengthChecker(data) || 0; - awsChunkedEncodingStream.push(`${length.toString(16)}\r -`); - awsChunkedEncodingStream.push(data); - awsChunkedEncodingStream.push("\r\n"); - }); - readableStream.on("end", async () => { - awsChunkedEncodingStream.push(`0\r -`); - if (checksumRequired) { - const checksum = base64Encoder(await digest); - awsChunkedEncodingStream.push(`${checksumLocationName}:${checksum}\r -`); - awsChunkedEncodingStream.push(`\r -`); - } - awsChunkedEncodingStream.push(null); - }); - return awsChunkedEncodingStream; - }; - exports2.getAwsChunkedEncodingStream = getAwsChunkedEncodingStream2; - } -}); - -// ../../../node_modules/@smithy/fetch-http-handler/node_modules/@smithy/querystring-builder/dist-cjs/index.js -var require_dist_cjs52 = __commonJS({ - "../../../node_modules/@smithy/fetch-http-handler/node_modules/@smithy/querystring-builder/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + return true; + } + function validateNumberAmpersand(xmlData, i) { + let re = /\d/; + if (xmlData[i] === "x") { + i++; + re = /[\da-fA-F]/; } - return to; - }; - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - buildQueryString: () => buildQueryString - }); - module2.exports = __toCommonJS2(src_exports); - var import_util_uri_escape = require_dist_cjs31(); - function buildQueryString(query) { - const parts = []; - for (let key of Object.keys(query).sort()) { - const value = query[key]; - key = (0, import_util_uri_escape.escapeUri)(key); - if (Array.isArray(value)) { - for (let i = 0, iLen = value.length; i < iLen; i++) { - parts.push(`${key}=${(0, import_util_uri_escape.escapeUri)(value[i])}`); - } - } else { - let qsEntry = key; - if (value || typeof value === "string") { - qsEntry += `=${(0, import_util_uri_escape.escapeUri)(value)}`; - } - parts.push(qsEntry); - } + for (; i < xmlData.length; i++) { + if (xmlData[i] === ";") + return i; + if (!xmlData[i].match(re)) + break; } - return parts.join("&"); + return -1; } - __name(buildQueryString, "buildQueryString"); - } -}); - -// ../../../node_modules/@smithy/fetch-http-handler/dist-cjs/index.js -var require_dist_cjs53 = __commonJS({ - "../../../node_modules/@smithy/fetch-http-handler/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + function validateAmpersand(xmlData, i) { + i++; + if (xmlData[i] === ";") + return -1; + if (xmlData[i] === "#") { + i++; + return validateNumberAmpersand(xmlData, i); } - return to; - }; - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - FetchHttpHandler: () => FetchHttpHandler, - keepAliveSupport: () => keepAliveSupport, - streamCollector: () => streamCollector - }); - module2.exports = __toCommonJS2(src_exports); - var import_protocol_http8 = require_dist_cjs2(); - var import_querystring_builder = require_dist_cjs52(); - function requestTimeout(timeoutInMs = 0) { - return new Promise((resolve, reject) => { - if (timeoutInMs) { - setTimeout(() => { - const timeoutError = new Error(`Request did not complete within ${timeoutInMs} ms`); - timeoutError.name = "TimeoutError"; - reject(timeoutError); - }, timeoutInMs); + let count = 0; + for (; i < xmlData.length; i++, count++) { + if (xmlData[i].match(/\w/) && count < 20) + continue; + if (xmlData[i] === ";") + break; + return -1; + } + return i; + } + function getErrorObject(code, message, lineNumber) { + return { + err: { + code, + msg: message, + line: lineNumber.line || lineNumber, + col: lineNumber.col } - }); + }; } - __name(requestTimeout, "requestTimeout"); - var keepAliveSupport = { - supported: void 0 + function validateAttrName(attrName) { + return util.isName(attrName); + } + function validateTagName(tagname) { + return util.isName(tagname); + } + function getLineNumberForPosition(xmlData, index) { + const lines = xmlData.substring(0, index).split(/\r?\n/); + return { + line: lines.length, + // column number is last line's length + 1, because column numbering starts at 1: + col: lines[lines.length - 1].length + 1 + }; + } + function getPositionFromMatch(match) { + return match.startIndex + match[1].length; + } + } +}); + +// ../../../node_modules/fast-xml-parser/src/xmlparser/OptionsBuilder.js +var require_OptionsBuilder = __commonJS({ + "../../../node_modules/fast-xml-parser/src/xmlparser/OptionsBuilder.js"(exports2) { + var defaultOptions = { + preserveOrder: false, + attributeNamePrefix: "@_", + attributesGroupName: false, + textNodeName: "#text", + ignoreAttributes: true, + removeNSPrefix: false, + // remove NS from tag name or attribute name if true + allowBooleanAttributes: false, + //a tag can have attributes without any value + //ignoreRootElement : false, + parseTagValue: true, + parseAttributeValue: false, + trimValues: true, + //Trim string values of tag and attributes + cdataPropName: false, + numberParseOptions: { + hex: true, + leadingZeros: true, + eNotation: true + }, + tagValueProcessor: function(tagName, val2) { + return val2; + }, + attributeValueProcessor: function(attrName, val2) { + return val2; + }, + stopNodes: [], + //nested tags will not be parsed even for errors + alwaysCreateTextNode: false, + isArray: () => false, + commentPropName: false, + unpairedTags: [], + processEntities: true, + htmlEntities: false, + ignoreDeclaration: false, + ignorePiTags: false, + transformTagName: false, + transformAttributeName: false, + updateTag: function(tagName, jPath, attrs) { + return tagName; + } + // skipEmptyListItem: false }; - var _FetchHttpHandler = class _FetchHttpHandler2 { - /** - * @returns the input if it is an HttpHandler of any class, - * or instantiates a new instance of this handler. - */ - static create(instanceOrOptions) { - if (typeof (instanceOrOptions == null ? void 0 : instanceOrOptions.handle) === "function") { - return instanceOrOptions; - } - return new _FetchHttpHandler2(instanceOrOptions); + var buildOptions = function(options) { + return Object.assign({}, defaultOptions, options); + }; + exports2.buildOptions = buildOptions; + exports2.defaultOptions = defaultOptions; + } +}); + +// ../../../node_modules/fast-xml-parser/src/xmlparser/xmlNode.js +var require_xmlNode = __commonJS({ + "../../../node_modules/fast-xml-parser/src/xmlparser/xmlNode.js"(exports2, module2) { + "use strict"; + var XmlNode = class { + constructor(tagname) { + this.tagname = tagname; + this.child = []; + this[":@"] = {}; } - constructor(options) { - if (typeof options === "function") { - this.configProvider = options().then((opts) => opts || {}); + add(key, val2) { + if (key === "__proto__") key = "#__proto__"; + this.child.push({ [key]: val2 }); + } + addChild(node) { + if (node.tagname === "__proto__") node.tagname = "#__proto__"; + if (node[":@"] && Object.keys(node[":@"]).length > 0) { + this.child.push({ [node.tagname]: node.child, [":@"]: node[":@"] }); } else { - this.config = options ?? {}; - this.configProvider = Promise.resolve(this.config); - } - if (keepAliveSupport.supported === void 0) { - keepAliveSupport.supported = Boolean( - typeof Request !== "undefined" && "keepalive" in new Request("https://[::1]") - ); + this.child.push({ [node.tagname]: node.child }); } } - destroy() { - } - async handle(request2, { abortSignal } = {}) { - if (!this.config) { - this.config = await this.configProvider; - } - const requestTimeoutInMs = this.config.requestTimeout; - const keepAlive = this.config.keepAlive === true; - const credentials = this.config.credentials; - if (abortSignal == null ? void 0 : abortSignal.aborted) { - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - return Promise.reject(abortError); - } - let path = request2.path; - const queryString = (0, import_querystring_builder.buildQueryString)(request2.query || {}); - if (queryString) { - path += `?${queryString}`; - } - if (request2.fragment) { - path += `#${request2.fragment}`; - } - let auth = ""; - if (request2.username != null || request2.password != null) { - const username = request2.username ?? ""; - const password = request2.password ?? ""; - auth = `${username}:${password}@`; - } - const { port, method } = request2; - const url2 = `${request2.protocol}//${auth}${request2.hostname}${port ? `:${port}` : ""}${path}`; - const body = method === "GET" || method === "HEAD" ? void 0 : request2.body; - const requestOptions = { - body, - headers: new Headers(request2.headers), - method, - credentials - }; - if (body) { - requestOptions.duplex = "half"; - } - if (typeof AbortController !== "undefined") { - requestOptions.signal = abortSignal; - } - if (keepAliveSupport.supported) { - requestOptions.keepalive = keepAlive; - } - let removeSignalEventListener = /* @__PURE__ */ __name(() => { - }, "removeSignalEventListener"); - const fetchRequest = new Request(url2, requestOptions); - const raceOfPromises = [ - fetch(fetchRequest).then((response) => { - const fetchHeaders = response.headers; - const transformedHeaders = {}; - for (const pair of fetchHeaders.entries()) { - transformedHeaders[pair[0]] = pair[1]; + }; + module2.exports = XmlNode; + } +}); + +// ../../../node_modules/fast-xml-parser/src/xmlparser/DocTypeReader.js +var require_DocTypeReader = __commonJS({ + "../../../node_modules/fast-xml-parser/src/xmlparser/DocTypeReader.js"(exports2, module2) { + var util = require_util(); + function readDocType(xmlData, i) { + const entities = {}; + if (xmlData[i + 3] === "O" && xmlData[i + 4] === "C" && xmlData[i + 5] === "T" && xmlData[i + 6] === "Y" && xmlData[i + 7] === "P" && xmlData[i + 8] === "E") { + i = i + 9; + let angleBracketsCount = 1; + let hasBody = false, comment = false; + let exp = ""; + for (; i < xmlData.length; i++) { + if (xmlData[i] === "<" && !comment) { + if (hasBody && isEntity(xmlData, i)) { + i += 7; + [entityName, val, i] = readEntityExp(xmlData, i + 1); + if (val.indexOf("&") === -1) + entities[validateEntityName(entityName)] = { + regx: RegExp(`&${entityName};`, "g"), + val + }; + } else if (hasBody && isElement(xmlData, i)) i += 8; + else if (hasBody && isAttlist(xmlData, i)) i += 8; + else if (hasBody && isNotation(xmlData, i)) i += 9; + else if (isComment) comment = true; + else throw new Error("Invalid DOCTYPE"); + angleBracketsCount++; + exp = ""; + } else if (xmlData[i] === ">") { + if (comment) { + if (xmlData[i - 1] === "-" && xmlData[i - 2] === "-") { + comment = false; + angleBracketsCount--; + } + } else { + angleBracketsCount--; } - const hasReadableStream = response.body != void 0; - if (!hasReadableStream) { - return response.blob().then((body2) => ({ - response: new import_protocol_http8.HttpResponse({ - headers: transformedHeaders, - reason: response.statusText, - statusCode: response.status, - body: body2 - }) - })); + if (angleBracketsCount === 0) { + break; } - return { - response: new import_protocol_http8.HttpResponse({ - headers: transformedHeaders, - reason: response.statusText, - statusCode: response.status, - body: response.body - }) - }; - }), - requestTimeout(requestTimeoutInMs) - ]; - if (abortSignal) { - raceOfPromises.push( - new Promise((resolve, reject) => { - const onAbort = /* @__PURE__ */ __name(() => { - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - reject(abortError); - }, "onAbort"); - if (typeof abortSignal.addEventListener === "function") { - const signal = abortSignal; - signal.addEventListener("abort", onAbort, { once: true }); - removeSignalEventListener = /* @__PURE__ */ __name(() => signal.removeEventListener("abort", onAbort), "removeSignalEventListener"); - } else { - abortSignal.onabort = onAbort; - } - }) - ); + } else if (xmlData[i] === "[") { + hasBody = true; + } else { + exp += xmlData[i]; + } } - return Promise.race(raceOfPromises).finally(removeSignalEventListener); - } - updateHttpClientConfig(key, value) { - this.config = void 0; - this.configProvider = this.configProvider.then((config) => { - config[key] = value; - return config; - }); - } - httpHandlerConfigs() { - return this.config ?? {}; - } - }; - __name(_FetchHttpHandler, "FetchHttpHandler"); - var FetchHttpHandler = _FetchHttpHandler; - var import_util_base64 = require_dist_cjs29(); - var streamCollector = /* @__PURE__ */ __name((stream) => { - if (typeof Blob === "function" && stream instanceof Blob) { - return collectBlob(stream); + if (angleBracketsCount !== 0) { + throw new Error(`Unclosed DOCTYPE`); + } + } else { + throw new Error(`Invalid Tag instead of DOCTYPE`); } - return collectStream(stream); - }, "streamCollector"); - async function collectBlob(blob) { - const base64 = await readToBase64(blob); - const arrayBuffer = (0, import_util_base64.fromBase64)(base64); - return new Uint8Array(arrayBuffer); + return { entities, i }; } - __name(collectBlob, "collectBlob"); - async function collectStream(stream) { - const chunks = []; - const reader = stream.getReader(); - let isDone = false; - let length = 0; - while (!isDone) { - const { done, value } = await reader.read(); - if (value) { - chunks.push(value); - length += value.length; - } - isDone = done; + function readEntityExp(xmlData, i) { + let entityName2 = ""; + for (; i < xmlData.length && (xmlData[i] !== "'" && xmlData[i] !== '"'); i++) { + entityName2 += xmlData[i]; } - const collected = new Uint8Array(length); - let offset = 0; - for (const chunk of chunks) { - collected.set(chunk, offset); - offset += chunk.length; + entityName2 = entityName2.trim(); + if (entityName2.indexOf(" ") !== -1) throw new Error("External entites are not supported"); + const startChar = xmlData[i++]; + let val2 = ""; + for (; i < xmlData.length && xmlData[i] !== startChar; i++) { + val2 += xmlData[i]; } - return collected; + return [entityName2, val2, i]; } - __name(collectStream, "collectStream"); - function readToBase64(blob) { - return new Promise((resolve, reject) => { - const reader = new FileReader(); - reader.onloadend = () => { - if (reader.readyState !== 2) { - return reject(new Error("Reader aborted too early")); - } - const result = reader.result ?? ""; - const commaIndex = result.indexOf(","); - const dataOffset = commaIndex > -1 ? commaIndex + 1 : result.length; - resolve(result.substring(dataOffset)); - }; - reader.onabort = () => reject(new Error("Read aborted")); - reader.onerror = () => reject(reader.error); - reader.readAsDataURL(blob); - }); + function isComment(xmlData, i) { + if (xmlData[i + 1] === "!" && xmlData[i + 2] === "-" && xmlData[i + 3] === "-") return true; + return false; + } + function isEntity(xmlData, i) { + if (xmlData[i + 1] === "!" && xmlData[i + 2] === "E" && xmlData[i + 3] === "N" && xmlData[i + 4] === "T" && xmlData[i + 5] === "I" && xmlData[i + 6] === "T" && xmlData[i + 7] === "Y") return true; + return false; + } + function isElement(xmlData, i) { + if (xmlData[i + 1] === "!" && xmlData[i + 2] === "E" && xmlData[i + 3] === "L" && xmlData[i + 4] === "E" && xmlData[i + 5] === "M" && xmlData[i + 6] === "E" && xmlData[i + 7] === "N" && xmlData[i + 8] === "T") return true; + return false; + } + function isAttlist(xmlData, i) { + if (xmlData[i + 1] === "!" && xmlData[i + 2] === "A" && xmlData[i + 3] === "T" && xmlData[i + 4] === "T" && xmlData[i + 5] === "L" && xmlData[i + 6] === "I" && xmlData[i + 7] === "S" && xmlData[i + 8] === "T") return true; + return false; + } + function isNotation(xmlData, i) { + if (xmlData[i + 1] === "!" && xmlData[i + 2] === "N" && xmlData[i + 3] === "O" && xmlData[i + 4] === "T" && xmlData[i + 5] === "A" && xmlData[i + 6] === "T" && xmlData[i + 7] === "I" && xmlData[i + 8] === "O" && xmlData[i + 9] === "N") return true; + return false; + } + function validateEntityName(name) { + if (util.isName(name)) + return name; + else + throw new Error(`Invalid entity name ${name}`); } - __name(readToBase64, "readToBase64"); + module2.exports = readDocType; } }); -// ../../../node_modules/@smithy/util-stream/dist-cjs/stream-type-check.js -var require_stream_type_check2 = __commonJS({ - "../../../node_modules/@smithy/util-stream/dist-cjs/stream-type-check.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.isReadableStream = void 0; - var isReadableStream2 = (stream) => { - var _a; - return typeof ReadableStream === "function" && (((_a = stream === null || stream === void 0 ? void 0 : stream.constructor) === null || _a === void 0 ? void 0 : _a.name) === ReadableStream.name || stream instanceof ReadableStream); +// ../../../node_modules/strnum/strnum.js +var require_strnum = __commonJS({ + "../../../node_modules/strnum/strnum.js"(exports2, module2) { + var hexRegex = /^[-+]?0x[a-fA-F0-9]+$/; + var numRegex = /^([\-\+])?(0*)(\.[0-9]+([eE]\-?[0-9]+)?|[0-9]+(\.[0-9]+([eE]\-?[0-9]+)?)?)$/; + if (!Number.parseInt && window.parseInt) { + Number.parseInt = window.parseInt; + } + if (!Number.parseFloat && window.parseFloat) { + Number.parseFloat = window.parseFloat; + } + var consider = { + hex: true, + leadingZeros: true, + decimalPoint: ".", + eNotation: true + //skipLike: /regex/ }; - exports2.isReadableStream = isReadableStream2; - } -}); - -// ../../../node_modules/@smithy/util-stream/dist-cjs/sdk-stream-mixin.browser.js -var require_sdk_stream_mixin_browser2 = __commonJS({ - "../../../node_modules/@smithy/util-stream/dist-cjs/sdk-stream-mixin.browser.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.sdkStreamMixin = void 0; - var fetch_http_handler_1 = require_dist_cjs53(); - var util_base64_1 = require_dist_cjs29(); - var util_hex_encoding_1 = require_dist_cjs35(); - var util_utf8_1 = require_dist_cjs28(); - var stream_type_check_1 = require_stream_type_check2(); - var ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED = "The stream has already been transformed."; - var sdkStreamMixin2 = (stream) => { - var _a, _b; - if (!isBlobInstance(stream) && !(0, stream_type_check_1.isReadableStream)(stream)) { - const name = ((_b = (_a = stream === null || stream === void 0 ? void 0 : stream.__proto__) === null || _a === void 0 ? void 0 : _a.constructor) === null || _b === void 0 ? void 0 : _b.name) || stream; - throw new Error(`Unexpected stream implementation, expect Blob or ReadableStream, got ${name}`); - } - let transformed = false; - const transformToByteArray = async () => { - if (transformed) { - throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED); - } - transformed = true; - return await (0, fetch_http_handler_1.streamCollector)(stream); - }; - const blobToWebStream = (blob) => { - if (typeof blob.stream !== "function") { - throw new Error("Cannot transform payload Blob to web stream. Please make sure the Blob.stream() is polyfilled.\nIf you are using React Native, this API is not yet supported, see: https://react-native.canny.io/feature-requests/p/fetch-streaming-body"); - } - return blob.stream(); - }; - return Object.assign(stream, { - transformToByteArray, - transformToString: async (encoding) => { - const buf = await transformToByteArray(); - if (encoding === "base64") { - return (0, util_base64_1.toBase64)(buf); - } else if (encoding === "hex") { - return (0, util_hex_encoding_1.toHex)(buf); - } else if (encoding === void 0 || encoding === "utf8" || encoding === "utf-8") { - return (0, util_utf8_1.toUtf8)(buf); - } else if (typeof TextDecoder === "function") { - return new TextDecoder(encoding).decode(buf); - } else { - throw new Error("TextDecoder is not available, please make sure polyfill is provided."); - } - }, - transformToWebStream: () => { - if (transformed) { - throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED); - } - transformed = true; - if (isBlobInstance(stream)) { - return blobToWebStream(stream); - } else if ((0, stream_type_check_1.isReadableStream)(stream)) { - return stream; - } else { - throw new Error(`Cannot transform payload to web stream, got ${stream}`); + function toNumber(str, options = {}) { + options = Object.assign({}, consider, options); + if (!str || typeof str !== "string") return str; + let trimmedStr = str.trim(); + if (options.skipLike !== void 0 && options.skipLike.test(trimmedStr)) return str; + else if (options.hex && hexRegex.test(trimmedStr)) { + return Number.parseInt(trimmedStr, 16); + } else { + const match = numRegex.exec(trimmedStr); + if (match) { + const sign = match[1]; + const leadingZeros = match[2]; + let numTrimmedByZeros = trimZeros(match[3]); + const eNotation = match[4] || match[6]; + if (!options.leadingZeros && leadingZeros.length > 0 && sign && trimmedStr[2] !== ".") return str; + else if (!options.leadingZeros && leadingZeros.length > 0 && !sign && trimmedStr[1] !== ".") return str; + else { + const num = Number(trimmedStr); + const numStr = "" + num; + if (numStr.search(/[eE]/) !== -1) { + if (options.eNotation) return num; + else return str; + } else if (eNotation) { + if (options.eNotation) return num; + else return str; + } else if (trimmedStr.indexOf(".") !== -1) { + if (numStr === "0" && numTrimmedByZeros === "") return num; + else if (numStr === numTrimmedByZeros) return num; + else if (sign && numStr === "-" + numTrimmedByZeros) return num; + else return str; + } + if (leadingZeros) { + if (numTrimmedByZeros === numStr) return num; + else if (sign + numTrimmedByZeros === numStr) return num; + else return str; + } + if (trimmedStr === numStr) return num; + else if (trimmedStr === sign + numStr) return num; + return str; } + } else { + return str; } - }); - }; - exports2.sdkStreamMixin = sdkStreamMixin2; - var isBlobInstance = (stream) => typeof Blob === "function" && stream instanceof Blob; + } + } + function trimZeros(numStr) { + if (numStr && numStr.indexOf(".") !== -1) { + numStr = numStr.replace(/0+$/, ""); + if (numStr === ".") numStr = "0"; + else if (numStr[0] === ".") numStr = "0" + numStr; + else if (numStr[numStr.length - 1] === ".") numStr = numStr.substr(0, numStr.length - 1); + return numStr; + } + return numStr; + } + module2.exports = toNumber; } }); -// ../../../node_modules/@smithy/util-stream/dist-cjs/sdk-stream-mixin.js -var require_sdk_stream_mixin2 = __commonJS({ - "../../../node_modules/@smithy/util-stream/dist-cjs/sdk-stream-mixin.js"(exports2) { +// ../../../node_modules/fast-xml-parser/src/xmlparser/OrderedObjParser.js +var require_OrderedObjParser = __commonJS({ + "../../../node_modules/fast-xml-parser/src/xmlparser/OrderedObjParser.js"(exports2, module2) { "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.sdkStreamMixin = void 0; - var node_http_handler_1 = require_dist_cjs51(); - var util_buffer_from_1 = require_dist_cjs27(); - var stream_1 = require("stream"); - var util_1 = require("util"); - var sdk_stream_mixin_browser_1 = require_sdk_stream_mixin_browser2(); - var ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED = "The stream has already been transformed."; - var sdkStreamMixin2 = (stream) => { - var _a, _b; - if (!(stream instanceof stream_1.Readable)) { - try { - return (0, sdk_stream_mixin_browser_1.sdkStreamMixin)(stream); - } catch (e) { - const name = ((_b = (_a = stream === null || stream === void 0 ? void 0 : stream.__proto__) === null || _a === void 0 ? void 0 : _a.constructor) === null || _b === void 0 ? void 0 : _b.name) || stream; - throw new Error(`Unexpected stream implementation, expect Stream.Readable instance, got ${name}`); - } + var util = require_util(); + var xmlNode = require_xmlNode(); + var readDocType = require_DocTypeReader(); + var toNumber = require_strnum(); + var OrderedObjParser = class { + constructor(options) { + this.options = options; + this.currentNode = null; + this.tagsNodeStack = []; + this.docTypeEntities = {}; + this.lastEntities = { + "apos": { regex: /&(apos|#39|#x27);/g, val: "'" }, + "gt": { regex: /&(gt|#62|#x3E);/g, val: ">" }, + "lt": { regex: /&(lt|#60|#x3C);/g, val: "<" }, + "quot": { regex: /&(quot|#34|#x22);/g, val: '"' } + }; + this.ampEntity = { regex: /&(amp|#38|#x26);/g, val: "&" }; + this.htmlEntities = { + "space": { regex: /&(nbsp|#160);/g, val: " " }, + // "lt" : { regex: /&(lt|#60);/g, val: "<" }, + // "gt" : { regex: /&(gt|#62);/g, val: ">" }, + // "amp" : { regex: /&(amp|#38);/g, val: "&" }, + // "quot" : { regex: /&(quot|#34);/g, val: "\"" }, + // "apos" : { regex: /&(apos|#39);/g, val: "'" }, + "cent": { regex: /&(cent|#162);/g, val: "\xA2" }, + "pound": { regex: /&(pound|#163);/g, val: "\xA3" }, + "yen": { regex: /&(yen|#165);/g, val: "\xA5" }, + "euro": { regex: /&(euro|#8364);/g, val: "\u20AC" }, + "copyright": { regex: /&(copy|#169);/g, val: "\xA9" }, + "reg": { regex: /&(reg|#174);/g, val: "\xAE" }, + "inr": { regex: /&(inr|#8377);/g, val: "\u20B9" }, + "num_dec": { regex: /&#([0-9]{1,7});/g, val: (_, str) => String.fromCharCode(Number.parseInt(str, 10)) }, + "num_hex": { regex: /&#x([0-9a-fA-F]{1,6});/g, val: (_, str) => String.fromCharCode(Number.parseInt(str, 16)) } + }; + this.addExternalEntities = addExternalEntities; + this.parseXml = parseXml; + this.parseTextData = parseTextData; + this.resolveNameSpace = resolveNameSpace; + this.buildAttributesMap = buildAttributesMap; + this.isItStopNode = isItStopNode; + this.replaceEntitiesValue = replaceEntitiesValue; + this.readStopNodeData = readStopNodeData; + this.saveTextToParentTag = saveTextToParentTag; + this.addChild = addChild; } - let transformed = false; - const transformToByteArray = async () => { - if (transformed) { - throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED); + }; + function addExternalEntities(externalEntities) { + const entKeys = Object.keys(externalEntities); + for (let i = 0; i < entKeys.length; i++) { + const ent = entKeys[i]; + this.lastEntities[ent] = { + regex: new RegExp("&" + ent + ";", "g"), + val: externalEntities[ent] + }; + } + } + function parseTextData(val2, tagName, jPath, dontTrim, hasAttributes, isLeafNode, escapeEntities) { + if (val2 !== void 0) { + if (this.options.trimValues && !dontTrim) { + val2 = val2.trim(); } - transformed = true; - return await (0, node_http_handler_1.streamCollector)(stream); - }; - return Object.assign(stream, { - transformToByteArray, - transformToString: async (encoding) => { - const buf = await transformToByteArray(); - if (encoding === void 0 || Buffer.isEncoding(encoding)) { - return (0, util_buffer_from_1.fromArrayBuffer)(buf.buffer, buf.byteOffset, buf.byteLength).toString(encoding); + if (val2.length > 0) { + if (!escapeEntities) val2 = this.replaceEntitiesValue(val2); + const newval = this.options.tagValueProcessor(tagName, val2, jPath, hasAttributes, isLeafNode); + if (newval === null || newval === void 0) { + return val2; + } else if (typeof newval !== typeof val2 || newval !== val2) { + return newval; + } else if (this.options.trimValues) { + return parseValue(val2, this.options.parseTagValue, this.options.numberParseOptions); } else { - const decoder2 = new util_1.TextDecoder(encoding); - return decoder2.decode(buf); - } - }, - transformToWebStream: () => { - if (transformed) { - throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED); - } - if (stream.readableFlowing !== null) { - throw new Error("The stream has been consumed by other callbacks."); - } - if (typeof stream_1.Readable.toWeb !== "function") { - throw new Error("Readable.toWeb() is not supported. Please make sure you are using Node.js >= 17.0.0, or polyfill is available."); + const trimmedVal = val2.trim(); + if (trimmedVal === val2) { + return parseValue(val2, this.options.parseTagValue, this.options.numberParseOptions); + } else { + return val2; + } } - transformed = true; - return stream_1.Readable.toWeb(stream); } - }); - }; - exports2.sdkStreamMixin = sdkStreamMixin2; - } -}); - -// ../../../node_modules/@smithy/util-stream/dist-cjs/splitStream.browser.js -var require_splitStream_browser2 = __commonJS({ - "../../../node_modules/@smithy/util-stream/dist-cjs/splitStream.browser.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.splitStream = void 0; - async function splitStream2(stream) { - if (typeof stream.stream === "function") { - stream = stream.stream(); } - const readableStream = stream; - return readableStream.tee(); } - exports2.splitStream = splitStream2; - } -}); - -// ../../../node_modules/@smithy/util-stream/dist-cjs/splitStream.js -var require_splitStream2 = __commonJS({ - "../../../node_modules/@smithy/util-stream/dist-cjs/splitStream.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.splitStream = void 0; - var stream_1 = require("stream"); - var splitStream_browser_1 = require_splitStream_browser2(); - var stream_type_check_1 = require_stream_type_check2(); - async function splitStream2(stream) { - if ((0, stream_type_check_1.isReadableStream)(stream)) { - return (0, splitStream_browser_1.splitStream)(stream); + function resolveNameSpace(tagname) { + if (this.options.removeNSPrefix) { + const tags = tagname.split(":"); + const prefix = tagname.charAt(0) === "/" ? "/" : ""; + if (tags[0] === "xmlns") { + return ""; + } + if (tags.length === 2) { + tagname = prefix + tags[1]; + } } - const stream1 = new stream_1.PassThrough(); - const stream2 = new stream_1.PassThrough(); - stream.pipe(stream1); - stream.pipe(stream2); - return [stream1, stream2]; + return tagname; } - exports2.splitStream = splitStream2; - } -}); - -// ../../../node_modules/@smithy/util-stream/dist-cjs/headStream.browser.js -var require_headStream_browser2 = __commonJS({ - "../../../node_modules/@smithy/util-stream/dist-cjs/headStream.browser.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.headStream = void 0; - async function headStream2(stream, bytes) { - var _a; - let byteLengthCounter = 0; - const chunks = []; - const reader = stream.getReader(); - let isDone = false; - while (!isDone) { - const { done, value } = await reader.read(); - if (value) { - chunks.push(value); - byteLengthCounter += (_a = value === null || value === void 0 ? void 0 : value.byteLength) !== null && _a !== void 0 ? _a : 0; + var attrsRegx = new RegExp(`([^\\s=]+)\\s*(=\\s*(['"])([\\s\\S]*?)\\3)?`, "gm"); + function buildAttributesMap(attrStr, jPath, tagName) { + if (!this.options.ignoreAttributes && typeof attrStr === "string") { + const matches = util.getAllMatches(attrStr, attrsRegx); + const len = matches.length; + const attrs = {}; + for (let i = 0; i < len; i++) { + const attrName = this.resolveNameSpace(matches[i][1]); + let oldVal = matches[i][4]; + let aName = this.options.attributeNamePrefix + attrName; + if (attrName.length) { + if (this.options.transformAttributeName) { + aName = this.options.transformAttributeName(aName); + } + if (aName === "__proto__") aName = "#__proto__"; + if (oldVal !== void 0) { + if (this.options.trimValues) { + oldVal = oldVal.trim(); + } + oldVal = this.replaceEntitiesValue(oldVal); + const newVal = this.options.attributeValueProcessor(attrName, oldVal, jPath); + if (newVal === null || newVal === void 0) { + attrs[aName] = oldVal; + } else if (typeof newVal !== typeof oldVal || newVal !== oldVal) { + attrs[aName] = newVal; + } else { + attrs[aName] = parseValue( + oldVal, + this.options.parseAttributeValue, + this.options.numberParseOptions + ); + } + } else if (this.options.allowBooleanAttributes) { + attrs[aName] = true; + } + } } - if (byteLengthCounter >= bytes) { - break; + if (!Object.keys(attrs).length) { + return; } - isDone = done; + if (this.options.attributesGroupName) { + const attrCollection = {}; + attrCollection[this.options.attributesGroupName] = attrs; + return attrCollection; + } + return attrs; } - reader.releaseLock(); - const collected = new Uint8Array(Math.min(bytes, byteLengthCounter)); - let offset = 0; - for (const chunk of chunks) { - if (chunk.byteLength > collected.byteLength - offset) { - collected.set(chunk.subarray(0, collected.byteLength - offset), offset); - break; + } + var parseXml = function(xmlData) { + xmlData = xmlData.replace(/\r\n?/g, "\n"); + const xmlObj = new xmlNode("!xml"); + let currentNode = xmlObj; + let textData = ""; + let jPath = ""; + for (let i = 0; i < xmlData.length; i++) { + const ch = xmlData[i]; + if (ch === "<") { + if (xmlData[i + 1] === "/") { + const closeIndex = findClosingIndex(xmlData, ">", i, "Closing Tag is not closed."); + let tagName = xmlData.substring(i + 2, closeIndex).trim(); + if (this.options.removeNSPrefix) { + const colonIndex = tagName.indexOf(":"); + if (colonIndex !== -1) { + tagName = tagName.substr(colonIndex + 1); + } + } + if (this.options.transformTagName) { + tagName = this.options.transformTagName(tagName); + } + if (currentNode) { + textData = this.saveTextToParentTag(textData, currentNode, jPath); + } + const lastTagName = jPath.substring(jPath.lastIndexOf(".") + 1); + if (tagName && this.options.unpairedTags.indexOf(tagName) !== -1) { + throw new Error(`Unpaired tag can not be used as closing tag: `); + } + let propIndex = 0; + if (lastTagName && this.options.unpairedTags.indexOf(lastTagName) !== -1) { + propIndex = jPath.lastIndexOf(".", jPath.lastIndexOf(".") - 1); + this.tagsNodeStack.pop(); + } else { + propIndex = jPath.lastIndexOf("."); + } + jPath = jPath.substring(0, propIndex); + currentNode = this.tagsNodeStack.pop(); + textData = ""; + i = closeIndex; + } else if (xmlData[i + 1] === "?") { + let tagData = readTagExp(xmlData, i, false, "?>"); + if (!tagData) throw new Error("Pi Tag is not closed."); + textData = this.saveTextToParentTag(textData, currentNode, jPath); + if (this.options.ignoreDeclaration && tagData.tagName === "?xml" || this.options.ignorePiTags) { + } else { + const childNode = new xmlNode(tagData.tagName); + childNode.add(this.options.textNodeName, ""); + if (tagData.tagName !== tagData.tagExp && tagData.attrExpPresent) { + childNode[":@"] = this.buildAttributesMap(tagData.tagExp, jPath, tagData.tagName); + } + this.addChild(currentNode, childNode, jPath); + } + i = tagData.closeIndex + 1; + } else if (xmlData.substr(i + 1, 3) === "!--") { + const endIndex = findClosingIndex(xmlData, "-->", i + 4, "Comment is not closed."); + if (this.options.commentPropName) { + const comment = xmlData.substring(i + 4, endIndex - 2); + textData = this.saveTextToParentTag(textData, currentNode, jPath); + currentNode.add(this.options.commentPropName, [{ [this.options.textNodeName]: comment }]); + } + i = endIndex; + } else if (xmlData.substr(i + 1, 2) === "!D") { + const result = readDocType(xmlData, i); + this.docTypeEntities = result.entities; + i = result.i; + } else if (xmlData.substr(i + 1, 2) === "![") { + const closeIndex = findClosingIndex(xmlData, "]]>", i, "CDATA is not closed.") - 2; + const tagExp = xmlData.substring(i + 9, closeIndex); + textData = this.saveTextToParentTag(textData, currentNode, jPath); + let val2 = this.parseTextData(tagExp, currentNode.tagname, jPath, true, false, true, true); + if (val2 == void 0) val2 = ""; + if (this.options.cdataPropName) { + currentNode.add(this.options.cdataPropName, [{ [this.options.textNodeName]: tagExp }]); + } else { + currentNode.add(this.options.textNodeName, val2); + } + i = closeIndex + 2; + } else { + let result = readTagExp(xmlData, i, this.options.removeNSPrefix); + let tagName = result.tagName; + const rawTagName = result.rawTagName; + let tagExp = result.tagExp; + let attrExpPresent = result.attrExpPresent; + let closeIndex = result.closeIndex; + if (this.options.transformTagName) { + tagName = this.options.transformTagName(tagName); + } + if (currentNode && textData) { + if (currentNode.tagname !== "!xml") { + textData = this.saveTextToParentTag(textData, currentNode, jPath, false); + } + } + const lastTag = currentNode; + if (lastTag && this.options.unpairedTags.indexOf(lastTag.tagname) !== -1) { + currentNode = this.tagsNodeStack.pop(); + jPath = jPath.substring(0, jPath.lastIndexOf(".")); + } + if (tagName !== xmlObj.tagname) { + jPath += jPath ? "." + tagName : tagName; + } + if (this.isItStopNode(this.options.stopNodes, jPath, tagName)) { + let tagContent = ""; + if (tagExp.length > 0 && tagExp.lastIndexOf("/") === tagExp.length - 1) { + if (tagName[tagName.length - 1] === "/") { + tagName = tagName.substr(0, tagName.length - 1); + jPath = jPath.substr(0, jPath.length - 1); + tagExp = tagName; + } else { + tagExp = tagExp.substr(0, tagExp.length - 1); + } + i = result.closeIndex; + } else if (this.options.unpairedTags.indexOf(tagName) !== -1) { + i = result.closeIndex; + } else { + const result2 = this.readStopNodeData(xmlData, rawTagName, closeIndex + 1); + if (!result2) throw new Error(`Unexpected end of ${rawTagName}`); + i = result2.i; + tagContent = result2.tagContent; + } + const childNode = new xmlNode(tagName); + if (tagName !== tagExp && attrExpPresent) { + childNode[":@"] = this.buildAttributesMap(tagExp, jPath, tagName); + } + if (tagContent) { + tagContent = this.parseTextData(tagContent, tagName, jPath, true, attrExpPresent, true, true); + } + jPath = jPath.substr(0, jPath.lastIndexOf(".")); + childNode.add(this.options.textNodeName, tagContent); + this.addChild(currentNode, childNode, jPath); + } else { + if (tagExp.length > 0 && tagExp.lastIndexOf("/") === tagExp.length - 1) { + if (tagName[tagName.length - 1] === "/") { + tagName = tagName.substr(0, tagName.length - 1); + jPath = jPath.substr(0, jPath.length - 1); + tagExp = tagName; + } else { + tagExp = tagExp.substr(0, tagExp.length - 1); + } + if (this.options.transformTagName) { + tagName = this.options.transformTagName(tagName); + } + const childNode = new xmlNode(tagName); + if (tagName !== tagExp && attrExpPresent) { + childNode[":@"] = this.buildAttributesMap(tagExp, jPath, tagName); + } + this.addChild(currentNode, childNode, jPath); + jPath = jPath.substr(0, jPath.lastIndexOf(".")); + } else { + const childNode = new xmlNode(tagName); + this.tagsNodeStack.push(currentNode); + if (tagName !== tagExp && attrExpPresent) { + childNode[":@"] = this.buildAttributesMap(tagExp, jPath, tagName); + } + this.addChild(currentNode, childNode, jPath); + currentNode = childNode; + } + textData = ""; + i = closeIndex; + } + } } else { - collected.set(chunk, offset); - } - offset += chunk.length; - } - return collected; - } - exports2.headStream = headStream2; - } -}); - -// ../../../node_modules/@smithy/util-stream/dist-cjs/headStream.js -var require_headStream2 = __commonJS({ - "../../../node_modules/@smithy/util-stream/dist-cjs/headStream.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.headStream = void 0; - var stream_1 = require("stream"); - var headStream_browser_1 = require_headStream_browser2(); - var stream_type_check_1 = require_stream_type_check2(); - var headStream2 = (stream, bytes) => { - if ((0, stream_type_check_1.isReadableStream)(stream)) { - return (0, headStream_browser_1.headStream)(stream, bytes); - } - return new Promise((resolve, reject) => { - const collector = new Collector(); - collector.limit = bytes; - stream.pipe(collector); - stream.on("error", (err) => { - collector.end(); - reject(err); - }); - collector.on("error", reject); - collector.on("finish", function() { - const bytes2 = new Uint8Array(Buffer.concat(this.buffers)); - resolve(bytes2); - }); - }); - }; - exports2.headStream = headStream2; - var Collector = class extends stream_1.Writable { - constructor() { - super(...arguments); - this.buffers = []; - this.limit = Infinity; - this.bytesBuffered = 0; - } - _write(chunk, encoding, callback) { - var _a; - this.buffers.push(chunk); - this.bytesBuffered += (_a = chunk.byteLength) !== null && _a !== void 0 ? _a : 0; - if (this.bytesBuffered >= this.limit) { - const excess = this.bytesBuffered - this.limit; - const tailBuffer = this.buffers[this.buffers.length - 1]; - this.buffers[this.buffers.length - 1] = tailBuffer.subarray(0, tailBuffer.byteLength - excess); - this.emit("finish"); + textData += xmlData[i]; } - callback(); - } - }; - } -}); - -// ../../../node_modules/@smithy/util-stream/dist-cjs/index.js -var require_dist_cjs54 = __commonJS({ - "../../../node_modules/@smithy/util-stream/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); } - return to; + return xmlObj.child; }; - var __reExport = (target, mod, secondTarget) => (__copyProps2(target, mod, "default"), secondTarget && __copyProps2(secondTarget, mod, "default")); - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - Uint8ArrayBlobAdapter: () => Uint8ArrayBlobAdapter - }); - module2.exports = __toCommonJS2(src_exports); - var import_util_base64 = require_dist_cjs29(); - var import_util_utf8 = require_dist_cjs28(); - function transformToString(payload, encoding = "utf-8") { - if (encoding === "base64") { - return (0, import_util_base64.toBase64)(payload); - } - return (0, import_util_utf8.toUtf8)(payload); - } - __name(transformToString, "transformToString"); - function transformFromString(str, encoding) { - if (encoding === "base64") { - return Uint8ArrayBlobAdapter.mutate((0, import_util_base64.fromBase64)(str)); + function addChild(currentNode, childNode, jPath) { + const result = this.options.updateTag(childNode.tagname, jPath, childNode[":@"]); + if (result === false) { + } else if (typeof result === "string") { + childNode.tagname = result; + currentNode.addChild(childNode); + } else { + currentNode.addChild(childNode); } - return Uint8ArrayBlobAdapter.mutate((0, import_util_utf8.fromUtf8)(str)); } - __name(transformFromString, "transformFromString"); - var _Uint8ArrayBlobAdapter = class _Uint8ArrayBlobAdapter2 extends Uint8Array { - /** - * @param source - such as a string or Stream. - * @returns a new Uint8ArrayBlobAdapter extending Uint8Array. - */ - static fromString(source, encoding = "utf-8") { - switch (typeof source) { - case "string": - return transformFromString(source, encoding); - default: - throw new Error(`Unsupported conversion from ${typeof source} to Uint8ArrayBlobAdapter.`); + var replaceEntitiesValue = function(val2) { + if (this.options.processEntities) { + for (let entityName2 in this.docTypeEntities) { + const entity = this.docTypeEntities[entityName2]; + val2 = val2.replace(entity.regx, entity.val); } + for (let entityName2 in this.lastEntities) { + const entity = this.lastEntities[entityName2]; + val2 = val2.replace(entity.regex, entity.val); + } + if (this.options.htmlEntities) { + for (let entityName2 in this.htmlEntities) { + const entity = this.htmlEntities[entityName2]; + val2 = val2.replace(entity.regex, entity.val); + } + } + val2 = val2.replace(this.ampEntity.regex, this.ampEntity.val); } - /** - * @param source - Uint8Array to be mutated. - * @returns the same Uint8Array but with prototype switched to Uint8ArrayBlobAdapter. - */ - static mutate(source) { - Object.setPrototypeOf(source, _Uint8ArrayBlobAdapter2.prototype); - return source; - } - /** - * @param encoding - default 'utf-8'. - * @returns the blob as string. - */ - transformToString(encoding = "utf-8") { - return transformToString(this, encoding); - } + return val2; }; - __name(_Uint8ArrayBlobAdapter, "Uint8ArrayBlobAdapter"); - var Uint8ArrayBlobAdapter = _Uint8ArrayBlobAdapter; - __reExport(src_exports, require_getAwsChunkedEncodingStream2(), module2.exports); - __reExport(src_exports, require_sdk_stream_mixin2(), module2.exports); - __reExport(src_exports, require_splitStream2(), module2.exports); - __reExport(src_exports, require_headStream2(), module2.exports); - __reExport(src_exports, require_stream_type_check2(), module2.exports); - } -}); - -// ../../../node_modules/@aws-sdk/credential-provider-http/dist-cjs/fromHttp/requestHelpers.js -var require_requestHelpers = __commonJS({ - "../../../node_modules/@aws-sdk/credential-provider-http/dist-cjs/fromHttp/requestHelpers.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.getCredentials = exports2.createGetRequest = void 0; - var property_provider_1 = require_dist_cjs40(); - var protocol_http_1 = require_dist_cjs2(); - var smithy_client_1 = require_dist_cjs37(); - var util_stream_1 = require_dist_cjs54(); - function createGetRequest(url2) { - return new protocol_http_1.HttpRequest({ - protocol: url2.protocol, - hostname: url2.hostname, - port: Number(url2.port), - path: url2.pathname, - query: Array.from(url2.searchParams.entries()).reduce((acc, [k, v]) => { - acc[k] = v; - return acc; - }, {}), - fragment: url2.hash - }); - } - exports2.createGetRequest = createGetRequest; - async function getCredentials(response, logger) { - const stream = (0, util_stream_1.sdkStreamMixin)(response.body); - const str = await stream.transformToString(); - if (response.statusCode === 200) { - const parsed = JSON.parse(str); - if (typeof parsed.AccessKeyId !== "string" || typeof parsed.SecretAccessKey !== "string" || typeof parsed.Token !== "string" || typeof parsed.Expiration !== "string") { - throw new property_provider_1.CredentialsProviderError("HTTP credential provider response not of the required format, an object matching: { AccessKeyId: string, SecretAccessKey: string, Token: string, Expiration: string(rfc3339) }", { logger }); - } - return { - accessKeyId: parsed.AccessKeyId, - secretAccessKey: parsed.SecretAccessKey, - sessionToken: parsed.Token, - expiration: (0, smithy_client_1.parseRfc3339DateTime)(parsed.Expiration) - }; + function saveTextToParentTag(textData, currentNode, jPath, isLeafNode) { + if (textData) { + if (isLeafNode === void 0) isLeafNode = Object.keys(currentNode.child).length === 0; + textData = this.parseTextData( + textData, + currentNode.tagname, + jPath, + false, + currentNode[":@"] ? Object.keys(currentNode[":@"]).length !== 0 : false, + isLeafNode + ); + if (textData !== void 0 && textData !== "") + currentNode.add(this.options.textNodeName, textData); + textData = ""; } - if (response.statusCode >= 400 && response.statusCode < 500) { - let parsedBody = {}; - try { - parsedBody = JSON.parse(str); - } catch (e) { - } - throw Object.assign(new property_provider_1.CredentialsProviderError(`Server responded with status: ${response.statusCode}`, { logger }), { - Code: parsedBody.Code, - Message: parsedBody.Message - }); + return textData; + } + function isItStopNode(stopNodes, jPath, currentTagName) { + const allNodesExp = "*." + currentTagName; + for (const stopNodePath in stopNodes) { + const stopNodeExp = stopNodes[stopNodePath]; + if (allNodesExp === stopNodeExp || jPath === stopNodeExp) return true; } - throw new property_provider_1.CredentialsProviderError(`Server responded with status: ${response.statusCode}`, { logger }); + return false; } - exports2.getCredentials = getCredentials; - } -}); - -// ../../../node_modules/@aws-sdk/credential-provider-http/dist-cjs/fromHttp/retry-wrapper.js -var require_retry_wrapper = __commonJS({ - "../../../node_modules/@aws-sdk/credential-provider-http/dist-cjs/fromHttp/retry-wrapper.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.retryWrapper = void 0; - var retryWrapper = (toRetry, maxRetries, delayMs) => { - return async () => { - for (let i = 0; i < maxRetries; ++i) { - try { - return await toRetry(); - } catch (e) { - await new Promise((resolve) => setTimeout(resolve, delayMs)); + function tagExpWithClosingIndex(xmlData, i, closingChar = ">") { + let attrBoundary; + let tagExp = ""; + for (let index = i; index < xmlData.length; index++) { + let ch = xmlData[index]; + if (attrBoundary) { + if (ch === attrBoundary) attrBoundary = ""; + } else if (ch === '"' || ch === "'") { + attrBoundary = ch; + } else if (ch === closingChar[0]) { + if (closingChar[1]) { + if (xmlData[index + 1] === closingChar[1]) { + return { + data: tagExp, + index + }; + } + } else { + return { + data: tagExp, + index + }; } + } else if (ch === " ") { + ch = " "; } - return await toRetry(); - }; - }; - exports2.retryWrapper = retryWrapper; - } -}); - -// ../../../node_modules/@aws-sdk/credential-provider-http/dist-cjs/fromHttp/fromHttp.js -var require_fromHttp = __commonJS({ - "../../../node_modules/@aws-sdk/credential-provider-http/dist-cjs/fromHttp/fromHttp.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.fromHttp = void 0; - var tslib_1 = (init_tslib_es6(), __toCommonJS(tslib_es6_exports)); - var node_http_handler_1 = require_dist_cjs51(); - var property_provider_1 = require_dist_cjs40(); - var promises_1 = tslib_1.__importDefault(require("fs/promises")); - var checkUrl_1 = require_checkUrl(); - var requestHelpers_1 = require_requestHelpers(); - var retry_wrapper_1 = require_retry_wrapper(); - var AWS_CONTAINER_CREDENTIALS_RELATIVE_URI = "AWS_CONTAINER_CREDENTIALS_RELATIVE_URI"; - var DEFAULT_LINK_LOCAL_HOST = "http://169.254.170.2"; - var AWS_CONTAINER_CREDENTIALS_FULL_URI = "AWS_CONTAINER_CREDENTIALS_FULL_URI"; - var AWS_CONTAINER_AUTHORIZATION_TOKEN_FILE = "AWS_CONTAINER_AUTHORIZATION_TOKEN_FILE"; - var AWS_CONTAINER_AUTHORIZATION_TOKEN = "AWS_CONTAINER_AUTHORIZATION_TOKEN"; - var fromHttp = (options = {}) => { - options.logger?.debug("@aws-sdk/credential-provider-http - fromHttp"); - let host; - const relative = options.awsContainerCredentialsRelativeUri ?? process.env[AWS_CONTAINER_CREDENTIALS_RELATIVE_URI]; - const full = options.awsContainerCredentialsFullUri ?? process.env[AWS_CONTAINER_CREDENTIALS_FULL_URI]; - const token = options.awsContainerAuthorizationToken ?? process.env[AWS_CONTAINER_AUTHORIZATION_TOKEN]; - const tokenFile = options.awsContainerAuthorizationTokenFile ?? process.env[AWS_CONTAINER_AUTHORIZATION_TOKEN_FILE]; - const warn = options.logger?.constructor?.name === "NoOpLogger" || !options.logger ? console.warn : options.logger.warn; - if (relative && full) { - warn("@aws-sdk/credential-provider-http: you have set both awsContainerCredentialsRelativeUri and awsContainerCredentialsFullUri."); - warn("awsContainerCredentialsFullUri will take precedence."); - } - if (token && tokenFile) { - warn("@aws-sdk/credential-provider-http: you have set both awsContainerAuthorizationToken and awsContainerAuthorizationTokenFile."); - warn("awsContainerAuthorizationToken will take precedence."); + tagExp += ch; } - if (full) { - host = full; - } else if (relative) { - host = `${DEFAULT_LINK_LOCAL_HOST}${relative}`; + } + function findClosingIndex(xmlData, str, i, errMsg) { + const closingIndex = xmlData.indexOf(str, i); + if (closingIndex === -1) { + throw new Error(errMsg); } else { - throw new property_provider_1.CredentialsProviderError(`No HTTP credential provider host provided. -Set AWS_CONTAINER_CREDENTIALS_FULL_URI or AWS_CONTAINER_CREDENTIALS_RELATIVE_URI.`, { logger: options.logger }); + return closingIndex + str.length - 1; } - const url2 = new URL(host); - (0, checkUrl_1.checkUrl)(url2, options.logger); - const requestHandler = new node_http_handler_1.NodeHttpHandler({ - requestTimeout: options.timeout ?? 1e3, - connectionTimeout: options.timeout ?? 1e3 - }); - return (0, retry_wrapper_1.retryWrapper)(async () => { - const request2 = (0, requestHelpers_1.createGetRequest)(url2); - if (token) { - request2.headers.Authorization = token; - } else if (tokenFile) { - request2.headers.Authorization = (await promises_1.default.readFile(tokenFile)).toString(); - } - try { - const result = await requestHandler.handle(request2); - return (0, requestHelpers_1.getCredentials)(result.response); - } catch (e) { - throw new property_provider_1.CredentialsProviderError(String(e), { logger: options.logger }); - } - }, options.maxRetries ?? 3, options.timeout ?? 1e3); - }; - exports2.fromHttp = fromHttp; - } -}); - -// ../../../node_modules/@aws-sdk/credential-provider-http/dist-cjs/index.js -var require_dist_cjs55 = __commonJS({ - "../../../node_modules/@aws-sdk/credential-provider-http/dist-cjs/index.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.fromHttp = void 0; - var fromHttp_1 = require_fromHttp(); - Object.defineProperty(exports2, "fromHttp", { enumerable: true, get: function() { - return fromHttp_1.fromHttp; - } }); - } -}); - -// ../../../node_modules/@aws-sdk/client-sso/dist-cjs/auth/httpAuthSchemeProvider.js -var require_httpAuthSchemeProvider2 = __commonJS({ - "../../../node_modules/@aws-sdk/client-sso/dist-cjs/auth/httpAuthSchemeProvider.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.resolveHttpAuthSchemeConfig = exports2.defaultSSOHttpAuthSchemeProvider = exports2.defaultSSOHttpAuthSchemeParametersProvider = void 0; - var core_1 = (init_dist_es2(), __toCommonJS(dist_es_exports2)); - var util_middleware_1 = require_dist_cjs10(); - var defaultSSOHttpAuthSchemeParametersProvider = async (config, context, input) => { - return { - operation: (0, util_middleware_1.getSmithyContext)(context).operation, - region: await (0, util_middleware_1.normalizeProvider)(config.region)() || (() => { - throw new Error("expected `region` to be configured for `aws.auth#sigv4`"); - })() - }; - }; - exports2.defaultSSOHttpAuthSchemeParametersProvider = defaultSSOHttpAuthSchemeParametersProvider; - function createAwsAuthSigv4HttpAuthOption(authParameters) { - return { - schemeId: "aws.auth#sigv4", - signingProperties: { - name: "awsssoportal", - region: authParameters.region - }, - propertiesExtractor: (config, context) => ({ - signingProperties: { - config, - context - } - }) - }; } - function createSmithyApiNoAuthHttpAuthOption(authParameters) { + function readTagExp(xmlData, i, removeNSPrefix, closingChar = ">") { + const result = tagExpWithClosingIndex(xmlData, i + 1, closingChar); + if (!result) return; + let tagExp = result.data; + const closeIndex = result.index; + const separatorIndex = tagExp.search(/\s/); + let tagName = tagExp; + let attrExpPresent = true; + if (separatorIndex !== -1) { + tagName = tagExp.substring(0, separatorIndex); + tagExp = tagExp.substring(separatorIndex + 1).trimStart(); + } + const rawTagName = tagName; + if (removeNSPrefix) { + const colonIndex = tagName.indexOf(":"); + if (colonIndex !== -1) { + tagName = tagName.substr(colonIndex + 1); + attrExpPresent = tagName !== result.data.substr(colonIndex + 1); + } + } return { - schemeId: "smithy.api#noAuth" + tagName, + tagExp, + closeIndex, + attrExpPresent, + rawTagName }; } - var defaultSSOHttpAuthSchemeProvider = (authParameters) => { - const options = []; - switch (authParameters.operation) { - case "GetRoleCredentials": { - options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); - break; - } - case "ListAccountRoles": { - options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); - break; - } - case "ListAccounts": { - options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); - break; - } - case "Logout": { - options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); - break; - } - default: { - options.push(createAwsAuthSigv4HttpAuthOption(authParameters)); + function readStopNodeData(xmlData, tagName, i) { + const startIndex = i; + let openTagCount = 1; + for (; i < xmlData.length; i++) { + if (xmlData[i] === "<") { + if (xmlData[i + 1] === "/") { + const closeIndex = findClosingIndex(xmlData, ">", i, `${tagName} is not closed`); + let closeTagName = xmlData.substring(i + 2, closeIndex).trim(); + if (closeTagName === tagName) { + openTagCount--; + if (openTagCount === 0) { + return { + tagContent: xmlData.substring(startIndex, i), + i: closeIndex + }; + } + } + i = closeIndex; + } else if (xmlData[i + 1] === "?") { + const closeIndex = findClosingIndex(xmlData, "?>", i + 1, "StopNode is not closed."); + i = closeIndex; + } else if (xmlData.substr(i + 1, 3) === "!--") { + const closeIndex = findClosingIndex(xmlData, "-->", i + 3, "StopNode is not closed."); + i = closeIndex; + } else if (xmlData.substr(i + 1, 2) === "![") { + const closeIndex = findClosingIndex(xmlData, "]]>", i, "StopNode is not closed.") - 2; + i = closeIndex; + } else { + const tagData = readTagExp(xmlData, i, ">"); + if (tagData) { + const openTagName = tagData && tagData.tagName; + if (openTagName === tagName && tagData.tagExp[tagData.tagExp.length - 1] !