mam.web.js

(function webpackUniversalModuleDefinition(root, factory) {
	if(typeof exports === 'object' && typeof module === 'object')
		module.exports = factory();
	else if(typeof define === 'function' && define.amd)
		define("mam.", [], factory);
	else if(typeof exports === 'object')
		exports["mam."] = factory();
	else
		root["mam."] = factory();
})(this, function() {
return /******/ (function(modules) { // webpackBootstrap
/******/ 	// The module cache
/******/ 	var installedModules = {};
/******/
/******/ 	// The require function
/******/ 	function __webpack_require__(moduleId) {
/******/
/******/ 		// Check if module is in cache
/******/ 		if(installedModules[moduleId]) {
/******/ 			return installedModules[moduleId].exports;
/******/ 		}
/******/ 		// Create a new module (and put it into the cache)
/******/ 		var module = installedModules[moduleId] = {
/******/ 			i: moduleId,
/******/ 			l: false,
/******/ 			exports: {}
/******/ 		};
/******/
/******/ 		// Execute the module function
/******/ 		modules[moduleId].call(module.exports, module, module.exports, __webpack_require__);
/******/
/******/ 		// Flag the module as loaded
/******/ 		module.l = true;
/******/
/******/ 		// Return the exports of the module
/******/ 		return module.exports;
/******/ 	}
/******/
/******/
/******/ 	// expose the modules object (__webpack_modules__)
/******/ 	__webpack_require__.m = modules;
/******/
/******/ 	// expose the module cache
/******/ 	__webpack_require__.c = installedModules;
/******/
/******/ 	// define getter function for harmony exports
/******/ 	__webpack_require__.d = function(exports, name, getter) {
/******/ 		if(!__webpack_require__.o(exports, name)) {
/******/ 			Object.defineProperty(exports, name, {
/******/ 				configurable: false,
/******/ 				enumerable: true,
/******/ 				get: getter
/******/ 			});
/******/ 		}
/******/ 	};
/******/
/******/ 	// getDefaultExport function for compatibility with non-harmony modules
/******/ 	__webpack_require__.n = function(module) {
/******/ 		var getter = module && module.__esModule ?
/******/ 			function getDefault() { return module['default']; } :
/******/ 			function getModuleExports() { return module; };
/******/ 		__webpack_require__.d(getter, 'a', getter);
/******/ 		return getter;
/******/ 	};
/******/
/******/ 	// Object.prototype.hasOwnProperty.call
/******/ 	__webpack_require__.o = function(object, property) { return Object.prototype.hasOwnProperty.call(object, property); };
/******/
/******/ 	// __webpack_public_path__
/******/ 	__webpack_require__.p = "";
/******/
/******/ 	// Load entry module and return exports
/******/ 	return __webpack_require__(__webpack_require__.s = 218);
/******/ })
/************************************************************************/
/******/ ([
/* 0 */
/***/ (function(module, exports, __webpack_require__) {

var global = __webpack_require__(3);
var core = __webpack_require__(30);
var hide = __webpack_require__(19);
var redefine = __webpack_require__(20);
var ctx = __webpack_require__(26);
var PROTOTYPE = 'prototype';

var $export = function (type, name, source) {
  var IS_FORCED = type & $export.F;
  var IS_GLOBAL = type & $export.G;
  var IS_STATIC = type & $export.S;
  var IS_PROTO = type & $export.P;
  var IS_BIND = type & $export.B;
  var target = IS_GLOBAL ? global : IS_STATIC ? global[name] || (global[name] = {}) : (global[name] || {})[PROTOTYPE];
  var exports = IS_GLOBAL ? core : core[name] || (core[name] = {});
  var expProto = exports[PROTOTYPE] || (exports[PROTOTYPE] = {});
  var key, own, out, exp;
  if (IS_GLOBAL) source = name;
  for (key in source) {
    // contains in native
    own = !IS_FORCED && target && target[key] !== undefined;
    // export native or passed
    out = (own ? target : source)[key];
    // bind timers to global for call from export context
    exp = IS_BIND && own ? ctx(out, global) : IS_PROTO && typeof out == 'function' ? ctx(Function.call, out) : out;
    // extend global
    if (target) redefine(target, key, out, type & $export.U);
    // export
    if (exports[key] != out) hide(exports, key, exp);
    if (IS_PROTO && expProto[key] != out) expProto[key] = out;
  }
};
global.core = core;
// type bitmap
$export.F = 1;   // forced
$export.G = 2;   // global
$export.S = 4;   // static
$export.P = 8;   // proto
$export.B = 16;  // bind
$export.W = 32;  // wrap
$export.U = 64;  // safe
$export.R = 128; // real proto method for `library`
module.exports = $export;


/***/ }),
/* 1 */
/***/ (function(module, exports) {

if (typeof Object.create === 'function') {
  // implementation from standard node.js 'util' module
  module.exports = function inherits(ctor, superCtor) {
    ctor.super_ = superCtor
    ctor.prototype = Object.create(superCtor.prototype, {
      constructor: {
        value: ctor,
        enumerable: false,
        writable: true,
        configurable: true
      }
    });
  };
} else {
  // old school shim for old browsers
  module.exports = function inherits(ctor, superCtor) {
    ctor.super_ = superCtor
    var TempCtor = function () {}
    TempCtor.prototype = superCtor.prototype
    ctor.prototype = new TempCtor()
    ctor.prototype.constructor = ctor
  }
}


/***/ }),
/* 2 */
/***/ (function(module, exports, __webpack_require__) {

var isObject = __webpack_require__(7);
module.exports = function (it) {
  if (!isObject(it)) throw TypeError(it + ' is not an object!');
  return it;
};


/***/ }),
/* 3 */
/***/ (function(module, exports) {

// https://github.com/zloirock/core-js/issues/86#issuecomment-115759028
var global = module.exports = typeof window != 'undefined' && window.Math == Math
  ? window : typeof self != 'undefined' && self.Math == Math ? self
  // eslint-disable-next-line no-new-func
  : Function('return this')();
if (typeof __g == 'number') __g = global; // eslint-disable-line no-undef


/***/ }),
/* 4 */
/***/ (function(module, exports, __webpack_require__) {

;(function (root, factory) {
	if (true) {
		// CommonJS
		module.exports = exports = factory();
	}
	else if (typeof define === "function" && define.amd) {
		// AMD
		define([], factory);
	}
	else {
		// Global (browser)
		root.CryptoJS = factory();
	}
}(this, function () {

	/**
	 * CryptoJS core components.
	 */
	var CryptoJS = CryptoJS || (function (Math, undefined) {
	    /*
	     * Local polyfil of Object.create
	     */
	    var create = Object.create || (function () {
	        function F() {};

	        return function (obj) {
	            var subtype;

	            F.prototype = obj;

	            subtype = new F();

	            F.prototype = null;

	            return subtype;
	        };
	    }())

	    /**
	     * CryptoJS namespace.
	     */
	    var C = {};

	    /**
	     * Library namespace.
	     */
	    var C_lib = C.lib = {};

	    /**
	     * Base object for prototypal inheritance.
	     */
	    var Base = C_lib.Base = (function () {


	        return {
	            /**
	             * Creates a new object that inherits from this object.
	             *
	             * @param {Object} overrides Properties to copy into the new object.
	             *
	             * @return {Object} The new object.
	             *
	             * @static
	             *
	             * @example
	             *
	             *     var MyType = CryptoJS.lib.Base.extend({
	             *         field: 'value',
	             *
	             *         method: function () {
	             *         }
	             *     });
	             */
	            extend: function (overrides) {
	                // Spawn
	                var subtype = create(this);

	                // Augment
	                if (overrides) {
	                    subtype.mixIn(overrides);
	                }

	                // Create default initializer
	                if (!subtype.hasOwnProperty('init') || this.init === subtype.init) {
	                    subtype.init = function () {
	                        subtype.$super.init.apply(this, arguments);
	                    };
	                }

	                // Initializer's prototype is the subtype object
	                subtype.init.prototype = subtype;

	                // Reference supertype
	                subtype.$super = this;

	                return subtype;
	            },

	            /**
	             * Extends this object and runs the init method.
	             * Arguments to create() will be passed to init().
	             *
	             * @return {Object} The new object.
	             *
	             * @static
	             *
	             * @example
	             *
	             *     var instance = MyType.create();
	             */
	            create: function () {
	                var instance = this.extend();
	                instance.init.apply(instance, arguments);

	                return instance;
	            },

	            /**
	             * Initializes a newly created object.
	             * Override this method to add some logic when your objects are created.
	             *
	             * @example
	             *
	             *     var MyType = CryptoJS.lib.Base.extend({
	             *         init: function () {
	             *             // ...
	             *         }
	             *     });
	             */
	            init: function () {
	            },

	            /**
	             * Copies properties into this object.
	             *
	             * @param {Object} properties The properties to mix in.
	             *
	             * @example
	             *
	             *     MyType.mixIn({
	             *         field: 'value'
	             *     });
	             */
	            mixIn: function (properties) {
	                for (var propertyName in properties) {
	                    if (properties.hasOwnProperty(propertyName)) {
	                        this[propertyName] = properties[propertyName];
	                    }
	                }

	                // IE won't copy toString using the loop above
	                if (properties.hasOwnProperty('toString')) {
	                    this.toString = properties.toString;
	                }
	            },

	            /**
	             * Creates a copy of this object.
	             *
	             * @return {Object} The clone.
	             *
	             * @example
	             *
	             *     var clone = instance.clone();
	             */
	            clone: function () {
	                return this.init.prototype.extend(this);
	            }
	        };
	    }());

	    /**
	     * An array of 32-bit words.
	     *
	     * @property {Array} words The array of 32-bit words.
	     * @property {number} sigBytes The number of significant bytes in this word array.
	     */
	    var WordArray = C_lib.WordArray = Base.extend({
	        /**
	         * Initializes a newly created word array.
	         *
	         * @param {Array} words (Optional) An array of 32-bit words.
	         * @param {number} sigBytes (Optional) The number of significant bytes in the words.
	         *
	         * @example
	         *
	         *     var wordArray = CryptoJS.lib.WordArray.create();
	         *     var wordArray = CryptoJS.lib.WordArray.create([0x00010203, 0x04050607]);
	         *     var wordArray = CryptoJS.lib.WordArray.create([0x00010203, 0x04050607], 6);
	         */
	        init: function (words, sigBytes) {
	            words = this.words = words || [];

	            if (sigBytes != undefined) {
	                this.sigBytes = sigBytes;
	            } else {
	                this.sigBytes = words.length * 4;
	            }
	        },

	        /**
	         * Converts this word array to a string.
	         *
	         * @param {Encoder} encoder (Optional) The encoding strategy to use. Default: CryptoJS.enc.Hex
	         *
	         * @return {string} The stringified word array.
	         *
	         * @example
	         *
	         *     var string = wordArray + '';
	         *     var string = wordArray.toString();
	         *     var string = wordArray.toString(CryptoJS.enc.Utf8);
	         */
	        toString: function (encoder) {
	            return (encoder || Hex).stringify(this);
	        },

	        /**
	         * Concatenates a word array to this word array.
	         *
	         * @param {WordArray} wordArray The word array to append.
	         *
	         * @return {WordArray} This word array.
	         *
	         * @example
	         *
	         *     wordArray1.concat(wordArray2);
	         */
	        concat: function (wordArray) {
	            // Shortcuts
	            var thisWords = this.words;
	            var thatWords = wordArray.words;
	            var thisSigBytes = this.sigBytes;
	            var thatSigBytes = wordArray.sigBytes;

	            // Clamp excess bits
	            this.clamp();

	            // Concat
	            if (thisSigBytes % 4) {
	                // Copy one byte at a time
	                for (var i = 0; i < thatSigBytes; i++) {
	                    var thatByte = (thatWords[i >>> 2] >>> (24 - (i % 4) * 8)) & 0xff;
	                    thisWords[(thisSigBytes + i) >>> 2] |= thatByte << (24 - ((thisSigBytes + i) % 4) * 8);
	                }
	            } else {
	                // Copy one word at a time
	                for (var i = 0; i < thatSigBytes; i += 4) {
	                    thisWords[(thisSigBytes + i) >>> 2] = thatWords[i >>> 2];
	                }
	            }
	            this.sigBytes += thatSigBytes;

	            // Chainable
	            return this;
	        },

	        /**
	         * Removes insignificant bits.
	         *
	         * @example
	         *
	         *     wordArray.clamp();
	         */
	        clamp: function () {
	            // Shortcuts
	            var words = this.words;
	            var sigBytes = this.sigBytes;

	            // Clamp
	            words[sigBytes >>> 2] &= 0xffffffff << (32 - (sigBytes % 4) * 8);
	            words.length = Math.ceil(sigBytes / 4);
	        },

	        /**
	         * Creates a copy of this word array.
	         *
	         * @return {WordArray} The clone.
	         *
	         * @example
	         *
	         *     var clone = wordArray.clone();
	         */
	        clone: function () {
	            var clone = Base.clone.call(this);
	            clone.words = this.words.slice(0);

	            return clone;
	        },

	        /**
	         * Creates a word array filled with random bytes.
	         *
	         * @param {number} nBytes The number of random bytes to generate.
	         *
	         * @return {WordArray} The random word array.
	         *
	         * @static
	         *
	         * @example
	         *
	         *     var wordArray = CryptoJS.lib.WordArray.random(16);
	         */
	        random: function (nBytes) {
	            var words = [];

	            var r = (function (m_w) {
	                var m_w = m_w;
	                var m_z = 0x3ade68b1;
	                var mask = 0xffffffff;

	                return function () {
	                    m_z = (0x9069 * (m_z & 0xFFFF) + (m_z >> 0x10)) & mask;
	                    m_w = (0x4650 * (m_w & 0xFFFF) + (m_w >> 0x10)) & mask;
	                    var result = ((m_z << 0x10) + m_w) & mask;
	                    result /= 0x100000000;
	                    result += 0.5;
	                    return result * (Math.random() > .5 ? 1 : -1);
	                }
	            });

	            for (var i = 0, rcache; i < nBytes; i += 4) {
	                var _r = r((rcache || Math.random()) * 0x100000000);

	                rcache = _r() * 0x3ade67b7;
	                words.push((_r() * 0x100000000) | 0);
	            }

	            return new WordArray.init(words, nBytes);
	        }
	    });

	    /**
	     * Encoder namespace.
	     */
	    var C_enc = C.enc = {};

	    /**
	     * Hex encoding strategy.
	     */
	    var Hex = C_enc.Hex = {
	        /**
	         * Converts a word array to a hex string.
	         *
	         * @param {WordArray} wordArray The word array.
	         *
	         * @return {string} The hex string.
	         *
	         * @static
	         *
	         * @example
	         *
	         *     var hexString = CryptoJS.enc.Hex.stringify(wordArray);
	         */
	        stringify: function (wordArray) {
	            // Shortcuts
	            var words = wordArray.words;
	            var sigBytes = wordArray.sigBytes;

	            // Convert
	            var hexChars = [];
	            for (var i = 0; i < sigBytes; i++) {
	                var bite = (words[i >>> 2] >>> (24 - (i % 4) * 8)) & 0xff;
	                hexChars.push((bite >>> 4).toString(16));
	                hexChars.push((bite & 0x0f).toString(16));
	            }

	            return hexChars.join('');
	        },

	        /**
	         * Converts a hex string to a word array.
	         *
	         * @param {string} hexStr The hex string.
	         *
	         * @return {WordArray} The word array.
	         *
	         * @static
	         *
	         * @example
	         *
	         *     var wordArray = CryptoJS.enc.Hex.parse(hexString);
	         */
	        parse: function (hexStr) {
	            // Shortcut
	            var hexStrLength = hexStr.length;

	            // Convert
	            var words = [];
	            for (var i = 0; i < hexStrLength; i += 2) {
	                words[i >>> 3] |= parseInt(hexStr.substr(i, 2), 16) << (24 - (i % 8) * 4);
	            }

	            return new WordArray.init(words, hexStrLength / 2);
	        }
	    };

	    /**
	     * Latin1 encoding strategy.
	     */
	    var Latin1 = C_enc.Latin1 = {
	        /**
	         * Converts a word array to a Latin1 string.
	         *
	         * @param {WordArray} wordArray The word array.
	         *
	         * @return {string} The Latin1 string.
	         *
	         * @static
	         *
	         * @example
	         *
	         *     var latin1String = CryptoJS.enc.Latin1.stringify(wordArray);
	         */
	        stringify: function (wordArray) {
	            // Shortcuts
	            var words = wordArray.words;
	            var sigBytes = wordArray.sigBytes;

	            // Convert
	            var latin1Chars = [];
	            for (var i = 0; i < sigBytes; i++) {
	                var bite = (words[i >>> 2] >>> (24 - (i % 4) * 8)) & 0xff;
	                latin1Chars.push(String.fromCharCode(bite));
	            }

	            return latin1Chars.join('');
	        },

	        /**
	         * Converts a Latin1 string to a word array.
	         *
	         * @param {string} latin1Str The Latin1 string.
	         *
	         * @return {WordArray} The word array.
	         *
	         * @static
	         *
	         * @example
	         *
	         *     var wordArray = CryptoJS.enc.Latin1.parse(latin1String);
	         */
	        parse: function (latin1Str) {
	            // Shortcut
	            var latin1StrLength = latin1Str.length;

	            // Convert
	            var words = [];
	            for (var i = 0; i < latin1StrLength; i++) {
	                words[i >>> 2] |= (latin1Str.charCodeAt(i) & 0xff) << (24 - (i % 4) * 8);
	            }

	            return new WordArray.init(words, latin1StrLength);
	        }
	    };

	    /**
	     * UTF-8 encoding strategy.
	     */
	    var Utf8 = C_enc.Utf8 = {
	        /**
	         * Converts a word array to a UTF-8 string.
	         *
	         * @param {WordArray} wordArray The word array.
	         *
	         * @return {string} The UTF-8 string.
	         *
	         * @static
	         *
	         * @example
	         *
	         *     var utf8String = CryptoJS.enc.Utf8.stringify(wordArray);
	         */
	        stringify: function (wordArray) {
	            try {
	                return decodeURIComponent(escape(Latin1.stringify(wordArray)));
	            } catch (e) {
	                throw new Error('Malformed UTF-8 data');
	            }
	        },

	        /**
	         * Converts a UTF-8 string to a word array.
	         *
	         * @param {string} utf8Str The UTF-8 string.
	         *
	         * @return {WordArray} The word array.
	         *
	         * @static
	         *
	         * @example
	         *
	         *     var wordArray = CryptoJS.enc.Utf8.parse(utf8String);
	         */
	        parse: function (utf8Str) {
	            return Latin1.parse(unescape(encodeURIComponent(utf8Str)));
	        }
	    };

	    /**
	     * Abstract buffered block algorithm template.
	     *
	     * The property blockSize must be implemented in a concrete subtype.
	     *
	     * @property {number} _minBufferSize The number of blocks that should be kept unprocessed in the buffer. Default: 0
	     */
	    var BufferedBlockAlgorithm = C_lib.BufferedBlockAlgorithm = Base.extend({
	        /**
	         * Resets this block algorithm's data buffer to its initial state.
	         *
	         * @example
	         *
	         *     bufferedBlockAlgorithm.reset();
	         */
	        reset: function () {
	            // Initial values
	            this._data = new WordArray.init();
	            this._nDataBytes = 0;
	        },

	        /**
	         * Adds new data to this block algorithm's buffer.
	         *
	         * @param {WordArray|string} data The data to append. Strings are converted to a WordArray using UTF-8.
	         *
	         * @example
	         *
	         *     bufferedBlockAlgorithm._append('data');
	         *     bufferedBlockAlgorithm._append(wordArray);
	         */
	        _append: function (data) {
	            // Convert string to WordArray, else assume WordArray already
	            if (typeof data == 'string') {
	                data = Utf8.parse(data);
	            }

	            // Append
	            this._data.concat(data);
	            this._nDataBytes += data.sigBytes;
	        },

	        /**
	         * Processes available data blocks.
	         *
	         * This method invokes _doProcessBlock(offset), which must be implemented by a concrete subtype.
	         *
	         * @param {boolean} doFlush Whether all blocks and partial blocks should be processed.
	         *
	         * @return {WordArray} The processed data.
	         *
	         * @example
	         *
	         *     var processedData = bufferedBlockAlgorithm._process();
	         *     var processedData = bufferedBlockAlgorithm._process(!!'flush');
	         */
	        _process: function (doFlush) {
	            // Shortcuts
	            var data = this._data;
	            var dataWords = data.words;
	            var dataSigBytes = data.sigBytes;
	            var blockSize = this.blockSize;
	            var blockSizeBytes = blockSize * 4;

	            // Count blocks ready
	            var nBlocksReady = dataSigBytes / blockSizeBytes;
	            if (doFlush) {
	                // Round up to include partial blocks
	                nBlocksReady = Math.ceil(nBlocksReady);
	            } else {
	                // Round down to include only full blocks,
	                // less the number of blocks that must remain in the buffer
	                nBlocksReady = Math.max((nBlocksReady | 0) - this._minBufferSize, 0);
	            }

	            // Count words ready
	            var nWordsReady = nBlocksReady * blockSize;

	            // Count bytes ready
	            var nBytesReady = Math.min(nWordsReady * 4, dataSigBytes);

	            // Process blocks
	            if (nWordsReady) {
	                for (var offset = 0; offset < nWordsReady; offset += blockSize) {
	                    // Perform concrete-algorithm logic
	                    this._doProcessBlock(dataWords, offset);
	                }

	                // Remove processed words
	                var processedWords = dataWords.splice(0, nWordsReady);
	                data.sigBytes -= nBytesReady;
	            }

	            // Return processed words
	            return new WordArray.init(processedWords, nBytesReady);
	        },

	        /**
	         * Creates a copy of this object.
	         *
	         * @return {Object} The clone.
	         *
	         * @example
	         *
	         *     var clone = bufferedBlockAlgorithm.clone();
	         */
	        clone: function () {
	            var clone = Base.clone.call(this);
	            clone._data = this._data.clone();

	            return clone;
	        },

	        _minBufferSize: 0
	    });

	    /**
	     * Abstract hasher template.
	     *
	     * @property {number} blockSize The number of 32-bit words this hasher operates on. Default: 16 (512 bits)
	     */
	    var Hasher = C_lib.Hasher = BufferedBlockAlgorithm.extend({
	        /**
	         * Configuration options.
	         */
	        cfg: Base.extend(),

	        /**
	         * Initializes a newly created hasher.
	         *
	         * @param {Object} cfg (Optional) The configuration options to use for this hash computation.
	         *
	         * @example
	         *
	         *     var hasher = CryptoJS.algo.SHA256.create();
	         */
	        init: function (cfg) {
	            // Apply config defaults
	            this.cfg = this.cfg.extend(cfg);

	            // Set initial values
	            this.reset();
	        },

	        /**
	         * Resets this hasher to its initial state.
	         *
	         * @example
	         *
	         *     hasher.reset();
	         */
	        reset: function () {
	            // Reset data buffer
	            BufferedBlockAlgorithm.reset.call(this);

	            // Perform concrete-hasher logic
	            this._doReset();
	        },

	        /**
	         * Updates this hasher with a message.
	         *
	         * @param {WordArray|string} messageUpdate The message to append.
	         *
	         * @return {Hasher} This hasher.
	         *
	         * @example
	         *
	         *     hasher.update('message');
	         *     hasher.update(wordArray);
	         */
	        update: function (messageUpdate) {
	            // Append
	            this._append(messageUpdate);

	            // Update the hash
	            this._process();

	            // Chainable
	            return this;
	        },

	        /**
	         * Finalizes the hash computation.
	         * Note that the finalize operation is effectively a destructive, read-once operation.
	         *
	         * @param {WordArray|string} messageUpdate (Optional) A final message update.
	         *
	         * @return {WordArray} The hash.
	         *
	         * @example
	         *
	         *     var hash = hasher.finalize();
	         *     var hash = hasher.finalize('message');
	         *     var hash = hasher.finalize(wordArray);
	         */
	        finalize: function (messageUpdate) {
	            // Final message update
	            if (messageUpdate) {
	                this._append(messageUpdate);
	            }

	            // Perform concrete-hasher logic
	            var hash = this._doFinalize();

	            return hash;
	        },

	        blockSize: 512/32,

	        /**
	         * Creates a shortcut function to a hasher's object interface.
	         *
	         * @param {Hasher} hasher The hasher to create a helper for.
	         *
	         * @return {Function} The shortcut function.
	         *
	         * @static
	         *
	         * @example
	         *
	         *     var SHA256 = CryptoJS.lib.Hasher._createHelper(CryptoJS.algo.SHA256);
	         */
	        _createHelper: function (hasher) {
	            return function (message, cfg) {
	                return new hasher.init(cfg).finalize(message);
	            };
	        },

	        /**
	         * Creates a shortcut function to the HMAC's object interface.
	         *
	         * @param {Hasher} hasher The hasher to use in this HMAC helper.
	         *
	         * @return {Function} The shortcut function.
	         *
	         * @static
	         *
	         * @example
	         *
	         *     var HmacSHA256 = CryptoJS.lib.Hasher._createHmacHelper(CryptoJS.algo.SHA256);
	         */
	        _createHmacHelper: function (hasher) {
	            return function (message, key) {
	                return new C_algo.HMAC.init(hasher, key).finalize(message);
	            };
	        }
	    });

	    /**
	     * Algorithm namespace.
	     */
	    var C_algo = C.algo = {};

	    return C;
	}(Math));


	return CryptoJS;

}));

/***/ }),
/* 5 */
/***/ (function(module, exports) {

module.exports = function (exec) {
  try {
    return !!exec();
  } catch (e) {
    return true;
  }
};


/***/ }),
/* 6 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";
/* WEBPACK VAR INJECTION */(function(global) {/*!
 * The buffer module from node.js, for the browser.
 *
 * @author   Feross Aboukhadijeh <feross@feross.org> <http://feross.org>
 * @license  MIT
 */
/* eslint-disable no-proto */



var base64 = __webpack_require__(220)
var ieee754 = __webpack_require__(221)
var isArray = __webpack_require__(144)

exports.Buffer = Buffer
exports.SlowBuffer = SlowBuffer
exports.INSPECT_MAX_BYTES = 50

/**
 * If `Buffer.TYPED_ARRAY_SUPPORT`:
 *   === true    Use Uint8Array implementation (fastest)
 *   === false   Use Object implementation (most compatible, even IE6)
 *
 * Browsers that support typed arrays are IE 10+, Firefox 4+, Chrome 7+, Safari 5.1+,
 * Opera 11.6+, iOS 4.2+.
 *
 * Due to various browser bugs, sometimes the Object implementation will be used even
 * when the browser supports typed arrays.
 *
 * Note:
 *
 *   - Firefox 4-29 lacks support for adding new properties to `Uint8Array` instances,
 *     See: https://bugzilla.mozilla.org/show_bug.cgi?id=695438.
 *
 *   - Chrome 9-10 is missing the `TypedArray.prototype.subarray` function.
 *
 *   - IE10 has a broken `TypedArray.prototype.subarray` function which returns arrays of
 *     incorrect length in some situations.

 * We detect these buggy browsers and set `Buffer.TYPED_ARRAY_SUPPORT` to `false` so they
 * get the Object implementation, which is slower but behaves correctly.
 */
Buffer.TYPED_ARRAY_SUPPORT = global.TYPED_ARRAY_SUPPORT !== undefined
  ? global.TYPED_ARRAY_SUPPORT
  : typedArraySupport()

/*
 * Export kMaxLength after typed array support is determined.
 */
exports.kMaxLength = kMaxLength()

function typedArraySupport () {
  try {
    var arr = new Uint8Array(1)
    arr.__proto__ = {__proto__: Uint8Array.prototype, foo: function () { return 42 }}
    return arr.foo() === 42 && // typed array instances can be augmented
        typeof arr.subarray === 'function' && // chrome 9-10 lack `subarray`
        arr.subarray(1, 1).byteLength === 0 // ie10 has broken `subarray`
  } catch (e) {
    return false
  }
}

function kMaxLength () {
  return Buffer.TYPED_ARRAY_SUPPORT
    ? 0x7fffffff
    : 0x3fffffff
}

function createBuffer (that, length) {
  if (kMaxLength() < length) {
    throw new RangeError('Invalid typed array length')
  }
  if (Buffer.TYPED_ARRAY_SUPPORT) {
    // Return an augmented `Uint8Array` instance, for best performance
    that = new Uint8Array(length)
    that.__proto__ = Buffer.prototype
  } else {
    // Fallback: Return an object instance of the Buffer class
    if (that === null) {
      that = new Buffer(length)
    }
    that.length = length
  }

  return that
}

/**
 * The Buffer constructor returns instances of `Uint8Array` that have their
 * prototype changed to `Buffer.prototype`. Furthermore, `Buffer` is a subclass of
 * `Uint8Array`, so the returned instances will have all the node `Buffer` methods
 * and the `Uint8Array` methods. Square bracket notation works as expected -- it
 * returns a single octet.
 *
 * The `Uint8Array` prototype remains unmodified.
 */

function Buffer (arg, encodingOrOffset, length) {
  if (!Buffer.TYPED_ARRAY_SUPPORT && !(this instanceof Buffer)) {
    return new Buffer(arg, encodingOrOffset, length)
  }

  // Common case.
  if (typeof arg === 'number') {
    if (typeof encodingOrOffset === 'string') {
      throw new Error(
        'If encoding is specified then the first argument must be a string'
      )
    }
    return allocUnsafe(this, arg)
  }
  return from(this, arg, encodingOrOffset, length)
}

Buffer.poolSize = 8192 // not used by this implementation

// TODO: Legacy, not needed anymore. Remove in next major version.
Buffer._augment = function (arr) {
  arr.__proto__ = Buffer.prototype
  return arr
}

function from (that, value, encodingOrOffset, length) {
  if (typeof value === 'number') {
    throw new TypeError('"value" argument must not be a number')
  }

  if (typeof ArrayBuffer !== 'undefined' && value instanceof ArrayBuffer) {
    return fromArrayBuffer(that, value, encodingOrOffset, length)
  }

  if (typeof value === 'string') {
    return fromString(that, value, encodingOrOffset)
  }

  return fromObject(that, value)
}

/**
 * Functionally equivalent to Buffer(arg, encoding) but throws a TypeError
 * if value is a number.
 * Buffer.from(str[, encoding])
 * Buffer.from(array)
 * Buffer.from(buffer)
 * Buffer.from(arrayBuffer[, byteOffset[, length]])
 **/
Buffer.from = function (value, encodingOrOffset, length) {
  return from(null, value, encodingOrOffset, length)
}

if (Buffer.TYPED_ARRAY_SUPPORT) {
  Buffer.prototype.__proto__ = Uint8Array.prototype
  Buffer.__proto__ = Uint8Array
  if (typeof Symbol !== 'undefined' && Symbol.species &&
      Buffer[Symbol.species] === Buffer) {
    // Fix subarray() in ES2016. See: https://github.com/feross/buffer/pull/97
    Object.defineProperty(Buffer, Symbol.species, {
      value: null,
      configurable: true
    })
  }
}

function assertSize (size) {
  if (typeof size !== 'number') {
    throw new TypeError('"size" argument must be a number')
  } else if (size < 0) {
    throw new RangeError('"size" argument must not be negative')
  }
}

function alloc (that, size, fill, encoding) {
  assertSize(size)
  if (size <= 0) {
    return createBuffer(that, size)
  }
  if (fill !== undefined) {
    // Only pay attention to encoding if it's a string. This
    // prevents accidentally sending in a number that would
    // be interpretted as a start offset.
    return typeof encoding === 'string'
      ? createBuffer(that, size).fill(fill, encoding)
      : createBuffer(that, size).fill(fill)
  }
  return createBuffer(that, size)
}

/**
 * Creates a new filled Buffer instance.
 * alloc(size[, fill[, encoding]])
 **/
Buffer.alloc = function (size, fill, encoding) {
  return alloc(null, size, fill, encoding)
}

function allocUnsafe (that, size) {
  assertSize(size)
  that = createBuffer(that, size < 0 ? 0 : checked(size) | 0)
  if (!Buffer.TYPED_ARRAY_SUPPORT) {
    for (var i = 0; i < size; ++i) {
      that[i] = 0
    }
  }
  return that
}

/**
 * Equivalent to Buffer(num), by default creates a non-zero-filled Buffer instance.
 * */
Buffer.allocUnsafe = function (size) {
  return allocUnsafe(null, size)
}
/**
 * Equivalent to SlowBuffer(num), by default creates a non-zero-filled Buffer instance.
 */
Buffer.allocUnsafeSlow = function (size) {
  return allocUnsafe(null, size)
}

function fromString (that, string, encoding) {
  if (typeof encoding !== 'string' || encoding === '') {
    encoding = 'utf8'
  }

  if (!Buffer.isEncoding(encoding)) {
    throw new TypeError('"encoding" must be a valid string encoding')
  }

  var length = byteLength(string, encoding) | 0
  that = createBuffer(that, length)

  var actual = that.write(string, encoding)

  if (actual !== length) {
    // Writing a hex string, for example, that contains invalid characters will
    // cause everything after the first invalid character to be ignored. (e.g.
    // 'abxxcd' will be treated as 'ab')
    that = that.slice(0, actual)
  }

  return that
}

function fromArrayLike (that, array) {
  var length = array.length < 0 ? 0 : checked(array.length) | 0
  that = createBuffer(that, length)
  for (var i = 0; i < length; i += 1) {
    that[i] = array[i] & 255
  }
  return that
}

function fromArrayBuffer (that, array, byteOffset, length) {
  array.byteLength // this throws if `array` is not a valid ArrayBuffer

  if (byteOffset < 0 || array.byteLength < byteOffset) {
    throw new RangeError('\'offset\' is out of bounds')
  }

  if (array.byteLength < byteOffset + (length || 0)) {
    throw new RangeError('\'length\' is out of bounds')
  }

  if (byteOffset === undefined && length === undefined) {
    array = new Uint8Array(array)
  } else if (length === undefined) {
    array = new Uint8Array(array, byteOffset)
  } else {
    array = new Uint8Array(array, byteOffset, length)
  }

  if (Buffer.TYPED_ARRAY_SUPPORT) {
    // Return an augmented `Uint8Array` instance, for best performance
    that = array
    that.__proto__ = Buffer.prototype
  } else {
    // Fallback: Return an object instance of the Buffer class
    that = fromArrayLike(that, array)
  }
  return that
}

function fromObject (that, obj) {
  if (Buffer.isBuffer(obj)) {
    var len = checked(obj.length) | 0
    that = createBuffer(that, len)

    if (that.length === 0) {
      return that
    }

    obj.copy(that, 0, 0, len)
    return that
  }

  if (obj) {
    if ((typeof ArrayBuffer !== 'undefined' &&
        obj.buffer instanceof ArrayBuffer) || 'length' in obj) {
      if (typeof obj.length !== 'number' || isnan(obj.length)) {
        return createBuffer(that, 0)
      }
      return fromArrayLike(that, obj)
    }

    if (obj.type === 'Buffer' && isArray(obj.data)) {
      return fromArrayLike(that, obj.data)
    }
  }

  throw new TypeError('First argument must be a string, Buffer, ArrayBuffer, Array, or array-like object.')
}

function checked (length) {
  // Note: cannot use `length < kMaxLength()` here because that fails when
  // length is NaN (which is otherwise coerced to zero.)
  if (length >= kMaxLength()) {
    throw new RangeError('Attempt to allocate Buffer larger than maximum ' +
                         'size: 0x' + kMaxLength().toString(16) + ' bytes')
  }
  return length | 0
}

function SlowBuffer (length) {
  if (+length != length) { // eslint-disable-line eqeqeq
    length = 0
  }
  return Buffer.alloc(+length)
}

Buffer.isBuffer = function isBuffer (b) {
  return !!(b != null && b._isBuffer)
}

Buffer.compare = function compare (a, b) {
  if (!Buffer.isBuffer(a) || !Buffer.isBuffer(b)) {
    throw new TypeError('Arguments must be Buffers')
  }

  if (a === b) return 0

  var x = a.length
  var y = b.length

  for (var i = 0, len = Math.min(x, y); i < len; ++i) {
    if (a[i] !== b[i]) {
      x = a[i]
      y = b[i]
      break
    }
  }

  if (x < y) return -1
  if (y < x) return 1
  return 0
}

Buffer.isEncoding = function isEncoding (encoding) {
  switch (String(encoding).toLowerCase()) {
    case 'hex':
    case 'utf8':
    case 'utf-8':
    case 'ascii':
    case 'latin1':
    case 'binary':
    case 'base64':
    case 'ucs2':
    case 'ucs-2':
    case 'utf16le':
    case 'utf-16le':
      return true
    default:
      return false
  }
}

Buffer.concat = function concat (list, length) {
  if (!isArray(list)) {
    throw new TypeError('"list" argument must be an Array of Buffers')
  }

  if (list.length === 0) {
    return Buffer.alloc(0)
  }

  var i
  if (length === undefined) {
    length = 0
    for (i = 0; i < list.length; ++i) {
      length += list[i].length
    }
  }

  var buffer = Buffer.allocUnsafe(length)
  var pos = 0
  for (i = 0; i < list.length; ++i) {
    var buf = list[i]
    if (!Buffer.isBuffer(buf)) {
      throw new TypeError('"list" argument must be an Array of Buffers')
    }
    buf.copy(buffer, pos)
    pos += buf.length
  }
  return buffer
}

function byteLength (string, encoding) {
  if (Buffer.isBuffer(string)) {
    return string.length
  }
  if (typeof ArrayBuffer !== 'undefined' && typeof ArrayBuffer.isView === 'function' &&
      (ArrayBuffer.isView(string) || string instanceof ArrayBuffer)) {
    return string.byteLength
  }
  if (typeof string !== 'string') {
    string = '' + string
  }

  var len = string.length
  if (len === 0) return 0

  // Use a for loop to avoid recursion
  var loweredCase = false
  for (;;) {
    switch (encoding) {
      case 'ascii':
      case 'latin1':
      case 'binary':
        return len
      case 'utf8':
      case 'utf-8':
      case undefined:
        return utf8ToBytes(string).length
      case 'ucs2':
      case 'ucs-2':
      case 'utf16le':
      case 'utf-16le':
        return len * 2
      case 'hex':
        return len >>> 1
      case 'base64':
        return base64ToBytes(string).length
      default:
        if (loweredCase) return utf8ToBytes(string).length // assume utf8
        encoding = ('' + encoding).toLowerCase()
        loweredCase = true
    }
  }
}
Buffer.byteLength = byteLength

function slowToString (encoding, start, end) {
  var loweredCase = false

  // No need to verify that "this.length <= MAX_UINT32" since it's a read-only
  // property of a typed array.

  // This behaves neither like String nor Uint8Array in that we set start/end
  // to their upper/lower bounds if the value passed is out of range.
  // undefined is handled specially as per ECMA-262 6th Edition,
  // Section 13.3.3.7 Runtime Semantics: KeyedBindingInitialization.
  if (start === undefined || start < 0) {
    start = 0
  }
  // Return early if start > this.length. Done here to prevent potential uint32
  // coercion fail below.
  if (start > this.length) {
    return ''
  }

  if (end === undefined || end > this.length) {
    end = this.length
  }

  if (end <= 0) {
    return ''
  }

  // Force coersion to uint32. This will also coerce falsey/NaN values to 0.
  end >>>= 0
  start >>>= 0

  if (end <= start) {
    return ''
  }

  if (!encoding) encoding = 'utf8'

  while (true) {
    switch (encoding) {
      case 'hex':
        return hexSlice(this, start, end)

      case 'utf8':
      case 'utf-8':
        return utf8Slice(this, start, end)

      case 'ascii':
        return asciiSlice(this, start, end)

      case 'latin1':
      case 'binary':
        return latin1Slice(this, start, end)

      case 'base64':
        return base64Slice(this, start, end)

      case 'ucs2':
      case 'ucs-2':
      case 'utf16le':
      case 'utf-16le':
        return utf16leSlice(this, start, end)

      default:
        if (loweredCase) throw new TypeError('Unknown encoding: ' + encoding)
        encoding = (encoding + '').toLowerCase()
        loweredCase = true
    }
  }
}

// The property is used by `Buffer.isBuffer` and `is-buffer` (in Safari 5-7) to detect
// Buffer instances.
Buffer.prototype._isBuffer = true

function swap (b, n, m) {
  var i = b[n]
  b[n] = b[m]
  b[m] = i
}

Buffer.prototype.swap16 = function swap16 () {
  var len = this.length
  if (len % 2 !== 0) {
    throw new RangeError('Buffer size must be a multiple of 16-bits')
  }
  for (var i = 0; i < len; i += 2) {
    swap(this, i, i + 1)
  }
  return this
}

Buffer.prototype.swap32 = function swap32 () {
  var len = this.length
  if (len % 4 !== 0) {
    throw new RangeError('Buffer size must be a multiple of 32-bits')
  }
  for (var i = 0; i < len; i += 4) {
    swap(this, i, i + 3)
    swap(this, i + 1, i + 2)
  }
  return this
}

Buffer.prototype.swap64 = function swap64 () {
  var len = this.length
  if (len % 8 !== 0) {
    throw new RangeError('Buffer size must be a multiple of 64-bits')
  }
  for (var i = 0; i < len; i += 8) {
    swap(this, i, i + 7)
    swap(this, i + 1, i + 6)
    swap(this, i + 2, i + 5)
    swap(this, i + 3, i + 4)
  }
  return this
}

Buffer.prototype.toString = function toString () {
  var length = this.length | 0
  if (length === 0) return ''
  if (arguments.length === 0) return utf8Slice(this, 0, length)
  return slowToString.apply(this, arguments)
}

Buffer.prototype.equals = function equals (b) {
  if (!Buffer.isBuffer(b)) throw new TypeError('Argument must be a Buffer')
  if (this === b) return true
  return Buffer.compare(this, b) === 0
}

Buffer.prototype.inspect = function inspect () {
  var str = ''
  var max = exports.INSPECT_MAX_BYTES
  if (this.length > 0) {
    str = this.toString('hex', 0, max).match(/.{2}/g).join(' ')
    if (this.length > max) str += ' ... '
  }
  return '<Buffer ' + str + '>'
}

Buffer.prototype.compare = function compare (target, start, end, thisStart, thisEnd) {
  if (!Buffer.isBuffer(target)) {
    throw new TypeError('Argument must be a Buffer')
  }

  if (start === undefined) {
    start = 0
  }
  if (end === undefined) {
    end = target ? target.length : 0
  }
  if (thisStart === undefined) {
    thisStart = 0
  }
  if (thisEnd === undefined) {
    thisEnd = this.length
  }

  if (start < 0 || end > target.length || thisStart < 0 || thisEnd > this.length) {
    throw new RangeError('out of range index')
  }

  if (thisStart >= thisEnd && start >= end) {
    return 0
  }
  if (thisStart >= thisEnd) {
    return -1
  }
  if (start >= end) {
    return 1
  }

  start >>>= 0
  end >>>= 0
  thisStart >>>= 0
  thisEnd >>>= 0

  if (this === target) return 0

  var x = thisEnd - thisStart
  var y = end - start
  var len = Math.min(x, y)

  var thisCopy = this.slice(thisStart, thisEnd)
  var targetCopy = target.slice(start, end)

  for (var i = 0; i < len; ++i) {
    if (thisCopy[i] !== targetCopy[i]) {
      x = thisCopy[i]
      y = targetCopy[i]
      break
    }
  }

  if (x < y) return -1
  if (y < x) return 1
  return 0
}

// Finds either the first index of `val` in `buffer` at offset >= `byteOffset`,
// OR the last index of `val` in `buffer` at offset <= `byteOffset`.
//
// Arguments:
// - buffer - a Buffer to search
// - val - a string, Buffer, or number
// - byteOffset - an index into `buffer`; will be clamped to an int32
// - encoding - an optional encoding, relevant is val is a string
// - dir - true for indexOf, false for lastIndexOf
function bidirectionalIndexOf (buffer, val, byteOffset, encoding, dir) {
  // Empty buffer means no match
  if (buffer.length === 0) return -1

  // Normalize byteOffset
  if (typeof byteOffset === 'string') {
    encoding = byteOffset
    byteOffset = 0
  } else if (byteOffset > 0x7fffffff) {
    byteOffset = 0x7fffffff
  } else if (byteOffset < -0x80000000) {
    byteOffset = -0x80000000
  }
  byteOffset = +byteOffset  // Coerce to Number.
  if (isNaN(byteOffset)) {
    // byteOffset: it it's undefined, null, NaN, "foo", etc, search whole buffer
    byteOffset = dir ? 0 : (buffer.length - 1)
  }

  // Normalize byteOffset: negative offsets start from the end of the buffer
  if (byteOffset < 0) byteOffset = buffer.length + byteOffset
  if (byteOffset >= buffer.length) {
    if (dir) return -1
    else byteOffset = buffer.length - 1
  } else if (byteOffset < 0) {
    if (dir) byteOffset = 0
    else return -1
  }

  // Normalize val
  if (typeof val === 'string') {
    val = Buffer.from(val, encoding)
  }

  // Finally, search either indexOf (if dir is true) or lastIndexOf
  if (Buffer.isBuffer(val)) {
    // Special case: looking for empty string/buffer always fails
    if (val.length === 0) {
      return -1
    }
    return arrayIndexOf(buffer, val, byteOffset, encoding, dir)
  } else if (typeof val === 'number') {
    val = val & 0xFF // Search for a byte value [0-255]
    if (Buffer.TYPED_ARRAY_SUPPORT &&
        typeof Uint8Array.prototype.indexOf === 'function') {
      if (dir) {
        return Uint8Array.prototype.indexOf.call(buffer, val, byteOffset)
      } else {
        return Uint8Array.prototype.lastIndexOf.call(buffer, val, byteOffset)
      }
    }
    return arrayIndexOf(buffer, [ val ], byteOffset, encoding, dir)
  }

  throw new TypeError('val must be string, number or Buffer')
}

function arrayIndexOf (arr, val, byteOffset, encoding, dir) {
  var indexSize = 1
  var arrLength = arr.length
  var valLength = val.length

  if (encoding !== undefined) {
    encoding = String(encoding).toLowerCase()
    if (encoding === 'ucs2' || encoding === 'ucs-2' ||
        encoding === 'utf16le' || encoding === 'utf-16le') {
      if (arr.length < 2 || val.length < 2) {
        return -1
      }
      indexSize = 2
      arrLength /= 2
      valLength /= 2
      byteOffset /= 2
    }
  }

  function read (buf, i) {
    if (indexSize === 1) {
      return buf[i]
    } else {
      return buf.readUInt16BE(i * indexSize)
    }
  }

  var i
  if (dir) {
    var foundIndex = -1
    for (i = byteOffset; i < arrLength; i++) {
      if (read(arr, i) === read(val, foundIndex === -1 ? 0 : i - foundIndex)) {
        if (foundIndex === -1) foundIndex = i
        if (i - foundIndex + 1 === valLength) return foundIndex * indexSize
      } else {
        if (foundIndex !== -1) i -= i - foundIndex
        foundIndex = -1
      }
    }
  } else {
    if (byteOffset + valLength > arrLength) byteOffset = arrLength - valLength
    for (i = byteOffset; i >= 0; i--) {
      var found = true
      for (var j = 0; j < valLength; j++) {
        if (read(arr, i + j) !== read(val, j)) {
          found = false
          break
        }
      }
      if (found) return i
    }
  }

  return -1
}

Buffer.prototype.includes = function includes (val, byteOffset, encoding) {
  return this.indexOf(val, byteOffset, encoding) !== -1
}

Buffer.prototype.indexOf = function indexOf (val, byteOffset, encoding) {
  return bidirectionalIndexOf(this, val, byteOffset, encoding, true)
}

Buffer.prototype.lastIndexOf = function lastIndexOf (val, byteOffset, encoding) {
  return bidirectionalIndexOf(this, val, byteOffset, encoding, false)
}

function hexWrite (buf, string, offset, length) {
  offset = Number(offset) || 0
  var remaining = buf.length - offset
  if (!length) {
    length = remaining
  } else {
    length = Number(length)
    if (length > remaining) {
      length = remaining
    }
  }

  // must be an even number of digits
  var strLen = string.length
  if (strLen % 2 !== 0) throw new TypeError('Invalid hex string')

  if (length > strLen / 2) {
    length = strLen / 2
  }
  for (var i = 0; i < length; ++i) {
    var parsed = parseInt(string.substr(i * 2, 2), 16)
    if (isNaN(parsed)) return i
    buf[offset + i] = parsed
  }
  return i
}

function utf8Write (buf, string, offset, length) {
  return blitBuffer(utf8ToBytes(string, buf.length - offset), buf, offset, length)
}

function asciiWrite (buf, string, offset, length) {
  return blitBuffer(asciiToBytes(string), buf, offset, length)
}

function latin1Write (buf, string, offset, length) {
  return asciiWrite(buf, string, offset, length)
}

function base64Write (buf, string, offset, length) {
  return blitBuffer(base64ToBytes(string), buf, offset, length)
}

function ucs2Write (buf, string, offset, length) {
  return blitBuffer(utf16leToBytes(string, buf.length - offset), buf, offset, length)
}

Buffer.prototype.write = function write (string, offset, length, encoding) {
  // Buffer#write(string)
  if (offset === undefined) {
    encoding = 'utf8'
    length = this.length
    offset = 0
  // Buffer#write(string, encoding)
  } else if (length === undefined && typeof offset === 'string') {
    encoding = offset
    length = this.length
    offset = 0
  // Buffer#write(string, offset[, length][, encoding])
  } else if (isFinite(offset)) {
    offset = offset | 0
    if (isFinite(length)) {
      length = length | 0
      if (encoding === undefined) encoding = 'utf8'
    } else {
      encoding = length
      length = undefined
    }
  // legacy write(string, encoding, offset, length) - remove in v0.13
  } else {
    throw new Error(
      'Buffer.write(string, encoding, offset[, length]) is no longer supported'
    )
  }

  var remaining = this.length - offset
  if (length === undefined || length > remaining) length = remaining

  if ((string.length > 0 && (length < 0 || offset < 0)) || offset > this.length) {
    throw new RangeError('Attempt to write outside buffer bounds')
  }

  if (!encoding) encoding = 'utf8'

  var loweredCase = false
  for (;;) {
    switch (encoding) {
      case 'hex':
        return hexWrite(this, string, offset, length)

      case 'utf8':
      case 'utf-8':
        return utf8Write(this, string, offset, length)

      case 'ascii':
        return asciiWrite(this, string, offset, length)

      case 'latin1':
      case 'binary':
        return latin1Write(this, string, offset, length)

      case 'base64':
        // Warning: maxLength not taken into account in base64Write
        return base64Write(this, string, offset, length)

      case 'ucs2':
      case 'ucs-2':
      case 'utf16le':
      case 'utf-16le':
        return ucs2Write(this, string, offset, length)

      default:
        if (loweredCase) throw new TypeError('Unknown encoding: ' + encoding)
        encoding = ('' + encoding).toLowerCase()
        loweredCase = true
    }
  }
}

Buffer.prototype.toJSON = function toJSON () {
  return {
    type: 'Buffer',
    data: Array.prototype.slice.call(this._arr || this, 0)
  }
}

function base64Slice (buf, start, end) {
  if (start === 0 && end === buf.length) {
    return base64.fromByteArray(buf)
  } else {
    return base64.fromByteArray(buf.slice(start, end))
  }
}

function utf8Slice (buf, start, end) {
  end = Math.min(buf.length, end)
  var res = []

  var i = start
  while (i < end) {
    var firstByte = buf[i]
    var codePoint = null
    var bytesPerSequence = (firstByte > 0xEF) ? 4
      : (firstByte > 0xDF) ? 3
      : (firstByte > 0xBF) ? 2
      : 1

    if (i + bytesPerSequence <= end) {
      var secondByte, thirdByte, fourthByte, tempCodePoint

      switch (bytesPerSequence) {
        case 1:
          if (firstByte < 0x80) {
            codePoint = firstByte
          }
          break
        case 2:
          secondByte = buf[i + 1]
          if ((secondByte & 0xC0) === 0x80) {
            tempCodePoint = (firstByte & 0x1F) << 0x6 | (secondByte & 0x3F)
            if (tempCodePoint > 0x7F) {
              codePoint = tempCodePoint
            }
          }
          break
        case 3:
          secondByte = buf[i + 1]
          thirdByte = buf[i + 2]
          if ((secondByte & 0xC0) === 0x80 && (thirdByte & 0xC0) === 0x80) {
            tempCodePoint = (firstByte & 0xF) << 0xC | (secondByte & 0x3F) << 0x6 | (thirdByte & 0x3F)
            if (tempCodePoint > 0x7FF && (tempCodePoint < 0xD800 || tempCodePoint > 0xDFFF)) {
              codePoint = tempCodePoint
            }
          }
          break
        case 4:
          secondByte = buf[i + 1]
          thirdByte = buf[i + 2]
          fourthByte = buf[i + 3]
          if ((secondByte & 0xC0) === 0x80 && (thirdByte & 0xC0) === 0x80 && (fourthByte & 0xC0) === 0x80) {
            tempCodePoint = (firstByte & 0xF) << 0x12 | (secondByte & 0x3F) << 0xC | (thirdByte & 0x3F) << 0x6 | (fourthByte & 0x3F)
            if (tempCodePoint > 0xFFFF && tempCodePoint < 0x110000) {
              codePoint = tempCodePoint
            }
          }
      }
    }

    if (codePoint === null) {
      // we did not generate a valid codePoint so insert a
      // replacement char (U+FFFD) and advance only 1 byte
      codePoint = 0xFFFD
      bytesPerSequence = 1
    } else if (codePoint > 0xFFFF) {
      // encode to utf16 (surrogate pair dance)
      codePoint -= 0x10000
      res.push(codePoint >>> 10 & 0x3FF | 0xD800)
      codePoint = 0xDC00 | codePoint & 0x3FF
    }

    res.push(codePoint)
    i += bytesPerSequence
  }

  return decodeCodePointsArray(res)
}

// Based on http://stackoverflow.com/a/22747272/680742, the browser with
// the lowest limit is Chrome, with 0x10000 args.
// We go 1 magnitude less, for safety
var MAX_ARGUMENTS_LENGTH = 0x1000

function decodeCodePointsArray (codePoints) {
  var len = codePoints.length
  if (len <= MAX_ARGUMENTS_LENGTH) {
    return String.fromCharCode.apply(String, codePoints) // avoid extra slice()
  }

  // Decode in chunks to avoid "call stack size exceeded".
  var res = ''
  var i = 0
  while (i < len) {
    res += String.fromCharCode.apply(
      String,
      codePoints.slice(i, i += MAX_ARGUMENTS_LENGTH)
    )
  }
  return res
}

function asciiSlice (buf, start, end) {
  var ret = ''
  end = Math.min(buf.length, end)

  for (var i = start; i < end; ++i) {
    ret += String.fromCharCode(buf[i] & 0x7F)
  }
  return ret
}

function latin1Slice (buf, start, end) {
  var ret = ''
  end = Math.min(buf.length, end)

  for (var i = start; i < end; ++i) {
    ret += String.fromCharCode(buf[i])
  }
  return ret
}

function hexSlice (buf, start, end) {
  var len = buf.length

  if (!start || start < 0) start = 0
  if (!end || end < 0 || end > len) end = len

  var out = ''
  for (var i = start; i < end; ++i) {
    out += toHex(buf[i])
  }
  return out
}

function utf16leSlice (buf, start, end) {
  var bytes = buf.slice(start, end)
  var res = ''
  for (var i = 0; i < bytes.length; i += 2) {
    res += String.fromCharCode(bytes[i] + bytes[i + 1] * 256)
  }
  return res
}

Buffer.prototype.slice = function slice (start, end) {
  var len = this.length
  start = ~~start
  end = end === undefined ? len : ~~end

  if (start < 0) {
    start += len
    if (start < 0) start = 0
  } else if (start > len) {
    start = len
  }

  if (end < 0) {
    end += len
    if (end < 0) end = 0
  } else if (end > len) {
    end = len
  }

  if (end < start) end = start

  var newBuf
  if (Buffer.TYPED_ARRAY_SUPPORT) {
    newBuf = this.subarray(start, end)
    newBuf.__proto__ = Buffer.prototype
  } else {
    var sliceLen = end - start
    newBuf = new Buffer(sliceLen, undefined)
    for (var i = 0; i < sliceLen; ++i) {
      newBuf[i] = this[i + start]
    }
  }

  return newBuf
}

/*
 * Need to make sure that buffer isn't trying to write out of bounds.
 */
function checkOffset (offset, ext, length) {
  if ((offset % 1) !== 0 || offset < 0) throw new RangeError('offset is not uint')
  if (offset + ext > length) throw new RangeError('Trying to access beyond buffer length')
}

Buffer.prototype.readUIntLE = function readUIntLE (offset, byteLength, noAssert) {
  offset = offset | 0
  byteLength = byteLength | 0
  if (!noAssert) checkOffset(offset, byteLength, this.length)

  var val = this[offset]
  var mul = 1
  var i = 0
  while (++i < byteLength && (mul *= 0x100)) {
    val += this[offset + i] * mul
  }

  return val
}

Buffer.prototype.readUIntBE = function readUIntBE (offset, byteLength, noAssert) {
  offset = offset | 0
  byteLength = byteLength | 0
  if (!noAssert) {
    checkOffset(offset, byteLength, this.length)
  }

  var val = this[offset + --byteLength]
  var mul = 1
  while (byteLength > 0 && (mul *= 0x100)) {
    val += this[offset + --byteLength] * mul
  }

  return val
}

Buffer.prototype.readUInt8 = function readUInt8 (offset, noAssert) {
  if (!noAssert) checkOffset(offset, 1, this.length)
  return this[offset]
}

Buffer.prototype.readUInt16LE = function readUInt16LE (offset, noAssert) {
  if (!noAssert) checkOffset(offset, 2, this.length)
  return this[offset] | (this[offset + 1] << 8)
}

Buffer.prototype.readUInt16BE = function readUInt16BE (offset, noAssert) {
  if (!noAssert) checkOffset(offset, 2, this.length)
  return (this[offset] << 8) | this[offset + 1]
}

Buffer.prototype.readUInt32LE = function readUInt32LE (offset, noAssert) {
  if (!noAssert) checkOffset(offset, 4, this.length)

  return ((this[offset]) |
      (this[offset + 1] << 8) |
      (this[offset + 2] << 16)) +
      (this[offset + 3] * 0x1000000)
}

Buffer.prototype.readUInt32BE = function readUInt32BE (offset, noAssert) {
  if (!noAssert) checkOffset(offset, 4, this.length)

  return (this[offset] * 0x1000000) +
    ((this[offset + 1] << 16) |
    (this[offset + 2] << 8) |
    this[offset + 3])
}

Buffer.prototype.readIntLE = function readIntLE (offset, byteLength, noAssert) {
  offset = offset | 0
  byteLength = byteLength | 0
  if (!noAssert) checkOffset(offset, byteLength, this.length)

  var val = this[offset]
  var mul = 1
  var i = 0
  while (++i < byteLength && (mul *= 0x100)) {
    val += this[offset + i] * mul
  }
  mul *= 0x80

  if (val >= mul) val -= Math.pow(2, 8 * byteLength)

  return val
}

Buffer.prototype.readIntBE = function readIntBE (offset, byteLength, noAssert) {
  offset = offset | 0
  byteLength = byteLength | 0
  if (!noAssert) checkOffset(offset, byteLength, this.length)

  var i = byteLength
  var mul = 1
  var val = this[offset + --i]
  while (i > 0 && (mul *= 0x100)) {
    val += this[offset + --i] * mul
  }
  mul *= 0x80

  if (val >= mul) val -= Math.pow(2, 8 * byteLength)

  return val
}

Buffer.prototype.readInt8 = function readInt8 (offset, noAssert) {
  if (!noAssert) checkOffset(offset, 1, this.length)
  if (!(this[offset] & 0x80)) return (this[offset])
  return ((0xff - this[offset] + 1) * -1)
}

Buffer.prototype.readInt16LE = function readInt16LE (offset, noAssert) {
  if (!noAssert) checkOffset(offset, 2, this.length)
  var val = this[offset] | (this[offset + 1] << 8)
  return (val & 0x8000) ? val | 0xFFFF0000 : val
}

Buffer.prototype.readInt16BE = function readInt16BE (offset, noAssert) {
  if (!noAssert) checkOffset(offset, 2, this.length)
  var val = this[offset + 1] | (this[offset] << 8)
  return (val & 0x8000) ? val | 0xFFFF0000 : val
}

Buffer.prototype.readInt32LE = function readInt32LE (offset, noAssert) {
  if (!noAssert) checkOffset(offset, 4, this.length)

  return (this[offset]) |
    (this[offset + 1] << 8) |
    (this[offset + 2] << 16) |
    (this[offset + 3] << 24)
}

Buffer.prototype.readInt32BE = function readInt32BE (offset, noAssert) {
  if (!noAssert) checkOffset(offset, 4, this.length)

  return (this[offset] << 24) |
    (this[offset + 1] << 16) |
    (this[offset + 2] << 8) |
    (this[offset + 3])
}

Buffer.prototype.readFloatLE = function readFloatLE (offset, noAssert) {
  if (!noAssert) checkOffset(offset, 4, this.length)
  return ieee754.read(this, offset, true, 23, 4)
}

Buffer.prototype.readFloatBE = function readFloatBE (offset, noAssert) {
  if (!noAssert) checkOffset(offset, 4, this.length)
  return ieee754.read(this, offset, false, 23, 4)
}

Buffer.prototype.readDoubleLE = function readDoubleLE (offset, noAssert) {
  if (!noAssert) checkOffset(offset, 8, this.length)
  return ieee754.read(this, offset, true, 52, 8)
}

Buffer.prototype.readDoubleBE = function readDoubleBE (offset, noAssert) {
  if (!noAssert) checkOffset(offset, 8, this.length)
  return ieee754.read(this, offset, false, 52, 8)
}

function checkInt (buf, value, offset, ext, max, min) {
  if (!Buffer.isBuffer(buf)) throw new TypeError('"buffer" argument must be a Buffer instance')
  if (value > max || value < min) throw new RangeError('"value" argument is out of bounds')
  if (offset + ext > buf.length) throw new RangeError('Index out of range')
}