== "/") { + openTagCount++; + } + i = tagData.closeIndex; + } + } } } - return options; - }; - exports2.defaultSSOHttpAuthSchemeProvider = defaultSSOHttpAuthSchemeProvider; - var resolveHttpAuthSchemeConfig = (config) => { - const config_0 = (0, core_1.resolveAwsSdkSigV4Config)(config); - return { - ...config_0 - }; - }; - exports2.resolveHttpAuthSchemeConfig = resolveHttpAuthSchemeConfig; - } -}); - -// ../../../node_modules/@aws-sdk/client-sso/package.json -var require_package2 = __commonJS({ - "../../../node_modules/@aws-sdk/client-sso/package.json"(exports2, module2) { - module2.exports = { - name: "@aws-sdk/client-sso", - description: "AWS SDK for JavaScript Sso Client for Node.js, Browser and React Native", - version: "3.632.0", - scripts: { - build: "concurrently 'yarn:build:cjs' 'yarn:build:es' 'yarn:build:types'", - "build:cjs": "node ../../scripts/compilation/inline client-sso", - "build:es": "tsc -p tsconfig.es.json", - "build:include:deps": "lerna run --scope $npm_package_name --include-dependencies build", - "build:types": "tsc -p tsconfig.types.json", - "build:types:downlevel": "downlevel-dts dist-types dist-types/ts3.4", - clean: "rimraf ./dist-* && rimraf *.tsbuildinfo", - "extract:docs": "api-extractor run --local", - "generate:client": "node ../../scripts/generate-clients/single-service --solo sso" - }, - main: "./dist-cjs/index.js", - types: "./dist-types/index.d.ts", - module: "./dist-es/index.js", - sideEffects: false, - dependencies: { - "@aws-crypto/sha256-browser": "5.2.0", - "@aws-crypto/sha256-js": "5.2.0", - "@aws-sdk/core": "3.629.0", - "@aws-sdk/middleware-host-header": "3.620.0", - "@aws-sdk/middleware-logger": "3.609.0", - "@aws-sdk/middleware-recursion-detection": "3.620.0", - "@aws-sdk/middleware-user-agent": "3.632.0", - "@aws-sdk/region-config-resolver": "3.614.0", - "@aws-sdk/types": "3.609.0", - "@aws-sdk/util-endpoints": "3.632.0", - "@aws-sdk/util-user-agent-browser": "3.609.0", - "@aws-sdk/util-user-agent-node": "3.614.0", - "@smithy/config-resolver": "^3.0.5", - "@smithy/core": "^2.3.2", - "@smithy/fetch-http-handler": "^3.2.4", - "@smithy/hash-node": "^3.0.3", - "@smithy/invalid-dependency": "^3.0.3", - "@smithy/middleware-content-length": "^3.0.5", - "@smithy/middleware-endpoint": "^3.1.0", - "@smithy/middleware-retry": "^3.0.14", - "@smithy/middleware-serde": "^3.0.3", - "@smithy/middleware-stack": "^3.0.3", - "@smithy/node-config-provider": "^3.1.4", - "@smithy/node-http-handler": "^3.1.4", - "@smithy/protocol-http": "^4.1.0", - "@smithy/smithy-client": "^3.1.12", - "@smithy/types": "^3.3.0", - "@smithy/url-parser": "^3.0.3", - "@smithy/util-base64": "^3.0.0", - "@smithy/util-body-length-browser": "^3.0.0", - "@smithy/util-body-length-node": "^3.0.0", - "@smithy/util-defaults-mode-browser": "^3.0.14", - "@smithy/util-defaults-mode-node": "^3.0.14", - "@smithy/util-endpoints": "^2.0.5", - "@smithy/util-middleware": "^3.0.3", - "@smithy/util-retry": "^3.0.3", - "@smithy/util-utf8": "^3.0.0", - tslib: "^2.6.2" - }, - devDependencies: { - "@tsconfig/node16": "16.1.3", - "@types/node": "^16.18.96", - concurrently: "7.0.0", - "downlevel-dts": "0.10.1", - rimraf: "3.0.2", - typescript: "~4.9.5" - }, - engines: { - node: ">=16.0.0" - }, - typesVersions: { - "<4.0": { - "dist-types/*": [ - "dist-types/ts3.4/*" - ] + } + function parseValue(val2, shouldParse, options) { + if (shouldParse && typeof val2 === "string") { + const newval = val2.trim(); + if (newval === "true") return true; + else if (newval === "false") return false; + else return toNumber(val2, options); + } else { + if (util.isExist(val2)) { + return val2; + } else { + return ""; } - }, - files: [ - "dist-*/**" - ], - author: { - name: "AWS SDK for JavaScript Team", - url: "https://aws.amazon.com/javascript/" - }, - license: "Apache-2.0", - browser: { - "./dist-es/runtimeConfig": "./dist-es/runtimeConfig.browser" - }, - "react-native": { - "./dist-es/runtimeConfig": "./dist-es/runtimeConfig.native" - }, - homepage: "https://github.com/aws/aws-sdk-js-v3/tree/main/clients/client-sso", - repository: { - type: "git", - url: "https://github.com/aws/aws-sdk-js-v3.git", - directory: "clients/client-sso" } - }; + } + module2.exports = OrderedObjParser; } }); -// ../../../node_modules/@aws-sdk/util-user-agent-node/dist-cjs/index.js -var require_dist_cjs56 = __commonJS({ - "../../../node_modules/@aws-sdk/util-user-agent-node/dist-cjs/index.js"(exports2, module2) { +// ../../../node_modules/fast-xml-parser/src/xmlparser/node2json.js +var require_node2json = __commonJS({ + "../../../node_modules/fast-xml-parser/src/xmlparser/node2json.js"(exports2) { "use strict"; - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + function prettify(node, options) { + return compress(node, options); + } + function compress(arr, options, jPath) { + let text; + const compressedObj = {}; + for (let i = 0; i < arr.length; i++) { + const tagObj = arr[i]; + const property = propName(tagObj); + let newJpath = ""; + if (jPath === void 0) newJpath = property; + else newJpath = jPath + "." + property; + if (property === options.textNodeName) { + if (text === void 0) text = tagObj[property]; + else text += "" + tagObj[property]; + } else if (property === void 0) { + continue; + } else if (tagObj[property]) { + let val2 = compress(tagObj[property], options, newJpath); + const isLeaf = isLeafTag(val2, options); + if (tagObj[":@"]) { + assignAttributes(val2, tagObj[":@"], newJpath, options); + } else if (Object.keys(val2).length === 1 && val2[options.textNodeName] !== void 0 && !options.alwaysCreateTextNode) { + val2 = val2[options.textNodeName]; + } else if (Object.keys(val2).length === 0) { + if (options.alwaysCreateTextNode) val2[options.textNodeName] = ""; + else val2 = ""; + } + if (compressedObj[property] !== void 0 && compressedObj.hasOwnProperty(property)) { + if (!Array.isArray(compressedObj[property])) { + compressedObj[property] = [compressedObj[property]]; + } + compressedObj[property].push(val2); + } else { + if (options.isArray(property, newJpath, isLeaf)) { + compressedObj[property] = [val2]; + } else { + compressedObj[property] = val2; + } + } + } } - return to; - }; - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - UA_APP_ID_ENV_NAME: () => UA_APP_ID_ENV_NAME, - UA_APP_ID_INI_NAME: () => UA_APP_ID_INI_NAME, - crtAvailability: () => crtAvailability, - defaultUserAgent: () => defaultUserAgent - }); - module2.exports = __toCommonJS2(src_exports); - var import_node_config_provider = require_dist_cjs42(); - var import_os = require("os"); - var import_process = require("process"); - var crtAvailability = { - isCrtAvailable: false - }; - var isCrtAvailable = /* @__PURE__ */ __name(() => { - if (crtAvailability.isCrtAvailable) { - return ["md/crt-avail"]; + if (typeof text === "string") { + if (text.length > 0) compressedObj[options.textNodeName] = text; + } else if (text !== void 0) compressedObj[options.textNodeName] = text; + return compressedObj; + } + function propName(obj) { + const keys = Object.keys(obj); + for (let i = 0; i < keys.length; i++) { + const key = keys[i]; + if (key !== ":@") return key; } - return null; - }, "isCrtAvailable"); - var UA_APP_ID_ENV_NAME = "AWS_SDK_UA_APP_ID"; - var UA_APP_ID_INI_NAME = "sdk-ua-app-id"; - var defaultUserAgent = /* @__PURE__ */ __name(({ serviceId, clientVersion }) => { - const sections = [ - // sdk-metadata - ["aws-sdk-js", clientVersion], - // ua-metadata - ["ua", "2.0"], - // os-metadata - [`os/${(0, import_os.platform)()}`, (0, import_os.release)()], - // language-metadata - // ECMAScript edition doesn't matter in JS, so no version needed. - ["lang/js"], - ["md/nodejs", `${import_process.versions.node}`] - ]; - const crtAvailable = isCrtAvailable(); - if (crtAvailable) { - sections.push(crtAvailable); + } + function assignAttributes(obj, attrMap, jpath, options) { + if (attrMap) { + const keys = Object.keys(attrMap); + const len = keys.length; + for (let i = 0; i < len; i++) { + const atrrName = keys[i]; + if (options.isArray(atrrName, jpath + "." + atrrName, true, true)) { + obj[atrrName] = [attrMap[atrrName]]; + } else { + obj[atrrName] = attrMap[atrrName]; + } + } } - if (serviceId) { - sections.push([`api/${serviceId}`, clientVersion]); + } + function isLeafTag(obj, options) { + const { textNodeName } = options; + const propCount = Object.keys(obj).length; + if (propCount === 0) { + return true; } - if (import_process.env.AWS_EXECUTION_ENV) { - sections.push([`exec-env/${import_process.env.AWS_EXECUTION_ENV}`]); + if (propCount === 1 && (obj[textNodeName] || typeof obj[textNodeName] === "boolean" || obj[textNodeName] === 0)) { + return true; } - const appIdPromise = (0, import_node_config_provider.loadConfig)({ - environmentVariableSelector: (env2) => env2[UA_APP_ID_ENV_NAME], - configFileSelector: (profile) => profile[UA_APP_ID_INI_NAME], - default: void 0 - })(); - let resolvedUserAgent = void 0; - return async () => { - if (!resolvedUserAgent) { - const appId = await appIdPromise; - resolvedUserAgent = appId ? [...sections, [`app/${appId}`]] : [...sections]; - } - return resolvedUserAgent; - }; - }, "defaultUserAgent"); + return false; + } + exports2.prettify = prettify; } }); -// ../../../node_modules/@smithy/hash-node/dist-cjs/index.js -var require_dist_cjs57 = __commonJS({ - "../../../node_modules/@smithy/hash-node/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); - } - return to; - }; - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - Hash: () => Hash - }); - module2.exports = __toCommonJS2(src_exports); - var import_util_buffer_from = require_dist_cjs27(); - var import_util_utf8 = require_dist_cjs28(); - var import_buffer = require("buffer"); - var import_crypto5 = require("crypto"); - var _Hash = class _Hash { - constructor(algorithmIdentifier, secret) { - this.algorithmIdentifier = algorithmIdentifier; - this.secret = secret; - this.reset(); - } - update(toHash, encoding) { - this.hash.update((0, import_util_utf8.toUint8Array)(castSourceData(toHash, encoding))); +// ../../../node_modules/fast-xml-parser/src/xmlparser/XMLParser.js +var require_XMLParser = __commonJS({ + "../../../node_modules/fast-xml-parser/src/xmlparser/XMLParser.js"(exports2, module2) { + var { buildOptions } = require_OptionsBuilder(); + var OrderedObjParser = require_OrderedObjParser(); + var { prettify } = require_node2json(); + var validator = require_validator(); + var XMLParser2 = class { + constructor(options) { + this.externalEntities = {}; + this.options = buildOptions(options); } - digest() { - return Promise.resolve(this.hash.digest()); + /** + * Parse XML dats to JS object + * @param {string|Buffer} xmlData + * @param {boolean|Object} validationOption + */ + parse(xmlData, validationOption) { + if (typeof xmlData === "string") { + } else if (xmlData.toString) { + xmlData = xmlData.toString(); + } else { + throw new Error("XML data is accepted in String or Bytes[] form."); + } + if (validationOption) { + if (validationOption === true) validationOption = {}; + const result = validator.validate(xmlData, validationOption); + if (result !== true) { + throw Error(`${result.err.msg}:${result.err.line}:${result.err.col}`); + } + } + const orderedObjParser = new OrderedObjParser(this.options); + orderedObjParser.addExternalEntities(this.externalEntities); + const orderedResult = orderedObjParser.parseXml(xmlData); + if (this.options.preserveOrder || orderedResult === void 0) return orderedResult; + else return prettify(orderedResult, this.options); } - reset() { - this.hash = this.secret ? (0, import_crypto5.createHmac)(this.algorithmIdentifier, castSourceData(this.secret)) : (0, import_crypto5.createHash)(this.algorithmIdentifier); + /** + * Add Entity which is not by default supported by this library + * @param {string} key + * @param {string} value + */ + addEntity(key, value) { + if (value.indexOf("&") !== -1) { + throw new Error("Entity value can't have '&'"); + } else if (key.indexOf("&") !== -1 || key.indexOf(";") !== -1) { + throw new Error("An entity must be set without '&' and ';'. Eg. use '#xD' for ' '"); + } else if (value === "&") { + throw new Error("An entity with value '&' is not permitted"); + } else { + this.externalEntities[key] = value; + } } }; - __name(_Hash, "Hash"); - var Hash = _Hash; - function castSourceData(toCast, encoding) { - if (import_buffer.Buffer.isBuffer(toCast)) { - return toCast; - } - if (typeof toCast === "string") { - return (0, import_util_buffer_from.fromString)(toCast, encoding); - } - if (ArrayBuffer.isView(toCast)) { - return (0, import_util_buffer_from.fromArrayBuffer)(toCast.buffer, toCast.byteOffset, toCast.byteLength); - } - return (0, import_util_buffer_from.fromArrayBuffer)(toCast); - } - __name(castSourceData, "castSourceData"); + module2.exports = XMLParser2; } }); -// ../../../node_modules/@smithy/util-body-length-node/dist-cjs/index.js -var require_dist_cjs58 = __commonJS({ - "../../../node_modules/@smithy/util-body-length-node/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); - } - return to; - }; - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - calculateBodyLength: () => calculateBodyLength - }); - module2.exports = __toCommonJS2(src_exports); - var import_fs = require("fs"); - var calculateBodyLength = /* @__PURE__ */ __name((body) => { - if (!body) { - return 0; +// ../../../node_modules/fast-xml-parser/src/xmlbuilder/orderedJs2Xml.js +var require_orderedJs2Xml = __commonJS({ + "../../../node_modules/fast-xml-parser/src/xmlbuilder/orderedJs2Xml.js"(exports2, module2) { + var EOL = "\n"; + function toXml(jArray, options) { + let indentation = ""; + if (options.format && options.indentBy.length > 0) { + indentation = EOL; } - if (typeof body === "string") { - return Buffer.byteLength(body); - } else if (typeof body.byteLength === "number") { - return body.byteLength; - } else if (typeof body.size === "number") { - return body.size; - } else if (typeof body.start === "number" && typeof body.end === "number") { - return body.end + 1 - body.start; - } else if (typeof body.path === "string" || Buffer.isBuffer(body.path)) { - return (0, import_fs.lstatSync)(body.path).size; - } else if (typeof body.fd === "number") { - return (0, import_fs.fstatSync)(body.fd).size; + return arrToStr(jArray, options, "", indentation); + } + function arrToStr(arr, options, jPath, indentation) { + let xmlStr = ""; + let isPreviousElementTag = false; + for (let i = 0; i < arr.length; i++) { + const tagObj = arr[i]; + const tagName = propName(tagObj); + if (tagName === void 0) continue; + let newJPath = ""; + if (jPath.length === 0) newJPath = tagName; + else newJPath = `${jPath}.${tagName}`; + if (tagName === options.textNodeName) { + let tagText = tagObj[tagName]; + if (!isStopNode(newJPath, options)) { + tagText = options.tagValueProcessor(tagName, tagText); + tagText = replaceEntitiesValue(tagText, options); + } + if (isPreviousElementTag) { + xmlStr += indentation; + } + xmlStr += tagText; + isPreviousElementTag = false; + continue; + } else if (tagName === options.cdataPropName) { + if (isPreviousElementTag) { + xmlStr += indentation; + } + xmlStr += ``; + isPreviousElementTag = false; + continue; + } else if (tagName === options.commentPropName) { + xmlStr += indentation + ``; + isPreviousElementTag = true; + continue; + } else if (tagName[0] === "?") { + const attStr2 = attr_to_str(tagObj[":@"], options); + const tempInd = tagName === "?xml" ? "" : indentation; + let piTextNodeName = tagObj[tagName][0][options.textNodeName]; + piTextNodeName = piTextNodeName.length !== 0 ? " " + piTextNodeName : ""; + xmlStr += tempInd + `<${tagName}${piTextNodeName}${attStr2}?>`; + isPreviousElementTag = true; + continue; + } + let newIdentation = indentation; + if (newIdentation !== "") { + newIdentation += options.indentBy; + } + const attStr = attr_to_str(tagObj[":@"], options); + const tagStart = indentation + `<${tagName}${attStr}`; + const tagValue = arrToStr(tagObj[tagName], options, newJPath, newIdentation); + if (options.unpairedTags.indexOf(tagName) !== -1) { + if (options.suppressUnpairedNode) xmlStr += tagStart + ">"; + else xmlStr += tagStart + "/>"; + } else if ((!tagValue || tagValue.length === 0) && options.suppressEmptyNode) { + xmlStr += tagStart + "/>"; + } else if (tagValue && tagValue.endsWith(">")) { + xmlStr += tagStart + `>${tagValue}${indentation}`; + } else { + xmlStr += tagStart + ">"; + if (tagValue && indentation !== "" && (tagValue.includes("/>") || tagValue.includes("`; + } + isPreviousElementTag = true; } - throw new Error(`Body Length computation failed for ${body}`); - }, "calculateBodyLength"); - } -}); - -// ../../../node_modules/@smithy/util-retry/node_modules/@smithy/service-error-classification/dist-cjs/index.js -var require_dist_cjs59 = __commonJS({ - "../../../node_modules/@smithy/util-retry/node_modules/@smithy/service-error-classification/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + return xmlStr; + } + function propName(obj) { + const keys = Object.keys(obj); + for (let i = 0; i < keys.length; i++) { + const key = keys[i]; + if (!obj.hasOwnProperty(key)) continue; + if (key !== ":@") return key; } - return to; - }; - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - isClockSkewCorrectedError: () => isClockSkewCorrectedError, - isClockSkewError: () => isClockSkewError, - isRetryableByTrait: () => isRetryableByTrait, - isServerError: () => isServerError, - isThrottlingError: () => isThrottlingError, - isTransientError: () => isTransientError - }); - module2.exports = __toCommonJS2(src_exports); - var CLOCK_SKEW_ERROR_CODES = [ - "AuthFailure", - "InvalidSignatureException", - "RequestExpired", - "RequestInTheFuture", - "RequestTimeTooSkewed", - "SignatureDoesNotMatch" - ]; - var THROTTLING_ERROR_CODES = [ - "BandwidthLimitExceeded", - "EC2ThrottledException", - "LimitExceededException", - "PriorRequestNotComplete", - "ProvisionedThroughputExceededException", - "RequestLimitExceeded", - "RequestThrottled", - "RequestThrottledException", - "SlowDown", - "ThrottledException", - "Throttling", - "ThrottlingException", - "TooManyRequestsException", - "TransactionInProgressException" - // DynamoDB - ]; - var TRANSIENT_ERROR_CODES = ["TimeoutError", "RequestTimeout", "RequestTimeoutException"]; - var TRANSIENT_ERROR_STATUS_CODES = [500, 502, 503, 504]; - var NODEJS_TIMEOUT_ERROR_CODES = ["ECONNRESET", "ECONNREFUSED", "EPIPE", "ETIMEDOUT"]; - var isRetryableByTrait = /* @__PURE__ */ __name((error) => error.$retryable !== void 0, "isRetryableByTrait"); - var isClockSkewError = /* @__PURE__ */ __name((error) => CLOCK_SKEW_ERROR_CODES.includes(error.name), "isClockSkewError"); - var isClockSkewCorrectedError = /* @__PURE__ */ __name((error) => { - var _a; - return (_a = error.$metadata) == null ? void 0 : _a.clockSkewCorrected; - }, "isClockSkewCorrectedError"); - var isThrottlingError = /* @__PURE__ */ __name((error) => { - var _a, _b; - return ((_a = error.$metadata) == null ? void 0 : _a.httpStatusCode) === 429 || THROTTLING_ERROR_CODES.includes(error.name) || ((_b = error.$retryable) == null ? void 0 : _b.throttling) == true; - }, "isThrottlingError"); - var isTransientError = /* @__PURE__ */ __name((error) => { - var _a; - return isClockSkewCorrectedError(error) || TRANSIENT_ERROR_CODES.includes(error.name) || NODEJS_TIMEOUT_ERROR_CODES.includes((error == null ? void 0 : error.code) || "") || TRANSIENT_ERROR_STATUS_CODES.includes(((_a = error.$metadata) == null ? void 0 : _a.httpStatusCode) || 0); - }, "isTransientError"); - var isServerError = /* @__PURE__ */ __name((error) => { - var _a; - if (((_a = error.$metadata) == null ? void 0 : _a.httpStatusCode) !== void 0) { - const statusCode = error.$metadata.httpStatusCode; - if (500 <= statusCode && statusCode <= 599 && !isTransientError(error)) { - return true; + } + function attr_to_str(attrMap, options) { + let attrStr = ""; + if (attrMap && !options.ignoreAttributes) { + for (let attr in attrMap) { + if (!attrMap.hasOwnProperty(attr)) continue; + let attrVal = options.attributeValueProcessor(attr, attrMap[attr]); + attrVal = replaceEntitiesValue(attrVal, options); + if (attrVal === true && options.suppressBooleanAttributes) { + attrStr += ` ${attr.substr(options.attributeNamePrefix.length)}`; + } else { + attrStr += ` ${attr.substr(options.attributeNamePrefix.length)}="${attrVal}"`; + } } - return false; + } + return attrStr; + } + function isStopNode(jPath, options) { + jPath = jPath.substr(0, jPath.length - options.textNodeName.length - 1); + let tagName = jPath.substr(jPath.lastIndexOf(".") + 1); + for (let index in options.stopNodes) { + if (options.stopNodes[index] === jPath || options.stopNodes[index] === "*." + tagName) return true; } return false; - }, "isServerError"); + } + function replaceEntitiesValue(textValue, options) { + if (textValue && textValue.length > 0 && options.processEntities) { + for (let i = 0; i < options.entities.length; i++) { + const entity = options.entities[i]; + textValue = textValue.replace(entity.regex, entity.val); + } + } + return textValue; + } + module2.exports = toXml; } }); -// ../../../node_modules/@smithy/util-retry/dist-cjs/index.js -var require_dist_cjs60 = __commonJS({ - "../../../node_modules/@smithy/util-retry/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); - } - return to; +// ../../../node_modules/fast-xml-parser/src/xmlbuilder/json2xml.js +var require_json2xml = __commonJS({ + "../../../node_modules/fast-xml-parser/src/xmlbuilder/json2xml.js"(exports2, module2) { + "use strict"; + var buildFromOrderedJs = require_orderedJs2Xml(); + var defaultOptions = { + attributeNamePrefix: "@_", + attributesGroupName: false, + textNodeName: "#text", + ignoreAttributes: true, + cdataPropName: false, + format: false, + indentBy: " ", + suppressEmptyNode: false, + suppressUnpairedNode: true, + suppressBooleanAttributes: true, + tagValueProcessor: function(key, a) { + return a; + }, + attributeValueProcessor: function(attrName, a) { + return a; + }, + preserveOrder: false, + commentPropName: false, + unpairedTags: [], + entities: [ + { regex: new RegExp("&", "g"), val: "&" }, + //it must be on top + { regex: new RegExp(">", "g"), val: ">" }, + { regex: new RegExp("<", "g"), val: "<" }, + { regex: new RegExp("'", "g"), val: "'" }, + { regex: new RegExp('"', "g"), val: """ } + ], + processEntities: true, + stopNodes: [], + // transformTagName: false, + // transformAttributeName: false, + oneListGroup: false }; - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - AdaptiveRetryStrategy: () => AdaptiveRetryStrategy, - ConfiguredRetryStrategy: () => ConfiguredRetryStrategy, - DEFAULT_MAX_ATTEMPTS: () => DEFAULT_MAX_ATTEMPTS, - DEFAULT_RETRY_DELAY_BASE: () => DEFAULT_RETRY_DELAY_BASE, - DEFAULT_RETRY_MODE: () => DEFAULT_RETRY_MODE, - DefaultRateLimiter: () => DefaultRateLimiter, - INITIAL_RETRY_TOKENS: () => INITIAL_RETRY_TOKENS, - INVOCATION_ID_HEADER: () => INVOCATION_ID_HEADER, - MAXIMUM_RETRY_DELAY: () => MAXIMUM_RETRY_DELAY, - NO_RETRY_INCREMENT: () => NO_RETRY_INCREMENT, - REQUEST_HEADER: () => REQUEST_HEADER, - RETRY_COST: () => RETRY_COST, - RETRY_MODES: () => RETRY_MODES, - StandardRetryStrategy: () => StandardRetryStrategy, - THROTTLING_RETRY_DELAY_BASE: () => THROTTLING_RETRY_DELAY_BASE, - TIMEOUT_RETRY_COST: () => TIMEOUT_RETRY_COST - }); - module2.exports = __toCommonJS2(src_exports); - var RETRY_MODES = /* @__PURE__ */ ((RETRY_MODES2) => { - RETRY_MODES2["STANDARD"] = "standard"; - RETRY_MODES2["ADAPTIVE"] = "adaptive"; - return RETRY_MODES2; - })(RETRY_MODES || {}); - var DEFAULT_MAX_ATTEMPTS = 3; - var DEFAULT_RETRY_MODE = "standard"; - var import_service_error_classification = require_dist_cjs59(); - var _DefaultRateLimiter = class _DefaultRateLimiter { - constructor(options) { - this.currentCapacity = 0; - this.enabled = false; - this.lastMaxRate = 0; - this.measuredTxRate = 0; - this.requestCount = 0; - this.lastTimestamp = 0; - this.timeWindow = 0; - this.beta = (options == null ? void 0 : options.beta) ?? 0.7; - this.minCapacity = (options == null ? void 0 : options.minCapacity) ?? 1; - this.minFillRate = (options == null ? void 0 : options.minFillRate) ?? 0.5; - this.scaleConstant = (options == null ? void 0 : options.scaleConstant) ?? 0.4; - this.smooth = (options == null ? void 0 : options.smooth) ?? 0.8; - const currentTimeInSeconds = this.getCurrentTimeInSeconds(); - this.lastThrottleTime = currentTimeInSeconds; - this.lastTxRateBucket = Math.floor(this.getCurrentTimeInSeconds()); - this.fillRate = this.minFillRate; - this.maxCapacity = this.minCapacity; - } - getCurrentTimeInSeconds() { - return Date.now() / 1e3; - } - async getSendToken() { - return this.acquireTokenBucket(1); + function Builder(options) { + this.options = Object.assign({}, defaultOptions, options); + if (this.options.ignoreAttributes || this.options.attributesGroupName) { + this.isAttribute = function() { + return false; + }; + } else { + this.attrPrefixLen = this.options.attributeNamePrefix.length; + this.isAttribute = isAttribute; } - async acquireTokenBucket(amount) { - if (!this.enabled) { - return; - } - this.refillTokenBucket(); - if (amount > this.currentCapacity) { - const delay = (amount - this.currentCapacity) / this.fillRate * 1e3; - await new Promise((resolve) => setTimeout(resolve, delay)); - } - this.currentCapacity = this.currentCapacity - amount; + this.processTextOrObjNode = processTextOrObjNode; + if (this.options.format) { + this.indentate = indentate; + this.tagEndChar = ">\n"; + this.newLine = "\n"; + } else { + this.indentate = function() { + return ""; + }; + this.tagEndChar = ">"; + this.newLine = ""; } - refillTokenBucket() { - const timestamp = this.getCurrentTimeInSeconds(); - if (!this.lastTimestamp) { - this.lastTimestamp = timestamp; - return; + } + Builder.prototype.build = function(jObj) { + if (this.options.preserveOrder) { + return buildFromOrderedJs(jObj, this.options); + } else { + if (Array.isArray(jObj) && this.options.arrayNodeName && this.options.arrayNodeName.length > 1) { + jObj = { + [this.options.arrayNodeName]: jObj + }; } - const fillAmount = (timestamp - this.lastTimestamp) * this.fillRate; - this.currentCapacity = Math.min(this.maxCapacity, this.currentCapacity + fillAmount); - this.lastTimestamp = timestamp; + return this.j2x(jObj, 0).val; } - updateClientSendingRate(response) { - let calculatedRate; - this.updateMeasuredRate(); - if ((0, import_service_error_classification.isThrottlingError)(response)) { - const rateToUse = !this.enabled ? this.measuredTxRate : Math.min(this.measuredTxRate, this.fillRate); - this.lastMaxRate = rateToUse; - this.calculateTimeWindow(); - this.lastThrottleTime = this.getCurrentTimeInSeconds(); - calculatedRate = this.cubicThrottle(rateToUse); - this.enableTokenBucket(); + }; + Builder.prototype.j2x = function(jObj, level) { + let attrStr = ""; + let val2 = ""; + for (let key in jObj) { + if (!Object.prototype.hasOwnProperty.call(jObj, key)) continue; + if (typeof jObj[key] === "undefined") { + if (this.isAttribute(key)) { + val2 += ""; + } + } else if (jObj[key] === null) { + if (this.isAttribute(key)) { + val2 += ""; + } else if (key[0] === "?") { + val2 += this.indentate(level) + "<" + key + "?" + this.tagEndChar; + } else { + val2 += this.indentate(level) + "<" + key + "/" + this.tagEndChar; + } + } else if (jObj[key] instanceof Date) { + val2 += this.buildTextValNode(jObj[key], key, "", level); + } else if (typeof jObj[key] !== "object") { + const attr = this.isAttribute(key); + if (attr) { + attrStr += this.buildAttrPairStr(attr, "" + jObj[key]); + } else { + if (key === this.options.textNodeName) { + let newval = this.options.tagValueProcessor(key, "" + jObj[key]); + val2 += this.replaceEntitiesValue(newval); + } else { + val2 += this.buildTextValNode(jObj[key], key, "", level); + } + } + } else if (Array.isArray(jObj[key])) { + const arrLen = jObj[key].length; + let listTagVal = ""; + let listTagAttr = ""; + for (let j = 0; j < arrLen; j++) { + const item = jObj[key][j]; + if (typeof item === "undefined") { + } else if (item === null) { + if (key[0] === "?") val2 += this.indentate(level) + "<" + key + "?" + this.tagEndChar; + else val2 += this.indentate(level) + "<" + key + "/" + this.tagEndChar; + } else if (typeof item === "object") { + if (this.options.oneListGroup) { + const result = this.j2x(item, level + 1); + listTagVal += result.val; + if (this.options.attributesGroupName && item.hasOwnProperty(this.options.attributesGroupName)) { + listTagAttr += result.attrStr; + } + } else { + listTagVal += this.processTextOrObjNode(item, key, level); + } + } else { + if (this.options.oneListGroup) { + let textValue = this.options.tagValueProcessor(key, item); + textValue = this.replaceEntitiesValue(textValue); + listTagVal += textValue; + } else { + listTagVal += this.buildTextValNode(item, key, "", level); + } + } + } + if (this.options.oneListGroup) { + listTagVal = this.buildObjectNode(listTagVal, key, listTagAttr, level); + } + val2 += listTagVal; } else { - this.calculateTimeWindow(); - calculatedRate = this.cubicSuccess(this.getCurrentTimeInSeconds()); - } - const newRate = Math.min(calculatedRate, 2 * this.measuredTxRate); - this.updateTokenBucketRate(newRate); - } - calculateTimeWindow() { - this.timeWindow = this.getPrecise(Math.pow(this.lastMaxRate * (1 - this.beta) / this.scaleConstant, 1 / 3)); - } - cubicThrottle(rateToUse) { - return this.getPrecise(rateToUse * this.beta); - } - cubicSuccess(timestamp) { - return this.getPrecise( - this.scaleConstant * Math.pow(timestamp - this.lastThrottleTime - this.timeWindow, 3) + this.lastMaxRate - ); - } - enableTokenBucket() { - this.enabled = true; - } - updateTokenBucketRate(newRate) { - this.refillTokenBucket(); - this.fillRate = Math.max(newRate, this.minFillRate); - this.maxCapacity = Math.max(newRate, this.minCapacity); - this.currentCapacity = Math.min(this.currentCapacity, this.maxCapacity); - } - updateMeasuredRate() { - const t = this.getCurrentTimeInSeconds(); - const timeBucket = Math.floor(t * 2) / 2; - this.requestCount++; - if (timeBucket > this.lastTxRateBucket) { - const currentRate = this.requestCount / (timeBucket - this.lastTxRateBucket); - this.measuredTxRate = this.getPrecise(currentRate * this.smooth + this.measuredTxRate * (1 - this.smooth)); - this.requestCount = 0; - this.lastTxRateBucket = timeBucket; + if (this.options.attributesGroupName && key === this.options.attributesGroupName) { + const Ks = Object.keys(jObj[key]); + const L = Ks.length; + for (let j = 0; j < L; j++) { + attrStr += this.buildAttrPairStr(Ks[j], "" + jObj[key][Ks[j]]); + } + } else { + val2 += this.processTextOrObjNode(jObj[key], key, level); + } } } - getPrecise(num) { - return parseFloat(num.toFixed(8)); - } + return { attrStr, val: val2 }; }; - __name(_DefaultRateLimiter, "DefaultRateLimiter"); - var DefaultRateLimiter = _DefaultRateLimiter; - var DEFAULT_RETRY_DELAY_BASE = 100; - var MAXIMUM_RETRY_DELAY = 20 * 1e3; - var THROTTLING_RETRY_DELAY_BASE = 500; - var INITIAL_RETRY_TOKENS = 500; - var RETRY_COST = 5; - var TIMEOUT_RETRY_COST = 10; - var NO_RETRY_INCREMENT = 1; - var INVOCATION_ID_HEADER = "amz-sdk-invocation-id"; - var REQUEST_HEADER = "amz-sdk-request"; - var getDefaultRetryBackoffStrategy = /* @__PURE__ */ __name(() => { - let delayBase = DEFAULT_RETRY_DELAY_BASE; - const computeNextBackoffDelay = /* @__PURE__ */ __name((attempts) => { - return Math.floor(Math.min(MAXIMUM_RETRY_DELAY, Math.random() * 2 ** attempts * delayBase)); - }, "computeNextBackoffDelay"); - const setDelayBase = /* @__PURE__ */ __name((delay) => { - delayBase = delay; - }, "setDelayBase"); - return { - computeNextBackoffDelay, - setDelayBase - }; - }, "getDefaultRetryBackoffStrategy"); - var createDefaultRetryToken = /* @__PURE__ */ __name(({ - retryDelay, - retryCount, - retryCost - }) => { - const getRetryCount = /* @__PURE__ */ __name(() => retryCount, "getRetryCount"); - const getRetryDelay = /* @__PURE__ */ __name(() => Math.min(MAXIMUM_RETRY_DELAY, retryDelay), "getRetryDelay"); - const getRetryCost = /* @__PURE__ */ __name(() => retryCost, "getRetryCost"); - return { - getRetryCount, - getRetryDelay, - getRetryCost - }; - }, "createDefaultRetryToken"); - var _StandardRetryStrategy = class _StandardRetryStrategy { - constructor(maxAttempts) { - this.maxAttempts = maxAttempts; - this.mode = "standard"; - this.capacity = INITIAL_RETRY_TOKENS; - this.retryBackoffStrategy = getDefaultRetryBackoffStrategy(); - this.maxAttemptsProvider = typeof maxAttempts === "function" ? maxAttempts : async () => maxAttempts; - } - // eslint-disable-next-line @typescript-eslint/no-unused-vars - async acquireInitialRetryToken(retryTokenScope) { - return createDefaultRetryToken({ - retryDelay: DEFAULT_RETRY_DELAY_BASE, - retryCount: 0 - }); + Builder.prototype.buildAttrPairStr = function(attrName, val2) { + val2 = this.options.attributeValueProcessor(attrName, "" + val2); + val2 = this.replaceEntitiesValue(val2); + if (this.options.suppressBooleanAttributes && val2 === "true") { + return " " + attrName; + } else return " " + attrName + '="' + val2 + '"'; + }; + function processTextOrObjNode(object, key, level) { + const result = this.j2x(object, level + 1); + if (object[this.options.textNodeName] !== void 0 && Object.keys(object).length === 1) { + return this.buildTextValNode(object[this.options.textNodeName], key, result.attrStr, level); + } else { + return this.buildObjectNode(result.val, key, result.attrStr, level); } - async refreshRetryTokenForRetry(token, errorInfo) { - const maxAttempts = await this.getMaxAttempts(); - if (this.shouldRetry(token, errorInfo, maxAttempts)) { - const errorType = errorInfo.errorType; - this.retryBackoffStrategy.setDelayBase( - errorType === "THROTTLING" ? THROTTLING_RETRY_DELAY_BASE : DEFAULT_RETRY_DELAY_BASE - ); - const delayFromErrorType = this.retryBackoffStrategy.computeNextBackoffDelay(token.getRetryCount()); - const retryDelay = errorInfo.retryAfterHint ? Math.max(errorInfo.retryAfterHint.getTime() - Date.now() || 0, delayFromErrorType) : delayFromErrorType; - const capacityCost = this.getCapacityCost(errorType); - this.capacity -= capacityCost; - return createDefaultRetryToken({ - retryDelay, - retryCount: token.getRetryCount() + 1, - retryCost: capacityCost - }); + } + Builder.prototype.buildObjectNode = function(val2, key, attrStr, level) { + if (val2 === "") { + if (key[0] === "?") return this.indentate(level) + "<" + key + attrStr + "?" + this.tagEndChar; + else { + return this.indentate(level) + "<" + key + attrStr + this.closeTag(key) + this.tagEndChar; } - throw new Error("No retry token available"); - } - recordSuccess(token) { - this.capacity = Math.max(INITIAL_RETRY_TOKENS, this.capacity + (token.getRetryCost() ?? NO_RETRY_INCREMENT)); - } - /** - * @returns the current available retry capacity. - * - * This number decreases when retries are executed and refills when requests or retries succeed. - */ - getCapacity() { - return this.capacity; - } - async getMaxAttempts() { - try { - return await this.maxAttemptsProvider(); - } catch (error) { - console.warn(`Max attempts provider could not resolve. Using default of ${DEFAULT_MAX_ATTEMPTS}`); - return DEFAULT_MAX_ATTEMPTS; + } else { + let tagEndExp = "" + val2 + tagEndExp; + } else if (this.options.commentPropName !== false && key === this.options.commentPropName && piClosingChar.length === 0) { + return this.indentate(level) + `` + this.newLine; + } else { + return this.indentate(level) + "<" + key + attrStr + piClosingChar + this.tagEndChar + val2 + this.indentate(level) + tagEndExp; } } - shouldRetry(tokenToRenew, errorInfo, maxAttempts) { - const attempts = tokenToRenew.getRetryCount() + 1; - return attempts < maxAttempts && this.capacity >= this.getCapacityCost(errorInfo.errorType) && this.isRetryableError(errorInfo.errorType); - } - getCapacityCost(errorType) { - return errorType === "TRANSIENT" ? TIMEOUT_RETRY_COST : RETRY_COST; + }; + Builder.prototype.closeTag = function(key) { + let closeTag = ""; + if (this.options.unpairedTags.indexOf(key) !== -1) { + if (!this.options.suppressUnpairedNode) closeTag = "/"; + } else if (this.options.suppressEmptyNode) { + closeTag = "/"; + } else { + closeTag = `>` + this.newLine; + } else if (this.options.commentPropName !== false && key === this.options.commentPropName) { + return this.indentate(level) + `` + this.newLine; + } else if (key[0] === "?") { + return this.indentate(level) + "<" + key + attrStr + "?" + this.tagEndChar; + } else { + let textValue = this.options.tagValueProcessor(key, val2); + textValue = this.replaceEntitiesValue(textValue); + if (textValue === "") { + return this.indentate(level) + "<" + key + attrStr + this.closeTag(key) + this.tagEndChar; + } else { + return this.indentate(level) + "<" + key + attrStr + ">" + textValue + " 0 && this.options.processEntities) { + for (let i = 0; i < this.options.entities.length; i++) { + const entity = this.options.entities[i]; + textValue = textValue.replace(entity.regex, entity.val); + } } - async acquireInitialRetryToken(retryTokenScope) { - await this.rateLimiter.getSendToken(); - return this.standardRetryStrategy.acquireInitialRetryToken(retryTokenScope); + return textValue; + }; + function indentate(level) { + return this.options.indentBy.repeat(level); + } + function isAttribute(name) { + if (name.startsWith(this.options.attributeNamePrefix) && name !== this.options.textNodeName) { + return name.substr(this.attrPrefixLen); + } else { + return false; } - async refreshRetryTokenForRetry(tokenToRenew, errorInfo) { - this.rateLimiter.updateClientSendingRate(errorInfo); - return this.standardRetryStrategy.refreshRetryTokenForRetry(tokenToRenew, errorInfo); + } + module2.exports = Builder; + } +}); + +// ../../../node_modules/fast-xml-parser/src/fxp.js +var require_fxp = __commonJS({ + "../../../node_modules/fast-xml-parser/src/fxp.js"(exports2, module2) { + "use strict"; + var validator = require_validator(); + var XMLParser2 = require_XMLParser(); + var XMLBuilder = require_json2xml(); + module2.exports = { + XMLParser: XMLParser2, + XMLValidator: validator, + XMLBuilder + }; + } +}); + +// ../../../node_modules/@aws-sdk/core/dist-es/submodules/protocols/xml/parseXmlBody.js +var import_smithy_client3, import_fast_xml_parser, parseXmlBody, parseXmlErrorBody, loadRestXmlErrorCode; +var init_parseXmlBody = __esm({ + "../../../node_modules/@aws-sdk/core/dist-es/submodules/protocols/xml/parseXmlBody.js"() { + import_smithy_client3 = __toESM(require_dist_cjs33()); + import_fast_xml_parser = __toESM(require_fxp()); + init_common(); + parseXmlBody = (streamBody, context) => collectBodyString(streamBody, context).then((encoded) => { + if (encoded.length) { + const parser = new import_fast_xml_parser.XMLParser({ + attributeNamePrefix: "", + htmlEntities: true, + ignoreAttributes: false, + ignoreDeclaration: true, + parseTagValue: false, + trimValues: false, + tagValueProcessor: (_, val2) => val2.trim() === "" && val2.includes("\n") ? "" : void 0 + }); + parser.addEntity("#xD", "\r"); + parser.addEntity("#10", "\n"); + let parsedObj; + try { + parsedObj = parser.parse(encoded, true); + } catch (e) { + if (e && typeof e === "object") { + Object.defineProperty(e, "$responseBodyText", { + value: encoded + }); + } + throw e; + } + const textNodeName = "#text"; + const key = Object.keys(parsedObj)[0]; + const parsedObjToReturn = parsedObj[key]; + if (parsedObjToReturn[textNodeName]) { + parsedObjToReturn[key] = parsedObjToReturn[textNodeName]; + delete parsedObjToReturn[textNodeName]; + } + return (0, import_smithy_client3.getValueFromTextNode)(parsedObjToReturn); } - recordSuccess(token) { - this.rateLimiter.updateClientSendingRate({}); - this.standardRetryStrategy.recordSuccess(token); + return {}; + }); + parseXmlErrorBody = async (errorBody, context) => { + const value = await parseXmlBody(errorBody, context); + if (value.Error) { + value.Error.message = value.Error.message ?? value.Error.Message; } + return value; }; - __name(_AdaptiveRetryStrategy, "AdaptiveRetryStrategy"); - var AdaptiveRetryStrategy = _AdaptiveRetryStrategy; - var _ConfiguredRetryStrategy = class _ConfiguredRetryStrategy extends StandardRetryStrategy { - /** - * @param maxAttempts - the maximum number of retry attempts allowed. - * e.g., if set to 3, then 4 total requests are possible. - * @param computeNextBackoffDelay - a millisecond delay for each retry or a function that takes the retry attempt - * and returns the delay. - * - * @example exponential backoff. - * ```js - * new Client({ - * retryStrategy: new ConfiguredRetryStrategy(3, (attempt) => attempt ** 2) - * }); - * ``` - * @example constant delay. - * ```js - * new Client({ - * retryStrategy: new ConfiguredRetryStrategy(3, 2000) - * }); - * ``` - */ - constructor(maxAttempts, computeNextBackoffDelay = DEFAULT_RETRY_DELAY_BASE) { - super(typeof maxAttempts === "function" ? maxAttempts : async () => maxAttempts); - if (typeof computeNextBackoffDelay === "number") { - this.computeNextBackoffDelay = () => computeNextBackoffDelay; - } else { - this.computeNextBackoffDelay = computeNextBackoffDelay; - } + loadRestXmlErrorCode = (output, data) => { + if (data?.Error?.Code !== void 0) { + return data.Error.Code; } - async refreshRetryTokenForRetry(tokenToRenew, errorInfo) { - const token = await super.refreshRetryTokenForRetry(tokenToRenew, errorInfo); - token.getRetryDelay = () => this.computeNextBackoffDelay(token.getRetryCount()); - return token; + if (data?.Code !== void 0) { + return data.Code; + } + if (output.statusCode == 404) { + return "NotFound"; } }; - __name(_ConfiguredRetryStrategy, "ConfiguredRetryStrategy"); - var ConfiguredRetryStrategy = _ConfiguredRetryStrategy; } }); -// ../../../node_modules/@aws-sdk/client-sso/dist-cjs/endpoint/ruleset.js -var require_ruleset = __commonJS({ - "../../../node_modules/@aws-sdk/client-sso/dist-cjs/endpoint/ruleset.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.ruleSet = void 0; - var u = "required"; - var v = "fn"; - var w = "argv"; - var x = "ref"; - var a = true; - var b = "isSet"; - var c = "booleanEquals"; - var d = "error"; - var e = "endpoint"; - var f = "tree"; - var g = "PartitionResult"; - var h = "getAttr"; - var i = { [u]: false, "type": "String" }; - var j = { [u]: true, "default": false, "type": "Boolean" }; - var k = { [x]: "Endpoint" }; - var l = { [v]: c, [w]: [{ [x]: "UseFIPS" }, true] }; - var m = { [v]: c, [w]: [{ [x]: "UseDualStack" }, true] }; - var n = {}; - var o = { [v]: h, [w]: [{ [x]: g }, "supportsFIPS"] }; - var p = { [x]: g }; - var q = { [v]: c, [w]: [true, { [v]: h, [w]: [p, "supportsDualStack"] }] }; - var r = [l]; - var s = [m]; - var t = [{ [x]: "Region" }]; - var _data = { version: "1.0", parameters: { Region: i, UseDualStack: j, UseFIPS: j, Endpoint: i }, rules: [{ conditions: [{ [v]: b, [w]: [k] }], rules: [{ conditions: r, error: "Invalid Configuration: FIPS and custom endpoint are not supported", type: d }, { conditions: s, error: "Invalid Configuration: Dualstack and custom endpoint are not supported", type: d }, { endpoint: { url: k, properties: n, headers: n }, type: e }], type: f }, { conditions: [{ [v]: b, [w]: t }], rules: [{ conditions: [{ [v]: "aws.partition", [w]: t, assign: g }], rules: [{ conditions: [l, m], rules: [{ conditions: [{ [v]: c, [w]: [a, o] }, q], rules: [{ endpoint: { url: "https://portal.sso-fips.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "FIPS and DualStack are enabled, but this partition does not support one or both", type: d }], type: f }, { conditions: r, rules: [{ conditions: [{ [v]: c, [w]: [o, a] }], rules: [{ conditions: [{ [v]: "stringEquals", [w]: [{ [v]: h, [w]: [p, "name"] }, "aws-us-gov"] }], endpoint: { url: "https://portal.sso.{Region}.amazonaws.com", properties: n, headers: n }, type: e }, { endpoint: { url: "https://portal.sso-fips.{Region}.{PartitionResult#dnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "FIPS is enabled but this partition does not support FIPS", type: d }], type: f }, { conditions: s, rules: [{ conditions: [q], rules: [{ endpoint: { url: "https://portal.sso.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "DualStack is enabled but this partition does not support DualStack", type: d }], type: f }, { endpoint: { url: "https://portal.sso.{Region}.{PartitionResult#dnsSuffix}", properties: n, headers: n }, type: e }], type: f }], type: f }, { error: "Invalid Configuration: Missing Region", type: d }] }; - exports2.ruleSet = _data; +// ../../../node_modules/@aws-sdk/core/dist-es/submodules/protocols/index.js +var init_protocols2 = __esm({ + "../../../node_modules/@aws-sdk/core/dist-es/submodules/protocols/index.js"() { + init_coercing_serializers(); + init_awsExpectUnion(); + init_parseJsonBody(); + init_parseXmlBody(); } }); -// ../../../node_modules/@aws-sdk/client-sso/dist-cjs/endpoint/endpointResolver.js -var require_endpointResolver = __commonJS({ - "../../../node_modules/@aws-sdk/client-sso/dist-cjs/endpoint/endpointResolver.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.defaultEndpointResolver = void 0; - var util_endpoints_1 = require_dist_cjs7(); - var util_endpoints_2 = require_dist_cjs6(); - var ruleset_1 = require_ruleset(); - var defaultEndpointResolver = (endpointParams, context = {}) => { - return (0, util_endpoints_2.resolveEndpoint)(ruleset_1.ruleSet, { - endpointParams, - logger: context.logger - }); - }; - exports2.defaultEndpointResolver = defaultEndpointResolver; - util_endpoints_2.customEndpointFunctions.aws = util_endpoints_1.awsEndpointFunctions; +// ../../../node_modules/@aws-sdk/core/dist-es/index.js +var dist_es_exports2 = {}; +__export(dist_es_exports2, { + AWSSDKSigV4Signer: () => AWSSDKSigV4Signer, + AwsSdkSigV4ASigner: () => AwsSdkSigV4ASigner, + AwsSdkSigV4Signer: () => AwsSdkSigV4Signer, + NODE_SIGV4A_CONFIG_OPTIONS: () => NODE_SIGV4A_CONFIG_OPTIONS, + _toBool: () => _toBool, + _toNum: () => _toNum, + _toStr: () => _toStr, + awsExpectUnion: () => awsExpectUnion, + emitWarningIfUnsupportedVersion: () => emitWarningIfUnsupportedVersion, + loadRestJsonErrorCode: () => loadRestJsonErrorCode, + loadRestXmlErrorCode: () => loadRestXmlErrorCode, + parseJsonBody: () => parseJsonBody, + parseJsonErrorBody: () => parseJsonErrorBody, + parseXmlBody: () => parseXmlBody, + parseXmlErrorBody: () => parseXmlErrorBody, + resolveAWSSDKSigV4Config: () => resolveAWSSDKSigV4Config, + resolveAwsSdkSigV4AConfig: () => resolveAwsSdkSigV4AConfig, + resolveAwsSdkSigV4Config: () => resolveAwsSdkSigV4Config, + validateSigningProperties: () => validateSigningProperties +}); +var init_dist_es2 = __esm({ + "../../../node_modules/@aws-sdk/core/dist-es/index.js"() { + init_client(); + init_httpAuthSchemes2(); + init_protocols2(); } }); -// ../../../node_modules/@aws-sdk/client-sso/dist-cjs/runtimeConfig.shared.js -var require_runtimeConfig_shared = __commonJS({ - "../../../node_modules/@aws-sdk/client-sso/dist-cjs/runtimeConfig.shared.js"(exports2) { +// ../../../node_modules/@aws-sdk/client-sfn/dist-cjs/auth/httpAuthSchemeProvider.js +var require_httpAuthSchemeProvider = __commonJS({ + "../../../node_modules/@aws-sdk/client-sfn/dist-cjs/auth/httpAuthSchemeProvider.js"(exports2) { "use strict"; Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.getRuntimeConfig = void 0; + exports2.resolveHttpAuthSchemeConfig = exports2.defaultSFNHttpAuthSchemeProvider = exports2.defaultSFNHttpAuthSchemeParametersProvider = void 0; var core_1 = (init_dist_es2(), __toCommonJS(dist_es_exports2)); - var core_2 = (init_dist_es(), __toCommonJS(dist_es_exports)); - var smithy_client_1 = require_dist_cjs37(); - var url_parser_1 = require_dist_cjs44(); - var util_base64_1 = require_dist_cjs29(); - var util_utf8_1 = require_dist_cjs28(); - var httpAuthSchemeProvider_1 = require_httpAuthSchemeProvider2(); - var endpointResolver_1 = require_endpointResolver(); - var getRuntimeConfig = (config) => { + var util_middleware_1 = require_dist_cjs10(); + var defaultSFNHttpAuthSchemeParametersProvider = async (config, context, input) => { return { - apiVersion: "2019-06-10", - base64Decoder: config?.base64Decoder ?? util_base64_1.fromBase64, - base64Encoder: config?.base64Encoder ?? util_base64_1.toBase64, - disableHostPrefix: config?.disableHostPrefix ?? false, - endpointProvider: config?.endpointProvider ?? endpointResolver_1.defaultEndpointResolver, - extensions: config?.extensions ?? [], - httpAuthSchemeProvider: config?.httpAuthSchemeProvider ?? httpAuthSchemeProvider_1.defaultSSOHttpAuthSchemeProvider, - httpAuthSchemes: config?.httpAuthSchemes ?? [ - { - schemeId: "aws.auth#sigv4", - identityProvider: (ipc) => ipc.getIdentityProvider("aws.auth#sigv4"), - signer: new core_1.AwsSdkSigV4Signer() - }, - { - schemeId: "smithy.api#noAuth", - identityProvider: (ipc) => ipc.getIdentityProvider("smithy.api#noAuth") || (async () => ({})), - signer: new core_2.NoAuthSigner() - } - ], - logger: config?.logger ?? new smithy_client_1.NoOpLogger(), - serviceId: config?.serviceId ?? "SSO", - urlParser: config?.urlParser ?? url_parser_1.parseUrl, - utf8Decoder: config?.utf8Decoder ?? util_utf8_1.fromUtf8, - utf8Encoder: config?.utf8Encoder ?? util_utf8_1.toUtf8 + operation: (0, util_middleware_1.getSmithyContext)(context).operation, + region: await (0, util_middleware_1.normalizeProvider)(config.region)() || (() => { + throw new Error("expected `region` to be configured for `aws.auth#sigv4`"); + })() }; }; - exports2.getRuntimeConfig = getRuntimeConfig; - } -}); - -// ../../../node_modules/@smithy/util-defaults-mode-node/node_modules/@smithy/util-middleware/dist-cjs/index.js -var require_dist_cjs61 = __commonJS({ - "../../../node_modules/@smithy/util-defaults-mode-node/node_modules/@smithy/util-middleware/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + exports2.defaultSFNHttpAuthSchemeParametersProvider = defaultSFNHttpAuthSchemeParametersProvider; + function createAwsAuthSigv4HttpAuthOption(authParameters) { + return { + schemeId: "aws.auth#sigv4", + signingProperties: { + name: "states", + region: authParameters.region + }, + propertiesExtractor: (config, context) => ({ + signingProperties: { + config, + context + } + }) + }; + } + var defaultSFNHttpAuthSchemeProvider = (authParameters) => { + const options = []; + switch (authParameters.operation) { + default: { + options.push(createAwsAuthSigv4HttpAuthOption(authParameters)); + } } - return to; + return options; }; - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - getSmithyContext: () => getSmithyContext4, - normalizeProvider: () => normalizeProvider2 - }); - module2.exports = __toCommonJS2(src_exports); - var import_types5 = require_dist_cjs(); - var getSmithyContext4 = /* @__PURE__ */ __name((context) => context[import_types5.SMITHY_CONTEXT_KEY] || (context[import_types5.SMITHY_CONTEXT_KEY] = {}), "getSmithyContext"); - var normalizeProvider2 = /* @__PURE__ */ __name((input) => { - if (typeof input === "function") - return input; - const promisified = Promise.resolve(input); - return () => promisified; - }, "normalizeProvider"); + exports2.defaultSFNHttpAuthSchemeProvider = defaultSFNHttpAuthSchemeProvider; + var resolveHttpAuthSchemeConfig = (config) => { + const config_0 = (0, core_1.resolveAwsSdkSigV4Config)(config); + return { + ...config_0 + }; + }; + exports2.resolveHttpAuthSchemeConfig = resolveHttpAuthSchemeConfig; } }); -// ../../../node_modules/@smithy/util-defaults-mode-node/node_modules/@smithy/config-resolver/dist-cjs/index.js -var require_dist_cjs62 = __commonJS({ - "../../../node_modules/@smithy/util-defaults-mode-node/node_modules/@smithy/config-resolver/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); - } - return to; +// ../../../node_modules/tslib/tslib.es6.mjs +var tslib_es6_exports = {}; +__export(tslib_es6_exports, { + __addDisposableResource: () => __addDisposableResource, + __assign: () => __assign, + __asyncDelegator: () => __asyncDelegator, + __asyncGenerator: () => __asyncGenerator, + __asyncValues: () => __asyncValues, + __await: () => __await, + __awaiter: () => __awaiter, + __classPrivateFieldGet: () => __classPrivateFieldGet, + __classPrivateFieldIn: () => __classPrivateFieldIn, + __classPrivateFieldSet: () => __classPrivateFieldSet, + __createBinding: () => __createBinding, + __decorate: () => __decorate, + __disposeResources: () => __disposeResources, + __esDecorate: () => __esDecorate, + __exportStar: () => __exportStar, + __extends: () => __extends, + __generator: () => __generator, + __importDefault: () => __importDefault, + __importStar: () => __importStar, + __makeTemplateObject: () => __makeTemplateObject, + __metadata: () => __metadata, + __param: () => __param, + __propKey: () => __propKey, + __read: () => __read, + __rest: () => __rest, + __rewriteRelativeImportExtension: () => __rewriteRelativeImportExtension, + __runInitializers: () => __runInitializers, + __setFunctionName: () => __setFunctionName, + __spread: () => __spread, + __spreadArray: () => __spreadArray, + __spreadArrays: () => __spreadArrays, + __values: () => __values, + default: () => tslib_es6_default +}); +function __extends(d, b) { + if (typeof b !== "function" && b !== null) + throw new TypeError("Class extends value " + String(b) + " is not a constructor or null"); + extendStatics(d, b); + function __() { + this.constructor = d; + } + d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __()); +} +function __rest(s, e) { + var t = {}; + for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0) + t[p] = s[p]; + if (s != null && typeof Object.getOwnPropertySymbols === "function") + for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++) { + if (e.indexOf(p[i]) < 0 && Object.prototype.propertyIsEnumerable.call(s, p[i])) + t[p[i]] = s[p[i]]; + } + return t; +} +function __decorate(decorators, target, key, desc) { + var c = arguments.length, r = c < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d; + if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r = Reflect.decorate(decorators, target, key, desc); + else for (var i = decorators.length - 1; i >= 0; i--) if (d = decorators[i]) r = (c < 3 ? d(r) : c > 3 ? d(target, key, r) : d(target, key)) || r; + return c > 3 && r && Object.defineProperty(target, key, r), r; +} +function __param(paramIndex, decorator) { + return function(target, key) { + decorator(target, key, paramIndex); + }; +} +function __esDecorate(ctor, descriptorIn, decorators, contextIn, initializers, extraInitializers) { + function accept(f) { + if (f !== void 0 && typeof f !== "function") throw new TypeError("Function expected"); + return f; + } + var kind = contextIn.kind, key = kind === "getter" ? "get" : kind === "setter" ? "set" : "value"; + var target = !descriptorIn && ctor ? contextIn["static"] ? ctor : ctor.prototype : null; + var descriptor = descriptorIn || (target ? Object.getOwnPropertyDescriptor(target, contextIn.name) : {}); + var _, done = false; + for (var i = decorators.length - 1; i >= 0; i--) { + var context = {}; + for (var p in contextIn) context[p] = p === "access" ? {} : contextIn[p]; + for (var p in contextIn.access) context.access[p] = contextIn.access[p]; + context.addInitializer = function(f) { + if (done) throw new TypeError("Cannot add initializers after decoration has completed"); + extraInitializers.push(accept(f || null)); }; - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - CONFIG_USE_DUALSTACK_ENDPOINT: () => CONFIG_USE_DUALSTACK_ENDPOINT, - CONFIG_USE_FIPS_ENDPOINT: () => CONFIG_USE_FIPS_ENDPOINT, - DEFAULT_USE_DUALSTACK_ENDPOINT: () => DEFAULT_USE_DUALSTACK_ENDPOINT, - DEFAULT_USE_FIPS_ENDPOINT: () => DEFAULT_USE_FIPS_ENDPOINT, - ENV_USE_DUALSTACK_ENDPOINT: () => ENV_USE_DUALSTACK_ENDPOINT, - ENV_USE_FIPS_ENDPOINT: () => ENV_USE_FIPS_ENDPOINT, - NODE_REGION_CONFIG_FILE_OPTIONS: () => NODE_REGION_CONFIG_FILE_OPTIONS, - NODE_REGION_CONFIG_OPTIONS: () => NODE_REGION_CONFIG_OPTIONS, - NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS: () => NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS, - NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS: () => NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS, - REGION_ENV_NAME: () => REGION_ENV_NAME, - REGION_INI_NAME: () => REGION_INI_NAME, - getRegionInfo: () => getRegionInfo, - resolveCustomEndpointsConfig: () => resolveCustomEndpointsConfig, - resolveEndpointsConfig: () => resolveEndpointsConfig, - resolveRegionConfig: () => resolveRegionConfig + var result = (0, decorators[i])(kind === "accessor" ? { get: descriptor.get, set: descriptor.set } : descriptor[key], context); + if (kind === "accessor") { + if (result === void 0) continue; + if (result === null || typeof result !== "object") throw new TypeError("Object expected"); + if (_ = accept(result.get)) descriptor.get = _; + if (_ = accept(result.set)) descriptor.set = _; + if (_ = accept(result.init)) initializers.unshift(_); + } else if (_ = accept(result)) { + if (kind === "field") initializers.unshift(_); + else descriptor[key] = _; + } + } + if (target) Object.defineProperty(target, contextIn.name, descriptor); + done = true; +} +function __runInitializers(thisArg, initializers, value) { + var useValue = arguments.length > 2; + for (var i = 0; i < initializers.length; i++) { + value = useValue ? initializers[i].call(thisArg, value) : initializers[i].call(thisArg); + } + return useValue ? value : void 0; +} +function __propKey(x) { + return typeof x === "symbol" ? x : "".concat(x); +} +function __setFunctionName(f, name, prefix) { + if (typeof name === "symbol") name = name.description ? "[".concat(name.description, "]") : ""; + return Object.defineProperty(f, "name", { configurable: true, value: prefix ? "".concat(prefix, " ", name) : name }); +} +function __metadata(metadataKey, metadataValue) { + if (typeof Reflect === "object" && typeof Reflect.metadata === "function") return Reflect.metadata(metadataKey, metadataValue); +} +function __awaiter(thisArg, _arguments, P, generator) { + function adopt(value) { + return value instanceof P ? value : new P(function(resolve) { + resolve(value); }); - module2.exports = __toCommonJS2(src_exports); - var import_util_config_provider = require_dist_cjs9(); - var ENV_USE_DUALSTACK_ENDPOINT = "AWS_USE_DUALSTACK_ENDPOINT"; - var CONFIG_USE_DUALSTACK_ENDPOINT = "use_dualstack_endpoint"; - var DEFAULT_USE_DUALSTACK_ENDPOINT = false; - var NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS = { - environmentVariableSelector: (env) => (0, import_util_config_provider.booleanSelector)(env, ENV_USE_DUALSTACK_ENDPOINT, import_util_config_provider.SelectorType.ENV), - configFileSelector: (profile) => (0, import_util_config_provider.booleanSelector)(profile, CONFIG_USE_DUALSTACK_ENDPOINT, import_util_config_provider.SelectorType.CONFIG), - default: false - }; - var ENV_USE_FIPS_ENDPOINT = "AWS_USE_FIPS_ENDPOINT"; - var CONFIG_USE_FIPS_ENDPOINT = "use_fips_endpoint"; - var DEFAULT_USE_FIPS_ENDPOINT = false; - var NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS = { - environmentVariableSelector: (env) => (0, import_util_config_provider.booleanSelector)(env, ENV_USE_FIPS_ENDPOINT, import_util_config_provider.SelectorType.ENV), - configFileSelector: (profile) => (0, import_util_config_provider.booleanSelector)(profile, CONFIG_USE_FIPS_ENDPOINT, import_util_config_provider.SelectorType.CONFIG), - default: false - }; - var import_util_middleware3 = require_dist_cjs61(); - var resolveCustomEndpointsConfig = /* @__PURE__ */ __name((input) => { - const { endpoint, urlParser } = input; - return { - ...input, - tls: input.tls ?? true, - endpoint: (0, import_util_middleware3.normalizeProvider)(typeof endpoint === "string" ? urlParser(endpoint) : endpoint), - isCustomEndpoint: true, - useDualstackEndpoint: (0, import_util_middleware3.normalizeProvider)(input.useDualstackEndpoint ?? false) - }; - }, "resolveCustomEndpointsConfig"); - var getEndpointFromRegion = /* @__PURE__ */ __name(async (input) => { - const { tls = true } = input; - const region = await input.region(); - const dnsHostRegex = new RegExp(/^([a-zA-Z0-9]|[a-zA-Z0-9][a-zA-Z0-9-]{0,61}[a-zA-Z0-9])$/); - if (!dnsHostRegex.test(region)) { - throw new Error("Invalid region in client config"); - } - const useDualstackEndpoint = await input.useDualstackEndpoint(); - const useFipsEndpoint = await input.useFipsEndpoint(); - const { hostname } = await input.regionInfoProvider(region, { useDualstackEndpoint, useFipsEndpoint }) ?? {}; - if (!hostname) { - throw new Error("Cannot resolve hostname from client config"); + } + return new (P || (P = Promise))(function(resolve, reject) { + function fulfilled(value) { + try { + step(generator.next(value)); + } catch (e) { + reject(e); } - return input.urlParser(`${tls ? "https:" : "http:"}//${hostname}`); - }, "getEndpointFromRegion"); - var resolveEndpointsConfig = /* @__PURE__ */ __name((input) => { - const useDualstackEndpoint = (0, import_util_middleware3.normalizeProvider)(input.useDualstackEndpoint ?? false); - const { endpoint, useFipsEndpoint, urlParser } = input; - return { - ...input, - tls: input.tls ?? true, - endpoint: endpoint ? (0, import_util_middleware3.normalizeProvider)(typeof endpoint === "string" ? urlParser(endpoint) : endpoint) : () => getEndpointFromRegion({ ...input, useDualstackEndpoint, useFipsEndpoint }), - isCustomEndpoint: !!endpoint, - useDualstackEndpoint - }; - }, "resolveEndpointsConfig"); - var REGION_ENV_NAME = "AWS_REGION"; - var REGION_INI_NAME = "region"; - var NODE_REGION_CONFIG_OPTIONS = { - environmentVariableSelector: (env) => env[REGION_ENV_NAME], - configFileSelector: (profile) => profile[REGION_INI_NAME], - default: () => { - throw new Error("Region is missing"); + } + function rejected(value) { + try { + step(generator["throw"](value)); + } catch (e) { + reject(e); } + } + function step(result) { + result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); + } + step((generator = generator.apply(thisArg, _arguments || [])).next()); + }); +} +function __generator(thisArg, body) { + var _ = { label: 0, sent: function() { + if (t[0] & 1) throw t[1]; + return t[1]; + }, trys: [], ops: [] }, f, y, t, g = Object.create((typeof Iterator === "function" ? Iterator : Object).prototype); + return g.next = verb(0), g["throw"] = verb(1), g["return"] = verb(2), typeof Symbol === "function" && (g[Symbol.iterator] = function() { + return this; + }), g; + function verb(n) { + return function(v) { + return step([n, v]); }; - var NODE_REGION_CONFIG_FILE_OPTIONS = { - preferredFile: "credentials" - }; - var isFipsRegion = /* @__PURE__ */ __name((region) => typeof region === "string" && (region.startsWith("fips-") || region.endsWith("-fips")), "isFipsRegion"); - var getRealRegion = /* @__PURE__ */ __name((region) => isFipsRegion(region) ? ["fips-aws-global", "aws-fips"].includes(region) ? "us-east-1" : region.replace(/fips-(dkr-|prod-)?|-fips/, "") : region, "getRealRegion"); - var resolveRegionConfig = /* @__PURE__ */ __name((input) => { - const { region, useFipsEndpoint } = input; - if (!region) { - throw new Error("Region is missing"); - } - return { - ...input, - region: async () => { - if (typeof region === "string") { - return getRealRegion(region); + } + function step(op) { + if (f) throw new TypeError("Generator is already executing."); + while (g && (g = 0, op[0] && (_ = 0)), _) try { + if (f = 1, y && (t = op[0] & 2 ? y["return"] : op[0] ? y["throw"] || ((t = y["return"]) && t.call(y), 0) : y.next) && !(t = t.call(y, op[1])).done) return t; + if (y = 0, t) op = [op[0] & 2, t.value]; + switch (op[0]) { + case 0: + case 1: + t = op; + break; + case 4: + _.label++; + return { value: op[1], done: false }; + case 5: + _.label++; + y = op[1]; + op = [0]; + continue; + case 7: + op = _.ops.pop(); + _.trys.pop(); + continue; + default: + if (!(t = _.trys, t = t.length > 0 && t[t.length - 1]) && (op[0] === 6 || op[0] === 2)) { + _ = 0; + continue; } - const providedRegion = await region(); - return getRealRegion(providedRegion); - }, - useFipsEndpoint: async () => { - const providedRegion = typeof region === "string" ? region : await region(); - if (isFipsRegion(providedRegion)) { - return true; + if (op[0] === 3 && (!t || op[1] > t[0] && op[1] < t[3])) { + _.label = op[1]; + break; } - return typeof useFipsEndpoint !== "function" ? Promise.resolve(!!useFipsEndpoint) : useFipsEndpoint(); - } - }; - }, "resolveRegionConfig"); - var getHostnameFromVariants = /* @__PURE__ */ __name((variants = [], { useFipsEndpoint, useDualstackEndpoint }) => { - var _a; - return (_a = variants.find( - ({ tags }) => useFipsEndpoint === tags.includes("fips") && useDualstackEndpoint === tags.includes("dualstack") - )) == null ? void 0 : _a.hostname; - }, "getHostnameFromVariants"); - var getResolvedHostname = /* @__PURE__ */ __name((resolvedRegion, { regionHostname, partitionHostname }) => regionHostname ? regionHostname : partitionHostname ? partitionHostname.replace("{region}", resolvedRegion) : void 0, "getResolvedHostname"); - var getResolvedPartition = /* @__PURE__ */ __name((region, { partitionHash }) => Object.keys(partitionHash || {}).find((key) => partitionHash[key].regions.includes(region)) ?? "aws", "getResolvedPartition"); - var getResolvedSigningRegion = /* @__PURE__ */ __name((hostname, { signingRegion, regionRegex, useFipsEndpoint }) => { - if (signingRegion) { - return signingRegion; - } else if (useFipsEndpoint) { - const regionRegexJs = regionRegex.replace("\\\\", "\\").replace(/^\^/g, "\\.").replace(/\$$/g, "\\."); - const regionRegexmatchArray = hostname.match(regionRegexJs); - if (regionRegexmatchArray) { - return regionRegexmatchArray[0].slice(1, -1); - } - } - }, "getResolvedSigningRegion"); - var getRegionInfo = /* @__PURE__ */ __name((region, { - useFipsEndpoint = false, - useDualstackEndpoint = false, - signingService, - regionHash, - partitionHash - }) => { - var _a, _b, _c, _d, _e; - const partition = getResolvedPartition(region, { partitionHash }); - const resolvedRegion = region in regionHash ? region : ((_a = partitionHash[partition]) == null ? void 0 : _a.endpoint) ?? region; - const hostnameOptions = { useFipsEndpoint, useDualstackEndpoint }; - const regionHostname = getHostnameFromVariants((_b = regionHash[resolvedRegion]) == null ? void 0 : _b.variants, hostnameOptions); - const partitionHostname = getHostnameFromVariants((_c = partitionHash[partition]) == null ? void 0 : _c.variants, hostnameOptions); - const hostname = getResolvedHostname(resolvedRegion, { regionHostname, partitionHostname }); - if (hostname === void 0) { - throw new Error(`Endpoint resolution failed for: ${{ resolvedRegion, useFipsEndpoint, useDualstackEndpoint }}`); + if (op[0] === 6 && _.label < t[1]) { + _.label = t[1]; + t = op; + break; + } + if (t && _.label < t[2]) { + _.label = t[2]; + _.ops.push(op); + break; + } + if (t[2]) _.ops.pop(); + _.trys.pop(); + continue; } - const signingRegion = getResolvedSigningRegion(hostname, { - signingRegion: (_d = regionHash[resolvedRegion]) == null ? void 0 : _d.signingRegion, - regionRegex: partitionHash[partition].regionRegex, - useFipsEndpoint - }); - return { - partition, - signingService, - hostname, - ...signingRegion && { signingRegion }, - ...((_e = regionHash[resolvedRegion]) == null ? void 0 : _e.signingService) && { - signingService: regionHash[resolvedRegion].signingService - } + op = body.call(thisArg, _); + } catch (e) { + op = [6, e]; + y = 0; + } finally { + f = t = 0; + } + if (op[0] & 5) throw op[1]; + return { value: op[0] ? op[1] : void 0, done: true }; + } +} +function __exportStar(m, o) { + for (var p in m) if (p !== "default" && !Object.prototype.hasOwnProperty.call(o, p)) __createBinding(o, m, p); +} +function __values(o) { + var s = typeof Symbol === "function" && Symbol.iterator, m = s && o[s], i = 0; + if (m) return m.call(o); + if (o && typeof o.length === "number") return { + next: function() { + if (o && i >= o.length) o = void 0; + return { value: o && o[i++], done: !o }; + } + }; + throw new TypeError(s ? "Object is not iterable." : "Symbol.iterator is not defined."); +} +function __read(o, n) { + var m = typeof Symbol === "function" && o[Symbol.iterator]; + if (!m) return o; + var i = m.call(o), r, ar = [], e; + try { + while ((n === void 0 || n-- > 0) && !(r = i.next()).done) ar.push(r.value); + } catch (error) { + e = { error }; + } finally { + try { + if (r && !r.done && (m = i["return"])) m.call(i); + } finally { + if (e) throw e.error; + } + } + return ar; +} +function __spread() { + for (var ar = [], i = 0; i < arguments.length; i++) + ar = ar.concat(__read(arguments[i])); + return ar; +} +function __spreadArrays() { + for (var s = 0, i = 0, il = arguments.length; i < il; i++) s += arguments[i].length; + for (var r = Array(s), k = 0, i = 0; i < il; i++) + for (var a = arguments[i], j = 0, jl = a.length; j < jl; j++, k++) + r[k] = a[j]; + return r; +} +function __spreadArray(to, from, pack) { + if (pack || arguments.length === 2) for (var i = 0, l = from.length, ar; i < l; i++) { + if (ar || !(i in from)) { + if (!ar) ar = Array.prototype.slice.call(from, 0, i); + ar[i] = from[i]; + } + } + return to.concat(ar || Array.prototype.slice.call(from)); +} +function __await(v) { + return this instanceof __await ? (this.v = v, this) : new __await(v); +} +function __asyncGenerator(thisArg, _arguments, generator) { + if (!Symbol.asyncIterator) throw new TypeError("Symbol.asyncIterator is not defined."); + var g = generator.apply(thisArg, _arguments || []), i, q = []; + return i = Object.create((typeof AsyncIterator === "function" ? AsyncIterator : Object).prototype), verb("next"), verb("throw"), verb("return", awaitReturn), i[Symbol.asyncIterator] = function() { + return this; + }, i; + function awaitReturn(f) { + return function(v) { + return Promise.resolve(v).then(f, reject); + }; + } + function verb(n, f) { + if (g[n]) { + i[n] = function(v) { + return new Promise(function(a, b) { + q.push([n, v, a, b]) > 1 || resume(n, v); + }); }; - }, "getRegionInfo"); + if (f) i[n] = f(i[n]); + } } -}); - -// ../../../node_modules/@smithy/util-defaults-mode-node/node_modules/@smithy/property-provider/dist-cjs/index.js -var require_dist_cjs63 = __commonJS({ - "../../../node_modules/@smithy/util-defaults-mode-node/node_modules/@smithy/property-provider/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); + function resume(n, v) { + try { + step(g[n](v)); + } catch (e) { + settle(q[0][3], e); + } + } + function step(r) { + r.value instanceof __await ? Promise.resolve(r.value.v).then(fulfill, reject) : settle(q[0][2], r); + } + function fulfill(value) { + resume("next", value); + } + function reject(value) { + resume("throw", value); + } + function settle(f, v) { + if (f(v), q.shift(), q.length) resume(q[0][0], q[0][1]); + } +} +function __asyncDelegator(o) { + var i, p; + return i = {}, verb("next"), verb("throw", function(e) { + throw e; + }), verb("return"), i[Symbol.iterator] = function() { + return this; + }, i; + function verb(n, f) { + i[n] = o[n] ? function(v) { + return (p = !p) ? { value: __await(o[n](v)), done: false } : f ? f(v) : v; + } : f; + } +} +function __asyncValues(o) { + if (!Symbol.asyncIterator) throw new TypeError("Symbol.asyncIterator is not defined."); + var m = o[Symbol.asyncIterator], i; + return m ? m.call(o) : (o = typeof __values === "function" ? __values(o) : o[Symbol.iterator](), i = {}, verb("next"), verb("throw"), verb("return"), i[Symbol.asyncIterator] = function() { + return this; + }, i); + function verb(n) { + i[n] = o[n] && function(v) { + return new Promise(function(resolve, reject) { + v = o[n](v), settle(resolve, reject, v.done, v.value); + }); }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + function settle(resolve, reject, d, v) { + Promise.resolve(v).then(function(v2) { + resolve({ value: v2, done: d }); + }, reject); + } +} +function __makeTemplateObject(cooked, raw) { + if (Object.defineProperty) { + Object.defineProperty(cooked, "raw", { value: raw }); + } else { + cooked.raw = raw; + } + return cooked; +} +function __importStar(mod) { + if (mod && mod.__esModule) return mod; + var result = {}; + if (mod != null) { + for (var k in mod) if (k !== "default" && Object.prototype.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k); + } + __setModuleDefault(result, mod); + return result; +} +function __importDefault(mod) { + return mod && mod.__esModule ? mod : { default: mod }; +} +function __classPrivateFieldGet(receiver, state, kind, f) { + if (kind === "a" && !f) throw new TypeError("Private accessor was defined without a getter"); + if (typeof state === "function" ? receiver !== state || !f : !state.has(receiver)) throw new TypeError("Cannot read private member from an object whose class did not declare it"); + return kind === "m" ? f : kind === "a" ? f.call(receiver) : f ? f.value : state.get(receiver); +} +function __classPrivateFieldSet(receiver, state, value, kind, f) { + if (kind === "m") throw new TypeError("Private method is not writable"); + if (kind === "a" && !f) throw new TypeError("Private accessor was defined without a setter"); + if (typeof state === "function" ? receiver !== state || !f : !state.has(receiver)) throw new TypeError("Cannot write private member to an object whose class did not declare it"); + return kind === "a" ? f.call(receiver, value) : f ? f.value = value : state.set(receiver, value), value; +} +function __classPrivateFieldIn(state, receiver) { + if (receiver === null || typeof receiver !== "object" && typeof receiver !== "function") throw new TypeError("Cannot use 'in' operator on non-object"); + return typeof state === "function" ? receiver === state : state.has(receiver); +} +function __addDisposableResource(env, value, async) { + if (value !== null && value !== void 0) { + if (typeof value !== "object" && typeof value !== "function") throw new TypeError("Object expected."); + var dispose, inner; + if (async) { + if (!Symbol.asyncDispose) throw new TypeError("Symbol.asyncDispose is not defined."); + dispose = value[Symbol.asyncDispose]; + } + if (dispose === void 0) { + if (!Symbol.dispose) throw new TypeError("Symbol.dispose is not defined."); + dispose = value[Symbol.dispose]; + if (async) inner = dispose; + } + if (typeof dispose !== "function") throw new TypeError("Object not disposable."); + if (inner) dispose = function() { + try { + inner.call(this); + } catch (e) { + return Promise.reject(e); } - return to; }; - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - CredentialsProviderError: () => CredentialsProviderError, - ProviderError: () => ProviderError2, - TokenProviderError: () => TokenProviderError, - chain: () => chain, - fromStatic: () => fromStatic, - memoize: () => memoize - }); - module2.exports = __toCommonJS2(src_exports); - var _ProviderError = class _ProviderError2 extends Error { - constructor(message, options = true) { - var _a; - let logger; - let tryNextLink = true; - if (typeof options === "boolean") { - logger = void 0; - tryNextLink = options; - } else if (options != null && typeof options === "object") { - logger = options.logger; - tryNextLink = options.tryNextLink ?? true; - } - super(message); - this.name = "ProviderError"; - this.tryNextLink = tryNextLink; - Object.setPrototypeOf(this, _ProviderError2.prototype); - (_a = logger == null ? void 0 : logger.debug) == null ? void 0 : _a.call(logger, `@smithy/property-provider ${tryNextLink ? "->" : "(!)"} ${message}`); - } - /** - * @deprecated use new operator. - */ - static from(error, options = true) { - return Object.assign(new this(error.message, options), error); + env.stack.push({ value, dispose, async }); + } else if (async) { + env.stack.push({ async: true }); + } + return value; +} +function __disposeResources(env) { + function fail(e) { + env.error = env.hasError ? new _SuppressedError(e, env.error, "An error was suppressed during disposal.") : e; + env.hasError = true; + } + var r, s = 0; + function next() { + while (r = env.stack.pop()) { + try { + if (!r.async && s === 1) return s = 0, env.stack.push(r), Promise.resolve().then(next); + if (r.dispose) { + var result = r.dispose.call(r.value); + if (r.async) return s |= 2, Promise.resolve(result).then(next, function(e) { + fail(e); + return next(); + }); + } else s |= 1; + } catch (e) { + fail(e); } + } + if (s === 1) return env.hasError ? Promise.reject(env.error) : Promise.resolve(); + if (env.hasError) throw env.error; + } + return next(); +} +function __rewriteRelativeImportExtension(path, preserveJsx) { + if (typeof path === "string" && /^\.\.?\//.test(path)) { + return path.replace(/\.(tsx)$|((?:\.d)?)((?:\.[^./]+?)?)\.([cm]?)ts$/i, function(m, tsx, d, ext, cm) { + return tsx ? preserveJsx ? ".jsx" : ".js" : d && (!ext || !cm) ? m : d + ext + "." + cm.toLowerCase() + "js"; + }); + } + return path; +} +var extendStatics, __assign, __createBinding, __setModuleDefault, _SuppressedError, tslib_es6_default; +var init_tslib_es6 = __esm({ + "../../../node_modules/tslib/tslib.es6.mjs"() { + extendStatics = function(d, b) { + extendStatics = Object.setPrototypeOf || { __proto__: [] } instanceof Array && function(d2, b2) { + d2.__proto__ = b2; + } || function(d2, b2) { + for (var p in b2) if (Object.prototype.hasOwnProperty.call(b2, p)) d2[p] = b2[p]; + }; + return extendStatics(d, b); + }; + __assign = function() { + __assign = Object.assign || function __assign2(t) { + for (var s, i = 1, n = arguments.length; i < n; i++) { + s = arguments[i]; + for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p)) t[p] = s[p]; + } + return t; + }; + return __assign.apply(this, arguments); }; - __name(_ProviderError, "ProviderError"); - var ProviderError2 = _ProviderError; - var _CredentialsProviderError = class _CredentialsProviderError2 extends ProviderError2 { - /** - * @override - */ - constructor(message, options = true) { - super(message, options); - this.name = "CredentialsProviderError"; - Object.setPrototypeOf(this, _CredentialsProviderError2.prototype); + __createBinding = Object.create ? function(o, m, k, k2) { + if (k2 === void 0) k2 = k; + var desc = Object.getOwnPropertyDescriptor(m, k); + if (!desc || ("get" in desc ? !m.__esModule : desc.writable || desc.configurable)) { + desc = { enumerable: true, get: function() { + return m[k]; + } }; } + Object.defineProperty(o, k2, desc); + } : function(o, m, k, k2) { + if (k2 === void 0) k2 = k; + o[k2] = m[k]; }; - __name(_CredentialsProviderError, "CredentialsProviderError"); - var CredentialsProviderError = _CredentialsProviderError; - var _TokenProviderError = class _TokenProviderError2 extends ProviderError2 { - /** - * @override - */ - constructor(message, options = true) { - super(message, options); - this.name = "TokenProviderError"; - Object.setPrototypeOf(this, _TokenProviderError2.prototype); - } + __setModuleDefault = Object.create ? function(o, v) { + Object.defineProperty(o, "default", { enumerable: true, value: v }); + } : function(o, v) { + o["default"] = v; + }; + _SuppressedError = typeof SuppressedError === "function" ? SuppressedError : function(error, suppressed, message) { + var e = new Error(message); + return e.name = "SuppressedError", e.error = error, e.suppressed = suppressed, e; + }; + tslib_es6_default = { + __extends, + __assign, + __rest, + __decorate, + __param, + __esDecorate, + __runInitializers, + __propKey, + __setFunctionName, + __metadata, + __awaiter, + __generator, + __createBinding, + __exportStar, + __values, + __read, + __spread, + __spreadArrays, + __spreadArray, + __await, + __asyncGenerator, + __asyncDelegator, + __asyncValues, + __makeTemplateObject, + __importStar, + __importDefault, + __classPrivateFieldGet, + __classPrivateFieldSet, + __classPrivateFieldIn, + __addDisposableResource, + __disposeResources, + __rewriteRelativeImportExtension }; - __name(_TokenProviderError, "TokenProviderError"); - var TokenProviderError = _TokenProviderError; - var chain = /* @__PURE__ */ __name((...providers) => async () => { - if (providers.length === 0) { - throw new ProviderError2("No providers in chain"); - } - let lastProviderError; - for (const provider of providers) { - try { - const credentials = await provider(); - return credentials; - } catch (err) { - lastProviderError = err; - if (err == null ? void 0 : err.tryNextLink) { - continue; - } - throw err; - } - } - throw lastProviderError; - }, "chain"); - var fromStatic = /* @__PURE__ */ __name((staticValue) => () => Promise.resolve(staticValue), "fromStatic"); - var memoize = /* @__PURE__ */ __name((provider, isExpired, requiresRefresh) => { - let resolved; - let pending; - let hasResult; - let isConstant = false; - const coalesceProvider = /* @__PURE__ */ __name(async () => { - if (!pending) { - pending = provider(); - } - try { - resolved = await pending; - hasResult = true; - isConstant = false; - } finally { - pending = void 0; - } - return resolved; - }, "coalesceProvider"); - if (isExpired === void 0) { - return async (options) => { - if (!hasResult || (options == null ? void 0 : options.forceRefresh)) { - resolved = await coalesceProvider(); - } - return resolved; - }; - } - return async (options) => { - if (!hasResult || (options == null ? void 0 : options.forceRefresh)) { - resolved = await coalesceProvider(); - } - if (isConstant) { - return resolved; - } - if (requiresRefresh && !requiresRefresh(resolved)) { - isConstant = true; - return resolved; - } - if (isExpired(resolved)) { - await coalesceProvider(); - return resolved; - } - return resolved; - }; - }, "memoize"); } }); -// ../../../node_modules/@smithy/util-defaults-mode-node/node_modules/@smithy/shared-ini-file-loader/dist-cjs/getHomeDir.js -var require_getHomeDir3 = __commonJS({ - "../../../node_modules/@smithy/util-defaults-mode-node/node_modules/@smithy/shared-ini-file-loader/dist-cjs/getHomeDir.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.getHomeDir = void 0; - var os_1 = require("os"); - var path_1 = require("path"); - var homeDirCache = {}; - var getHomeDirCacheKey = () => { - if (process && process.geteuid) { - return `${process.geteuid()}`; - } - return "DEFAULT"; - }; - var getHomeDir2 = () => { - const { HOME, USERPROFILE, HOMEPATH, HOMEDRIVE = `C:${path_1.sep}` } = process.env; - if (HOME) - return HOME; - if (USERPROFILE) - return USERPROFILE; - if (HOMEPATH) - return `${HOMEDRIVE}${HOMEPATH}`; - const homeDirCacheKey = getHomeDirCacheKey(); - if (!homeDirCache[homeDirCacheKey]) - homeDirCache[homeDirCacheKey] = (0, os_1.homedir)(); - return homeDirCache[homeDirCacheKey]; +// ../../../node_modules/@aws-sdk/client-sfn/package.json +var require_package = __commonJS({ + "../../../node_modules/@aws-sdk/client-sfn/package.json"(exports2, module2) { + module2.exports = { + name: "@aws-sdk/client-sfn", + description: "AWS SDK for JavaScript Sfn Client for Node.js, Browser and React Native", + version: "3.632.0", + scripts: { + build: "concurrently 'yarn:build:cjs' 'yarn:build:es' 'yarn:build:types'", + "build:cjs": "node ../../scripts/compilation/inline client-sfn", + "build:es": "tsc -p tsconfig.es.json", + "build:include:deps": "lerna run --scope $npm_package_name --include-dependencies build", + "build:types": "tsc -p tsconfig.types.json", + "build:types:downlevel": "downlevel-dts dist-types dist-types/ts3.4", + clean: "rimraf ./dist-* && rimraf *.tsbuildinfo", + "extract:docs": "api-extractor run --local", + "generate:client": "node ../../scripts/generate-clients/single-service --solo sfn" + }, + main: "./dist-cjs/index.js", + types: "./dist-types/index.d.ts", + module: "./dist-es/index.js", + sideEffects: false, + dependencies: { + "@aws-crypto/sha256-browser": "5.2.0", + "@aws-crypto/sha256-js": "5.2.0", + "@aws-sdk/client-sso-oidc": "3.632.0", + "@aws-sdk/client-sts": "3.632.0", + "@aws-sdk/core": "3.629.0", + "@aws-sdk/credential-provider-node": "3.632.0", + "@aws-sdk/middleware-host-header": "3.620.0", + "@aws-sdk/middleware-logger": "3.609.0", + "@aws-sdk/middleware-recursion-detection": "3.620.0", + "@aws-sdk/middleware-user-agent": "3.632.0", + "@aws-sdk/region-config-resolver": "3.614.0", + "@aws-sdk/types": "3.609.0", + "@aws-sdk/util-endpoints": "3.632.0", + "@aws-sdk/util-user-agent-browser": "3.609.0", + "@aws-sdk/util-user-agent-node": "3.614.0", + "@smithy/config-resolver": "^3.0.5", + "@smithy/core": "^2.3.2", + "@smithy/fetch-http-handler": "^3.2.4", + "@smithy/hash-node": "^3.0.3", + "@smithy/invalid-dependency": "^3.0.3", + "@smithy/middleware-content-length": "^3.0.5", + "@smithy/middleware-endpoint": "^3.1.0", + "@smithy/middleware-retry": "^3.0.14", + "@smithy/middleware-serde": "^3.0.3", + "@smithy/middleware-stack": "^3.0.3", + "@smithy/node-config-provider": "^3.1.4", + "@smithy/node-http-handler": "^3.1.4", + "@smithy/protocol-http": "^4.1.0", + "@smithy/smithy-client": "^3.1.12", + "@smithy/types": "^3.3.0", + "@smithy/url-parser": "^3.0.3", + "@smithy/util-base64": "^3.0.0", + "@smithy/util-body-length-browser": "^3.0.0", + "@smithy/util-body-length-node": "^3.0.0", + "@smithy/util-defaults-mode-browser": "^3.0.14", + "@smithy/util-defaults-mode-node": "^3.0.14", + "@smithy/util-endpoints": "^2.0.5", + "@smithy/util-middleware": "^3.0.3", + "@smithy/util-retry": "^3.0.3", + "@smithy/util-utf8": "^3.0.0", + tslib: "^2.6.2", + uuid: "^9.0.1" + }, + devDependencies: { + "@tsconfig/node16": "16.1.3", + "@types/node": "^16.18.96", + "@types/uuid": "^9.0.4", + concurrently: "7.0.0", + "downlevel-dts": "0.10.1", + rimraf: "3.0.2", + typescript: "~4.9.5" + }, + engines: { + node: ">=16.0.0" + }, + typesVersions: { + "<4.0": { + "dist-types/*": [ + "dist-types/ts3.4/*" + ] + } + }, + files: [ + "dist-*/**" + ], + author: { + name: "AWS SDK for JavaScript Team", + url: "https://aws.amazon.com/javascript/" + }, + license: "Apache-2.0", + browser: { + "./dist-es/runtimeConfig": "./dist-es/runtimeConfig.browser" + }, + "react-native": { + "./dist-es/runtimeConfig": "./dist-es/runtimeConfig.native" + }, + homepage: "https://github.com/aws/aws-sdk-js-v3/tree/main/clients/client-sfn", + repository: { + type: "git", + url: "https://github.com/aws/aws-sdk-js-v3.git", + directory: "clients/client-sfn" + } }; - exports2.getHomeDir = getHomeDir2; } }); -// ../../../node_modules/@smithy/util-defaults-mode-node/node_modules/@smithy/shared-ini-file-loader/dist-cjs/getSSOTokenFilepath.js -var require_getSSOTokenFilepath3 = __commonJS({ - "../../../node_modules/@smithy/util-defaults-mode-node/node_modules/@smithy/shared-ini-file-loader/dist-cjs/getSSOTokenFilepath.js"(exports2) { +// ../../../node_modules/@aws-sdk/credential-provider-env/dist-cjs/index.js +var require_dist_cjs36 = __commonJS({ + "../../../node_modules/@aws-sdk/credential-provider-env/dist-cjs/index.js"(exports2, module2) { "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.getSSOTokenFilepath = void 0; - var crypto_1 = require("crypto"); - var path_1 = require("path"); - var getHomeDir_1 = require_getHomeDir3(); - var getSSOTokenFilepath2 = (id) => { - const hasher = (0, crypto_1.createHash)("sha1"); - const cacheName = hasher.update(id).digest("hex"); - return (0, path_1.join)((0, getHomeDir_1.getHomeDir)(), ".aws", "sso", "cache", `${cacheName}.json`); + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); }; - exports2.getSSOTokenFilepath = getSSOTokenFilepath2; - } -}); - -// ../../../node_modules/@smithy/util-defaults-mode-node/node_modules/@smithy/shared-ini-file-loader/dist-cjs/getSSOTokenFromFile.js -var require_getSSOTokenFromFile3 = __commonJS({ - "../../../node_modules/@smithy/util-defaults-mode-node/node_modules/@smithy/shared-ini-file-loader/dist-cjs/getSSOTokenFromFile.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.getSSOTokenFromFile = void 0; - var fs_1 = require("fs"); - var getSSOTokenFilepath_1 = require_getSSOTokenFilepath3(); - var { readFile } = fs_1.promises; - var getSSOTokenFromFile2 = async (id) => { - const ssoTokenFilepath = (0, getSSOTokenFilepath_1.getSSOTokenFilepath)(id); - const ssoTokenText = await readFile(ssoTokenFilepath, "utf8"); - return JSON.parse(ssoTokenText); + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; }; - exports2.getSSOTokenFromFile = getSSOTokenFromFile2; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + ENV_ACCOUNT_ID: () => ENV_ACCOUNT_ID, + ENV_CREDENTIAL_SCOPE: () => ENV_CREDENTIAL_SCOPE, + ENV_EXPIRATION: () => ENV_EXPIRATION, + ENV_KEY: () => ENV_KEY, + ENV_SECRET: () => ENV_SECRET, + ENV_SESSION: () => ENV_SESSION, + fromEnv: () => fromEnv + }); + module2.exports = __toCommonJS2(src_exports); + var import_property_provider2 = require_dist_cjs24(); + var ENV_KEY = "AWS_ACCESS_KEY_ID"; + var ENV_SECRET = "AWS_SECRET_ACCESS_KEY"; + var ENV_SESSION = "AWS_SESSION_TOKEN"; + var ENV_EXPIRATION = "AWS_CREDENTIAL_EXPIRATION"; + var ENV_CREDENTIAL_SCOPE = "AWS_CREDENTIAL_SCOPE"; + var ENV_ACCOUNT_ID = "AWS_ACCOUNT_ID"; + var fromEnv = /* @__PURE__ */ __name((init) => async () => { + var _a; + (_a = init == null ? void 0 : init.logger) == null ? void 0 : _a.debug("@aws-sdk/credential-provider-env - fromEnv"); + const accessKeyId = process.env[ENV_KEY]; + const secretAccessKey = process.env[ENV_SECRET]; + const sessionToken = process.env[ENV_SESSION]; + const expiry = process.env[ENV_EXPIRATION]; + const credentialScope = process.env[ENV_CREDENTIAL_SCOPE]; + const accountId = process.env[ENV_ACCOUNT_ID]; + if (accessKeyId && secretAccessKey) { + return { + accessKeyId, + secretAccessKey, + ...sessionToken && { sessionToken }, + ...expiry && { expiration: new Date(expiry) }, + ...credentialScope && { credentialScope }, + ...accountId && { accountId } + }; + } + throw new import_property_provider2.CredentialsProviderError("Unable to find environment variable credentials.", { logger: init == null ? void 0 : init.logger }); + }, "fromEnv"); } }); -// ../../../node_modules/@smithy/util-defaults-mode-node/node_modules/@smithy/shared-ini-file-loader/dist-cjs/slurpFile.js -var require_slurpFile3 = __commonJS({ - "../../../node_modules/@smithy/util-defaults-mode-node/node_modules/@smithy/shared-ini-file-loader/dist-cjs/slurpFile.js"(exports2) { - "use strict"; - Object.defineProperty(exports2, "__esModule", { value: true }); - exports2.slurpFile = void 0; - var fs_1 = require("fs"); - var { readFile } = fs_1.promises; - var filePromisesHash = {}; - var slurpFile = (path, options) => { - if (!filePromisesHash[path] || (options === null || options === void 0 ? void 0 : options.ignoreCache)) { - filePromisesHash[path] = readFile(path, "utf8"); +// ../../../node_modules/@smithy/credential-provider-imds/dist-cjs/index.js +var require_dist_cjs37 = __commonJS({ + "../../../node_modules/@smithy/credential-provider-imds/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + DEFAULT_MAX_RETRIES: () => DEFAULT_MAX_RETRIES, + DEFAULT_TIMEOUT: () => DEFAULT_TIMEOUT, + ENV_CMDS_AUTH_TOKEN: () => ENV_CMDS_AUTH_TOKEN, + ENV_CMDS_FULL_URI: () => ENV_CMDS_FULL_URI, + ENV_CMDS_RELATIVE_URI: () => ENV_CMDS_RELATIVE_URI, + Endpoint: () => Endpoint, + fromContainerMetadata: () => fromContainerMetadata, + fromInstanceMetadata: () => fromInstanceMetadata, + getInstanceMetadataEndpoint: () => getInstanceMetadataEndpoint, + httpRequest: () => httpRequest, + providerConfigFromInit: () => providerConfigFromInit + }); + module2.exports = __toCommonJS2(src_exports); + var import_url = require("url"); + var import_property_provider2 = require_dist_cjs24(); + var import_buffer = require("buffer"); + var import_http2 = require("http"); + function httpRequest(options) { + return new Promise((resolve, reject) => { + var _a; + const req = (0, import_http2.request)({ + method: "GET", + ...options, + // Node.js http module doesn't accept hostname with square brackets + // Refs: https://github.com/nodejs/node/issues/39738 + hostname: (_a = options.hostname) == null ? void 0 : _a.replace(/^\[(.+)\]$/, "$1") + }); + req.on("error", (err) => { + reject(Object.assign(new import_property_provider2.ProviderError("Unable to connect to instance metadata service"), err)); + req.destroy(); + }); + req.on("timeout", () => { + reject(new import_property_provider2.ProviderError("TimeoutError from instance metadata service")); + req.destroy(); + }); + req.on("response", (res) => { + const { statusCode = 400 } = res; + if (statusCode < 200 || 300 <= statusCode) { + reject( + Object.assign(new import_property_provider2.ProviderError("Error response received from instance metadata service"), { statusCode }) + ); + req.destroy(); + } + const chunks = []; + res.on("data", (chunk) => { + chunks.push(chunk); + }); + res.on("end", () => { + resolve(import_buffer.Buffer.concat(chunks)); + req.destroy(); + }); + }); + req.end(); + }); + } + __name(httpRequest, "httpRequest"); + var isImdsCredentials = /* @__PURE__ */ __name((arg) => Boolean(arg) && typeof arg === "object" && typeof arg.AccessKeyId === "string" && typeof arg.SecretAccessKey === "string" && typeof arg.Token === "string" && typeof arg.Expiration === "string", "isImdsCredentials"); + var fromImdsCredentials = /* @__PURE__ */ __name((creds) => ({ + accessKeyId: creds.AccessKeyId, + secretAccessKey: creds.SecretAccessKey, + sessionToken: creds.Token, + expiration: new Date(creds.Expiration), + ...creds.AccountId && { accountId: creds.AccountId } + }), "fromImdsCredentials"); + var DEFAULT_TIMEOUT = 1e3; + var DEFAULT_MAX_RETRIES = 0; + var providerConfigFromInit = /* @__PURE__ */ __name(({ + maxRetries = DEFAULT_MAX_RETRIES, + timeout = DEFAULT_TIMEOUT + }) => ({ maxRetries, timeout }), "providerConfigFromInit"); + var retry = /* @__PURE__ */ __name((toRetry, maxRetries) => { + let promise = toRetry(); + for (let i = 0; i < maxRetries; i++) { + promise = promise.catch(toRetry); + } + return promise; + }, "retry"); + var ENV_CMDS_FULL_URI = "AWS_CONTAINER_CREDENTIALS_FULL_URI"; + var ENV_CMDS_RELATIVE_URI = "AWS_CONTAINER_CREDENTIALS_RELATIVE_URI"; + var ENV_CMDS_AUTH_TOKEN = "AWS_CONTAINER_AUTHORIZATION_TOKEN"; + var fromContainerMetadata = /* @__PURE__ */ __name((init = {}) => { + const { timeout, maxRetries } = providerConfigFromInit(init); + return () => retry(async () => { + const requestOptions = await getCmdsUri({ logger: init.logger }); + const credsResponse = JSON.parse(await requestFromEcsImds(timeout, requestOptions)); + if (!isImdsCredentials(credsResponse)) { + throw new import_property_provider2.CredentialsProviderError("Invalid response received from instance metadata service.", { + logger: init.logger + }); + } + return fromImdsCredentials(credsResponse); + }, maxRetries); + }, "fromContainerMetadata"); + var requestFromEcsImds = /* @__PURE__ */ __name(async (timeout, options) => { + if (process.env[ENV_CMDS_AUTH_TOKEN]) { + options.headers = { + ...options.headers, + Authorization: process.env[ENV_CMDS_AUTH_TOKEN] + }; + } + const buffer = await httpRequest({ + ...options, + timeout + }); + return buffer.toString(); + }, "requestFromEcsImds"); + var CMDS_IP = "169.254.170.2"; + var GREENGRASS_HOSTS = { + localhost: true, + "127.0.0.1": true + }; + var GREENGRASS_PROTOCOLS = { + "http:": true, + "https:": true + }; + var getCmdsUri = /* @__PURE__ */ __name(async ({ logger }) => { + if (process.env[ENV_CMDS_RELATIVE_URI]) { + return { + hostname: CMDS_IP, + path: process.env[ENV_CMDS_RELATIVE_URI] + }; + } + if (process.env[ENV_CMDS_FULL_URI]) { + const parsed = (0, import_url.parse)(process.env[ENV_CMDS_FULL_URI]); + if (!parsed.hostname || !(parsed.hostname in GREENGRASS_HOSTS)) { + throw new import_property_provider2.CredentialsProviderError(`${parsed.hostname} is not a valid container metadata service hostname`, { + tryNextLink: false, + logger + }); + } + if (!parsed.protocol || !(parsed.protocol in GREENGRASS_PROTOCOLS)) { + throw new import_property_provider2.CredentialsProviderError(`${parsed.protocol} is not a valid container metadata service protocol`, { + tryNextLink: false, + logger + }); + } + return { + ...parsed, + port: parsed.port ? parseInt(parsed.port, 10) : void 0 + }; + } + throw new import_property_provider2.CredentialsProviderError( + `The container metadata credential provider cannot be used unless the ${ENV_CMDS_RELATIVE_URI} or ${ENV_CMDS_FULL_URI} environment variable is set`, + { + tryNextLink: false, + logger + } + ); + }, "getCmdsUri"); + var _InstanceMetadataV1FallbackError = class _InstanceMetadataV1FallbackError2 extends import_property_provider2.CredentialsProviderError { + constructor(message, tryNextLink = true) { + super(message, tryNextLink); + this.tryNextLink = tryNextLink; + this.name = "InstanceMetadataV1FallbackError"; + Object.setPrototypeOf(this, _InstanceMetadataV1FallbackError2.prototype); } - return filePromisesHash[path]; }; - exports2.slurpFile = slurpFile; - } -}); - -// ../../../node_modules/@smithy/util-defaults-mode-node/node_modules/@smithy/shared-ini-file-loader/dist-cjs/index.js -var require_dist_cjs64 = __commonJS({ - "../../../node_modules/@smithy/util-defaults-mode-node/node_modules/@smithy/shared-ini-file-loader/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); + __name(_InstanceMetadataV1FallbackError, "InstanceMetadataV1FallbackError"); + var InstanceMetadataV1FallbackError = _InstanceMetadataV1FallbackError; + var import_node_config_provider = require_dist_cjs26(); + var import_url_parser = require_dist_cjs28(); + var Endpoint = /* @__PURE__ */ ((Endpoint2) => { + Endpoint2["IPv4"] = "http://169.254.169.254"; + Endpoint2["IPv6"] = "http://[fd00:ec2::254]"; + return Endpoint2; + })(Endpoint || {}); + var ENV_ENDPOINT_NAME = "AWS_EC2_METADATA_SERVICE_ENDPOINT"; + var CONFIG_ENDPOINT_NAME = "ec2_metadata_service_endpoint"; + var ENDPOINT_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => env[ENV_ENDPOINT_NAME], + configFileSelector: (profile) => profile[CONFIG_ENDPOINT_NAME], + default: void 0 }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); - } - return to; + var EndpointMode = /* @__PURE__ */ ((EndpointMode2) => { + EndpointMode2["IPv4"] = "IPv4"; + EndpointMode2["IPv6"] = "IPv6"; + return EndpointMode2; + })(EndpointMode || {}); + var ENV_ENDPOINT_MODE_NAME = "AWS_EC2_METADATA_SERVICE_ENDPOINT_MODE"; + var CONFIG_ENDPOINT_MODE_NAME = "ec2_metadata_service_endpoint_mode"; + var ENDPOINT_MODE_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => env[ENV_ENDPOINT_MODE_NAME], + configFileSelector: (profile) => profile[CONFIG_ENDPOINT_MODE_NAME], + default: "IPv4" + /* IPv4 */ }; - var __reExport = (target, mod, secondTarget) => (__copyProps2(target, mod, "default"), secondTarget && __copyProps2(secondTarget, mod, "default")); - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - CONFIG_PREFIX_SEPARATOR: () => CONFIG_PREFIX_SEPARATOR, - DEFAULT_PROFILE: () => DEFAULT_PROFILE, - ENV_PROFILE: () => ENV_PROFILE, - getProfileName: () => getProfileName, - loadSharedConfigFiles: () => loadSharedConfigFiles, - loadSsoSessionData: () => loadSsoSessionData, - parseKnownFiles: () => parseKnownFiles - }); - module2.exports = __toCommonJS2(src_exports); - __reExport(src_exports, require_getHomeDir3(), module2.exports); - var ENV_PROFILE = "AWS_PROFILE"; - var DEFAULT_PROFILE = "default"; - var getProfileName = /* @__PURE__ */ __name((init) => init.profile || process.env[ENV_PROFILE] || DEFAULT_PROFILE, "getProfileName"); - __reExport(src_exports, require_getSSOTokenFilepath3(), module2.exports); - __reExport(src_exports, require_getSSOTokenFromFile3(), module2.exports); - var import_types5 = require_dist_cjs(); - var getConfigData = /* @__PURE__ */ __name((data) => Object.entries(data).filter(([key]) => { - const indexOfSeparator = key.indexOf(CONFIG_PREFIX_SEPARATOR); - if (indexOfSeparator === -1) { - return false; - } - return Object.values(import_types5.IniSectionType).includes(key.substring(0, indexOfSeparator)); - }).reduce( - (acc, [key, value]) => { - const indexOfSeparator = key.indexOf(CONFIG_PREFIX_SEPARATOR); - const updatedKey = key.substring(0, indexOfSeparator) === import_types5.IniSectionType.PROFILE ? key.substring(indexOfSeparator + 1) : key; - acc[updatedKey] = value; - return acc; - }, - { - // Populate default profile, if present. - ...data.default && { default: data.default } + var getInstanceMetadataEndpoint = /* @__PURE__ */ __name(async () => (0, import_url_parser.parseUrl)(await getFromEndpointConfig() || await getFromEndpointModeConfig()), "getInstanceMetadataEndpoint"); + var getFromEndpointConfig = /* @__PURE__ */ __name(async () => (0, import_node_config_provider.loadConfig)(ENDPOINT_CONFIG_OPTIONS)(), "getFromEndpointConfig"); + var getFromEndpointModeConfig = /* @__PURE__ */ __name(async () => { + const endpointMode = await (0, import_node_config_provider.loadConfig)(ENDPOINT_MODE_CONFIG_OPTIONS)(); + switch (endpointMode) { + case "IPv4": + return "http://169.254.169.254"; + case "IPv6": + return "http://[fd00:ec2::254]"; + default: + throw new Error(`Unsupported endpoint mode: ${endpointMode}. Select from ${Object.values(EndpointMode)}`); } - ), "getConfigData"); - var import_path = require("path"); - var import_getHomeDir = require_getHomeDir3(); - var ENV_CONFIG_PATH = "AWS_CONFIG_FILE"; - var getConfigFilepath = /* @__PURE__ */ __name(() => process.env[ENV_CONFIG_PATH] || (0, import_path.join)((0, import_getHomeDir.getHomeDir)(), ".aws", "config"), "getConfigFilepath"); - var import_getHomeDir2 = require_getHomeDir3(); - var ENV_CREDENTIALS_PATH = "AWS_SHARED_CREDENTIALS_FILE"; - var getCredentialsFilepath = /* @__PURE__ */ __name(() => process.env[ENV_CREDENTIALS_PATH] || (0, import_path.join)((0, import_getHomeDir2.getHomeDir)(), ".aws", "credentials"), "getCredentialsFilepath"); - var import_getHomeDir3 = require_getHomeDir3(); - var prefixKeyRegex = /^([\w-]+)\s(["'])?([\w-@\+\.%:/]+)\2$/; - var profileNameBlockList = ["__proto__", "profile __proto__"]; - var parseIni = /* @__PURE__ */ __name((iniData) => { - const map = {}; - let currentSection; - let currentSubSection; - for (const iniLine of iniData.split(/\r?\n/)) { - const trimmedLine = iniLine.split(/(^|\s)[;#]/)[0].trim(); - const isSection = trimmedLine[0] === "[" && trimmedLine[trimmedLine.length - 1] === "]"; - if (isSection) { - currentSection = void 0; - currentSubSection = void 0; - const sectionName = trimmedLine.substring(1, trimmedLine.length - 1); - const matches = prefixKeyRegex.exec(sectionName); - if (matches) { - const [, prefix, , name] = matches; - if (Object.values(import_types5.IniSectionType).includes(prefix)) { - currentSection = [prefix, name].join(CONFIG_PREFIX_SEPARATOR); - } + }, "getFromEndpointModeConfig"); + var STATIC_STABILITY_REFRESH_INTERVAL_SECONDS = 5 * 60; + var STATIC_STABILITY_REFRESH_INTERVAL_JITTER_WINDOW_SECONDS = 5 * 60; + var STATIC_STABILITY_DOC_URL = "https://docs.aws.amazon.com/sdkref/latest/guide/feature-static-credentials.html"; + var getExtendedInstanceMetadataCredentials = /* @__PURE__ */ __name((credentials, logger) => { + const refreshInterval = STATIC_STABILITY_REFRESH_INTERVAL_SECONDS + Math.floor(Math.random() * STATIC_STABILITY_REFRESH_INTERVAL_JITTER_WINDOW_SECONDS); + const newExpiration = new Date(Date.now() + refreshInterval * 1e3); + logger.warn( + `Attempting credential expiration extension due to a credential service availability issue. A refresh of these credentials will be attempted after ${new Date(newExpiration)}. +For more information, please visit: ` + STATIC_STABILITY_DOC_URL + ); + const originalExpiration = credentials.originalExpiration ?? credentials.expiration; + return { + ...credentials, + ...originalExpiration ? { originalExpiration } : {}, + expiration: newExpiration + }; + }, "getExtendedInstanceMetadataCredentials"); + var staticStabilityProvider = /* @__PURE__ */ __name((provider, options = {}) => { + const logger = (options == null ? void 0 : options.logger) || console; + let pastCredentials; + return async () => { + let credentials; + try { + credentials = await provider(); + if (credentials.expiration && credentials.expiration.getTime() < Date.now()) { + credentials = getExtendedInstanceMetadataCredentials(credentials, logger); + } + } catch (e) { + if (pastCredentials) { + logger.warn("Credential renew failed: ", e); + credentials = getExtendedInstanceMetadataCredentials(pastCredentials, logger); } else { - currentSection = sectionName; + throw e; } - if (profileNameBlockList.includes(sectionName)) { - throw new Error(`Found invalid profile name "${sectionName}"`); + } + pastCredentials = credentials; + return credentials; + }; + }, "staticStabilityProvider"); + var IMDS_PATH = "/latest/meta-data/iam/security-credentials/"; + var IMDS_TOKEN_PATH = "/latest/api/token"; + var AWS_EC2_METADATA_V1_DISABLED = "AWS_EC2_METADATA_V1_DISABLED"; + var PROFILE_AWS_EC2_METADATA_V1_DISABLED = "ec2_metadata_v1_disabled"; + var X_AWS_EC2_METADATA_TOKEN = "x-aws-ec2-metadata-token"; + var fromInstanceMetadata = /* @__PURE__ */ __name((init = {}) => staticStabilityProvider(getInstanceMetadataProvider(init), { logger: init.logger }), "fromInstanceMetadata"); + var getInstanceMetadataProvider = /* @__PURE__ */ __name((init = {}) => { + let disableFetchToken = false; + const { logger, profile } = init; + const { timeout, maxRetries } = providerConfigFromInit(init); + const getCredentials = /* @__PURE__ */ __name(async (maxRetries2, options) => { + var _a; + const isImdsV1Fallback = disableFetchToken || ((_a = options.headers) == null ? void 0 : _a[X_AWS_EC2_METADATA_TOKEN]) == null; + if (isImdsV1Fallback) { + let fallbackBlockedFromProfile = false; + let fallbackBlockedFromProcessEnv = false; + const configValue = await (0, import_node_config_provider.loadConfig)( + { + environmentVariableSelector: (env) => { + const envValue = env[AWS_EC2_METADATA_V1_DISABLED]; + fallbackBlockedFromProcessEnv = !!envValue && envValue !== "false"; + if (envValue === void 0) { + throw new import_property_provider2.CredentialsProviderError( + `${AWS_EC2_METADATA_V1_DISABLED} not set in env, checking config file next.`, + { logger: init.logger } + ); + } + return fallbackBlockedFromProcessEnv; + }, + configFileSelector: (profile2) => { + const profileValue = profile2[PROFILE_AWS_EC2_METADATA_V1_DISABLED]; + fallbackBlockedFromProfile = !!profileValue && profileValue !== "false"; + return fallbackBlockedFromProfile; + }, + default: false + }, + { + profile + } + )(); + if (init.ec2MetadataV1Disabled || configValue) { + const causes = []; + if (init.ec2MetadataV1Disabled) + causes.push("credential provider initialization (runtime option ec2MetadataV1Disabled)"); + if (fallbackBlockedFromProfile) + causes.push(`config file profile (${PROFILE_AWS_EC2_METADATA_V1_DISABLED})`); + if (fallbackBlockedFromProcessEnv) + causes.push(`process environment variable (${AWS_EC2_METADATA_V1_DISABLED})`); + throw new InstanceMetadataV1FallbackError( + `AWS EC2 Metadata v1 fallback has been blocked by AWS SDK configuration in the following: [${causes.join( + ", " + )}].` + ); } - } else if (currentSection) { - const indexOfEqualsSign = trimmedLine.indexOf("="); - if (![0, -1].includes(indexOfEqualsSign)) { - const [name, value] = [ - trimmedLine.substring(0, indexOfEqualsSign).trim(), - trimmedLine.substring(indexOfEqualsSign + 1).trim() - ]; - if (value === "") { - currentSubSection = name; - } else { - if (currentSubSection && iniLine.trimStart() === iniLine) { - currentSubSection = void 0; - } - map[currentSection] = map[currentSection] || {}; - const key = currentSubSection ? [currentSubSection, name].join(CONFIG_PREFIX_SEPARATOR) : name; - map[currentSection][key] = value; + } + const imdsProfile = (await retry(async () => { + let profile2; + try { + profile2 = await getProfile(options); + } catch (err) { + if (err.statusCode === 401) { + disableFetchToken = false; + } + throw err; + } + return profile2; + }, maxRetries2)).trim(); + return retry(async () => { + let creds; + try { + creds = await getCredentialsFromProfile(imdsProfile, options, init); + } catch (err) { + if (err.statusCode === 401) { + disableFetchToken = false; } + throw err; } - } - } - return map; - }, "parseIni"); - var import_slurpFile = require_slurpFile3(); - var swallowError = /* @__PURE__ */ __name(() => ({}), "swallowError"); - var CONFIG_PREFIX_SEPARATOR = "."; - var loadSharedConfigFiles = /* @__PURE__ */ __name(async (init = {}) => { - const { filepath = getCredentialsFilepath(), configFilepath = getConfigFilepath() } = init; - const homeDir = (0, import_getHomeDir3.getHomeDir)(); - const relativeHomeDirPrefix = "~/"; - let resolvedFilepath = filepath; - if (filepath.startsWith(relativeHomeDirPrefix)) { - resolvedFilepath = (0, import_path.join)(homeDir, filepath.slice(2)); - } - let resolvedConfigFilepath = configFilepath; - if (configFilepath.startsWith(relativeHomeDirPrefix)) { - resolvedConfigFilepath = (0, import_path.join)(homeDir, configFilepath.slice(2)); - } - const parsedFiles = await Promise.all([ - (0, import_slurpFile.slurpFile)(resolvedConfigFilepath, { - ignoreCache: init.ignoreCache - }).then(parseIni).then(getConfigData).catch(swallowError), - (0, import_slurpFile.slurpFile)(resolvedFilepath, { - ignoreCache: init.ignoreCache - }).then(parseIni).catch(swallowError) - ]); - return { - configFile: parsedFiles[0], - credentialsFile: parsedFiles[1] - }; - }, "loadSharedConfigFiles"); - var getSsoSessionData = /* @__PURE__ */ __name((data) => Object.entries(data).filter(([key]) => key.startsWith(import_types5.IniSectionType.SSO_SESSION + CONFIG_PREFIX_SEPARATOR)).reduce((acc, [key, value]) => ({ ...acc, [key.substring(key.indexOf(CONFIG_PREFIX_SEPARATOR) + 1)]: value }), {}), "getSsoSessionData"); - var import_slurpFile2 = require_slurpFile3(); - var swallowError2 = /* @__PURE__ */ __name(() => ({}), "swallowError"); - var loadSsoSessionData = /* @__PURE__ */ __name(async (init = {}) => (0, import_slurpFile2.slurpFile)(init.configFilepath ?? getConfigFilepath()).then(parseIni).then(getSsoSessionData).catch(swallowError2), "loadSsoSessionData"); - var mergeConfigFiles = /* @__PURE__ */ __name((...files) => { - const merged = {}; - for (const file of files) { - for (const [key, values] of Object.entries(file)) { - if (merged[key] !== void 0) { - Object.assign(merged[key], values); - } else { - merged[key] = values; + return creds; + }, maxRetries2); + }, "getCredentials"); + return async () => { + const endpoint = await getInstanceMetadataEndpoint(); + if (disableFetchToken) { + logger == null ? void 0 : logger.debug("AWS SDK Instance Metadata", "using v1 fallback (no token fetch)"); + return getCredentials(maxRetries, { ...endpoint, timeout }); + } else { + let token; + try { + token = (await getMetadataToken({ ...endpoint, timeout })).toString(); + } catch (error) { + if ((error == null ? void 0 : error.statusCode) === 400) { + throw Object.assign(error, { + message: "EC2 Metadata token request returned error" + }); + } else if (error.message === "TimeoutError" || [403, 404, 405].includes(error.statusCode)) { + disableFetchToken = true; + } + logger == null ? void 0 : logger.debug("AWS SDK Instance Metadata", "using v1 fallback (initial)"); + return getCredentials(maxRetries, { ...endpoint, timeout }); } + return getCredentials(maxRetries, { + ...endpoint, + headers: { + [X_AWS_EC2_METADATA_TOKEN]: token + }, + timeout + }); } + }; + }, "getInstanceMetadataProvider"); + var getMetadataToken = /* @__PURE__ */ __name(async (options) => httpRequest({ + ...options, + path: IMDS_TOKEN_PATH, + method: "PUT", + headers: { + "x-aws-ec2-metadata-token-ttl-seconds": "21600" } - return merged; - }, "mergeConfigFiles"); - var parseKnownFiles = /* @__PURE__ */ __name(async (init) => { - const parsedFiles = await loadSharedConfigFiles(init); - return mergeConfigFiles(parsedFiles.configFile, parsedFiles.credentialsFile); - }, "parseKnownFiles"); + }), "getMetadataToken"); + var getProfile = /* @__PURE__ */ __name(async (options) => (await httpRequest({ ...options, path: IMDS_PATH })).toString(), "getProfile"); + var getCredentialsFromProfile = /* @__PURE__ */ __name(async (profile, options, init) => { + const credentialsResponse = JSON.parse( + (await httpRequest({ + ...options, + path: IMDS_PATH + profile + })).toString() + ); + if (!isImdsCredentials(credentialsResponse)) { + throw new import_property_provider2.CredentialsProviderError("Invalid response received from instance metadata service.", { + logger: init.logger + }); + } + return fromImdsCredentials(credentialsResponse); + }, "getCredentialsFromProfile"); } }); -// ../../../node_modules/@smithy/util-defaults-mode-node/node_modules/@smithy/node-config-provider/dist-cjs/index.js -var require_dist_cjs65 = __commonJS({ - "../../../node_modules/@smithy/util-defaults-mode-node/node_modules/@smithy/node-config-provider/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); +// ../../../node_modules/@aws-sdk/credential-provider-http/dist-cjs/fromHttp/checkUrl.js +var require_checkUrl = __commonJS({ + "../../../node_modules/@aws-sdk/credential-provider-http/dist-cjs/fromHttp/checkUrl.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.checkUrl = void 0; + var property_provider_1 = require_dist_cjs24(); + var ECS_CONTAINER_HOST = "169.254.170.2"; + var EKS_CONTAINER_HOST_IPv4 = "169.254.170.23"; + var EKS_CONTAINER_HOST_IPv6 = "[fd00:ec2::23]"; + var checkUrl = (url2, logger) => { + if (url2.protocol === "https:") { + return; } - return to; - }; - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - loadConfig: () => loadConfig - }); - module2.exports = __toCommonJS2(src_exports); - var import_property_provider2 = require_dist_cjs63(); - function getSelectorName(functionString) { - try { - const constants = new Set(Array.from(functionString.match(/([A-Z_]){3,}/g) ?? [])); - constants.delete("CONFIG"); - constants.delete("CONFIG_PREFIX_SEPARATOR"); - constants.delete("ENV"); - return [...constants].join(", "); - } catch (e) { - return functionString; + if (url2.hostname === ECS_CONTAINER_HOST || url2.hostname === EKS_CONTAINER_HOST_IPv4 || url2.hostname === EKS_CONTAINER_HOST_IPv6) { + return; } - } - __name(getSelectorName, "getSelectorName"); - var fromEnv = /* @__PURE__ */ __name((envVarSelector, logger) => async () => { - try { - const config = envVarSelector(process.env); - if (config === void 0) { - throw new Error(); + if (url2.hostname.includes("[")) { + if (url2.hostname === "[::1]" || url2.hostname === "[0000:0000:0000:0000:0000:0000:0000:0001]") { + return; } - return config; - } catch (e) { - throw new import_property_provider2.CredentialsProviderError( - e.message || `Not found in ENV: ${getSelectorName(envVarSelector.toString())}`, - { logger } - ); - } - }, "fromEnv"); - var import_shared_ini_file_loader = require_dist_cjs64(); - var fromSharedConfigFiles = /* @__PURE__ */ __name((configSelector, { preferredFile = "config", ...init } = {}) => async () => { - const profile = (0, import_shared_ini_file_loader.getProfileName)(init); - const { configFile, credentialsFile } = await (0, import_shared_ini_file_loader.loadSharedConfigFiles)(init); - const profileFromCredentials = credentialsFile[profile] || {}; - const profileFromConfig = configFile[profile] || {}; - const mergedProfile = preferredFile === "config" ? { ...profileFromCredentials, ...profileFromConfig } : { ...profileFromConfig, ...profileFromCredentials }; - try { - const cfgFile = preferredFile === "config" ? configFile : credentialsFile; - const configValue = configSelector(mergedProfile, cfgFile); - if (configValue === void 0) { - throw new Error(); + } else { + if (url2.hostname === "localhost") { + return; } - return configValue; - } catch (e) { - throw new import_property_provider2.CredentialsProviderError( - e.message || `Not found in config files w/ profile [${profile}]: ${getSelectorName(configSelector.toString())}`, - { logger: init.logger } - ); - } - }, "fromSharedConfigFiles"); - var isFunction = /* @__PURE__ */ __name((func) => typeof func === "function", "isFunction"); - var fromStatic = /* @__PURE__ */ __name((defaultValue) => isFunction(defaultValue) ? async () => await defaultValue() : (0, import_property_provider2.fromStatic)(defaultValue), "fromStatic"); - var loadConfig = /* @__PURE__ */ __name(({ environmentVariableSelector, configFileSelector, default: defaultValue }, configuration = {}) => (0, import_property_provider2.memoize)( - (0, import_property_provider2.chain)( - fromEnv(environmentVariableSelector), - fromSharedConfigFiles(configFileSelector, configuration), - fromStatic(defaultValue) - ) - ), "loadConfig"); - } -}); - -// ../../../node_modules/@smithy/util-defaults-mode-node/node_modules/@smithy/querystring-parser/dist-cjs/index.js -var require_dist_cjs66 = __commonJS({ - "../../../node_modules/@smithy/util-defaults-mode-node/node_modules/@smithy/querystring-parser/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); - } - return to; - }; - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - parseQueryString: () => parseQueryString - }); - module2.exports = __toCommonJS2(src_exports); - function parseQueryString(querystring) { - const query = {}; - querystring = querystring.replace(/^\?/, ""); - if (querystring) { - for (const pair of querystring.split("&")) { - let [key, value = null] = pair.split("="); - key = decodeURIComponent(key); - if (value) { - value = decodeURIComponent(value); - } - if (!(key in query)) { - query[key] = value; - } else if (Array.isArray(query[key])) { - query[key].push(value); - } else { - query[key] = [query[key], value]; - } + const ipComponents = url2.hostname.split("."); + const inRange = (component) => { + const num = parseInt(component, 10); + return 0 <= num && num <= 255; + }; + if (ipComponents[0] === "127" && inRange(ipComponents[1]) && inRange(ipComponents[2]) && inRange(ipComponents[3]) && ipComponents.length === 4) { + return; } } - return query; - } - __name(parseQueryString, "parseQueryString"); + throw new property_provider_1.CredentialsProviderError(`URL not accepted. It must either be HTTPS or match one of the following: + - loopback CIDR 127.0.0.0/8 or [::1/128] + - ECS container host 169.254.170.2 + - EKS container host 169.254.170.23 or [fd00:ec2::23]`, { logger }); + }; + exports2.checkUrl = checkUrl; } }); -// ../../../node_modules/@smithy/util-defaults-mode-node/node_modules/@smithy/url-parser/dist-cjs/index.js -var require_dist_cjs67 = __commonJS({ - "../../../node_modules/@smithy/util-defaults-mode-node/node_modules/@smithy/url-parser/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); - } - return to; - }; - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - parseUrl: () => parseUrl - }); - module2.exports = __toCommonJS2(src_exports); - var import_querystring_parser = require_dist_cjs66(); - var parseUrl = /* @__PURE__ */ __name((url2) => { - if (typeof url2 === "string") { - return parseUrl(new URL(url2)); +// ../../../node_modules/@aws-sdk/credential-provider-http/dist-cjs/fromHttp/requestHelpers.js +var require_requestHelpers = __commonJS({ + "../../../node_modules/@aws-sdk/credential-provider-http/dist-cjs/fromHttp/requestHelpers.