Buffer.prototype.writeUIntLE = function writeUIntLE (value, offset, byteLength, noAssert) {
  value = +value
  offset = offset | 0
  byteLength = byteLength | 0
  if (!noAssert) {
    var maxBytes = Math.pow(2, 8 * byteLength) - 1
    checkInt(this, value, offset, byteLength, maxBytes, 0)
  }

  var mul = 1
  var i = 0
  this[offset] = value & 0xFF
  while (++i < byteLength && (mul *= 0x100)) {
    this[offset + i] = (value / mul) & 0xFF
  }

  return offset + byteLength
}

Buffer.prototype.writeUIntBE = function writeUIntBE (value, offset, byteLength, noAssert) {
  value = +value
  offset = offset | 0
  byteLength = byteLength | 0
  if (!noAssert) {
    var maxBytes = Math.pow(2, 8 * byteLength) - 1
    checkInt(this, value, offset, byteLength, maxBytes, 0)
  }

  var i = byteLength - 1
  var mul = 1
  this[offset + i] = value & 0xFF
  while (--i >= 0 && (mul *= 0x100)) {
    this[offset + i] = (value / mul) & 0xFF
  }

  return offset + byteLength
}

Buffer.prototype.writeUInt8 = function writeUInt8 (value, offset, noAssert) {
  value = +value
  offset = offset | 0
  if (!noAssert) checkInt(this, value, offset, 1, 0xff, 0)
  if (!Buffer.TYPED_ARRAY_SUPPORT) value = Math.floor(value)
  this[offset] = (value & 0xff)
  return offset + 1
}

function objectWriteUInt16 (buf, value, offset, littleEndian) {
  if (value < 0) value = 0xffff + value + 1
  for (var i = 0, j = Math.min(buf.length - offset, 2); i < j; ++i) {
    buf[offset + i] = (value & (0xff << (8 * (littleEndian ? i : 1 - i)))) >>>
      (littleEndian ? i : 1 - i) * 8
  }
}

Buffer.prototype.writeUInt16LE = function writeUInt16LE (value, offset, noAssert) {
  value = +value
  offset = offset | 0
  if (!noAssert) checkInt(this, value, offset, 2, 0xffff, 0)
  if (Buffer.TYPED_ARRAY_SUPPORT) {
    this[offset] = (value & 0xff)
    this[offset + 1] = (value >>> 8)
  } else {
    objectWriteUInt16(this, value, offset, true)
  }
  return offset + 2
}

Buffer.prototype.writeUInt16BE = function writeUInt16BE (value, offset, noAssert) {
  value = +value
  offset = offset | 0
  if (!noAssert) checkInt(this, value, offset, 2, 0xffff, 0)
  if (Buffer.TYPED_ARRAY_SUPPORT) {
    this[offset] = (value >>> 8)
    this[offset + 1] = (value & 0xff)
  } else {
    objectWriteUInt16(this, value, offset, false)
  }
  return offset + 2
}

function objectWriteUInt32 (buf, value, offset, littleEndian) {
  if (value < 0) value = 0xffffffff + value + 1
  for (var i = 0, j = Math.min(buf.length - offset, 4); i < j; ++i) {
    buf[offset + i] = (value >>> (littleEndian ? i : 3 - i) * 8) & 0xff
  }
}

Buffer.prototype.writeUInt32LE = function writeUInt32LE (value, offset, noAssert) {
  value = +value
  offset = offset | 0
  if (!noAssert) checkInt(this, value, offset, 4, 0xffffffff, 0)
  if (Buffer.TYPED_ARRAY_SUPPORT) {
    this[offset + 3] = (value >>> 24)
    this[offset + 2] = (value >>> 16)
    this[offset + 1] = (value >>> 8)
    this[offset] = (value & 0xff)
  } else {
    objectWriteUInt32(this, value, offset, true)
  }
  return offset + 4
}

Buffer.prototype.writeUInt32BE = function writeUInt32BE (value, offset, noAssert) {
  value = +value
  offset = offset | 0
  if (!noAssert) checkInt(this, value, offset, 4, 0xffffffff, 0)
  if (Buffer.TYPED_ARRAY_SUPPORT) {
    this[offset] = (value >>> 24)
    this[offset + 1] = (value >>> 16)
    this[offset + 2] = (value >>> 8)
    this[offset + 3] = (value & 0xff)
  } else {
    objectWriteUInt32(this, value, offset, false)
  }
  return offset + 4
}

Buffer.prototype.writeIntLE = function writeIntLE (value, offset, byteLength, noAssert) {
  value = +value
  offset = offset | 0
  if (!noAssert) {
    var limit = Math.pow(2, 8 * byteLength - 1)

    checkInt(this, value, offset, byteLength, limit - 1, -limit)
  }

  var i = 0
  var mul = 1
  var sub = 0
  this[offset] = value & 0xFF
  while (++i < byteLength && (mul *= 0x100)) {
    if (value < 0 && sub === 0 && this[offset + i - 1] !== 0) {
      sub = 1
    }
    this[offset + i] = ((value / mul) >> 0) - sub & 0xFF
  }

  return offset + byteLength
}

Buffer.prototype.writeIntBE = function writeIntBE (value, offset, byteLength, noAssert) {
  value = +value
  offset = offset | 0
  if (!noAssert) {
    var limit = Math.pow(2, 8 * byteLength - 1)

    checkInt(this, value, offset, byteLength, limit - 1, -limit)
  }

  var i = byteLength - 1
  var mul = 1
  var sub = 0
  this[offset + i] = value & 0xFF
  while (--i >= 0 && (mul *= 0x100)) {
    if (value < 0 && sub === 0 && this[offset + i + 1] !== 0) {
      sub = 1
    }
    this[offset + i] = ((value / mul) >> 0) - sub & 0xFF
  }

  return offset + byteLength
}

Buffer.prototype.writeInt8 = function writeInt8 (value, offset, noAssert) {
  value = +value
  offset = offset | 0
  if (!noAssert) checkInt(this, value, offset, 1, 0x7f, -0x80)
  if (!Buffer.TYPED_ARRAY_SUPPORT) value = Math.floor(value)
  if (value < 0) value = 0xff + value + 1
  this[offset] = (value & 0xff)
  return offset + 1
}

Buffer.prototype.writeInt16LE = function writeInt16LE (value, offset, noAssert) {
  value = +value
  offset = offset | 0
  if (!noAssert) checkInt(this, value, offset, 2, 0x7fff, -0x8000)
  if (Buffer.TYPED_ARRAY_SUPPORT) {
    this[offset] = (value & 0xff)
    this[offset + 1] = (value >>> 8)
  } else {
    objectWriteUInt16(this, value, offset, true)
  }
  return offset + 2
}

Buffer.prototype.writeInt16BE = function writeInt16BE (value, offset, noAssert) {
  value = +value
  offset = offset | 0
  if (!noAssert) checkInt(this, value, offset, 2, 0x7fff, -0x8000)
  if (Buffer.TYPED_ARRAY_SUPPORT) {
    this[offset] = (value >>> 8)
    this[offset + 1] = (value & 0xff)
  } else {
    objectWriteUInt16(this, value, offset, false)
  }
  return offset + 2
}

Buffer.prototype.writeInt32LE = function writeInt32LE (value, offset, noAssert) {
  value = +value
  offset = offset | 0
  if (!noAssert) checkInt(this, value, offset, 4, 0x7fffffff, -0x80000000)
  if (Buffer.TYPED_ARRAY_SUPPORT) {
    this[offset] = (value & 0xff)
    this[offset + 1] = (value >>> 8)
    this[offset + 2] = (value >>> 16)
    this[offset + 3] = (value >>> 24)
  } else {
    objectWriteUInt32(this, value, offset, true)
  }
  return offset + 4
}

Buffer.prototype.writeInt32BE = function writeInt32BE (value, offset, noAssert) {
  value = +value
  offset = offset | 0
  if (!noAssert) checkInt(this, value, offset, 4, 0x7fffffff, -0x80000000)
  if (value < 0) value = 0xffffffff + value + 1
  if (Buffer.TYPED_ARRAY_SUPPORT) {
    this[offset] = (value >>> 24)
    this[offset + 1] = (value >>> 16)
    this[offset + 2] = (value >>> 8)
    this[offset + 3] = (value & 0xff)
  } else {
    objectWriteUInt32(this, value, offset, false)
  }
  return offset + 4
}

function checkIEEE754 (buf, value, offset, ext, max, min) {
  if (offset + ext > buf.length) throw new RangeError('Index out of range')
  if (offset < 0) throw new RangeError('Index out of range')
}

function writeFloat (buf, value, offset, littleEndian, noAssert) {
  if (!noAssert) {
    checkIEEE754(buf, value, offset, 4, 3.4028234663852886e+38, -3.4028234663852886e+38)
  }
  ieee754.write(buf, value, offset, littleEndian, 23, 4)
  return offset + 4
}

Buffer.prototype.writeFloatLE = function writeFloatLE (value, offset, noAssert) {
  return writeFloat(this, value, offset, true, noAssert)
}

Buffer.prototype.writeFloatBE = function writeFloatBE (value, offset, noAssert) {
  return writeFloat(this, value, offset, false, noAssert)
}

function writeDouble (buf, value, offset, littleEndian, noAssert) {
  if (!noAssert) {
    checkIEEE754(buf, value, offset, 8, 1.7976931348623157E+308, -1.7976931348623157E+308)
  }
  ieee754.write(buf, value, offset, littleEndian, 52, 8)
  return offset + 8
}

Buffer.prototype.writeDoubleLE = function writeDoubleLE (value, offset, noAssert) {
  return writeDouble(this, value, offset, true, noAssert)
}

Buffer.prototype.writeDoubleBE = function writeDoubleBE (value, offset, noAssert) {
  return writeDouble(this, value, offset, false, noAssert)
}

// copy(targetBuffer, targetStart=0, sourceStart=0, sourceEnd=buffer.length)
Buffer.prototype.copy = function copy (target, targetStart, start, end) {
  if (!start) start = 0
  if (!end && end !== 0) end = this.length
  if (targetStart >= target.length) targetStart = target.length
  if (!targetStart) targetStart = 0
  if (end > 0 && end < start) end = start

  // Copy 0 bytes; we're done
  if (end === start) return 0
  if (target.length === 0 || this.length === 0) return 0

  // Fatal error conditions
  if (targetStart < 0) {
    throw new RangeError('targetStart out of bounds')
  }
  if (start < 0 || start >= this.length) throw new RangeError('sourceStart out of bounds')
  if (end < 0) throw new RangeError('sourceEnd out of bounds')

  // Are we oob?
  if (end > this.length) end = this.length
  if (target.length - targetStart < end - start) {
    end = target.length - targetStart + start
  }

  var len = end - start
  var i

  if (this === target && start < targetStart && targetStart < end) {
    // descending copy from end
    for (i = len - 1; i >= 0; --i) {
      target[i + targetStart] = this[i + start]
    }
  } else if (len < 1000 || !Buffer.TYPED_ARRAY_SUPPORT) {
    // ascending copy from start
    for (i = 0; i < len; ++i) {
      target[i + targetStart] = this[i + start]
    }
  } else {
    Uint8Array.prototype.set.call(
      target,
      this.subarray(start, start + len),
      targetStart
    )
  }

  return len
}

// Usage:
//    buffer.fill(number[, offset[, end]])
//    buffer.fill(buffer[, offset[, end]])
//    buffer.fill(string[, offset[, end]][, encoding])
Buffer.prototype.fill = function fill (val, start, end, encoding) {
  // Handle string cases:
  if (typeof val === 'string') {
    if (typeof start === 'string') {
      encoding = start
      start = 0
      end = this.length
    } else if (typeof end === 'string') {
      encoding = end
      end = this.length
    }
    if (val.length === 1) {
      var code = val.charCodeAt(0)
      if (code < 256) {
        val = code
      }
    }
    if (encoding !== undefined && typeof encoding !== 'string') {
      throw new TypeError('encoding must be a string')
    }
    if (typeof encoding === 'string' && !Buffer.isEncoding(encoding)) {
      throw new TypeError('Unknown encoding: ' + encoding)
    }
  } else if (typeof val === 'number') {
    val = val & 255
  }

  // Invalid ranges are not set to a default, so can range check early.
  if (start < 0 || this.length < start || this.length < end) {
    throw new RangeError('Out of range index')
  }

  if (end <= start) {
    return this
  }

  start = start >>> 0
  end = end === undefined ? this.length : end >>> 0

  if (!val) val = 0

  var i
  if (typeof val === 'number') {
    for (i = start; i < end; ++i) {
      this[i] = val
    }
  } else {
    var bytes = Buffer.isBuffer(val)
      ? val
      : utf8ToBytes(new Buffer(val, encoding).toString())
    var len = bytes.length
    for (i = 0; i < end - start; ++i) {
      this[i + start] = bytes[i % len]
    }
  }

  return this
}

// HELPER FUNCTIONS
// ================

var INVALID_BASE64_RE = /[^+\/0-9A-Za-z-_]/g

function base64clean (str) {
  // Node strips out invalid characters like \n and \t from the string, base64-js does not
  str = stringtrim(str).replace(INVALID_BASE64_RE, '')
  // Node converts strings with length < 2 to ''
  if (str.length < 2) return ''
  // Node allows for non-padded base64 strings (missing trailing ===), base64-js does not
  while (str.length % 4 !== 0) {
    str = str + '='
  }
  return str
}

function stringtrim (str) {
  if (str.trim) return str.trim()
  return str.replace(/^\s+|\s+$/g, '')
}

function toHex (n) {
  if (n < 16) return '0' + n.toString(16)
  return n.toString(16)
}

function utf8ToBytes (string, units) {
  units = units || Infinity
  var codePoint
  var length = string.length
  var leadSurrogate = null
  var bytes = []

  for (var i = 0; i < length; ++i) {
    codePoint = string.charCodeAt(i)

    // is surrogate component
    if (codePoint > 0xD7FF && codePoint < 0xE000) {
      // last char was a lead
      if (!leadSurrogate) {
        // no lead yet
        if (codePoint > 0xDBFF) {
          // unexpected trail
          if ((units -= 3) > -1) bytes.push(0xEF, 0xBF, 0xBD)
          continue
        } else if (i + 1 === length) {
          // unpaired lead
          if ((units -= 3) > -1) bytes.push(0xEF, 0xBF, 0xBD)
          continue
        }

        // valid lead
        leadSurrogate = codePoint

        continue
      }

      // 2 leads in a row
      if (codePoint < 0xDC00) {
        if ((units -= 3) > -1) bytes.push(0xEF, 0xBF, 0xBD)
        leadSurrogate = codePoint
        continue
      }

      // valid surrogate pair
      codePoint = (leadSurrogate - 0xD800 << 10 | codePoint - 0xDC00) + 0x10000
    } else if (leadSurrogate) {
      // valid bmp char, but last char was a lead
      if ((units -= 3) > -1) bytes.push(0xEF, 0xBF, 0xBD)
    }

    leadSurrogate = null

    // encode utf8
    if (codePoint < 0x80) {
      if ((units -= 1) < 0) break
      bytes.push(codePoint)
    } else if (codePoint < 0x800) {
      if ((units -= 2) < 0) break
      bytes.push(
        codePoint >> 0x6 | 0xC0,
        codePoint & 0x3F | 0x80
      )
    } else if (codePoint < 0x10000) {
      if ((units -= 3) < 0) break
      bytes.push(
        codePoint >> 0xC | 0xE0,
        codePoint >> 0x6 & 0x3F | 0x80,
        codePoint & 0x3F | 0x80
      )
    } else if (codePoint < 0x110000) {
      if ((units -= 4) < 0) break
      bytes.push(
        codePoint >> 0x12 | 0xF0,
        codePoint >> 0xC & 0x3F | 0x80,
        codePoint >> 0x6 & 0x3F | 0x80,
        codePoint & 0x3F | 0x80
      )
    } else {
      throw new Error('Invalid code point')
    }
  }

  return bytes
}

function asciiToBytes (str) {
  var byteArray = []
  for (var i = 0; i < str.length; ++i) {
    // Node's code seems to be doing this and not & 0x7F..
    byteArray.push(str.charCodeAt(i) & 0xFF)
  }
  return byteArray
}

function utf16leToBytes (str, units) {
  var c, hi, lo
  var byteArray = []
  for (var i = 0; i < str.length; ++i) {
    if ((units -= 2) < 0) break

    c = str.charCodeAt(i)
    hi = c >> 8
    lo = c % 256
    byteArray.push(lo)
    byteArray.push(hi)
  }

  return byteArray
}

function base64ToBytes (str) {
  return base64.toByteArray(base64clean(str))
}

function blitBuffer (src, dst, offset, length) {
  for (var i = 0; i < length; ++i) {
    if ((i + offset >= dst.length) || (i >= src.length)) break
    dst[i + offset] = src[i]
  }
  return i
}

function isnan (val) {
  return val !== val // eslint-disable-line no-self-compare
}

/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(37)))

/***/ }),
/* 7 */
/***/ (function(module, exports) {

module.exports = function (it) {
  return typeof it === 'object' ? it !== null : typeof it === 'function';
};


/***/ }),
/* 8 */
/***/ (function(module, exports, __webpack_require__) {

/* eslint-disable node/no-deprecated-api */
var buffer = __webpack_require__(6)
var Buffer = buffer.Buffer

// alternative to using Object.keys for old browsers
function copyProps (src, dst) {
  for (var key in src) {
    dst[key] = src[key]
  }
}
if (Buffer.from && Buffer.alloc && Buffer.allocUnsafe && Buffer.allocUnsafeSlow) {
  module.exports = buffer
} else {
  // Copy properties from require('buffer')
  copyProps(buffer, exports)
  exports.Buffer = SafeBuffer
}

function SafeBuffer (arg, encodingOrOffset, length) {
  return Buffer(arg, encodingOrOffset, length)
}

// Copy static methods from Buffer
copyProps(Buffer, SafeBuffer)

SafeBuffer.from = function (arg, encodingOrOffset, length) {
  if (typeof arg === 'number') {
    throw new TypeError('Argument must not be a number')
  }
  return Buffer(arg, encodingOrOffset, length)
}

SafeBuffer.alloc = function (size, fill, encoding) {
  if (typeof size !== 'number') {
    throw new TypeError('Argument must be a number')
  }
  var buf = Buffer(size)
  if (fill !== undefined) {
    if (typeof encoding === 'string') {
      buf.fill(fill, encoding)
    } else {
      buf.fill(fill)
    }
  } else {
    buf.fill(0)
  }
  return buf
}

SafeBuffer.allocUnsafe = function (size) {
  if (typeof size !== 'number') {
    throw new TypeError('Argument must be a number')
  }
  return Buffer(size)
}

SafeBuffer.allocUnsafeSlow = function (size) {
  if (typeof size !== 'number') {
    throw new TypeError('Argument must be a number')
  }
  return buffer.SlowBuffer(size)
}


/***/ }),
/* 9 */
/***/ (function(module, exports, __webpack_require__) {

var store = __webpack_require__(82)('wks');
var uid = __webpack_require__(47);
var Symbol = __webpack_require__(3).Symbol;
var USE_SYMBOL = typeof Symbol == 'function';

var $exports = module.exports = function (name) {
  return store[name] || (store[name] =
    USE_SYMBOL && Symbol[name] || (USE_SYMBOL ? Symbol : uid)('Symbol.' + name));
};

$exports.store = store;


/***/ }),
/* 10 */
/***/ (function(module, exports, __webpack_require__) {

// Thank's IE8 for his funny defineProperty
module.exports = !__webpack_require__(5)(function () {
  return Object.defineProperty({}, 'a', { get: function () { return 7; } }).a != 7;
});


/***/ }),
/* 11 */
/***/ (function(module, exports, __webpack_require__) {

var anObject = __webpack_require__(2);
var IE8_DOM_DEFINE = __webpack_require__(179);
var toPrimitive = __webpack_require__(31);
var dP = Object.defineProperty;

exports.f = __webpack_require__(10) ? Object.defineProperty : function defineProperty(O, P, Attributes) {
  anObject(O);
  P = toPrimitive(P, true);
  anObject(Attributes);
  if (IE8_DOM_DEFINE) try {
    return dP(O, P, Attributes);
  } catch (e) { /* empty */ }
  if ('get' in Attributes || 'set' in Attributes) throw TypeError('Accessors not supported!');
  if ('value' in Attributes) O[P] = Attributes.value;
  return O;
};


/***/ }),
/* 12 */
/***/ (function(module, exports, __webpack_require__) {

// 7.1.15 ToLength
var toInteger = __webpack_require__(33);
var min = Math.min;
module.exports = function (it) {
  return it > 0 ? min(toInteger(it), 0x1fffffffffffff) : 0; // pow(2, 53) - 1 == 9007199254740991
};


/***/ }),
/* 13 */
/***/ (function(module, exports, __webpack_require__) {

/* WEBPACK VAR INJECTION */(function(module) {(function (module, exports) {
  'use strict';

  // Utils
  function assert (val, msg) {
    if (!val) throw new Error(msg || 'Assertion failed');
  }

  // Could use `inherits` module, but don't want to move from single file
  // architecture yet.
  function inherits (ctor, superCtor) {
    ctor.super_ = superCtor;
    var TempCtor = function () {};
    TempCtor.prototype = superCtor.prototype;
    ctor.prototype = new TempCtor();
    ctor.prototype.constructor = ctor;
  }

  // BN

  function BN (number, base, endian) {
    if (BN.isBN(number)) {
      return number;
    }

    this.negative = 0;
    this.words = null;
    this.length = 0;

    // Reduction context
    this.red = null;

    if (number !== null) {
      if (base === 'le' || base === 'be') {
        endian = base;
        base = 10;
      }

      this._init(number || 0, base || 10, endian || 'be');
    }
  }
  if (typeof module === 'object') {
    module.exports = BN;
  } else {
    exports.BN = BN;
  }

  BN.BN = BN;
  BN.wordSize = 26;

  var Buffer;
  try {
    Buffer = __webpack_require__(260).Buffer;
  } catch (e) {
  }

  BN.isBN = function isBN (num) {
    if (num instanceof BN) {
      return true;
    }

    return num !== null && typeof num === 'object' &&
      num.constructor.wordSize === BN.wordSize && Array.isArray(num.words);
  };

  BN.max = function max (left, right) {
    if (left.cmp(right) > 0) return left;
    return right;
  };

  BN.min = function min (left, right) {
    if (left.cmp(right) < 0) return left;
    return right;
  };

  BN.prototype._init = function init (number, base, endian) {
    if (typeof number === 'number') {
      return this._initNumber(number, base, endian);
    }

    if (typeof number === 'object') {
      return this._initArray(number, base, endian);
    }

    if (base === 'hex') {
      base = 16;
    }
    assert(base === (base | 0) && base >= 2 && base <= 36);

    number = number.toString().replace(/\s+/g, '');
    var start = 0;
    if (number[0] === '-') {
      start++;
    }

    if (base === 16) {
      this._parseHex(number, start);
    } else {
      this._parseBase(number, base, start);
    }

    if (number[0] === '-') {
      this.negative = 1;
    }

    this.strip();

    if (endian !== 'le') return;

    this._initArray(this.toArray(), base, endian);
  };

  BN.prototype._initNumber = function _initNumber (number, base, endian) {
    if (number < 0) {
      this.negative = 1;
      number = -number;
    }
    if (number < 0x4000000) {
      this.words = [ number & 0x3ffffff ];
      this.length = 1;
    } else if (number < 0x10000000000000) {
      this.words = [
        number & 0x3ffffff,
        (number / 0x4000000) & 0x3ffffff
      ];
      this.length = 2;
    } else {
      assert(number < 0x20000000000000); // 2 ^ 53 (unsafe)
      this.words = [
        number & 0x3ffffff,
        (number / 0x4000000) & 0x3ffffff,
        1
      ];
      this.length = 3;
    }

    if (endian !== 'le') return;

    // Reverse the bytes
    this._initArray(this.toArray(), base, endian);
  };

  BN.prototype._initArray = function _initArray (number, base, endian) {
    // Perhaps a Uint8Array
    assert(typeof number.length === 'number');
    if (number.length <= 0) {
      this.words = [ 0 ];
      this.length = 1;
      return this;
    }

    this.length = Math.ceil(number.length / 3);
    this.words = new Array(this.length);
    for (var i = 0; i < this.length; i++) {
      this.words[i] = 0;
    }

    var j, w;
    var off = 0;
    if (endian === 'be') {
      for (i = number.length - 1, j = 0; i >= 0; i -= 3) {
        w = number[i] | (number[i - 1] << 8) | (number[i - 2] << 16);
        this.words[j] |= (w << off) & 0x3ffffff;
        this.words[j + 1] = (w >>> (26 - off)) & 0x3ffffff;
        off += 24;
        if (off >= 26) {
          off -= 26;
          j++;
        }
      }
    } else if (endian === 'le') {
      for (i = 0, j = 0; i < number.length; i += 3) {
        w = number[i] | (number[i + 1] << 8) | (number[i + 2] << 16);
        this.words[j] |= (w << off) & 0x3ffffff;
        this.words[j + 1] = (w >>> (26 - off)) & 0x3ffffff;
        off += 24;
        if (off >= 26) {
          off -= 26;
          j++;
        }
      }
    }
    return this.strip();
  };

  function parseHex (str, start, end) {
    var r = 0;
    var len = Math.min(str.length, end);
    for (var i = start; i < len; i++) {
      var c = str.charCodeAt(i) - 48;

      r <<= 4;

      // 'a' - 'f'
      if (c >= 49 && c <= 54) {
        r |= c - 49 + 0xa;

      // 'A' - 'F'
      } else if (c >= 17 && c <= 22) {
        r |= c - 17 + 0xa;

      // '0' - '9'
      } else {
        r |= c & 0xf;
      }
    }
    return r;
  }

  BN.prototype._parseHex = function _parseHex (number, start) {
    // Create possibly bigger array to ensure that it fits the number
    this.length = Math.ceil((number.length - start) / 6);
    this.words = new Array(this.length);
    for (var i = 0; i < this.length; i++) {
      this.words[i] = 0;
    }

    var j, w;
    // Scan 24-bit chunks and add them to the number
    var off = 0;
    for (i = number.length - 6, j = 0; i >= start; i -= 6) {
      w = parseHex(number, i, i + 6);
      this.words[j] |= (w << off) & 0x3ffffff;
      // NOTE: `0x3fffff` is intentional here, 26bits max shift + 24bit hex limb
      this.words[j + 1] |= w >>> (26 - off) & 0x3fffff;
      off += 24;
      if (off >= 26) {
        off -= 26;
        j++;
      }
    }
    if (i + 6 !== start) {
      w = parseHex(number, start, i + 6);
      this.words[j] |= (w << off) & 0x3ffffff;
      this.words[j + 1] |= w >>> (26 - off) & 0x3fffff;
    }
    this.strip();
  };

  function parseBase (str, start, end, mul) {
    var r = 0;
    var len = Math.min(str.length, end);
    for (var i = start; i < len; i++) {
      var c = str.charCodeAt(i) - 48;

      r *= mul;

      // 'a'
      if (c >= 49) {
        r += c - 49 + 0xa;

      // 'A'
      } else if (c >= 17) {
        r += c - 17 + 0xa;

      // '0' - '9'
      } else {
        r += c;
      }
    }
    return r;
  }

  BN.prototype._parseBase = function _parseBase (number, base, start) {
    // Initialize as zero
    this.words = [ 0 ];
    this.length = 1;

    // Find length of limb in base
    for (var limbLen = 0, limbPow = 1; limbPow <= 0x3ffffff; limbPow *= base) {
      limbLen++;
    }
    limbLen--;
    limbPow = (limbPow / base) | 0;

    var total = number.length - start;
    var mod = total % limbLen;
    var end = Math.min(total, total - mod) + start;

    var word = 0;
    for (var i = start; i < end; i += limbLen) {
      word = parseBase(number, i, i + limbLen, base);

      this.imuln(limbPow);
      if (this.words[0] + word < 0x4000000) {
        this.words[0] += word;
      } else {
        this._iaddn(word);
      }
    }

    if (mod !== 0) {
      var pow = 1;
      word = parseBase(number, i, number.length, base);

      for (i = 0; i < mod; i++) {
        pow *= base;
      }

      this.imuln(pow);
      if (this.words[0] + word < 0x4000000) {
        this.words[0] += word;
      } else {
        this._iaddn(word);
      }
    }
  };

  BN.prototype.copy = function copy (dest) {
    dest.words = new Array(this.length);
    for (var i = 0; i < this.length; i++) {
      dest.words[i] = this.words[i];
    }
    dest.length = this.length;
    dest.negative = this.negative;
    dest.red = this.red;
  };

  BN.prototype.clone = function clone () {
    var r = new BN(null);
    this.copy(r);
    return r;
  };

  BN.prototype._expand = function _expand (size) {
    while (this.length < size) {
      this.words[this.length++] = 0;
    }
    return this;
  };

  // Remove leading `0` from `this`
  BN.prototype.strip = function strip () {
    while (this.length > 1 && this.words[this.length - 1] === 0) {
      this.length--;
    }
    return this._normSign();
  };

  BN.prototype._normSign = function _normSign () {
    // -0 = 0
    if (this.length === 1 && this.words[0] === 0) {
      this.negative = 0;
    }
    return this;
  };

  BN.prototype.inspect = function inspect () {
    return (this.red ? '<BN-R: ' : '<BN: ') + this.toString(16) + '>';
  };

  /*

  var zeros = [];
  var groupSizes = [];
  var groupBases = [];

  var s = '';
  var i = -1;
  while (++i < BN.wordSize) {
    zeros[i] = s;
    s += '0';
  }
  groupSizes[0] = 0;
  groupSizes[1] = 0;
  groupBases[0] = 0;
  groupBases[1] = 0;
  var base = 2 - 1;
  while (++base < 36 + 1) {
    var groupSize = 0;
    var groupBase = 1;
    while (groupBase < (1 << BN.wordSize) / base) {
      groupBase *= base;
      groupSize += 1;
    }
    groupSizes[base] = groupSize;
    groupBases[base] = groupBase;
  }

  */

  var zeros = [
    '',
    '0',
    '00',
    '000',
    '0000',
    '00000',
    '000000',
    '0000000',
    '00000000',
    '000000000',
    '0000000000',
    '00000000000',
    '000000000000',
    '0000000000000',
    '00000000000000',
    '000000000000000',
    '0000000000000000',
    '00000000000000000',
    '000000000000000000',
    '0000000000000000000',
    '00000000000000000000',
    '000000000000000000000',
    '0000000000000000000000',
    '00000000000000000000000',
    '000000000000000000000000',
    '0000000000000000000000000'
  ];

  var groupSizes = [
    0, 0,
    25, 16, 12, 11, 10, 9, 8,
    8, 7, 7, 7, 7, 6, 6,
    6, 6, 6, 6, 6, 5, 5,
    5, 5, 5, 5, 5, 5, 5,
    5, 5, 5, 5, 5, 5, 5
  ];

  var groupBases = [
    0, 0,
    33554432, 43046721, 16777216, 48828125, 60466176, 40353607, 16777216,
    43046721, 10000000, 19487171, 35831808, 62748517, 7529536, 11390625,
    16777216, 24137569, 34012224, 47045881, 64000000, 4084101, 5153632,
    6436343, 7962624, 9765625, 11881376, 14348907, 17210368, 20511149,
    24300000, 28629151, 33554432, 39135393, 45435424, 52521875, 60466176
  ];

  BN.prototype.toString = function toString (base, padding) {
    base = base || 10;
    padding = padding | 0 || 1;

    var out;
    if (base === 16 || base === 'hex') {
      out = '';
      var off = 0;
      var carry = 0;
      for (var i = 0; i < this.length; i++) {
        var w = this.words[i];
        var word = (((w << off) | carry) & 0xffffff).toString(16);
        carry = (w >>> (24 - off)) & 0xffffff;
        if (carry !== 0 || i !== this.length - 1) {
          out = zeros[6 - word.length] + word + out;
        } else {
          out = word + out;
        }
        off += 2;
        if (off >= 26) {
          off -= 26;
          i--;
        }
      }
      if (carry !== 0) {
        out = carry.toString(16) + out;
      }
      while (out.length % padding !== 0) {
        out = '0' + out;
      }
      if (this.negative !== 0) {
        out = '-' + out;
      }
      return out;
    }

    if (base === (base | 0) && base >= 2 && base <= 36) {
      // var groupSize = Math.floor(BN.wordSize * Math.LN2 / Math.log(base));
      var groupSize = groupSizes[base];
      // var groupBase = Math.pow(base, groupSize);
      var groupBase = groupBases[base];
      out = '';
      var c = this.clone();
      c.negative = 0;
      while (!c.isZero()) {
        var r = c.modn(groupBase).toString(base);
        c = c.idivn(groupBase);

        if (!c.isZero()) {
          out = zeros[groupSize - r.length] + r + out;
        } else {
          out = r + out;
        }
      }
      if (this.isZero()) {
        out = '0' + out;
      }
      while (out.length % padding !== 0) {
        out = '0' + out;
      }
      if (this.negative !== 0) {
        out = '-' + out;
      }
      return out;
    }

    assert(false, 'Base should be between 2 and 36');
  };

  BN.prototype.toNumber = function toNumber () {
    var ret = this.words[0];
    if (this.length === 2) {
      ret += this.words[1] * 0x4000000;
    } else if (this.length === 3 && this.words[2] === 0x01) {
      // NOTE: at this stage it is known that the top bit is set
      ret += 0x10000000000000 + (this.words[1] * 0x4000000);
    } else if (this.length > 2) {
      assert(false, 'Number can only safely store up to 53 bits');
    }
    return (this.negative !== 0) ? -ret : ret;
  };

  BN.prototype.toJSON = function toJSON () {
    return this.toString(16);
  };

  BN.prototype.toBuffer = function toBuffer (endian, length) {
    assert(typeof Buffer !== 'undefined');
    return this.toArrayLike(Buffer, endian, length);
  };

  BN.prototype.toArray = function toArray (endian, length) {
    return this.toArrayLike(Array, endian, length);
  };

  BN.prototype.toArrayLike = function toArrayLike (ArrayType, endian, length) {
    var byteLength = this.byteLength();
    var reqLength = length || Math.max(1, byteLength);
    assert(byteLength <= reqLength, 'byte array longer than desired length');
    assert(reqLength > 0, 'Requested array length <= 0');

    this.strip();
    var littleEndian = endian === 'le';
    var res = new ArrayType(reqLength);

    var b, i;
    var q = this.clone();
    if (!littleEndian) {
      // Assume big-endian
      for (i = 0; i < reqLength - byteLength; i++) {
        res[i] = 0;
      }

      for (i = 0; !q.isZero(); i++) {
        b = q.andln(0xff);
        q.iushrn(8);

        res[reqLength - i - 1] = b;
      }
    } else {
      for (i = 0; !q.isZero(); i++) {
        b = q.andln(0xff);
        q.iushrn(8);

        res[i] = b;
      }

      for (; i < reqLength; i++) {
        res[i] = 0;
      }
    }

    return res;
  };

  if (Math.clz32) {
    BN.prototype._countBits = function _countBits (w) {
      return 32 - Math.clz32(w);
    };
  } else {
    BN.prototype._countBits = function _countBits (w) {
      var t = w;
      var r = 0;
      if (t >= 0x1000) {
        r += 13;
        t >>>= 13;
      }
      if (t >= 0x40) {
        r += 7;
        t >>>= 7;
      }
      if (t >= 0x8) {
        r += 4;
        t >>>= 4;
      }
      if (t >= 0x02) {
        r += 2;
        t >>>= 2;
      }
      return r + t;
    };
  }

  BN.prototype._zeroBits = function _zeroBits (w) {
    // Short-cut
    if (w === 0) return 26;

    var t = w;
    var r = 0;
    if ((t & 0x1fff) === 0) {
      r += 13;
      t >>>= 13;
    }
    if ((t & 0x7f) === 0) {
      r += 7;
      t >>>= 7;
    }
    if ((t & 0xf) === 0) {
      r += 4;
      t >>>= 4;
    }
    if ((t & 0x3) === 0) {
      r += 2;
      t >>>= 2;
    }
    if ((t & 0x1) === 0) {
      r++;
    }
    return r;
  };

  // Return number of used bits in a BN
  BN.prototype.bitLength = function bitLength () {
    var w = this.words[this.length - 1];
    var hi = this._countBits(w);
    return (this.length - 1) * 26 + hi;
  };

  function toBitArray (num) {
    var w = new Array(num.bitLength());

    for (var bit = 0; bit < w.length; bit++) {
      var off = (bit / 26) | 0;
      var wbit = bit % 26;

      w[bit] = (num.words[off] & (1 << wbit)) >>> wbit;
    }

    return w;
  }

  // Number of trailing zero bits
  BN.prototype.zeroBits = function zeroBits () {
    if (this.isZero()) return 0;

    var r = 0;
    for (var i = 0; i < this.length; i++) {
      var b = this._zeroBits(this.words[i]);
      r += b;
      if (b !== 26) break;
    }
    return r;
  };

  BN.prototype.byteLength = function byteLength () {
    return Math.ceil(this.bitLength() / 8);
  };

  BN.prototype.toTwos = function toTwos (width) {
    if (this.negative !== 0) {
      return this.abs().inotn(width).iaddn(1);
    }
    return this.clone();
  };

  BN.prototype.fromTwos = function fromTwos (width) {
    if (this.testn(width - 1)) {
      return this.notn(width).iaddn(1).ineg();
    }
    return this.clone();
  };

  BN.prototype.isNeg = function isNeg () {
    return this.negative !== 0;
  };

  // Return negative clone of `this`
  BN.prototype.neg = function neg () {
    return this.clone().ineg();
  };

  BN.prototype.ineg = function ineg () {
    if (!this.isZero()) {
      this.negative ^= 1;
    }

    return this;
  };

  // Or `num` with `this` in-place
  BN.prototype.iuor = function iuor (num) {
    while (this.length < num.length) {
      this.words[this.length++] = 0;
    }

    for (var i = 0; i < num.length; i++) {
      this.words[i] = this.words[i] | num.words[i];
    }

    return this.strip();
  };

  BN.prototype.ior = function ior (num) {
    assert((this.negative | num.negative) === 0);
    return this.iuor(num);
  };

  // Or `num` with `this`
  BN.prototype.or = function or (num) {
    if (this.length > num.length) return this.clone().ior(num);
    return num.clone().ior(this);
  };

  BN.prototype.uor = function uor (num) {
    if (this.length > num.length) return this.clone().iuor(num);
    return num.clone().iuor(this);
  };

  // And `num` with `this` in-place
  BN.prototype.iuand = function iuand (num) {
    // b = min-length(num, this)
    var b;
    if (this.length > num.length) {
      b = num;
    } else {
      b = this;
    }

    for (var i = 0; i < b.length; i++) {
      this.words[i] = this.words[i] & num.words[i];
    }

    this.length = b.length;

    return this.strip();
  };

  BN.prototype.iand = function iand (num) {
    assert((this.negative | num.negative) === 0);
    return this.iuand(num);
  };

  // And `num` with `this`
  BN.prototype.and = function and (num) {
    if (this.length > num.length) return this.clone().iand(num);
    return num.clone().iand(this);
  };

  BN.prototype.uand = function uand (num) {
    if (this.length > num.length) return this.clone().iuand(num);
    return num.clone().iuand(this);
  };

  // Xor `num` with `this` in-place
  BN.prototype.iuxor = function iuxor (num) {
    // a.length > b.length
    var a;
    var b;
    if (this.length > num.length) {
      a = this;
      b = num;
    } else {
      a = num;
      b = this;
    }

    for (var i = 0; i < b.length; i++) {
      this.words[i] = a.words[i] ^ b.words[i];
    }

    if (this !== a) {
      for (; i < a.length; i++) {
        this.words[i] = a.words[i];
      }
    }

    this.length = a.length;

    return this.strip();
  };

  BN.prototype.ixor = function ixor (num) {
    assert((this.negative | num.negative) === 0);
    return this.iuxor(num);
  };

  // Xor `num` with `this`
  BN.prototype.xor = function xor (num) {
    if (this.length > num.length) return this.clone().ixor(num);
    return num.clone().ixor(this);
  };

  BN.prototype.uxor = function uxor (num) {
    if (this.length > num.length) return this.clone().iuxor(num);
    return num.clone().iuxor(this);
  };

  // Not ``this`` with ``width`` bitwidth
  BN.prototype.inotn = function inotn (width) {
    assert(typeof width === 'number' && width >= 0);

    var bytesNeeded = Math.ceil(width / 26) | 0;
    var bitsLeft = width % 26;

    // Extend the buffer with leading zeroes
    this._expand(bytesNeeded);

    if (bitsLeft > 0) {
      bytesNeeded--;
    }

    // Handle complete words
    for (var i = 0; i < bytesNeeded; i++) {
      this.words[i] = ~this.words[i] & 0x3ffffff;
    }

    // Handle the residue
    if (bitsLeft > 0) {
      this.words[i] = ~this.words[i] & (0x3ffffff >> (26 - bitsLeft));
    }

    // And remove leading zeroes
    return this.strip();
  };

  BN.prototype.notn = function notn (width) {
    return this.clone().inotn(width);
  };

  // Set `bit` of `this`
  BN.prototype.setn = function setn (bit, val) {
    assert(typeof bit === 'number' && bit >= 0);

    var off = (bit / 26) | 0;
    var wbit = bit % 26;

    this._expand(off + 1);

    if (val) {
      this.words[off] = this.words[off] | (1 << wbit);
    } else {
      this.words[off] = this.words[off] & ~(1 << wbit);
    }

    return this.strip();
  };

  // Add `num` to `this` in-place
  BN.prototype.iadd = function iadd (num) {
    var r;

    // negative + positive
    if (this.negative !== 0 && num.negative === 0) {
      this.negative = 0;
      r = this.isub(num);
      this.negative ^= 1;
      return this._normSign();

    // positive + negative
    } else if (this.negative === 0 && num.negative !== 0) {
      num.negative = 0;
      r = this.isub(num);
      num.negative = 1;
      return r._normSign();
    }

    // a.length > b.length
    var a, b;
    if (this.length > num.length) {
      a = this;
      b = num;
    } else {
      a = num;
      b = this;
    }

    var carry = 0;
    for (var i = 0; i < b.length; i++) {
      r = (a.words[i] | 0) + (b.words[i] | 0) + carry;
      this.words[i] = r & 0x3ffffff;
      carry = r >>> 26;
    }
    for (; carry !== 0 && i < a.length; i++) {
      r = (a.words[i] | 0) + carry;
      this.words[i] = r & 0x3ffffff;
      carry = r >>> 26;
    }

    this.length = a.length;
    if (carry !== 0) {
      this.words[this.length] = carry;
      this.length++;
    // Copy the rest of the words
    } else if (a !== this) {
      for (; i < a.length; i++) {
        this.words[i] = a.words[i];
      }
    }

    return this;
  };

  // Add `num` to `this`
  BN.prototype.add = function add (num) {
    var res;
    if (num.negative !== 0 && this.negative === 0) {
      num.negative = 0;
      res = this.sub(num);
      num.negative ^= 1;
      return res;
    } else if (num.negative === 0 && this.negative !== 0) {
      this.negative = 0;
      res = num.sub(this);
      this.negative = 1;
      return res;
    }

    if (this.length > num.length) return this.clone().iadd(num);

    return num.clone().iadd(this);
  };

  // Subtract `num` from `this` in-place
  BN.prototype.isub = function isub (num) {
    // this - (-num) = this + num
    if (num.negative !== 0) {
      num.negative = 0;
      var r = this.iadd(num);
      num.negative = 1;
      return r._normSign();

    // -this - num = -(this + num)
    } else if (this.negative !== 0) {
      this.negative = 0;
      this.iadd(num);
      this.negative = 1;
      return this._normSign();
    }

    // At this point both numbers are positive
    var cmp = this.cmp(num);

    // Optimization - zeroify
    if (cmp === 0) {
      this.negative = 0;
      this.length = 1;
      this.words[0] = 0;
      return this;
    }

    // a > b
    var a, b;
    if (cmp > 0) {
      a = this;
      b = num;
    } else {
      a = num;
      b = this;
    }

    var carry = 0;
    for (var i = 0; i < b.length; i++) {
      r = (a.words[i] | 0) - (b.words[i] | 0) + carry;
      carry = r >> 26;
      this.words[i] = r & 0x3ffffff;
    }
    for (; carry !== 0 && i < a.length; i++) {
      r = (a.words[i] | 0) + carry;
      carry = r >> 26;
      this.words[i] = r & 0x3ffffff;
    }

    // Copy rest of the words
    if (carry === 0 && i < a.length && a !== this) {
      for (; i < a.length; i++) {
        this.words[i] = a.words[i];
      }
    }

    this.length = Math.max(this.length, i);

    if (a !== this) {
      this.negative = 1;
    }

    return this.strip();
  };

  // Subtract `num` from `this`
  BN.prototype.sub = function sub (num) {
    return this.clone().isub(num);
  };

  function smallMulTo (self, num, out) {
    out.negative = num.negative ^ self.negative;
    var len = (self.length + num.length) | 0;
    out.length = len;
    len = (len - 1) | 0;

    // Peel one iteration (compiler can't do it, because of code complexity)
    var a = self.words[0] | 0;
    var b = num.words[0] | 0;
    var r = a * b;

    var lo = r & 0x3ffffff;
    var carry = (r / 0x4000000) | 0;
    out.words[0] = lo;

    for (var k = 1; k < len; k++) {
      // Sum all words with the same `i + j = k` and accumulate `ncarry`,
      // note that ncarry could be >= 0x3ffffff
      var ncarry = carry >>> 26;
      var rword = carry & 0x3ffffff;
      var maxJ = Math.min(k, num.length - 1);
      for (var j = Math.max(0, k - self.length + 1); j <= maxJ; j++) {
        var i = (k - j) | 0;
        a = self.words[i] | 0;
        b = num.words[j] | 0;
        r = a * b + rword;
        ncarry += (r / 0x4000000) | 0;
        rword = r & 0x3ffffff;
      }
      out.words[k] = rword | 0;
      carry = ncarry | 0;
    }
    if (carry !== 0) {
      out.words[k] = carry | 0;
    } else {
      out.length--;
    }

    return out.strip();
  }

  // TODO(indutny): it may be reasonable to omit it for users who don't need
  // to work with 256-bit numbers, otherwise it gives 20% improvement for 256-bit
  // multiplication (like elliptic secp256k1).
  var comb10MulTo = function comb10MulTo (self, num, out) {
    var a = self.words;
    var b = num.words;
    var o = out.words;
    var c = 0;
    var lo;
    var mid;
    var hi;
    var a0 = a[0] | 0;
    var al0 = a0 & 0x1fff;
    var ah0 = a0 >>> 13;
    var a1 = a[1] | 0;
    var al1 = a1 & 0x1fff;
    var ah1 = a1 >>> 13;
    var a2 = a[2] | 0;
    var al2 = a2 & 0x1fff;
    var ah2 = a2 >>> 13;
    var a3 = a[3] | 0;
    var al3 = a3 & 0x1fff;
    var ah3 = a3 >>> 13;
    var a4 = a[4] | 0;
    var al4 = a4 & 0x1fff;
    var ah4 = a4 >>> 13;
    var a5 = a[5] | 0;
    var al5 = a5 & 0x1fff;
    var ah5 = a5 >>> 13;
    var a6 = a[6] | 0;
    var al6 = a6 & 0x1fff;
    var ah6 = a6 >>> 13;
    var a7 = a[7] | 0;
    var al7 = a7 & 0x1fff;
    var ah7 = a7 >>> 13;
    var a8 = a[8] | 0;
    var al8 = a8 & 0x1fff;
    var ah8 = a8 >>> 13;
    var a9 = a[9] | 0;
    var al9 = a9 & 0x1fff;
    var ah9 = a9 >>> 13;
    var b0 = b[0] | 0;
    var bl0 = b0 & 0x1fff;
    var bh0 = b0 >>> 13;
    var b1 = b[1] | 0;
    var bl1 = b1 & 0x1fff;
    var bh1 = b1 >>> 13;
    var b2 = b[2] | 0;
    var bl2 = b2 & 0x1fff;
    var bh2 = b2 >>> 13;
    var b3 = b[3] | 0;
    var bl3 = b3 & 0x1fff;
    var bh3 = b3 >>> 13;
    var b4 = b[4] | 0;
    var bl4 = b4 & 0x1fff;
    var bh4 = b4 >>> 13;
    var b5 = b[5] | 0;
    var bl5 = b5 & 0x1fff;
    var bh5 = b5 >>> 13;
    var b6 = b[6] | 0;
    var bl6 = b6 & 0x1fff;
    var bh6 = b6 >>> 13;
    var b7 = b[7] | 0;
    var bl7 = b7 & 0x1fff;
    var bh7 = b7 >>> 13;
    var b8 = b[8] | 0;
    var bl8 = b8 & 0x1fff;
    var bh8 = b8 >>> 13;
    var b9 = b[9] | 0;
    var bl9 = b9 & 0x1fff;
    var bh9 = b9 >>> 13;