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.getCredentials = exports2.createGetRequest = void 0; + var property_provider_1 = require_dist_cjs24(); + var protocol_http_1 = require_dist_cjs2(); + var smithy_client_1 = require_dist_cjs33(); + var util_stream_1 = require_dist_cjs22(); + function createGetRequest(url2) { + return new protocol_http_1.HttpRequest({ + protocol: url2.protocol, + hostname: url2.hostname, + port: Number(url2.port), + path: url2.pathname, + query: Array.from(url2.searchParams.entries()).reduce((acc, [k, v]) => { + acc[k] = v; + return acc; + }, {}), + fragment: url2.hash + }); + } + exports2.createGetRequest = createGetRequest; + async function getCredentials(response, logger) { + const stream = (0, util_stream_1.sdkStreamMixin)(response.body); + const str = await stream.transformToString(); + if (response.statusCode === 200) { + const parsed = JSON.parse(str); + if (typeof parsed.AccessKeyId !== "string" || typeof parsed.SecretAccessKey !== "string" || typeof parsed.Token !== "string" || typeof parsed.Expiration !== "string") { + throw new property_provider_1.CredentialsProviderError("HTTP credential provider response not of the required format, an object matching: { AccessKeyId: string, SecretAccessKey: string, Token: string, Expiration: string(rfc3339) }", { logger }); + } + return { + accessKeyId: parsed.AccessKeyId, + secretAccessKey: parsed.SecretAccessKey, + sessionToken: parsed.Token, + expiration: (0, smithy_client_1.parseRfc3339DateTime)(parsed.Expiration) + }; } - const { hostname, pathname, port, protocol, search } = url2; - let query; - if (search) { - query = (0, import_querystring_parser.parseQueryString)(search); + if (response.statusCode >= 400 && response.statusCode < 500) { + let parsedBody = {}; + try { + parsedBody = JSON.parse(str); + } catch (e) { + } + throw Object.assign(new property_provider_1.CredentialsProviderError(`Server responded with status: ${response.statusCode}`, { logger }), { + Code: parsedBody.Code, + Message: parsedBody.Message + }); } - return { - hostname, - port: port ? parseInt(port) : void 0, - protocol, - path: pathname, - query - }; - }, "parseUrl"); + throw new property_provider_1.CredentialsProviderError(`Server responded with status: ${response.statusCode}`, { logger }); + } + exports2.getCredentials = getCredentials; } }); -// ../../../node_modules/@smithy/util-defaults-mode-node/node_modules/@smithy/credential-provider-imds/dist-cjs/index.js -var require_dist_cjs68 = __commonJS({ - "../../../node_modules/@smithy/util-defaults-mode-node/node_modules/@smithy/credential-provider-imds/dist-cjs/index.js"(exports2, module2) { - var __defProp2 = Object.defineProperty; - var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; - var __getOwnPropNames2 = Object.getOwnPropertyNames; - var __hasOwnProp2 = Object.prototype.hasOwnProperty; - var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); - var __export2 = (target, all) => { - for (var name in all) - __defProp2(target, name, { get: all[name], enumerable: true }); - }; - var __copyProps2 = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames2(from)) - if (!__hasOwnProp2.call(to, key) && key !== except) - __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); - } - return to; - }; - var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); - var src_exports = {}; - __export2(src_exports, { - DEFAULT_MAX_RETRIES: () => DEFAULT_MAX_RETRIES, - DEFAULT_TIMEOUT: () => DEFAULT_TIMEOUT, - ENV_CMDS_AUTH_TOKEN: () => ENV_CMDS_AUTH_TOKEN, - ENV_CMDS_FULL_URI: () => ENV_CMDS_FULL_URI, - ENV_CMDS_RELATIVE_URI: () => ENV_CMDS_RELATIVE_URI, - Endpoint: () => Endpoint, - fromContainerMetadata: () => fromContainerMetadata, - fromInstanceMetadata: () => fromInstanceMetadata, - getInstanceMetadataEndpoint: () => getInstanceMetadataEndpoint, - httpRequest: () => httpRequest, - providerConfigFromInit: () => providerConfigFromInit - }); - module2.exports = __toCommonJS2(src_exports); - var import_url = require("url"); - var import_property_provider2 = require_dist_cjs63(); - var import_buffer = require("buffer"); - var import_http2 = require("http"); - function httpRequest(options) { - return new Promise((resolve, reject) => { - var _a; - const req = (0, import_http2.request)({ - method: "GET", - ...options, - // Node.js http module doesn't accept hostname with square brackets - // Refs: https://github.com/nodejs/node/issues/39738 - hostname: (_a = options.hostname) == null ? void 0 : _a.replace(/^\[(.+)\]$/, "$1") - }); - req.on("error", (err) => { - reject(Object.assign(new import_property_provider2.ProviderError("Unable to connect to instance metadata service"), err)); - req.destroy(); - }); - req.on("timeout", () => { - reject(new import_property_provider2.ProviderError("TimeoutError from instance metadata service")); - req.destroy(); - }); - req.on("response", (res) => { - const { statusCode = 400 } = res; - if (statusCode < 200 || 300 <= statusCode) { - reject( - Object.assign(new import_property_provider2.ProviderError("Error response received from instance metadata service"), { statusCode }) - ); - req.destroy(); +// ../../../node_modules/@aws-sdk/credential-provider-http/dist-cjs/fromHttp/retry-wrapper.js +var require_retry_wrapper = __commonJS({ + "../../../node_modules/@aws-sdk/credential-provider-http/dist-cjs/fromHttp/retry-wrapper.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.retryWrapper = void 0; + var retryWrapper = (toRetry, maxRetries, delayMs) => { + return async () => { + for (let i = 0; i < maxRetries; ++i) { + try { + return await toRetry(); + } catch (e) { + await new Promise((resolve) => setTimeout(resolve, delayMs)); } - const chunks = []; - res.on("data", (chunk) => { - chunks.push(chunk); - }); - res.on("end", () => { - resolve(import_buffer.Buffer.concat(chunks)); - req.destroy(); - }); - }); - req.end(); - }); - } - __name(httpRequest, "httpRequest"); - var isImdsCredentials = /* @__PURE__ */ __name((arg) => Boolean(arg) && typeof arg === "object" && typeof arg.AccessKeyId === "string" && typeof arg.SecretAccessKey === "string" && typeof arg.Token === "string" && typeof arg.Expiration === "string", "isImdsCredentials"); - var fromImdsCredentials = /* @__PURE__ */ __name((creds) => ({ - accessKeyId: creds.AccessKeyId, - secretAccessKey: creds.SecretAccessKey, - sessionToken: creds.Token, - expiration: new Date(creds.Expiration), - ...creds.AccountId && { accountId: creds.AccountId } - }), "fromImdsCredentials"); - var DEFAULT_TIMEOUT = 1e3; - var DEFAULT_MAX_RETRIES = 0; - var providerConfigFromInit = /* @__PURE__ */ __name(({ - maxRetries = DEFAULT_MAX_RETRIES, - timeout = DEFAULT_TIMEOUT - }) => ({ maxRetries, timeout }), "providerConfigFromInit"); - var retry = /* @__PURE__ */ __name((toRetry, maxRetries) => { - let promise = toRetry(); - for (let i = 0; i < maxRetries; i++) { - promise = promise.catch(toRetry); - } - return promise; - }, "retry"); - var ENV_CMDS_FULL_URI = "AWS_CONTAINER_CREDENTIALS_FULL_URI"; - var ENV_CMDS_RELATIVE_URI = "AWS_CONTAINER_CREDENTIALS_RELATIVE_URI"; - var ENV_CMDS_AUTH_TOKEN = "AWS_CONTAINER_AUTHORIZATION_TOKEN"; - var fromContainerMetadata = /* @__PURE__ */ __name((init = {}) => { - const { timeout, maxRetries } = providerConfigFromInit(init); - return () => retry(async () => { - const requestOptions = await getCmdsUri({ logger: init.logger }); - const credsResponse = JSON.parse(await requestFromEcsImds(timeout, requestOptions)); - if (!isImdsCredentials(credsResponse)) { - throw new import_property_provider2.CredentialsProviderError("Invalid response received from instance metadata service.", { - logger: init.logger - }); } - return fromImdsCredentials(credsResponse); - }, maxRetries); - }, "fromContainerMetadata"); - var requestFromEcsImds = /* @__PURE__ */ __name(async (timeout, options) => { - if (process.env[ENV_CMDS_AUTH_TOKEN]) { - options.headers = { - ...options.headers, - Authorization: process.env[ENV_CMDS_AUTH_TOKEN] - }; + return await toRetry(); + }; + }; + exports2.retryWrapper = retryWrapper; + } +}); + +// ../../../node_modules/@aws-sdk/credential-provider-http/dist-cjs/fromHttp/fromHttp.js +var require_fromHttp = __commonJS({ + "../../../node_modules/@aws-sdk/credential-provider-http/dist-cjs/fromHttp/fromHttp.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.fromHttp = void 0; + var tslib_1 = (init_tslib_es6(), __toCommonJS(tslib_es6_exports)); + var node_http_handler_1 = require_dist_cjs19(); + var property_provider_1 = require_dist_cjs24(); + var promises_1 = tslib_1.__importDefault(require("fs/promises")); + var checkUrl_1 = require_checkUrl(); + var requestHelpers_1 = require_requestHelpers(); + var retry_wrapper_1 = require_retry_wrapper(); + var AWS_CONTAINER_CREDENTIALS_RELATIVE_URI = "AWS_CONTAINER_CREDENTIALS_RELATIVE_URI"; + var DEFAULT_LINK_LOCAL_HOST = "http://169.254.170.2"; + var AWS_CONTAINER_CREDENTIALS_FULL_URI = "AWS_CONTAINER_CREDENTIALS_FULL_URI"; + var AWS_CONTAINER_AUTHORIZATION_TOKEN_FILE = "AWS_CONTAINER_AUTHORIZATION_TOKEN_FILE"; + var AWS_CONTAINER_AUTHORIZATION_TOKEN = "AWS_CONTAINER_AUTHORIZATION_TOKEN"; + var fromHttp = (options = {}) => { + options.logger?.debug("@aws-sdk/credential-provider-http - fromHttp"); + let host; + const relative = options.awsContainerCredentialsRelativeUri ?? process.env[AWS_CONTAINER_CREDENTIALS_RELATIVE_URI]; + const full = options.awsContainerCredentialsFullUri ?? process.env[AWS_CONTAINER_CREDENTIALS_FULL_URI]; + const token = options.awsContainerAuthorizationToken ?? process.env[AWS_CONTAINER_AUTHORIZATION_TOKEN]; + const tokenFile = options.awsContainerAuthorizationTokenFile ?? process.env[AWS_CONTAINER_AUTHORIZATION_TOKEN_FILE]; + const warn = options.logger?.constructor?.name === "NoOpLogger" || !options.logger ? console.warn : options.logger.warn; + if (relative && full) { + warn("@aws-sdk/credential-provider-http: you have set both awsContainerCredentialsRelativeUri and awsContainerCredentialsFullUri."); + warn("awsContainerCredentialsFullUri will take precedence."); } - const buffer = await httpRequest({ - ...options, - timeout + if (token && tokenFile) { + warn("@aws-sdk/credential-provider-http: you have set both awsContainerAuthorizationToken and awsContainerAuthorizationTokenFile."); + warn("awsContainerAuthorizationToken will take precedence."); + } + if (full) { + host = full; + } else if (relative) { + host = `${DEFAULT_LINK_LOCAL_HOST}${relative}`; + } else { + throw new property_provider_1.CredentialsProviderError(`No HTTP credential provider host provided. +Set AWS_CONTAINER_CREDENTIALS_FULL_URI or AWS_CONTAINER_CREDENTIALS_RELATIVE_URI.`, { logger: options.logger }); + } + const url2 = new URL(host); + (0, checkUrl_1.checkUrl)(url2, options.logger); + const requestHandler = new node_http_handler_1.NodeHttpHandler({ + requestTimeout: options.timeout ?? 1e3, + connectionTimeout: options.timeout ?? 1e3 }); - return buffer.toString(); - }, "requestFromEcsImds"); - var CMDS_IP = "169.254.170.2"; - var GREENGRASS_HOSTS = { - localhost: true, - "127.0.0.1": true + return (0, retry_wrapper_1.retryWrapper)(async () => { + const request2 = (0, requestHelpers_1.createGetRequest)(url2); + if (token) { + request2.headers.Authorization = token; + } else if (tokenFile) { + request2.headers.Authorization = (await promises_1.default.readFile(tokenFile)).toString(); + } + try { + const result = await requestHandler.handle(request2); + return (0, requestHelpers_1.getCredentials)(result.response); + } catch (e) { + throw new property_provider_1.CredentialsProviderError(String(e), { logger: options.logger }); + } + }, options.maxRetries ?? 3, options.timeout ?? 1e3); }; - var GREENGRASS_PROTOCOLS = { - "http:": true, - "https:": true + exports2.fromHttp = fromHttp; + } +}); + +// ../../../node_modules/@aws-sdk/credential-provider-http/dist-cjs/index.js +var require_dist_cjs38 = __commonJS({ + "../../../node_modules/@aws-sdk/credential-provider-http/dist-cjs/index.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.fromHttp = void 0; + var fromHttp_1 = require_fromHttp(); + Object.defineProperty(exports2, "fromHttp", { enumerable: true, get: function() { + return fromHttp_1.fromHttp; + } }); + } +}); + +// ../../../node_modules/@aws-sdk/client-sso/dist-cjs/auth/httpAuthSchemeProvider.js +var require_httpAuthSchemeProvider2 = __commonJS({ + "../../../node_modules/@aws-sdk/client-sso/dist-cjs/auth/httpAuthSchemeProvider.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.resolveHttpAuthSchemeConfig = exports2.defaultSSOHttpAuthSchemeProvider = exports2.defaultSSOHttpAuthSchemeParametersProvider = void 0; + var core_1 = (init_dist_es2(), __toCommonJS(dist_es_exports2)); + var util_middleware_1 = require_dist_cjs10(); + var defaultSSOHttpAuthSchemeParametersProvider = async (config, context, input) => { + return { + operation: (0, util_middleware_1.getSmithyContext)(context).operation, + region: await (0, util_middleware_1.normalizeProvider)(config.region)() || (() => { + throw new Error("expected `region` to be configured for `aws.auth#sigv4`"); + })() + }; }; - var getCmdsUri = /* @__PURE__ */ __name(async ({ logger }) => { - if (process.env[ENV_CMDS_RELATIVE_URI]) { - return { - hostname: CMDS_IP, - path: process.env[ENV_CMDS_RELATIVE_URI] - }; - } - if (process.env[ENV_CMDS_FULL_URI]) { - const parsed = (0, import_url.parse)(process.env[ENV_CMDS_FULL_URI]); - if (!parsed.hostname || !(parsed.hostname in GREENGRASS_HOSTS)) { - throw new import_property_provider2.CredentialsProviderError(`${parsed.hostname} is not a valid container metadata service hostname`, { - tryNextLink: false, - logger - }); + exports2.defaultSSOHttpAuthSchemeParametersProvider = defaultSSOHttpAuthSchemeParametersProvider; + function createAwsAuthSigv4HttpAuthOption(authParameters) { + return { + schemeId: "aws.auth#sigv4", + signingProperties: { + name: "awsssoportal", + region: authParameters.region + }, + propertiesExtractor: (config, context) => ({ + signingProperties: { + config, + context + } + }) + }; + } + function createSmithyApiNoAuthHttpAuthOption(authParameters) { + return { + schemeId: "smithy.api#noAuth" + }; + } + var defaultSSOHttpAuthSchemeProvider = (authParameters) => { + const options = []; + switch (authParameters.operation) { + case "GetRoleCredentials": { + options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); + break; } - if (!parsed.protocol || !(parsed.protocol in GREENGRASS_PROTOCOLS)) { - throw new import_property_provider2.CredentialsProviderError(`${parsed.protocol} is not a valid container metadata service protocol`, { - tryNextLink: false, - logger - }); + case "ListAccountRoles": { + options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); + break; + } + case "ListAccounts": { + options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); + break; + } + case "Logout": { + options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); + break; + } + default: { + options.push(createAwsAuthSigv4HttpAuthOption(authParameters)); } - return { - ...parsed, - port: parsed.port ? parseInt(parsed.port, 10) : void 0 - }; } - throw new import_property_provider2.CredentialsProviderError( - `The container metadata credential provider cannot be used unless the ${ENV_CMDS_RELATIVE_URI} or ${ENV_CMDS_FULL_URI} environment variable is set`, - { - tryNextLink: false, - logger + return options; + }; + exports2.defaultSSOHttpAuthSchemeProvider = defaultSSOHttpAuthSchemeProvider; + var resolveHttpAuthSchemeConfig = (config) => { + const config_0 = (0, core_1.resolveAwsSdkSigV4Config)(config); + return { + ...config_0 + }; + }; + exports2.resolveHttpAuthSchemeConfig = resolveHttpAuthSchemeConfig; + } +}); + +// ../../../node_modules/@aws-sdk/client-sso/package.json +var require_package2 = __commonJS({ + "../../../node_modules/@aws-sdk/client-sso/package.json"(exports2, module2) { + module2.exports = { + name: "@aws-sdk/client-sso", + description: "AWS SDK for JavaScript Sso Client for Node.js, Browser and React Native", + version: "3.632.0", + scripts: { + build: "concurrently 'yarn:build:cjs' 'yarn:build:es' 'yarn:build:types'", + "build:cjs": "node ../../scripts/compilation/inline client-sso", + "build:es": "tsc -p tsconfig.es.json", + "build:include:deps": "lerna run --scope $npm_package_name --include-dependencies build", + "build:types": "tsc -p tsconfig.types.json", + "build:types:downlevel": "downlevel-dts dist-types dist-types/ts3.4", + clean: "rimraf ./dist-* && rimraf *.tsbuildinfo", + "extract:docs": "api-extractor run --local", + "generate:client": "node ../../scripts/generate-clients/single-service --solo sso" + }, + main: "./dist-cjs/index.js", + types: "./dist-types/index.d.ts", + module: "./dist-es/index.js", + sideEffects: false, + dependencies: { + "@aws-crypto/sha256-browser": "5.2.0", + "@aws-crypto/sha256-js": "5.2.0", + "@aws-sdk/core": "3.629.0", + "@aws-sdk/middleware-host-header": "3.620.0", + "@aws-sdk/middleware-logger": "3.609.0", + "@aws-sdk/middleware-recursion-detection": "3.620.0", + "@aws-sdk/middleware-user-agent": "3.632.0", + "@aws-sdk/region-config-resolver": "3.614.0", + "@aws-sdk/types": "3.609.0", + "@aws-sdk/util-endpoints": "3.632.0", + "@aws-sdk/util-user-agent-browser": "3.609.0", + "@aws-sdk/util-user-agent-node": "3.614.0", + "@smithy/config-resolver": "^3.0.5", + "@smithy/core": "^2.3.2", + "@smithy/fetch-http-handler": "^3.2.4", + "@smithy/hash-node": "^3.0.3", + "@smithy/invalid-dependency": "^3.0.3", + "@smithy/middleware-content-length": "^3.0.5", + "@smithy/middleware-endpoint": "^3.1.0", + "@smithy/middleware-retry": "^3.0.14", + "@smithy/middleware-serde": "^3.0.3", + "@smithy/middleware-stack": "^3.0.3", + "@smithy/node-config-provider": "^3.1.4", + "@smithy/node-http-handler": "^3.1.4", + "@smithy/protocol-http": "^4.1.0", + "@smithy/smithy-client": "^3.1.12", + "@smithy/types": "^3.3.0", + "@smithy/url-parser": "^3.0.3", + "@smithy/util-base64": "^3.0.0", + "@smithy/util-body-length-browser": "^3.0.0", + "@smithy/util-body-length-node": "^3.0.0", + "@smithy/util-defaults-mode-browser": "^3.0.14", + "@smithy/util-defaults-mode-node": "^3.0.14", + "@smithy/util-endpoints": "^2.0.5", + "@smithy/util-middleware": "^3.0.3", + "@smithy/util-retry": "^3.0.3", + "@smithy/util-utf8": "^3.0.0", + tslib: "^2.6.2" + }, + devDependencies: { + "@tsconfig/node16": "16.1.3", + "@types/node": "^16.18.96", + concurrently: "7.0.0", + "downlevel-dts": "0.10.1", + rimraf: "3.0.2", + typescript: "~4.9.5" + }, + engines: { + node: ">=16.0.0" + }, + typesVersions: { + "<4.0": { + "dist-types/*": [ + "dist-types/ts3.4/*" + ] } - ); - }, "getCmdsUri"); - var _InstanceMetadataV1FallbackError = class _InstanceMetadataV1FallbackError2 extends import_property_provider2.CredentialsProviderError { - constructor(message, tryNextLink = true) { - super(message, tryNextLink); - this.tryNextLink = tryNextLink; - this.name = "InstanceMetadataV1FallbackError"; - Object.setPrototypeOf(this, _InstanceMetadataV1FallbackError2.prototype); + }, + files: [ + "dist-*/**" + ], + author: { + name: "AWS SDK for JavaScript Team", + url: "https://aws.amazon.com/javascript/" + }, + license: "Apache-2.0", + browser: { + "./dist-es/runtimeConfig": "./dist-es/runtimeConfig.browser" + }, + "react-native": { + "./dist-es/runtimeConfig": "./dist-es/runtimeConfig.native" + }, + homepage: "https://github.com/aws/aws-sdk-js-v3/tree/main/clients/client-sso", + repository: { + type: "git", + url: "https://github.com/aws/aws-sdk-js-v3.git", + directory: "clients/client-sso" } }; - __name(_InstanceMetadataV1FallbackError, "InstanceMetadataV1FallbackError"); - var InstanceMetadataV1FallbackError = _InstanceMetadataV1FallbackError; - var import_node_config_provider = require_dist_cjs65(); - var import_url_parser = require_dist_cjs67(); - var Endpoint = /* @__PURE__ */ ((Endpoint2) => { - Endpoint2["IPv4"] = "http://169.254.169.254"; - Endpoint2["IPv6"] = "http://[fd00:ec2::254]"; - return Endpoint2; - })(Endpoint || {}); - var ENV_ENDPOINT_NAME = "AWS_EC2_METADATA_SERVICE_ENDPOINT"; - var CONFIG_ENDPOINT_NAME = "ec2_metadata_service_endpoint"; - var ENDPOINT_CONFIG_OPTIONS = { - environmentVariableSelector: (env) => env[ENV_ENDPOINT_NAME], - configFileSelector: (profile) => profile[CONFIG_ENDPOINT_NAME], - default: void 0 + } +}); + +// ../../../node_modules/@aws-sdk/util-user-agent-node/dist-cjs/index.js +var require_dist_cjs39 = __commonJS({ + "../../../node_modules/@aws-sdk/util-user-agent-node/dist-cjs/index.js"(exports2, module2) { + "use strict"; + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); }; - var EndpointMode = /* @__PURE__ */ ((EndpointMode2) => { - EndpointMode2["IPv4"] = "IPv4"; - EndpointMode2["IPv6"] = "IPv6"; - return EndpointMode2; - })(EndpointMode || {}); - var ENV_ENDPOINT_MODE_NAME = "AWS_EC2_METADATA_SERVICE_ENDPOINT_MODE"; - var CONFIG_ENDPOINT_MODE_NAME = "ec2_metadata_service_endpoint_mode"; - var ENDPOINT_MODE_CONFIG_OPTIONS = { - environmentVariableSelector: (env) => env[ENV_ENDPOINT_MODE_NAME], - configFileSelector: (profile) => profile[CONFIG_ENDPOINT_MODE_NAME], - default: "IPv4" - /* IPv4 */ + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; }; - var getInstanceMetadataEndpoint = /* @__PURE__ */ __name(async () => (0, import_url_parser.parseUrl)(await getFromEndpointConfig() || await getFromEndpointModeConfig()), "getInstanceMetadataEndpoint"); - var getFromEndpointConfig = /* @__PURE__ */ __name(async () => (0, import_node_config_provider.loadConfig)(ENDPOINT_CONFIG_OPTIONS)(), "getFromEndpointConfig"); - var getFromEndpointModeConfig = /* @__PURE__ */ __name(async () => { - const endpointMode = await (0, import_node_config_provider.loadConfig)(ENDPOINT_MODE_CONFIG_OPTIONS)(); - switch (endpointMode) { - case "IPv4": - return "http://169.254.169.254"; - case "IPv6": - return "http://[fd00:ec2::254]"; - default: - throw new Error(`Unsupported endpoint mode: ${endpointMode}. Select from ${Object.values(EndpointMode)}`); + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + UA_APP_ID_ENV_NAME: () => UA_APP_ID_ENV_NAME, + UA_APP_ID_INI_NAME: () => UA_APP_ID_INI_NAME, + crtAvailability: () => crtAvailability, + defaultUserAgent: () => defaultUserAgent + }); + module2.exports = __toCommonJS2(src_exports); + var import_node_config_provider = require_dist_cjs26(); + var import_os = require("os"); + var import_process = require("process"); + var crtAvailability = { + isCrtAvailable: false + }; + var isCrtAvailable = /* @__PURE__ */ __name(() => { + if (crtAvailability.isCrtAvailable) { + return ["md/crt-avail"]; } - }, "getFromEndpointModeConfig"); - var STATIC_STABILITY_REFRESH_INTERVAL_SECONDS = 5 * 60; - var STATIC_STABILITY_REFRESH_INTERVAL_JITTER_WINDOW_SECONDS = 5 * 60; - var STATIC_STABILITY_DOC_URL = "https://docs.aws.amazon.com/sdkref/latest/guide/feature-static-credentials.html"; - var getExtendedInstanceMetadataCredentials = /* @__PURE__ */ __name((credentials, logger) => { - const refreshInterval = STATIC_STABILITY_REFRESH_INTERVAL_SECONDS + Math.floor(Math.random() * STATIC_STABILITY_REFRESH_INTERVAL_JITTER_WINDOW_SECONDS); - const newExpiration = new Date(Date.now() + refreshInterval * 1e3); - logger.warn( - `Attempting credential expiration extension due to a credential service availability issue. A refresh of these credentials will be attempted after ${new Date(newExpiration)}. -For more information, please visit: ` + STATIC_STABILITY_DOC_URL - ); - const originalExpiration = credentials.originalExpiration ?? credentials.expiration; - return { - ...credentials, - ...originalExpiration ? { originalExpiration } : {}, - expiration: newExpiration - }; - }, "getExtendedInstanceMetadataCredentials"); - var staticStabilityProvider = /* @__PURE__ */ __name((provider, options = {}) => { - const logger = (options == null ? void 0 : options.logger) || console; - let pastCredentials; - return async () => { - let credentials; - try { - credentials = await provider(); - if (credentials.expiration && credentials.expiration.getTime() < Date.now()) { - credentials = getExtendedInstanceMetadataCredentials(credentials, logger); - } - } catch (e) { - if (pastCredentials) { - logger.warn("Credential renew failed: ", e); - credentials = getExtendedInstanceMetadataCredentials(pastCredentials, logger); - } else { - throw e; - } - } - pastCredentials = credentials; - return credentials; - }; - }, "staticStabilityProvider"); - var IMDS_PATH = "/latest/meta-data/iam/security-credentials/"; - var IMDS_TOKEN_PATH = "/latest/api/token"; - var AWS_EC2_METADATA_V1_DISABLED = "AWS_EC2_METADATA_V1_DISABLED"; - var PROFILE_AWS_EC2_METADATA_V1_DISABLED = "ec2_metadata_v1_disabled"; - var X_AWS_EC2_METADATA_TOKEN = "x-aws-ec2-metadata-token"; - var fromInstanceMetadata = /* @__PURE__ */ __name((init = {}) => staticStabilityProvider(getInstanceMetadataProvider(init), { logger: init.logger }), "fromInstanceMetadata"); - var getInstanceMetadataProvider = /* @__PURE__ */ __name((init = {}) => { - let disableFetchToken = false; - const { logger, profile } = init; - const { timeout, maxRetries } = providerConfigFromInit(init); - const getCredentials = /* @__PURE__ */ __name(async (maxRetries2, options) => { - var _a; - const isImdsV1Fallback = disableFetchToken || ((_a = options.headers) == null ? void 0 : _a[X_AWS_EC2_METADATA_TOKEN]) == null; - if (isImdsV1Fallback) { - let fallbackBlockedFromProfile = false; - let fallbackBlockedFromProcessEnv = false; - const configValue = await (0, import_node_config_provider.loadConfig)( - { - environmentVariableSelector: (env) => { - const envValue = env[AWS_EC2_METADATA_V1_DISABLED]; - fallbackBlockedFromProcessEnv = !!envValue && envValue !== "false"; - if (envValue === void 0) { - throw new import_property_provider2.CredentialsProviderError( - `${AWS_EC2_METADATA_V1_DISABLED} not set in env, checking config file next.`, - { logger: init.logger } - ); - } - return fallbackBlockedFromProcessEnv; - }, - configFileSelector: (profile2) => { - const profileValue = profile2[PROFILE_AWS_EC2_METADATA_V1_DISABLED]; - fallbackBlockedFromProfile = !!profileValue && profileValue !== "false"; - return fallbackBlockedFromProfile; - }, - default: false - }, - { - profile - } - )(); - if (init.ec2MetadataV1Disabled || configValue) { - const causes = []; - if (init.ec2MetadataV1Disabled) - causes.push("credential provider initialization (runtime option ec2MetadataV1Disabled)"); - if (fallbackBlockedFromProfile) - causes.push(`config file profile (${PROFILE_AWS_EC2_METADATA_V1_DISABLED})`); - if (fallbackBlockedFromProcessEnv) - causes.push(`process environment variable (${AWS_EC2_METADATA_V1_DISABLED})`); - throw new InstanceMetadataV1FallbackError( - `AWS EC2 Metadata v1 fallback has been blocked by AWS SDK configuration in the following: [${causes.join( - ", " - )}].` - ); - } - } - const imdsProfile = (await retry(async () => { - let profile2; - try { - profile2 = await getProfile(options); - } catch (err) { - if (err.statusCode === 401) { - disableFetchToken = false; - } - throw err; - } - return profile2; - }, maxRetries2)).trim(); - return retry(async () => { - let creds; - try { - creds = await getCredentialsFromProfile(imdsProfile, options, init); - } catch (err) { - if (err.statusCode === 401) { - disableFetchToken = false; - } - throw err; - } - return creds; - }, maxRetries2); - }, "getCredentials"); - return async () => { - const endpoint = await getInstanceMetadataEndpoint(); - if (disableFetchToken) { - logger == null ? void 0 : logger.debug("AWS SDK Instance Metadata", "using v1 fallback (no token fetch)"); - return getCredentials(maxRetries, { ...endpoint, timeout }); - } else { - let token; - try { - token = (await getMetadataToken({ ...endpoint, timeout })).toString(); - } catch (error) { - if ((error == null ? void 0 : error.statusCode) === 400) { - throw Object.assign(error, { - message: "EC2 Metadata token request returned error" - }); - } else if (error.message === "TimeoutError" || [403, 404, 405].includes(error.statusCode)) { - disableFetchToken = true; - } - logger == null ? void 0 : logger.debug("AWS SDK Instance Metadata", "using v1 fallback (initial)"); - return getCredentials(maxRetries, { ...endpoint, timeout }); - } - return getCredentials(maxRetries, { - ...endpoint, - headers: { - [X_AWS_EC2_METADATA_TOKEN]: token - }, - timeout - }); + return null; + }, "isCrtAvailable"); + var UA_APP_ID_ENV_NAME = "AWS_SDK_UA_APP_ID"; + var UA_APP_ID_INI_NAME = "sdk-ua-app-id"; + var defaultUserAgent = /* @__PURE__ */ __name(({ serviceId, clientVersion }) => { + const sections = [ + // sdk-metadata + ["aws-sdk-js", clientVersion], + // ua-metadata + ["ua", "2.0"], + // os-metadata + [`os/${(0, import_os.platform)()}`, (0, import_os.release)()], + // language-metadata + // ECMAScript edition doesn't matter in JS, so no version needed. + ["lang/js"], + ["md/nodejs", `${import_process.versions.node}`] + ]; + const crtAvailable = isCrtAvailable(); + if (crtAvailable) { + sections.push(crtAvailable); + } + if (serviceId) { + sections.push([`api/${serviceId}`, clientVersion]); + } + if (import_process.env.AWS_EXECUTION_ENV) { + sections.push([`exec-env/${import_process.env.AWS_EXECUTION_ENV}`]); + } + const appIdPromise = (0, import_node_config_provider.loadConfig)({ + environmentVariableSelector: (env2) => env2[UA_APP_ID_ENV_NAME], + configFileSelector: (profile) => profile[UA_APP_ID_INI_NAME], + default: void 0 + })(); + let resolvedUserAgent = void 0; + return async () => { + if (!resolvedUserAgent) { + const appId = await appIdPromise; + resolvedUserAgent = appId ? [...sections, [`app/${appId}`]] : [...sections]; } + return resolvedUserAgent; }; - }, "getInstanceMetadataProvider"); - var getMetadataToken = /* @__PURE__ */ __name(async (options) => httpRequest({ - ...options, - path: IMDS_TOKEN_PATH, - method: "PUT", - headers: { - "x-aws-ec2-metadata-token-ttl-seconds": "21600" + }, "defaultUserAgent"); + } +}); + +// ../../../node_modules/@smithy/hash-node/dist-cjs/index.js +var require_dist_cjs40 = __commonJS({ + "../../../node_modules/@smithy/hash-node/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); } - }), "getMetadataToken"); - var getProfile = /* @__PURE__ */ __name(async (options) => (await httpRequest({ ...options, path: IMDS_PATH })).toString(), "getProfile"); - var getCredentialsFromProfile = /* @__PURE__ */ __name(async (profile, options, init) => { - const credentialsResponse = JSON.parse( - (await httpRequest({ - ...options, - path: IMDS_PATH + profile - })).toString() - ); - if (!isImdsCredentials(credentialsResponse)) { - throw new import_property_provider2.CredentialsProviderError("Invalid response received from instance metadata service.", { - logger: init.logger - }); + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + Hash: () => Hash + }); + module2.exports = __toCommonJS2(src_exports); + var import_util_buffer_from = require_dist_cjs14(); + var import_util_utf8 = require_dist_cjs15(); + var import_buffer = require("buffer"); + var import_crypto5 = require("crypto"); + var _Hash = class _Hash { + constructor(algorithmIdentifier, secret) { + this.algorithmIdentifier = algorithmIdentifier; + this.secret = secret; + this.reset(); } - return fromImdsCredentials(credentialsResponse); - }, "getCredentialsFromProfile"); + update(toHash, encoding) { + this.hash.update((0, import_util_utf8.toUint8Array)(castSourceData(toHash, encoding))); + } + digest() { + return Promise.resolve(this.hash.digest()); + } + reset() { + this.hash = this.secret ? (0, import_crypto5.createHmac)(this.algorithmIdentifier, castSourceData(this.secret)) : (0, import_crypto5.createHash)(this.algorithmIdentifier); + } + }; + __name(_Hash, "Hash"); + var Hash = _Hash; + function castSourceData(toCast, encoding) { + if (import_buffer.Buffer.isBuffer(toCast)) { + return toCast; + } + if (typeof toCast === "string") { + return (0, import_util_buffer_from.fromString)(toCast, encoding); + } + if (ArrayBuffer.isView(toCast)) { + return (0, import_util_buffer_from.fromArrayBuffer)(toCast.buffer, toCast.byteOffset, toCast.byteLength); + } + return (0, import_util_buffer_from.fromArrayBuffer)(toCast); + } + __name(castSourceData, "castSourceData"); + } +}); + +// ../../../node_modules/@smithy/util-body-length-node/dist-cjs/index.js +var require_dist_cjs41 = __commonJS({ + "../../../node_modules/@smithy/util-body-length-node/dist-cjs/index.js"(exports2, module2) { + var __defProp2 = Object.defineProperty; + var __getOwnPropDesc2 = Object.getOwnPropertyDescriptor; + var __getOwnPropNames2 = Object.getOwnPropertyNames; + var __hasOwnProp2 = Object.prototype.hasOwnProperty; + var __name = (target, value) => __defProp2(target, "name", { value, configurable: true }); + var __export2 = (target, all) => { + for (var name in all) + __defProp2(target, name, { get: all[name], enumerable: true }); + }; + var __copyProps2 = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames2(from)) + if (!__hasOwnProp2.call(to, key) && key !== except) + __defProp2(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc2(from, key)) || desc.enumerable }); + } + return to; + }; + var __toCommonJS2 = (mod) => __copyProps2(__defProp2({}, "__esModule", { value: true }), mod); + var src_exports = {}; + __export2(src_exports, { + calculateBodyLength: () => calculateBodyLength + }); + module2.exports = __toCommonJS2(src_exports); + var import_fs = require("fs"); + var calculateBodyLength = /* @__PURE__ */ __name((body) => { + if (!body) { + return 0; + } + if (typeof body === "string") { + return Buffer.byteLength(body); + } else if (typeof body.byteLength === "number") { + return body.byteLength; + } else if (typeof body.size === "number") { + return body.size; + } else if (typeof body.start === "number" && typeof body.end === "number") { + return body.end + 1 - body.start; + } else if (typeof body.path === "string" || Buffer.isBuffer(body.path)) { + return (0, import_fs.lstatSync)(body.path).size; + } else if (typeof body.fd === "number") { + return (0, import_fs.fstatSync)(body.fd).size; + } + throw new Error(`Body Length computation failed for ${body}`); + }, "calculateBodyLength"); + } +}); + +// ../../../node_modules/@aws-sdk/client-sso/dist-cjs/endpoint/ruleset.js +var require_ruleset = __commonJS({ + "../../../node_modules/@aws-sdk/client-sso/dist-cjs/endpoint/ruleset.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.ruleSet = void 0; + var u = "required"; + var v = "fn"; + var w = "argv"; + var x = "ref"; + var a = true; + var b = "isSet"; + var c = "booleanEquals"; + var d = "error"; + var e = "endpoint"; + var f = "tree"; + var g = "PartitionResult"; + var h = "getAttr"; + var i = { [u]: false, "type": "String" }; + var j = { [u]: true, "default": false, "type": "Boolean" }; + var k = { [x]: "Endpoint" }; + var l = { [v]: c, [w]: [{ [x]: "UseFIPS" }, true] }; + var m = { [v]: c, [w]: [{ [x]: "UseDualStack" }, true] }; + var n = {}; + var o = { [v]: h, [w]: [{ [x]: g }, "supportsFIPS"] }; + var p = { [x]: g }; + var q = { [v]: c, [w]: [true, { [v]: h, [w]: [p, "supportsDualStack"] }] }; + var r = [l]; + var s = [m]; + var t = [{ [x]: "Region" }]; + var _data = { version: "1.0", parameters: { Region: i, UseDualStack: j, UseFIPS: j, Endpoint: i }, rules: [{ conditions: [{ [v]: b, [w]: [k] }], rules: [{ conditions: r, error: "Invalid Configuration: FIPS and custom endpoint are not supported", type: d }, { conditions: s, error: "Invalid Configuration: Dualstack and custom endpoint are not supported", type: d }, { endpoint: { url: k, properties: n, headers: n }, type: e }], type: f }, { conditions: [{ [v]: b, [w]: t }], rules: [{ conditions: [{ [v]: "aws.partition", [w]: t, assign: g }], rules: [{ conditions: [l, m], rules: [{ conditions: [{ [v]: c, [w]: [a, o] }, q], rules: [{ endpoint: { url: "https://portal.sso-fips.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "FIPS and DualStack are enabled, but this partition does not support one or both", type: d }], type: f }, { conditions: r, rules: [{ conditions: [{ [v]: c, [w]: [o, a] }], rules: [{ conditions: [{ [v]: "stringEquals", [w]: [{ [v]: h, [w]: [p, "name"] }, "aws-us-gov"] }], endpoint: { url: "https://portal.sso.{Region}.amazonaws.com", properties: n, headers: n }, type: e }, { endpoint: { url: "https://portal.sso-fips.{Region}.{PartitionResult#dnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "FIPS is enabled but this partition does not support FIPS", type: d }], type: f }, { conditions: s, rules: [{ conditions: [q], rules: [{ endpoint: { url: "https://portal.sso.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "DualStack is enabled but this partition does not support DualStack", type: d }], type: f }, { endpoint: { url: "https://portal.sso.{Region}.{PartitionResult#dnsSuffix}", properties: n, headers: n }, type: e }], type: f }], type: f }, { error: "Invalid Configuration: Missing Region", type: d }] }; + exports2.ruleSet = _data; + } +}); + +// ../../../node_modules/@aws-sdk/client-sso/dist-cjs/endpoint/endpointResolver.js +var require_endpointResolver = __commonJS({ + "../../../node_modules/@aws-sdk/client-sso/dist-cjs/endpoint/endpointResolver.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.defaultEndpointResolver = void 0; + var util_endpoints_1 = require_dist_cjs7(); + var util_endpoints_2 = require_dist_cjs6(); + var ruleset_1 = require_ruleset(); + var defaultEndpointResolver = (endpointParams, context = {}) => { + return (0, util_endpoints_2.resolveEndpoint)(ruleset_1.ruleSet, { + endpointParams, + logger: context.logger + }); + }; + exports2.defaultEndpointResolver = defaultEndpointResolver; + util_endpoints_2.customEndpointFunctions.aws = util_endpoints_1.awsEndpointFunctions; + } +}); + +// ../../../node_modules/@aws-sdk/client-sso/dist-cjs/runtimeConfig.shared.js +var require_runtimeConfig_shared = __commonJS({ + "../../../node_modules/@aws-sdk/client-sso/dist-cjs/runtimeConfig.shared.js"(exports2) { + "use strict"; + Object.defineProperty(exports2, "__esModule", { value: true }); + exports2.getRuntimeConfig = void 0; + var core_1 = (init_dist_es2(), __toCommonJS(dist_es_exports2)); + var core_2 = (init_dist_es(), __toCommonJS(dist_es_exports)); + var smithy_client_1 = require_dist_cjs33(); + var url_parser_1 = require_dist_cjs28(); + var util_base64_1 = require_dist_cjs16(); + var util_utf8_1 = require_dist_cjs15(); + var httpAuthSchemeProvider_1 = require_httpAuthSchemeProvider2(); + var endpointResolver_1 = require_endpointResolver(); + var getRuntimeConfig = (config) => { + return { + apiVersion: "2019-06-10", + base64Decoder: config?.base64Decoder ?? util_base64_1.fromBase64, + base64Encoder: config?.base64Encoder ?? util_base64_1.toBase64, + disableHostPrefix: config?.disableHostPrefix ?? false, + endpointProvider: config?.endpointProvider ?? endpointResolver_1.defaultEndpointResolver, + extensions: config?.extensions ?? [], + httpAuthSchemeProvider: config?.httpAuthSchemeProvider ?? httpAuthSchemeProvider_1.defaultSSOHttpAuthSchemeProvider, + httpAuthSchemes: config?.httpAuthSchemes ?? [ + { + schemeId: "aws.auth#sigv4", + identityProvider: (ipc) => ipc.getIdentityProvider("aws.auth#sigv4"), + signer: new core_1.AwsSdkSigV4Signer() + }, + { + schemeId: "smithy.api#noAuth", + identityProvider: (ipc) => ipc.getIdentityProvider("smithy.api#noAuth") || (async () => ({})), + signer: new core_2.NoAuthSigner() + } + ], + logger: config?.logger ?? new smithy_client_1.NoOpLogger(), + serviceId: config?.serviceId ?? "SSO", + urlParser: config?.urlParser ?? url_parser_1.parseUrl, + utf8Decoder: config?.utf8Decoder ?? util_utf8_1.fromUtf8, + utf8Encoder: config?.utf8Encoder ?? util_utf8_1.toUtf8 + }; + }; + exports2.getRuntimeConfig = getRuntimeConfig; } }); // ../../../node_modules/@smithy/util-defaults-mode-node/dist-cjs/index.js -var require_dist_cjs69 = __commonJS({ +var require_dist_cjs42 = __commonJS({ "../../../node_modules/@smithy/util-defaults-mode-node/dist-cjs/index.js"(exports2, module2) { var __create2 = Object.create; var __defProp2 = Object.defineProperty; @@ -18005,9 +13345,9 @@ var require_dist_cjs69 = __commonJS({ resolveDefaultsModeConfig: () => resolveDefaultsModeConfig }); module2.exports = __toCommonJS2(src_exports); - var import_config_resolver = require_dist_cjs62(); - var import_node_config_provider = require_dist_cjs65(); - var import_property_provider2 = require_dist_cjs63(); + var import_config_resolver = require_dist_cjs11(); + var import_node_config_provider = require_dist_cjs26(); + var import_property_provider2 = require_dist_cjs24(); var AWS_EXECUTION_ENV = "AWS_EXECUTION_ENV"; var AWS_REGION_ENV = "AWS_REGION"; var AWS_DEFAULT_REGION_ENV = "AWS_DEFAULT_REGION"; @@ -18068,7 +13408,7 @@ var require_dist_cjs69 = __commonJS({ } if (!process.env[ENV_IMDS_DISABLED]) { try { - const { getInstanceMetadataEndpoint, httpRequest } = await Promise.resolve().then(() => __toESM2(require_dist_cjs68())); + const { getInstanceMetadataEndpoint, httpRequest } = await Promise.resolve().then(() => __toESM2(require_dist_cjs37())); const endpoint = await getInstanceMetadataEndpoint(); return (await httpRequest({ ...endpoint, path: IMDS_REGION_PATH })).toString(); } catch (e) { @@ -18087,18 +13427,18 @@ var require_runtimeConfig = __commonJS({ var tslib_1 = (init_tslib_es6(), __toCommonJS(tslib_es6_exports)); var package_json_1 = tslib_1.__importDefault(require_package2()); var core_1 = (init_dist_es2(), __toCommonJS(dist_es_exports2)); - var util_user_agent_node_1 = require_dist_cjs56(); + var util_user_agent_node_1 = require_dist_cjs39(); var config_resolver_1 = require_dist_cjs11(); - var hash_node_1 = require_dist_cjs57(); - var middleware_retry_1 = require_dist_cjs38(); - var node_config_provider_1 = require_dist_cjs42(); - var node_http_handler_1 = require_dist_cjs51(); - var util_body_length_node_1 = require_dist_cjs58(); - var util_retry_1 = require_dist_cjs60(); + var hash_node_1 = require_dist_cjs40(); + var middleware_retry_1 = require_dist_cjs34(); + var node_config_provider_1 = require_dist_cjs26(); + var node_http_handler_1 = require_dist_cjs19(); + var util_body_length_node_1 = require_dist_cjs41(); + var util_retry_1 = require_dist_cjs31(); var runtimeConfig_shared_1 = require_runtimeConfig_shared(); - var smithy_client_1 = require_dist_cjs37(); - var util_defaults_mode_node_1 = require_dist_cjs69(); - var smithy_client_2 = require_dist_cjs37(); + var smithy_client_1 = require_dist_cjs33(); + var util_defaults_mode_node_1 = require_dist_cjs42(); + var smithy_client_2 = require_dist_cjs33(); var getRuntimeConfig = (config) => { (0, smithy_client_2.emitWarningIfUnsupportedVersion)(process.version); const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config); @@ -18130,7 +13470,7 @@ var require_runtimeConfig = __commonJS({ }); // ../../../node_modules/@aws-sdk/region-config-resolver/dist-cjs/index.js -var require_dist_cjs70 = __commonJS({ +var require_dist_cjs43 = __commonJS({ "../../../node_modules/@aws-sdk/region-config-resolver/dist-cjs/index.js"(exports2, module2) { "use strict"; var __defProp2 = Object.defineProperty; @@ -18228,7 +13568,7 @@ var require_dist_cjs70 = __commonJS({ }); // ../../../node_modules/@aws-sdk/client-sso/dist-cjs/index.js -var require_dist_cjs71 = __commonJS({ +var require_dist_cjs44 = __commonJS({ "../../../node_modules/@aws-sdk/client-sso/dist-cjs/index.js"(exports2, module2) { "use strict"; var __defProp2 = Object.defineProperty; @@ -18268,7 +13608,7 @@ var require_dist_cjs71 = __commonJS({ SSOServiceException: () => SSOServiceException, TooManyRequestsException: () => TooManyRequestsException, UnauthorizedException: () => UnauthorizedException, - __Client: () => import_smithy_client5.Client, + __Client: () => import_smithy_client4.Client, paginateListAccountRoles: () => paginateListAccountRoles, paginateListAccounts: () => paginateListAccounts }); @@ -18279,9 +13619,9 @@ var require_dist_cjs71 = __commonJS({ var import_middleware_user_agent = require_dist_cjs8(); var import_config_resolver = require_dist_cjs11(); var import_core3 = (init_dist_es(), __toCommonJS(dist_es_exports)); - var import_middleware_content_length = require_dist_cjs39(); - var import_middleware_endpoint2 = require_dist_cjs46(); - var import_middleware_retry2 = require_dist_cjs38(); + var import_middleware_content_length = require_dist_cjs23(); + var import_middleware_endpoint = require_dist_cjs29(); + var import_middleware_retry = require_dist_cjs34(); var import_httpAuthSchemeProvider = require_httpAuthSchemeProvider2(); var resolveClientEndpointParameters = /* @__PURE__ */ __name((options) => { return { @@ -18298,9 +13638,9 @@ var require_dist_cjs71 = __commonJS({ UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" } }; var import_runtimeConfig = require_runtimeConfig(); - var import_region_config_resolver = require_dist_cjs70(); + var import_region_config_resolver = require_dist_cjs43(); var import_protocol_http8 = require_dist_cjs2(); - var import_smithy_client5 = require_dist_cjs37(); + var import_smithy_client4 = require_dist_cjs33(); var getHttpAuthExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { const _httpAuthSchemes = runtimeConfig.httpAuthSchemes; let _httpAuthSchemeProvider = runtimeConfig.httpAuthSchemeProvider; @@ -18342,7 +13682,7 @@ var require_dist_cjs71 = __commonJS({ var resolveRuntimeExtensions = /* @__PURE__ */ __name((runtimeConfig, extensions) => { const extensionConfiguration = { ...asPartial((0, import_region_config_resolver.getAwsRegionExtensionConfiguration)(runtimeConfig)), - ...asPartial((0, import_smithy_client5.getDefaultExtensionConfiguration)(runtimeConfig)), + ...asPartial((0, import_smithy_client4.getDefaultExtensionConfiguration)(runtimeConfig)), ...asPartial((0, import_protocol_http8.getHttpHandlerExtensionConfiguration)(runtimeConfig)), ...asPartial(getHttpAuthExtensionConfiguration(runtimeConfig)) }; @@ -18350,26 +13690,26 @@ var require_dist_cjs71 = __commonJS({ return { ...runtimeConfig, ...(0, import_region_config_resolver.resolveAwsRegionExtensionConfiguration)(extensionConfiguration), - ...(0, import_smithy_client5.resolveDefaultRuntimeConfig)(extensionConfiguration), + ...(0, import_smithy_client4.resolveDefaultRuntimeConfig)(extensionConfiguration), ...(0, import_protocol_http8.resolveHttpHandlerRuntimeConfig)(extensionConfiguration), ...resolveHttpAuthRuntimeConfig(extensionConfiguration) }; }, "resolveRuntimeExtensions"); - var _SSOClient = class _SSOClient extends import_smithy_client5.Client { + var _SSOClient = class _SSOClient extends import_smithy_client4.Client { constructor(...[configuration]) { const _config_0 = (0, import_runtimeConfig.getRuntimeConfig)(configuration || {}); const _config_1 = resolveClientEndpointParameters(_config_0); const _config_2 = (0, import_middleware_user_agent.resolveUserAgentConfig)(_config_1); - const _config_3 = (0, import_middleware_retry2.resolveRetryConfig)(_config_2); + const _config_3 = (0, import_middleware_retry.resolveRetryConfig)(_config_2); const _config_4 = (0, import_config_resolver.resolveRegionConfig)(_config_3); const _config_5 = (0, import_middleware_host_header.resolveHostHeaderConfig)(_config_4); - const _config_6 = (0, import_middleware_endpoint2.resolveEndpointConfig)(_config_5); + const _config_6 = (0, import_middleware_endpoint.resolveEndpointConfig)(_config_5); const _config_7 = (0, import_httpAuthSchemeProvider.resolveHttpAuthSchemeConfig)(_config_6); const _config_8 = resolveRuntimeExtensions(_config_7, (configuration == null ? void 0 : configuration.extensions) || []); super(_config_8); this.config = _config_8; this.middlewareStack.use((0, import_middleware_user_agent.getUserAgentPlugin)(this.config)); - this.middlewareStack.use((0, import_middleware_retry2.getRetryPlugin)(this.config)); + this.middlewareStack.use((0, import_middleware_retry.getRetryPlugin)(this.config)); this.middlewareStack.use((0, import_middleware_content_length.getContentLengthPlugin)(this.config)); this.middlewareStack.use((0, import_middleware_host_header.getHostHeaderPlugin)(this.config)); this.middlewareStack.use((0, import_middleware_logger.getLoggerPlugin)(this.config)); @@ -18395,8 +13735,8 @@ var require_dist_cjs71 = __commonJS({ }; __name(_SSOClient, "SSOClient"); var SSOClient = _SSOClient; - var import_middleware_serde2 = require_dist_cjs45(); - var _SSOServiceException = class _SSOServiceException2 extends import_smithy_client5.ServiceException { + var import_middleware_serde2 = require_dist_cjs12(); + var _SSOServiceException = class _SSOServiceException2 extends import_smithy_client4.ServiceException { /** * @internal */ @@ -18477,12 +13817,12 @@ var require_dist_cjs71 = __commonJS({ var UnauthorizedException = _UnauthorizedException; var GetRoleCredentialsRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.accessToken && { accessToken: import_smithy_client5.SENSITIVE_STRING } + ...obj.accessToken && { accessToken: import_smithy_client4.SENSITIVE_STRING } }), "GetRoleCredentialsRequestFilterSensitiveLog"); var RoleCredentialsFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.secretAccessKey && { secretAccessKey: import_smithy_client5.SENSITIVE_STRING }, - ...obj.sessionToken && { sessionToken: import_smithy_client5.SENSITIVE_STRING } + ...obj.secretAccessKey && { secretAccessKey: import_smithy_client4.SENSITIVE_STRING }, + ...obj.sessionToken && { sessionToken: import_smithy_client4.SENSITIVE_STRING } }), "RoleCredentialsFilterSensitiveLog"); var GetRoleCredentialsResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, @@ -18490,26 +13830,26 @@ var require_dist_cjs71 = __commonJS({ }), "GetRoleCredentialsResponseFilterSensitiveLog"); var ListAccountRolesRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.accessToken && { accessToken: import_smithy_client5.SENSITIVE_STRING } + ...obj.accessToken && { accessToken: import_smithy_client4.SENSITIVE_STRING } }), "ListAccountRolesRequestFilterSensitiveLog"); var ListAccountsRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.accessToken && { accessToken: import_smithy_client5.SENSITIVE_STRING } + ...obj.accessToken && { accessToken: import_smithy_client4.SENSITIVE_STRING } }), "ListAccountsRequestFilterSensitiveLog"); var LogoutRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.accessToken && { accessToken: import_smithy_client5.SENSITIVE_STRING } + ...obj.accessToken && { accessToken: import_smithy_client4.SENSITIVE_STRING } }), "LogoutRequestFilterSensitiveLog"); var import_core22 = (init_dist_es2(), __toCommonJS(dist_es_exports2)); var se_GetRoleCredentialsCommand = /* @__PURE__ */ __name(async (input, context) => { const b = (0, import_core3.requestBuilder)(input, context); - const headers = (0, import_smithy_client5.map)({}, isSerializableHeaderValue, { + const headers = (0, import_smithy_client4.map)({}, isSerializableHeaderValue, { [_xasbt]: input[_aT] }); b.bp("/federation/credentials"); - const query = (0, import_smithy_client5.map)({ - [_rn]: [, (0, import_smithy_client5.expectNonNull)(input[_rN], `roleName`)], - [_ai]: [, (0, import_smithy_client5.expectNonNull)(input[_aI], `accountId`)] + const query = (0, import_smithy_client4.map)({ + [_rn]: [, (0, import_smithy_client4.expectNonNull)(input[_rN], `roleName`)], + [_ai]: [, (0, import_smithy_client4.expectNonNull)(input[_aI], `accountId`)] }); let body; b.m("GET").h(headers).q(query).b(body); @@ -18517,14 +13857,14 @@ var require_dist_cjs71 = __commonJS({ }, "se_GetRoleCredentialsCommand"); var se_ListAccountRolesCommand = /* @__PURE__ */ __name(async (input, context) => { const b = (0, import_core3.requestBuilder)(input, context); - const headers = (0, import_smithy_client5.map)({}, isSerializableHeaderValue, { + const headers = (0, import_smithy_client4.map)({}, isSerializableHeaderValue, { [_xasbt]: input[_aT] }); b.bp("/assignment/roles"); - const query = (0, import_smithy_client5.map)({ + const query = (0, import_smithy_client4.map)({ [_nt]: [, input[_nT]], [_mr]: [() => input.maxResults !== void 0, () => input[_mR].toString()], - [_ai]: [, (0, import_smithy_client5.expectNonNull)(input[_aI], `accountId`)] + [_ai]: [, (0, import_smithy_client4.expectNonNull)(input[_aI], `accountId`)] }); let body; b.m("GET").h(headers).q(query).b(body); @@ -18532,11 +13872,11 @@ var require_dist_cjs71 = __commonJS({ }, "se_ListAccountRolesCommand"); var se_ListAccountsCommand = /* @__PURE__ */ __name(async (input, context) => { const b = (0, import_core3.requestBuilder)(input, context); - const headers = (0, import_smithy_client5.map)({}, isSerializableHeaderValue, { + const headers = (0, import_smithy_client4.map)({}, isSerializableHeaderValue, { [_xasbt]: input[_aT] }); b.bp("/assignment/accounts"); - const query = (0, import_smithy_client5.map)({ + const query = (0, import_smithy_client4.map)({ [_nt]: [, input[_nT]], [_mr]: [() => input.maxResults !== void 0, () => input[_mR].toString()] }); @@ -18546,7 +13886,7 @@ var require_dist_cjs71 = __commonJS({ }, "se_ListAccountsCommand"); var se_LogoutCommand = /* @__PURE__ */ __name(async (input, context) => { const b = (0, import_core3.requestBuilder)(input, context); - const headers = (0, import_smithy_client5.map)({}, isSerializableHeaderValue, { + const headers = (0, import_smithy_client4.map)({}, isSerializableHeaderValue, { [_xasbt]: input[_aT] }); b.bp("/logout"); @@ -18558,12 +13898,12 @@ var require_dist_cjs71 = __commonJS({ if (output.statusCode !== 200 && output.statusCode >= 300) { return de_CommandError(output, context); } - const contents = (0, import_smithy_client5.map)({ + const contents = (0, import_smithy_client4.map)({ $metadata: deserializeMetadata(output) }); - const data = (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.expectObject)(await (0, import_core22.parseJsonBody)(output.body, context)), "body"); - const doc = (0, import_smithy_client5.take)(data, { - roleCredentials: import_smithy_client5._json + const data = (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.expectObject)(await (0, import_core22.parseJsonBody)(output.body, context)), "body"); + const doc = (0, import_smithy_client4.take)(data, { + roleCredentials: import_smithy_client4._json }); Object.assign(contents, doc); return contents; @@ -18572,13 +13912,13 @@ var require_dist_cjs71 = __commonJS({ if (output.statusCode !== 200 && output.statusCode >= 300) { return de_CommandError(output, context); } - const contents = (0, import_smithy_client5.map)({ + const contents = (0, import_smithy_client4.map)({ $metadata: deserializeMetadata(output) }); - const data = (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.expectObject)(await (0, import_core22.parseJsonBody)(output.body, context)), "body"); - const doc = (0, import_smithy_client5.take)(data, { - nextToken: import_smithy_client5.expectString, - roleList: import_smithy_client5._json + const data = (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.expectObject)(await (0, import_core22.parseJsonBody)(output.body, context)), "body"); + const doc = (0, import_smithy_client4.take)(data, { + nextToken: import_smithy_client4.expectString, + roleList: import_smithy_client4._json }); Object.assign(contents, doc); return contents; @@ -18587,13 +13927,13 @@ var require_dist_cjs71 = __commonJS({ if (output.statusCode !== 200 && output.statusCode >= 300) { return de_CommandError(output, context); } - const contents = (0, import_smithy_client5.map)({ + const contents = (0, import_smithy_client4.map)({ $metadata: deserializeMetadata(output) }); - const data = (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.expectObject)(await (0, import_core22.parseJsonBody)(output.body, context)), "body"); - const doc = (0, import_smithy_client5.take)(data, { - accountList: import_smithy_client5._json, - nextToken: import_smithy_client5.expectString + const data = (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.expectObject)(await (0, import_core22.parseJsonBody)(output.body, context)), "body"); + const doc = (0, import_smithy_client4.take)(data, { + accountList: import_smithy_client4._json, + nextToken: import_smithy_client4.expectString }); Object.assign(contents, doc); return contents; @@ -18602,10 +13942,10 @@ var require_dist_cjs71 = __commonJS({ if (output.statusCode !