    out.negative = self.negative ^ num.negative;
    out.length = 19;
    /* k = 0 */
    lo = Math.imul(al0, bl0);
    mid = Math.imul(al0, bh0);
    mid = (mid + Math.imul(ah0, bl0)) | 0;
    hi = Math.imul(ah0, bh0);
    var w0 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
    c = (((hi + (mid >>> 13)) | 0) + (w0 >>> 26)) | 0;
    w0 &= 0x3ffffff;
    /* k = 1 */
    lo = Math.imul(al1, bl0);
    mid = Math.imul(al1, bh0);
    mid = (mid + Math.imul(ah1, bl0)) | 0;
    hi = Math.imul(ah1, bh0);
    lo = (lo + Math.imul(al0, bl1)) | 0;
    mid = (mid + Math.imul(al0, bh1)) | 0;
    mid = (mid + Math.imul(ah0, bl1)) | 0;
    hi = (hi + Math.imul(ah0, bh1)) | 0;
    var w1 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
    c = (((hi + (mid >>> 13)) | 0) + (w1 >>> 26)) | 0;
    w1 &= 0x3ffffff;
    /* k = 2 */
    lo = Math.imul(al2, bl0);
    mid = Math.imul(al2, bh0);
    mid = (mid + Math.imul(ah2, bl0)) | 0;
    hi = Math.imul(ah2, bh0);
    lo = (lo + Math.imul(al1, bl1)) | 0;
    mid = (mid + Math.imul(al1, bh1)) | 0;
    mid = (mid + Math.imul(ah1, bl1)) | 0;
    hi = (hi + Math.imul(ah1, bh1)) | 0;
    lo = (lo + Math.imul(al0, bl2)) | 0;
    mid = (mid + Math.imul(al0, bh2)) | 0;
    mid = (mid + Math.imul(ah0, bl2)) | 0;
    hi = (hi + Math.imul(ah0, bh2)) | 0;
    var w2 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
    c = (((hi + (mid >>> 13)) | 0) + (w2 >>> 26)) | 0;
    w2 &= 0x3ffffff;
    /* k = 3 */
    lo = Math.imul(al3, bl0);
    mid = Math.imul(al3, bh0);
    mid = (mid + Math.imul(ah3, bl0)) | 0;
    hi = Math.imul(ah3, bh0);
    lo = (lo + Math.imul(al2, bl1)) | 0;
    mid = (mid + Math.imul(al2, bh1)) | 0;
    mid = (mid + Math.imul(ah2, bl1)) | 0;
    hi = (hi + Math.imul(ah2, bh1)) | 0;
    lo = (lo + Math.imul(al1, bl2)) | 0;
    mid = (mid + Math.imul(al1, bh2)) | 0;
    mid = (mid + Math.imul(ah1, bl2)) | 0;
    hi = (hi + Math.imul(ah1, bh2)) | 0;
    lo = (lo + Math.imul(al0, bl3)) | 0;
    mid = (mid + Math.imul(al0, bh3)) | 0;
    mid = (mid + Math.imul(ah0, bl3)) | 0;
    hi = (hi + Math.imul(ah0, bh3)) | 0;
    var w3 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
    c = (((hi + (mid >>> 13)) | 0) + (w3 >>> 26)) | 0;
    w3 &= 0x3ffffff;
    /* k = 4 */
    lo = Math.imul(al4, bl0);
    mid = Math.imul(al4, bh0);
    mid = (mid + Math.imul(ah4, bl0)) | 0;
    hi = Math.imul(ah4, bh0);
    lo = (lo + Math.imul(al3, bl1)) | 0;
    mid = (mid + Math.imul(al3, bh1)) | 0;
    mid = (mid + Math.imul(ah3, bl1)) | 0;
    hi = (hi + Math.imul(ah3, bh1)) | 0;
    lo = (lo + Math.imul(al2, bl2)) | 0;
    mid = (mid + Math.imul(al2, bh2)) | 0;
    mid = (mid + Math.imul(ah2, bl2)) | 0;
    hi = (hi + Math.imul(ah2, bh2)) | 0;
    lo = (lo + Math.imul(al1, bl3)) | 0;
    mid = (mid + Math.imul(al1, bh3)) | 0;
    mid = (mid + Math.imul(ah1, bl3)) | 0;
    hi = (hi + Math.imul(ah1, bh3)) | 0;
    lo = (lo + Math.imul(al0, bl4)) | 0;
    mid = (mid + Math.imul(al0, bh4)) | 0;
    mid = (mid + Math.imul(ah0, bl4)) | 0;
    hi = (hi + Math.imul(ah0, bh4)) | 0;
    var w4 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
    c = (((hi + (mid >>> 13)) | 0) + (w4 >>> 26)) | 0;
    w4 &= 0x3ffffff;
    /* k = 5 */
    lo = Math.imul(al5, bl0);
    mid = Math.imul(al5, bh0);
    mid = (mid + Math.imul(ah5, bl0)) | 0;
    hi = Math.imul(ah5, bh0);
    lo = (lo + Math.imul(al4, bl1)) | 0;
    mid = (mid + Math.imul(al4, bh1)) | 0;
    mid = (mid + Math.imul(ah4, bl1)) | 0;
    hi = (hi + Math.imul(ah4, bh1)) | 0;
    lo = (lo + Math.imul(al3, bl2)) | 0;
    mid = (mid + Math.imul(al3, bh2)) | 0;
    mid = (mid + Math.imul(ah3, bl2)) | 0;
    hi = (hi + Math.imul(ah3, bh2)) | 0;
    lo = (lo + Math.imul(al2, bl3)) | 0;
    mid = (mid + Math.imul(al2, bh3)) | 0;
    mid = (mid + Math.imul(ah2, bl3)) | 0;
    hi = (hi + Math.imul(ah2, bh3)) | 0;
    lo = (lo + Math.imul(al1, bl4)) | 0;
    mid = (mid + Math.imul(al1, bh4)) | 0;
    mid = (mid + Math.imul(ah1, bl4)) | 0;
    hi = (hi + Math.imul(ah1, bh4)) | 0;
    lo = (lo + Math.imul(al0, bl5)) | 0;
    mid = (mid + Math.imul(al0, bh5)) | 0;
    mid = (mid + Math.imul(ah0, bl5)) | 0;
    hi = (hi + Math.imul(ah0, bh5)) | 0;
    var w5 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
    c = (((hi + (mid >>> 13)) | 0) + (w5 >>> 26)) | 0;
    w5 &= 0x3ffffff;
    /* k = 6 */
    lo = Math.imul(al6, bl0);
    mid = Math.imul(al6, bh0);
    mid = (mid + Math.imul(ah6, bl0)) | 0;
    hi = Math.imul(ah6, bh0);
    lo = (lo + Math.imul(al5, bl1)) | 0;
    mid = (mid + Math.imul(al5, bh1)) | 0;
    mid = (mid + Math.imul(ah5, bl1)) | 0;
    hi = (hi + Math.imul(ah5, bh1)) | 0;
    lo = (lo + Math.imul(al4, bl2)) | 0;
    mid = (mid + Math.imul(al4, bh2)) | 0;
    mid = (mid + Math.imul(ah4, bl2)) | 0;
    hi = (hi + Math.imul(ah4, bh2)) | 0;
    lo = (lo + Math.imul(al3, bl3)) | 0;
    mid = (mid + Math.imul(al3, bh3)) | 0;
    mid = (mid + Math.imul(ah3, bl3)) | 0;
    hi = (hi + Math.imul(ah3, bh3)) | 0;
    lo = (lo + Math.imul(al2, bl4)) | 0;
    mid = (mid + Math.imul(al2, bh4)) | 0;
    mid = (mid + Math.imul(ah2, bl4)) | 0;
    hi = (hi + Math.imul(ah2, bh4)) | 0;
    lo = (lo + Math.imul(al1, bl5)) | 0;
    mid = (mid + Math.imul(al1, bh5)) | 0;
    mid = (mid + Math.imul(ah1, bl5)) | 0;
    hi = (hi + Math.imul(ah1, bh5)) | 0;
    lo = (lo + Math.imul(al0, bl6)) | 0;
    mid = (mid + Math.imul(al0, bh6)) | 0;
    mid = (mid + Math.imul(ah0, bl6)) | 0;
    hi = (hi + Math.imul(ah0, bh6)) | 0;
    var w6 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
    c = (((hi + (mid >>> 13)) | 0) + (w6 >>> 26)) | 0;
    w6 &= 0x3ffffff;
    /* k = 7 */
    lo = Math.imul(al7, bl0);
    mid = Math.imul(al7, bh0);
    mid = (mid + Math.imul(ah7, bl0)) | 0;
    hi = Math.imul(ah7, bh0);
    lo = (lo + Math.imul(al6, bl1)) | 0;
    mid = (mid + Math.imul(al6, bh1)) | 0;
    mid = (mid + Math.imul(ah6, bl1)) | 0;
    hi = (hi + Math.imul(ah6, bh1)) | 0;
    lo = (lo + Math.imul(al5, bl2)) | 0;
    mid = (mid + Math.imul(al5, bh2)) | 0;
    mid = (mid + Math.imul(ah5, bl2)) | 0;
    hi = (hi + Math.imul(ah5, bh2)) | 0;
    lo = (lo + Math.imul(al4, bl3)) | 0;
    mid = (mid + Math.imul(al4, bh3)) | 0;
    mid = (mid + Math.imul(ah4, bl3)) | 0;
    hi = (hi + Math.imul(ah4, bh3)) | 0;
    lo = (lo + Math.imul(al3, bl4)) | 0;
    mid = (mid + Math.imul(al3, bh4)) | 0;
    mid = (mid + Math.imul(ah3, bl4)) | 0;
    hi = (hi + Math.imul(ah3, bh4)) | 0;
    lo = (lo + Math.imul(al2, bl5)) | 0;
    mid = (mid + Math.imul(al2, bh5)) | 0;
    mid = (mid + Math.imul(ah2, bl5)) | 0;
    hi = (hi + Math.imul(ah2, bh5)) | 0;
    lo = (lo + Math.imul(al1, bl6)) | 0;
    mid = (mid + Math.imul(al1, bh6)) | 0;
    mid = (mid + Math.imul(ah1, bl6)) | 0;
    hi = (hi + Math.imul(ah1, bh6)) | 0;
    lo = (lo + Math.imul(al0, bl7)) | 0;
    mid = (mid + Math.imul(al0, bh7)) | 0;
    mid = (mid + Math.imul(ah0, bl7)) | 0;
    hi = (hi + Math.imul(ah0, bh7)) | 0;
    var w7 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
    c = (((hi + (mid >>> 13)) | 0) + (w7 >>> 26)) | 0;
    w7 &= 0x3ffffff;
    /* k = 8 */
    lo = Math.imul(al8, bl0);
    mid = Math.imul(al8, bh0);
    mid = (mid + Math.imul(ah8, bl0)) | 0;
    hi = Math.imul(ah8, bh0);
    lo = (lo + Math.imul(al7, bl1)) | 0;
    mid = (mid + Math.imul(al7, bh1)) | 0;
    mid = (mid + Math.imul(ah7, bl1)) | 0;
    hi = (hi + Math.imul(ah7, bh1)) | 0;
    lo = (lo + Math.imul(al6, bl2)) | 0;
    mid = (mid + Math.imul(al6, bh2)) | 0;
    mid = (mid + Math.imul(ah6, bl2)) | 0;
    hi = (hi + Math.imul(ah6, bh2)) | 0;
    lo = (lo + Math.imul(al5, bl3)) | 0;
    mid = (mid + Math.imul(al5, bh3)) | 0;
    mid = (mid + Math.imul(ah5, bl3)) | 0;
    hi = (hi + Math.imul(ah5, bh3)) | 0;
    lo = (lo + Math.imul(al4, bl4)) | 0;
    mid = (mid + Math.imul(al4, bh4)) | 0;
    mid = (mid + Math.imul(ah4, bl4)) | 0;
    hi = (hi + Math.imul(ah4, bh4)) | 0;
    lo = (lo + Math.imul(al3, bl5)) | 0;
    mid = (mid + Math.imul(al3, bh5)) | 0;
    mid = (mid + Math.imul(ah3, bl5)) | 0;
    hi = (hi + Math.imul(ah3, bh5)) | 0;
    lo = (lo + Math.imul(al2, bl6)) | 0;
    mid = (mid + Math.imul(al2, bh6)) | 0;
    mid = (mid + Math.imul(ah2, bl6)) | 0;
    hi = (hi + Math.imul(ah2, bh6)) | 0;
    lo = (lo + Math.imul(al1, bl7)) | 0;
    mid = (mid + Math.imul(al1, bh7)) | 0;
    mid = (mid + Math.imul(ah1, bl7)) | 0;
    hi = (hi + Math.imul(ah1, bh7)) | 0;
    lo = (lo + Math.imul(al0, bl8)) | 0;
    mid = (mid + Math.imul(al0, bh8)) | 0;
    mid = (mid + Math.imul(ah0, bl8)) | 0;
    hi = (hi + Math.imul(ah0, bh8)) | 0;
    var w8 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
    c = (((hi + (mid >>> 13)) | 0) + (w8 >>> 26)) | 0;
    w8 &= 0x3ffffff;
    /* k = 9 */
    lo = Math.imul(al9, bl0);
    mid = Math.imul(al9, bh0);
    mid = (mid + Math.imul(ah9, bl0)) | 0;
    hi = Math.imul(ah9, bh0);
    lo = (lo + Math.imul(al8, bl1)) | 0;
    mid = (mid + Math.imul(al8, bh1)) | 0;
    mid = (mid + Math.imul(ah8, bl1)) | 0;
    hi = (hi + Math.imul(ah8, bh1)) | 0;
    lo = (lo + Math.imul(al7, bl2)) | 0;
    mid = (mid + Math.imul(al7, bh2)) | 0;
    mid = (mid + Math.imul(ah7, bl2)) | 0;
    hi = (hi + Math.imul(ah7, bh2)) | 0;
    lo = (lo + Math.imul(al6, bl3)) | 0;
    mid = (mid + Math.imul(al6, bh3)) | 0;
    mid = (mid + Math.imul(ah6, bl3)) | 0;
    hi = (hi + Math.imul(ah6, bh3)) | 0;
    lo = (lo + Math.imul(al5, bl4)) | 0;
    mid = (mid + Math.imul(al5, bh4)) | 0;
    mid = (mid + Math.imul(ah5, bl4)) | 0;
    hi = (hi + Math.imul(ah5, bh4)) | 0;
    lo = (lo + Math.imul(al4, bl5)) | 0;
    mid = (mid + Math.imul(al4, bh5)) | 0;
    mid = (mid + Math.imul(ah4, bl5)) | 0;
    hi = (hi + Math.imul(ah4, bh5)) | 0;
    lo = (lo + Math.imul(al3, bl6)) | 0;
    mid = (mid + Math.imul(al3, bh6)) | 0;
    mid = (mid + Math.imul(ah3, bl6)) | 0;
    hi = (hi + Math.imul(ah3, bh6)) | 0;
    lo = (lo + Math.imul(al2, bl7)) | 0;
    mid = (mid + Math.imul(al2, bh7)) | 0;
    mid = (mid + Math.imul(ah2, bl7)) | 0;
    hi = (hi + Math.imul(ah2, bh7)) | 0;
    lo = (lo + Math.imul(al1, bl8)) | 0;
    mid = (mid + Math.imul(al1, bh8)) | 0;
    mid = (mid + Math.imul(ah1, bl8)) | 0;
    hi = (hi + Math.imul(ah1, bh8)) | 0;
    lo = (lo + Math.imul(al0, bl9)) | 0;
    mid = (mid + Math.imul(al0, bh9)) | 0;
    mid = (mid + Math.imul(ah0, bl9)) | 0;
    hi = (hi + Math.imul(ah0, bh9)) | 0;
    var w9 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
    c = (((hi + (mid >>> 13)) | 0) + (w9 >>> 26)) | 0;
    w9 &= 0x3ffffff;
    /* k = 10 */
    lo = Math.imul(al9, bl1);
    mid = Math.imul(al9, bh1);
    mid = (mid + Math.imul(ah9, bl1)) | 0;
    hi = Math.imul(ah9, bh1);
    lo = (lo + Math.imul(al8, bl2)) | 0;
    mid = (mid + Math.imul(al8, bh2)) | 0;
    mid = (mid + Math.imul(ah8, bl2)) | 0;
    hi = (hi + Math.imul(ah8, bh2)) | 0;
    lo = (lo + Math.imul(al7, bl3)) | 0;
    mid = (mid + Math.imul(al7, bh3)) | 0;
    mid = (mid + Math.imul(ah7, bl3)) | 0;
    hi = (hi + Math.imul(ah7, bh3)) | 0;
    lo = (lo + Math.imul(al6, bl4)) | 0;
    mid = (mid + Math.imul(al6, bh4)) | 0;
    mid = (mid + Math.imul(ah6, bl4)) | 0;
    hi = (hi + Math.imul(ah6, bh4)) | 0;
    lo = (lo + Math.imul(al5, bl5)) | 0;
    mid = (mid + Math.imul(al5, bh5)) | 0;
    mid = (mid + Math.imul(ah5, bl5)) | 0;
    hi = (hi + Math.imul(ah5, bh5)) | 0;
    lo = (lo + Math.imul(al4, bl6)) | 0;
    mid = (mid + Math.imul(al4, bh6)) | 0;
    mid = (mid + Math.imul(ah4, bl6)) | 0;
    hi = (hi + Math.imul(ah4, bh6)) | 0;
    lo = (lo + Math.imul(al3, bl7)) | 0;
    mid = (mid + Math.imul(al3, bh7)) | 0;
    mid = (mid + Math.imul(ah3, bl7)) | 0;
    hi = (hi + Math.imul(ah3, bh7)) | 0;
    lo = (lo + Math.imul(al2, bl8)) | 0;
    mid = (mid + Math.imul(al2, bh8)) | 0;
    mid = (mid + Math.imul(ah2, bl8)) | 0;
    hi = (hi + Math.imul(ah2, bh8)) | 0;
    lo = (lo + Math.imul(al1, bl9)) | 0;
    mid = (mid + Math.imul(al1, bh9)) | 0;
    mid = (mid + Math.imul(ah1, bl9)) | 0;
    hi = (hi + Math.imul(ah1, bh9)) | 0;
    var w10 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
    c = (((hi + (mid >>> 13)) | 0) + (w10 >>> 26)) | 0;
    w10 &= 0x3ffffff;
    /* k = 11 */
    lo = Math.imul(al9, bl2);
    mid = Math.imul(al9, bh2);
    mid = (mid + Math.imul(ah9, bl2)) | 0;
    hi = Math.imul(ah9, bh2);
    lo = (lo + Math.imul(al8, bl3)) | 0;
    mid = (mid + Math.imul(al8, bh3)) | 0;
    mid = (mid + Math.imul(ah8, bl3)) | 0;
    hi = (hi + Math.imul(ah8, bh3)) | 0;
    lo = (lo + Math.imul(al7, bl4)) | 0;
    mid = (mid + Math.imul(al7, bh4)) | 0;
    mid = (mid + Math.imul(ah7, bl4)) | 0;
    hi = (hi + Math.imul(ah7, bh4)) | 0;
    lo = (lo + Math.imul(al6, bl5)) | 0;
    mid = (mid + Math.imul(al6, bh5)) | 0;
    mid = (mid + Math.imul(ah6, bl5)) | 0;
    hi = (hi + Math.imul(ah6, bh5)) | 0;
    lo = (lo + Math.imul(al5, bl6)) | 0;
    mid = (mid + Math.imul(al5, bh6)) | 0;
    mid = (mid + Math.imul(ah5, bl6)) | 0;
    hi = (hi + Math.imul(ah5, bh6)) | 0;
    lo = (lo + Math.imul(al4, bl7)) | 0;
    mid = (mid + Math.imul(al4, bh7)) | 0;
    mid = (mid + Math.imul(ah4, bl7)) | 0;
    hi = (hi + Math.imul(ah4, bh7)) | 0;
    lo = (lo + Math.imul(al3, bl8)) | 0;
    mid = (mid + Math.imul(al3, bh8)) | 0;
    mid = (mid + Math.imul(ah3, bl8)) | 0;
    hi = (hi + Math.imul(ah3, bh8)) | 0;
    lo = (lo + Math.imul(al2, bl9)) | 0;
    mid = (mid + Math.imul(al2, bh9)) | 0;
    mid = (mid + Math.imul(ah2, bl9)) | 0;
    hi = (hi + Math.imul(ah2, bh9)) | 0;
    var w11 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
    c = (((hi + (mid >>> 13)) | 0) + (w11 >>> 26)) | 0;
    w11 &= 0x3ffffff;
    /* k = 12 */
    lo = Math.imul(al9, bl3);
    mid = Math.imul(al9, bh3);
    mid = (mid + Math.imul(ah9, bl3)) | 0;
    hi = Math.imul(ah9, bh3);
    lo = (lo + Math.imul(al8, bl4)) | 0;
    mid = (mid + Math.imul(al8, bh4)) | 0;
    mid = (mid + Math.imul(ah8, bl4)) | 0;
    hi = (hi + Math.imul(ah8, bh4)) | 0;
    lo = (lo + Math.imul(al7, bl5)) | 0;
    mid = (mid + Math.imul(al7, bh5)) | 0;
    mid = (mid + Math.imul(ah7, bl5)) | 0;
    hi = (hi + Math.imul(ah7, bh5)) | 0;
    lo = (lo + Math.imul(al6, bl6)) | 0;
    mid = (mid + Math.imul(al6, bh6)) | 0;
    mid = (mid + Math.imul(ah6, bl6)) | 0;
    hi = (hi + Math.imul(ah6, bh6)) | 0;
    lo = (lo + Math.imul(al5, bl7)) | 0;
    mid = (mid + Math.imul(al5, bh7)) | 0;
    mid = (mid + Math.imul(ah5, bl7)) | 0;
    hi = (hi + Math.imul(ah5, bh7)) | 0;
    lo = (lo + Math.imul(al4, bl8)) | 0;
    mid = (mid + Math.imul(al4, bh8)) | 0;
    mid = (mid + Math.imul(ah4, bl8)) | 0;
    hi = (hi + Math.imul(ah4, bh8)) | 0;
    lo = (lo + Math.imul(al3, bl9)) | 0;
    mid = (mid + Math.imul(al3, bh9)) | 0;
    mid = (mid + Math.imul(ah3, bl9)) | 0;
    hi = (hi + Math.imul(ah3, bh9)) | 0;
    var w12 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
    c = (((hi + (mid >>> 13)) | 0) + (w12 >>> 26)) | 0;
    w12 &= 0x3ffffff;
    /* k = 13 */
    lo = Math.imul(al9, bl4);
    mid = Math.imul(al9, bh4);
    mid = (mid + Math.imul(ah9, bl4)) | 0;
    hi = Math.imul(ah9, bh4);
    lo = (lo + Math.imul(al8, bl5)) | 0;
    mid = (mid + Math.imul(al8, bh5)) | 0;
    mid = (mid + Math.imul(ah8, bl5)) | 0;
    hi = (hi + Math.imul(ah8, bh5)) | 0;
    lo = (lo + Math.imul(al7, bl6)) | 0;
    mid = (mid + Math.imul(al7, bh6)) | 0;
    mid = (mid + Math.imul(ah7, bl6)) | 0;
    hi = (hi + Math.imul(ah7, bh6)) | 0;
    lo = (lo + Math.imul(al6, bl7)) | 0;
    mid = (mid + Math.imul(al6, bh7)) | 0;
    mid = (mid + Math.imul(ah6, bl7)) | 0;
    hi = (hi + Math.imul(ah6, bh7)) | 0;
    lo = (lo + Math.imul(al5, bl8)) | 0;
    mid = (mid + Math.imul(al5, bh8)) | 0;
    mid = (mid + Math.imul(ah5, bl8)) | 0;
    hi = (hi + Math.imul(ah5, bh8)) | 0;
    lo = (lo + Math.imul(al4, bl9)) | 0;
    mid = (mid + Math.imul(al4, bh9)) | 0;
    mid = (mid + Math.imul(ah4, bl9)) | 0;
    hi = (hi + Math.imul(ah4, bh9)) | 0;
    var w13 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
    c = (((hi + (mid >>> 13)) | 0) + (w13 >>> 26)) | 0;
    w13 &= 0x3ffffff;
    /* k = 14 */
    lo = Math.imul(al9, bl5);
    mid = Math.imul(al9, bh5);
    mid = (mid + Math.imul(ah9, bl5)) | 0;
    hi = Math.imul(ah9, bh5);
    lo = (lo + Math.imul(al8, bl6)) | 0;
    mid = (mid + Math.imul(al8, bh6)) | 0;
    mid = (mid + Math.imul(ah8, bl6)) | 0;
    hi = (hi + Math.imul(ah8, bh6)) | 0;
    lo = (lo + Math.imul(al7, bl7)) | 0;
    mid = (mid + Math.imul(al7, bh7)) | 0;
    mid = (mid + Math.imul(ah7, bl7)) | 0;
    hi = (hi + Math.imul(ah7, bh7)) | 0;
    lo = (lo + Math.imul(al6, bl8)) | 0;
    mid = (mid + Math.imul(al6, bh8)) | 0;
    mid = (mid + Math.imul(ah6, bl8)) | 0;
    hi = (hi + Math.imul(ah6, bh8)) | 0;
    lo = (lo + Math.imul(al5, bl9)) | 0;
    mid = (mid + Math.imul(al5, bh9)) | 0;
    mid = (mid + Math.imul(ah5, bl9)) | 0;
    hi = (hi + Math.imul(ah5, bh9)) | 0;
    var w14 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
    c = (((hi + (mid >>> 13)) | 0) + (w14 >>> 26)) | 0;
    w14 &= 0x3ffffff;
    /* k = 15 */
    lo = Math.imul(al9, bl6);
    mid = Math.imul(al9, bh6);
    mid = (mid + Math.imul(ah9, bl6)) | 0;
    hi = Math.imul(ah9, bh6);
    lo = (lo + Math.imul(al8, bl7)) | 0;
    mid = (mid + Math.imul(al8, bh7)) | 0;
    mid = (mid + Math.imul(ah8, bl7)) | 0;
    hi = (hi + Math.imul(ah8, bh7)) | 0;
    lo = (lo + Math.imul(al7, bl8)) | 0;
    mid = (mid + Math.imul(al7, bh8)) | 0;
    mid = (mid + Math.imul(ah7, bl8)) | 0;
    hi = (hi + Math.imul(ah7, bh8)) | 0;
    lo = (lo + Math.imul(al6, bl9)) | 0;
    mid = (mid + Math.imul(al6, bh9)) | 0;
    mid = (mid + Math.imul(ah6, bl9)) | 0;
    hi = (hi + Math.imul(ah6, bh9)) | 0;
    var w15 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
    c = (((hi + (mid >>> 13)) | 0) + (w15 >>> 26)) | 0;
    w15 &= 0x3ffffff;
    /* k = 16 */
    lo = Math.imul(al9, bl7);
    mid = Math.imul(al9, bh7);
    mid = (mid + Math.imul(ah9, bl7)) | 0;
    hi = Math.imul(ah9, bh7);
    lo = (lo + Math.imul(al8, bl8)) | 0;
    mid = (mid + Math.imul(al8, bh8)) | 0;
    mid = (mid + Math.imul(ah8, bl8)) | 0;
    hi = (hi + Math.imul(ah8, bh8)) | 0;
    lo = (lo + Math.imul(al7, bl9)) | 0;
    mid = (mid + Math.imul(al7, bh9)) | 0;
    mid = (mid + Math.imul(ah7, bl9)) | 0;
    hi = (hi + Math.imul(ah7, bh9)) | 0;
    var w16 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
    c = (((hi + (mid >>> 13)) | 0) + (w16 >>> 26)) | 0;
    w16 &= 0x3ffffff;
    /* k = 17 */
    lo = Math.imul(al9, bl8);
    mid = Math.imul(al9, bh8);
    mid = (mid + Math.imul(ah9, bl8)) | 0;
    hi = Math.imul(ah9, bh8);
    lo = (lo + Math.imul(al8, bl9)) | 0;
    mid = (mid + Math.imul(al8, bh9)) | 0;
    mid = (mid + Math.imul(ah8, bl9)) | 0;
    hi = (hi + Math.imul(ah8, bh9)) | 0;
    var w17 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
    c = (((hi + (mid >>> 13)) | 0) + (w17 >>> 26)) | 0;
    w17 &= 0x3ffffff;
    /* k = 18 */
    lo = Math.imul(al9, bl9);
    mid = Math.imul(al9, bh9);
    mid = (mid + Math.imul(ah9, bl9)) | 0;
    hi = Math.imul(ah9, bh9);
    var w18 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
    c = (((hi + (mid >>> 13)) | 0) + (w18 >>> 26)) | 0;
    w18 &= 0x3ffffff;
    o[0] = w0;
    o[1] = w1;
    o[2] = w2;
    o[3] = w3;
    o[4] = w4;
    o[5] = w5;
    o[6] = w6;
    o[7] = w7;
    o[8] = w8;
    o[9] = w9;
    o[10] = w10;
    o[11] = w11;
    o[12] = w12;
    o[13] = w13;
    o[14] = w14;
    o[15] = w15;
    o[16] = w16;
    o[17] = w17;
    o[18] = w18;
    if (c !== 0) {
      o[19] = c;
      out.length++;
    }
    return out;
  };

  // Polyfill comb
  if (!Math.imul) {
    comb10MulTo = smallMulTo;
  }

  function bigMulTo (self, num, out) {
    out.negative = num.negative ^ self.negative;
    out.length = self.length + num.length;

    var carry = 0;
    var hncarry = 0;
    for (var k = 0; k < out.length - 1; k++) {
      // Sum all words with the same `i + j = k` and accumulate `ncarry`,
      // note that ncarry could be >= 0x3ffffff
      var ncarry = hncarry;
      hncarry = 0;
      var rword = carry & 0x3ffffff;
      var maxJ = Math.min(k, num.length - 1);
      for (var j = Math.max(0, k - self.length + 1); j <= maxJ; j++) {
        var i = k - j;
        var a = self.words[i] | 0;
        var b = num.words[j] | 0;
        var r = a * b;

        var lo = r & 0x3ffffff;
        ncarry = (ncarry + ((r / 0x4000000) | 0)) | 0;
        lo = (lo + rword) | 0;
        rword = lo & 0x3ffffff;
        ncarry = (ncarry + (lo >>> 26)) | 0;

        hncarry += ncarry >>> 26;
        ncarry &= 0x3ffffff;
      }
      out.words[k] = rword;
      carry = ncarry;
      ncarry = hncarry;
    }
    if (carry !== 0) {
      out.words[k] = carry;
    } else {
      out.length--;
    }

    return out.strip();
  }

  function jumboMulTo (self, num, out) {
    var fftm = new FFTM();
    return fftm.mulp(self, num, out);
  }

  BN.prototype.mulTo = function mulTo (num, out) {
    var res;
    var len = this.length + num.length;
    if (this.length === 10 && num.length === 10) {
      res = comb10MulTo(this, num, out);
    } else if (len < 63) {
      res = smallMulTo(this, num, out);
    } else if (len < 1024) {
      res = bigMulTo(this, num, out);
    } else {
      res = jumboMulTo(this, num, out);
    }

    return res;
  };

  // Cooley-Tukey algorithm for FFT
  // slightly revisited to rely on looping instead of recursion

  function FFTM (x, y) {
    this.x = x;
    this.y = y;
  }

  FFTM.prototype.makeRBT = function makeRBT (N) {
    var t = new Array(N);
    var l = BN.prototype._countBits(N) - 1;
    for (var i = 0; i < N; i++) {
      t[i] = this.revBin(i, l, N);
    }

    return t;
  };

  // Returns binary-reversed representation of `x`
  FFTM.prototype.revBin = function revBin (x, l, N) {
    if (x === 0 || x === N - 1) return x;

    var rb = 0;
    for (var i = 0; i < l; i++) {
      rb |= (x & 1) << (l - i - 1);
      x >>= 1;
    }

    return rb;
  };

  // Performs "tweedling" phase, therefore 'emulating'
  // behaviour of the recursive algorithm
  FFTM.prototype.permute = function permute (rbt, rws, iws, rtws, itws, N) {
    for (var i = 0; i < N; i++) {
      rtws[i] = rws[rbt[i]];
      itws[i] = iws[rbt[i]];
    }
  };

  FFTM.prototype.transform = function transform (rws, iws, rtws, itws, N, rbt) {
    this.permute(rbt, rws, iws, rtws, itws, N);

    for (var s = 1; s < N; s <<= 1) {
      var l = s << 1;

      var rtwdf = Math.cos(2 * Math.PI / l);
      var itwdf = Math.sin(2 * Math.PI / l);

      for (var p = 0; p < N; p += l) {
        var rtwdf_ = rtwdf;
        var itwdf_ = itwdf;

        for (var j = 0; j < s; j++) {
          var re = rtws[p + j];
          var ie = itws[p + j];

          var ro = rtws[p + j + s];
          var io = itws[p + j + s];

          var rx = rtwdf_ * ro - itwdf_ * io;

          io = rtwdf_ * io + itwdf_ * ro;
          ro = rx;

          rtws[p + j] = re + ro;
          itws[p + j] = ie + io;

          rtws[p + j + s] = re - ro;
          itws[p + j + s] = ie - io;

          /* jshint maxdepth : false */
          if (j !== l) {
            rx = rtwdf * rtwdf_ - itwdf * itwdf_;

            itwdf_ = rtwdf * itwdf_ + itwdf * rtwdf_;
            rtwdf_ = rx;
          }
        }
      }
    }
  };

  FFTM.prototype.guessLen13b = function guessLen13b (n, m) {
    var N = Math.max(m, n) | 1;
    var odd = N & 1;
    var i = 0;
    for (N = N / 2 | 0; N; N = N >>> 1) {
      i++;
    }

    return 1 << i + 1 + odd;
  };

  FFTM.prototype.conjugate = function conjugate (rws, iws, N) {
    if (N <= 1) return;

    for (var i = 0; i < N / 2; i++) {
      var t = rws[i];

      rws[i] = rws[N - i - 1];
      rws[N - i - 1] = t;

      t = iws[i];

      iws[i] = -iws[N - i - 1];
      iws[N - i - 1] = -t;
    }
  };

  FFTM.prototype.normalize13b = function normalize13b (ws, N) {
    var carry = 0;
    for (var i = 0; i < N / 2; i++) {
      var w = Math.round(ws[2 * i + 1] / N) * 0x2000 +
        Math.round(ws[2 * i] / N) +
        carry;

      ws[i] = w & 0x3ffffff;

      if (w < 0x4000000) {
        carry = 0;
      } else {
        carry = w / 0x4000000 | 0;
      }
    }

    return ws;
  };

  FFTM.prototype.convert13b = function convert13b (ws, len, rws, N) {
    var carry = 0;
    for (var i = 0; i < len; i++) {
      carry = carry + (ws[i] | 0);

      rws[2 * i] = carry & 0x1fff; carry = carry >>> 13;
      rws[2 * i + 1] = carry & 0x1fff; carry = carry >>> 13;
    }

    // Pad with zeroes
    for (i = 2 * len; i < N; ++i) {
      rws[i] = 0;
    }

    assert(carry === 0);
    assert((carry & ~0x1fff) === 0);
  };

  FFTM.prototype.stub = function stub (N) {
    var ph = new Array(N);
    for (var i = 0; i < N; i++) {
      ph[i] = 0;
    }

    return ph;
  };

  FFTM.prototype.mulp = function mulp (x, y, out) {
    var N = 2 * this.guessLen13b(x.length, y.length);

    var rbt = this.makeRBT(N);

    var _ = this.stub(N);

    var rws = new Array(N);
    var rwst = new Array(N);
    var iwst = new Array(N);

    var nrws = new Array(N);
    var nrwst = new Array(N);
    var niwst = new Array(N);

    var rmws = out.words;
    rmws.length = N;

    this.convert13b(x.words, x.length, rws, N);
    this.convert13b(y.words, y.length, nrws, N);

    this.transform(rws, _, rwst, iwst, N, rbt);
    this.transform(nrws, _, nrwst, niwst, N, rbt);

    for (var i = 0; i < N; i++) {
      var rx = rwst[i] * nrwst[i] - iwst[i] * niwst[i];
      iwst[i] = rwst[i] * niwst[i] + iwst[i] * nrwst[i];
      rwst[i] = rx;
    }

    this.conjugate(rwst, iwst, N);
    this.transform(rwst, iwst, rmws, _, N, rbt);
    this.conjugate(rmws, _, N);
    this.normalize13b(rmws, N);

    out.negative = x.negative ^ y.negative;
    out.length = x.length + y.length;
    return out.strip();
  };

  // Multiply `this` by `num`
  BN.prototype.mul = function mul (num) {
    var out = new BN(null);
    out.words = new Array(this.length + num.length);
    return this.mulTo(num, out);
  };

  // Multiply employing FFT
  BN.prototype.mulf = function mulf (num) {
    var out = new BN(null);
    out.words = new Array(this.length + num.length);
    return jumboMulTo(this, num, out);
  };

  // In-place Multiplication
  BN.prototype.imul = function imul (num) {
    return this.clone().mulTo(num, this);
  };

  BN.prototype.imuln = function imuln (num) {
    assert(typeof num === 'number');
    assert(num < 0x4000000);

    // Carry
    var carry = 0;
    for (var i = 0; i < this.length; i++) {
      var w = (this.words[i] | 0) * num;
      var lo = (w & 0x3ffffff) + (carry & 0x3ffffff);
      carry >>= 26;
      carry += (w / 0x4000000) | 0;
      // NOTE: lo is 27bit maximum
      carry += lo >>> 26;
      this.words[i] = lo & 0x3ffffff;
    }

    if (carry !== 0) {
      this.words[i] = carry;
      this.length++;
    }

    return this;
  };

  BN.prototype.muln = function muln (num) {
    return this.clone().imuln(num);
  };

  // `this` * `this`
  BN.prototype.sqr = function sqr () {
    return this.mul(this);
  };

  // `this` * `this` in-place
  BN.prototype.isqr = function isqr () {
    return this.imul(this.clone());
  };

  // Math.pow(`this`, `num`)
  BN.prototype.pow = function pow (num) {
    var w = toBitArray(num);
    if (w.length === 0) return new BN(1);

    // Skip leading zeroes
    var res = this;
    for (var i = 0; i < w.length; i++, res = res.sqr()) {
      if (w[i] !== 0) break;
    }

    if (++i < w.length) {
      for (var q = res.sqr(); i < w.length; i++, q = q.sqr()) {
        if (w[i] === 0) continue;

        res = res.mul(q);
      }
    }

    return res;
  };

  // Shift-left in-place
  BN.prototype.iushln = function iushln (bits) {
    assert(typeof bits === 'number' && bits >= 0);
    var r = bits % 26;
    var s = (bits - r) / 26;
    var carryMask = (0x3ffffff >>> (26 - r)) << (26 - r);
    var i;

    if (r !== 0) {
      var carry = 0;

      for (i = 0; i < this.length; i++) {
        var newCarry = this.words[i] & carryMask;
        var c = ((this.words[i] | 0) - newCarry) << r;
        this.words[i] = c | carry;
        carry = newCarry >>> (26 - r);
      }

      if (carry) {
        this.words[i] = carry;
        this.length++;
      }
    }

    if (s !== 0) {
      for (i = this.length - 1; i >= 0; i--) {
        this.words[i + s] = this.words[i];
      }

      for (i = 0; i < s; i++) {
        this.words[i] = 0;
      }

      this.length += s;
    }

    return this.strip();
  };

  BN.prototype.ishln = function ishln (bits) {
    // TODO(indutny): implement me
    assert(this.negative === 0);
    return this.iushln(bits);
  };

  // Shift-right in-place
  // NOTE: `hint` is a lowest bit before trailing zeroes
  // NOTE: if `extended` is present - it will be filled with destroyed bits
  BN.prototype.iushrn = function iushrn (bits, hint, extended) {
    assert(typeof bits === 'number' && bits >= 0);
    var h;
    if (hint) {
      h = (hint - (hint % 26)) / 26;
    } else {
      h = 0;
    }

    var r = bits % 26;
    var s = Math.min((bits - r) / 26, this.length);
    var mask = 0x3ffffff ^ ((0x3ffffff >>> r) << r);
    var maskedWords = extended;

    h -= s;
    h = Math.max(0, h);

    // Extended mode, copy masked part
    if (maskedWords) {
      for (var i = 0; i < s; i++) {
        maskedWords.words[i] = this.words[i];
      }
      maskedWords.length = s;
    }

    if (s === 0) {
      // No-op, we should not move anything at all
    } else if (this.length > s) {
      this.length -= s;
      for (i = 0; i < this.length; i++) {
        this.words[i] = this.words[i + s];
      }
    } else {
      this.words[0] = 0;
      this.length = 1;
    }

    var carry = 0;
    for (i = this.length - 1; i >= 0 && (carry !== 0 || i >= h); i--) {
      var word = this.words[i] | 0;
      this.words[i] = (carry << (26 - r)) | (word >>> r);
      carry = word & mask;
    }

    // Push carried bits as a mask
    if (maskedWords && carry !== 0) {
      maskedWords.words[maskedWords.length++] = carry;
    }

    if (this.length === 0) {
      this.words[0] = 0;
      this.length = 1;
    }

    return this.strip();
  };

  BN.prototype.ishrn = function ishrn (bits, hint, extended) {
    // TODO(indutny): implement me
    assert(this.negative === 0);
    return this.iushrn(bits, hint, extended);
  };

  // Shift-left
  BN.prototype.shln = function shln (bits) {
    return this.clone().ishln(bits);
  };

  BN.prototype.ushln = function ushln (bits) {
    return this.clone().iushln(bits);
  };

  // Shift-right
  BN.prototype.shrn = function shrn (bits) {
    return this.clone().ishrn(bits);
  };

  BN.prototype.ushrn = function ushrn (bits) {
    return this.clone().iushrn(bits);
  };

  // Test if n bit is set
  BN.prototype.testn = function testn (bit) {
    assert(typeof bit === 'number' && bit >= 0);
    var r = bit % 26;
    var s = (bit - r) / 26;
    var q = 1 << r;

    // Fast case: bit is much higher than all existing words
    if (this.length <= s) return false;

    // Check bit and return
    var w = this.words[s];

    return !!(w & q);
  };

  // Return only lowers bits of number (in-place)
  BN.prototype.imaskn = function imaskn (bits) {
    assert(typeof bits === 'number' && bits >= 0);
    var r = bits % 26;
    var s = (bits - r) / 26;

    assert(this.negative === 0, 'imaskn works only with positive numbers');

    if (this.length <= s) {
      return this;
    }

    if (r !== 0) {
      s++;
    }
    this.length = Math.min(s, this.length);

    if (r !== 0) {
      var mask = 0x3ffffff ^ ((0x3ffffff >>> r) << r);
      this.words[this.length - 1] &= mask;
    }

    return this.strip();
  };

  // Return only lowers bits of number
  BN.prototype.maskn = function maskn (bits) {
    return this.clone().imaskn(bits);
  };

  // Add plain number `num` to `this`
  BN.prototype.iaddn = function iaddn (num) {
    assert(typeof num === 'number');
    assert(num < 0x4000000);
    if (num < 0) return this.isubn(-num);

    // Possible sign change
    if (this.negative !== 0) {
      if (this.length === 1 && (this.words[0] | 0) < num) {
        this.words[0] = num - (this.words[0] | 0);
        this.negative = 0;
        return this;
      }

      this.negative = 0;
      this.isubn(num);
      this.negative = 1;
      return this;
    }

    // Add without checks
    return this._iaddn(num);
  };

  BN.prototype._iaddn = function _iaddn (num) {
    this.words[0] += num;

    // Carry
    for (var i = 0; i < this.length && this.words[i] >= 0x4000000; i++) {
      this.words[i] -= 0x4000000;
      if (i === this.length - 1) {
        this.words[i + 1] = 1;
      } else {
        this.words[i + 1]++;
      }
    }
    this.length = Math.max(this.length, i + 1);

    return this;
  };