== 200 && output.statusCode >= 300) { return de_CommandError(output, context); } - const contents = (0, import_smithy_client5.map)({ + const contents = (0, import_smithy_client4.map)({ $metadata: deserializeMetadata(output) }); - await (0, import_smithy_client5.collectBody)(output.body, context); + await (0, import_smithy_client4.collectBody)(output.body, context); return contents; }, "de_LogoutCommand"); var de_CommandError = /* @__PURE__ */ __name(async (output, context) => { @@ -18636,58 +13976,58 @@ var require_dist_cjs71 = __commonJS({ }); } }, "de_CommandError"); - var throwDefaultError = (0, import_smithy_client5.withBaseException)(SSOServiceException); + var throwDefaultError = (0, import_smithy_client4.withBaseException)(SSOServiceException); var de_InvalidRequestExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); + const contents = (0, import_smithy_client4.map)({}); const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - message: import_smithy_client5.expectString + const doc = (0, import_smithy_client4.take)(data, { + message: import_smithy_client4.expectString }); Object.assign(contents, doc); const exception = new InvalidRequestException({ $metadata: deserializeMetadata(parsedOutput), ...contents }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); + return (0, import_smithy_client4.decorateServiceException)(exception, parsedOutput.body); }, "de_InvalidRequestExceptionRes"); var de_ResourceNotFoundExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); + const contents = (0, import_smithy_client4.map)({}); const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - message: import_smithy_client5.expectString + const doc = (0, import_smithy_client4.take)(data, { + message: import_smithy_client4.expectString }); Object.assign(contents, doc); const exception = new ResourceNotFoundException({ $metadata: deserializeMetadata(parsedOutput), ...contents }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); + return (0, import_smithy_client4.decorateServiceException)(exception, parsedOutput.body); }, "de_ResourceNotFoundExceptionRes"); var de_TooManyRequestsExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); + const contents = (0, import_smithy_client4.map)({}); const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - message: import_smithy_client5.expectString + const doc = (0, import_smithy_client4.take)(data, { + message: import_smithy_client4.expectString }); Object.assign(contents, doc); const exception = new TooManyRequestsException({ $metadata: deserializeMetadata(parsedOutput), ...contents }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); + return (0, import_smithy_client4.decorateServiceException)(exception, parsedOutput.body); }, "de_TooManyRequestsExceptionRes"); var de_UnauthorizedExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); + const contents = (0, import_smithy_client4.map)({}); const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - message: import_smithy_client5.expectString + const doc = (0, import_smithy_client4.take)(data, { + message: import_smithy_client4.expectString }); Object.assign(contents, doc); const exception = new UnauthorizedException({ $metadata: deserializeMetadata(parsedOutput), ...contents }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); + return (0, import_smithy_client4.decorateServiceException)(exception, parsedOutput.body); }, "de_UnauthorizedExceptionRes"); var deserializeMetadata = /* @__PURE__ */ __name((output) => ({ httpStatusCode: output.statusCode, @@ -18706,45 +14046,45 @@ var require_dist_cjs71 = __commonJS({ var _rN = "roleName"; var _rn = "role_name"; var _xasbt = "x-amz-sso_bearer_token"; - var _GetRoleCredentialsCommand = class _GetRoleCredentialsCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _GetRoleCredentialsCommand = class _GetRoleCredentialsCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("SWBPortalService", "GetRoleCredentials", {}).n("SSOClient", "GetRoleCredentialsCommand").f(GetRoleCredentialsRequestFilterSensitiveLog, GetRoleCredentialsResponseFilterSensitiveLog).ser(se_GetRoleCredentialsCommand).de(de_GetRoleCredentialsCommand).build() { }; __name(_GetRoleCredentialsCommand, "GetRoleCredentialsCommand"); var GetRoleCredentialsCommand = _GetRoleCredentialsCommand; - var _ListAccountRolesCommand = class _ListAccountRolesCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _ListAccountRolesCommand = class _ListAccountRolesCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("SWBPortalService", "ListAccountRoles", {}).n("SSOClient", "ListAccountRolesCommand").f(ListAccountRolesRequestFilterSensitiveLog, void 0).ser(se_ListAccountRolesCommand).de(de_ListAccountRolesCommand).build() { }; __name(_ListAccountRolesCommand, "ListAccountRolesCommand"); var ListAccountRolesCommand = _ListAccountRolesCommand; - var _ListAccountsCommand = class _ListAccountsCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _ListAccountsCommand = class _ListAccountsCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("SWBPortalService", "ListAccounts", {}).n("SSOClient", "ListAccountsCommand").f(ListAccountsRequestFilterSensitiveLog, void 0).ser(se_ListAccountsCommand).de(de_ListAccountsCommand).build() { }; __name(_ListAccountsCommand, "ListAccountsCommand"); var ListAccountsCommand = _ListAccountsCommand; - var _LogoutCommand = class _LogoutCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _LogoutCommand = class _LogoutCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("SWBPortalService", "Logout", {}).n("SSOClient", "LogoutCommand").f(LogoutRequestFilterSensitiveLog, void 0).ser(se_LogoutCommand).de(de_LogoutCommand).build() { }; @@ -18760,7 +14100,7 @@ var require_dist_cjs71 = __commonJS({ }; __name(_SSO, "SSO"); var SSO = _SSO; - (0, import_smithy_client5.createAggregatedClient)(commands, SSO); + (0, import_smithy_client4.createAggregatedClient)(commands, SSO); var paginateListAccountRoles = (0, import_core3.createPaginator)(SSOClient, ListAccountRolesCommand, "nextToken", "nextToken", "maxResults"); var paginateListAccounts = (0, import_core3.createPaginator)(SSOClient, ListAccountsCommand, "nextToken", "nextToken", "maxResults"); } @@ -19006,10 +14346,10 @@ var require_runtimeConfig_shared2 = __commonJS({ exports2.getRuntimeConfig = void 0; var core_1 = (init_dist_es2(), __toCommonJS(dist_es_exports2)); var core_2 = (init_dist_es(), __toCommonJS(dist_es_exports)); - var smithy_client_1 = require_dist_cjs37(); - var url_parser_1 = require_dist_cjs44(); - var util_base64_1 = require_dist_cjs29(); - var util_utf8_1 = require_dist_cjs28(); + var smithy_client_1 = require_dist_cjs33(); + var url_parser_1 = require_dist_cjs28(); + var util_base64_1 = require_dist_cjs16(); + var util_utf8_1 = require_dist_cjs15(); var httpAuthSchemeProvider_1 = require_httpAuthSchemeProvider3(); var endpointResolver_1 = require_endpointResolver2(); var getRuntimeConfig = (config) => { @@ -19053,19 +14393,19 @@ var require_runtimeConfig2 = __commonJS({ var tslib_1 = (init_tslib_es6(), __toCommonJS(tslib_es6_exports)); var package_json_1 = tslib_1.__importDefault(require_package3()); var core_1 = (init_dist_es2(), __toCommonJS(dist_es_exports2)); - var credential_provider_node_1 = require_dist_cjs79(); - var util_user_agent_node_1 = require_dist_cjs56(); + var credential_provider_node_1 = require_dist_cjs52(); + var util_user_agent_node_1 = require_dist_cjs39(); var config_resolver_1 = require_dist_cjs11(); - var hash_node_1 = require_dist_cjs57(); - var middleware_retry_1 = require_dist_cjs38(); - var node_config_provider_1 = require_dist_cjs42(); - var node_http_handler_1 = require_dist_cjs51(); - var util_body_length_node_1 = require_dist_cjs58(); - var util_retry_1 = require_dist_cjs60(); + var hash_node_1 = require_dist_cjs40(); + var middleware_retry_1 = require_dist_cjs34(); + var node_config_provider_1 = require_dist_cjs26(); + var node_http_handler_1 = require_dist_cjs19(); + var util_body_length_node_1 = require_dist_cjs41(); + var util_retry_1 = require_dist_cjs31(); var runtimeConfig_shared_1 = require_runtimeConfig_shared2(); - var smithy_client_1 = require_dist_cjs37(); - var util_defaults_mode_node_1 = require_dist_cjs69(); - var smithy_client_2 = require_dist_cjs37(); + var smithy_client_1 = require_dist_cjs33(); + var util_defaults_mode_node_1 = require_dist_cjs42(); + var smithy_client_2 = require_dist_cjs33(); var getRuntimeConfig = (config) => { (0, smithy_client_2.emitWarningIfUnsupportedVersion)(process.version); const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config); @@ -19098,7 +14438,7 @@ var require_runtimeConfig2 = __commonJS({ }); // ../../../node_modules/@aws-sdk/client-sso-oidc/dist-cjs/index.js -var require_dist_cjs72 = __commonJS({ +var require_dist_cjs45 = __commonJS({ "../../../node_modules/@aws-sdk/client-sso-oidc/dist-cjs/index.js"(exports2, module2) { "use strict"; var __defProp2 = Object.defineProperty; @@ -19148,7 +14488,7 @@ var require_dist_cjs72 = __commonJS({ StartDeviceAuthorizationRequestFilterSensitiveLog: () => StartDeviceAuthorizationRequestFilterSensitiveLog, UnauthorizedClientException: () => UnauthorizedClientException, UnsupportedGrantTypeException: () => UnsupportedGrantTypeException, - __Client: () => import_smithy_client5.Client + __Client: () => import_smithy_client4.Client }); module2.exports = __toCommonJS2(src_exports); var import_middleware_host_header = require_dist_cjs3(); @@ -19157,9 +14497,9 @@ var require_dist_cjs72 = __commonJS({ var import_middleware_user_agent = require_dist_cjs8(); var import_config_resolver = require_dist_cjs11(); var import_core3 = (init_dist_es(), __toCommonJS(dist_es_exports)); - var import_middleware_content_length = require_dist_cjs39(); - var import_middleware_endpoint2 = require_dist_cjs46(); - var import_middleware_retry2 = require_dist_cjs38(); + var import_middleware_content_length = require_dist_cjs23(); + var import_middleware_endpoint = require_dist_cjs29(); + var import_middleware_retry = require_dist_cjs34(); var import_httpAuthSchemeProvider = require_httpAuthSchemeProvider3(); var resolveClientEndpointParameters = /* @__PURE__ */ __name((options) => { return { @@ -19176,9 +14516,9 @@ var require_dist_cjs72 = __commonJS({ UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" } }; var import_runtimeConfig = require_runtimeConfig2(); - var import_region_config_resolver = require_dist_cjs70(); + var import_region_config_resolver = require_dist_cjs43(); var import_protocol_http8 = require_dist_cjs2(); - var import_smithy_client5 = require_dist_cjs37(); + var import_smithy_client4 = require_dist_cjs33(); var getHttpAuthExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { const _httpAuthSchemes = runtimeConfig.httpAuthSchemes; let _httpAuthSchemeProvider = runtimeConfig.httpAuthSchemeProvider; @@ -19220,7 +14560,7 @@ var require_dist_cjs72 = __commonJS({ var resolveRuntimeExtensions = /* @__PURE__ */ __name((runtimeConfig, extensions) => { const extensionConfiguration = { ...asPartial((0, import_region_config_resolver.getAwsRegionExtensionConfiguration)(runtimeConfig)), - ...asPartial((0, import_smithy_client5.getDefaultExtensionConfiguration)(runtimeConfig)), + ...asPartial((0, import_smithy_client4.getDefaultExtensionConfiguration)(runtimeConfig)), ...asPartial((0, import_protocol_http8.getHttpHandlerExtensionConfiguration)(runtimeConfig)), ...asPartial(getHttpAuthExtensionConfiguration(runtimeConfig)) }; @@ -19228,26 +14568,26 @@ var require_dist_cjs72 = __commonJS({ return { ...runtimeConfig, ...(0, import_region_config_resolver.resolveAwsRegionExtensionConfiguration)(extensionConfiguration), - ...(0, import_smithy_client5.resolveDefaultRuntimeConfig)(extensionConfiguration), + ...(0, import_smithy_client4.resolveDefaultRuntimeConfig)(extensionConfiguration), ...(0, import_protocol_http8.resolveHttpHandlerRuntimeConfig)(extensionConfiguration), ...resolveHttpAuthRuntimeConfig(extensionConfiguration) }; }, "resolveRuntimeExtensions"); - var _SSOOIDCClient = class _SSOOIDCClient extends import_smithy_client5.Client { + var _SSOOIDCClient = class _SSOOIDCClient extends import_smithy_client4.Client { constructor(...[configuration]) { const _config_0 = (0, import_runtimeConfig.getRuntimeConfig)(configuration || {}); const _config_1 = resolveClientEndpointParameters(_config_0); const _config_2 = (0, import_middleware_user_agent.resolveUserAgentConfig)(_config_1); - const _config_3 = (0, import_middleware_retry2.resolveRetryConfig)(_config_2); + const _config_3 = (0, import_middleware_retry.resolveRetryConfig)(_config_2); const _config_4 = (0, import_config_resolver.resolveRegionConfig)(_config_3); const _config_5 = (0, import_middleware_host_header.resolveHostHeaderConfig)(_config_4); - const _config_6 = (0, import_middleware_endpoint2.resolveEndpointConfig)(_config_5); + const _config_6 = (0, import_middleware_endpoint.resolveEndpointConfig)(_config_5); const _config_7 = (0, import_httpAuthSchemeProvider.resolveHttpAuthSchemeConfig)(_config_6); const _config_8 = resolveRuntimeExtensions(_config_7, (configuration == null ? void 0 : configuration.extensions) || []); super(_config_8); this.config = _config_8; this.middlewareStack.use((0, import_middleware_user_agent.getUserAgentPlugin)(this.config)); - this.middlewareStack.use((0, import_middleware_retry2.getRetryPlugin)(this.config)); + this.middlewareStack.use((0, import_middleware_retry.getRetryPlugin)(this.config)); this.middlewareStack.use((0, import_middleware_content_length.getContentLengthPlugin)(this.config)); this.middlewareStack.use((0, import_middleware_host_header.getHostHeaderPlugin)(this.config)); this.middlewareStack.use((0, import_middleware_logger.getLoggerPlugin)(this.config)); @@ -19273,8 +14613,8 @@ var require_dist_cjs72 = __commonJS({ }; __name(_SSOOIDCClient, "SSOOIDCClient"); var SSOOIDCClient = _SSOOIDCClient; - var import_middleware_serde2 = require_dist_cjs45(); - var _SSOOIDCServiceException = class _SSOOIDCServiceException2 extends import_smithy_client5.ServiceException { + var import_middleware_serde2 = require_dist_cjs12(); + var _SSOOIDCServiceException = class _SSOOIDCServiceException2 extends import_smithy_client4.ServiceException { /** * @internal */ @@ -19555,36 +14895,36 @@ var require_dist_cjs72 = __commonJS({ var InvalidRedirectUriException = _InvalidRedirectUriException; var CreateTokenRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.clientSecret && { clientSecret: import_smithy_client5.SENSITIVE_STRING }, - ...obj.refreshToken && { refreshToken: import_smithy_client5.SENSITIVE_STRING }, - ...obj.codeVerifier && { codeVerifier: import_smithy_client5.SENSITIVE_STRING } + ...obj.clientSecret && { clientSecret: import_smithy_client4.SENSITIVE_STRING }, + ...obj.refreshToken && { refreshToken: import_smithy_client4.SENSITIVE_STRING }, + ...obj.codeVerifier && { codeVerifier: import_smithy_client4.SENSITIVE_STRING } }), "CreateTokenRequestFilterSensitiveLog"); var CreateTokenResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.accessToken && { accessToken: import_smithy_client5.SENSITIVE_STRING }, - ...obj.refreshToken && { refreshToken: import_smithy_client5.SENSITIVE_STRING }, - ...obj.idToken && { idToken: import_smithy_client5.SENSITIVE_STRING } + ...obj.accessToken && { accessToken: import_smithy_client4.SENSITIVE_STRING }, + ...obj.refreshToken && { refreshToken: import_smithy_client4.SENSITIVE_STRING }, + ...obj.idToken && { idToken: import_smithy_client4.SENSITIVE_STRING } }), "CreateTokenResponseFilterSensitiveLog"); var CreateTokenWithIAMRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.refreshToken && { refreshToken: import_smithy_client5.SENSITIVE_STRING }, - ...obj.assertion && { assertion: import_smithy_client5.SENSITIVE_STRING }, - ...obj.subjectToken && { subjectToken: import_smithy_client5.SENSITIVE_STRING }, - ...obj.codeVerifier && { codeVerifier: import_smithy_client5.SENSITIVE_STRING } + ...obj.refreshToken && { refreshToken: import_smithy_client4.SENSITIVE_STRING }, + ...obj.assertion && { assertion: import_smithy_client4.SENSITIVE_STRING }, + ...obj.subjectToken && { subjectToken: import_smithy_client4.SENSITIVE_STRING }, + ...obj.codeVerifier && { codeVerifier: import_smithy_client4.SENSITIVE_STRING } }), "CreateTokenWithIAMRequestFilterSensitiveLog"); var CreateTokenWithIAMResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.accessToken && { accessToken: import_smithy_client5.SENSITIVE_STRING }, - ...obj.refreshToken && { refreshToken: import_smithy_client5.SENSITIVE_STRING }, - ...obj.idToken && { idToken: import_smithy_client5.SENSITIVE_STRING } + ...obj.accessToken && { accessToken: import_smithy_client4.SENSITIVE_STRING }, + ...obj.refreshToken && { refreshToken: import_smithy_client4.SENSITIVE_STRING }, + ...obj.idToken && { idToken: import_smithy_client4.SENSITIVE_STRING } }), "CreateTokenWithIAMResponseFilterSensitiveLog"); var RegisterClientResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.clientSecret && { clientSecret: import_smithy_client5.SENSITIVE_STRING } + ...obj.clientSecret && { clientSecret: import_smithy_client4.SENSITIVE_STRING } }), "RegisterClientResponseFilterSensitiveLog"); var StartDeviceAuthorizationRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.clientSecret && { clientSecret: import_smithy_client5.SENSITIVE_STRING } + ...obj.clientSecret && { clientSecret: import_smithy_client4.SENSITIVE_STRING } }), "StartDeviceAuthorizationRequestFilterSensitiveLog"); var import_core22 = (init_dist_es2(), __toCommonJS(dist_es_exports2)); var se_CreateTokenCommand = /* @__PURE__ */ __name(async (input, context) => { @@ -19595,7 +14935,7 @@ var require_dist_cjs72 = __commonJS({ b.bp("/token"); let body; body = JSON.stringify( - (0, import_smithy_client5.take)(input, { + (0, import_smithy_client4.take)(input, { clientId: [], clientSecret: [], code: [], @@ -19604,7 +14944,7 @@ var require_dist_cjs72 = __commonJS({ grantType: [], redirectUri: [], refreshToken: [], - scope: (_) => (0, import_smithy_client5._json)(_) + scope: (_) => (0, import_smithy_client4._json)(_) }) ); b.m("POST").h(headers).b(body); @@ -19616,12 +14956,12 @@ var require_dist_cjs72 = __commonJS({ "content-type": "application/json" }; b.bp("/token"); - const query = (0, import_smithy_client5.map)({ + const query = (0, import_smithy_client4.map)({ [_ai]: [, "t"] }); let body; body = JSON.stringify( - (0, import_smithy_client5.take)(input, { + (0, import_smithy_client4.take)(input, { assertion: [], clientId: [], code: [], @@ -19630,7 +14970,7 @@ var require_dist_cjs72 = __commonJS({ redirectUri: [], refreshToken: [], requestedTokenType: [], - scope: (_) => (0, import_smithy_client5._json)(_), + scope: (_) => (0, import_smithy_client4._json)(_), subjectToken: [], subjectTokenType: [] }) @@ -19646,14 +14986,14 @@ var require_dist_cjs72 = __commonJS({ b.bp("/client/register"); let body; body = JSON.stringify( - (0, import_smithy_client5.take)(input, { + (0, import_smithy_client4.take)(input, { clientName: [], clientType: [], entitledApplicationArn: [], - grantTypes: (_) => (0, import_smithy_client5._json)(_), + grantTypes: (_) => (0, import_smithy_client4._json)(_), issuerUrl: [], - redirectUris: (_) => (0, import_smithy_client5._json)(_), - scopes: (_) => (0, import_smithy_client5._json)(_) + redirectUris: (_) => (0, import_smithy_client4._json)(_), + scopes: (_) => (0, import_smithy_client4._json)(_) }) ); b.m("POST").h(headers).b(body); @@ -19667,7 +15007,7 @@ var require_dist_cjs72 = __commonJS({ b.bp("/device_authorization"); let body; body = JSON.stringify( - (0, import_smithy_client5.take)(input, { + (0, import_smithy_client4.take)(input, { clientId: [], clientSecret: [], startUrl: [] @@ -19680,16 +15020,16 @@ var require_dist_cjs72 = __commonJS({ if (output.statusCode !== 200 && output.statusCode >= 300) { return de_CommandError(output, context); } - const contents = (0, import_smithy_client5.map)({ + const contents = (0, import_smithy_client4.map)({ $metadata: deserializeMetadata(output) }); - const data = (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.expectObject)(await (0, import_core22.parseJsonBody)(output.body, context)), "body"); - const doc = (0, import_smithy_client5.take)(data, { - accessToken: import_smithy_client5.expectString, - expiresIn: import_smithy_client5.expectInt32, - idToken: import_smithy_client5.expectString, - refreshToken: import_smithy_client5.expectString, - tokenType: import_smithy_client5.expectString + const data = (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.expectObject)(await (0, import_core22.parseJsonBody)(output.body, context)), "body"); + const doc = (0, import_smithy_client4.take)(data, { + accessToken: import_smithy_client4.expectString, + expiresIn: import_smithy_client4.expectInt32, + idToken: import_smithy_client4.expectString, + refreshToken: import_smithy_client4.expectString, + tokenType: import_smithy_client4.expectString }); Object.assign(contents, doc); return contents; @@ -19698,18 +15038,18 @@ var require_dist_cjs72 = __commonJS({ if (output.statusCode !== 200 && output.statusCode >= 300) { return de_CommandError(output, context); } - const contents = (0, import_smithy_client5.map)({ + const contents = (0, import_smithy_client4.map)({ $metadata: deserializeMetadata(output) }); - const data = (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.expectObject)(await (0, import_core22.parseJsonBody)(output.body, context)), "body"); - const doc = (0, import_smithy_client5.take)(data, { - accessToken: import_smithy_client5.expectString, - expiresIn: import_smithy_client5.expectInt32, - idToken: import_smithy_client5.expectString, - issuedTokenType: import_smithy_client5.expectString, - refreshToken: import_smithy_client5.expectString, - scope: import_smithy_client5._json, - tokenType: import_smithy_client5.expectString + const data = (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.expectObject)(await (0, import_core22.parseJsonBody)(output.body, context)), "body"); + const doc = (0, import_smithy_client4.take)(data, { + accessToken: import_smithy_client4.expectString, + expiresIn: import_smithy_client4.expectInt32, + idToken: import_smithy_client4.expectString, + issuedTokenType: import_smithy_client4.expectString, + refreshToken: import_smithy_client4.expectString, + scope: import_smithy_client4._json, + tokenType: import_smithy_client4.expectString }); Object.assign(contents, doc); return contents; @@ -19718,17 +15058,17 @@ var require_dist_cjs72 = __commonJS({ if (output.statusCode !== 200 && output.statusCode >= 300) { return de_CommandError(output, context); } - const contents = (0, import_smithy_client5.map)({ + const contents = (0, import_smithy_client4.map)({ $metadata: deserializeMetadata(output) }); - const data = (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.expectObject)(await (0, import_core22.parseJsonBody)(output.body, context)), "body"); - const doc = (0, import_smithy_client5.take)(data, { - authorizationEndpoint: import_smithy_client5.expectString, - clientId: import_smithy_client5.expectString, - clientIdIssuedAt: import_smithy_client5.expectLong, - clientSecret: import_smithy_client5.expectString, - clientSecretExpiresAt: import_smithy_client5.expectLong, - tokenEndpoint: import_smithy_client5.expectString + const data = (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.expectObject)(await (0, import_core22.parseJsonBody)(output.body, context)), "body"); + const doc = (0, import_smithy_client4.take)(data, { + authorizationEndpoint: import_smithy_client4.expectString, + clientId: import_smithy_client4.expectString, + clientIdIssuedAt: import_smithy_client4.expectLong, + clientSecret: import_smithy_client4.expectString, + clientSecretExpiresAt: import_smithy_client4.expectLong, + tokenEndpoint: import_smithy_client4.expectString }); Object.assign(contents, doc); return contents; @@ -19737,17 +15077,17 @@ var require_dist_cjs72 = __commonJS({ if (output.statusCode !== 200 && output.statusCode >= 300) { return de_CommandError(output, context); } - const contents = (0, import_smithy_client5.map)({ + const contents = (0, import_smithy_client4.map)({ $metadata: deserializeMetadata(output) }); - const data = (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.expectObject)(await (0, import_core22.parseJsonBody)(output.body, context)), "body"); - const doc = (0, import_smithy_client5.take)(data, { - deviceCode: import_smithy_client5.expectString, - expiresIn: import_smithy_client5.expectInt32, - interval: import_smithy_client5.expectInt32, - userCode: import_smithy_client5.expectString, - verificationUri: import_smithy_client5.expectString, - verificationUriComplete: import_smithy_client5.expectString + const data = (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.expectObject)(await (0, import_core22.parseJsonBody)(output.body, context)), "body"); + const doc = (0, import_smithy_client4.take)(data, { + deviceCode: import_smithy_client4.expectString, + expiresIn: import_smithy_client4.expectInt32, + interval: import_smithy_client4.expectInt32, + userCode: import_smithy_client4.expectString, + verificationUri: import_smithy_client4.expectString, + verificationUriComplete: import_smithy_client4.expectString }); Object.assign(contents, doc); return contents; @@ -19810,204 +15150,204 @@ var require_dist_cjs72 = __commonJS({ }); } }, "de_CommandError"); - var throwDefaultError = (0, import_smithy_client5.withBaseException)(SSOOIDCServiceException); + var throwDefaultError = (0, import_smithy_client4.withBaseException)(SSOOIDCServiceException); var de_AccessDeniedExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); + const contents = (0, import_smithy_client4.map)({}); const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - error: import_smithy_client5.expectString, - error_description: import_smithy_client5.expectString + const doc = (0, import_smithy_client4.take)(data, { + error: import_smithy_client4.expectString, + error_description: import_smithy_client4.expectString }); Object.assign(contents, doc); const exception = new AccessDeniedException({ $metadata: deserializeMetadata(parsedOutput), ...contents }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); + return (0, import_smithy_client4.decorateServiceException)(exception, parsedOutput.body); }, "de_AccessDeniedExceptionRes"); var de_AuthorizationPendingExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); + const contents = (0, import_smithy_client4.map)({}); const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - error: import_smithy_client5.expectString, - error_description: import_smithy_client5.expectString + const doc = (0, import_smithy_client4.take)(data, { + error: import_smithy_client4.expectString, + error_description: import_smithy_client4.expectString }); Object.assign(contents, doc); const exception = new AuthorizationPendingException({ $metadata: deserializeMetadata(parsedOutput), ...contents }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); + return (0, import_smithy_client4.decorateServiceException)(exception, parsedOutput.body); }, "de_AuthorizationPendingExceptionRes"); var de_ExpiredTokenExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); + const contents = (0, import_smithy_client4.map)({}); const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - error: import_smithy_client5.expectString, - error_description: import_smithy_client5.expectString + const doc = (0, import_smithy_client4.take)(data, { + error: import_smithy_client4.expectString, + error_description: import_smithy_client4.expectString }); Object.assign(contents, doc); const exception = new ExpiredTokenException({ $metadata: deserializeMetadata(parsedOutput), ...contents }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); + return (0, import_smithy_client4.decorateServiceException)(exception, parsedOutput.body); }, "de_ExpiredTokenExceptionRes"); var de_InternalServerExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); + const contents = (0, import_smithy_client4.map)({}); const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - error: import_smithy_client5.expectString, - error_description: import_smithy_client5.expectString + const doc = (0, import_smithy_client4.take)(data, { + error: import_smithy_client4.expectString, + error_description: import_smithy_client4.expectString }); Object.assign(contents, doc); const exception = new InternalServerException({ $metadata: deserializeMetadata(parsedOutput), ...contents }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); + return (0, import_smithy_client4.decorateServiceException)(exception, parsedOutput.body); }, "de_InternalServerExceptionRes"); var de_InvalidClientExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); + const contents = (0, import_smithy_client4.map)({}); const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - error: import_smithy_client5.expectString, - error_description: import_smithy_client5.expectString + const doc = (0, import_smithy_client4.take)(data, { + error: import_smithy_client4.expectString, + error_description: import_smithy_client4.expectString }); Object.assign(contents, doc); const exception = new InvalidClientException({ $metadata: deserializeMetadata(parsedOutput), ...contents }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); + return (0, import_smithy_client4.decorateServiceException)(exception, parsedOutput.body); }, "de_InvalidClientExceptionRes"); var de_InvalidClientMetadataExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); + const contents = (0, import_smithy_client4.map)({}); const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - error: import_smithy_client5.expectString, - error_description: import_smithy_client5.expectString + const doc = (0, import_smithy_client4.take)(data, { + error: import_smithy_client4.expectString, + error_description: import_smithy_client4.expectString }); Object.assign(contents, doc); const exception = new InvalidClientMetadataException({ $metadata: deserializeMetadata(parsedOutput), ...contents }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); + return (0, import_smithy_client4.decorateServiceException)(exception, parsedOutput.body); }, "de_InvalidClientMetadataExceptionRes"); var de_InvalidGrantExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); + const contents = (0, import_smithy_client4.map)({}); const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - error: import_smithy_client5.expectString, - error_description: import_smithy_client5.expectString + const doc = (0, import_smithy_client4.take)(data, { + error: import_smithy_client4.expectString, + error_description: import_smithy_client4.expectString }); Object.assign(contents, doc); const exception = new InvalidGrantException({ $metadata: deserializeMetadata(parsedOutput), ...contents }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); + return (0, import_smithy_client4.decorateServiceException)(exception, parsedOutput.body); }, "de_InvalidGrantExceptionRes"); var de_InvalidRedirectUriExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); + const contents = (0, import_smithy_client4.map)({}); const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - error: import_smithy_client5.expectString, - error_description: import_smithy_client5.expectString + const doc = (0, import_smithy_client4.take)(data, { + error: import_smithy_client4.expectString, + error_description: import_smithy_client4.expectString }); Object.assign(contents, doc); const exception = new InvalidRedirectUriException({ $metadata: deserializeMetadata(parsedOutput), ...contents }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); + return (0, import_smithy_client4.decorateServiceException)(exception, parsedOutput.body); }, "de_InvalidRedirectUriExceptionRes"); var de_InvalidRequestExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); + const contents = (0, import_smithy_client4.map)({}); const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - error: import_smithy_client5.expectString, - error_description: import_smithy_client5.expectString + const doc = (0, import_smithy_client4.take)(data, { + error: import_smithy_client4.expectString, + error_description: import_smithy_client4.expectString }); Object.assign(contents, doc); const exception = new InvalidRequestException({ $metadata: deserializeMetadata(parsedOutput), ...contents }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); + return (0, import_smithy_client4.decorateServiceException)(exception, parsedOutput.body); }, "de_InvalidRequestExceptionRes"); var de_InvalidRequestRegionExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); + const contents = (0, import_smithy_client4.map)({}); const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - endpoint: import_smithy_client5.expectString, - error: import_smithy_client5.expectString, - error_description: import_smithy_client5.expectString, - region: import_smithy_client5.expectString + const doc = (0, import_smithy_client4.take)(data, { + endpoint: import_smithy_client4.expectString, + error: import_smithy_client4.expectString, + error_description: import_smithy_client4.expectString, + region: import_smithy_client4.expectString }); Object.assign(contents, doc); const exception = new InvalidRequestRegionException({ $metadata: deserializeMetadata(parsedOutput), ...contents }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); + return (0, import_smithy_client4.decorateServiceException)(exception, parsedOutput.body); }, "de_InvalidRequestRegionExceptionRes"); var de_InvalidScopeExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); + const contents = (0, import_smithy_client4.map)({}); const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - error: import_smithy_client5.expectString, - error_description: import_smithy_client5.expectString + const doc = (0, import_smithy_client4.take)(data, { + error: import_smithy_client4.expectString, + error_description: import_smithy_client4.expectString }); Object.assign(contents, doc); const exception = new InvalidScopeException({ $metadata: deserializeMetadata(parsedOutput), ...contents }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); + return (0, import_smithy_client4.decorateServiceException)(exception, parsedOutput.body); }, "de_InvalidScopeExceptionRes"); var de_SlowDownExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); + const contents = (0, import_smithy_client4.map)({}); const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - error: import_smithy_client5.expectString, - error_description: import_smithy_client5.expectString + const doc = (0, import_smithy_client4.take)(data, { + error: import_smithy_client4.expectString, + error_description: import_smithy_client4.expectString }); Object.assign(contents, doc); const exception = new SlowDownException({ $metadata: deserializeMetadata(parsedOutput), ...contents }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); + return (0, import_smithy_client4.decorateServiceException)(exception, parsedOutput.body); }, "de_SlowDownExceptionRes"); var de_UnauthorizedClientExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); + const contents = (0, import_smithy_client4.map)({}); const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - error: import_smithy_client5.expectString, - error_description: import_smithy_client5.expectString + const doc = (0, import_smithy_client4.take)(data, { + error: import_smithy_client4.expectString, + error_description: import_smithy_client4.expectString }); Object.assign(contents, doc); const exception = new UnauthorizedClientException({ $metadata: deserializeMetadata(parsedOutput), ...contents }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); + return (0, import_smithy_client4.decorateServiceException)(exception, parsedOutput.body); }, "de_UnauthorizedClientExceptionRes"); var de_UnsupportedGrantTypeExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); + const contents = (0, import_smithy_client4.map)({}); const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - error: import_smithy_client5.expectString, - error_description: import_smithy_client5.expectString + const doc = (0, import_smithy_client4.take)(data, { + error: import_smithy_client4.expectString, + error_description: import_smithy_client4.expectString }); Object.assign(contents, doc); const exception = new UnsupportedGrantTypeException({ $metadata: deserializeMetadata(parsedOutput), ...contents }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); + return (0, import_smithy_client4.decorateServiceException)(exception, parsedOutput.body); }, "de_UnsupportedGrantTypeExceptionRes"); var deserializeMetadata = /* @__PURE__ */ __name((output) => ({ httpStatusCode: output.statusCode, @@ -20016,45 +15356,45 @@ var require_dist_cjs72 = __commonJS({ cfId: output.headers["x-amz-cf-id"] }), "deserializeMetadata"); var _ai = "aws_iam"; - var _CreateTokenCommand = class _CreateTokenCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _CreateTokenCommand = class _CreateTokenCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSSSOOIDCService", "CreateToken", {}).n("SSOOIDCClient", "CreateTokenCommand").f(CreateTokenRequestFilterSensitiveLog, CreateTokenResponseFilterSensitiveLog).ser(se_CreateTokenCommand).de(de_CreateTokenCommand).build() { }; __name(_CreateTokenCommand, "CreateTokenCommand"); var CreateTokenCommand = _CreateTokenCommand; - var _CreateTokenWithIAMCommand = class _CreateTokenWithIAMCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _CreateTokenWithIAMCommand = class _CreateTokenWithIAMCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSSSOOIDCService", "CreateTokenWithIAM", {}).n("SSOOIDCClient", "CreateTokenWithIAMCommand").f(CreateTokenWithIAMRequestFilterSensitiveLog, CreateTokenWithIAMResponseFilterSensitiveLog).ser(se_CreateTokenWithIAMCommand).de(de_CreateTokenWithIAMCommand).build() { }; __name(_CreateTokenWithIAMCommand, "CreateTokenWithIAMCommand"); var CreateTokenWithIAMCommand = _CreateTokenWithIAMCommand; - var _RegisterClientCommand = class _RegisterClientCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _RegisterClientCommand = class _RegisterClientCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSSSOOIDCService", "RegisterClient", {}).n("SSOOIDCClient", "RegisterClientCommand").f(void 0, RegisterClientResponseFilterSensitiveLog).ser(se_RegisterClientCommand).de(de_RegisterClientCommand).build() { }; __name(_RegisterClientCommand, "RegisterClientCommand"); var RegisterClientCommand = _RegisterClientCommand; - var _StartDeviceAuthorizationCommand = class _StartDeviceAuthorizationCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _StartDeviceAuthorizationCommand = class _StartDeviceAuthorizationCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSSSOOIDCService", "StartDeviceAuthorization", {}).n("SSOOIDCClient", "StartDeviceAuthorizationCommand").f(StartDeviceAuthorizationRequestFilterSensitiveLog, void 0).ser(se_StartDeviceAuthorizationCommand).de(de_StartDeviceAuthorizationCommand).build() { }; @@ -20070,12 +15410,12 @@ var require_dist_cjs72 = __commonJS({ }; __name(_SSOOIDC, "SSOOIDC"); var SSOOIDC = _SSOOIDC; - (0, import_smithy_client5.createAggregatedClient)(commands, SSOOIDC); + (0, import_smithy_client4.createAggregatedClient)(commands, SSOOIDC); } }); // ../../../node_modules/@aws-sdk/token-providers/dist-cjs/index.js -var require_dist_cjs73 = __commonJS({ +var require_dist_cjs46 = __commonJS({ "../../../node_modules/@aws-sdk/token-providers/dist-cjs/index.js"(exports2, module2) { "use strict"; var __create2 = Object.create; @@ -20117,7 +15457,7 @@ var require_dist_cjs73 = __commonJS({ var REFRESH_MESSAGE = `To refresh this SSO session run 'aws sso login' with the corresponding profile.`; var ssoOidcClientsHash = {}; var getSsoOidcClient = /* @__PURE__ */ __name(async (ssoRegion) => { - const { SSOOIDCClient } = await Promise.resolve().then(() => __toESM2(require_dist_cjs72())); + const { SSOOIDCClient } = await Promise.resolve().then(() => __toESM2(require_dist_cjs45())); if (ssoOidcClientsHash[ssoRegion]) { return ssoOidcClientsHash[ssoRegion]; } @@ -20126,7 +15466,7 @@ var require_dist_cjs73 = __commonJS({ return ssoOidcClient; }, "getSsoOidcClient"); var getNewSsoOidcToken = /* @__PURE__ */ __name(async (ssoToken, ssoRegion) => { - const { CreateTokenCommand } = await Promise.resolve().then(() => __toESM2(require_dist_cjs72())); + const { CreateTokenCommand } = await Promise.resolve().then(() => __toESM2(require_dist_cjs45())); const ssoOidcClient = await getSsoOidcClient(ssoRegion); return ssoOidcClient.send( new CreateTokenCommand({ @@ -20137,7 +15477,7 @@ var require_dist_cjs73 = __commonJS({ }) ); }, "getNewSsoOidcToken"); - var import_property_provider2 = require_dist_cjs40(); + var import_property_provider2 = require_dist_cjs24(); var validateTokenExpiry = /* @__PURE__ */ __name((token) => { if (token.expiration && token.expiration.getTime() < Date.now()) { throw new import_property_provider2.TokenProviderError(`Token is expired. ${REFRESH_MESSAGE}`, false); @@ -20151,7 +15491,7 @@ var require_dist_cjs73 = __commonJS({ ); } }, "validateTokenKey"); - var import_shared_ini_file_loader = require_dist_cjs41(); + var import_shared_ini_file_loader = require_dist_cjs25(); var import_fs = require("fs"); var { writeFile } = import_fs.promises; var writeSSOTokenToFile = /* @__PURE__ */ __name((id, ssoToken) => { @@ -20255,7 +15595,7 @@ var require_dist_cjs73 = __commonJS({ }); // ../../../node_modules/@aws-sdk/credential-provider-sso/dist-cjs/index.js -var require_dist_cjs74 = __commonJS({ +var require_dist_cjs47 = __commonJS({ "../../../node_modules/@aws-sdk/credential-provider-sso/dist-cjs/index.js"(exports2, module2) { "use strict"; var __defProp2 = Object.defineProperty; @@ -20288,7 +15628,7 @@ var require_dist_cjs74 = __commonJS({ var init_loadSso = __esm2({ "src/loadSso.ts"() { "use strict"; - import_client_sso = require_dist_cjs71(); + import_client_sso = require_dist_cjs44(); } }); var src_exports = {}; @@ -20299,9 +15639,9 @@ var require_dist_cjs74 = __commonJS({ }); module2.exports = __toCommonJS2(src_exports); var isSsoProfile = /* @__PURE__ */ __name((arg) => arg && (typeof arg.sso_start_url === "string" || typeof arg.sso_account_id === "string" || typeof arg.sso_session === "string" || typeof arg.sso_region === "string" || typeof arg.sso_role_name === "string"), "isSsoProfile"); - var import_token_providers = require_dist_cjs73(); - var import_property_provider2 = require_dist_cjs40(); - var import_shared_ini_file_loader = require_dist_cjs41(); + var import_token_providers = require_dist_cjs46(); + var import_property_provider2 = require_dist_cjs24(); + var import_shared_ini_file_loader = require_dist_cjs25(); var SHOULD_FAIL_CREDENTIAL_CHAIN = false; var resolveSSOCredentials = /* @__PURE__ */ __name(async ({ ssoStartUrl, @@ -20750,10 +16090,10 @@ var require_runtimeConfig_shared3 = __commonJS({ exports2.getRuntimeConfig = void 0; var core_1 = (init_dist_es2(), __toCommonJS(dist_es_exports2)); var core_2 = (init_dist_es(), __toCommonJS(dist_es_exports)); - var smithy_client_1 = require_dist_cjs37(); - var url_parser_1 = require_dist_cjs44(); - var util_base64_1 = require_dist_cjs29(); - var util_utf8_1 = require_dist_cjs28(); + var smithy_client_1 = require_dist_cjs33(); + var url_parser_1 = require_dist_cjs28(); + var util_base64_1 = require_dist_cjs16(); + var util_utf8_1 = require_dist_cjs15(); var httpAuthSchemeProvider_1 = require_httpAuthSchemeProvider4(); var endpointResolver_1 = require_endpointResolver3(); var getRuntimeConfig = (config) => { @@ -20797,20 +16137,20 @@ var require_runtimeConfig3 = __commonJS({ var tslib_1 = (init_tslib_es6(), __toCommonJS(tslib_es6_exports)); var package_json_1 = tslib_1.__importDefault(require_package4()); var core_1 = (init_dist_es2(), __toCommonJS(dist_es_exports2)); - var credential_provider_node_1 = require_dist_cjs79(); - var util_user_agent_node_1 = require_dist_cjs56(); + var credential_provider_node_1 = require_dist_cjs52(); + var util_user_agent_node_1 = require_dist_cjs39(); var config_resolver_1 = require_dist_cjs11(); var core_2 = (init_dist_es(), __toCommonJS(dist_es_exports)); - var hash_node_1 = require_dist_cjs57(); - var middleware_retry_1 = require_dist_cjs38(); - var node_config_provider_1 = require_dist_cjs42(); - var node_http_handler_1 = require_dist_cjs51(); - var util_body_length_node_1 = require_dist_cjs58(); - var util_retry_1 = require_dist_cjs60(); + var hash_node_1 = require_dist_cjs40(); + var middleware_retry_1 = require_dist_cjs34(); + var node_config_provider_1 = require_dist_cjs26(); + var node_http_handler_1 = require_dist_cjs19(); + var util_body_length_node_1 = require_dist_cjs41(); + var util_retry_1 = require_dist_cjs31(); var runtimeConfig_shared_1 = require_runtimeConfig_shared3(); - var smithy_client_1 = require_dist_cjs37(); - var util_defaults_mode_node_1 = require_dist_cjs69(); - var smithy_client_2 = require_dist_cjs37(); + var smithy_client_1 = require_dist_cjs33(); + var util_defaults_mode_node_1 = require_dist_cjs42(); + var smithy_client_2 = require_dist_cjs33(); var getRuntimeConfig = (config) => { (0, smithy_client_2.emitWarningIfUnsupportedVersion)(process.version); const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config); @@ -20908,9 +16248,9 @@ var require_runtimeExtensions = __commonJS({ "use strict"; Object.defineProperty(exports2, "__esModule", { value: true }); exports2.resolveRuntimeExtensions = void 0; - var region_config_resolver_1 = require_dist_cjs70(); + var region_config_resolver_1 = require_dist_cjs43(); var protocol_http_1 = require_dist_cjs2(); - var smithy_client_1 = require_dist_cjs37(); + var smithy_client_1 = require_dist_cjs33(); var httpAuthExtensionConfiguration_1 = require_httpAuthExtensionConfiguration(); var asPartial = (t) => t; var resolveRuntimeExtensions = (runtimeConfig, extensions) => { @@ -20945,10 +16285,10 @@ var require_STSClient = __commonJS({ var middleware_user_agent_1 = require_dist_cjs8(); var config_resolver_1 = require_dist_cjs11(); var core_1 = (init_dist_es(), __toCommonJS(dist_es_exports)); - var middleware_content_length_1 = require_dist_cjs39(); - var middleware_endpoint_1 = require_dist_cjs46(); - var middleware_retry_1 = require_dist_cjs38(); - var smithy_client_1 = require_dist_cjs37(); + var middleware_content_length_1 = require_dist_cjs23(); + var middleware_endpoint_1 = require_dist_cjs29(); + var middleware_retry_1 = require_dist_cjs34(); + var smithy_client_1 = require_dist_cjs33(); Object.defineProperty(exports2, "__Client", { enumerable: true, get: function() { return smithy_client_1.Client; } }); @@ -20992,7 +16332,7 @@ var require_STSClient = __commonJS({ }); // ../../../node_modules/@aws-sdk/client-sts/dist-cjs/index.js -var require_dist_cjs75 = __commonJS({ +var require_dist_cjs48 = __commonJS({ "../../../node_modules/@aws-sdk/client-sts/dist-cjs/index.js"(exports2, module2) { "use strict"; var __defProp2 = Object.defineProperty; @@ -21049,11 +16389,11 @@ var require_dist_cjs75 = __commonJS({ }); module2.exports = __toCommonJS2(src_exports); __reExport(src_exports, require_STSClient(), module2.exports); - var import_middleware_endpoint2 = require_dist_cjs46(); - var import_middleware_serde2 = require_dist_cjs45(); + var import_middleware_endpoint = require_dist_cjs29(); + var import_middleware_serde2 = require_dist_cjs12(); var import_EndpointParameters = require_EndpointParameters(); - var import_smithy_client5 = require_dist_cjs37(); - var _STSServiceException = class _STSServiceException2 extends import_smithy_client5.ServiceException { + var import_smithy_client4 = require_dist_cjs33(); + var _STSServiceException = class _STSServiceException2 extends import_smithy_client4.ServiceException { /** * @internal */ @@ -21202,7 +16542,7 @@ var require_dist_cjs75 = __commonJS({ var InvalidAuthorizationMessageException = _InvalidAuthorizationMessageException; var CredentialsFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.SecretAccessKey && { SecretAccessKey: import_smithy_client5.SENSITIVE_STRING } + ...obj.SecretAccessKey && { SecretAccessKey: import_smithy_client4.SENSITIVE_STRING } }), "CredentialsFilterSensitiveLog"); var AssumeRoleResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, @@ -21210,7 +16550,7 @@ var require_dist_cjs75 = __commonJS({ }), "AssumeRoleResponseFilterSensitiveLog"); var AssumeRoleWithSAMLRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.SAMLAssertion && { SAMLAssertion: import_smithy_client5.SENSITIVE_STRING } + ...obj.SAMLAssertion && { SAMLAssertion: import_smithy_client4.SENSITIVE_STRING } }), "AssumeRoleWithSAMLRequestFilterSensitiveLog"); var AssumeRoleWithSAMLResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, @@ -21218,7 +16558,7 @@ var require_dist_cjs75 = __commonJS({ }), "AssumeRoleWithSAMLResponseFilterSensitiveLog"); var AssumeRoleWithWebIdentityRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.WebIdentityToken && { WebIdentityToken: import_smithy_client5.SENSITIVE_STRING } + ...obj.WebIdentityToken && { WebIdentityToken: import_smithy_client4.SENSITIVE_STRING } }), "AssumeRoleWithWebIdentityRequestFilterSensitiveLog"); var AssumeRoleWithWebIdentityResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, @@ -21465,7 +16805,7 @@ var require_dist_cjs75 = __commonJS({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_ExpiredTokenExceptionRes"); var de_IDPCommunicationErrorExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; @@ -21474,7 +16814,7 @@ var require_dist_cjs75 = __commonJS({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_IDPCommunicationErrorExceptionRes"); var de_IDPRejectedClaimExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; @@ -21483,7 +16823,7 @@ var require_dist_cjs75 = __commonJS({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_IDPRejectedClaimExceptionRes"); var de_InvalidAuthorizationMessageExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; @@ -21492,7 +16832,7 @@ var require_dist_cjs75 = __commonJS({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_InvalidAuthorizationMessageExceptionRes"); var de_InvalidIdentityTokenExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; @@ -21501,7 +16841,7 @@ var require_dist_cjs75 = __commonJS({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_InvalidIdentityTokenExceptionRes"); var de_MalformedPolicyDocumentExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; @@ -21510,7 +16850,7 @@ var require_dist_cjs75 = __commonJS({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_MalformedPolicyDocumentExceptionRes"); var de_PackedPolicyTooLargeExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; @@ -21519,7 +16859,7 @@ var require_dist_cjs75 = __commonJS({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_PackedPolicyTooLargeExceptionRes"); var de_RegionDisabledExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; @@ -21528,7 +16868,7 @@ var require_dist_cjs75 = __commonJS({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_RegionDisabledExceptionRes"); var se_AssumeRoleRequest = /* @__PURE__ */ __name((input, context) => { var _a2, _b, _c, _d; @@ -21814,10 +17154,10 @@ var require_dist_cjs75 = __commonJS({ var de_AssumedRoleUser = /* @__PURE__ */ __name((output, context) => { const contents = {}; if (output[_ARI] != null) { - contents[_ARI] = (0, import_smithy_client5.expectString)(output[_ARI]); + contents[_ARI] = (0, import_smithy_client4.expectString)(output[_ARI]); } if (output[_Ar] != null) { - contents[_Ar] = (0, import_smithy_client5.expectString)(output[_Ar]); + contents[_Ar] = (0, import_smithy_client4.expectString)(output[_Ar]); } return contents; }, "de_AssumedRoleUser"); @@ -21830,10 +17170,10 @@ var require_dist_cjs75 = __commonJS({ contents[_ARU] = de_AssumedRoleUser(output[_ARU], context); } if (output[_PPS] != null) { - contents[_PPS] = (0, import_smithy_client5.strictParseInt32)(output[_PPS]); + contents[_PPS] = (0, import_smithy_client4.strictParseInt32)(output[_PPS]); } if (output[_SI] != null) { - contents[_SI] = (0, import_smithy_client5.expectString)(output[_SI]); + contents[_SI] = (0, import_smithy_client4.expectString)(output[_SI]); } return contents; }, "de_AssumeRoleResponse"); @@ -21846,25 +17186,25 @@ var require_dist_cjs75 = __commonJS({ contents[_ARU] = de_AssumedRoleUser(output[_ARU], context); } if (output[_PPS] != null) { - contents[_PPS] = (0, import_smithy_client5.strictParseInt32)(output[_PPS]); + contents[_PPS] = (0, import_smithy_client4.strictParseInt32)(output[_PPS]); } if (output[_S] != null) { - contents[_S] = (0, import_smithy_client5.expectString)(output[_S]); + contents[_S] = (0, import_smithy_client4.expectString)(output[_S]); } if (output[_ST] != null) { - contents[_ST] = (0, import_smithy_client5.expectString)(output[_ST]); + contents[_ST] = (0, import_smithy_client4.expectString)(output[_ST]); } if (output[_I] != null) { - contents[_I] = (0, import_smithy_client5.expectString)(output[_I]); + contents[_I] = (0, import_smithy_client4.expectString)(output[_I]); } if (output[_Au] != null) { - contents[_Au] = (0, import_smithy_client5.expectString)(output[_Au]); + contents[_Au] = (0, import_smithy_client4.expectString)(output[_Au]); } if (output[_NQ] != null) { - contents[_NQ] = (0, import_smithy_client5.expectString)(output[_NQ]); + contents[_NQ] = (0, import_smithy_client4.expectString)(output[_NQ]); } if (output[_SI] != null) { - contents[_SI] = (0, import_smithy_client5.expectString)(output[_SI]); + contents[_SI] = (0, import_smithy_client4.expectString)(output[_SI]); } return contents; }, "de_AssumeRoleWithSAMLResponse"); @@ -21874,82 +17214,82 @@ var require_dist_cjs75 = __commonJS({ contents[_C] = de_Credentials(output[_C], context); } if (output[_SFWIT] != null) { - contents[_SFWIT] = (0, import_smithy_client5.expectString)(output[_SFWIT]); + contents[_SFWIT] = (0, import_smithy_client4.expectString)(output[_SFWIT]); } if (output[_ARU] != null) { contents[_ARU] = de_AssumedRoleUser(output[_ARU], context); } if (output[_PPS] != null) { - contents[_PPS] = (0, import_smithy_client5.strictParseInt32)(output[_PPS]); + contents[_PPS] = (0, import_smithy_client4.strictParseInt32)(output[_PPS]); } if (output[_Pr] != null) { - contents[_Pr] = (0, import_smithy_client5.expectString)(output[_Pr]); + contents[_Pr] = (0, import_smithy_client4.expectString)(output[_Pr]); } if (output[_Au] != null) { - contents[_Au] = (0, import_smithy_client5.expectString)(output[_Au]); + contents[_Au] = (0, import_smithy_client4.expectString)(output[_Au]); } if (output[_SI] != null) { - contents[_SI] = (0, import_smithy_client5.expectString)(output[_SI]); + contents[_SI] = (0, import_smithy_client4.expectString)(output[_SI]); } return contents; }, "de_AssumeRoleWithWebIdentityResponse"); var de_Credentials = /* @__PURE__ */ __name((output, context) => { const contents = {}; if (output[_AKI] != null) { - contents[_AKI] = (0, import_smithy_client5.expectString)(output[_AKI]); + contents[_AKI] = (0, import_smithy_client4.expectString)(output[_AKI]); } if (output[_SAK] != null) { - contents[_SAK] = (0, import_smithy_client5.expectString)(output[_SAK]); + contents[_SAK] = (0, import_smithy_client4.expectString)(output[_SAK]); } if (output[_STe] != null) { - contents[_STe] = (0, import_smithy_client5.expectString)(output[_STe]); + contents[_STe] = (0, import_smithy_client4.expectString)(output[_STe]); } if (output[_E] != null) { - contents[_E] = (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseRfc3339DateTimeWithOffset)(output[_E])); + contents[_E] = (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.parseRfc3339DateTimeWithOffset)(output[_E])); } return contents; }, "de_Credentials"); var de_DecodeAuthorizationMessageResponse = /* @__PURE__ */ __name((output, context) => { const contents = {}; if (output[_DM] != null) { - contents[_DM] = (0, import_smithy_client5.expectString)(output[_DM]); + contents[_DM] = (0, import_smithy_client4.expectString)(output[_DM]); } return contents; }, "de_DecodeAuthorizationMessageResponse"); var de_ExpiredTokenException = /* @__PURE__ */ __name((output, context) => { const contents = {}; if (output[_m] != null) { - contents[_m] = (0, import_smithy_client5.expectString)(output[_m]); + contents[_m] = (0, import_smithy_client4.expectString)(output[_m]); } return contents; }, "de_ExpiredTokenException"); var de_FederatedUser = /* @__PURE__ */ __name((output, context) => { const contents = {}; if (output[_FUI] != null) { - contents[_FUI] = (0, import_smithy_client5.expectString)(output[_FUI]); + contents[_FUI] = (0, import_smithy_client4.expectString)(output[_FUI]); } if (output[_Ar] != null) { - contents[_Ar] = (0, import_smithy_client5.expectString)(output[_Ar]); + contents[_Ar] = (0, import_smithy_client4.expectString)(output[_Ar]); } return contents; }, "de_FederatedUser"); var de_GetAccessKeyInfoResponse = /* @__PURE__ */ __name((output, context) => { const contents = {}; if (output[_Ac] != null) { - contents[_Ac] = (0, import_smithy_client5.expectString)(output[_Ac]); + contents[_Ac] = (0, import_smithy_client4.expectString)(output[_Ac]); } return contents; }, "de_GetAccessKeyInfoResponse"); var de_GetCallerIdentityResponse = /* @__PURE__ */ __name((output, context) => { const contents = {}; if (output[_UI] != null) { - contents[_UI] = (0, import_smithy_client5.expectString)(output[_UI]); + contents[_UI] = (0, import_smithy_client4.expectString)(output[_UI]); } if (output[_Ac] != null) { - contents[_Ac] = (0, import_smithy_client5.expectString)(output[_Ac]); + contents[_Ac] = (0, import_smithy_client4.expectString)(output[_Ac]); } if (output[_Ar] != null) { - contents[_Ar] = (0, import_smithy_client5.expectString)(output[_Ar]); + contents[_Ar] = (0, import_smithy_client4.expectString)(output[_Ar]); } return contents; }, "de_GetCallerIdentityResponse"); @@ -21962,7 +17302,7 @@ var require_dist_cjs75 = __commonJS({ contents[_FU] = de_FederatedUser(output[_FU], context); } if (output[_PPS] != null) { - contents[_PPS] = (0, import_smithy_client5.strictParseInt32)(output[_PPS]); + contents[_PPS] = (0, import_smithy_client4.strictParseInt32)(output[_PPS]); } return contents; }, "de_GetFederationTokenResponse"); @@ -21976,49 +17316,49 @@ var require_dist_cjs75 = __commonJS({ var de_IDPCommunicationErrorException = /* @__PURE__ */ __name((output, context) => { const contents = {}; if (output[_m] != null) { - contents[_m] = (0, import_smithy_client5.expectString)(output[_m]); + contents[_m] = (0, import_smithy_client4.expectString)(output[_m]); } return contents; }, "de_IDPCommunicationErrorException"); var de_IDPRejectedClaimException = /* @__PURE__ */ __name((output, context) => { const contents = {}; if (output[_m] != null) { - contents[_m] = (0, import_smithy_client5.expectString)(output[_m]); + contents[_m] = (0, import_smithy_client4.expectString)(output[_m]); } return contents; }, "de_IDPRejectedClaimException"); var de_InvalidAuthorizationMessageException = /* @__PURE__ */ __name((output, context) => { const contents = {}; if (output[_m] != null) { - contents[_m] = (0, import_smithy_client5.expectString)(output[_m]); + contents[_m] = (0, import_smithy_client4.expectString)(output[_m]); } return contents; }, "de_InvalidAuthorizationMessageException"); var de_InvalidIdentityTokenException = /* @__PURE__ */ __name((output, context) => { const contents = {}; if (output[_m] != null) { - contents[_m] = (0, import_smithy_client5.expectString)(output[_m]); + contents[_m] = (0, import_smithy_client4.expectString)(output[_m]); } return contents; }, "de_InvalidIdentityTokenException"); var de_MalformedPolicyDocumentException = /* @__PURE__ */ __name((output, context) => { const contents = {}; if (output[_m] != null) { - contents[_m] = (0, import_smithy_client5.expectString)(output[_m]); + contents[_m] = (0, import_smithy_client4.expectString)(output[_m]); } return contents; }, "de_MalformedPolicyDocumentException"); var de_PackedPolicyTooLargeException = /* @__PURE__ */ __name((output, context) => { const contents = {}; if (output[_m] != null) { - contents[_m] = (0, import_smithy_client5.expectString)(output[_m]); + contents[_m] = (0, import_smithy_client4.expectString)(output[_m]); } return contents; }, "de_PackedPolicyTooLargeException"); var de_RegionDisabledException = /* @__PURE__ */ __name((output, context) => { const contents = {}; if (output[_m] != null) { - contents[_m] = (0, import_smithy_client5.expectString)(output[_m]); + contents[_m] = (0, import_smithy_client4.expectString)(output[_m]); } return contents; }, "de_RegionDisabledException"); @@ -22028,7 +17368,7 @@ var require_dist_cjs75 = __commonJS({ extendedRequestId: output.headers["x-amz-id-2"], cfId: output.headers["x-amz-cf-id"] }), "deserializeMetadata"); - var throwDefaultError = (0, import_smithy_client5.withBaseException)(STSServiceException); + var throwDefaultError = (0, import_smithy_client4.withBaseException)(STSServiceException); var buildHttpRpcRequest = /* @__PURE__ */ __name(async (context, headers, path, resolvedHostname, body) => { const { hostname, protocol = "https", port, path: basePath } = await context.endpoint(); const contents = { @@ -22106,7 +17446,7 @@ var require_dist_cjs75 = __commonJS({ var _WIT = "WebIdentityToken"; var _a = "arn"; var _m = "message"; - var buildFormUrlencodedString = /* @__PURE__ */ __name((formEntries) => Object.entries(formEntries).map(([key, value]) => (0, import_smithy_client5.extendedEncodeURIComponent)(key) + "=" + (0, import_smithy_client5.extendedEncodeURIComponent)(value)).join("&"), "buildFormUrlencodedString"); + var buildFormUrlencodedString = /* @__PURE__ */ __name((formEntries) => Object.entries(formEntries).map(([key, value]) => (0, import_smithy_client4.extendedEncodeURIComponent)(key) + "=" + (0, import_smithy_client4.extendedEncodeURIComponent)(value)).join("&"), "buildFormUrlencodedString"); var loadQueryErrorCode = /* @__PURE__ */ __name((output, data) => { var _a2; if (((_a2 = data.Error) == null ? void 0 : _a2.Code) !== void 0) { @@ -22116,96 +17456,96 @@ var require_dist_cjs75 = __commonJS({ return "NotFound"; } }, "loadQueryErrorCode"); - var _AssumeRoleCommand = class _AssumeRoleCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _AssumeRoleCommand = class _AssumeRoleCommand extends import_smithy_client4.Command.classBuilder().ep({ ...import_EndpointParameters.commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSSecurityTokenServiceV20110615", "AssumeRole", {}).n("STSClient", "AssumeRoleCommand").f(void 0, AssumeRoleResponseFilterSensitiveLog).ser(se_AssumeRoleCommand).de(de_AssumeRoleCommand).build() { }; __name(_AssumeRoleCommand, "AssumeRoleCommand"); var AssumeRoleCommand = _AssumeRoleCommand; var import_EndpointParameters2 = require_EndpointParameters(); - var _AssumeRoleWithSAMLCommand = class _AssumeRoleWithSAMLCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _AssumeRoleWithSAMLCommand = class _AssumeRoleWithSAMLCommand extends import_smithy_client4.Command.classBuilder().ep({ ...import_EndpointParameters2.commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSSecurityTokenServiceV20110615", "AssumeRoleWithSAML", {}).n("STSClient", "AssumeRoleWithSAMLCommand").f(AssumeRoleWithSAMLRequestFilterSensitiveLog, AssumeRoleWithSAMLResponseFilterSensitiveLog).ser(se_AssumeRoleWithSAMLCommand).de(de_AssumeRoleWithSAMLCommand).build() { }; __name(_AssumeRoleWithSAMLCommand, "AssumeRoleWithSAMLCommand"); var AssumeRoleWithSAMLCommand = _AssumeRoleWithSAMLCommand; var import_EndpointParameters3 = require_EndpointParameters(); - var _AssumeRoleWithWebIdentityCommand = class _AssumeRoleWithWebIdentityCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _AssumeRoleWithWebIdentityCommand = class _AssumeRoleWithWebIdentityCommand extends import_smithy_client4.Command.classBuilder().ep({ ...import_EndpointParameters3.commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSSecurityTokenServiceV20110615", "AssumeRoleWithWebIdentity", {}).n("STSClient", "AssumeRoleWithWebIdentityCommand").f(AssumeRoleWithWebIdentityRequestFilterSensitiveLog, AssumeRoleWithWebIdentityResponseFilterSensitiveLog).ser(se_AssumeRoleWithWebIdentityCommand).de(de_AssumeRoleWithWebIdentityCommand).build() { }; __name(_AssumeRoleWithWebIdentityCommand, "AssumeRoleWithWebIdentityCommand"); var AssumeRoleWithWebIdentityCommand = _AssumeRoleWithWebIdentityCommand; var import_EndpointParameters4 = require_EndpointParameters(); - var _DecodeAuthorizationMessageCommand = class _DecodeAuthorizationMessageCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _DecodeAuthorizationMessageCommand = class _DecodeAuthorizationMessageCommand extends import_smithy_client4.Command.classBuilder().ep({ ...import_EndpointParameters4.commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSSecurityTokenServiceV20110615", "DecodeAuthorizationMessage", {}).n("STSClient", "DecodeAuthorizationMessageCommand").f(void 0, void 0).ser(se_DecodeAuthorizationMessageCommand).de(de_DecodeAuthorizationMessageCommand).build() { }; __name(_DecodeAuthorizationMessageCommand, "DecodeAuthorizationMessageCommand"); var DecodeAuthorizationMessageCommand = _DecodeAuthorizationMessageCommand; var import_EndpointParameters5 = require_EndpointParameters(); - var _GetAccessKeyInfoCommand = class _GetAccessKeyInfoCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _GetAccessKeyInfoCommand = class _GetAccessKeyInfoCommand extends import_smithy_client4.Command.classBuilder().ep({ ...import_EndpointParameters5.commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSSecurityTokenServiceV20110615", "GetAccessKeyInfo", {}).n("STSClient", "GetAccessKeyInfoCommand").f(void 0, void 0).ser(se_GetAccessKeyInfoCommand).de(de_GetAccessKeyInfoCommand).build() { }; __name(_GetAccessKeyInfoCommand, "GetAccessKeyInfoCommand"); var GetAccessKeyInfoCommand = _GetAccessKeyInfoCommand; var import_EndpointParameters6 = require_EndpointParameters(); - var _GetCallerIdentityCommand = class _GetCallerIdentityCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _GetCallerIdentityCommand = class _GetCallerIdentityCommand extends import_smithy_client4.Command.classBuilder().ep({ ...import_EndpointParameters6.commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSSecurityTokenServiceV20110615", "GetCallerIdentity", {}).n("STSClient", "GetCallerIdentityCommand").f(void 0, void 0).ser(se_GetCallerIdentityCommand).de(de_GetCallerIdentityCommand).build() { }; __name(_GetCallerIdentityCommand, "GetCallerIdentityCommand"); var GetCallerIdentityCommand = _GetCallerIdentityCommand; var import_EndpointParameters7 = require_EndpointParameters(); - var _GetFederationTokenCommand = class _GetFederationTokenCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _GetFederationTokenCommand = class _GetFederationTokenCommand extends import_smithy_client4.Command.classBuilder().ep({ ...import_EndpointParameters7.commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSSecurityTokenServiceV20110615", "GetFederationToken", {}).n("STSClient", "GetFederationTokenCommand").f(void 0, GetFederationTokenResponseFilterSensitiveLog).ser(se_GetFederationTokenCommand).de(de_GetFederationTokenCommand).build() { }; __name(_GetFederationTokenCommand, "GetFederationTokenCommand"); var GetFederationTokenCommand = _GetFederationTokenCommand; var import_EndpointParameters8 = require_EndpointParameters(); - var _GetSessionTokenCommand = class _GetSessionTokenCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _GetSessionTokenCommand = class _GetSessionTokenCommand extends import_smithy_client4.Command.classBuilder().ep({ ...import_EndpointParameters8.commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSSecurityTokenServiceV20110615", "GetSessionToken", {}).n("STSClient", "GetSessionTokenCommand").f(void 0, GetSessionTokenResponseFilterSensitiveLog).ser(se_GetSessionTokenCommand).de(de_GetSessionTokenCommand).build() { }; @@ -22226,7 +17566,7 @@ var require_dist_cjs75 = __commonJS({ }; __name(_STS, "STS"); var STS = _STS; - (0, import_smithy_client5.createAggregatedClient)(commands, STS); + (0, import_smithy_client4.createAggregatedClient)(commands, STS); var import_EndpointParameters9 = require_EndpointParameters(); var ASSUME_ROLE_DEFAULT_REGION = "us-east-1"; var getAccountIdFromAssumedRoleUser = /* @__PURE__ */ __name((assumedRoleUser) => { @@ -22364,7 +17704,7 @@ var require_dist_cjs75 = __commonJS({ }); // ../../../node_modules/@aws-sdk/credential-provider-process/dist-cjs/index.js -var require_dist_cjs76 = __commonJS({ +var require_dist_cjs49 = __commonJS({ "../../../node_modules/@aws-sdk/credential-provider-process/dist-cjs/index.js"(exports2, module2) { "use strict"; var __defProp2 = Object.defineProperty; @@ -22390,8 +17730,8 @@ var require_dist_cjs76 = __commonJS({ fromProcess: () => fromProcess }); module2.exports = __toCommonJS2(src_exports); - var import_shared_ini_file_loader = require_dist_cjs41(); - var import_property_provider2 = require_dist_cjs40(); + var import_shared_ini_file_loader = require_dist_cjs25(); + var import_property_provider2 = require_dist_cjs24(); var import_child_process = require("child_process"); var import_util = require("util"); var getValidatedProcessCredentials = /* @__PURE__ */ __name((profileName, data, profiles) => { @@ -22496,7 +17836,7 @@ var require_fromWebToken = __commonJS({ const { roleArn, roleSessionName, webIdentityToken, providerId, policyArns, policy, durationSeconds } = init; let { roleAssumerWithWebIdentity } = init; if (!roleAssumerWithWebIdentity) { - const { getDefaultRoleAssumerWithWebIdentity } = await Promise.resolve().then(() => __importStar2(require_dist_cjs75())); + const { getDefaultRoleAssumerWithWebIdentity } = await Promise.resolve().then(() => __importStar2(require_dist_cjs48())); roleAssumerWithWebIdentity = getDefaultRoleAssumerWithWebIdentity({ ...init.clientConfig, credentialProviderLogger: init.logger, @@ -22523,7 +17863,7 @@ var require_fromTokenFile = __commonJS({ "use strict"; Object.defineProperty(exports2, "__esModule", { value: true }); exports2.fromTokenFile = void 0; - var property_provider_1 = require_dist_cjs40(); + var property_provider_1 = require_dist_cjs24(); var fs_1 = require("fs"); var fromWebToken_1 = require_fromWebToken(); var ENV_TOKEN_FILE = "AWS_WEB_IDENTITY_TOKEN_FILE"; @@ -22551,7 +17891,7 @@ var require_fromTokenFile = __commonJS({ }); // ../../../node_modules/@aws-sdk/credential-provider-web-identity/dist-cjs/index.js -var require_dist_cjs77 = __commonJS({ +var require_dist_cjs50 = __commonJS({ "../../../node_modules/@aws-sdk/credential-provider-web-identity/dist-cjs/index.js"(exports2, module2) { "use strict"; var __defProp2 = Object.defineProperty; @@ -22576,7 +17916,7 @@ var require_dist_cjs77 = __commonJS({ }); // ../../../node_modules/@aws-sdk/credential-provider-ini/dist-cjs/index.js -var require_dist_cjs78 = __commonJS({ +var require_dist_cjs51 = __commonJS({ "../../../node_modules/@aws-sdk/credential-provider-ini/dist-cjs/index.js"(exports2, module2) { "use strict"; var __create2 = Object.create; @@ -22612,24 +17952,24 @@ var require_dist_cjs78 = __commonJS({ fromIni: () => fromIni }); module2.exports = __toCommonJS2(src_exports); - var import_shared_ini_file_loader = require_dist_cjs41(); - var import_property_provider2 = require_dist_cjs40(); + var import_shared_ini_file_loader = require_dist_cjs25(); + var import_property_provider2 = require_dist_cjs24(); var resolveCredentialSource = /* @__PURE__ */ __name((credentialSource, profileName, logger) => { const sourceProvidersMap = { EcsContainer: async (options) => { - const { fromHttp } = await Promise.resolve().then(() => __toESM2(require_dist_cjs55())); - const { fromContainerMetadata } = await Promise.resolve().then(() => __toESM2(require_dist_cjs49())); + const { fromHttp } = await Promise.resolve().then(() => __toESM2(require_dist_cjs38())); + const { fromContainerMetadata } = await Promise.resolve().then(() => __toESM2(require_dist_cjs37())); logger == null ? void 0 : logger.debug("@aws-sdk/credential-provider-ini - credential_source is EcsContainer"); return (0, import_property_provider2.chain)(fromHttp(options ?? {}), fromContainerMetadata(options)); }, Ec2InstanceMetadata: async (options) => { logger == null ? void 0 : logger.debug("@aws-sdk/credential-provider-ini - credential_source is Ec2InstanceMetadata"); - const { fromInstanceMetadata } = await Promise.resolve().then(() => __toESM2(require_dist_cjs49())); + const { fromInstanceMetadata } = await Promise.resolve().then(() => __toESM2(require_dist_cjs37())); return fromInstanceMetadata(options); }, Environment: async (options) => { logger == null ? void 0 : logger.debug("@aws-sdk/credential-provider-ini - credential_source is Environment"); - const { fromEnv } = await Promise.resolve().then(() => __toESM2(require_dist_cjs48())); + const { fromEnv } = await Promise.resolve().then(() => __toESM2(require_dist_cjs36())); return fromEnv(options); } }; @@ -22666,7 +18006,7 @@ var require_dist_cjs78 = __commonJS({ (_a = options.logger) == null ? void 0 : _a.debug("@aws-sdk/credential-provider-ini - resolveAssumeRoleCredentials (STS)"); const data = profiles[profileName]; if (!options.roleAssumer) { - const { getDefaultRoleAssumer } = await Promise.resolve().then(() => __toESM2(require_dist_cjs75())); + const { getDefaultRoleAssumer } = await Promise.resolve().then(() => __toESM2(require_dist_cjs48())); options.roleAssumer = getDefaultRoleAssumer( { ...options.clientConfig, @@ -22725,14 +18065,14 @@ var require_dist_cjs78 = __commonJS({ return options.roleAssumer(sourceCreds, params); }, "resolveAssumeRoleCredentials"); var isProcessProfile = /* @__PURE__ */ __name((arg) => Boolean(arg) && typeof arg === "object" && typeof arg.credential_process === "string", "isProcessProfile"); - var resolveProcessCredentials = /* @__PURE__ */ __name(async (options, profile) => Promise.resolve().then(() => __toESM2(require_dist_cjs76())).then( + var resolveProcessCredentials = /* @__PURE__ */ __name(async (options, profile) => Promise.resolve().then(() => __toESM2(require_dist_cjs49())).then( ({ fromProcess }) => fromProcess({ ...options, profile })() ), "resolveProcessCredentials"); var resolveSsoCredentials = /* @__PURE__ */ __name(async (profile, options = {}) => { - const { fromSSO } = await Promise.resolve().then(() => __toESM2(require_dist_cjs74())); + const { fromSSO } = await Promise.resolve().then(() => __toESM2(require_dist_cjs47())); return fromSSO({ profile, logger: options.logger @@ -22752,7 +18092,7 @@ var require_dist_cjs78 = __commonJS({ }); }, "resolveStaticCredentials"); var isWebIdentityProfile = /* @__PURE__ */ __name((arg) => Boolean(arg) && typeof arg === "object" && typeof arg.web_identity_token_file === "string" && typeof arg.role_arn === "string" && ["undefined", "string"].indexOf(typeof arg.role_session_name) > -1, "isWebIdentityProfile"); - var resolveWebIdentityCredentials = /* @__PURE__ */ __name(async (profile, options) => Promise.resolve().then(() => __toESM2(require_dist_cjs77())).then( + var resolveWebIdentityCredentials = /* @__PURE__ */ __name(async (profile, options) => Promise.resolve().then(() => __toESM2(require_dist_cjs50())).then( ({ fromTokenFile: fromTokenFile2 }) => fromTokenFile2({ webIdentityTokenFile: profile.web_identity_token_file, roleArn: profile.role_arn, @@ -22797,7 +18137,7 @@ var require_dist_cjs78 = __commonJS({ }); // ../../../node_modules/@aws-sdk/credential-provider-node/dist-cjs/index.js -var require_dist_cjs79 = __commonJS({ +var require_dist_cjs52 = __commonJS({ "../../../node_modules/@aws-sdk/credential-provider-node/dist-cjs/index.js"(exports2, module2) { "use strict"; var __create2 = Object.create; @@ -22835,16 +18175,16 @@ var require_dist_cjs79 = __commonJS({ defaultProvider: () => defaultProvider }); module2.exports = __toCommonJS2(src_exports); - var import_credential_provider_env = require_dist_cjs48(); - var import_shared_ini_file_loader = require_dist_cjs41(); - var import_property_provider2 = require_dist_cjs40(); + var import_credential_provider_env = require_dist_cjs36(); + var import_shared_ini_file_loader = require_dist_cjs25(); + var import_property_provider2 = require_dist_cjs24(); var ENV_IMDS_DISABLED = "AWS_EC2_METADATA_DISABLED"; var remoteProvider = /* @__PURE__ */ __name(async (init) => { var _a, _b; - const { ENV_CMDS_FULL_URI, ENV_CMDS_RELATIVE_URI, fromContainerMetadata, fromInstanceMetadata } = await Promise.resolve().then(() => __toESM2(require_dist_cjs49())); + const { ENV_CMDS_FULL_URI, ENV_CMDS_RELATIVE_URI, fromContainerMetadata, fromInstanceMetadata } = await Promise.resolve().then(() => __toESM2(require_dist_cjs37())); if (process.env[ENV_CMDS_RELATIVE_URI] || process.env[ENV_CMDS_FULL_URI]) { (_a = init.logger) == null ? void 0 : _a.debug("@aws-sdk/credential-provider-node - remoteProvider::fromHttp/fromContainerMetadata"); - const { fromHttp } = await Promise.resolve().then(() => __toESM2(require_dist_cjs55())); + const { fromHttp } = await Promise.resolve().then(() => __toESM2(require_dist_cjs38())); return (0, import_property_provider2.chain)(fromHttp(init), fromContainerMetadata(init)); } if (process.env[ENV_IMDS_DISABLED]) { @@ -22898,25 +18238,25 @@ var require_dist_cjs79 = __commonJS({ { logger: init.logger } ); } - const { fromSSO } = await Promise.resolve().then(() => __toESM2(require_dist_cjs74())); + const { fromSSO } = await Promise.resolve().then(() => __toESM2(require_dist_cjs47())); return fromSSO(init)(); }, async () => { var _a; (_a = init.logger) == null ? void 0 : _a.debug("@aws-sdk/credential-provider-node - defaultProvider::fromIni"); - const { fromIni } = await Promise.resolve().then(() => __toESM2(require_dist_cjs78())); + const { fromIni } = await Promise.resolve().then(() => __toESM2(require_dist_cjs51())); return fromIni(init)(); }, async () => { var _a; (_a = init.logger) == null ? void 0 : _a.debug("@aws-sdk/credential-provider-node - defaultProvider::fromProcess"); - const { fromProcess } = await Promise.resolve().then(() => __toESM2(require_dist_cjs76())); + const { fromProcess } = await Promise.resolve().then(() => __toESM2(require_dist_cjs49())); return fromProcess(init)(); }, async () => { var _a; (_a = init.logger) == null ? void 0 : _a.debug("@aws-sdk/credential-provider-node - defaultProvider::fromTokenFile"); - const { fromTokenFile: fromTokenFile2 } = await Promise.resolve().then(() => __toESM2(require_dist_cjs77())); + const { fromTokenFile: fromTokenFile2 } = await Promise.resolve().then(() => __toESM2(require_dist_cjs50())); return fromTokenFile2(init)(); }, async () => { @@ -23000,10 +18340,10 @@ var require_runtimeConfig_shared4 = __commonJS({ Object.defineProperty(exports2, "__esModule", { value: true }); exports2.getRuntimeConfig = void 0; var core_1 = (init_dist_es2(), __toCommonJS(dist_es_exports2)); - var smithy_client_1 = require_dist_cjs37(); - var url_parser_1 = require_dist_cjs44(); - var util_base64_1 = require_dist_cjs29(); - var util_utf8_1 = require_dist_cjs28(); + var smithy_client_1 = require_dist_cjs33(); + var url_parser_1 = require_dist_cjs28(); + var util_base64_1 = require_dist_cjs16(); + var util_utf8_1 = require_dist_cjs15(); var httpAuthSchemeProvider_1 = require_httpAuthSchemeProvider(); var endpointResolver_1 = require_endpointResolver4(); var getRuntimeConfig = (config) => { @@ -23042,19 +18382,19 @@ var require_runtimeConfig4 = __commonJS({ var tslib_1 = (init_tslib_es6(), __toCommonJS(tslib_es6_exports)); var package_json_1 = tslib_1.__importDefault(require_package()); var core_1 = (init_dist_es2(), __toCommonJS(dist_es_exports2)); - var credential_provider_node_1 = require_dist_cjs79(); - var util_user_agent_node_1 = require_dist_cjs56(); + var credential_provider_node_1 = require_dist_cjs52(); + var util_user_agent_node_1 = require_dist_cjs39(); var config_resolver_1 = require_dist_cjs11(); - var hash_node_1 = require_dist_cjs57(); - var middleware_retry_1 = require_dist_cjs38(); - var node_config_provider_1 = require_dist_cjs42(); - var node_http_handler_1 = require_dist_cjs51(); - var util_body_length_node_1 = require_dist_cjs58(); - var util_retry_1 = require_dist_cjs60(); + var hash_node_1 = require_dist_cjs40(); + var middleware_retry_1 = require_dist_cjs34(); + var node_config_provider_1 = require_dist_cjs26(); + var node_http_handler_1 = require_dist_cjs19(); + var util_body_length_node_1 = require_dist_cjs41(); + var util_retry_1 = require_dist_cjs31(); var runtimeConfig_shared_1 = require_runtimeConfig_shared4(); - var smithy_client_1 = require_dist_cjs37(); - var util_defaults_mode_node_1 = require_dist_cjs69(); - var smithy_client_2 = require_dist_cjs37(); + var smithy_client_1 = require_dist_cjs33(); + var util_defaults_mode_node_1 = require_dist_cjs42(); + var smithy_client_2 = require_dist_cjs33(); var getRuntimeConfig = (config) => { (0, smithy_client_2.emitWarningIfUnsupportedVersion)(process.version); const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config); @@ -23087,7 +18427,7 @@ var require_runtimeConfig4 = __commonJS({ }); // ../../../node_modules/@aws-sdk/client-sfn/dist-cjs/index.js -var require_dist_cjs80 = __commonJS({ +var require_dist_cjs53 = __commonJS({ "../../../node_modules/@aws-sdk/client-sfn/dist-cjs/index.js"(exports2, module2) { "use strict"; var __defProp2 = Object.defineProperty; @@ -23248,7 +18588,7 @@ var require_dist_cjs80 = __commonJS({ ValidateStateMachineDefinitionSeverity: () => ValidateStateMachineDefinitionSeverity, ValidationException: () => ValidationException, ValidationExceptionReason: () => ValidationExceptionReason, - __Client: () => import_smithy_client5.Client, + __Client: () => import_smithy_client4.Client, paginateGetExecutionHistory: () => paginateGetExecutionHistory, paginateListActivities: () => paginateListActivities, paginateListExecutions: () => paginateListExecutions, @@ -23262,9 +18602,9 @@ var require_dist_cjs80 = __commonJS({ var import_middleware_user_agent = require_dist_cjs8(); var import_config_resolver = require_dist_cjs11(); var import_core3 = (init_dist_es(), __toCommonJS(dist_es_exports)); - var import_middleware_content_length = require_dist_cjs39(); - var import_middleware_endpoint2 = require_dist_cjs46(); - var import_middleware_retry2 = require_dist_cjs38(); + var import_middleware_content_length = require_dist_cjs23(); + var import_middleware_endpoint = require_dist_cjs29(); + var import_middleware_retry = require_dist_cjs34(); var import_httpAuthSchemeProvider = require_httpAuthSchemeProvider(); var resolveClientEndpointParameters = /* @__PURE__ */ __name((options) => { return { @@ -23281,9 +18621,9 @@ var require_dist_cjs80 = __commonJS({ UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" } }; var import_runtimeConfig = require_runtimeConfig4(); - var import_region_config_resolver = require_dist_cjs70(); + var import_region_config_resolver = require_dist_cjs43(); var import_protocol_http8 = require_dist_cjs2(); - var import_smithy_client5 = require_dist_cjs37(); + var import_smithy_client4 = require_dist_cjs33(); var getHttpAuthExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { const _httpAuthSchemes = runtimeConfig.httpAuthSchemes; let _httpAuthSchemeProvider = runtimeConfig.httpAuthSchemeProvider; @@ -23325,7 +18665,7 @@ var require_dist_cjs80 = __commonJS({ var resolveRuntimeExtensions = /* @__PURE__ */ __name((runtimeConfig, extensions) => { const extensionConfiguration = { ...asPartial((0, import_region_config_resolver.getAwsRegionExtensionConfiguration)(runtimeConfig)), - ...asPartial((0, import_smithy_client5.getDefaultExtensionConfiguration)(runtimeConfig)), + ...asPartial((0, import_smithy_client4.getDefaultExtensionConfiguration)(runtimeConfig)), ...asPartial((0, import_protocol_http8.getHttpHandlerExtensionConfiguration)(runtimeConfig)), ...asPartial(getHttpAuthExtensionConfiguration(runtimeConfig)) }; @@ -23333,26 +18673,26 @@ var require_dist_cjs80 = __commonJS({ return { ...runtimeConfig, ...(0, import_region_config_resolver.resolveAwsRegionExtensionConfiguration)(extensionConfiguration), - ...(0, import_smithy_client5.resolveDefaultRuntimeConfig)(extensionConfiguration), + ...(0, import_smithy_client4.resolveDefaultRuntimeConfig)(extensionConfiguration), ...(0, import_protocol_http8.resolveHttpHandlerRuntimeConfig)(extensionConfiguration), ...resolveHttpAuthRuntimeConfig(extensionConfiguration) }; }, "resolveRuntimeExtensions"); - var _SFNClient = class _SFNClient extends import_smithy_client5.Client { + var _SFNClient = class _SFNClient extends import_smithy_client4.Client { constructor(...[configuration]) { const _config_0 = (0, import_runtimeConfig.getRuntimeConfig)(configuration || {}); const _config_1 = resolveClientEndpointParameters(_config_0); const _config_2 = (0, import_middleware_user_agent.resolveUserAgentConfig)(_config_1); - const _config_3 = (0, import_middleware_retry2.resolveRetryConfig)(_config_2); + const _config_3 = (0, import_middleware_retry.resolveRetryConfig)(_config_2); const _config_4 = (0, import_config_resolver.resolveRegionConfig)(_config_3); const _config_5 = (0, import_middleware_host_header.resolveHostHeaderConfig)(_config_4); - const _config_6 = (0, import_middleware_endpoint2.resolveEndpointConfig)(_config_5); + const _config_6 = (0, import_middleware_endpoint.resolveEndpointConfig)(_config_5); const _config_7 = (0, import_httpAuthSchemeProvider.resolveHttpAuthSchemeConfig)(_config_6); const _config_8 = resolveRuntimeExtensions(_config_7, (configuration == null ? void 0 : configuration.extensions) || []); super(_config_8); this.config = _config_8; this.middlewareStack.use((0, import_middleware_user_agent.getUserAgentPlugin)(this.config)); - this.middlewareStack.use((0, import_middleware_retry2.getRetryPlugin)(this.config)); + this.middlewareStack.use((0, import_middleware_retry.getRetryPlugin)(this.config)); this.middlewareStack.use((0, import_middleware_content_length.getContentLengthPlugin)(this.config)); this.middlewareStack.use((0, import_middleware_host_header.getHostHeaderPlugin)(this.config)); this.middlewareStack.use((0, import_middleware_logger.getLoggerPlugin)(this.config)); @@ -23378,10 +18718,10 @@ var require_dist_cjs80 = __commonJS({ }; __name(_SFNClient, "SFNClient"); var SFNClient = _SFNClient; - var import_middleware_serde2 = require_dist_cjs45(); + var import_middleware_serde2 = require_dist_cjs12(); var import_core22 = (init_dist_es2(), __toCommonJS(dist_es_exports2)); var import_uuid = (init_esm_node(), __toCommonJS(esm_node_exports)); - var _SFNServiceException = class _SFNServiceException2 extends import_smithy_client5.ServiceException { + var _SFNServiceException = class _SFNServiceException2 extends import_smithy_client4.ServiceException { /** * @internal */ @@ -24103,156 +19443,156 @@ var require_dist_cjs80 = __commonJS({ }; var ActivityFailedEventDetailsFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.error && { error: import_smithy_client5.SENSITIVE_STRING }, - ...obj.cause && { cause: import_smithy_client5.SENSITIVE_STRING } + ...obj.error && { error: import_smithy_client4.SENSITIVE_STRING }, + ...obj.cause && { cause: import_smithy_client4.SENSITIVE_STRING } }), "ActivityFailedEventDetailsFilterSensitiveLog"); var ActivityScheduledEventDetailsFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.input && { input: import_smithy_client5.SENSITIVE_STRING } + ...obj.input && { input: import_smithy_client4.SENSITIVE_STRING } }), "ActivityScheduledEventDetailsFilterSensitiveLog"); var ActivityScheduleFailedEventDetailsFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.error && { error: import_smithy_client5.SENSITIVE_STRING }, - ...obj.cause && { cause: import_smithy_client5.SENSITIVE_STRING } + ...obj.error && { error: import_smithy_client4.SENSITIVE_STRING }, + ...obj.cause && { cause: import_smithy_client4.SENSITIVE_STRING } }), "ActivityScheduleFailedEventDetailsFilterSensitiveLog"); var ActivitySucceededEventDetailsFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.output && { output: import_smithy_client5.SENSITIVE_STRING } + ...obj.output && { output: import_smithy_client4.SENSITIVE_STRING } }), "ActivitySucceededEventDetailsFilterSensitiveLog"); var ActivityTimedOutEventDetailsFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.error && { error: import_smithy_client5.SENSITIVE_STRING }, - ...obj.cause && { cause: import_smithy_client5.SENSITIVE_STRING } + ...obj.error && { error: import_smithy_client4.SENSITIVE_STRING }, + ...obj.cause && { cause: import_smithy_client4.SENSITIVE_STRING } }), "ActivityTimedOutEventDetailsFilterSensitiveLog"); var CreateStateMachineInputFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.definition && { definition: import_smithy_client5.SENSITIVE_STRING }, - ...obj.versionDescription && { versionDescription: import_smithy_client5.SENSITIVE_STRING } + ...obj.definition && { definition: import_smithy_client4.SENSITIVE_STRING }, + ...obj.versionDescription && { versionDescription: import_smithy_client4.SENSITIVE_STRING } }), "CreateStateMachineInputFilterSensitiveLog"); var CreateStateMachineAliasInputFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.description && { description: import_smithy_client5.SENSITIVE_STRING } + ...obj.description && { description: import_smithy_client4.SENSITIVE_STRING } }), "CreateStateMachineAliasInputFilterSensitiveLog"); var DescribeExecutionOutputFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.input && { input: import_smithy_client5.SENSITIVE_STRING }, - ...obj.output && { output: import_smithy_client5.SENSITIVE_STRING }, - ...obj.error && { error: import_smithy_client5.SENSITIVE_STRING }, - ...obj.cause && { cause: import_smithy_client5.SENSITIVE_STRING }, - ...obj.redriveStatusReason && { redriveStatusReason: import_smithy_client5.SENSITIVE_STRING } + ...obj.input && { input: import_smithy_client4.SENSITIVE_STRING }, + ...obj.output && { output: import_smithy_client4.SENSITIVE_STRING }, + ...obj.error && { error: import_smithy_client4.SENSITIVE_STRING }, + ...obj.cause && { cause: import_smithy_client4.SENSITIVE_STRING }, + ...obj.redriveStatusReason && { redriveStatusReason: import_smithy_client4.SENSITIVE_STRING } }), "DescribeExecutionOutputFilterSensitiveLog"); var DescribeStateMachineOutputFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.definition && { definition: import_smithy_client5.SENSITIVE_STRING }, - ...obj.description && { description: import_smithy_client5.SENSITIVE_STRING } + ...obj.definition && { definition: import_smithy_client4.SENSITIVE_STRING }, + ...obj.description && { description: import_smithy_client4.SENSITIVE_STRING } }), "DescribeStateMachineOutputFilterSensitiveLog"); var DescribeStateMachineAliasOutputFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.description && { description: import_smithy_client5.SENSITIVE_STRING } + ...obj.description && { description: import_smithy_client4.SENSITIVE_STRING } }), "DescribeStateMachineAliasOutputFilterSensitiveLog"); var DescribeStateMachineForExecutionOutputFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.definition && { definition: import_smithy_client5.SENSITIVE_STRING } + ...obj.definition && { definition: import_smithy_client4.SENSITIVE_STRING } }), "DescribeStateMachineForExecutionOutputFilterSensitiveLog"); var GetActivityTaskOutputFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.input && { input: import_smithy_client5.SENSITIVE_STRING } + ...obj.input && { input: import_smithy_client4.SENSITIVE_STRING } }), "GetActivityTaskOutputFilterSensitiveLog"); var ExecutionAbortedEventDetailsFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.error && { error: import_smithy_client5.SENSITIVE_STRING }, - ...obj.cause && { cause: import_smithy_client5.SENSITIVE_STRING } + ...obj.error && { error: import_smithy_client4.SENSITIVE_STRING }, + ...obj.cause && { cause: import_smithy_client4.SENSITIVE_STRING } }), "ExecutionAbortedEventDetailsFilterSensitiveLog"); var ExecutionFailedEventDetailsFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.error && { error: import_smithy_client5.SENSITIVE_STRING }, - ...obj.cause && { cause: import_smithy_client5.SENSITIVE_STRING } + ...obj.error && { error: import_smithy_client4.SENSITIVE_STRING }, + ...obj.cause && { cause: import_smithy_client4.SENSITIVE_STRING } }), "ExecutionFailedEventDetailsFilterSensitiveLog"); var ExecutionStartedEventDetailsFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.input && { input: import_smithy_client5.SENSITIVE_STRING } + ...obj.input && { input: import_smithy_client4.SENSITIVE_STRING } }), "ExecutionStartedEventDetailsFilterSensitiveLog"); var ExecutionSucceededEventDetailsFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.output && { output: import_smithy_client5.SENSITIVE_STRING } + ...obj.output && { output: import_smithy_client4.SENSITIVE_STRING } }), "ExecutionSucceededEventDetailsFilterSensitiveLog"); var ExecutionTimedOutEventDetailsFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.error && { error: import_smithy_client5.SENSITIVE_STRING }, - ...obj.cause && { cause: import_smithy_client5.SENSITIVE_STRING } + ...obj.error && { error: import_smithy_client4.SENSITIVE_STRING }, + ...obj.cause && { cause: import_smithy_client4.SENSITIVE_STRING } }), "ExecutionTimedOutEventDetailsFilterSensitiveLog"); var LambdaFunctionFailedEventDetailsFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.error && { error: import_smithy_client5.SENSITIVE_STRING }, - ...obj.cause && { cause: import_smithy_client5.SENSITIVE_STRING } + ...obj.error && { error: import_smithy_client4.SENSITIVE_STRING }, + ...obj.cause && { cause: import_smithy_client4.SENSITIVE_STRING } }), "LambdaFunctionFailedEventDetailsFilterSensitiveLog"); var LambdaFunctionScheduledEventDetailsFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.input && { input: import_smithy_client5.SENSITIVE_STRING } + ...obj.input && { input: import_smithy_client4.SENSITIVE_STRING } }), "LambdaFunctionScheduledEventDetailsFilterSensitiveLog"); var LambdaFunctionScheduleFailedEventDetailsFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.error && { error: import_smithy_client5.SENSITIVE_STRING }, - ...obj.cause && { cause: import_smithy_client5.SENSITIVE_STRING } + ...obj.error && { error: import_smithy_client4.SENSITIVE_STRING }, + ...obj.cause && { cause: import_smithy_client4.SENSITIVE_STRING } }), "LambdaFunctionScheduleFailedEventDetailsFilterSensitiveLog"); var LambdaFunctionStartFailedEventDetailsFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.error && { error: import_smithy_client5.SENSITIVE_STRING }, - ...obj.cause && { cause: import_smithy_client5.SENSITIVE_STRING } + ...obj.error && { error: import_smithy_client4.SENSITIVE_STRING }, + ...obj.cause && { cause: import_smithy_client4.SENSITIVE_STRING } }), "LambdaFunctionStartFailedEventDetailsFilterSensitiveLog"); var LambdaFunctionSucceededEventDetailsFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.output && { output: import_smithy_client5.SENSITIVE_STRING } + ...obj.output && { output: import_smithy_client4.SENSITIVE_STRING } }), "LambdaFunctionSucceededEventDetailsFilterSensitiveLog"); var LambdaFunctionTimedOutEventDetailsFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.error && { error: import_smithy_client5.SENSITIVE_STRING }, - ...obj.cause && { cause: import_smithy_client5.SENSITIVE_STRING } + ...obj.error && { error: import_smithy_client4.SENSITIVE_STRING }, + ...obj.cause && { cause: import_smithy_client4.SENSITIVE_STRING } }), "LambdaFunctionTimedOutEventDetailsFilterSensitiveLog"); var MapRunFailedEventDetailsFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.error && { error: import_smithy_client5.SENSITIVE_STRING }, - ...obj.cause && { cause: import_smithy_client5.SENSITIVE_STRING } + ...obj.error && { error: import_smithy_client4.SENSITIVE_STRING }, + ...obj.cause && { cause: import_smithy_client4.SENSITIVE_STRING } }), "MapRunFailedEventDetailsFilterSensitiveLog"); var StateEnteredEventDetailsFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.input && { input: import_smithy_client5.SENSITIVE_STRING } + ...obj.input && { input: import_smithy_client4.SENSITIVE_STRING } }), "StateEnteredEventDetailsFilterSensitiveLog"); var StateExitedEventDetailsFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.output && { output: import_smithy_client5.SENSITIVE_STRING } + ...obj.output && { output: import_smithy_client4.SENSITIVE_STRING } }), "StateExitedEventDetailsFilterSensitiveLog"); var TaskFailedEventDetailsFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.error && { error: import_smithy_client5.SENSITIVE_STRING }, - ...obj.cause && { cause: import_smithy_client5.SENSITIVE_STRING } + ...obj.error && { error: import_smithy_client4.SENSITIVE_STRING }, + ...obj.cause && { cause: import_smithy_client4.SENSITIVE_STRING } }), "TaskFailedEventDetailsFilterSensitiveLog"); var TaskScheduledEventDetailsFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.parameters && { parameters: import_smithy_client5.SENSITIVE_STRING } + ...obj.parameters && { parameters: import_smithy_client4.SENSITIVE_STRING } }), "TaskScheduledEventDetailsFilterSensitiveLog"); var TaskStartFailedEventDetailsFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.error && { error: import_smithy_client5.SENSITIVE_STRING }, - ...obj.cause && { cause: import_smithy_client5.SENSITIVE_STRING } + ...obj.error && { error: import_smithy_client4.SENSITIVE_STRING }, + ...obj.cause && { cause: import_smithy_client4.SENSITIVE_STRING } }), "TaskStartFailedEventDetailsFilterSensitiveLog"); var TaskSubmitFailedEventDetailsFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.error && { error: import_smithy_client5.SENSITIVE_STRING }, - ...obj.cause && { cause: import_smithy_client5.SENSITIVE_STRING } + ...obj.error && { error: import_smithy_client4.SENSITIVE_STRING }, + ...obj.cause && { cause: import_smithy_client4.SENSITIVE_STRING } }), "TaskSubmitFailedEventDetailsFilterSensitiveLog"); var TaskSubmittedEventDetailsFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.output && { output: import_smithy_client5.SENSITIVE_STRING } + ...obj.output && { output: import_smithy_client4.SENSITIVE_STRING } }), "TaskSubmittedEventDetailsFilterSensitiveLog"); var TaskSucceededEventDetailsFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.output && { output: import_smithy_client5.SENSITIVE_STRING } + ...obj.output && { output: import_smithy_client4.SENSITIVE_STRING } }), "TaskSucceededEventDetailsFilterSensitiveLog"); var TaskTimedOutEventDetailsFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.error && { error: import_smithy_client5.SENSITIVE_STRING }, - ...obj.cause && { cause: import_smithy_client5.SENSITIVE_STRING } + ...obj.error && { error: import_smithy_client4.SENSITIVE_STRING }, + ...obj.cause && { cause: import_smithy_client4.SENSITIVE_STRING } }), "TaskTimedOutEventDetailsFilterSensitiveLog"); var HistoryEventFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, @@ -24357,207 +19697,207 @@ var require_dist_cjs80 = __commonJS({ }), "GetExecutionHistoryOutputFilterSensitiveLog"); var PublishStateMachineVersionInputFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.description && { description: import_smithy_client5.SENSITIVE_STRING } + ...obj.description && { description: import_smithy_client4.SENSITIVE_STRING } }), "PublishStateMachineVersionInputFilterSensitiveLog"); var SendTaskFailureInputFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.error && { error: import_smithy_client5.SENSITIVE_STRING }, - ...obj.cause && { cause: import_smithy_client5.SENSITIVE_STRING } + ...obj.error && { error: import_smithy_client4.SENSITIVE_STRING }, + ...obj.cause && { cause: import_smithy_client4.SENSITIVE_STRING } }), "SendTaskFailureInputFilterSensitiveLog"); var SendTaskSuccessInputFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.output && { output: import_smithy_client5.SENSITIVE_STRING } + ...obj.output && { output: import_smithy_client4.SENSITIVE_STRING } }), "SendTaskSuccessInputFilterSensitiveLog"); var StartExecutionInputFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.input && { input: import_smithy_client5.SENSITIVE_STRING } + ...obj.input && { input: import_smithy_client4.SENSITIVE_STRING } }), "StartExecutionInputFilterSensitiveLog"); var StartSyncExecutionInputFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.input && { input: import_smithy_client5.SENSITIVE_STRING } + ...obj.input && { input: import_smithy_client4.SENSITIVE_STRING } }), "StartSyncExecutionInputFilterSensitiveLog"); var StartSyncExecutionOutputFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.error && { error: import_smithy_client5.SENSITIVE_STRING }, - ...obj.cause && { cause: import_smithy_client5.SENSITIVE_STRING }, - ...obj.input && { input: import_smithy_client5.SENSITIVE_STRING }, - ...obj.output && { output: import_smithy_client5.SENSITIVE_STRING } + ...obj.error && { error: import_smithy_client4.SENSITIVE_STRING }, + ...obj.cause && { cause: import_smithy_client4.SENSITIVE_STRING }, + ...obj.input && { input: import_smithy_client4.SENSITIVE_STRING }, + ...obj.output && { output: import_smithy_client4.SENSITIVE_STRING } }), "StartSyncExecutionOutputFilterSensitiveLog"); var StopExecutionInputFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.error && { error: import_smithy_client5.SENSITIVE_STRING }, - ...obj.cause && { cause: import_smithy_client5.SENSITIVE_STRING } + ...obj.error && { error: import_smithy_client4.SENSITIVE_STRING }, + ...obj.cause && { cause: import_smithy_client4.SENSITIVE_STRING } }), "StopExecutionInputFilterSensitiveLog"); var TestStateInputFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.definition && { definition: import_smithy_client5.SENSITIVE_STRING }, - ...obj.input && { input: import_smithy_client5.SENSITIVE_STRING } + ...obj.definition && { definition: import_smithy_client4.SENSITIVE_STRING }, + ...obj.input && { input: import_smithy_client4.SENSITIVE_STRING } }), "TestStateInputFilterSensitiveLog"); var InspectionDataFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.input && { input: import_smithy_client5.SENSITIVE_STRING }, - ...obj.afterInputPath && { afterInputPath: import_smithy_client5.SENSITIVE_STRING }, - ...obj.afterParameters && { afterParameters: import_smithy_client5.SENSITIVE_STRING }, - ...obj.result && { result: import_smithy_client5.SENSITIVE_STRING }, - ...obj.afterResultSelector && { afterResultSelector: import_smithy_client5.SENSITIVE_STRING }, - ...obj.afterResultPath && { afterResultPath: import_smithy_client5.SENSITIVE_STRING } + ...obj.input && { input: import_smithy_client4.SENSITIVE_STRING }, + ...obj.afterInputPath && { afterInputPath: import_smithy_client4.SENSITIVE_STRING }, + ...obj.afterParameters && { afterParameters: import_smithy_client4.SENSITIVE_STRING }, + ...obj.result && { result: import_smithy_client4.SENSITIVE_STRING }, + ...obj.afterResultSelector && { afterResultSelector: import_smithy_client4.SENSITIVE_STRING }, + ...obj.afterResultPath && { afterResultPath: import_smithy_client4.SENSITIVE_STRING } }), "InspectionDataFilterSensitiveLog"); var TestStateOutputFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.output && { output: import_smithy_client5.SENSITIVE_STRING }, - ...obj.error && { error: import_smithy_client5.SENSITIVE_STRING }, - ...obj.cause && { cause: import_smithy_client5.SENSITIVE_STRING }, - ...obj.inspectionData && { inspectionData: import_smithy_client5.SENSITIVE_STRING } + ...obj.output && { output: import_smithy_client4.SENSITIVE_STRING }, + ...obj.error && { error: import_smithy_client4.SENSITIVE_STRING }, + ...obj.cause && { cause: import_smithy_client4.SENSITIVE_STRING }, + ...obj.inspectionData && { inspectionData: import_smithy_client4.SENSITIVE_STRING } }), "TestStateOutputFilterSensitiveLog"); var UpdateStateMachineInputFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.definition && { definition: import_smithy_client5.SENSITIVE_STRING }, - ...obj.versionDescription && { versionDescription: import_smithy_client5.SENSITIVE_STRING } + ...obj.definition && { definition: import_smithy_client4.SENSITIVE_STRING }, + ...obj.versionDescription && { versionDescription: import_smithy_client4.SENSITIVE_STRING } }), "UpdateStateMachineInputFilterSensitiveLog"); var UpdateStateMachineAliasInputFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.description && { description: import_smithy_client5.SENSITIVE_STRING } + ...obj.description && { description: import_smithy_client4.SENSITIVE_STRING } }), "UpdateStateMachineAliasInputFilterSensitiveLog"); var ValidateStateMachineDefinitionInputFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ ...obj, - ...obj.definition && { definition: import_smithy_client5.SENSITIVE_STRING } + ...obj.definition && { definition: import_smithy_client4.SENSITIVE_STRING } }), "ValidateStateMachineDefinitionInputFilterSensitiveLog"); var se_CreateActivityCommand = /* @__PURE__ */ __name(async (input, context) => { const headers = sharedHeaders("CreateActivity"); let body; - body = JSON.stringify((0, import_smithy_client5._json)(input)); + body = JSON.stringify((0, import_smithy_client4._json)(input)); return buildHttpRpcRequest(context, headers, "/", void 0, body); }, "se_CreateActivityCommand"); var se_CreateStateMachineCommand = /* @__PURE__ */ __name(async (input, context) => { const headers = sharedHeaders("CreateStateMachine"); let body; - body = JSON.stringify((0, import_smithy_client5._json)(input)); + body = JSON.stringify((0, import_smithy_client4._json)(input)); return buildHttpRpcRequest(context, headers, "/", void 0, body); }, "se_CreateStateMachineCommand"); var se_CreateStateMachineAliasCommand = /* @__PURE__ */ __name(async (input, context) => { const headers = sharedHeaders("CreateStateMachineAlias"); let body; - body = JSON.stringify((0, import_smithy_client5._json)(input)); + body = JSON.stringify((0, import_smithy_client4._json)(input)); return buildHttpRpcRequest(context, headers, "/", void 0, body); }, "se_CreateStateMachineAliasCommand"); var se_DeleteActivityCommand = /* @__PURE__ */ __name(async (input, context) => { const headers = sharedHeaders("DeleteActivity"); let body; - body = JSON.stringify((0, import_smithy_client5._json)(input)); + body = JSON.stringify((0, import_smithy_client4._json)(input)); return buildHttpRpcRequest(context, headers, "/", void 0, body); }, "se_DeleteActivityCommand"); var se_DeleteStateMachineCommand = /* @__PURE__ */ __name(async (input, context) => { const headers = sharedHeaders("DeleteStateMachine"); let body; - body = JSON.stringify((0, import_smithy_client5._json)(input)); + body = JSON.stringify((0, import_smithy_client4._json)(input)); return buildHttpRpcRequest(context, headers, "/", void 0, body); }, "se_DeleteStateMachineCommand"); var se_DeleteStateMachineAliasCommand = /* @__PURE__ */ __name(async (input, context) => { const headers = sharedHeaders("DeleteStateMachineAlias"); let body; - body = JSON.stringify((0, import_smithy_client5._json)(input)); + body = JSON.stringify((0, import_smithy_client4._json)(input)); return buildHttpRpcRequest(context, headers, "/", void 0, body); }, "se_DeleteStateMachineAliasCommand"); var se_DeleteStateMachineVersionCommand = /* @__PURE__ */ __name(async (input, context) => { const headers = sharedHeaders("DeleteStateMachineVersion"); let body; - body = JSON.stringify((0, import_smithy_client5._json)(input)); + body = JSON.stringify((0, import_smithy_client4._json)(input)); return buildHttpRpcRequest(context, headers, "/", void 0, body); }, "se_DeleteStateMachineVersionCommand"); var se_DescribeActivityCommand = /* @__PURE__ */ __name(async (input, context) => { const headers = sharedHeaders("DescribeActivity"); let body; - body = JSON.stringify((0, import_smithy_client5._json)(input)); + body = JSON.stringify((0, import_smithy_client4._json)(input)); return buildHttpRpcRequest(context, headers, "/", void 0, body); }, "se_DescribeActivityCommand"); var se_DescribeExecutionCommand = /* @__PURE__ */ __name(async (input, context) => { const headers = sharedHeaders("DescribeExecution"); let body; - body = JSON.stringify((0, import_smithy_client5._json)(input)); + body = JSON.stringify((0, import_smithy_client4._json)(input)); return buildHttpRpcRequest(context, headers, "/", void 0, body); }, "se_DescribeExecutionCommand"); var se_DescribeMapRunCommand = /* @__PURE__ */ __name(async (input, context) => { const headers = sharedHeaders("DescribeMapRun"); let body; - body = JSON.stringify((0, import_smithy_client5._json)(input)); + body = JSON.stringify((0, import_smithy_client4._json)(input)); return buildHttpRpcRequest(context, headers, "/", void 0, body); }, "se_DescribeMapRunCommand"); var se_DescribeStateMachineCommand = /* @__PURE__ */ __name(async (input, context) => { const headers = sharedHeaders("DescribeStateMachine"); let body; - body = JSON.stringify((0, import_smithy_client5._json)(input)); + body = JSON.stringify((0, import_smithy_client4._json)(input)); return buildHttpRpcRequest(context, headers, "/", void 0, body); }, "se_DescribeStateMachineCommand"); var se_DescribeStateMachineAliasCommand = /* @__PURE__ */ __name(async (input, context) => { const headers = sharedHeaders("DescribeStateMachineAlias"); let body; - body = JSON.stringify((0, import_smithy_client5._json)(input)); + body = JSON.stringify((0, import_smithy_client4._json)(input)); return buildHttpRpcRequest(context, headers, "/", void 0, body); }, "se_DescribeStateMachineAliasCommand"); var se_DescribeStateMachineForExecutionCommand = /* @__PURE__ */ __name(async (input, context) => { const headers = sharedHeaders("DescribeStateMachineForExecution"); let body; - body = JSON.stringify((0, import_smithy_client5._json)(input)); + body = JSON.stringify((0, import_smithy_client4._json)(input)); return buildHttpRpcRequest(context, headers, "/", void 0, body); }, "se_DescribeStateMachineForExecutionCommand"); var se_GetActivityTaskCommand = /* @__PURE__ */ __name(async (input, context) => { const headers = sharedHeaders("GetActivityTask"); let body; - body = JSON.stringify((0, import_smithy_client5._json)(input)); + body = JSON.stringify((0, import_smithy_client4._json)(input)); return buildHttpRpcRequest(context, headers, "/", void 0, body); }, "se_GetActivityTaskCommand"); var se_GetExecutionHistoryCommand = /* @__PURE__ */ __name(async (input, context) => { const headers = sharedHeaders("GetExecutionHistory"); let body; - body = JSON.stringify((0, import_smithy_client5._json)(input)); + body = JSON.stringify((0, import_smithy_client4._json)(input)); return buildHttpRpcRequest(context, headers, "/", void 0, body); }, "se_GetExecutionHistoryCommand"); var se_ListActivitiesCommand = /* @__PURE__ */ __name(async (input, context) => { const headers = sharedHeaders("ListActivities"); let body; - body = JSON.stringify((0, import_smithy_client5._json)(input)); + body = JSON.stringify((0, import_smithy_client4._json)(input)); return buildHttpRpcRequest(context, headers, "/", void 0, body); }, "se_ListActivitiesCommand"); var se_ListExecutionsCommand = /* @__PURE__ */ __name(async (input, context) => { const headers = sharedHeaders("ListExecutions"); let body; - body = JSON.stringify((0, import_smithy_client5._json)(input)); + body = JSON.stringify((0, import_smithy_client4._json)(input)); return buildHttpRpcRequest(context, headers, "/", void 0, body); }, "se_ListExecutionsCommand"); var se_ListMapRunsCommand = /* @__PURE__ */ __name(async (input, context) => { const headers = sharedHeaders("ListMapRuns"); let body; - body = JSON.stringify((0, import_smithy_client5._json)(input)); + body = JSON.stringify((0, import_smithy_client4._json)(input)); return buildHttpRpcRequest(context, headers, "/", void 0, body); }, "se_ListMapRunsCommand"); var se_ListStateMachineAliasesCommand = /* @__PURE__ */ __name(async (input, context) => { const headers = sharedHeaders("ListStateMachineAliases"); let body; - body = JSON.stringify((0, import_smithy_client5._json)(input)); + body = JSON.stringify((0, import_smithy_client4._json)(input)); return buildHttpRpcRequest(context, headers, "/", void 0, body); }, "se_ListStateMachineAliasesCommand"); var se_ListStateMachinesCommand = /* @__PURE__ */ __name(async (input, context) => { const headers = sharedHeaders("ListStateMachines"); let body; - body = JSON.stringify((0, import_smithy_client5._json)(input)); + body = JSON.stringify((0, import_smithy_client4._json)(input)); return buildHttpRpcRequest(context, headers, "/", void 0, body); }, "se_ListStateMachinesCommand"); var se_ListStateMachineVersionsCommand = /* @__PURE__ */ __name(async (input, context) => { const headers = sharedHeaders("ListStateMachineVersions"); let body; - body = JSON.stringify((0, import_smithy_client5._json)(input)); + body = JSON.stringify((0, import_smithy_client4._json)(input)); return buildHttpRpcRequest(context, headers, "/", void 0, body); }, "se_ListStateMachineVersionsCommand"); var se_ListTagsForResourceCommand = /* @__PURE__ */ __name(async (input, context) => { const headers = sharedHeaders("ListTagsForResource"); let body; - body = JSON.stringify((0, import_smithy_client5._json)(input)); + body = JSON.stringify((0, import_smithy_client4._json)(input)); return buildHttpRpcRequest(context, headers, "/", void 0, body); }, "se_ListTagsForResourceCommand"); var se_PublishStateMachineVersionCommand = /* @__PURE__ */ __name(async (input, context) => { const headers = sharedHeaders("PublishStateMachineVersion"); let body; - body = JSON.stringify((0, import_smithy_client5._json)(input)); + body = JSON.stringify((0, import_smithy_client4._json)(input)); return buildHttpRpcRequest(context, headers, "/", void 0, body); }, "se_PublishStateMachineVersionCommand"); var se_RedriveExecutionCommand = /* @__PURE__ */ __name(async (input, context) => { @@ -24569,31 +19909,31 @@ var require_dist_cjs80 = __commonJS({ var se_SendTaskFailureCommand = /* @__PURE__ */ __name(async (input, context) => { const headers = sharedHeaders("SendTaskFailure"); let body; - body = JSON.stringify((0, import_smithy_client5._json)(input)); + body = JSON.stringify((0, import_smithy_client4._json)(input)); return buildHttpRpcRequest(context, headers, "/", void 0, body); }, "se_SendTaskFailureCommand"); var se_SendTaskHeartbeatCommand = /* @__PURE__ */ __name(async (input, context) => { const headers = sharedHeaders("SendTaskHeartbeat"); let body; - body = JSON.stringify((0, import_smithy_client5._json)(input)); + body = JSON.stringify((0, import_smithy_client4._json)(input)); return buildHttpRpcRequest(context, headers, "/", void 0, body); }, "se_SendTaskHeartbeatCommand"); var se_SendTaskSuccessCommand = /* @__PURE__ */ __name(async (input, context) => { const headers = sharedHeaders("SendTaskSuccess"); let body; - body = JSON.stringify((0, import_smithy_client5._json)(input)); + body = JSON.stringify((0, import_smithy_client4._json)(input)); return buildHttpRpcRequest(context, headers, "/", void 0, body); }, "se_SendTaskSuccessCommand"); var se_StartExecutionCommand = /* @__PURE__ */ __name(async (input, context) => { const headers = sharedHeaders("StartExecution"); let body; - body = JSON.stringify((0, import_smithy_client5._json)(input)); + body = JSON.stringify((0, import_smithy_client4._json)(input)); return buildHttpRpcRequest(context, headers, "/", void 0, body); }, "se_StartExecutionCommand"); var se_StartSyncExecutionCommand = /* @__PURE__ */ __name(async (input, context) => { const headers = sharedHeaders("StartSyncExecution"); let body; - body = JSON.stringify((0, import_smithy_client5._json)(input)); + body = JSON.stringify((0, import_smithy_client4._json)(input)); let { hostname: resolvedHostname } = await context.endpoint(); if (context.disableHostPrefix !== true) { resolvedHostname = "sync-" + resolvedHostname; @@ -24606,19 +19946,19 @@ var require_dist_cjs80 = __commonJS({ var se_StopExecutionCommand = /* @__PURE__ */ __name(async (input, context) => { const headers = sharedHeaders("StopExecution"); let body; - body = JSON.stringify((0, import_smithy_client5._json)(input)); + body = JSON.stringify((0, import_smithy_client4._json)(input)); return buildHttpRpcRequest(context, headers, "/", void 0, body); }, "se_StopExecutionCommand"); var se_TagResourceCommand = /* @__PURE__ */ __name(async (input, context) => { const headers = sharedHeaders("TagResource"); let body; - body = JSON.stringify((0, import_smithy_client5._json)(input)); + body = JSON.stringify((0, import_smithy_client4._json)(input)); return buildHttpRpcRequest(context, headers, "/", void 0, body); }, "se_TagResourceCommand"); var se_TestStateCommand = /* @__PURE__ */ __name(async (input, context) => { const headers = sharedHeaders("TestState"); let body; - body = JSON.stringify((0, import_smithy_client5._json)(input)); + body = JSON.stringify((0, import_smithy_client4._json)(input)); let { hostname: resolvedHostname } = await context.endpoint(); if (context.disableHostPrefix !