  // Subtract plain number `num` from `this`
  BN.prototype.isubn = function isubn (num) {
    assert(typeof num === 'number');
    assert(num < 0x4000000);
    if (num < 0) return this.iaddn(-num);

    if (this.negative !== 0) {
      this.negative = 0;
      this.iaddn(num);
      this.negative = 1;
      return this;
    }

    this.words[0] -= num;

    if (this.length === 1 && this.words[0] < 0) {
      this.words[0] = -this.words[0];
      this.negative = 1;
    } else {
      // Carry
      for (var i = 0; i < this.length && this.words[i] < 0; i++) {
        this.words[i] += 0x4000000;
        this.words[i + 1] -= 1;
      }
    }

    return this.strip();
  };

  BN.prototype.addn = function addn (num) {
    return this.clone().iaddn(num);
  };

  BN.prototype.subn = function subn (num) {
    return this.clone().isubn(num);
  };

  BN.prototype.iabs = function iabs () {
    this.negative = 0;

    return this;
  };

  BN.prototype.abs = function abs () {
    return this.clone().iabs();
  };

  BN.prototype._ishlnsubmul = function _ishlnsubmul (num, mul, shift) {
    var len = num.length + shift;
    var i;

    this._expand(len);

    var w;
    var carry = 0;
    for (i = 0; i < num.length; i++) {
      w = (this.words[i + shift] | 0) + carry;
      var right = (num.words[i] | 0) * mul;
      w -= right & 0x3ffffff;
      carry = (w >> 26) - ((right / 0x4000000) | 0);
      this.words[i + shift] = w & 0x3ffffff;
    }
    for (; i < this.length - shift; i++) {
      w = (this.words[i + shift] | 0) + carry;
      carry = w >> 26;
      this.words[i + shift] = w & 0x3ffffff;
    }

    if (carry === 0) return this.strip();

    // Subtraction overflow
    assert(carry === -1);
    carry = 0;
    for (i = 0; i < this.length; i++) {
      w = -(this.words[i] | 0) + carry;
      carry = w >> 26;
      this.words[i] = w & 0x3ffffff;
    }
    this.negative = 1;

    return this.strip();
  };

  BN.prototype._wordDiv = function _wordDiv (num, mode) {
    var shift = this.length - num.length;

    var a = this.clone();
    var b = num;

    // Normalize
    var bhi = b.words[b.length - 1] | 0;
    var bhiBits = this._countBits(bhi);
    shift = 26 - bhiBits;
    if (shift !== 0) {
      b = b.ushln(shift);
      a.iushln(shift);
      bhi = b.words[b.length - 1] | 0;
    }

    // Initialize quotient
    var m = a.length - b.length;
    var q;

    if (mode !== 'mod') {
      q = new BN(null);
      q.length = m + 1;
      q.words = new Array(q.length);
      for (var i = 0; i < q.length; i++) {
        q.words[i] = 0;
      }
    }

    var diff = a.clone()._ishlnsubmul(b, 1, m);
    if (diff.negative === 0) {
      a = diff;
      if (q) {
        q.words[m] = 1;
      }
    }

    for (var j = m - 1; j >= 0; j--) {
      var qj = (a.words[b.length + j] | 0) * 0x4000000 +
        (a.words[b.length + j - 1] | 0);

      // NOTE: (qj / bhi) is (0x3ffffff * 0x4000000 + 0x3ffffff) / 0x2000000 max
      // (0x7ffffff)
      qj = Math.min((qj / bhi) | 0, 0x3ffffff);

      a._ishlnsubmul(b, qj, j);
      while (a.negative !== 0) {
        qj--;
        a.negative = 0;
        a._ishlnsubmul(b, 1, j);
        if (!a.isZero()) {
          a.negative ^= 1;
        }
      }
      if (q) {
        q.words[j] = qj;
      }
    }
    if (q) {
      q.strip();
    }
    a.strip();

    // Denormalize
    if (mode !== 'div' && shift !== 0) {
      a.iushrn(shift);
    }

    return {
      div: q || null,
      mod: a
    };
  };

  // NOTE: 1) `mode` can be set to `mod` to request mod only,
  //       to `div` to request div only, or be absent to
  //       request both div & mod
  //       2) `positive` is true if unsigned mod is requested
  BN.prototype.divmod = function divmod (num, mode, positive) {
    assert(!num.isZero());

    if (this.isZero()) {
      return {
        div: new BN(0),
        mod: new BN(0)
      };
    }

    var div, mod, res;
    if (this.negative !== 0 && num.negative === 0) {
      res = this.neg().divmod(num, mode);

      if (mode !== 'mod') {
        div = res.div.neg();
      }

      if (mode !== 'div') {
        mod = res.mod.neg();
        if (positive && mod.negative !== 0) {
          mod.iadd(num);
        }
      }

      return {
        div: div,
        mod: mod
      };
    }

    if (this.negative === 0 && num.negative !== 0) {
      res = this.divmod(num.neg(), mode);

      if (mode !== 'mod') {
        div = res.div.neg();
      }

      return {
        div: div,
        mod: res.mod
      };
    }

    if ((this.negative & num.negative) !== 0) {
      res = this.neg().divmod(num.neg(), mode);

      if (mode !== 'div') {
        mod = res.mod.neg();
        if (positive && mod.negative !== 0) {
          mod.isub(num);
        }
      }

      return {
        div: res.div,
        mod: mod
      };
    }

    // Both numbers are positive at this point

    // Strip both numbers to approximate shift value
    if (num.length > this.length || this.cmp(num) < 0) {
      return {
        div: new BN(0),
        mod: this
      };
    }

    // Very short reduction
    if (num.length === 1) {
      if (mode === 'div') {
        return {
          div: this.divn(num.words[0]),
          mod: null
        };
      }

      if (mode === 'mod') {
        return {
          div: null,
          mod: new BN(this.modn(num.words[0]))
        };
      }

      return {
        div: this.divn(num.words[0]),
        mod: new BN(this.modn(num.words[0]))
      };
    }

    return this._wordDiv(num, mode);
  };

  // Find `this` / `num`
  BN.prototype.div = function div (num) {
    return this.divmod(num, 'div', false).div;
  };

  // Find `this` % `num`
  BN.prototype.mod = function mod (num) {
    return this.divmod(num, 'mod', false).mod;
  };

  BN.prototype.umod = function umod (num) {
    return this.divmod(num, 'mod', true).mod;
  };

  // Find Round(`this` / `num`)
  BN.prototype.divRound = function divRound (num) {
    var dm = this.divmod(num);

    // Fast case - exact division
    if (dm.mod.isZero()) return dm.div;

    var mod = dm.div.negative !== 0 ? dm.mod.isub(num) : dm.mod;

    var half = num.ushrn(1);
    var r2 = num.andln(1);
    var cmp = mod.cmp(half);

    // Round down
    if (cmp < 0 || r2 === 1 && cmp === 0) return dm.div;

    // Round up
    return dm.div.negative !== 0 ? dm.div.isubn(1) : dm.div.iaddn(1);
  };

  BN.prototype.modn = function modn (num) {
    assert(num <= 0x3ffffff);
    var p = (1 << 26) % num;

    var acc = 0;
    for (var i = this.length - 1; i >= 0; i--) {
      acc = (p * acc + (this.words[i] | 0)) % num;
    }

    return acc;
  };

  // In-place division by number
  BN.prototype.idivn = function idivn (num) {
    assert(num <= 0x3ffffff);

    var carry = 0;
    for (var i = this.length - 1; i >= 0; i--) {
      var w = (this.words[i] | 0) + carry * 0x4000000;
      this.words[i] = (w / num) | 0;
      carry = w % num;
    }

    return this.strip();
  };

  BN.prototype.divn = function divn (num) {
    return this.clone().idivn(num);
  };

  BN.prototype.egcd = function egcd (p) {
    assert(p.negative === 0);
    assert(!p.isZero());

    var x = this;
    var y = p.clone();

    if (x.negative !== 0) {
      x = x.umod(p);
    } else {
      x = x.clone();
    }

    // A * x + B * y = x
    var A = new BN(1);
    var B = new BN(0);

    // C * x + D * y = y
    var C = new BN(0);
    var D = new BN(1);

    var g = 0;

    while (x.isEven() && y.isEven()) {
      x.iushrn(1);
      y.iushrn(1);
      ++g;
    }

    var yp = y.clone();
    var xp = x.clone();

    while (!x.isZero()) {
      for (var i = 0, im = 1; (x.words[0] & im) === 0 && i < 26; ++i, im <<= 1);
      if (i > 0) {
        x.iushrn(i);
        while (i-- > 0) {
          if (A.isOdd() || B.isOdd()) {
            A.iadd(yp);
            B.isub(xp);
          }

          A.iushrn(1);
          B.iushrn(1);
        }
      }

      for (var j = 0, jm = 1; (y.words[0] & jm) === 0 && j < 26; ++j, jm <<= 1);
      if (j > 0) {
        y.iushrn(j);
        while (j-- > 0) {
          if (C.isOdd() || D.isOdd()) {
            C.iadd(yp);
            D.isub(xp);
          }

          C.iushrn(1);
          D.iushrn(1);
        }
      }

      if (x.cmp(y) >= 0) {
        x.isub(y);
        A.isub(C);
        B.isub(D);
      } else {
        y.isub(x);
        C.isub(A);
        D.isub(B);
      }
    }

    return {
      a: C,
      b: D,
      gcd: y.iushln(g)
    };
  };

  // This is reduced incarnation of the binary EEA
  // above, designated to invert members of the
  // _prime_ fields F(p) at a maximal speed
  BN.prototype._invmp = function _invmp (p) {
    assert(p.negative === 0);
    assert(!p.isZero());

    var a = this;
    var b = p.clone();

    if (a.negative !== 0) {
      a = a.umod(p);
    } else {
      a = a.clone();
    }

    var x1 = new BN(1);
    var x2 = new BN(0);

    var delta = b.clone();

    while (a.cmpn(1) > 0 && b.cmpn(1) > 0) {
      for (var i = 0, im = 1; (a.words[0] & im) === 0 && i < 26; ++i, im <<= 1);
      if (i > 0) {
        a.iushrn(i);
        while (i-- > 0) {
          if (x1.isOdd()) {
            x1.iadd(delta);
          }

          x1.iushrn(1);
        }
      }

      for (var j = 0, jm = 1; (b.words[0] & jm) === 0 && j < 26; ++j, jm <<= 1);
      if (j > 0) {
        b.iushrn(j);
        while (j-- > 0) {
          if (x2.isOdd()) {
            x2.iadd(delta);
          }

          x2.iushrn(1);
        }
      }

      if (a.cmp(b) >= 0) {
        a.isub(b);
        x1.isub(x2);
      } else {
        b.isub(a);
        x2.isub(x1);
      }
    }

    var res;
    if (a.cmpn(1) === 0) {
      res = x1;
    } else {
      res = x2;
    }

    if (res.cmpn(0) < 0) {
      res.iadd(p);
    }

    return res;
  };

  BN.prototype.gcd = function gcd (num) {
    if (this.isZero()) return num.abs();
    if (num.isZero()) return this.abs();

    var a = this.clone();
    var b = num.clone();
    a.negative = 0;
    b.negative = 0;

    // Remove common factor of two
    for (var shift = 0; a.isEven() && b.isEven(); shift++) {
      a.iushrn(1);
      b.iushrn(1);
    }

    do {
      while (a.isEven()) {
        a.iushrn(1);
      }
      while (b.isEven()) {
        b.iushrn(1);
      }

      var r = a.cmp(b);
      if (r < 0) {
        // Swap `a` and `b` to make `a` always bigger than `b`
        var t = a;
        a = b;
        b = t;
      } else if (r === 0 || b.cmpn(1) === 0) {
        break;
      }

      a.isub(b);
    } while (true);

    return b.iushln(shift);
  };

  // Invert number in the field F(num)
  BN.prototype.invm = function invm (num) {
    return this.egcd(num).a.umod(num);
  };

  BN.prototype.isEven = function isEven () {
    return (this.words[0] & 1) === 0;
  };

  BN.prototype.isOdd = function isOdd () {
    return (this.words[0] & 1) === 1;
  };

  // And first word and num
  BN.prototype.andln = function andln (num) {
    return this.words[0] & num;
  };

  // Increment at the bit position in-line
  BN.prototype.bincn = function bincn (bit) {
    assert(typeof bit === 'number');
    var r = bit % 26;
    var s = (bit - r) / 26;
    var q = 1 << r;

    // Fast case: bit is much higher than all existing words
    if (this.length <= s) {
      this._expand(s + 1);
      this.words[s] |= q;
      return this;
    }

    // Add bit and propagate, if needed
    var carry = q;
    for (var i = s; carry !== 0 && i < this.length; i++) {
      var w = this.words[i] | 0;
      w += carry;
      carry = w >>> 26;
      w &= 0x3ffffff;
      this.words[i] = w;
    }
    if (carry !== 0) {
      this.words[i] = carry;
      this.length++;
    }
    return this;
  };

  BN.prototype.isZero = function isZero () {
    return this.length === 1 && this.words[0] === 0;
  };

  BN.prototype.cmpn = function cmpn (num) {
    var negative = num < 0;

    if (this.negative !== 0 && !negative) return -1;
    if (this.negative === 0 && negative) return 1;

    this.strip();

    var res;
    if (this.length > 1) {
      res = 1;
    } else {
      if (negative) {
        num = -num;
      }

      assert(num <= 0x3ffffff, 'Number is too big');

      var w = this.words[0] | 0;
      res = w === num ? 0 : w < num ? -1 : 1;
    }
    if (this.negative !== 0) return -res | 0;
    return res;
  };

  // Compare two numbers and return:
  // 1 - if `this` > `num`
  // 0 - if `this` == `num`
  // -1 - if `this` < `num`
  BN.prototype.cmp = function cmp (num) {
    if (this.negative !== 0 && num.negative === 0) return -1;
    if (this.negative === 0 && num.negative !== 0) return 1;

    var res = this.ucmp(num);
    if (this.negative !== 0) return -res | 0;
    return res;
  };

  // Unsigned comparison
  BN.prototype.ucmp = function ucmp (num) {
    // At this point both numbers have the same sign
    if (this.length > num.length) return 1;
    if (this.length < num.length) return -1;

    var res = 0;
    for (var i = this.length - 1; i >= 0; i--) {
      var a = this.words[i] | 0;
      var b = num.words[i] | 0;

      if (a === b) continue;
      if (a < b) {
        res = -1;
      } else if (a > b) {
        res = 1;
      }
      break;
    }
    return res;
  };

  BN.prototype.gtn = function gtn (num) {
    return this.cmpn(num) === 1;
  };

  BN.prototype.gt = function gt (num) {
    return this.cmp(num) === 1;
  };

  BN.prototype.gten = function gten (num) {
    return this.cmpn(num) >= 0;
  };

  BN.prototype.gte = function gte (num) {
    return this.cmp(num) >= 0;
  };

  BN.prototype.ltn = function ltn (num) {
    return this.cmpn(num) === -1;
  };

  BN.prototype.lt = function lt (num) {
    return this.cmp(num) === -1;
  };

  BN.prototype.lten = function lten (num) {
    return this.cmpn(num) <= 0;
  };

  BN.prototype.lte = function lte (num) {
    return this.cmp(num) <= 0;
  };

  BN.prototype.eqn = function eqn (num) {
    return this.cmpn(num) === 0;
  };

  BN.prototype.eq = function eq (num) {
    return this.cmp(num) === 0;
  };

  //
  // A reduce context, could be using montgomery or something better, depending
  // on the `m` itself.
  //
  BN.red = function red (num) {
    return new Red(num);
  };

  BN.prototype.toRed = function toRed (ctx) {
    assert(!this.red, 'Already a number in reduction context');
    assert(this.negative === 0, 'red works only with positives');
    return ctx.convertTo(this)._forceRed(ctx);
  };

  BN.prototype.fromRed = function fromRed () {
    assert(this.red, 'fromRed works only with numbers in reduction context');
    return this.red.convertFrom(this);
  };

  BN.prototype._forceRed = function _forceRed (ctx) {
    this.red = ctx;
    return this;
  };

  BN.prototype.forceRed = function forceRed (ctx) {
    assert(!this.red, 'Already a number in reduction context');
    return this._forceRed(ctx);
  };

  BN.prototype.redAdd = function redAdd (num) {
    assert(this.red, 'redAdd works only with red numbers');
    return this.red.add(this, num);
  };

  BN.prototype.redIAdd = function redIAdd (num) {
    assert(this.red, 'redIAdd works only with red numbers');
    return this.red.iadd(this, num);
  };

  BN.prototype.redSub = function redSub (num) {
    assert(this.red, 'redSub works only with red numbers');
    return this.red.sub(this, num);
  };

  BN.prototype.redISub = function redISub (num) {
    assert(this.red, 'redISub works only with red numbers');
    return this.red.isub(this, num);
  };

  BN.prototype.redShl = function redShl (num) {
    assert(this.red, 'redShl works only with red numbers');
    return this.red.shl(this, num);
  };

  BN.prototype.redMul = function redMul (num) {
    assert(this.red, 'redMul works only with red numbers');
    this.red._verify2(this, num);
    return this.red.mul(this, num);
  };

  BN.prototype.redIMul = function redIMul (num) {
    assert(this.red, 'redMul works only with red numbers');
    this.red._verify2(this, num);
    return this.red.imul(this, num);
  };

  BN.prototype.redSqr = function redSqr () {
    assert(this.red, 'redSqr works only with red numbers');
    this.red._verify1(this);
    return this.red.sqr(this);
  };

  BN.prototype.redISqr = function redISqr () {
    assert(this.red, 'redISqr works only with red numbers');
    this.red._verify1(this);
    return this.red.isqr(this);
  };

  // Square root over p
  BN.prototype.redSqrt = function redSqrt () {
    assert(this.red, 'redSqrt works only with red numbers');
    this.red._verify1(this);
    return this.red.sqrt(this);
  };

  BN.prototype.redInvm = function redInvm () {
    assert(this.red, 'redInvm works only with red numbers');
    this.red._verify1(this);
    return this.red.invm(this);
  };

  // Return negative clone of `this` % `red modulo`
  BN.prototype.redNeg = function redNeg () {
    assert(this.red, 'redNeg works only with red numbers');
    this.red._verify1(this);
    return this.red.neg(this);
  };

  BN.prototype.redPow = function redPow (num) {
    assert(this.red && !num.red, 'redPow(normalNum)');
    this.red._verify1(this);
    return this.red.pow(this, num);
  };

  // Prime numbers with efficient reduction
  var primes = {
    k256: null,
    p224: null,
    p192: null,
    p25519: null
  };

  // Pseudo-Mersenne prime
  function MPrime (name, p) {
    // P = 2 ^ N - K
    this.name = name;
    this.p = new BN(p, 16);
    this.n = this.p.bitLength();
    this.k = new BN(1).iushln(this.n).isub(this.p);

    this.tmp = this._tmp();
  }

  MPrime.prototype._tmp = function _tmp () {
    var tmp = new BN(null);
    tmp.words = new Array(Math.ceil(this.n / 13));
    return tmp;
  };

  MPrime.prototype.ireduce = function ireduce (num) {
    // Assumes that `num` is less than `P^2`
    // num = HI * (2 ^ N - K) + HI * K + LO = HI * K + LO (mod P)
    var r = num;
    var rlen;

    do {
      this.split(r, this.tmp);
      r = this.imulK(r);
      r = r.iadd(this.tmp);
      rlen = r.bitLength();
    } while (rlen > this.n);

    var cmp = rlen < this.n ? -1 : r.ucmp(this.p);
    if (cmp === 0) {
      r.words[0] = 0;
      r.length = 1;
    } else if (cmp > 0) {
      r.isub(this.p);
    } else {
      r.strip();
    }

    return r;
  };

  MPrime.prototype.split = function split (input, out) {
    input.iushrn(this.n, 0, out);
  };

  MPrime.prototype.imulK = function imulK (num) {
    return num.imul(this.k);
  };

  function K256 () {
    MPrime.call(
      this,
      'k256',
      'ffffffff ffffffff ffffffff ffffffff ffffffff ffffffff fffffffe fffffc2f');
  }
  inherits(K256, MPrime);

  K256.prototype.split = function split (input, output) {
    // 256 = 9 * 26 + 22
    var mask = 0x3fffff;

    var outLen = Math.min(input.length, 9);
    for (var i = 0; i < outLen; i++) {
      output.words[i] = input.words[i];
    }
    output.length = outLen;

    if (input.length <= 9) {
      input.words[0] = 0;
      input.length = 1;
      return;
    }

    // Shift by 9 limbs
    var prev = input.words[9];
    output.words[output.length++] = prev & mask;

    for (i = 10; i < input.length; i++) {
      var next = input.words[i] | 0;
      input.words[i - 10] = ((next & mask) << 4) | (prev >>> 22);
      prev = next;
    }
    prev >>>= 22;
    input.words[i - 10] = prev;
    if (prev === 0 && input.length > 10) {
      input.length -= 10;
    } else {
      input.length -= 9;
    }
  };

  K256.prototype.imulK = function imulK (num) {
    // K = 0x1000003d1 = [ 0x40, 0x3d1 ]
    num.words[num.length] = 0;
    num.words[num.length + 1] = 0;
    num.length += 2;

    // bounded at: 0x40 * 0x3ffffff + 0x3d0 = 0x100000390
    var lo = 0;
    for (var i = 0; i < num.length; i++) {
      var w = num.words[i] | 0;
      lo += w * 0x3d1;
      num.words[i] = lo & 0x3ffffff;
      lo = w * 0x40 + ((lo / 0x4000000) | 0);
    }

    // Fast length reduction
    if (num.words[num.length - 1] === 0) {
      num.length--;
      if (num.words[num.length - 1] === 0) {
        num.length--;
      }
    }
    return num;
  };

  function P224 () {
    MPrime.call(
      this,
      'p224',
      'ffffffff ffffffff ffffffff ffffffff 00000000 00000000 00000001');
  }
  inherits(P224, MPrime);

  function P192 () {
    MPrime.call(
      this,
      'p192',
      'ffffffff ffffffff ffffffff fffffffe ffffffff ffffffff');
  }
  inherits(P192, MPrime);

  function P25519 () {
    // 2 ^ 255 - 19
    MPrime.call(
      this,
      '25519',
      '7fffffffffffffff ffffffffffffffff ffffffffffffffff ffffffffffffffed');
  }
  inherits(P25519, MPrime);

  P25519.prototype.imulK = function imulK (num) {
    // K = 0x13
    var carry = 0;
    for (var i = 0; i < num.length; i++) {
      var hi = (num.words[i] | 0) * 0x13 + carry;
      var lo = hi & 0x3ffffff;
      hi >>>= 26;

      num.words[i] = lo;
      carry = hi;
    }
    if (carry !== 0) {
      num.words[num.length++] = carry;
    }
    return num;
  };

  // Exported mostly for testing purposes, use plain name instead
  BN._prime = function prime (name) {
    // Cached version of prime
    if (primes[name]) return primes[name];

    var prime;
    if (name === 'k256') {
      prime = new K256();
    } else if (name === 'p224') {
      prime = new P224();
    } else if (name === 'p192') {
      prime = new P192();
    } else if (name === 'p25519') {
      prime = new P25519();
    } else {
      throw new Error('Unknown prime ' + name);
    }
    primes[name] = prime;

    return prime;
  };

  //
  // Base reduction engine
  //
  function Red (m) {
    if (typeof m === 'string') {
      var prime = BN._prime(m);
      this.m = prime.p;
      this.prime = prime;
    } else {
      assert(m.gtn(1), 'modulus must be greater than 1');
      this.m = m;
      this.prime = null;
    }
  }

  Red.prototype._verify1 = function _verify1 (a) {
    assert(a.negative === 0, 'red works only with positives');
    assert(a.red, 'red works only with red numbers');
  };

  Red.prototype._verify2 = function _verify2 (a, b) {
    assert((a.negative | b.negative) === 0, 'red works only with positives');
    assert(a.red && a.red === b.red,
      'red works only with red numbers');
  };

  Red.prototype.imod = function imod (a) {
    if (this.prime) return this.prime.ireduce(a)._forceRed(this);
    return a.umod(this.m)._forceRed(this);
  };

  Red.prototype.neg = function neg (a) {
    if (a.isZero()) {
      return a.clone();
    }

    return this.m.sub(a)._forceRed(this);
  };

  Red.prototype.add = function add (a, b) {
    this._verify2(a, b);

    var res = a.add(b);
    if (res.cmp(this.m) >= 0) {
      res.isub(this.m);
    }
    return res._forceRed(this);
  };

  Red.prototype.iadd = function iadd (a, b) {
    this._verify2(a, b);

    var res = a.iadd(b);
    if (res.cmp(this.m) >= 0) {
      res.isub(this.m);
    }
    return res;
  };

  Red.prototype.sub = function sub (a, b) {
    this._verify2(a, b);

    var res = a.sub(b);
    if (res.cmpn(0) < 0) {
      res.iadd(this.m);
    }
    return res._forceRed(this);
  };

  Red.prototype.isub = function isub (a, b) {
    this._verify2(a, b);

    var res = a.isub(b);
    if (res.cmpn(0) < 0) {
      res.iadd(this.m);
    }
    return res;
  };

  Red.prototype.shl = function shl (a, num) {
    this._verify1(a);
    return this.imod(a.ushln(num));
  };

  Red.prototype.imul = function imul (a, b) {
    this._verify2(a, b);
    return this.imod(a.imul(b));
  };

  Red.prototype.mul = function mul (a, b) {
    this._verify2(a, b);
    return this.imod(a.mul(b));
  };

  Red.prototype.isqr = function isqr (a) {
    return this.imul(a, a.clone());
  };

  Red.prototype.sqr = function sqr (a) {
    return this.mul(a, a);
  };

  Red.prototype.sqrt = function sqrt (a) {
    if (a.isZero()) return a.clone();

    var mod3 = this.m.andln(3);
    assert(mod3 % 2 === 1);

    // Fast case
    if (mod3 === 3) {
      var pow = this.m.add(new BN(1)).iushrn(2);
      return this.pow(a, pow);
    }

    // Tonelli-Shanks algorithm (Totally unoptimized and slow)
    //
    // Find Q and S, that Q * 2 ^ S = (P - 1)
    var q = this.m.subn(1);
    var s = 0;
    while (!q.isZero() && q.andln(1) === 0) {
      s++;
      q.iushrn(1);
    }
    assert(!q.isZero());

    var one = new BN(1).toRed(this);
    var nOne = one.redNeg();

    // Find quadratic non-residue
    // NOTE: Max is such because of generalized Riemann hypothesis.
    var lpow = this.m.subn(1).iushrn(1);
    var z = this.m.bitLength();
    z = new BN(2 * z * z).toRed(this);

    while (this.pow(z, lpow).cmp(nOne) !== 0) {
      z.redIAdd(nOne);
    }

    var c = this.pow(z, q);
    var r = this.pow(a, q.addn(1).iushrn(1));
    var t = this.pow(a, q);
    var m = s;
    while (t.cmp(one) !== 0) {
      var tmp = t;
      for (var i = 0; tmp.cmp(one) !== 0; i++) {
        tmp = tmp.redSqr();
      }
      assert(i < m);
      var b = this.pow(c, new BN(1).iushln(m - i - 1));

      r = r.redMul(b);
      c = b.redSqr();
      t = t.redMul(c);
      m = i;
    }

    return r;
  };

  Red.prototype.invm = function invm (a) {
    var inv = a._invmp(this.m);
    if (inv.negative !== 0) {
      inv.negative = 0;
      return this.imod(inv).redNeg();
    } else {
      return this.imod(inv);
    }
  };

  Red.prototype.pow = function pow (a, num) {
    if (num.isZero()) return new BN(1).toRed(this);
    if (num.cmpn(1) === 0) return a.clone();

    var windowSize = 4;
    var wnd = new Array(1 << windowSize);
    wnd[0] = new BN(1).toRed(this);
    wnd[1] = a;
    for (var i = 2; i < wnd.length; i++) {
      wnd[i] = this.mul(wnd[i - 1], a);
    }

    var res = wnd[0];
    var current = 0;
    var currentLen = 0;
    var start = num.bitLength() % 26;
    if (start === 0) {
      start = 26;
    }

    for (i = num.length - 1; i >= 0; i--) {
      var word = num.words[i];
      for (var j = start - 1; j >= 0; j--) {
        var bit = (word >> j) & 1;
        if (res !== wnd[0]) {
          res = this.sqr(res);
        }

        if (bit === 0 && current === 0) {
          currentLen = 0;
          continue;
        }

        current <<= 1;
        current |= bit;
        currentLen++;
        if (currentLen !== windowSize && (i !== 0 || j !== 0)) continue;

        res = this.mul(res, wnd[current]);
        currentLen = 0;
        current = 0;
      }
      start = 26;
    }

    return res;
  };

  Red.prototype.convertTo = function convertTo (num) {
    var r = num.umod(this.m);

    return r === num ? r.clone() : r;
  };

  Red.prototype.convertFrom = function convertFrom (num) {
    var res = num.clone();
    res.red = null;
    return res;
  };

  //
  // Montgomery method engine
  //

  BN.mont = function mont (num) {
    return new Mont(num);
  };

  function Mont (m) {
    Red.call(this, m);

    this.shift = this.m.bitLength();
    if (this.shift % 26 !== 0) {
      this.shift += 26 - (this.shift % 26);
    }

    this.r = new BN(1).iushln(this.shift);
    this.r2 = this.imod(this.r.sqr());
    this.rinv = this.r._invmp(this.m);

    this.minv = this.rinv.mul(this.r).isubn(1).div(this.m);
    this.minv = this.minv.umod(this.r);
    this.minv = this.r.sub(this.minv);
  }
  inherits(Mont, Red);

  Mont.prototype.convertTo = function convertTo (num) {
    return this.imod(num.ushln(this.shift));
  };

  Mont.prototype.convertFrom = function convertFrom (num) {
    var r = this.imod(num.mul(this.rinv));
    r.red = null;
    return r;
  };

  Mont.prototype.imul = function imul (a, b) {
    if (a.isZero() || b.isZero()) {
      a.words[0] = 0;
      a.length = 1;
      return a;
    }

    var t = a.imul(b);
    var c = t.maskn(this.shift).mul(this.minv).imaskn(this.shift).mul(this.m);
    var u = t.isub(c).iushrn(this.shift);
    var res = u;

    if (u.cmp(this.m) >= 0) {
      res = u.isub(this.m);
    } else if (u.cmpn(0) < 0) {
      res = u.iadd(this.m);
    }

    return res._forceRed(this);
  };

  Mont.prototype.mul = function mul (a, b) {
    if (a.isZero() || b.isZero()) return new BN(0)._forceRed(this);

    var t = a.mul(b);
    var c = t.maskn(this.shift).mul(this.minv).imaskn(this.shift).mul(this.m);
    var u = t.isub(c).iushrn(this.shift);
    var res = u;
    if (u.cmp(this.m) >= 0) {
      res = u.isub(this.m);
    } else if (u.cmpn(0) < 0) {
      res = u.iadd(this.m);
    }

    return res._forceRed(this);
  };

  Mont.prototype.invm = function invm (a) {
    // (AR)^-1 * R^2 = (A^-1 * R^-1) * R^2 = A^-1 * R
    var res = this.imod(a._invmp(this.m).mul(this.r2));
    return res._forceRed(this);
  };
})(typeof module === 'undefined' || module, this);

/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(259)(module)))

/***/ }),
/* 14 */
/***/ (function(module, exports, __webpack_require__) {

// 7.1.13 ToObject(argument)
var defined = __webpack_require__(32);
module.exports = function (it) {
  return Object(defined(it));
};


/***/ }),
/* 15 */
/***/ (function(module, exports, __webpack_require__) {

;(function (root, factory, undef) {
	if (true) {
		// CommonJS
		module.exports = exports = factory(__webpack_require__(4), __webpack_require__(57));
	}
	else if (typeof define === "function" && define.amd) {
		// AMD
		define(["./core", "./evpkdf"], factory);
	}
	else {
		// Global (browser)
		factory(root.CryptoJS);
	}
}(this, function (CryptoJS) {

	/**
	 * Cipher core components.
	 */
	CryptoJS.lib.Cipher || (function (undefined) {
	    // Shortcuts
	    var C = CryptoJS;
	    var C_lib = C.lib;
	    var Base = C_lib.Base;
	    var WordArray = C_lib.WordArray;
	    var BufferedBlockAlgorithm = C_lib.BufferedBlockAlgorithm;
	    var C_enc = C.enc;
	    var Utf8 = C_enc.Utf8;
	    var Base64 = C_enc.Base64;
	    var C_algo = C.algo;
	    var EvpKDF = C_algo.EvpKDF;

	    /**
	     * Abstract base cipher template.
	     *
	     * @property {number} keySize This cipher's key size. Default: 4 (128 bits)
	     * @property {number} ivSize This cipher's IV size. Default: 4 (128 bits)
	     * @property {number} _ENC_XFORM_MODE A constant representing encryption mode.
	     * @property {number} _DEC_XFORM_MODE A constant representing decryption mode.
	     */
	    var Cipher = C_lib.Cipher = BufferedBlockAlgorithm.extend({
	        /**
	         * Configuration options.
	         *
	         * @property {WordArray} iv The IV to use for this operation.
	         */
	        cfg: Base.extend(),

	        /**
	         * Creates this cipher in encryption mode.
	         *
	         * @param {WordArray} key The key.
	         * @param {Object} cfg (Optional) The configuration options to use for this operation.
	         *
	         * @return {Cipher} A cipher instance.
	         *
	         * @static
	         *
	         * @example
	         *
	         *     var cipher = CryptoJS.algo.AES.createEncryptor(keyWordArray, { iv: ivWordArray });
	         */
	        createEncryptor: function (key, cfg) {
	            return this.create(this._ENC_XFORM_MODE, key, cfg);
	        },

	        /**
	         * Creates this cipher in decryption mode.
	         *
	         * @param {WordArray} key The key.
	         * @param {Object} cfg (Optional) The configuration options to use for this operation.
	         *
	         * @return {Cipher} A cipher instance.
	         *
	         * @static
	         *
	         * @example
	         *
	         *     var cipher = CryptoJS.algo.AES.createDecryptor(keyWordArray, { iv: ivWordArray });
	         */
	        createDecryptor: function (key, cfg) {
	            return this.create(this._DEC_XFORM_MODE, key, cfg);
	        },

	        /**
	         * Initializes a newly created cipher.
	         *
	         * @param {number} xformMode Either the encryption or decryption transormation mode constant.
	         * @param {WordArray} key The key.
	         * @param {Object} cfg (Optional) The configuration options to use for this operation.
	         *
	         * @example
	         *
	         *     var cipher = CryptoJS.algo.AES.create(CryptoJS.algo.AES._ENC_XFORM_MODE, keyWordArray, { iv: ivWordArray });
	         */
	        init: function (xformMode, key, cfg) {
	            // Apply config defaults
	            this.cfg = this.cfg.extend(cfg);

	            // Store transform mode and key
	            this._xformMode = xformMode;
	            this._key = key;

	            // Set initial values
	            this.reset();
	        },

	        /**
	         * Resets this cipher to its initial state.
	         *
	         * @example
	         *
	         *     cipher.reset();
	         */
	        reset: function () {
	            // Reset data buffer
	            BufferedBlockAlgorithm.reset.call(this);

	            // Perform concrete-cipher logic
	            this._doReset();
	        },

	        /**
	         * Adds data to be encrypted or decrypted.
	         *
	         * @param {WordArray|string} dataUpdate The data to encrypt or decrypt.
	         *
	         * @return {WordArray} The data after processing.
	         *
	         * @example
	         *
	         *     var encrypted = cipher.process('data');
	         *     var encrypted = cipher.process(wordArray);
	         */
	        process: function (dataUpdate) {
	            // Append
	            this._append(dataUpdate);

	            // Process available blocks
	            return this._process();
	        },

	        /**
	         * Finalizes the encryption or decryption process.
	         * Note that the finalize operation is effectively a destructive, read-once operation.
	         *
	         * @param {WordArray|string} dataUpdate The final data to encrypt or decrypt.
	         *
	         * @return {WordArray} The data after final processing.
	         *
	         * @example
	         *
	         *     var encrypted = cipher.finalize();
	         *     var encrypted = cipher.finalize('data');
	         *     var encrypted = cipher.finalize(wordArray);
	         */
	        finalize: function (dataUpdate) {
	            // Final data update
	            if (dataUpdate) {
	                this._append(dataUpdate);
	            }

	            // Perform concrete-cipher logic
	            var finalProcessedData = this._doFinalize();

	            return finalProcessedData;
	        },

	        keySize: 128/32,

	        ivSize: 128/32,

	        _ENC_XFORM_MODE: 1,

	        _DEC_XFORM_MODE: 2,

	        /**
	         * Creates shortcut functions to a cipher's object interface.
	         *
	         * @param {Cipher} cipher The cipher to create a helper for.
	         *
	         * @return {Object} An object with encrypt and decrypt shortcut functions.
	         *
	         * @static
	         *
	         * @example
	         *
	         *     var AES = CryptoJS.lib.Cipher._createHelper(CryptoJS.algo.AES);
	         */
	        _createHelper: (function () {
	            function selectCipherStrategy(key) {
	                if (typeof key == 'string') {
	                    return PasswordBasedCipher;
	                } else {
	                    return SerializableCipher;
	                }
	            }

	            return function (cipher) {
	                return {
	                    encrypt: function (message, key, cfg) {
	                        return selectCipherStrategy(key).encrypt(cipher, message, key, cfg);
	                    },

	                    decrypt: function (ciphertext, key, cfg) {
	                        return selectCipherStrategy(key).decrypt(cipher, ciphertext, key, cfg);
	                    }
	                };
	            };
	        }())
	    });

	    /**
	     * Abstract base stream cipher template.
	     *
	     * @property {number} blockSize The number of 32-bit words this cipher operates on. Default: 1 (32 bits)
	     */
	    var StreamCipher = C_lib.StreamCipher = Cipher.extend({
	        _doFinalize: function () {
	            // Process partial blocks
	            var finalProcessedBlocks = this._process(!!'flush');

	            return finalProcessedBlocks;
	        },

	        blockSize: 1
	    });

	    /**
	     * Mode namespace.
	     */
	    var C_mode = C.mode = {};

	    /**
	     * Abstract base block cipher mode template.
	     */
	    var BlockCipherMode = C_lib.BlockCipherMode = Base.extend({
	        /**
	         * Creates this mode for encryption.
	         *
	         * @param {Cipher} cipher A block cipher instance.
	         * @param {Array} iv The IV words.
	         *
	         * @static
	         *
	         * @example
	         *
	         *     var mode = CryptoJS.mode.CBC.createEncryptor(cipher, iv.words);
	         */
	        createEncryptor: function (cipher, iv) {
	            return this.Encryptor.create(cipher, iv);
	        },

	        /**
	         * Creates this mode for decryption.
	         *
	         * @param {Cipher} cipher A block cipher instance.
	         * @param {Array} iv The IV words.
	         *
	         * @static
	         *
	         * @example
	         *
	         *     var mode = CryptoJS.mode.CBC.createDecryptor(cipher, iv.words);
	         */
	        createDecryptor: function (cipher, iv) {
	            return this.Decryptor.create(cipher, iv);
	        },

	        /**
	         * Initializes a newly created mode.
	         *
	         * @param {Cipher} cipher A block cipher instance.
	         * @param {Array} iv The IV words.
	         *
	         * @example
	         *
	         *     var mode = CryptoJS.mode.CBC.Encryptor.create(cipher, iv.words);
	         */
	        init: function (cipher, iv) {
	            this._cipher = cipher;
	            this._iv = iv;
	        }
	    });

	    /**
	     * Cipher Block Chaining mode.
	     */
	    var CBC = C_mode.CBC = (function () {
	        /**
	         * Abstract base CBC mode.
	         */
	        var CBC = BlockCipherMode.extend();

	        /**
	         * CBC encryptor.
	         */
	        CBC.Encryptor = CBC.extend({
	            /**
	             * Processes the data block at offset.
	             *
	             * @param {Array} words The data words to operate on.
	             * @param {number} offset The offset where the block starts.
	             *
	             * @example
	             *
	             *     mode.processBlock(data.words, offset);
	             */
	            processBlock: function (words, offset) {
	                // Shortcuts
	                var cipher = this._cipher;
	                var blockSize = cipher.blockSize;

	                // XOR and encrypt
	                xorBlock.call(this, words, offset, blockSize);
	                cipher.encryptBlock(words, offset);

	                // Remember this block to use with next block
	                this._prevBlock = words.slice(offset, offset + blockSize);
	            }
	        });

	        /**
	         * CBC decryptor.
	         */
	        CBC.Decryptor = CBC.extend({
	            /**
	             * Processes the data block at offset.
	             *
	             * @param {Array} words The data words to operate on.
	             * @param {number} offset The offset where the block starts.
	             *
	             * @example
	             *
	             *     mode.processBlock(data.words, offset);
	             */
	            processBlock: function (words, offset) {
	                // Shortcuts
	                var cipher = this._cipher;
	                var blockSize = cipher.blockSize;

	                // Remember this block to use with next block
	                var thisBlock = words.slice(offset, offset + blockSize);

	                // Decrypt and XOR
	                cipher.decryptBlock(words, offset);
	                xorBlock.call(this, words, offset, blockSize);

	                // This block becomes the previous block
	                this._prevBlock = thisBlock;
	            }
	        });

	        function xorBlock(words, offset, blockSize) {
	            // Shortcut
	            var iv = this._iv;

	            // Choose mixing block
	            if (iv) {
	                var block = iv;

	                // Remove IV for subsequent blocks
	                this._iv = undefined;
	            } else {
	                var block = this._prevBlock;
	            }

	            // XOR blocks
	            for (var i = 0; i < blockSize; i++) {
	                words[offset + i] ^= block[i];
	            }
	        }

	        return CBC;
	    }());

	    /**
	     * Padding namespace.
	     */
	    var C_pad = C.pad = {};

	    /**
	     * PKCS #5/7 padding strategy.
	     */
	    var Pkcs7 = C_pad.Pkcs7 = {
	        /**
	         * Pads data using the algorithm defined in PKCS #5/7.
	         *
	         * @param {WordArray} data The data to pad.
	         * @param {number} blockSize The multiple that the data should be padded to.
	         *
	         * @static
	         *
	         * @example
	         *
	         *     CryptoJS.pad.Pkcs7.pad(wordArray, 4);
	         */
	        pad: function (data, blockSize) {
	            // Shortcut
	            var blockSizeBytes = blockSize * 4;

	            // Count padding bytes
	            var nPaddingBytes = blockSizeBytes - data.sigBytes % blockSizeBytes;

	            // Create padding word
	            var paddingWord = (nPaddingBytes << 24) | (nPaddingBytes << 16) | (nPaddingBytes << 8) | nPaddingBytes;

	            // Create padding
	            var paddingWords = [];
	            for (var i = 0; i < nPaddingBytes; i += 4) {
	                paddingWords.push(paddingWord);
	            }
	            var padding = WordArray.create(paddingWords, nPaddingBytes);

	            // Add padding
	            data.concat(padding);
	        },

	        /**
	         * Unpads data that had been padded using the algorithm defined in PKCS #5/7.
	         *
	         * @param {WordArray} data The data to unpad.
	         *
	         * @static
	         *
	         * @example
	         *
	         *     CryptoJS.pad.Pkcs7.unpad(wordArray);
	         */
	        unpad: function (data) {
	            // Get number of padding bytes from last byte
	            var nPaddingBytes = data.words[(data.sigBytes - 1) >>> 2] & 0xff;

	            // Remove padding
	            data.sigBytes -= nPaddingBytes;
	        }
	    };

	    /**
	     * Abstract base block cipher template.
	     *
	     * @property {number} blockSize The number of 32-bit words this cipher operates on. Default: 4 (128 bits)
	     */
	    var BlockCipher = C_lib.BlockCipher = Cipher.extend({
	        /**
	         * Configuration options.
	         *
	         * @property {Mode} mode The block mode to use. Default: CBC
	         * @property {Padding} padding The padding strategy to use. Default: Pkcs7
	         */
	        cfg: Cipher.cfg.extend({
	            mode: CBC,
	            padding: Pkcs7
	        }),

	        reset: function () {
	            // Reset cipher
	            Cipher.reset.call(this);

	            // Shortcuts
	            var cfg = this.cfg;
	            var iv = cfg.iv;
	            var mode = cfg.mode;

	            // Reset block mode
	            if (this._xformMode == this._ENC_XFORM_MODE) {
	                var modeCreator = mode.createEncryptor;
	            } else /* if (this._xformMode == this._DEC_XFORM_MODE) */ {
	                var modeCreator = mode.createDecryptor;
	                // Keep at least one block in the buffer for unpadding
	                this._minBufferSize = 1;
	            }

	            if (this._mode && this._mode.__creator == modeCreator) {
	                this._mode.init(this, iv && iv.words);
	            } else {
	                this._mode = modeCreator.call(mode, this, iv && iv.words);
	                this._mode.__creator = modeCreator;
	            }
	        },

	        _doProcessBlock: function (words, offset) {
	            this._mode.processBlock(words, offset);
	        },

	        _doFinalize: function () {
	            // Shortcut
	            var padding = this.cfg.padding;

	            // Finalize
	            if (this._xformMode == this._ENC_XFORM_MODE) {
	                // Pad data
	                padding.pad(this._data, this.blockSize);

	                // Process final blocks
	                var finalProcessedBlocks = this._process(!!'flush');
	            } else /* if (this._xformMode == this._DEC_XFORM_MODE) */ {
	                // Process final blocks
	                var finalProcessedBlocks = this._process(!!'flush');

	                // Unpad data
	                padding.unpad(finalProcessedBlocks);
	            }

	            return finalProcessedBlocks;
	        },

	        blockSize: 128/32
	    });

	    /**
	     * A collection of cipher parameters.
	     *
	     * @property {WordArray} ciphertext The raw ciphertext.
	     * @property {WordArray} key The key to this ciphertext.
	     * @property {WordArray} iv The IV used in the ciphering operation.
	     * @property {WordArray} salt The salt used with a key derivation function.
	     * @property {Cipher} algorithm The cipher algorithm.
	     * @property {Mode} mode The block mode used in the ciphering operation.
	     * @property {Padding} padding The padding scheme used in the ciphering operation.
	     * @property {number} blockSize The block size of the cipher.
	     * @property {Format} formatter The default formatting strategy to convert this cipher params object to a string.
	     */
	    var CipherParams = C_lib.CipherParams = Base.extend({
	        /**
	         * Initializes a newly created cipher params object.
	         *
	         * @param {Object} cipherParams An object with any of the possible cipher parameters.
	         *
	         * @example
	         *
	         *     var cipherParams = CryptoJS.lib.CipherParams.create({
	         *         ciphertext: ciphertextWordArray,
	         *         key: keyWordArray,
	         *         iv: ivWordArray,
	         *         salt: saltWordArray,
	         *         algorithm: CryptoJS.algo.AES,
	         *         mode: CryptoJS.mode.CBC,
	         *         padding: CryptoJS.pad.PKCS7,
	         *         blockSize: 4,
	         *         formatter: CryptoJS.format.OpenSSL
	         *     });
	         */
	        init: function (cipherParams) {
	            this.mixIn(cipherParams);
	        },

	        /**
	         * Converts this cipher params object to a string.
	         *
	         * @param {Format} formatter (Optional) The formatting strategy to use.
	         *
	         * @return {string} The stringified cipher params.
	         *
	         * @throws Error If neither the formatter nor the default formatter is set.
	         *
	         * @example
	         *
	         *     var string = cipherParams + '';
	         *     var string = cipherParams.toString();
	         *     var string = cipherParams.toString(CryptoJS.format.OpenSSL);
	         */
	        toString: function (formatter) {
	            return (formatter || this.formatter).stringify(this);
	        }
	    });

	    /**
	     * Format namespace.
	     */
	    var C_format = C.format = {};

	    /**
	     * OpenSSL formatting strategy.
	     */
	    var OpenSSLFormatter = C_format.OpenSSL = {
	        /**
	         * Converts a cipher params object to an OpenSSL-compatible string.
	         *
	         * @param {CipherParams} cipherParams The cipher params object.
	         *
	         * @return {string} The OpenSSL-compatible string.
	         *
	         * @static
	         *
	         * @example
	         *
	         *     var openSSLString = CryptoJS.format.OpenSSL.stringify(cipherParams);
	         */
	        stringify: function (cipherParams) {
	            // Shortcuts
	            var ciphertext = cipherParams.ciphertext;
	            var salt = cipherParams.salt;

	            // Format
	            if (salt) {
	                var wordArray = WordArray.create([0x53616c74, 0x65645f5f]).concat(salt).concat(ciphertext);
	            } else {
	                var wordArray = ciphertext;
	            }

	            return wordArray.toString(Base64);
	        },

	        /**
	         * Converts an OpenSSL-compatible string to a cipher params object.
	         *
	         * @param {string} openSSLStr The OpenSSL-compatible string.
	         *
	         * @return {CipherParams} The cipher params object.
	         *
	         * @static
	         *
	         * @example
	         *
	         *     var cipherParams = CryptoJS.format.OpenSSL.parse(openSSLString);
	         */
	        parse: function (openSSLStr) {
	            // Parse base64
	            var ciphertext = Base64.parse(openSSLStr);

	            // Shortcut
	            var ciphertextWords = ciphertext.words;

	            // Test for salt
	            if (ciphertextWords[0] == 0x53616c74 && ciphertextWords[1] == 0x65645f5f) {
	                // Extract salt
	                var salt = WordArray.create(ciphertextWords.slice(2, 4));

	                // Remove salt from ciphertext
	                ciphertextWords.splice(0, 4);
	                ciphertext.sigBytes -= 16;
	            }

	            return CipherParams.create({ ciphertext: ciphertext, salt: salt });
	        }
	    };

	    /**
	     * A cipher wrapper that returns ciphertext as a serializable cipher params object.
	     */
	    var SerializableCipher = C_lib.SerializableCipher = Base.extend({
	        /**
	         * Configuration options.
	         *
	         * @property {Formatter} format The formatting strategy to convert cipher param objects to and from a string. Default: OpenSSL
	         */
	        cfg: Base.extend({
	            format: OpenSSLFormatter
	        }),

	        /**
	         * Encrypts a message.
	         *
	         * @param {Cipher} cipher The cipher algorithm to use.
	         * @param {WordArray|string} message The message to encrypt.
	         * @param {WordArray} key The key.
	         * @param {Object} cfg (Optional) The configuration options to use for this operation.
	         *
	         * @return {CipherParams} A cipher params object.
	         *
	         * @static
	         *
	         * @example
	         *
	         *     var ciphertextParams = CryptoJS.lib.SerializableCipher.encrypt(CryptoJS.algo.AES, message, key);
	         *     var ciphertextParams = CryptoJS.lib.SerializableCipher.encrypt(CryptoJS.algo.AES, message, key, { iv: iv });
	         *     var ciphertextParams = CryptoJS.lib.SerializableCipher.encrypt(CryptoJS.algo.AES, message, key, { iv: iv, format: CryptoJS.format.OpenSSL });
	         */
	        encrypt: function (cipher, message, key, cfg) {
	            // Apply config defaults
	            cfg = this.cfg.extend(cfg);

	            // Encrypt
	            var encryptor = cipher.createEncryptor(key, cfg);
	            var ciphertext = encryptor.finalize(message);

	            // Shortcut
	            var cipherCfg = encryptor.cfg;

	            // Create and return serializable cipher params
	            return CipherParams.create({
	                ciphertext: ciphertext,
	                key: key,
	                iv: cipherCfg.iv,
	                algorithm: cipher,
	                mode: cipherCfg.mode,
	                padding: cipherCfg.padding,
	                blockSize: cipher.blockSize,
	                formatter: cfg.format
	            });
	        },

	        /**
	         * Decrypts serialized ciphertext.
	         *
	         * @param {Cipher} cipher The cipher algorithm to use.
	         * @param {CipherParams|string} ciphertext The ciphertext to decrypt.
	         * @param {WordArray} key The key.
	         * @param {Object} cfg (Optional) The configuration options to use for this operation.
	         *
	         * @return {WordArray} The plaintext.
	         *
	         * @static
	         *
	         * @example
	         *
	         *     var plaintext = CryptoJS.lib.SerializableCipher.decrypt(CryptoJS.algo.AES, formattedCiphertext, key, { iv: iv, format: CryptoJS.format.OpenSSL });
	         *     var plaintext = CryptoJS.lib.SerializableCipher.decrypt(CryptoJS.algo.AES, ciphertextParams, key, { iv: iv, format: CryptoJS.format.OpenSSL });
	         */
	        decrypt: function (cipher, ciphertext, key, cfg) {
	            // Apply config defaults
	            cfg = this.cfg.extend(cfg);

	            // Convert string to CipherParams
	            ciphertext = this._parse(ciphertext, cfg.format);

	            // Decrypt
	            var plaintext = cipher.createDecryptor(key, cfg).finalize(ciphertext.ciphertext);

	            return plaintext;
	        },

	        /**
	         * Converts serialized ciphertext to CipherParams,
	         * else assumed CipherParams already and returns ciphertext unchanged.
	         *
	         * @param {CipherParams|string} ciphertext The ciphertext.
	         * @param {Formatter} format The formatting strategy to use to parse serialized ciphertext.
	         *
	         * @return {CipherParams} The unserialized ciphertext.
	         *
	         * @static
	         *
	         * @example
	         *
	         *     var ciphertextParams = CryptoJS.lib.SerializableCipher._parse(ciphertextStringOrParams, format);
	         */
	        _parse: function (ciphertext, format) {
	            if (typeof ciphertext == 'string') {
	                return format.parse(ciphertext, this);
	            } else {
	                return ciphertext;
	            }
	        }
	    });

	    /**
	     * Key derivation function namespace.
	     */
	    var C_kdf = C.kdf = {};

	    /**
	     * OpenSSL key derivation function.
	     */
	    var OpenSSLKdf = C_kdf.OpenSSL = {
	        /**
	         * Derives a key and IV from a password.
	         *
	         * @param {string} password The password to derive from.
	         * @param {number} keySize The size in words of the key to generate.
	         * @param {number} ivSize The size in words of the IV to generate.
	         * @param {WordArray|string} salt (Optional) A 64-bit salt to use. If omitted, a salt will be generated randomly.
	         *
	         * @return {CipherParams} A cipher params object with the key, IV, and salt.
	         *
	         * @static
	         *
	         * @example
	         *
	         *     var derivedParams = CryptoJS.kdf.OpenSSL.execute('Password', 256/32, 128/32);
	         *     var derivedParams = CryptoJS.kdf.OpenSSL.execute('Password', 256/32, 128/32, 'saltsalt');
	         */
	        execute: function (password, keySize, ivSize, salt) {
	            // Generate random salt
	            if (!salt) {
	                salt = WordArray.random(64/8);
	            }

	            // Derive key and IV
	            var key = EvpKDF.create({ keySize: keySize + ivSize }).compute(password, salt);

	            // Separate key and IV
	            var iv = WordArray.create(key.words.slice(keySize), ivSize * 4);
	            key.sigBytes = keySize * 4;

	            // Return params
	            return CipherParams.create({ key: key, iv: iv, salt: salt });
	        }
	    };

	    /**
	     * A serializable cipher wrapper that derives the key from a password,
	     * and returns ciphertext as a serializable cipher params object.
	     */
	    var PasswordBasedCipher = C_lib.PasswordBasedCipher = SerializableCipher.extend({
	        /**
	         * Configuration options.
	         *
	         * @property {KDF} kdf The key derivation function to use to generate a key and IV from a password. Default: OpenSSL
	         */
	        cfg: SerializableCipher.cfg.extend({
	            kdf: OpenSSLKdf
	        }),

	        /**
	         * Encrypts a message using a password.
	         *
	         * @param {Cipher} cipher The cipher algorithm to use.
	         * @param {WordArray|string} message The message to encrypt.
	         * @param {string} password The password.
	         * @param {Object} cfg (Optional) The configuration options to use for this operation.
	         *
	         * @return {CipherParams} A cipher params object.
	         *
	         * @static
	         *
	         * @example
	         *
	         *     var ciphertextParams = CryptoJS.lib.PasswordBasedCipher.encrypt(CryptoJS.algo.AES, message, 'password');
	         *     var ciphertextParams = CryptoJS.lib.PasswordBasedCipher.encrypt(CryptoJS.algo.AES, message, 'password', { format: CryptoJS.format.OpenSSL });
	         */
	        encrypt: function (cipher, message, password, cfg) {
	            // Apply config defaults
	            cfg = this.cfg.extend(cfg);

	            // Derive key and other params
	            var derivedParams = cfg.kdf.execute(password, cipher.keySize, cipher.ivSize);

	            // Add IV to config
	            cfg.iv = derivedParams.iv;

	            // Encrypt
	            var ciphertext = SerializableCipher.encrypt.call(this, cipher, message, derivedParams.key, cfg);

	            // Mix in derived params
	            ciphertext.mixIn(derivedParams);

	            return ciphertext;
	        },

	        /**
	         * Decrypts serialized ciphertext using a password.
	         *
	         * @param {Cipher} cipher The cipher algorithm to use.
	         * @param {CipherParams|string} ciphertext The ciphertext to decrypt.
	         * @param {string} password The password.
	         * @param {Object} cfg (Optional) The configuration options to use for this operation.
	         *
	         * @return {WordArray} The plaintext.
	         *
	         * @static
	         *
	         * @example
	         *
	         *     var plaintext = CryptoJS.lib.PasswordBasedCipher.decrypt(CryptoJS.algo.AES, formattedCiphertext, 'password', { format: CryptoJS.format.OpenSSL });
	         *     var plaintext = CryptoJS.lib.PasswordBasedCipher.decrypt(CryptoJS.algo.AES, ciphertextParams, 'password', { format: CryptoJS.format.OpenSSL });
	         */
	        decrypt: function (cipher, ciphertext, password, cfg) {
	            // Apply config defaults
	            cfg = this.cfg.extend(cfg);

	            // Convert string to CipherParams
	            ciphertext = this._parse(ciphertext, cfg.format);

	            // Derive key and other params
	            var derivedParams = cfg.kdf.execute(password, cipher.keySize, cipher.ivSize, ciphertext.salt);

	            // Add IV to config
	            cfg.iv = derivedParams.iv;

	            // Decrypt
	            var plaintext = SerializableCipher.decrypt.call(this, cipher, ciphertext, derivedParams.key, cfg);

	            return plaintext;
	        }
	    });
	}());


}));

/***/ }),
/* 16 */
/***/ (function(module, exports) {

module.exports = function (it) {
  if (typeof it != 'function') throw TypeError(it + ' is not a function!');
  return it;
};


/***/ }),
/* 17 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var elliptic = exports;

elliptic.version = __webpack_require__(266).version;
elliptic.utils = __webpack_require__(267);
elliptic.rand = __webpack_require__(166);
elliptic.curve = __webpack_require__(80);
elliptic.curves = __webpack_require__(272);

// Protocols
elliptic.ec = __webpack_require__(280);
elliptic.eddsa = __webpack_require__(284);


/***/ }),
/* 18 */
/***/ (function(module, exports) {

var hasOwnProperty = {}.hasOwnProperty;
module.exports = function (it, key) {
  return hasOwnProperty.call(it, key);
};


/***/ }),
/* 19 */
/***/ (function(module, exports, __webpack_require__) {

var dP = __webpack_require__(11);
var createDesc = __webpack_require__(46);
module.exports = __webpack_require__(10) ? function (object, key, value) {
  return dP.f(object, key, createDesc(1, value));
} : function (object, key, value) {
  object[key] = value;
  return object;
};


/***/ }),
/* 20 */
/***/ (function(module, exports, __webpack_require__) {

var global = __webpack_require__(3);
var hide = __webpack_require__(19);
var has = __webpack_require__(18);
var SRC = __webpack_require__(47)('src');
var TO_STRING = 'toString';
var $toString = Function[TO_STRING];
var TPL = ('' + $toString).split(TO_STRING);

__webpack_require__(30).inspectSource = function (it) {
  return $toString.call(it);
};

(module.exports = function (O, key, val, safe) {
  var isFunction = typeof val == 'function';
  if (isFunction) has(val, 'name') || hide(val, 'name', key);
  if (O[key] === val) return;
  if (isFunction) has(val, SRC) || hide(val, SRC, O[key] ? '' + O[key] : TPL.join(String(key)));
  if (O === global) {
    O[key] = val;
  } else if (!safe) {
    delete O[key];
    hide(O, key, val);
  } else if (O[key]) {
    O[key] = val;
  } else {
    hide(O, key, val);
  }
// add fake Function#toString for correct work wrapped methods / constructors with methods like LoDash isNative
})(Function.prototype, TO_STRING, function toString() {
  return typeof this == 'function' && this[SRC] || $toString.call(this);
});


/***/ }),
/* 21 */
/***/ (function(module, exports, __webpack_require__) {

var $export = __webpack_require__(0);
var fails = __webpack_require__(5);
var defined = __webpack_require__(32);
var quot = /"/g;
// B.2.3.2.1 CreateHTML(string, tag, attribute, value)
var createHTML = function (string, tag, attribute, value) {
  var S = String(defined(string));
  var p1 = '<' + tag;
  if (attribute !== '') p1 += ' ' + attribute + '="' + String(value).replace(quot, '&quot;') + '"';
  return p1 + '>' + S + '</' + tag + '>';
};
module.exports = function (NAME, exec) {
  var O = {};
  O[NAME] = exec(createHTML);
  $export($export.P + $export.F * fails(function () {
    var test = ''[NAME]('"');
    return test !== test.toLowerCase() || test.split('"').length > 3;
  }), 'String', O);
};


/***/ }),
/* 22 */
/***/ (function(module, exports) {

module.exports = assert;

function assert(val, msg) {
  if (!val)
    throw new Error(msg || 'Assertion failed');
}

assert.equal = function assertEqual(l, r, msg) {
  if (l != r)
    throw new Error(msg || ('Assertion failed: ' + l + ' != ' + r));
};