== true) { resolvedHostname = "sync-" + resolvedHostname; @@ -24631,7 +19971,7 @@ var require_dist_cjs80 = __commonJS({ var se_UntagResourceCommand = /* @__PURE__ */ __name(async (input, context) => { const headers = sharedHeaders("UntagResource"); let body; - body = JSON.stringify((0, import_smithy_client5._json)(input)); + body = JSON.stringify((0, import_smithy_client4._json)(input)); return buildHttpRpcRequest(context, headers, "/", void 0, body); }, "se_UntagResourceCommand"); var se_UpdateMapRunCommand = /* @__PURE__ */ __name(async (input, context) => { @@ -24643,19 +19983,19 @@ var require_dist_cjs80 = __commonJS({ var se_UpdateStateMachineCommand = /* @__PURE__ */ __name(async (input, context) => { const headers = sharedHeaders("UpdateStateMachine"); let body; - body = JSON.stringify((0, import_smithy_client5._json)(input)); + body = JSON.stringify((0, import_smithy_client4._json)(input)); return buildHttpRpcRequest(context, headers, "/", void 0, body); }, "se_UpdateStateMachineCommand"); var se_UpdateStateMachineAliasCommand = /* @__PURE__ */ __name(async (input, context) => { const headers = sharedHeaders("UpdateStateMachineAlias"); let body; - body = JSON.stringify((0, import_smithy_client5._json)(input)); + body = JSON.stringify((0, import_smithy_client4._json)(input)); return buildHttpRpcRequest(context, headers, "/", void 0, body); }, "se_UpdateStateMachineAliasCommand"); var se_ValidateStateMachineDefinitionCommand = /* @__PURE__ */ __name(async (input, context) => { const headers = sharedHeaders("ValidateStateMachineDefinition"); let body; - body = JSON.stringify((0, import_smithy_client5._json)(input)); + body = JSON.stringify((0, import_smithy_client4._json)(input)); return buildHttpRpcRequest(context, headers, "/", void 0, body); }, "se_ValidateStateMachineDefinitionCommand"); var de_CreateActivityCommand = /* @__PURE__ */ __name(async (output, context) => { @@ -24703,7 +20043,7 @@ var require_dist_cjs80 = __commonJS({ } const data = await (0, import_core22.parseJsonBody)(output.body, context); let contents = {}; - contents = (0, import_smithy_client5._json)(data); + contents = (0, import_smithy_client4._json)(data); const response = { $metadata: deserializeMetadata(output), ...contents @@ -24716,7 +20056,7 @@ var require_dist_cjs80 = __commonJS({ } const data = await (0, import_core22.parseJsonBody)(output.body, context); let contents = {}; - contents = (0, import_smithy_client5._json)(data); + contents = (0, import_smithy_client4._json)(data); const response = { $metadata: deserializeMetadata(output), ...contents @@ -24729,7 +20069,7 @@ var require_dist_cjs80 = __commonJS({ } const data = await (0, import_core22.parseJsonBody)(output.body, context); let contents = {}; - contents = (0, import_smithy_client5._json)(data); + contents = (0, import_smithy_client4._json)(data); const response = { $metadata: deserializeMetadata(output), ...contents @@ -24742,7 +20082,7 @@ var require_dist_cjs80 = __commonJS({ } const data = await (0, import_core22.parseJsonBody)(output.body, context); let contents = {}; - contents = (0, import_smithy_client5._json)(data); + contents = (0, import_smithy_client4._json)(data); const response = { $metadata: deserializeMetadata(output), ...contents @@ -24833,7 +20173,7 @@ var require_dist_cjs80 = __commonJS({ } const data = await (0, import_core22.parseJsonBody)(output.body, context); let contents = {}; - contents = (0, import_smithy_client5._json)(data); + contents = (0, import_smithy_client4._json)(data); const response = { $metadata: deserializeMetadata(output), ...contents @@ -24937,7 +20277,7 @@ var require_dist_cjs80 = __commonJS({ } const data = await (0, import_core22.parseJsonBody)(output.body, context); let contents = {}; - contents = (0, import_smithy_client5._json)(data); + contents = (0, import_smithy_client4._json)(data); const response = { $metadata: deserializeMetadata(output), ...contents @@ -24976,7 +20316,7 @@ var require_dist_cjs80 = __commonJS({ } const data = await (0, import_core22.parseJsonBody)(output.body, context); let contents = {}; - contents = (0, import_smithy_client5._json)(data); + contents = (0, import_smithy_client4._json)(data); const response = { $metadata: deserializeMetadata(output), ...contents @@ -24989,7 +20329,7 @@ var require_dist_cjs80 = __commonJS({ } const data = await (0, import_core22.parseJsonBody)(output.body, context); let contents = {}; - contents = (0, import_smithy_client5._json)(data); + contents = (0, import_smithy_client4._json)(data); const response = { $metadata: deserializeMetadata(output), ...contents @@ -25002,7 +20342,7 @@ var require_dist_cjs80 = __commonJS({ } const data = await (0, import_core22.parseJsonBody)(output.body, context); let contents = {}; - contents = (0, import_smithy_client5._json)(data); + contents = (0, import_smithy_client4._json)(data); const response = { $metadata: deserializeMetadata(output), ...contents @@ -25054,7 +20394,7 @@ var require_dist_cjs80 = __commonJS({ } const data = await (0, import_core22.parseJsonBody)(output.body, context); let contents = {}; - contents = (0, import_smithy_client5._json)(data); + contents = (0, import_smithy_client4._json)(data); const response = { $metadata: deserializeMetadata(output), ...contents @@ -25067,7 +20407,7 @@ var require_dist_cjs80 = __commonJS({ } const data = await (0, import_core22.parseJsonBody)(output.body, context); let contents = {}; - contents = (0, import_smithy_client5._json)(data); + contents = (0, import_smithy_client4._json)(data); const response = { $metadata: deserializeMetadata(output), ...contents @@ -25080,7 +20420,7 @@ var require_dist_cjs80 = __commonJS({ } const data = await (0, import_core22.parseJsonBody)(output.body, context); let contents = {}; - contents = (0, import_smithy_client5._json)(data); + contents = (0, import_smithy_client4._json)(data); const response = { $metadata: deserializeMetadata(output), ...contents @@ -25093,7 +20433,7 @@ var require_dist_cjs80 = __commonJS({ } const data = await (0, import_core22.parseJsonBody)(output.body, context); let contents = {}; - contents = (0, import_smithy_client5._json)(data); + contents = (0, import_smithy_client4._json)(data); const response = { $metadata: deserializeMetadata(output), ...contents @@ -25132,7 +20472,7 @@ var require_dist_cjs80 = __commonJS({ } const data = await (0, import_core22.parseJsonBody)(output.body, context); let contents = {}; - contents = (0, import_smithy_client5._json)(data); + contents = (0, import_smithy_client4._json)(data); const response = { $metadata: deserializeMetadata(output), ...contents @@ -25256,313 +20596,313 @@ var require_dist_cjs80 = __commonJS({ }, "de_CommandError"); var de_ActivityAlreadyExistsRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; - const deserialized = (0, import_smithy_client5._json)(body); + const deserialized = (0, import_smithy_client4._json)(body); const exception = new ActivityAlreadyExists({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_ActivityAlreadyExistsRes"); var de_ActivityDoesNotExistRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; - const deserialized = (0, import_smithy_client5._json)(body); + const deserialized = (0, import_smithy_client4._json)(body); const exception = new ActivityDoesNotExist({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_ActivityDoesNotExistRes"); var de_ActivityLimitExceededRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; - const deserialized = (0, import_smithy_client5._json)(body); + const deserialized = (0, import_smithy_client4._json)(body); const exception = new ActivityLimitExceeded({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_ActivityLimitExceededRes"); var de_ActivityWorkerLimitExceededRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; - const deserialized = (0, import_smithy_client5._json)(body); + const deserialized = (0, import_smithy_client4._json)(body); const exception = new ActivityWorkerLimitExceeded({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_ActivityWorkerLimitExceededRes"); var de_ConflictExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; - const deserialized = (0, import_smithy_client5._json)(body); + const deserialized = (0, import_smithy_client4._json)(body); const exception = new ConflictException({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_ConflictExceptionRes"); var de_ExecutionAlreadyExistsRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; - const deserialized = (0, import_smithy_client5._json)(body); + const deserialized = (0, import_smithy_client4._json)(body); const exception = new ExecutionAlreadyExists({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_ExecutionAlreadyExistsRes"); var de_ExecutionDoesNotExistRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; - const deserialized = (0, import_smithy_client5._json)(body); + const deserialized = (0, import_smithy_client4._json)(body); const exception = new ExecutionDoesNotExist({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_ExecutionDoesNotExistRes"); var de_ExecutionLimitExceededRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; - const deserialized = (0, import_smithy_client5._json)(body); + const deserialized = (0, import_smithy_client4._json)(body); const exception = new ExecutionLimitExceeded({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_ExecutionLimitExceededRes"); var de_ExecutionNotRedrivableRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; - const deserialized = (0, import_smithy_client5._json)(body); + const deserialized = (0, import_smithy_client4._json)(body); const exception = new ExecutionNotRedrivable({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_ExecutionNotRedrivableRes"); var de_InvalidArnRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; - const deserialized = (0, import_smithy_client5._json)(body); + const deserialized = (0, import_smithy_client4._json)(body); const exception = new InvalidArn({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_InvalidArnRes"); var de_InvalidDefinitionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; - const deserialized = (0, import_smithy_client5._json)(body); + const deserialized = (0, import_smithy_client4._json)(body); const exception = new InvalidDefinition({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_InvalidDefinitionRes"); var de_InvalidEncryptionConfigurationRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; - const deserialized = (0, import_smithy_client5._json)(body); + const deserialized = (0, import_smithy_client4._json)(body); const exception = new InvalidEncryptionConfiguration({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_InvalidEncryptionConfigurationRes"); var de_InvalidExecutionInputRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; - const deserialized = (0, import_smithy_client5._json)(body); + const deserialized = (0, import_smithy_client4._json)(body); const exception = new InvalidExecutionInput({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_InvalidExecutionInputRes"); var de_InvalidLoggingConfigurationRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; - const deserialized = (0, import_smithy_client5._json)(body); + const deserialized = (0, import_smithy_client4._json)(body); const exception = new InvalidLoggingConfiguration({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_InvalidLoggingConfigurationRes"); var de_InvalidNameRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; - const deserialized = (0, import_smithy_client5._json)(body); + const deserialized = (0, import_smithy_client4._json)(body); const exception = new InvalidName({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_InvalidNameRes"); var de_InvalidOutputRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; - const deserialized = (0, import_smithy_client5._json)(body); + const deserialized = (0, import_smithy_client4._json)(body); const exception = new InvalidOutput({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_InvalidOutputRes"); var de_InvalidTokenRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; - const deserialized = (0, import_smithy_client5._json)(body); + const deserialized = (0, import_smithy_client4._json)(body); const exception = new InvalidToken({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_InvalidTokenRes"); var de_InvalidTracingConfigurationRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; - const deserialized = (0, import_smithy_client5._json)(body); + const deserialized = (0, import_smithy_client4._json)(body); const exception = new InvalidTracingConfiguration({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_InvalidTracingConfigurationRes"); var de_KmsAccessDeniedExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; - const deserialized = (0, import_smithy_client5._json)(body); + const deserialized = (0, import_smithy_client4._json)(body); const exception = new KmsAccessDeniedException({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_KmsAccessDeniedExceptionRes"); var de_KmsInvalidStateExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; - const deserialized = (0, import_smithy_client5._json)(body); + const deserialized = (0, import_smithy_client4._json)(body); const exception = new KmsInvalidStateException({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_KmsInvalidStateExceptionRes"); var de_KmsThrottlingExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; - const deserialized = (0, import_smithy_client5._json)(body); + const deserialized = (0, import_smithy_client4._json)(body); const exception = new KmsThrottlingException({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_KmsThrottlingExceptionRes"); var de_MissingRequiredParameterRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; - const deserialized = (0, import_smithy_client5._json)(body); + const deserialized = (0, import_smithy_client4._json)(body); const exception = new MissingRequiredParameter({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_MissingRequiredParameterRes"); var de_ResourceNotFoundRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; - const deserialized = (0, import_smithy_client5._json)(body); + const deserialized = (0, import_smithy_client4._json)(body); const exception = new ResourceNotFound({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_ResourceNotFoundRes"); var de_ServiceQuotaExceededExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; - const deserialized = (0, import_smithy_client5._json)(body); + const deserialized = (0, import_smithy_client4._json)(body); const exception = new ServiceQuotaExceededException({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_ServiceQuotaExceededExceptionRes"); var de_StateMachineAlreadyExistsRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; - const deserialized = (0, import_smithy_client5._json)(body); + const deserialized = (0, import_smithy_client4._json)(body); const exception = new StateMachineAlreadyExists({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_StateMachineAlreadyExistsRes"); var de_StateMachineDeletingRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; - const deserialized = (0, import_smithy_client5._json)(body); + const deserialized = (0, import_smithy_client4._json)(body); const exception = new StateMachineDeleting({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_StateMachineDeletingRes"); var de_StateMachineDoesNotExistRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; - const deserialized = (0, import_smithy_client5._json)(body); + const deserialized = (0, import_smithy_client4._json)(body); const exception = new StateMachineDoesNotExist({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_StateMachineDoesNotExistRes"); var de_StateMachineLimitExceededRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; - const deserialized = (0, import_smithy_client5._json)(body); + const deserialized = (0, import_smithy_client4._json)(body); const exception = new StateMachineLimitExceeded({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_StateMachineLimitExceededRes"); var de_StateMachineTypeNotSupportedRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; - const deserialized = (0, import_smithy_client5._json)(body); + const deserialized = (0, import_smithy_client4._json)(body); const exception = new StateMachineTypeNotSupported({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_StateMachineTypeNotSupportedRes"); var de_TaskDoesNotExistRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; - const deserialized = (0, import_smithy_client5._json)(body); + const deserialized = (0, import_smithy_client4._json)(body); const exception = new TaskDoesNotExist({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_TaskDoesNotExistRes"); var de_TaskTimedOutRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; - const deserialized = (0, import_smithy_client5._json)(body); + const deserialized = (0, import_smithy_client4._json)(body); const exception = new TaskTimedOut({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_TaskTimedOutRes"); var de_TooManyTagsRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; - const deserialized = (0, import_smithy_client5._json)(body); + const deserialized = (0, import_smithy_client4._json)(body); const exception = new TooManyTags({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_TooManyTagsRes"); var de_ValidationExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { const body = parsedOutput.body; - const deserialized = (0, import_smithy_client5._json)(body); + const deserialized = (0, import_smithy_client4._json)(body); const exception = new ValidationException({ $metadata: deserializeMetadata(parsedOutput), ...deserialized }); - return (0, import_smithy_client5.decorateServiceException)(exception, body); + return (0, import_smithy_client4.decorateServiceException)(exception, body); }, "de_ValidationExceptionRes"); var se_RedriveExecutionInput = /* @__PURE__ */ __name((input, context) => { - return (0, import_smithy_client5.take)(input, { + return (0, import_smithy_client4.take)(input, { clientToken: [true, (_) => _ ?? (0, import_uuid.v4)()], executionArn: [] }); }, "se_RedriveExecutionInput"); var se_UpdateMapRunInput = /* @__PURE__ */ __name((input, context) => { - return (0, import_smithy_client5.take)(input, { + return (0, import_smithy_client4.take)(input, { mapRunArn: [], maxConcurrency: [], toleratedFailureCount: [], - toleratedFailurePercentage: import_smithy_client5.serializeFloat + toleratedFailurePercentage: import_smithy_client4.serializeFloat }); }, "se_UpdateMapRunInput"); var de_ActivityList = /* @__PURE__ */ __name((output, context) => { @@ -25572,119 +20912,119 @@ var require_dist_cjs80 = __commonJS({ return retVal; }, "de_ActivityList"); var de_ActivityListItem = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client5.take)(output, { - activityArn: import_smithy_client5.expectString, - creationDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))), - name: import_smithy_client5.expectString + return (0, import_smithy_client4.take)(output, { + activityArn: import_smithy_client4.expectString, + creationDate: (_) => (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.parseEpochTimestamp)((0, import_smithy_client4.expectNumber)(_))), + name: import_smithy_client4.expectString }); }, "de_ActivityListItem"); var de_CreateActivityOutput = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client5.take)(output, { - activityArn: import_smithy_client5.expectString, - creationDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))) + return (0, import_smithy_client4.take)(output, { + activityArn: import_smithy_client4.expectString, + creationDate: (_) => (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.parseEpochTimestamp)((0, import_smithy_client4.expectNumber)(_))) }); }, "de_CreateActivityOutput"); var de_CreateStateMachineAliasOutput = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client5.take)(output, { - creationDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))), - stateMachineAliasArn: import_smithy_client5.expectString + return (0, import_smithy_client4.take)(output, { + creationDate: (_) => (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.parseEpochTimestamp)((0, import_smithy_client4.expectNumber)(_))), + stateMachineAliasArn: import_smithy_client4.expectString }); }, "de_CreateStateMachineAliasOutput"); var de_CreateStateMachineOutput = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client5.take)(output, { - creationDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))), - stateMachineArn: import_smithy_client5.expectString, - stateMachineVersionArn: import_smithy_client5.expectString + return (0, import_smithy_client4.take)(output, { + creationDate: (_) => (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.parseEpochTimestamp)((0, import_smithy_client4.expectNumber)(_))), + stateMachineArn: import_smithy_client4.expectString, + stateMachineVersionArn: import_smithy_client4.expectString }); }, "de_CreateStateMachineOutput"); var de_DescribeActivityOutput = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client5.take)(output, { - activityArn: import_smithy_client5.expectString, - creationDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))), - encryptionConfiguration: import_smithy_client5._json, - name: import_smithy_client5.expectString + return (0, import_smithy_client4.take)(output, { + activityArn: import_smithy_client4.expectString, + creationDate: (_) => (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.parseEpochTimestamp)((0, import_smithy_client4.expectNumber)(_))), + encryptionConfiguration: import_smithy_client4._json, + name: import_smithy_client4.expectString }); }, "de_DescribeActivityOutput"); var de_DescribeExecutionOutput = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client5.take)(output, { - cause: import_smithy_client5.expectString, - error: import_smithy_client5.expectString, - executionArn: import_smithy_client5.expectString, - input: import_smithy_client5.expectString, - inputDetails: import_smithy_client5._json, - mapRunArn: import_smithy_client5.expectString, - name: import_smithy_client5.expectString, - output: import_smithy_client5.expectString, - outputDetails: import_smithy_client5._json, - redriveCount: import_smithy_client5.expectInt32, - redriveDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))), - redriveStatus: import_smithy_client5.expectString, - redriveStatusReason: import_smithy_client5.expectString, - startDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))), - stateMachineAliasArn: import_smithy_client5.expectString, - stateMachineArn: import_smithy_client5.expectString, - stateMachineVersionArn: import_smithy_client5.expectString, - status: import_smithy_client5.expectString, - stopDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))), - traceHeader: import_smithy_client5.expectString + return (0, import_smithy_client4.take)(output, { + cause: import_smithy_client4.expectString, + error: import_smithy_client4.expectString, + executionArn: import_smithy_client4.expectString, + input: import_smithy_client4.expectString, + inputDetails: import_smithy_client4._json, + mapRunArn: import_smithy_client4.expectString, + name: import_smithy_client4.expectString, + output: import_smithy_client4.expectString, + outputDetails: import_smithy_client4._json, + redriveCount: import_smithy_client4.expectInt32, + redriveDate: (_) => (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.parseEpochTimestamp)((0, import_smithy_client4.expectNumber)(_))), + redriveStatus: import_smithy_client4.expectString, + redriveStatusReason: import_smithy_client4.expectString, + startDate: (_) => (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.parseEpochTimestamp)((0, import_smithy_client4.expectNumber)(_))), + stateMachineAliasArn: import_smithy_client4.expectString, + stateMachineArn: import_smithy_client4.expectString, + stateMachineVersionArn: import_smithy_client4.expectString, + status: import_smithy_client4.expectString, + stopDate: (_) => (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.parseEpochTimestamp)((0, import_smithy_client4.expectNumber)(_))), + traceHeader: import_smithy_client4.expectString }); }, "de_DescribeExecutionOutput"); var de_DescribeMapRunOutput = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client5.take)(output, { - executionArn: import_smithy_client5.expectString, - executionCounts: import_smithy_client5._json, - itemCounts: import_smithy_client5._json, - mapRunArn: import_smithy_client5.expectString, - maxConcurrency: import_smithy_client5.expectInt32, - redriveCount: import_smithy_client5.expectInt32, - redriveDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))), - startDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))), - status: import_smithy_client5.expectString, - stopDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))), - toleratedFailureCount: import_smithy_client5.expectLong, - toleratedFailurePercentage: import_smithy_client5.limitedParseFloat32 + return (0, import_smithy_client4.take)(output, { + executionArn: import_smithy_client4.expectString, + executionCounts: import_smithy_client4._json, + itemCounts: import_smithy_client4._json, + mapRunArn: import_smithy_client4.expectString, + maxConcurrency: import_smithy_client4.expectInt32, + redriveCount: import_smithy_client4.expectInt32, + redriveDate: (_) => (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.parseEpochTimestamp)((0, import_smithy_client4.expectNumber)(_))), + startDate: (_) => (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.parseEpochTimestamp)((0, import_smithy_client4.expectNumber)(_))), + status: import_smithy_client4.expectString, + stopDate: (_) => (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.parseEpochTimestamp)((0, import_smithy_client4.expectNumber)(_))), + toleratedFailureCount: import_smithy_client4.expectLong, + toleratedFailurePercentage: import_smithy_client4.limitedParseFloat32 }); }, "de_DescribeMapRunOutput"); var de_DescribeStateMachineAliasOutput = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client5.take)(output, { - creationDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))), - description: import_smithy_client5.expectString, - name: import_smithy_client5.expectString, - routingConfiguration: import_smithy_client5._json, - stateMachineAliasArn: import_smithy_client5.expectString, - updateDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))) + return (0, import_smithy_client4.take)(output, { + creationDate: (_) => (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.parseEpochTimestamp)((0, import_smithy_client4.expectNumber)(_))), + description: import_smithy_client4.expectString, + name: import_smithy_client4.expectString, + routingConfiguration: import_smithy_client4._json, + stateMachineAliasArn: import_smithy_client4.expectString, + updateDate: (_) => (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.parseEpochTimestamp)((0, import_smithy_client4.expectNumber)(_))) }); }, "de_DescribeStateMachineAliasOutput"); var de_DescribeStateMachineForExecutionOutput = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client5.take)(output, { - definition: import_smithy_client5.expectString, - encryptionConfiguration: import_smithy_client5._json, - label: import_smithy_client5.expectString, - loggingConfiguration: import_smithy_client5._json, - mapRunArn: import_smithy_client5.expectString, - name: import_smithy_client5.expectString, - revisionId: import_smithy_client5.expectString, - roleArn: import_smithy_client5.expectString, - stateMachineArn: import_smithy_client5.expectString, - tracingConfiguration: import_smithy_client5._json, - updateDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))) + return (0, import_smithy_client4.take)(output, { + definition: import_smithy_client4.expectString, + encryptionConfiguration: import_smithy_client4._json, + label: import_smithy_client4.expectString, + loggingConfiguration: import_smithy_client4._json, + mapRunArn: import_smithy_client4.expectString, + name: import_smithy_client4.expectString, + revisionId: import_smithy_client4.expectString, + roleArn: import_smithy_client4.expectString, + stateMachineArn: import_smithy_client4.expectString, + tracingConfiguration: import_smithy_client4._json, + updateDate: (_) => (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.parseEpochTimestamp)((0, import_smithy_client4.expectNumber)(_))) }); }, "de_DescribeStateMachineForExecutionOutput"); var de_DescribeStateMachineOutput = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client5.take)(output, { - creationDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))), - definition: import_smithy_client5.expectString, - description: import_smithy_client5.expectString, - encryptionConfiguration: import_smithy_client5._json, - label: import_smithy_client5.expectString, - loggingConfiguration: import_smithy_client5._json, - name: import_smithy_client5.expectString, - revisionId: import_smithy_client5.expectString, - roleArn: import_smithy_client5.expectString, - stateMachineArn: import_smithy_client5.expectString, - status: import_smithy_client5.expectString, - tracingConfiguration: import_smithy_client5._json, - type: import_smithy_client5.expectString + return (0, import_smithy_client4.take)(output, { + creationDate: (_) => (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.parseEpochTimestamp)((0, import_smithy_client4.expectNumber)(_))), + definition: import_smithy_client4.expectString, + description: import_smithy_client4.expectString, + encryptionConfiguration: import_smithy_client4._json, + label: import_smithy_client4.expectString, + loggingConfiguration: import_smithy_client4._json, + name: import_smithy_client4.expectString, + revisionId: import_smithy_client4.expectString, + roleArn: import_smithy_client4.expectString, + stateMachineArn: import_smithy_client4.expectString, + status: import_smithy_client4.expectString, + tracingConfiguration: import_smithy_client4._json, + type: import_smithy_client4.expectString }); }, "de_DescribeStateMachineOutput"); var de_ExecutionList = /* @__PURE__ */ __name((output, context) => { @@ -25694,69 +21034,69 @@ var require_dist_cjs80 = __commonJS({ return retVal; }, "de_ExecutionList"); var de_ExecutionListItem = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client5.take)(output, { - executionArn: import_smithy_client5.expectString, - itemCount: import_smithy_client5.expectInt32, - mapRunArn: import_smithy_client5.expectString, - name: import_smithy_client5.expectString, - redriveCount: import_smithy_client5.expectInt32, - redriveDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))), - startDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))), - stateMachineAliasArn: import_smithy_client5.expectString, - stateMachineArn: import_smithy_client5.expectString, - stateMachineVersionArn: import_smithy_client5.expectString, - status: import_smithy_client5.expectString, - stopDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))) + return (0, import_smithy_client4.take)(output, { + executionArn: import_smithy_client4.expectString, + itemCount: import_smithy_client4.expectInt32, + mapRunArn: import_smithy_client4.expectString, + name: import_smithy_client4.expectString, + redriveCount: import_smithy_client4.expectInt32, + redriveDate: (_) => (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.parseEpochTimestamp)((0, import_smithy_client4.expectNumber)(_))), + startDate: (_) => (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.parseEpochTimestamp)((0, import_smithy_client4.expectNumber)(_))), + stateMachineAliasArn: import_smithy_client4.expectString, + stateMachineArn: import_smithy_client4.expectString, + stateMachineVersionArn: import_smithy_client4.expectString, + status: import_smithy_client4.expectString, + stopDate: (_) => (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.parseEpochTimestamp)((0, import_smithy_client4.expectNumber)(_))) }); }, "de_ExecutionListItem"); var de_GetExecutionHistoryOutput = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client5.take)(output, { + return (0, import_smithy_client4.take)(output, { events: (_) => de_HistoryEventList(_, context), - nextToken: import_smithy_client5.expectString + nextToken: import_smithy_client4.expectString }); }, "de_GetExecutionHistoryOutput"); var de_HistoryEvent = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client5.take)(output, { - activityFailedEventDetails: import_smithy_client5._json, - activityScheduleFailedEventDetails: import_smithy_client5._json, - activityScheduledEventDetails: import_smithy_client5._json, - activityStartedEventDetails: import_smithy_client5._json, - activitySucceededEventDetails: import_smithy_client5._json, - activityTimedOutEventDetails: import_smithy_client5._json, - executionAbortedEventDetails: import_smithy_client5._json, - executionFailedEventDetails: import_smithy_client5._json, - executionRedrivenEventDetails: import_smithy_client5._json, - executionStartedEventDetails: import_smithy_client5._json, - executionSucceededEventDetails: import_smithy_client5._json, - executionTimedOutEventDetails: import_smithy_client5._json, - id: import_smithy_client5.expectLong, - lambdaFunctionFailedEventDetails: import_smithy_client5._json, - lambdaFunctionScheduleFailedEventDetails: import_smithy_client5._json, - lambdaFunctionScheduledEventDetails: import_smithy_client5._json, - lambdaFunctionStartFailedEventDetails: import_smithy_client5._json, - lambdaFunctionSucceededEventDetails: import_smithy_client5._json, - lambdaFunctionTimedOutEventDetails: import_smithy_client5._json, - mapIterationAbortedEventDetails: import_smithy_client5._json, - mapIterationFailedEventDetails: import_smithy_client5._json, - mapIterationStartedEventDetails: import_smithy_client5._json, - mapIterationSucceededEventDetails: import_smithy_client5._json, - mapRunFailedEventDetails: import_smithy_client5._json, - mapRunRedrivenEventDetails: import_smithy_client5._json, - mapRunStartedEventDetails: import_smithy_client5._json, - mapStateStartedEventDetails: import_smithy_client5._json, - previousEventId: import_smithy_client5.expectLong, - stateEnteredEventDetails: import_smithy_client5._json, - stateExitedEventDetails: import_smithy_client5._json, - taskFailedEventDetails: import_smithy_client5._json, - taskScheduledEventDetails: import_smithy_client5._json, - taskStartFailedEventDetails: import_smithy_client5._json, - taskStartedEventDetails: import_smithy_client5._json, - taskSubmitFailedEventDetails: import_smithy_client5._json, - taskSubmittedEventDetails: import_smithy_client5._json, - taskSucceededEventDetails: import_smithy_client5._json, - taskTimedOutEventDetails: import_smithy_client5._json, - timestamp: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))), - type: import_smithy_client5.expectString + return (0, import_smithy_client4.take)(output, { + activityFailedEventDetails: import_smithy_client4._json, + activityScheduleFailedEventDetails: import_smithy_client4._json, + activityScheduledEventDetails: import_smithy_client4._json, + activityStartedEventDetails: import_smithy_client4._json, + activitySucceededEventDetails: import_smithy_client4._json, + activityTimedOutEventDetails: import_smithy_client4._json, + executionAbortedEventDetails: import_smithy_client4._json, + executionFailedEventDetails: import_smithy_client4._json, + executionRedrivenEventDetails: import_smithy_client4._json, + executionStartedEventDetails: import_smithy_client4._json, + executionSucceededEventDetails: import_smithy_client4._json, + executionTimedOutEventDetails: import_smithy_client4._json, + id: import_smithy_client4.expectLong, + lambdaFunctionFailedEventDetails: import_smithy_client4._json, + lambdaFunctionScheduleFailedEventDetails: import_smithy_client4._json, + lambdaFunctionScheduledEventDetails: import_smithy_client4._json, + lambdaFunctionStartFailedEventDetails: import_smithy_client4._json, + lambdaFunctionSucceededEventDetails: import_smithy_client4._json, + lambdaFunctionTimedOutEventDetails: import_smithy_client4._json, + mapIterationAbortedEventDetails: import_smithy_client4._json, + mapIterationFailedEventDetails: import_smithy_client4._json, + mapIterationStartedEventDetails: import_smithy_client4._json, + mapIterationSucceededEventDetails: import_smithy_client4._json, + mapRunFailedEventDetails: import_smithy_client4._json, + mapRunRedrivenEventDetails: import_smithy_client4._json, + mapRunStartedEventDetails: import_smithy_client4._json, + mapStateStartedEventDetails: import_smithy_client4._json, + previousEventId: import_smithy_client4.expectLong, + stateEnteredEventDetails: import_smithy_client4._json, + stateExitedEventDetails: import_smithy_client4._json, + taskFailedEventDetails: import_smithy_client4._json, + taskScheduledEventDetails: import_smithy_client4._json, + taskStartFailedEventDetails: import_smithy_client4._json, + taskStartedEventDetails: import_smithy_client4._json, + taskSubmitFailedEventDetails: import_smithy_client4._json, + taskSubmittedEventDetails: import_smithy_client4._json, + taskSucceededEventDetails: import_smithy_client4._json, + taskTimedOutEventDetails: import_smithy_client4._json, + timestamp: (_) => (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.parseEpochTimestamp)((0, import_smithy_client4.expectNumber)(_))), + type: import_smithy_client4.expectString }); }, "de_HistoryEvent"); var de_HistoryEventList = /* @__PURE__ */ __name((output, context) => { @@ -25766,38 +21106,38 @@ var require_dist_cjs80 = __commonJS({ return retVal; }, "de_HistoryEventList"); var de_ListActivitiesOutput = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client5.take)(output, { + return (0, import_smithy_client4.take)(output, { activities: (_) => de_ActivityList(_, context), - nextToken: import_smithy_client5.expectString + nextToken: import_smithy_client4.expectString }); }, "de_ListActivitiesOutput"); var de_ListExecutionsOutput = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client5.take)(output, { + return (0, import_smithy_client4.take)(output, { executions: (_) => de_ExecutionList(_, context), - nextToken: import_smithy_client5.expectString + nextToken: import_smithy_client4.expectString }); }, "de_ListExecutionsOutput"); var de_ListMapRunsOutput = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client5.take)(output, { + return (0, import_smithy_client4.take)(output, { mapRuns: (_) => de_MapRunList(_, context), - nextToken: import_smithy_client5.expectString + nextToken: import_smithy_client4.expectString }); }, "de_ListMapRunsOutput"); var de_ListStateMachineAliasesOutput = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client5.take)(output, { - nextToken: import_smithy_client5.expectString, + return (0, import_smithy_client4.take)(output, { + nextToken: import_smithy_client4.expectString, stateMachineAliases: (_) => de_StateMachineAliasList(_, context) }); }, "de_ListStateMachineAliasesOutput"); var de_ListStateMachinesOutput = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client5.take)(output, { - nextToken: import_smithy_client5.expectString, + return (0, import_smithy_client4.take)(output, { + nextToken: import_smithy_client4.expectString, stateMachines: (_) => de_StateMachineList(_, context) }); }, "de_ListStateMachinesOutput"); var de_ListStateMachineVersionsOutput = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client5.take)(output, { - nextToken: import_smithy_client5.expectString, + return (0, import_smithy_client4.take)(output, { + nextToken: import_smithy_client4.expectString, stateMachineVersions: (_) => de_StateMachineVersionList(_, context) }); }, "de_ListStateMachineVersionsOutput"); @@ -25808,47 +21148,47 @@ var require_dist_cjs80 = __commonJS({ return retVal; }, "de_MapRunList"); var de_MapRunListItem = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client5.take)(output, { - executionArn: import_smithy_client5.expectString, - mapRunArn: import_smithy_client5.expectString, - startDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))), - stateMachineArn: import_smithy_client5.expectString, - stopDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))) + return (0, import_smithy_client4.take)(output, { + executionArn: import_smithy_client4.expectString, + mapRunArn: import_smithy_client4.expectString, + startDate: (_) => (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.parseEpochTimestamp)((0, import_smithy_client4.expectNumber)(_))), + stateMachineArn: import_smithy_client4.expectString, + stopDate: (_) => (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.parseEpochTimestamp)((0, import_smithy_client4.expectNumber)(_))) }); }, "de_MapRunListItem"); var de_PublishStateMachineVersionOutput = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client5.take)(output, { - creationDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))), - stateMachineVersionArn: import_smithy_client5.expectString + return (0, import_smithy_client4.take)(output, { + creationDate: (_) => (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.parseEpochTimestamp)((0, import_smithy_client4.expectNumber)(_))), + stateMachineVersionArn: import_smithy_client4.expectString }); }, "de_PublishStateMachineVersionOutput"); var de_RedriveExecutionOutput = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client5.take)(output, { - redriveDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))) + return (0, import_smithy_client4.take)(output, { + redriveDate: (_) => (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.parseEpochTimestamp)((0, import_smithy_client4.expectNumber)(_))) }); }, "de_RedriveExecutionOutput"); var de_StartExecutionOutput = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client5.take)(output, { - executionArn: import_smithy_client5.expectString, - startDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))) + return (0, import_smithy_client4.take)(output, { + executionArn: import_smithy_client4.expectString, + startDate: (_) => (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.parseEpochTimestamp)((0, import_smithy_client4.expectNumber)(_))) }); }, "de_StartExecutionOutput"); var de_StartSyncExecutionOutput = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client5.take)(output, { - billingDetails: import_smithy_client5._json, - cause: import_smithy_client5.expectString, - error: import_smithy_client5.expectString, - executionArn: import_smithy_client5.expectString, - input: import_smithy_client5.expectString, - inputDetails: import_smithy_client5._json, - name: import_smithy_client5.expectString, - output: import_smithy_client5.expectString, - outputDetails: import_smithy_client5._json, - startDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))), - stateMachineArn: import_smithy_client5.expectString, - status: import_smithy_client5.expectString, - stopDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))), - traceHeader: import_smithy_client5.expectString + return (0, import_smithy_client4.take)(output, { + billingDetails: import_smithy_client4._json, + cause: import_smithy_client4.expectString, + error: import_smithy_client4.expectString, + executionArn: import_smithy_client4.expectString, + input: import_smithy_client4.expectString, + inputDetails: import_smithy_client4._json, + name: import_smithy_client4.expectString, + output: import_smithy_client4.expectString, + outputDetails: import_smithy_client4._json, + startDate: (_) => (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.parseEpochTimestamp)((0, import_smithy_client4.expectNumber)(_))), + stateMachineArn: import_smithy_client4.expectString, + status: import_smithy_client4.expectString, + stopDate: (_) => (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.parseEpochTimestamp)((0, import_smithy_client4.expectNumber)(_))), + traceHeader: import_smithy_client4.expectString }); }, "de_StartSyncExecutionOutput"); var de_StateMachineAliasList = /* @__PURE__ */ __name((output, context) => { @@ -25858,9 +21198,9 @@ var require_dist_cjs80 = __commonJS({ return retVal; }, "de_StateMachineAliasList"); var de_StateMachineAliasListItem = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client5.take)(output, { - creationDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))), - stateMachineAliasArn: import_smithy_client5.expectString + return (0, import_smithy_client4.take)(output, { + creationDate: (_) => (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.parseEpochTimestamp)((0, import_smithy_client4.expectNumber)(_))), + stateMachineAliasArn: import_smithy_client4.expectString }); }, "de_StateMachineAliasListItem"); var de_StateMachineList = /* @__PURE__ */ __name((output, context) => { @@ -25870,11 +21210,11 @@ var require_dist_cjs80 = __commonJS({ return retVal; }, "de_StateMachineList"); var de_StateMachineListItem = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client5.take)(output, { - creationDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))), - name: import_smithy_client5.expectString, - stateMachineArn: import_smithy_client5.expectString, - type: import_smithy_client5.expectString + return (0, import_smithy_client4.take)(output, { + creationDate: (_) => (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.parseEpochTimestamp)((0, import_smithy_client4.expectNumber)(_))), + name: import_smithy_client4.expectString, + stateMachineArn: import_smithy_client4.expectString, + type: import_smithy_client4.expectString }); }, "de_StateMachineListItem"); var de_StateMachineVersionList = /* @__PURE__ */ __name((output, context) => { @@ -25884,26 +21224,26 @@ var require_dist_cjs80 = __commonJS({ return retVal; }, "de_StateMachineVersionList"); var de_StateMachineVersionListItem = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client5.take)(output, { - creationDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))), - stateMachineVersionArn: import_smithy_client5.expectString + return (0, import_smithy_client4.take)(output, { + creationDate: (_) => (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.parseEpochTimestamp)((0, import_smithy_client4.expectNumber)(_))), + stateMachineVersionArn: import_smithy_client4.expectString }); }, "de_StateMachineVersionListItem"); var de_StopExecutionOutput = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client5.take)(output, { - stopDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))) + return (0, import_smithy_client4.take)(output, { + stopDate: (_) => (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.parseEpochTimestamp)((0, import_smithy_client4.expectNumber)(_))) }); }, "de_StopExecutionOutput"); var de_UpdateStateMachineAliasOutput = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client5.take)(output, { - updateDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))) + return (0, import_smithy_client4.take)(output, { + updateDate: (_) => (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.parseEpochTimestamp)((0, import_smithy_client4.expectNumber)(_))) }); }, "de_UpdateStateMachineAliasOutput"); var de_UpdateStateMachineOutput = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client5.take)(output, { - revisionId: import_smithy_client5.expectString, - stateMachineVersionArn: import_smithy_client5.expectString, - updateDate: (_) => (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.parseEpochTimestamp)((0, import_smithy_client5.expectNumber)(_))) + return (0, import_smithy_client4.take)(output, { + revisionId: import_smithy_client4.expectString, + stateMachineVersionArn: import_smithy_client4.expectString, + updateDate: (_) => (0, import_smithy_client4.expectNonNull)((0, import_smithy_client4.parseEpochTimestamp)((0, import_smithy_client4.expectNumber)(_))) }); }, "de_UpdateStateMachineOutput"); var deserializeMetadata = /* @__PURE__ */ __name((output) => ({ @@ -25912,7 +21252,7 @@ var require_dist_cjs80 = __commonJS({ extendedRequestId: output.headers["x-amz-id-2"], cfId: output.headers["x-amz-cf-id"] }), "deserializeMetadata"); - var throwDefaultError = (0, import_smithy_client5.withBaseException)(SFNServiceException); + var throwDefaultError = (0, import_smithy_client4.withBaseException)(SFNServiceException); var buildHttpRpcRequest = /* @__PURE__ */ __name(async (context, headers, path, resolvedHostname, body) => { const { hostname, protocol = "https", port, path: basePath } = await context.endpoint(); const contents = { @@ -25938,408 +21278,408 @@ var require_dist_cjs80 = __commonJS({ }; } __name(sharedHeaders, "sharedHeaders"); - var _CreateActivityCommand = class _CreateActivityCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _CreateActivityCommand = class _CreateActivityCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSStepFunctions", "CreateActivity", {}).n("SFNClient", "CreateActivityCommand").f(void 0, void 0).ser(se_CreateActivityCommand).de(de_CreateActivityCommand).build() { }; __name(_CreateActivityCommand, "CreateActivityCommand"); var CreateActivityCommand = _CreateActivityCommand; - var _CreateStateMachineAliasCommand = class _CreateStateMachineAliasCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _CreateStateMachineAliasCommand = class _CreateStateMachineAliasCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSStepFunctions", "CreateStateMachineAlias", {}).n("SFNClient", "CreateStateMachineAliasCommand").f(CreateStateMachineAliasInputFilterSensitiveLog, void 0).ser(se_CreateStateMachineAliasCommand).de(de_CreateStateMachineAliasCommand).build() { }; __name(_CreateStateMachineAliasCommand, "CreateStateMachineAliasCommand"); var CreateStateMachineAliasCommand = _CreateStateMachineAliasCommand; - var _CreateStateMachineCommand = class _CreateStateMachineCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _CreateStateMachineCommand = class _CreateStateMachineCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSStepFunctions", "CreateStateMachine", {}).n("SFNClient", "CreateStateMachineCommand").f(CreateStateMachineInputFilterSensitiveLog, void 0).ser(se_CreateStateMachineCommand).de(de_CreateStateMachineCommand).build() { }; __name(_CreateStateMachineCommand, "CreateStateMachineCommand"); var CreateStateMachineCommand = _CreateStateMachineCommand; - var _DeleteActivityCommand = class _DeleteActivityCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _DeleteActivityCommand = class _DeleteActivityCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSStepFunctions", "DeleteActivity", {}).n("SFNClient", "DeleteActivityCommand").f(void 0, void 0).ser(se_DeleteActivityCommand).de(de_DeleteActivityCommand).build() { }; __name(_DeleteActivityCommand, "DeleteActivityCommand"); var DeleteActivityCommand = _DeleteActivityCommand; - var _DeleteStateMachineAliasCommand = class _DeleteStateMachineAliasCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _DeleteStateMachineAliasCommand = class _DeleteStateMachineAliasCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSStepFunctions", "DeleteStateMachineAlias", {}).n("SFNClient", "DeleteStateMachineAliasCommand").f(void 0, void 0).ser(se_DeleteStateMachineAliasCommand).de(de_DeleteStateMachineAliasCommand).build() { }; __name(_DeleteStateMachineAliasCommand, "DeleteStateMachineAliasCommand"); var DeleteStateMachineAliasCommand = _DeleteStateMachineAliasCommand; - var _DeleteStateMachineCommand = class _DeleteStateMachineCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _DeleteStateMachineCommand = class _DeleteStateMachineCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSStepFunctions", "DeleteStateMachine", {}).n("SFNClient", "DeleteStateMachineCommand").f(void 0, void 0).ser(se_DeleteStateMachineCommand).de(de_DeleteStateMachineCommand).build() { }; __name(_DeleteStateMachineCommand, "DeleteStateMachineCommand"); var DeleteStateMachineCommand = _DeleteStateMachineCommand; - var _DeleteStateMachineVersionCommand = class _DeleteStateMachineVersionCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _DeleteStateMachineVersionCommand = class _DeleteStateMachineVersionCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSStepFunctions", "DeleteStateMachineVersion", {}).n("SFNClient", "DeleteStateMachineVersionCommand").f(void 0, void 0).ser(se_DeleteStateMachineVersionCommand).de(de_DeleteStateMachineVersionCommand).build() { }; __name(_DeleteStateMachineVersionCommand, "DeleteStateMachineVersionCommand"); var DeleteStateMachineVersionCommand = _DeleteStateMachineVersionCommand; - var _DescribeActivityCommand = class _DescribeActivityCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _DescribeActivityCommand = class _DescribeActivityCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSStepFunctions", "DescribeActivity", {}).n("SFNClient", "DescribeActivityCommand").f(void 0, void 0).ser(se_DescribeActivityCommand).de(de_DescribeActivityCommand).build() { }; __name(_DescribeActivityCommand, "DescribeActivityCommand"); var DescribeActivityCommand = _DescribeActivityCommand; - var _DescribeExecutionCommand = class _DescribeExecutionCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _DescribeExecutionCommand = class _DescribeExecutionCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSStepFunctions", "DescribeExecution", {}).n("SFNClient", "DescribeExecutionCommand").f(void 0, DescribeExecutionOutputFilterSensitiveLog).ser(se_DescribeExecutionCommand).de(de_DescribeExecutionCommand).build() { }; __name(_DescribeExecutionCommand, "DescribeExecutionCommand"); var DescribeExecutionCommand = _DescribeExecutionCommand; - var _DescribeMapRunCommand = class _DescribeMapRunCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _DescribeMapRunCommand = class _DescribeMapRunCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSStepFunctions", "DescribeMapRun", {}).n("SFNClient", "DescribeMapRunCommand").f(void 0, void 0).ser(se_DescribeMapRunCommand).de(de_DescribeMapRunCommand).build() { }; __name(_DescribeMapRunCommand, "DescribeMapRunCommand"); var DescribeMapRunCommand = _DescribeMapRunCommand; - var _DescribeStateMachineAliasCommand = class _DescribeStateMachineAliasCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _DescribeStateMachineAliasCommand = class _DescribeStateMachineAliasCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSStepFunctions", "DescribeStateMachineAlias", {}).n("SFNClient", "DescribeStateMachineAliasCommand").f(void 0, DescribeStateMachineAliasOutputFilterSensitiveLog).ser(se_DescribeStateMachineAliasCommand).de(de_DescribeStateMachineAliasCommand).build() { }; __name(_DescribeStateMachineAliasCommand, "DescribeStateMachineAliasCommand"); var DescribeStateMachineAliasCommand = _DescribeStateMachineAliasCommand; - var _DescribeStateMachineCommand = class _DescribeStateMachineCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _DescribeStateMachineCommand = class _DescribeStateMachineCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSStepFunctions", "DescribeStateMachine", {}).n("SFNClient", "DescribeStateMachineCommand").f(void 0, DescribeStateMachineOutputFilterSensitiveLog).ser(se_DescribeStateMachineCommand).de(de_DescribeStateMachineCommand).build() { }; __name(_DescribeStateMachineCommand, "DescribeStateMachineCommand"); var DescribeStateMachineCommand = _DescribeStateMachineCommand; - var _DescribeStateMachineForExecutionCommand = class _DescribeStateMachineForExecutionCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _DescribeStateMachineForExecutionCommand = class _DescribeStateMachineForExecutionCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSStepFunctions", "DescribeStateMachineForExecution", {}).n("SFNClient", "DescribeStateMachineForExecutionCommand").f(void 0, DescribeStateMachineForExecutionOutputFilterSensitiveLog).ser(se_DescribeStateMachineForExecutionCommand).de(de_DescribeStateMachineForExecutionCommand).build() { }; __name(_DescribeStateMachineForExecutionCommand, "DescribeStateMachineForExecutionCommand"); var DescribeStateMachineForExecutionCommand = _DescribeStateMachineForExecutionCommand; - var _GetActivityTaskCommand = class _GetActivityTaskCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _GetActivityTaskCommand = class _GetActivityTaskCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSStepFunctions", "GetActivityTask", {}).n("SFNClient", "GetActivityTaskCommand").f(void 0, GetActivityTaskOutputFilterSensitiveLog).ser(se_GetActivityTaskCommand).de(de_GetActivityTaskCommand).build() { }; __name(_GetActivityTaskCommand, "GetActivityTaskCommand"); var GetActivityTaskCommand = _GetActivityTaskCommand; - var _GetExecutionHistoryCommand = class _GetExecutionHistoryCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _GetExecutionHistoryCommand = class _GetExecutionHistoryCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSStepFunctions", "GetExecutionHistory", {}).n("SFNClient", "GetExecutionHistoryCommand").f(void 0, GetExecutionHistoryOutputFilterSensitiveLog).ser(se_GetExecutionHistoryCommand).de(de_GetExecutionHistoryCommand).build() { }; __name(_GetExecutionHistoryCommand, "GetExecutionHistoryCommand"); var GetExecutionHistoryCommand = _GetExecutionHistoryCommand; - var _ListActivitiesCommand = class _ListActivitiesCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _ListActivitiesCommand = class _ListActivitiesCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSStepFunctions", "ListActivities", {}).n("SFNClient", "ListActivitiesCommand").f(void 0, void 0).ser(se_ListActivitiesCommand).de(de_ListActivitiesCommand).build() { }; __name(_ListActivitiesCommand, "ListActivitiesCommand"); var ListActivitiesCommand = _ListActivitiesCommand; - var _ListExecutionsCommand = class _ListExecutionsCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _ListExecutionsCommand = class _ListExecutionsCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSStepFunctions", "ListExecutions", {}).n("SFNClient", "ListExecutionsCommand").f(void 0, void 0).ser(se_ListExecutionsCommand).de(de_ListExecutionsCommand).build() { }; __name(_ListExecutionsCommand, "ListExecutionsCommand"); var ListExecutionsCommand = _ListExecutionsCommand; - var _ListMapRunsCommand = class _ListMapRunsCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _ListMapRunsCommand = class _ListMapRunsCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSStepFunctions", "ListMapRuns", {}).n("SFNClient", "ListMapRunsCommand").f(void 0, void 0).ser(se_ListMapRunsCommand).de(de_ListMapRunsCommand).build() { }; __name(_ListMapRunsCommand, "ListMapRunsCommand"); var ListMapRunsCommand = _ListMapRunsCommand; - var _ListStateMachineAliasesCommand = class _ListStateMachineAliasesCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _ListStateMachineAliasesCommand = class _ListStateMachineAliasesCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSStepFunctions", "ListStateMachineAliases", {}).n("SFNClient", "ListStateMachineAliasesCommand").f(void 0, void 0).ser(se_ListStateMachineAliasesCommand).de(de_ListStateMachineAliasesCommand).build() { }; __name(_ListStateMachineAliasesCommand, "ListStateMachineAliasesCommand"); var ListStateMachineAliasesCommand = _ListStateMachineAliasesCommand; - var _ListStateMachinesCommand = class _ListStateMachinesCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _ListStateMachinesCommand = class _ListStateMachinesCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSStepFunctions", "ListStateMachines", {}).n("SFNClient", "ListStateMachinesCommand").f(void 0, void 0).ser(se_ListStateMachinesCommand).de(de_ListStateMachinesCommand).build() { }; __name(_ListStateMachinesCommand, "ListStateMachinesCommand"); var ListStateMachinesCommand = _ListStateMachinesCommand; - var _ListStateMachineVersionsCommand = class _ListStateMachineVersionsCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _ListStateMachineVersionsCommand = class _ListStateMachineVersionsCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSStepFunctions", "ListStateMachineVersions", {}).n("SFNClient", "ListStateMachineVersionsCommand").f(void 0, void 0).ser(se_ListStateMachineVersionsCommand).de(de_ListStateMachineVersionsCommand).build() { }; __name(_ListStateMachineVersionsCommand, "ListStateMachineVersionsCommand"); var ListStateMachineVersionsCommand = _ListStateMachineVersionsCommand; - var _ListTagsForResourceCommand = class _ListTagsForResourceCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _ListTagsForResourceCommand = class _ListTagsForResourceCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSStepFunctions", "ListTagsForResource", {}).n("SFNClient", "ListTagsForResourceCommand").f(void 0, void 0).ser(se_ListTagsForResourceCommand).de(de_ListTagsForResourceCommand).build() { }; __name(_ListTagsForResourceCommand, "ListTagsForResourceCommand"); var ListTagsForResourceCommand = _ListTagsForResourceCommand; - var _PublishStateMachineVersionCommand = class _PublishStateMachineVersionCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _PublishStateMachineVersionCommand = class _PublishStateMachineVersionCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSStepFunctions", "PublishStateMachineVersion", {}).n("SFNClient", "PublishStateMachineVersionCommand").f(PublishStateMachineVersionInputFilterSensitiveLog, void 0).ser(se_PublishStateMachineVersionCommand).de(de_PublishStateMachineVersionCommand).build() { }; __name(_PublishStateMachineVersionCommand, "PublishStateMachineVersionCommand"); var PublishStateMachineVersionCommand = _PublishStateMachineVersionCommand; - var _RedriveExecutionCommand = class _RedriveExecutionCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _RedriveExecutionCommand = class _RedriveExecutionCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSStepFunctions", "RedriveExecution", {}).n("SFNClient", "RedriveExecutionCommand").f(void 0, void 0).ser(se_RedriveExecutionCommand).de(de_RedriveExecutionCommand).build() { }; __name(_RedriveExecutionCommand, "RedriveExecutionCommand"); var RedriveExecutionCommand = _RedriveExecutionCommand; - var _SendTaskFailureCommand = class _SendTaskFailureCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _SendTaskFailureCommand = class _SendTaskFailureCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSStepFunctions", "SendTaskFailure", {}).n("SFNClient", "SendTaskFailureCommand").f(SendTaskFailureInputFilterSensitiveLog, void 0).ser(se_SendTaskFailureCommand).de(de_SendTaskFailureCommand).build() { }; __name(_SendTaskFailureCommand, "SendTaskFailureCommand"); var SendTaskFailureCommand = _SendTaskFailureCommand; - var _SendTaskHeartbeatCommand = class _SendTaskHeartbeatCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _SendTaskHeartbeatCommand = class _SendTaskHeartbeatCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSStepFunctions", "SendTaskHeartbeat", {}).n("SFNClient", "SendTaskHeartbeatCommand").f(void 0, void 0).ser(se_SendTaskHeartbeatCommand).de(de_SendTaskHeartbeatCommand).build() { }; __name(_SendTaskHeartbeatCommand, "SendTaskHeartbeatCommand"); var SendTaskHeartbeatCommand = _SendTaskHeartbeatCommand; - var _SendTaskSuccessCommand = class _SendTaskSuccessCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _SendTaskSuccessCommand = class _SendTaskSuccessCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSStepFunctions", "SendTaskSuccess", {}).n("SFNClient", "SendTaskSuccessCommand").f(SendTaskSuccessInputFilterSensitiveLog, void 0).ser(se_SendTaskSuccessCommand).de(de_SendTaskSuccessCommand).build() { }; __name(_SendTaskSuccessCommand, "SendTaskSuccessCommand"); var SendTaskSuccessCommand = _SendTaskSuccessCommand; - var _StartExecutionCommand = class _StartExecutionCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _StartExecutionCommand = class _StartExecutionCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSStepFunctions", "StartExecution", {}).n("SFNClient", "StartExecutionCommand").f(StartExecutionInputFilterSensitiveLog, void 0).ser(se_StartExecutionCommand).de(de_StartExecutionCommand).build() { }; __name(_StartExecutionCommand, "StartExecutionCommand"); var StartExecutionCommand = _StartExecutionCommand; - var _StartSyncExecutionCommand = class _StartSyncExecutionCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _StartSyncExecutionCommand = class _StartSyncExecutionCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSStepFunctions", "StartSyncExecution", {}).n("SFNClient", "StartSyncExecutionCommand").f(StartSyncExecutionInputFilterSensitiveLog, StartSyncExecutionOutputFilterSensitiveLog).ser(se_StartSyncExecutionCommand).de(de_StartSyncExecutionCommand).build() { }; __name(_StartSyncExecutionCommand, "StartSyncExecutionCommand"); var StartSyncExecutionCommand = _StartSyncExecutionCommand; - var _StopExecutionCommand = class _StopExecutionCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _StopExecutionCommand = class _StopExecutionCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSStepFunctions", "StopExecution", {}).n("SFNClient", "StopExecutionCommand").f(StopExecutionInputFilterSensitiveLog, void 0).ser(se_StopExecutionCommand).de(de_StopExecutionCommand).build() { }; __name(_StopExecutionCommand, "StopExecutionCommand"); var StopExecutionCommand = _StopExecutionCommand; - var _TagResourceCommand = class _TagResourceCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _TagResourceCommand = class _TagResourceCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSStepFunctions", "TagResource", {}).n("SFNClient", "TagResourceCommand").f(void 0, void 0).ser(se_TagResourceCommand).de(de_TagResourceCommand).build() { }; __name(_TagResourceCommand, "TagResourceCommand"); var TagResourceCommand = _TagResourceCommand; - var _TestStateCommand = class _TestStateCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _TestStateCommand = class _TestStateCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSStepFunctions", "TestState", {}).n("SFNClient", "TestStateCommand").f(TestStateInputFilterSensitiveLog, TestStateOutputFilterSensitiveLog).ser(se_TestStateCommand).de(de_TestStateCommand).build() { }; __name(_TestStateCommand, "TestStateCommand"); var TestStateCommand = _TestStateCommand; - var _UntagResourceCommand = class _UntagResourceCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _UntagResourceCommand = class _UntagResourceCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSStepFunctions", "UntagResource", {}).n("SFNClient", "UntagResourceCommand").f(void 0, void 0).ser(se_UntagResourceCommand).de(de_UntagResourceCommand).build() { }; __name(_UntagResourceCommand, "UntagResourceCommand"); var UntagResourceCommand = _UntagResourceCommand; - var _UpdateMapRunCommand = class _UpdateMapRunCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _UpdateMapRunCommand = class _UpdateMapRunCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSStepFunctions", "UpdateMapRun", {}).n("SFNClient", "UpdateMapRunCommand").f(void 0, void 0).ser(se_UpdateMapRunCommand).de(de_UpdateMapRunCommand).build() { }; __name(_UpdateMapRunCommand, "UpdateMapRunCommand"); var UpdateMapRunCommand = _UpdateMapRunCommand; - var _UpdateStateMachineAliasCommand = class _UpdateStateMachineAliasCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _UpdateStateMachineAliasCommand = class _UpdateStateMachineAliasCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSStepFunctions", "UpdateStateMachineAlias", {}).n("SFNClient", "UpdateStateMachineAliasCommand").f(UpdateStateMachineAliasInputFilterSensitiveLog, void 0).ser(se_UpdateStateMachineAliasCommand).de(de_UpdateStateMachineAliasCommand).build() { }; __name(_UpdateStateMachineAliasCommand, "UpdateStateMachineAliasCommand"); var UpdateStateMachineAliasCommand = _UpdateStateMachineAliasCommand; - var _UpdateStateMachineCommand = class _UpdateStateMachineCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _UpdateStateMachineCommand = class _UpdateStateMachineCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSStepFunctions", "UpdateStateMachine", {}).n("SFNClient", "UpdateStateMachineCommand").f(UpdateStateMachineInputFilterSensitiveLog, void 0).ser(se_UpdateStateMachineCommand).de(de_UpdateStateMachineCommand).build() { }; __name(_UpdateStateMachineCommand, "UpdateStateMachineCommand"); var UpdateStateMachineCommand = _UpdateStateMachineCommand; - var _ValidateStateMachineDefinitionCommand = class _ValidateStateMachineDefinitionCommand extends import_smithy_client5.Command.classBuilder().ep({ + var _ValidateStateMachineDefinitionCommand = class _ValidateStateMachineDefinitionCommand extends import_smithy_client4.Command.classBuilder().ep({ ...commonParams }).m(function(Command, cs, config, o) { return [ (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) ]; }).s("AWSStepFunctions", "ValidateStateMachineDefinition", {}).n("SFNClient", "ValidateStateMachineDefinitionCommand").f(ValidateStateMachineDefinitionInputFilterSensitiveLog, void 0).ser(se_ValidateStateMachineDefinitionCommand).de(de_ValidateStateMachineDefinitionCommand).build() { }; @@ -26388,7 +21728,7 @@ var require_dist_cjs80 = __commonJS({ }; __name(_SFN, "SFN"); var SFN2 = _SFN; - (0, import_smithy_client5.createAggregatedClient)(commands, SFN2); + (0, import_smithy_client4.createAggregatedClient)(commands, SFN2); var paginateGetExecutionHistory = (0, import_core3.createPaginator)(SFNClient, GetExecutionHistoryCommand, "nextToken", "nextToken", "maxResults"); var paginateListActivities = (0, import_core3.createPaginator)(SFNClient, ListActivitiesCommand, "nextToken", "nextToken", "maxResults"); var paginateListExecutions = (0, import_core3.createPaginator)(SFNClient, ListExecutionsCommand, "nextToken", "nextToken", "maxResults"); @@ -34732,7 +30072,7 @@ var import_helpers_internal = __toESM(require_helpers_internal()); // lib/assertions/providers/lambda-handler/base.ts var https = __toESM(require("https")); var url = __toESM(require("url")); -var import_client_sfn = __toESM(require_dist_cjs80()); +var import_client_sfn = __toESM(require_dist_cjs53()); var CustomResourceHandler = class { constructor(event, context) { this.event = event; diff --git a/packages/@aws-cdk/aws-scheduler-targets-alpha/test/integ.kinesis-data-firehose-put-record.js.snapshot/aws-cdk-scheduler-targets-firehose-put-record.assets.json b/packages/@aws-cdk/aws-scheduler-targets-alpha/test/integ.kinesis-data-firehose-put-record.js.snapshot/aws-cdk-scheduler-targets-firehose-put-record.assets.json index 71805a8864d7b..afc674925e5a9 100644 --- a/packages/@aws-cdk/aws-scheduler-targets-alpha/test/integ.kinesis-data-firehose-put-record.js.snapshot/aws-cdk-scheduler-targets-firehose-put-record.assets.json +++ b/packages/@aws-cdk/aws-scheduler-targets-alpha/test/integ.kinesis-data-firehose-put-record.js.snapshot/aws-cdk-scheduler-targets-firehose-put-record.assets.json @@ -14,7 +14,7 @@ } } }, - "b294e83eca6f470c39e7c0370b0118ec835f0f4c29ef07c651c402f89dee2f55": { + "f569395a4a44f508c8621208274341ea9bb959b3d5c2e827800776ba34832173": { "source": { "path": "aws-cdk-scheduler-targets-firehose-put-record.template.json", "packaging": "file" @@ -22,7 +22,7 @@ "destinations": { "current_account-current_region": { "bucketName": "cdk-hnb659fds-assets-${AWS::AccountId}-${AWS::Region}", - "objectKey": "b294e83eca6f470c39e7c0370b0118ec835f0f4c29ef07c651c402f89dee2f55.json", + "objectKey": "f569395a4a44f508c8621208274341ea9bb959b3d5c2e827800776ba34832173.json", "assumeRoleArn": "arn:${AWS::Partition}:iam::${AWS::AccountId}:role/cdk-hnb659fds-file-publishing-role-${AWS::AccountId}-${AWS::Region}" } } diff --git a/packages/@aws-cdk/aws-scheduler-targets-alpha/test/integ.kinesis-data-firehose-put-record.js.snapshot/aws-cdk-scheduler-targets-firehose-put-record.template.json b/packages/@aws-cdk/aws-scheduler-targets-alpha/test/integ.kinesis-data-firehose-put-record.js.snapshot/aws-cdk-scheduler-targets-firehose-put-record.template.json index 3596ac3e751bd..e7f0c59070e65 100644 --- a/packages/@aws-cdk/aws-scheduler-targets-alpha/test/integ.kinesis-data-firehose-put-record.js.snapshot/aws-cdk-scheduler-targets-firehose-put-record.template.json +++ b/packages/@aws-cdk/aws-scheduler-targets-alpha/test/integ.kinesis-data-firehose-put-record.js.snapshot/aws-cdk-scheduler-targets-firehose-put-record.template.json @@ -208,6 +208,19 @@ ] } ] + }, + { + "Action": [ + "logs:CreateLogStream", + "logs:PutLogEvents" + ], + "Effect": "Allow", + "Resource": { + "Fn::GetAtt": [ + "MyFirehoseStreamLogGroup5DE95CF8", + "Arn" + ] + } } ], "Version": "2012-10-17" @@ -220,10 +233,29 @@ ] } }, - "MyFirehose": { + "MyFirehoseStreamLogGroup5DE95CF8": { + "Type": "AWS::Logs::LogGroup", + "Properties": { + "RetentionInDays": 731 + }, + "UpdateReplacePolicy": "Retain", + "DeletionPolicy": "Retain" + }, + "MyFirehoseStreamLogGroupS3DestinationB2F1AD1D": { + "Type": "AWS::Logs::LogStream", + "Properties": { + "LogGroupName": { + "Ref": "MyFirehoseStreamLogGroup5DE95CF8" + } + }, + "UpdateReplacePolicy": "Retain", + "DeletionPolicy": "Retain" + }, + "MyFirehoseStream2282904B": { "Type": "AWS::KinesisFirehose::DeliveryStream", "Properties": { - "S3DestinationConfiguration": { + "DeliveryStreamType": "DirectPut", + "ExtendedS3DestinationConfiguration": { "BucketARN": { "Fn::GetAtt": [ "DestinationBucket4BECDB47", @@ -231,7 +263,17 @@ ] }, "BufferingHints": { - "IntervalInSeconds": 60 + "IntervalInSeconds": 60, + "SizeInMBs": 5 + }, + "CloudWatchLoggingOptions": { + "Enabled": true, + "LogGroupName": { + "Ref": "MyFirehoseStreamLogGroup5DE95CF8" + }, + "LogStreamName": { + "Ref": "MyFirehoseStreamLogGroupS3DestinationB2F1AD1D" + } }, "RoleARN": { "Fn::GetAtt": [ @@ -240,7 +282,10 @@ ] } } - } + }, + "DependsOn": [ + "deliveryStreamRoleDefaultPolicyC9208632" + ] }, "Schedule83A77FD1": { "Type": "AWS::Scheduler::Schedule", @@ -254,7 +299,7 @@ "Target": { "Arn": { "Fn::GetAtt": [ - "MyFirehose", + "MyFirehoseStream2282904B", "Arn" ] }, @@ -265,14 +310,14 @@ }, "RoleArn": { "Fn::GetAtt": [ - "SchedulerRoleForTarget380bba149146B2", + "SchedulerRoleForTarget5bddb4D77D7575", "Arn" ] } } } }, - "SchedulerRoleForTarget380bba149146B2": { + "SchedulerRoleForTarget5bddb4D77D7575": { "Type": "AWS::IAM::Role", "Properties": { "AssumeRolePolicyDocument": { @@ -316,7 +361,7 @@ } } }, - "SchedulerRoleForTarget380bbaDefaultPolicy076E1FE7": { + "SchedulerRoleForTarget5bddb4DefaultPolicy95F55636": { "Type": "AWS::IAM::Policy", "Properties": { "PolicyDocument": { @@ -326,7 +371,7 @@ "Effect": "Allow", "Resource": { "Fn::GetAtt": [ - "MyFirehose", + "MyFirehoseStream2282904B", "Arn" ] } @@ -334,10 +379,10 @@ ], "Version": "2012-10-17" }, - "PolicyName": "SchedulerRoleForTarget380bbaDefaultPolicy076E1FE7", + "PolicyName": "SchedulerRoleForTarget5bddb4DefaultPolicy95F55636", "Roles": [ { - "Ref": "SchedulerRoleForTarget380bba149146B2" + "Ref": "SchedulerRoleForTarget5bddb4D77D7575" } ] } @@ -465,6 +510,107 @@ "us-west-2": { "value": "nodejs20.x" } + }, + "awscdkawskinesisfirehoseCidrBlocks": { + "af-south-1": { + "FirehoseCidrBlock": "13.244.121.224/27" + }, + "ap-east-1": { + "FirehoseCidrBlock": "18.162.221.32/27" + }, + "ap-northeast-1": { + "FirehoseCidrBlock": "13.113.196.224/27" + }, + "ap-northeast-2": { + "FirehoseCidrBlock": "13.209.1.64/27" + }, + "ap-northeast-3": { + "FirehoseCidrBlock": "13.208.177.192/27" + }, + "ap-south-1": { + "FirehoseCidrBlock": "13.232.67.32/27" + }, + "ap-south-2": { + "FirehoseCidrBlock": "18.60.192.128/27" + }, + "ap-southeast-1": { + "FirehoseCidrBlock": "13.228.64.192/27" + }, + "ap-southeast-2": { + "FirehoseCidrBlock": "13.210.67.224/27" + }, + "ap-southeast-3": { + "FirehoseCidrBlock": "108.136.221.64/27" + }, + "ap-southeast-4": { + "FirehoseCidrBlock": "16.50.161.128/27" + }, + "ca-central-1": { + "FirehoseCidrBlock": "35.183.92.128/27" + }, + "ca-west-1": { + "FirehoseCidrBlock": "40.176.98.192/27" + }, + "cn-north-1": { + "FirehoseCidrBlock": "52.81.151.32/27" + }, + "cn-northwest-1": { + "FirehoseCidrBlock": "161.189.23.64/27" + }, + "eu-central-1": { + "FirehoseCidrBlock": "35.158.127.160/27" + }, + "eu-central-2": { + "FirehoseCidrBlock": "16.62.183.32/27" + }, + "eu-north-1": { + "FirehoseCidrBlock": "13.53.63.224/27" + }, + "eu-south-1": { + "FirehoseCidrBlock": "15.161.135.128/27" + }, + "eu-south-2": { + "FirehoseCidrBlock": "18.100.71.96/27" + }, + "eu-west-1": { + "FirehoseCidrBlock": "52.19.239.192/27" + }, + "eu-west-2": { + "FirehoseCidrBlock": "18.130.1.96/27" + }, + "eu-west-3": { + "FirehoseCidrBlock": "35.180.1.96/27" + }, + "il-central-1": { + "FirehoseCidrBlock": "51.16.102.0/27" + }, + "me-central-1": { + "FirehoseCidrBlock": "3.28.159.32/27" + }, + "me-south-1": { + "FirehoseCidrBlock": "15.185.91.0/27" + }, + "sa-east-1": { + "FirehoseCidrBlock": "18.228.1.128/27" + }, + "us-east-1": { + "FirehoseCidrBlock": "52.70.63.192/27" + }, + "us-east-2": { + "FirehoseCidrBlock": "13.58.135.96/27" + }, + "us-gov-east-1": { + "FirehoseCidrBlock": "18.253.138.96/27" + }, + "us-gov-west-1": { + "FirehoseCidrBlock": "52.61.204.160/27" + }, + "us-west-1": { + "FirehoseCidrBlock": "13.57.135.192/27" + }, + "us-west-2": { + "FirehoseCidrBlock": "52.89.255.224/27" + } } }, "Outputs": { diff --git a/packages/@aws-cdk/aws-scheduler-targets-alpha/test/integ.kinesis-data-firehose-put-record.js.snapshot/integrationtestfirehoseputrecordDefaultTestDeployAssert781A189E.assets.json b/packages/@aws-cdk/aws-scheduler-targets-alpha/test/integ.kinesis-data-firehose-put-record.js.snapshot/integrationtestfirehoseputrecordDefaultTestDeployAssert781A189E.assets.json index fce900ed5cea4..5746f6887ed8f 100644 --- a/packages/@aws-cdk/aws-scheduler-targets-alpha/test/integ.kinesis-data-firehose-put-record.js.snapshot/integrationtestfirehoseputrecordDefaultTestDeployAssert781A189E.assets.json +++ b/packages/@aws-cdk/aws-scheduler-targets-alpha/test/integ.kinesis-data-firehose-put-record.js.snapshot/integrationtestfirehoseputrecordDefaultTestDeployAssert781A189E.assets.json @@ -1,20 +1,20 @@ { "version": "38.0.1", "files": { - "d1a40db4788714a346364a87b7de0ff15b732e7367f085acf14f4a680c57c418": { + "b98abee59e034ed29eeb601684dc34752baa86509a7d457d72305d4e19ecc80b": { "source": { - "path": "asset.d1a40db4788714a346364a87b7de0ff15b732e7367f085acf14f4a680c57c418.bundle", + "path": "asset.b98abee59e034ed29eeb601684dc34752baa86509a7d457d72305d4e19ecc80b.bundle", "packaging": "zip" }, "destinations": { "current_account-current_region": { "bucketName": "cdk-hnb659fds-assets-${AWS::AccountId}-${AWS::Region}", - "objectKey": "d1a40db4788714a346364a87b7de0ff15b732e7367f085acf14f4a680c57c418.zip", + "objectKey": "b98abee59e034ed29eeb601684dc34752baa86509a7d457d72305d4e19ecc80b.zip", "assumeRoleArn": "arn:${AWS::Partition}:iam::${AWS::AccountId}:role/cdk-hnb659fds-file-publishing-role-${AWS::AccountId}-${AWS::Region}" } } }, - "3cacb68a454cfdf8b21666d7e59e470a9a13e93759e0e90f539d234089157703": { + "69760e9fa48394a0f609dd69735f45547567fb59eaebdffe3589b5a20f226520": { "source": { "path": "integrationtestfirehoseputrecordDefaultTestDeployAssert781A189E.template.json", "packaging": "file" @@ -22,7 +22,7 @@ "destinations": { "current_account-current_region": { "bucketName": "cdk-hnb659fds-assets-${AWS::AccountId}-${AWS::Region}", - "objectKey": "3cacb68a454cfdf8b21666d7e59e470a9a13e93759e0e90f539d234089157703.json", + "objectKey": "69760e9fa48394a0f609dd69735f45547567fb59eaebdffe3589b5a20f226520.json", "assumeRoleArn": "arn:${AWS::Partition}:iam::${AWS::AccountId}:role/cdk-hnb659fds-file-publishing-role-${AWS::AccountId}-${AWS::Region}" } } diff --git a/packages/@aws-cdk/aws-scheduler-targets-alpha/test/integ.kinesis-data-firehose-put-record.js.snapshot/integrationtestfirehoseputrecordDefaultTestDeployAssert781A189E.template.json b/packages/@aws-cdk/aws-scheduler-targets-alpha/test/integ.kinesis-data-firehose-put-record.js.snapshot/integrationtestfirehoseputrecordDefaultTestDeployAssert781A189E.template.json index 1d77b7c725cd5..42e7210323df5 100644 --- a/packages/@aws-cdk/aws-scheduler-targets-alpha/test/integ.kinesis-data-firehose-put-record.js.snapshot/integrationtestfirehoseputrecordDefaultTestDeployAssert781A189E.template.json +++ b/packages/@aws-cdk/aws-scheduler-targets-alpha/test/integ.kinesis-data-firehose-put-record.js.snapshot/integrationtestfirehoseputrecordDefaultTestDeployAssert781A189E.template.json @@ -31,7 +31,7 @@ "MaxKeys": "1" }, "flattenResponse": "false", - "salt": "1730405309461" + "salt": "1731665442449" }, "UpdateReplacePolicy": "Delete", "DeletionPolicy": "Delete" @@ -219,7 +219,7 @@ "S3Bucket": { "Fn::Sub": "cdk-hnb659fds-assets-${AWS::AccountId}-${AWS::Region}" }, - "S3Key": "d1a40db4788714a346364a87b7de0ff15b732e7367f085acf14f4a680c57c418.zip" + "S3Key": "b98abee59e034ed29eeb601684dc34752baa86509a7d457d72305d4e19ecc80b.zip" }, "Timeout": 120, "Handler": "index.handler", @@ -298,7 +298,7 @@ "S3Bucket": { "Fn::Sub": "cdk-hnb659fds-assets-${AWS::AccountId}-${AWS::Region}" }, - "S3Key": "d1a40db4788714a346364a87b7de0ff15b732e7367f085acf14f4a680c57c418.zip" + "S3Key": "b98abee59e034ed29eeb601684dc34752baa86509a7d457d72305d4e19ecc80b.zip" }, "Timeout": 120, "Handler": "index.isComplete", @@ -348,7 +348,7 @@ "S3Bucket": { "Fn::Sub": "cdk-hnb659fds-assets-${AWS::AccountId}-${AWS::Region}" }, - "S3Key": "d1a40db4788714a346364a87b7de0ff15b732e7367f085acf14f4a680c57c418.zip" + "S3Key": "b98abee59e034ed29eeb601684dc34752baa86509a7d457d72305d4e19ecc80b.zip" }, "Timeout": 120, "Handler": "index.onTimeout", diff --git a/packages/@aws-cdk/aws-scheduler-targets-alpha/test/integ.kinesis-data-firehose-put-record.js.snapshot/manifest.json b/packages/@aws-cdk/aws-scheduler-targets-alpha/test/integ.kinesis-data-firehose-put-record.js.snapshot/manifest.json index e5f9d964c04aa..390a7b40ea24b 100644 --- a/packages/@aws-cdk/aws-scheduler-targets-alpha/test/integ.kinesis-data-firehose-put-record.js.snapshot/manifest.json +++ b/packages/@aws-cdk/aws-scheduler-targets-alpha/test/integ.kinesis-data-firehose-put-record.js.snapshot/manifest.json @@ -19,7 +19,7 @@ "notificationArns": [], "assumeRoleArn": "arn:${AWS::Partition}:iam::${AWS::AccountId}:role/cdk-hnb659fds-deploy-role-${AWS::AccountId}-${AWS::Region}", "cloudFormationExecutionRoleArn": "arn:${AWS::Partition}:iam::${AWS::AccountId}:role/cdk-hnb659fds-cfn-exec-role-${AWS::AccountId}-${AWS::Region}", - "stackTemplateAssetObjectUrl": "s3://cdk-hnb659fds-assets-${AWS::AccountId}-${AWS::Region}/b294e83eca6f470c39e7c0370b0118ec835f0f4c29ef07c651c402f89dee2f55.json", + "stackTemplateAssetObjectUrl": "s3://cdk-hnb659fds-assets-${AWS::AccountId}-${AWS::Region}/f569395a4a44f508c8621208274341ea9bb959b3d5c2e827800776ba34832173.json", "requiresBootstrapStackVersion": 6, "bootstrapStackVersionSsmParameter": "/cdk-bootstrap/hnb659fds/version", "additionalDependencies": [ @@ -89,10 +89,28 @@ "data": "deliveryStreamRoleDefaultPolicyC9208632" } ], - "/aws-cdk-scheduler-targets-firehose-put-record/MyFirehose": [ + "/aws-cdk-scheduler-targets-firehose-put-record/MyFirehoseStream/LogGroup/Resource": [ { "type": "aws:cdk:logicalId", - "data": "MyFirehose" + "data": "MyFirehoseStreamLogGroup5DE95CF8" + } + ], + "/aws-cdk-scheduler-targets-firehose-put-record/MyFirehoseStream/LogGroup/S3Destination/Resource": [ + { + "type": "aws:cdk:logicalId", + "data": "MyFirehoseStreamLogGroupS3DestinationB2F1AD1D" + } + ], + "/aws-cdk-scheduler-targets-firehose-put-record/MyFirehoseStream/Resource": [ + { + "type": "aws:cdk:logicalId", + "data": "MyFirehoseStream2282904B" + } + ], + "/aws-cdk-scheduler-targets-firehose-put-record/@aws-cdk--aws-kinesisfirehose.CidrBlocks": [ + { + "type": "aws:cdk:logicalId", + "data": "awscdkawskinesisfirehoseCidrBlocks" } ], "/aws-cdk-scheduler-targets-firehose-put-record/Schedule/Resource": [ @@ -101,16 +119,16 @@ "data": "Schedule83A77FD1" } ], - "/aws-cdk-scheduler-targets-firehose-put-record/SchedulerRoleForTarget-380bba/Resource": [ + "/aws-cdk-scheduler-targets-firehose-put-record/SchedulerRoleForTarget-5bddb4/Resource": [ { "type": "aws:cdk:logicalId", - "data": "SchedulerRoleForTarget380bba149146B2" + "data": "SchedulerRoleForTarget5bddb4D77D7575" } ], - "/aws-cdk-scheduler-targets-firehose-put-record/SchedulerRoleForTarget-380bba/DefaultPolicy/Resource": [ + "/aws-cdk-scheduler-targets-firehose-put-record/SchedulerRoleForTarget-5bddb4/DefaultPolicy/Resource": [ { "type": "aws:cdk:logicalId", - "data": "SchedulerRoleForTarget380bbaDefaultPolicy076E1FE7" + "data": "SchedulerRoleForTarget5bddb4DefaultPolicy95F55636" } ], "/aws-cdk-scheduler-targets-firehose-put-record/Exports/Output{\"Ref\":\"DestinationBucket4BECDB47\"}": [ @@ -130,6 +148,33 @@ "type": "aws:cdk:logicalId", "data": "CheckBootstrapVersion" } + ], + "MyFirehose": [ + { + "type": "aws:cdk:logicalId", + "data": "MyFirehose", + "trace": [ + "!!DESTRUCTIVE_CHANGES: WILL_DESTROY" + ] + } + ], + "SchedulerRoleForTarget380bba149146B2": [ + { + "type": "aws:cdk:logicalId", + "data": "SchedulerRoleForTarget380bba149146B2", + "trace": [ + "!!DESTRUCTIVE_CHANGES: WILL_DESTROY" + ] + } + ], + "SchedulerRoleForTarget380bbaDefaultPolicy076E1FE7": [ + { + "type": "aws:cdk:logicalId", + "data": "SchedulerRoleForTarget380bbaDefaultPolicy076E1FE7", + "trace": [ + "!!DESTRUCTIVE_CHANGES: WILL_DESTROY" + ] + } ] }, "displayName": "aws-cdk-scheduler-targets-firehose-put-record" @@ -152,7 +197,7 @@ "notificationArns": [], "assumeRoleArn": "arn:${AWS::Partition}:iam::${AWS::AccountId}:role/cdk-hnb659fds-deploy-role-${AWS::AccountId}-${AWS::Region}", "cloudFormationExecutionRoleArn": "arn:${AWS::Partition}:iam::${AWS::AccountId}:role/cdk-hnb659fds-cfn-exec-role-${AWS::AccountId}-${AWS::Region}", - "stackTemplateAssetObjectUrl": "s3://cdk-hnb659fds-assets-${AWS::AccountId}-${AWS::Region}/3cacb68a454cfdf8b21666d7e59e470a9a13e93759e0e90f539d234089157703.json", + "stackTemplateAssetObjectUrl": "s3://cdk-hnb659fds-assets-${AWS::AccountId}-${AWS::Region}/69760e9fa48394a0f609dd69735f45547567fb59eaebdffe3589b5a20f226520.json", "requiresBootstrapStackVersion": 6, "bootstrapStackVersionSsmParameter": "/cdk-bootstrap/hnb659fds/version", "additionalDependencies": [ diff --git a/packages/@aws-cdk/aws-scheduler-targets-alpha/test/integ.kinesis-data-firehose-put-record.js.snapshot/tree.json b/packages/@aws-cdk/aws-scheduler-targets-alpha/test/integ.kinesis-data-firehose-put-record.js.snapshot/tree.json index 00aa620699e71..dcc601ad79553 100644 --- a/packages/@aws-cdk/aws-scheduler-targets-alpha/test/integ.kinesis-data-firehose-put-record.js.snapshot/tree.json +++ b/packages/@aws-cdk/aws-scheduler-targets-alpha/test/integ.kinesis-data-firehose-put-record.js.snapshot/tree.json @@ -252,6 +252,19 @@ ] } ] + }, + { + "Action": [ + "logs:CreateLogStream", + "logs:PutLogEvents" + ], + "Effect": "Allow", + "Resource": { + "Fn::GetAtt": [ + "MyFirehoseStreamLogGroup5DE95CF8", + "Arn" + ] + } } ], "Version": "2012-10-17" @@ -281,33 +294,112 @@ "version": "0.0.0" } }, - "MyFirehose": { - "id": "MyFirehose", - "path": "aws-cdk-scheduler-targets-firehose-put-record/MyFirehose", - "attributes": { - "aws:cdk:cloudformation:type": "AWS::KinesisFirehose::DeliveryStream", - "aws:cdk:cloudformation:props": { - "s3DestinationConfiguration": { - "bucketArn": { - "Fn::GetAtt": [ - "DestinationBucket4BECDB47", - "Arn" - ] - }, - "roleArn": { - "Fn::GetAtt": [ - "deliveryStreamRoleB4288E26", - "Arn" - ] + "MyFirehoseStream": { + "id": "MyFirehoseStream", + "path": "aws-cdk-scheduler-targets-firehose-put-record/MyFirehoseStream", + "children": { + "LogGroup": { + "id": "LogGroup", + "path": "aws-cdk-scheduler-targets-firehose-put-record/MyFirehoseStream/LogGroup", + "children": { + "Resource": { + "id": "Resource", + "path": "aws-cdk-scheduler-targets-firehose-put-record/MyFirehoseStream/LogGroup/Resource", + "attributes": { + "aws:cdk:cloudformation:type": "AWS::Logs::LogGroup", + "aws:cdk:cloudformation:props": { + "retentionInDays": 731 + } + }, + "constructInfo": { + "fqn": "aws-cdk-lib.aws_logs.CfnLogGroup", + "version": "0.0.0" + } }, - "bufferingHints": { - "intervalInSeconds": 60 + "S3Destination": { + "id": "S3Destination", + "path": "aws-cdk-scheduler-targets-firehose-put-record/MyFirehoseStream/LogGroup/S3Destination", + "children": { + "Resource": { + "id": "Resource", + "path": "aws-cdk-scheduler-targets-firehose-put-record/MyFirehoseStream/LogGroup/S3Destination/Resource", + "attributes": { + "aws:cdk:cloudformation:type": "AWS::Logs::LogStream", + "aws:cdk:cloudformation:props": { + "logGroupName": { + "Ref": "MyFirehoseStreamLogGroup5DE95CF8" + } + } + }, + "constructInfo": { + "fqn": "aws-cdk-lib.aws_logs.CfnLogStream", + "version": "0.0.0" + } + } + }, + "constructInfo": { + "fqn": "aws-cdk-lib.aws_logs.LogStream", + "version": "0.0.0" + } + } + }, + "constructInfo": { + "fqn": "aws-cdk-lib.aws_logs.LogGroup", + "version": "0.0.0" + } + }, + "Resource": { + "id": "Resource", + "path": "aws-cdk-scheduler-targets-firehose-put-record/MyFirehoseStream/Resource", + "attributes": { + "aws:cdk:cloudformation:type": "AWS::KinesisFirehose::DeliveryStream", + "aws:cdk:cloudformation:props": { + "deliveryStreamType": "DirectPut", + "extendedS3DestinationConfiguration": { + "cloudWatchLoggingOptions": { + "enabled": true, + "logGroupName": { + "Ref": "MyFirehoseStreamLogGroup5DE95CF8" + }, + "logStreamName": { + "Ref": "MyFirehoseStreamLogGroupS3DestinationB2F1AD1D" + } + }, + "roleArn": { + "Fn::GetAtt": [ + "deliveryStreamRoleB4288E26", + "Arn" + ] + }, + "bufferingHints": { + "intervalInSeconds": 60, + "sizeInMBs": 5 + }, + "bucketArn": { + "Fn::GetAtt": [ + "DestinationBucket4BECDB47", + "Arn" + ] + } + } } + }, + "constructInfo": { + "fqn": "aws-cdk-lib.aws_kinesisfirehose.CfnDeliveryStream", + "version": "0.0.0" } } }, "constructInfo": { - "fqn": "aws-cdk-lib.aws_kinesisfirehose.CfnDeliveryStream", + "fqn": "@aws-cdk/aws-kinesisfirehose-alpha.DeliveryStream", + "version": "0.0.0" + } + }, + "@aws-cdk--aws-kinesisfirehose.CidrBlocks": { + "id": "@aws-cdk--aws-kinesisfirehose.CidrBlocks", + "path": "aws-cdk-scheduler-targets-firehose-put-record/@aws-cdk--aws-kinesisfirehose.CidrBlocks", + "constructInfo": { + "fqn": "aws-cdk-lib.CfnMapping", "version": "0.0.0" } }, @@ -330,13 +422,13 @@ "target": { "arn": { "Fn::GetAtt": [ - "MyFirehose", + "MyFirehoseStream2282904B", "Arn" ] }, "roleArn": { "Fn::GetAtt": [ - "SchedulerRoleForTarget380bba149146B2", + "SchedulerRoleForTarget5bddb4D77D7575", "Arn" ] }, @@ -355,17 +447,17 @@ } }, "constructInfo": { - "fqn": "aws-cdk-lib.Resource", + "fqn": "@aws-cdk/aws-scheduler-alpha.Schedule", "version": "0.0.0" } }, - "SchedulerRoleForTarget-380bba": { - "id": "SchedulerRoleForTarget-380bba", - "path": "aws-cdk-scheduler-targets-firehose-put-record/SchedulerRoleForTarget-380bba", + "SchedulerRoleForTarget-5bddb4": { + "id": "SchedulerRoleForTarget-5bddb4", + "path": "aws-cdk-scheduler-targets-firehose-put-record/SchedulerRoleForTarget-5bddb4", "children": { - "ImportSchedulerRoleForTarget-380bba": { - "id": "ImportSchedulerRoleForTarget-380bba", - "path": "aws-cdk-scheduler-targets-firehose-put-record/SchedulerRoleForTarget-380bba/ImportSchedulerRoleForTarget-380bba", + "ImportSchedulerRoleForTarget-5bddb4": { + "id": "ImportSchedulerRoleForTarget-5bddb4", + "path": "aws-cdk-scheduler-targets-firehose-put-record/SchedulerRoleForTarget-5bddb4/ImportSchedulerRoleForTarget-5bddb4", "constructInfo": { "fqn": "aws-cdk-lib.Resource", "version": "0.0.0" @@ -373,7 +465,7 @@ }, "Resource": { "id": "Resource", - "path": "aws-cdk-scheduler-targets-firehose-put-record/SchedulerRoleForTarget-380bba/Resource", + "path": "aws-cdk-scheduler-targets-firehose-put-record/SchedulerRoleForTarget-5bddb4/Resource", "attributes": { "aws:cdk:cloudformation:type": "AWS::IAM::Role", "aws:cdk:cloudformation:props": { @@ -425,11 +517,11 @@ }, "DefaultPolicy": { "id": "DefaultPolicy", - "path": "aws-cdk-scheduler-targets-firehose-put-record/SchedulerRoleForTarget-380bba/DefaultPolicy", + "path": "aws-cdk-scheduler-targets-firehose-put-record/SchedulerRoleForTarget-5bddb4/DefaultPolicy", "children": { "Resource": { "id": "Resource", - "path": "aws-cdk-scheduler-targets-firehose-put-record/SchedulerRoleForTarget-380bba/DefaultPolicy/Resource", + "path": "aws-cdk-scheduler-targets-firehose-put-record/SchedulerRoleForTarget-5bddb4/DefaultPolicy/Resource", "attributes": { "aws:cdk:cloudformation:type": "AWS::IAM::Policy", "aws:cdk:cloudformation:props": { @@ -440,7 +532,7 @@ "Effect": "Allow", "Resource": { "Fn::GetAtt": [ - "MyFirehose", + "MyFirehoseStream2282904B", "Arn" ] } @@ -448,10 +540,10 @@ ], "Version": "2012-10-17" }, - "policyName": "SchedulerRoleForTarget380bbaDefaultPolicy076E1FE7", + "policyName": "SchedulerRoleForTarget5bddb4DefaultPolicy95F55636", "roles": [ { - "Ref": "SchedulerRoleForTarget380bba149146B2" + "Ref": "SchedulerRoleForTarget5bddb4D77D7575" } ] } @@ -488,7 +580,7 @@ }, "constructInfo": { "fqn": "constructs.Construct", - "version": "10.3.0" + "version": "10.4.2" } }, "BootstrapVersion": { @@ -526,7 +618,7 @@ "path": "integrationtest-firehose-put-record/DefaultTest/Default", "constructInfo": { "fqn": "constructs.Construct", - "version": "10.3.0" + "version": "10.4.2" } }, "DeployAssert": { @@ -546,7 +638,7 @@ "path": "integrationtest-firehose-put-record/DefaultTest/DeployAssert/AwsApiCallS3listObjectsV282e20e13f84521e63643504ea8e737e5/SdkProvider/AssertionsProvider", "constructInfo": { "fqn": "constructs.Construct", - "version": "10.3.0" + "version": "10.4.2" } } }, @@ -586,7 +678,7 @@ "path": "integrationtest-firehose-put-record/DefaultTest/DeployAssert/AwsApiCallS3listObjectsV282e20e13f84521e63643504ea8e737e5/WaitFor/IsCompleteProvider/AssertionsProvider", "constructInfo": { "fqn": "constructs.Construct", - "version": "10.3.0" + "version": "10.4.2" } }, "Invoke": { @@ -612,7 +704,7 @@ "path": "integrationtest-firehose-put-record/DefaultTest/DeployAssert/AwsApiCallS3listObjectsV282e20e13f84521e63643504ea8e737e5/WaitFor/TimeoutProvider/AssertionsProvider", "constructInfo": { "fqn": "constructs.Construct", - "version": "10.3.0" + "version": "10.4.2" } }, "Invoke": { @@ -696,7 +788,7 @@ }, "constructInfo": { "fqn": "constructs.Construct", - "version": "10.3.0" + "version": "10.4.2" } }, "LatestNodeRuntimeMap": { @@ -738,7 +830,7 @@ }, "constructInfo": { "fqn": "constructs.Construct", - "version": "10.3.0" + "version": "10.4.2" } }, "SingletonFunction5c1898e096fb4e3e95d5f6c67f3ce41a": { @@ -772,7 +864,7 @@ }, "constructInfo": { "fqn": "constructs.Construct", - "version": "10.3.0" + "version": "10.4.2" } }, "BootstrapVersion": { @@ -814,7 +906,7 @@ "path": "Tree", "constructInfo": { "fqn": "constructs.Construct", - "version": "10.3.0" + "version": "10.4.2" } } }, diff --git a/packages/@aws-cdk/aws-scheduler-targets-alpha/test/integ.kinesis-data-firehose-put-record.ts b/packages/@aws-cdk/aws-scheduler-targets-alpha/test/integ.kinesis-data-firehose-put-record.ts index bf8400a5bf004..47160ad3f52fe 100644 --- a/packages/@aws-cdk/aws-scheduler-targets-alpha/test/integ.kinesis-data-firehose-put-record.ts +++ b/packages/@aws-cdk/aws-scheduler-targets-alpha/test/integ.kinesis-data-firehose-put-record.ts @@ -1,7 +1,8 @@ +import * as firehose from '@aws-cdk/aws-kinesisfirehose-alpha'; +import * as destinations from '@aws-cdk/aws-kinesisfirehose-destinations-alpha'; import * as scheduler from '@aws-cdk/aws-scheduler-alpha'; import { AwsApiCall, ExpectedResult, IntegTest } from '@aws-cdk/integ-tests-alpha'; import * as cdk from 'aws-cdk-lib'; -import { CfnDeliveryStream } from 'aws-cdk-lib/aws-kinesisfirehose'; import { Bucket } from 'aws-cdk-lib/aws-s3'; import { KinesisDataFirehosePutRecord } from '../lib'; @@ -29,19 +30,16 @@ const deliveryStreamRole = new cdk.aws_iam.Role(stack, 'deliveryStreamRole', { destinationBucket.grantReadWrite(deliveryStreamRole); -const firehose = new CfnDeliveryStream(stack, 'MyFirehose', { - s3DestinationConfiguration: { - bucketArn: destinationBucket.bucketArn, - roleArn: deliveryStreamRole.roleArn, - bufferingHints: { - intervalInSeconds: 60, - }, - }, +const firehoseStream = new firehose.DeliveryStream(stack, 'MyFirehoseStream', { + destination: new destinations.S3Bucket(destinationBucket, { + role: deliveryStreamRole, + bufferingInterval: cdk.Duration.minutes(1), + }), }); new scheduler.Schedule(stack, 'Schedule', { schedule: scheduler.ScheduleExpression.rate(cdk.Duration.minutes(1)), - target: new KinesisDataFirehosePutRecord(firehose, { + target: new KinesisDataFirehosePutRecord(firehoseStream, { input: scheduler.ScheduleTargetInput.fromObject(payload), }), }); diff --git a/packages/@aws-cdk/aws-scheduler-targets-alpha/test/kinesis-data-firehose-put-record.test.ts b/packages/@aws-cdk/aws-scheduler-targets-alpha/test/kinesis-data-firehose-put-record.test.ts index 03b55ad0993f8..092193c80268c 100644 --- a/packages/@aws-cdk/aws-scheduler-targets-alpha/test/kinesis-data-firehose-put-record.test.ts +++ b/packages/@aws-cdk/aws-scheduler-targets-alpha/test/kinesis-data-firehose-put-record.test.ts @@ -1,26 +1,53 @@ +import * as firehose from '@aws-cdk/aws-kinesisfirehose-alpha'; import { ScheduleExpression, Schedule, Group } from '@aws-cdk/aws-scheduler-alpha'; -import { App, Duration, Stack } from 'aws-cdk-lib'; +import { App, CfnResource, Duration, Stack } from 'aws-cdk-lib'; import { Template } from 'aws-cdk-lib/assertions'; import { AccountRootPrincipal, Role } from 'aws-cdk-lib/aws-iam'; -import { CfnDeliveryStream } from 'aws-cdk-lib/aws-kinesisfirehose'; import * as sqs from 'aws-cdk-lib/aws-sqs'; +import { Construct } from 'constructs'; import { KinesisDataFirehosePutRecord } from '../lib'; describe('schedule target', () => { let app: App; let stack: Stack; - let firehose: CfnDeliveryStream; + let firehoseStream: firehose.DeliveryStream; + let dependable: Construct; + let mockS3Destination: firehose.IDestination; + + const bucketArn = 'arn:aws:s3:::my-bucket'; + const roleArn = 'arn:aws:iam::111122223333:role/my-role'; + const expr = ScheduleExpression.at(new Date(Date.UTC(1969, 10, 20, 0, 0, 0))); - const roleId = 'SchedulerRoleForTarget380bba149146B2'; + const firehoseStreamId = 'MyFirehoseFCA2F9D3'; + const roleId = 'SchedulerRoleForTarget047201570CF076'; beforeEach(() => { app = new App({ context: { '@aws-cdk/aws-iam:minimizePolicies': true } }); stack = new Stack(app, 'Stack', { env: { region: 'us-east-1', account: '123456789012' } }); - firehose = new CfnDeliveryStream(stack, 'MyFirehose'); + mockS3Destination = { + bind(scope: Construct, _options: firehose.DestinationBindOptions): firehose.DestinationConfig { + dependable = new class extends Construct { + constructor(depScope: Construct, id: string) { + super(depScope, id); + new CfnResource(this, 'Resource', { type: 'CDK::Dummy' }); + } + }(scope, 'Dummy Dep'); + return { + extendedS3DestinationConfiguration: { + bucketArn: bucketArn, + roleArn: roleArn, + }, + dependables: [dependable], + }; + }, + }; + firehoseStream = new firehose.DeliveryStream(stack, 'MyFirehose', { + destination: mockS3Destination, + }); }); test('creates IAM role and IAM policy for kinesis data firehose target in the same account', () => { - const firehoseTarget = new KinesisDataFirehosePutRecord(firehose); + const firehoseTarget = new KinesisDataFirehosePutRecord(firehoseStream); new Schedule(stack, 'MyScheduleDummy', { schedule: expr, @@ -31,7 +58,7 @@ describe('schedule target', () => { Properties: { Target: { Arn: { - 'Fn::GetAtt': ['MyFirehose', 'Arn'], + 'Fn::GetAtt': [firehoseStreamId, 'Arn'], }, RoleArn: { 'Fn::GetAtt': [roleId, 'Arn'] }, RetryPolicy: {}, @@ -46,7 +73,7 @@ describe('schedule target', () => { Action: 'firehose:PutRecord', Effect: 'Allow', Resource: { - 'Fn::GetAtt': ['MyFirehose', 'Arn'], + 'Fn::GetAtt': [firehoseStreamId, 'Arn'], }, }, ], @@ -92,7 +119,7 @@ describe('schedule target', () => { assumedBy: new AccountRootPrincipal(), }); - const firehoseTarget = new KinesisDataFirehosePutRecord(firehose, { + const firehoseTarget = new KinesisDataFirehosePutRecord(firehoseStream, { role: targetExecutionRole, }); @@ -105,7 +132,7 @@ describe('schedule target', () => { Properties: { Target: { Arn: { - 'Fn::GetAtt': ['MyFirehose', 'Arn'], + 'Fn::GetAtt': [firehoseStreamId, 'Arn'], }, RoleArn: { 'Fn::GetAtt': ['ProvidedTargetRole8CFDD54A', 'Arn'] }, RetryPolicy: {}, @@ -120,7 +147,7 @@ describe('schedule target', () => { Action: 'firehose:PutRecord', Effect: 'Allow', Resource: { - 'Fn::GetAtt': ['MyFirehose', 'Arn'], + 'Fn::GetAtt': [firehoseStreamId, 'Arn'], }, }, ], @@ -130,7 +157,7 @@ describe('schedule target', () => { }); test('reuses IAM role and IAM policy for two schedules with the same target from the same account', () => { - const firehoseTarget = new KinesisDataFirehosePutRecord(firehose); + const firehoseTarget = new KinesisDataFirehosePutRecord(firehoseStream); new Schedule(stack, 'MyScheduleDummy1', { schedule: expr, @@ -181,7 +208,7 @@ describe('schedule target', () => { Action: 'firehose:PutRecord', Effect: 'Allow', Resource: { - 'Fn::GetAtt': ['MyFirehose', 'Arn'], + 'Fn::GetAtt': [firehoseStreamId, 'Arn'], }, }, ], @@ -191,7 +218,7 @@ describe('schedule target', () => { }); test('creates IAM role and IAM policy for two schedules with the same target but different groups', () => { - const firehoseTarget = new KinesisDataFirehosePutRecord(firehose); + const firehoseTarget = new KinesisDataFirehosePutRecord(firehoseStream); const group = new Group(stack, 'Group', { groupName: 'mygroup', }); @@ -264,7 +291,7 @@ describe('schedule target', () => { Action: 'firehose:PutRecord', Effect: 'Allow', Resource: { - 'Fn::GetAtt': ['MyFirehose', 'Arn'], + 'Fn::GetAtt': [firehoseStreamId, 'Arn'], }, }, ], @@ -273,14 +300,16 @@ describe('schedule target', () => { }, 1); }); - test('creates IAM policy for firehose in the another stack with the same account', () => { + test('creates IAM policy for firehose in another stack with the same account', () => { const stack2 = new Stack(app, 'Stack2', { env: { region: 'us-east-1', account: '123456789012', }, }); - const anotherFirehose = new CfnDeliveryStream(stack2, 'AnotherFirehose'); + const anotherFirehose = new firehose.DeliveryStream(stack2, 'AnotherFirehose', { + destination: mockS3Destination, + }); const firehoseTarget = new KinesisDataFirehosePutRecord(anotherFirehose); @@ -293,9 +322,9 @@ describe('schedule target', () => { Properties: { Target: { Arn: { - 'Fn::ImportValue': 'Stack2:ExportsOutputFnGetAttAnotherFirehoseArn24CBF54A', + 'Fn::ImportValue': 'Stack2:ExportsOutputFnGetAttAnotherFirehose028A8805Arn2409390E', }, - RoleArn: { 'Fn::GetAtt': ['SchedulerRoleForTarget4b70ebDC2428DE', 'Arn'] }, + RoleArn: { 'Fn::GetAtt': ['SchedulerRoleForTargetd57ce0DB208927', 'Arn'] }, RetryPolicy: {}, }, }, @@ -308,19 +337,19 @@ describe('schedule target', () => { Action: 'firehose:PutRecord', Effect: 'Allow', Resource: { - 'Fn::ImportValue': 'Stack2:ExportsOutputFnGetAttAnotherFirehoseArn24CBF54A', + 'Fn::ImportValue': 'Stack2:ExportsOutputFnGetAttAnotherFirehose028A8805Arn2409390E', }, }, ], }, - Roles: [{ Ref: 'SchedulerRoleForTarget4b70ebDC2428DE' }], + Roles: [{ Ref: 'SchedulerRoleForTargetd57ce0DB208927' }], }); }); test('creates IAM policy for imported role for firehose in the same account', () => { const importedRole = Role.fromRoleArn(stack, 'ImportedRole', 'arn:aws:iam::123456789012:role/someRole'); - const firehoseTarget = new KinesisDataFirehosePutRecord(firehose, { + const firehoseTarget = new KinesisDataFirehosePutRecord(firehoseStream, { role: importedRole, }); @@ -333,7 +362,7 @@ describe('schedule target', () => { Properties: { Target: { Arn: { - 'Fn::GetAtt': ['MyFirehose', 'Arn'], + 'Fn::GetAtt': [firehoseStreamId, 'Arn'], }, RoleArn: 'arn:aws:iam::123456789012:role/someRole', RetryPolicy: {}, @@ -348,7 +377,7 @@ describe('schedule target', () => { Action: 'firehose:PutRecord', Effect: 'Allow', Resource: { - 'Fn::GetAtt': ['MyFirehose', 'Arn'], + 'Fn::GetAtt': [firehoseStreamId, 'Arn'], }, }, ], @@ -357,14 +386,16 @@ describe('schedule target', () => { }); }); - test('creates IAM policy for firehose in the another stack with imported IAM role in the same account', () => { + test('creates IAM policy for firehose in another stack with imported IAM role in the same account', () => { const stack2 = new Stack(app, 'Stack2', { env: { region: 'us-east-1', account: '123456789012', }, }); - const anotherFirehose = new CfnDeliveryStream(stack2, 'AnotherFirehose'); + const anotherFirehose = new firehose.DeliveryStream(stack2, 'AnotherFirehose', { + destination: mockS3Destination, + }); const importedRole = Role.fromRoleArn(stack, 'ImportedRole', 'arn:aws:iam::123456789012:role/someRole'); const firehoseTarget = new KinesisDataFirehosePutRecord(anotherFirehose, { @@ -380,7 +411,7 @@ describe('schedule target', () => { Properties: { Target: { Arn: { - 'Fn::ImportValue': 'Stack2:ExportsOutputFnGetAttAnotherFirehoseArn24CBF54A', + 'Fn::ImportValue': 'Stack2:ExportsOutputFnGetAttAnotherFirehose028A8805Arn2409390E', }, RoleArn: 'arn:aws:iam::123456789012:role/someRole', RetryPolicy: {}, @@ -395,7 +426,7 @@ describe('schedule target', () => { Action: 'firehose:PutRecord', Effect: 'Allow', Resource: { - 'Fn::ImportValue': 'Stack2:ExportsOutputFnGetAttAnotherFirehoseArn24CBF54A', + 'Fn::ImportValue': 'Stack2:ExportsOutputFnGetAttAnotherFirehose028A8805Arn2409390E', }, }, ], @@ -407,7 +438,7 @@ describe('schedule target', () => { test('adds permissions to execution role for sending messages to DLQ', () => { const dlq = new sqs.Queue(stack, 'DummyDeadLetterQueue'); - const firehoseTarget = new KinesisDataFirehosePutRecord(firehose, { + const firehoseTarget = new KinesisDataFirehosePutRecord(firehoseStream, { deadLetterQueue: dlq, }); @@ -423,7 +454,7 @@ describe('schedule target', () => { Action: 'firehose:PutRecord', Effect: 'Allow', Resource: { - 'Fn::GetAtt': ['MyFirehose', 'Arn'], + 'Fn::GetAtt': [firehoseStreamId, 'Arn'], }, }, { @@ -442,7 +473,7 @@ describe('schedule target', () => { test('adds permission to execution role when imported DLQ is in same account', () => { const importedQueue = sqs.Queue.fromQueueArn(stack, 'ImportedQueue', 'arn:aws:sqs:us-east-1:123456789012:queue1'); - const firehoseTarget = new KinesisDataFirehosePutRecord(firehose, { + const firehoseTarget = new KinesisDataFirehosePutRecord(firehoseStream, { deadLetterQueue: importedQueue, }); @@ -458,7 +489,7 @@ describe('schedule target', () => { Action: 'firehose:PutRecord', Effect: 'Allow', Resource: { - 'Fn::GetAtt': ['MyFirehose', 'Arn'], + 'Fn::GetAtt': [firehoseStreamId, 'Arn'], }, }, { @@ -473,7 +504,7 @@ describe('schedule target', () => { }); test('renders expected retry policy', () => { - const firehoseTarget = new KinesisDataFirehosePutRecord(firehose, { + const firehoseTarget = new KinesisDataFirehosePutRecord(firehoseStream, { retryAttempts: 5, maxEventAge: Duration.hours(3), }); @@ -487,7 +518,7 @@ describe('schedule target', () => { Properties: { Target: { Arn: { - 'Fn::GetAtt': ['MyFirehose', 'Arn'], + 'Fn::GetAtt': [firehoseStreamId, 'Arn'], }, RoleArn: { 'Fn::GetAtt': [roleId, 'Arn'] }, RetryPolicy: { @@ -500,7 +531,7 @@ describe('schedule target', () => { }); test('throws when retry policy max age is more than 1 day', () => { - const firehoseTarget = new KinesisDataFirehosePutRecord(firehose, { + const firehoseTarget = new KinesisDataFirehosePutRecord(firehoseStream, { maxEventAge: Duration.days(3), }); @@ -512,7 +543,7 @@ describe('schedule target', () => { }); test('throws when retry policy max age is less than 15 minutes', () => { - const firehoseTarget = new KinesisDataFirehosePutRecord(firehose, { + const firehoseTarget = new KinesisDataFirehosePutRecord(firehoseStream, { maxEventAge: Duration.minutes(5), }); @@ -524,7 +555,7 @@ describe('schedule target', () => { }); test('throws when retry policy max retry attempts is out of the allowed limits', () => { - const firehoseTarget = new KinesisDataFirehosePutRecord(firehose, { + const firehoseTarget = new KinesisDataFirehosePutRecord(firehoseStream, { retryAttempts: 200, }); diff --git a/packages/aws-cdk-lib/aws-opensearchservice/lib/version.ts b/packages/aws-cdk-lib/aws-opensearchservice/lib/version.ts index 68b508559daa7..821d0b58cd791 100644 --- a/packages/aws-cdk-lib/aws-opensearchservice/lib/version.ts +++ b/packages/aws-cdk-lib/aws-opensearchservice/lib/version.ts @@ -105,6 +105,9 @@ export class EngineVersion { /** AWS OpenSearch 2.15 */ public static readonly OPENSEARCH_2_15 = EngineVersion.openSearch('2.15'); + /** AWS OpenSearch 2.17 */ + public static readonly OPENSEARCH_2_17 = EngineVersion.openSearch('2.17'); + /** * Custom ElasticSearch version * @param version custom version number diff --git a/packages/aws-cdk-lib/aws-opensearchservice/test/domain.test.ts b/packages/aws-cdk-lib/aws-opensearchservice/test/domain.test.ts index f1eb4f1a12e41..2fffbebd72777 100644 --- a/packages/aws-cdk-lib/aws-opensearchservice/test/domain.test.ts +++ b/packages/aws-cdk-lib/aws-opensearchservice/test/domain.test.ts @@ -44,6 +44,7 @@ const testedOpenSearchVersions = [ EngineVersion.OPENSEARCH_2_11, EngineVersion.OPENSEARCH_2_13, EngineVersion.OPENSEARCH_2_15, + EngineVersion.OPENSEARCH_2_17, ]; each(testedOpenSearchVersions).test('connections throws if domain is not placed inside a vpc', (engineVersion) => { @@ -211,6 +212,7 @@ each([ [EngineVersion.OPENSEARCH_2_11, 'OpenSearch_2.11'], [EngineVersion.OPENSEARCH_2_13, 'OpenSearch_2.13'], [EngineVersion.OPENSEARCH_2_15, 'OpenSearch_2.15'], + [EngineVersion.OPENSEARCH_2_17, 'OpenSearch_2.17'], ]).test('minimal example renders correctly', (engineVersion, expectedCfVersion) => { new Domain(stack, 'Domain', { version: engineVersion }); diff --git a/packages/aws-cdk-lib/aws-rds/lib/instance-engine.ts b/packages/aws-cdk-lib/aws-rds/lib/instance-engine.ts index f6a02c6e4b23c..18c0155fcce62 100644 --- a/packages/aws-cdk-lib/aws-rds/lib/instance-engine.ts +++ b/packages/aws-cdk-lib/aws-rds/lib/instance-engine.ts @@ -1545,6 +1545,8 @@ export class PostgresEngineVersion { public static readonly VER_12_19 = PostgresEngineVersion.of('12.19', '12', { s3Import: true, s3Export: true }); /** Version "12.20". */ public static readonly VER_12_20 = PostgresEngineVersion.of('12.20', '12', { s3Import: true, s3Export: true }); + /** Version "12.21". */ + public static readonly VER_12_21 = PostgresEngineVersion.of('12.21', '12', { s3Import: true, s3Export: true }); /** Version "13" (only a major version, without a specific minor version). */ public static readonly VER_13 = PostgresEngineVersion.of('13', '13', { s3Import: true, s3Export: true }); @@ -1610,6 +1612,8 @@ export class PostgresEngineVersion { public static readonly VER_13_15 = PostgresEngineVersion.of('13.15', '13', { s3Import: true, s3Export: true }); /** Version "13.16". */ public static readonly VER_13_16 = PostgresEngineVersion.of('13.16', '13', { s3Import: true, s3Export: true }); + /** Version "13.17". */ + public static readonly VER_13_17 = PostgresEngineVersion.of('13.17', '13', { s3Import: true, s3Export: true }); /** Version "14" (only a major version, without a specific minor version). */ public static readonly VER_14 = PostgresEngineVersion.of('14', '14', { s3Import: true, s3Export: true }); @@ -1663,6 +1667,8 @@ export class PostgresEngineVersion { public static readonly VER_14_12 = PostgresEngineVersion.of('14.12', '14', { s3Import: true, s3Export: true }); /** Version "14.13". */ public static readonly VER_14_13 = PostgresEngineVersion.of('14.13', '14', { s3Import: true, s3Export: true }); + /** Version "14.14". */ + public static readonly VER_14_14 = PostgresEngineVersion.of('14.14', '14', { s3Import: true, s3Export: true }); /** Version "15" (only a major version, without a specific minor version). */ public static readonly VER_15 = PostgresEngineVersion.of('15', '15', { s3Import: true, s3Export: true }); @@ -1686,6 +1692,8 @@ export class PostgresEngineVersion { public static readonly VER_15_7 = PostgresEngineVersion.of('15.7', '15', { s3Import: true, s3Export: true }); /** Version "15.8". */ public static readonly VER_15_8 = PostgresEngineVersion.of('15.8', '15', { s3Import: true, s3Export: true }); + /** Version "15.9". */ + public static readonly VER_15_9 = PostgresEngineVersion.of('15.9', '15', { s3Import: true, s3Export: true }); /** Version "16" (only a major version, without a specific minor version). */ public static readonly VER_16 = PostgresEngineVersion.of('16', '16', { s3Import: true, s3Export: true }); @@ -1697,6 +1705,13 @@ export class PostgresEngineVersion { public static readonly VER_16_3 = PostgresEngineVersion.of('16.3', '16', { s3Import: true, s3Export: true }); /** Version "16.4". */ public static readonly VER_16_4 = PostgresEngineVersion.of('16.4', '16', { s3Import: true, s3Export: true }); + /** Version "16.5". */ + public static readonly VER_16_5 = PostgresEngineVersion.of('16.5', '16', { s3Import: true, s3Export: true }); + + /** Version "17" (only a major version, without a specific minor version). */ + public static readonly VER_17 = PostgresEngineVersion.of('17', '17', { s3Import: true, s3Export: true }); + /** Version "17.1". */ + public static readonly VER_17_1 = PostgresEngineVersion.of('17.1', '17', { s3Import: true, s3Export: true }); /** * Create a new PostgresEngineVersion with an arbitrary version. diff --git a/packages/aws-cdk/lib/api/util/cloudformation.ts b/packages/aws-cdk/lib/api/util/cloudformation.ts index 79ac7cb461c1a..dcfe8a62dc6ef 100644 --- a/packages/aws-cdk/lib/api/util/cloudformation.ts +++ b/packages/aws-cdk/lib/api/util/cloudformation.ts @@ -400,7 +400,6 @@ async function uploadBodyParameterAndCreateChangeSet( env.resolvedEnvironment, new AssetManifestBuilder(), env.resources, - env.sdk, ); const cfn = env.sdk.cloudFormation(); const exists = (await CloudFormationStack.lookup(cfn, options.stack.stackName, false)).exists; diff --git a/packages/aws-cdk/lib/context-providers/load-balancers.ts b/packages/aws-cdk/lib/context-providers/load-balancers.ts index 5441a118fa210..f9f2e53089295 100644 --- a/packages/aws-cdk/lib/context-providers/load-balancers.ts +++ b/packages/aws-cdk/lib/context-providers/load-balancers.ts @@ -160,15 +160,12 @@ class LoadBalancerProvider { } return (await this.describeTags(loadBalancers.map((lb) => lb.LoadBalancerArn!))) .filter((tagDescription) => { - return ( - tagDescription.Tags?.length === this.filter.loadBalancerTags?.length && - tagDescription.Tags?.filter( - (tag) => - !this.filter.loadBalancerTags!.some((filter) => { - return filter.key === tag.Key && filter.value === tag.Value; - }), - ).length === 0 - ); + // For every tag in the filter, there is some tag in the LB that matches it. + // In other words, the set of tags in the filter is a subset of the set of tags in the LB. + return this.filter.loadBalancerTags!.every((filter) => { + return tagDescription.Tags?.some((tag) => + filter.key === tag.Key && filter.value === tag.Value); + }); }) .flatMap((tag) => loadBalancers.filter((loadBalancer) => tag.ResourceArn === loadBalancer.LoadBalancerArn)); } diff --git a/packages/aws-cdk/test/context-providers/load-balancers.test.ts b/packages/aws-cdk/test/context-providers/load-balancers.test.ts index 7ccb952a75ee1..c3ffa75e8d7a3 100644 --- a/packages/aws-cdk/test/context-providers/load-balancers.test.ts +++ b/packages/aws-cdk/test/context-providers/load-balancers.test.ts @@ -199,6 +199,52 @@ describe('load balancer context provider plugin', () => { }); }); + test('looks up by tags - query by subset', async () => { + // GIVEN + mockElasticLoadBalancingV2Client + .on(DescribeLoadBalancersCommand) + .resolves({ + LoadBalancers: [ + { + IpAddressType: 'ipv4', + LoadBalancerArn: 'arn:load-balancer2', + DNSName: 'dns2.example.com', + CanonicalHostedZoneId: 'Z1234', + SecurityGroups: ['sg-1234'], + VpcId: 'vpc-1234', + Type: 'application', + }, + ], + }) + .on(DescribeTagsCommand) + .resolves({ + TagDescriptions: [ + { + ResourceArn: 'arn:load-balancer2', + Tags: [ + // Load balancer has two tags... + { Key: 'some', Value: 'tag' }, + { Key: 'second', Value: 'tag2' }, + ], + }, + ], + }); + const provider = new LoadBalancerContextProviderPlugin(mockSDK); + + // WHEN + const result = await provider.getValue({ + account: '1234', + region: 'us-east-1', + loadBalancerType: LoadBalancerType.APPLICATION, + loadBalancerTags: [ + // ...but we are querying for only one of them + { key: 'second', value: 'tag2' }, + ], + }); + + expect(result.loadBalancerArn).toEqual('arn:load-balancer2'); + }); + test('filters by type', async () => { // GIVEN mockElasticLoadBalancingV2Client