/***/ }),
/* 23 */
/***/ (function(module, exports, __webpack_require__) {

// to indexed object, toObject with fallback for non-array-like ES3 strings
var IObject = __webpack_require__(73);
var defined = __webpack_require__(32);
module.exports = function (it) {
  return IObject(defined(it));
};


/***/ }),
/* 24 */
/***/ (function(module, exports, __webpack_require__) {

var pIE = __webpack_require__(74);
var createDesc = __webpack_require__(46);
var toIObject = __webpack_require__(23);
var toPrimitive = __webpack_require__(31);
var has = __webpack_require__(18);
var IE8_DOM_DEFINE = __webpack_require__(179);
var gOPD = Object.getOwnPropertyDescriptor;

exports.f = __webpack_require__(10) ? gOPD : function getOwnPropertyDescriptor(O, P) {
  O = toIObject(O);
  P = toPrimitive(P, true);
  if (IE8_DOM_DEFINE) try {
    return gOPD(O, P);
  } catch (e) { /* empty */ }
  if (has(O, P)) return createDesc(!pIE.f.call(O, P), O[P]);
};


/***/ }),
/* 25 */
/***/ (function(module, exports, __webpack_require__) {

// 19.1.2.9 / 15.2.3.2 Object.getPrototypeOf(O)
var has = __webpack_require__(18);
var toObject = __webpack_require__(14);
var IE_PROTO = __webpack_require__(115)('IE_PROTO');
var ObjectProto = Object.prototype;

module.exports = Object.getPrototypeOf || function (O) {
  O = toObject(O);
  if (has(O, IE_PROTO)) return O[IE_PROTO];
  if (typeof O.constructor == 'function' && O instanceof O.constructor) {
    return O.constructor.prototype;
  } return O instanceof Object ? ObjectProto : null;
};


/***/ }),
/* 26 */
/***/ (function(module, exports, __webpack_require__) {

// optional / simple context binding
var aFunction = __webpack_require__(16);
module.exports = function (fn, that, length) {
  aFunction(fn);
  if (that === undefined) return fn;
  switch (length) {
    case 1: return function (a) {
      return fn.call(that, a);
    };
    case 2: return function (a, b) {
      return fn.call(that, a, b);
    };
    case 3: return function (a, b, c) {
      return fn.call(that, a, b, c);
    };
  }
  return function (/* ...args */) {
    return fn.apply(that, arguments);
  };
};


/***/ }),
/* 27 */
/***/ (function(module, exports) {

var toString = {}.toString;

module.exports = function (it) {
  return toString.call(it).slice(8, -1);
};


/***/ }),
/* 28 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var fails = __webpack_require__(5);

module.exports = function (method, arg) {
  return !!method && fails(function () {
    // eslint-disable-next-line no-useless-call
    arg ? method.call(null, function () { /* empty */ }, 1) : method.call(null);
  });
};


/***/ }),
/* 29 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var assert = __webpack_require__(22);
var inherits = __webpack_require__(1);

exports.inherits = inherits;

function toArray(msg, enc) {
  if (Array.isArray(msg))
    return msg.slice();
  if (!msg)
    return [];
  var res = [];
  if (typeof msg === 'string') {
    if (!enc) {
      for (var i = 0; i < msg.length; i++) {
        var c = msg.charCodeAt(i);
        var hi = c >> 8;
        var lo = c & 0xff;
        if (hi)
          res.push(hi, lo);
        else
          res.push(lo);
      }
    } else if (enc === 'hex') {
      msg = msg.replace(/[^a-z0-9]+/ig, '');
      if (msg.length % 2 !== 0)
        msg = '0' + msg;
      for (i = 0; i < msg.length; i += 2)
        res.push(parseInt(msg[i] + msg[i + 1], 16));
    }
  } else {
    for (i = 0; i < msg.length; i++)
      res[i] = msg[i] | 0;
  }
  return res;
}
exports.toArray = toArray;

function toHex(msg) {
  var res = '';
  for (var i = 0; i < msg.length; i++)
    res += zero2(msg[i].toString(16));
  return res;
}
exports.toHex = toHex;

function htonl(w) {
  var res = (w >>> 24) |
            ((w >>> 8) & 0xff00) |
            ((w << 8) & 0xff0000) |
            ((w & 0xff) << 24);
  return res >>> 0;
}
exports.htonl = htonl;

function toHex32(msg, endian) {
  var res = '';
  for (var i = 0; i < msg.length; i++) {
    var w = msg[i];
    if (endian === 'little')
      w = htonl(w);
    res += zero8(w.toString(16));
  }
  return res;
}
exports.toHex32 = toHex32;

function zero2(word) {
  if (word.length === 1)
    return '0' + word;
  else
    return word;
}
exports.zero2 = zero2;

function zero8(word) {
  if (word.length === 7)
    return '0' + word;
  else if (word.length === 6)
    return '00' + word;
  else if (word.length === 5)
    return '000' + word;
  else if (word.length === 4)
    return '0000' + word;
  else if (word.length === 3)
    return '00000' + word;
  else if (word.length === 2)
    return '000000' + word;
  else if (word.length === 1)
    return '0000000' + word;
  else
    return word;
}
exports.zero8 = zero8;

function join32(msg, start, end, endian) {
  var len = end - start;
  assert(len % 4 === 0);
  var res = new Array(len / 4);
  for (var i = 0, k = start; i < res.length; i++, k += 4) {
    var w;
    if (endian === 'big')
      w = (msg[k] << 24) | (msg[k + 1] << 16) | (msg[k + 2] << 8) | msg[k + 3];
    else
      w = (msg[k + 3] << 24) | (msg[k + 2] << 16) | (msg[k + 1] << 8) | msg[k];
    res[i] = w >>> 0;
  }
  return res;
}
exports.join32 = join32;

function split32(msg, endian) {
  var res = new Array(msg.length * 4);
  for (var i = 0, k = 0; i < msg.length; i++, k += 4) {
    var m = msg[i];
    if (endian === 'big') {
      res[k] = m >>> 24;
      res[k + 1] = (m >>> 16) & 0xff;
      res[k + 2] = (m >>> 8) & 0xff;
      res[k + 3] = m & 0xff;
    } else {
      res[k + 3] = m >>> 24;
      res[k + 2] = (m >>> 16) & 0xff;
      res[k + 1] = (m >>> 8) & 0xff;
      res[k] = m & 0xff;
    }
  }
  return res;
}
exports.split32 = split32;

function rotr32(w, b) {
  return (w >>> b) | (w << (32 - b));
}
exports.rotr32 = rotr32;

function rotl32(w, b) {
  return (w << b) | (w >>> (32 - b));
}
exports.rotl32 = rotl32;

function sum32(a, b) {
  return (a + b) >>> 0;
}
exports.sum32 = sum32;

function sum32_3(a, b, c) {
  return (a + b + c) >>> 0;
}
exports.sum32_3 = sum32_3;

function sum32_4(a, b, c, d) {
  return (a + b + c + d) >>> 0;
}
exports.sum32_4 = sum32_4;

function sum32_5(a, b, c, d, e) {
  return (a + b + c + d + e) >>> 0;
}
exports.sum32_5 = sum32_5;

function sum64(buf, pos, ah, al) {
  var bh = buf[pos];
  var bl = buf[pos + 1];

  var lo = (al + bl) >>> 0;
  var hi = (lo < al ? 1 : 0) + ah + bh;
  buf[pos] = hi >>> 0;
  buf[pos + 1] = lo;
}
exports.sum64 = sum64;

function sum64_hi(ah, al, bh, bl) {
  var lo = (al + bl) >>> 0;
  var hi = (lo < al ? 1 : 0) + ah + bh;
  return hi >>> 0;
}
exports.sum64_hi = sum64_hi;

function sum64_lo(ah, al, bh, bl) {
  var lo = al + bl;
  return lo >>> 0;
}
exports.sum64_lo = sum64_lo;

function sum64_4_hi(ah, al, bh, bl, ch, cl, dh, dl) {
  var carry = 0;
  var lo = al;
  lo = (lo + bl) >>> 0;
  carry += lo < al ? 1 : 0;
  lo = (lo + cl) >>> 0;
  carry += lo < cl ? 1 : 0;
  lo = (lo + dl) >>> 0;
  carry += lo < dl ? 1 : 0;

  var hi = ah + bh + ch + dh + carry;
  return hi >>> 0;
}
exports.sum64_4_hi = sum64_4_hi;

function sum64_4_lo(ah, al, bh, bl, ch, cl, dh, dl) {
  var lo = al + bl + cl + dl;
  return lo >>> 0;
}
exports.sum64_4_lo = sum64_4_lo;

function sum64_5_hi(ah, al, bh, bl, ch, cl, dh, dl, eh, el) {
  var carry = 0;
  var lo = al;
  lo = (lo + bl) >>> 0;
  carry += lo < al ? 1 : 0;
  lo = (lo + cl) >>> 0;
  carry += lo < cl ? 1 : 0;
  lo = (lo + dl) >>> 0;
  carry += lo < dl ? 1 : 0;
  lo = (lo + el) >>> 0;
  carry += lo < el ? 1 : 0;

  var hi = ah + bh + ch + dh + eh + carry;
  return hi >>> 0;
}
exports.sum64_5_hi = sum64_5_hi;

function sum64_5_lo(ah, al, bh, bl, ch, cl, dh, dl, eh, el) {
  var lo = al + bl + cl + dl + el;

  return lo >>> 0;
}
exports.sum64_5_lo = sum64_5_lo;

function rotr64_hi(ah, al, num) {
  var r = (al << (32 - num)) | (ah >>> num);
  return r >>> 0;
}
exports.rotr64_hi = rotr64_hi;

function rotr64_lo(ah, al, num) {
  var r = (ah << (32 - num)) | (al >>> num);
  return r >>> 0;
}
exports.rotr64_lo = rotr64_lo;

function shr64_hi(ah, al, num) {
  return ah >>> num;
}
exports.shr64_hi = shr64_hi;

function shr64_lo(ah, al, num) {
  var r = (ah << (32 - num)) | (al >>> num);
  return r >>> 0;
}
exports.shr64_lo = shr64_lo;


/***/ }),
/* 30 */
/***/ (function(module, exports) {

var core = module.exports = { version: '2.5.1' };
if (typeof __e == 'number') __e = core; // eslint-disable-line no-undef


/***/ }),
/* 31 */
/***/ (function(module, exports, __webpack_require__) {

// 7.1.1 ToPrimitive(input [, PreferredType])
var isObject = __webpack_require__(7);
// instead of the ES6 spec version, we didn't implement @@toPrimitive case
// and the second argument - flag - preferred type is a string
module.exports = function (it, S) {
  if (!isObject(it)) return it;
  var fn, val;
  if (S && typeof (fn = it.toString) == 'function' && !isObject(val = fn.call(it))) return val;
  if (typeof (fn = it.valueOf) == 'function' && !isObject(val = fn.call(it))) return val;
  if (!S && typeof (fn = it.toString) == 'function' && !isObject(val = fn.call(it))) return val;
  throw TypeError("Can't convert object to primitive value");
};


/***/ }),
/* 32 */
/***/ (function(module, exports) {

// 7.2.1 RequireObjectCoercible(argument)
module.exports = function (it) {
  if (it == undefined) throw TypeError("Can't call method on  " + it);
  return it;
};


/***/ }),
/* 33 */
/***/ (function(module, exports) {

// 7.1.4 ToInteger
var ceil = Math.ceil;
var floor = Math.floor;
module.exports = function (it) {
  return isNaN(it = +it) ? 0 : (it > 0 ? floor : ceil)(it);
};


/***/ }),
/* 34 */
/***/ (function(module, exports, __webpack_require__) {

// most Object methods by ES6 should accept primitives
var $export = __webpack_require__(0);
var core = __webpack_require__(30);
var fails = __webpack_require__(5);
module.exports = function (KEY, exec) {
  var fn = (core.Object || {})[KEY] || Object[KEY];
  var exp = {};
  exp[KEY] = exec(fn);
  $export($export.S + $export.F * fails(function () { fn(1); }), 'Object', exp);
};


/***/ }),
/* 35 */
/***/ (function(module, exports, __webpack_require__) {

// 0 -> Array#forEach
// 1 -> Array#map
// 2 -> Array#filter
// 3 -> Array#some
// 4 -> Array#every
// 5 -> Array#find
// 6 -> Array#findIndex
var ctx = __webpack_require__(26);
var IObject = __webpack_require__(73);
var toObject = __webpack_require__(14);
var toLength = __webpack_require__(12);
var asc = __webpack_require__(132);
module.exports = function (TYPE, $create) {
  var IS_MAP = TYPE == 1;
  var IS_FILTER = TYPE == 2;
  var IS_SOME = TYPE == 3;
  var IS_EVERY = TYPE == 4;
  var IS_FIND_INDEX = TYPE == 6;
  var NO_HOLES = TYPE == 5 || IS_FIND_INDEX;
  var create = $create || asc;
  return function ($this, callbackfn, that) {
    var O = toObject($this);
    var self = IObject(O);
    var f = ctx(callbackfn, that, 3);
    var length = toLength(self.length);
    var index = 0;
    var result = IS_MAP ? create($this, length) : IS_FILTER ? create($this, 0) : undefined;
    var val, res;
    for (;length > index; index++) if (NO_HOLES || index in self) {
      val = self[index];
      res = f(val, index, O);
      if (TYPE) {
        if (IS_MAP) result[index] = res;   // map
        else if (res) switch (TYPE) {
          case 3: return true;             // some
          case 5: return val;              // find
          case 6: return index;            // findIndex
          case 2: result.push(val);        // filter
        } else if (IS_EVERY) return false; // every
      }
    }
    return IS_FIND_INDEX ? -1 : IS_SOME || IS_EVERY ? IS_EVERY : result;
  };
};


/***/ }),
/* 36 */
/***/ (function(module, exports) {

/**
 *
 *   Conversion functions
 *
 **/

var RADIX = 3;
var RADIX_BYTES = 256;
var MAX_TRIT_VALUE = 1;
var MIN_TRIT_VALUE = -1;
var BYTE_HASH_LENGTH = 48;

// All possible tryte values
var trytesAlphabet = "9ABCDEFGHIJKLMNOPQRSTUVWXYZ"

// map of all trits representations
var trytesTrits = [
    [ 0,  0,  0],
    [ 1,  0,  0],
    [-1,  1,  0],
    [ 0,  1,  0],
    [ 1,  1,  0],
    [-1, -1,  1],
    [ 0, -1,  1],
    [ 1, -1,  1],
    [-1,  0,  1],
    [ 0,  0,  1],
    [ 1,  0,  1],
    [-1,  1,  1],
    [ 0,  1,  1],
    [ 1,  1,  1],
    [-1, -1, -1],
    [ 0, -1, -1],
    [ 1, -1, -1],
    [-1,  0, -1],
    [ 0,  0, -1],
    [ 1,  0, -1],
    [-1,  1, -1],
    [ 0,  1, -1],
    [ 1,  1, -1],
    [-1, -1,  0],
    [ 0, -1,  0],
    [ 1, -1,  0],
    [-1,  0,  0]
];

/**
 *   Converts trytes into trits
 *
 *   @method trits
 *   @param {String|Int} input Tryte value to be converted. Can either be string or int
 *   @param {Array} state (optional) state to be modified
 *   @returns {Array} trits
 **/
var trits = function( input, state ) {

    var trits = state || [];

    if (Number.isInteger(input)) {

        var absoluteValue = input < 0 ? -input : input;

        while (absoluteValue > 0) {

            var remainder = absoluteValue % 3;
            absoluteValue = Math.floor(absoluteValue / 3);

            if (remainder > 1) {
                remainder = -1;
                absoluteValue++;
            }

            trits[trits.length] = remainder;
        }
        if (input < 0) {

            for (var i = 0; i < trits.length; i++) {

                trits[i] = -trits[i];
            }
        }
    } else {

        for (var i = 0; i < input.length; i++) {

            var index = trytesAlphabet.indexOf(input.charAt(i));
            trits[i * 3] = trytesTrits[index][0];
            trits[i * 3 + 1] = trytesTrits[index][1];
            trits[i * 3 + 2] = trytesTrits[index][2];
        }
    }

    return trits;
}

/**
 *   Converts trits into trytes
 *
 *   @method trytes
 *   @param {Array} trits
 *   @returns {String} trytes
 **/
var trytes = function(trits) {

    var trytes = "";

    for ( var i = 0; i < trits.length; i += 3 ) {

        // Iterate over all possible tryte values to find correct trit representation
        for ( var j = 0; j < trytesAlphabet.length; j++ ) {

            if ( trytesTrits[ j ][ 0 ] === trits[ i ] && trytesTrits[ j ][ 1 ] === trits[ i + 1 ] && trytesTrits[ j ][ 2 ] === trits[ i + 2 ] ) {

                trytes += trytesAlphabet.charAt( j );
                break;

            }

        }

    }

    return trytes;
}

/**
 *   Converts trits into an integer value
 *
 *   @method value
 *   @param {Array} trits
 *   @returns {int} value
 **/
var value = function(trits) {

    var returnValue = 0;

    for ( var i = trits.length; i-- > 0; ) {

        returnValue = returnValue * 3 + trits[ i ];
    }

    return returnValue;
}

/**
 *   Converts an integer value to trits
 *
 *   @method value
 *   @param {Int} value
 *   @returns {Array} trits
 **/
var fromValue = function(value) {

    var destination = [];
    var absoluteValue = value < 0 ? -value : value;
    var i = 0;

    while( absoluteValue > 0 ) {

        var remainder = ( absoluteValue % RADIX );
        absoluteValue = Math.floor( absoluteValue / RADIX );

        if ( remainder > MAX_TRIT_VALUE ) {

            remainder = MIN_TRIT_VALUE;
            absoluteValue++;

        }

        destination[ i ] = remainder;
        i++;

    }

    if ( value < 0 ) {

        for ( var j = 0; j < destination.length; j++ ) {

            // switch values
            destination[ j ] = destination[ j ] === 0 ? 0: -destination[ j ];

        }

    }

    return destination;
}

module.exports = {
    trits           : trits,
    trytes          : trytes,
    value           : value,
    fromValue       : fromValue
};


/***/ }),
/* 37 */
/***/ (function(module, exports) {

var g;

// This works in non-strict mode
g = (function() {
	return this;
})();

try {
	// This works if eval is allowed (see CSP)
	g = g || Function("return this")() || (1,eval)("this");
} catch(e) {
	// This works if the window reference is available
	if(typeof window === "object")
		g = window;
}

// g can still be undefined, but nothing to do about it...
// We return undefined, instead of nothing here, so it's
// easier to handle this case. if(!global) { ...}

module.exports = g;


/***/ }),
/* 38 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

if (__webpack_require__(10)) {
  var LIBRARY = __webpack_require__(48);
  var global = __webpack_require__(3);
  var fails = __webpack_require__(5);
  var $export = __webpack_require__(0);
  var $typed = __webpack_require__(92);
  var $buffer = __webpack_require__(138);
  var ctx = __webpack_require__(26);
  var anInstance = __webpack_require__(54);
  var propertyDesc = __webpack_require__(46);
  var hide = __webpack_require__(19);
  var redefineAll = __webpack_require__(56);
  var toInteger = __webpack_require__(33);
  var toLength = __webpack_require__(12);
  var toIndex = __webpack_require__(205);
  var toAbsoluteIndex = __webpack_require__(50);
  var toPrimitive = __webpack_require__(31);
  var has = __webpack_require__(18);
  var classof = __webpack_require__(75);
  var isObject = __webpack_require__(7);
  var toObject = __webpack_require__(14);
  var isArrayIter = __webpack_require__(129);
  var create = __webpack_require__(51);
  var getPrototypeOf = __webpack_require__(25);
  var gOPN = __webpack_require__(52).f;
  var getIterFn = __webpack_require__(131);
  var uid = __webpack_require__(47);
  var wks = __webpack_require__(9);
  var createArrayMethod = __webpack_require__(35);
  var createArrayIncludes = __webpack_require__(83);
  var speciesConstructor = __webpack_require__(90);
  var ArrayIterators = __webpack_require__(134);
  var Iterators = __webpack_require__(61);
  var $iterDetect = __webpack_require__(87);
  var setSpecies = __webpack_require__(53);
  var arrayFill = __webpack_require__(133);
  var arrayCopyWithin = __webpack_require__(195);
  var $DP = __webpack_require__(11);
  var $GOPD = __webpack_require__(24);
  var dP = $DP.f;
  var gOPD = $GOPD.f;
  var RangeError = global.RangeError;
  var TypeError = global.TypeError;
  var Uint8Array = global.Uint8Array;
  var ARRAY_BUFFER = 'ArrayBuffer';
  var SHARED_BUFFER = 'Shared' + ARRAY_BUFFER;
  var BYTES_PER_ELEMENT = 'BYTES_PER_ELEMENT';
  var PROTOTYPE = 'prototype';
  var ArrayProto = Array[PROTOTYPE];
  var $ArrayBuffer = $buffer.ArrayBuffer;
  var $DataView = $buffer.DataView;
  var arrayForEach = createArrayMethod(0);
  var arrayFilter = createArrayMethod(2);
  var arraySome = createArrayMethod(3);
  var arrayEvery = createArrayMethod(4);
  var arrayFind = createArrayMethod(5);
  var arrayFindIndex = createArrayMethod(6);
  var arrayIncludes = createArrayIncludes(true);
  var arrayIndexOf = createArrayIncludes(false);
  var arrayValues = ArrayIterators.values;
  var arrayKeys = ArrayIterators.keys;
  var arrayEntries = ArrayIterators.entries;
  var arrayLastIndexOf = ArrayProto.lastIndexOf;
  var arrayReduce = ArrayProto.reduce;
  var arrayReduceRight = ArrayProto.reduceRight;
  var arrayJoin = ArrayProto.join;
  var arraySort = ArrayProto.sort;
  var arraySlice = ArrayProto.slice;
  var arrayToString = ArrayProto.toString;
  var arrayToLocaleString = ArrayProto.toLocaleString;
  var ITERATOR = wks('iterator');
  var TAG = wks('toStringTag');
  var TYPED_CONSTRUCTOR = uid('typed_constructor');
  var DEF_CONSTRUCTOR = uid('def_constructor');
  var ALL_CONSTRUCTORS = $typed.CONSTR;
  var TYPED_ARRAY = $typed.TYPED;
  var VIEW = $typed.VIEW;
  var WRONG_LENGTH = 'Wrong length!';

  var $map = createArrayMethod(1, function (O, length) {
    return allocate(speciesConstructor(O, O[DEF_CONSTRUCTOR]), length);
  });

  var LITTLE_ENDIAN = fails(function () {
    // eslint-disable-next-line no-undef
    return new Uint8Array(new Uint16Array([1]).buffer)[0] === 1;
  });

  var FORCED_SET = !!Uint8Array && !!Uint8Array[PROTOTYPE].set && fails(function () {
    new Uint8Array(1).set({});
  });

  var toOffset = function (it, BYTES) {
    var offset = toInteger(it);
    if (offset < 0 || offset % BYTES) throw RangeError('Wrong offset!');
    return offset;
  };

  var validate = function (it) {
    if (isObject(it) && TYPED_ARRAY in it) return it;
    throw TypeError(it + ' is not a typed array!');
  };

  var allocate = function (C, length) {
    if (!(isObject(C) && TYPED_CONSTRUCTOR in C)) {
      throw TypeError('It is not a typed array constructor!');
    } return new C(length);
  };

  var speciesFromList = function (O, list) {
    return fromList(speciesConstructor(O, O[DEF_CONSTRUCTOR]), list);
  };

  var fromList = function (C, list) {
    var index = 0;
    var length = list.length;
    var result = allocate(C, length);
    while (length > index) result[index] = list[index++];
    return result;
  };

  var addGetter = function (it, key, internal) {
    dP(it, key, { get: function () { return this._d[internal]; } });
  };

  var $from = function from(source /* , mapfn, thisArg */) {
    var O = toObject(source);
    var aLen = arguments.length;
    var mapfn = aLen > 1 ? arguments[1] : undefined;
    var mapping = mapfn !== undefined;
    var iterFn = getIterFn(O);
    var i, length, values, result, step, iterator;
    if (iterFn != undefined && !isArrayIter(iterFn)) {
      for (iterator = iterFn.call(O), values = [], i = 0; !(step = iterator.next()).done; i++) {
        values.push(step.value);
      } O = values;
    }
    if (mapping && aLen > 2) mapfn = ctx(mapfn, arguments[2], 2);
    for (i = 0, length = toLength(O.length), result = allocate(this, length); length > i; i++) {
      result[i] = mapping ? mapfn(O[i], i) : O[i];
    }
    return result;
  };

  var $of = function of(/* ...items */) {
    var index = 0;
    var length = arguments.length;
    var result = allocate(this, length);
    while (length > index) result[index] = arguments[index++];
    return result;
  };

  // iOS Safari 6.x fails here
  var TO_LOCALE_BUG = !!Uint8Array && fails(function () { arrayToLocaleString.call(new Uint8Array(1)); });

  var $toLocaleString = function toLocaleString() {
    return arrayToLocaleString.apply(TO_LOCALE_BUG ? arraySlice.call(validate(this)) : validate(this), arguments);
  };

  var proto = {
    copyWithin: function copyWithin(target, start /* , end */) {
      return arrayCopyWithin.call(validate(this), target, start, arguments.length > 2 ? arguments[2] : undefined);
    },
    every: function every(callbackfn /* , thisArg */) {
      return arrayEvery(validate(this), callbackfn, arguments.length > 1 ? arguments[1] : undefined);
    },
    fill: function fill(value /* , start, end */) { // eslint-disable-line no-unused-vars
      return arrayFill.apply(validate(this), arguments);
    },
    filter: function filter(callbackfn /* , thisArg */) {
      return speciesFromList(this, arrayFilter(validate(this), callbackfn,
        arguments.length > 1 ? arguments[1] : undefined));
    },
    find: function find(predicate /* , thisArg */) {
      return arrayFind(validate(this), predicate, arguments.length > 1 ? arguments[1] : undefined);
    },
    findIndex: function findIndex(predicate /* , thisArg */) {
      return arrayFindIndex(validate(this), predicate, arguments.length > 1 ? arguments[1] : undefined);
    },
    forEach: function forEach(callbackfn /* , thisArg */) {
      arrayForEach(validate(this), callbackfn, arguments.length > 1 ? arguments[1] : undefined);
    },
    indexOf: function indexOf(searchElement /* , fromIndex */) {
      return arrayIndexOf(validate(this), searchElement, arguments.length > 1 ? arguments[1] : undefined);
    },
    includes: function includes(searchElement /* , fromIndex */) {
      return arrayIncludes(validate(this), searchElement, arguments.length > 1 ? arguments[1] : undefined);
    },
    join: function join(separator) { // eslint-disable-line no-unused-vars
      return arrayJoin.apply(validate(this), arguments);
    },
    lastIndexOf: function lastIndexOf(searchElement /* , fromIndex */) { // eslint-disable-line no-unused-vars
      return arrayLastIndexOf.apply(validate(this), arguments);
    },
    map: function map(mapfn /* , thisArg */) {
      return $map(validate(this), mapfn, arguments.length > 1 ? arguments[1] : undefined);
    },
    reduce: function reduce(callbackfn /* , initialValue */) { // eslint-disable-line no-unused-vars
      return arrayReduce.apply(validate(this), arguments);
    },
    reduceRight: function reduceRight(callbackfn /* , initialValue */) { // eslint-disable-line no-unused-vars
      return arrayReduceRight.apply(validate(this), arguments);
    },
    reverse: function reverse() {
      var that = this;
      var length = validate(that).length;
      var middle = Math.floor(length / 2);
      var index = 0;
      var value;
      while (index < middle) {
        value = that[index];
        that[index++] = that[--length];
        that[length] = value;
      } return that;
    },
    some: function some(callbackfn /* , thisArg */) {
      return arraySome(validate(this), callbackfn, arguments.length > 1 ? arguments[1] : undefined);
    },
    sort: function sort(comparefn) {
      return arraySort.call(validate(this), comparefn);
    },
    subarray: function subarray(begin, end) {
      var O = validate(this);
      var length = O.length;
      var $begin = toAbsoluteIndex(begin, length);
      return new (speciesConstructor(O, O[DEF_CONSTRUCTOR]))(
        O.buffer,
        O.byteOffset + $begin * O.BYTES_PER_ELEMENT,
        toLength((end === undefined ? length : toAbsoluteIndex(end, length)) - $begin)
      );
    }
  };

  var $slice = function slice(start, end) {
    return speciesFromList(this, arraySlice.call(validate(this), start, end));
  };

  var $set = function set(arrayLike /* , offset */) {
    validate(this);
    var offset = toOffset(arguments[1], 1);
    var length = this.length;
    var src = toObject(arrayLike);
    var len = toLength(src.length);
    var index = 0;
    if (len + offset > length) throw RangeError(WRONG_LENGTH);
    while (index < len) this[offset + index] = src[index++];
  };

  var $iterators = {
    entries: function entries() {
      return arrayEntries.call(validate(this));
    },
    keys: function keys() {
      return arrayKeys.call(validate(this));
    },
    values: function values() {
      return arrayValues.call(validate(this));
    }
  };

  var isTAIndex = function (target, key) {
    return isObject(target)
      && target[TYPED_ARRAY]
      && typeof key != 'symbol'
      && key in target
      && String(+key) == String(key);
  };
  var $getDesc = function getOwnPropertyDescriptor(target, key) {
    return isTAIndex(target, key = toPrimitive(key, true))
      ? propertyDesc(2, target[key])
      : gOPD(target, key);
  };
  var $setDesc = function defineProperty(target, key, desc) {
    if (isTAIndex(target, key = toPrimitive(key, true))
      && isObject(desc)
      && has(desc, 'value')
      && !has(desc, 'get')
      && !has(desc, 'set')
      // TODO: add validation descriptor w/o calling accessors
      && !desc.configurable
      && (!has(desc, 'writable') || desc.writable)
      && (!has(desc, 'enumerable') || desc.enumerable)
    ) {
      target[key] = desc.value;
      return target;
    } return dP(target, key, desc);
  };

  if (!ALL_CONSTRUCTORS) {
    $GOPD.f = $getDesc;
    $DP.f = $setDesc;
  }

  $export($export.S + $export.F * !ALL_CONSTRUCTORS, 'Object', {
    getOwnPropertyDescriptor: $getDesc,
    defineProperty: $setDesc
  });

  if (fails(function () { arrayToString.call({}); })) {
    arrayToString = arrayToLocaleString = function toString() {
      return arrayJoin.call(this);
    };
  }

  var $TypedArrayPrototype$ = redefineAll({}, proto);
  redefineAll($TypedArrayPrototype$, $iterators);
  hide($TypedArrayPrototype$, ITERATOR, $iterators.values);
  redefineAll($TypedArrayPrototype$, {
    slice: $slice,
    set: $set,
    constructor: function () { /* noop */ },
    toString: arrayToString,
    toLocaleString: $toLocaleString
  });
  addGetter($TypedArrayPrototype$, 'buffer', 'b');
  addGetter($TypedArrayPrototype$, 'byteOffset', 'o');
  addGetter($TypedArrayPrototype$, 'byteLength', 'l');
  addGetter($TypedArrayPrototype$, 'length', 'e');
  dP($TypedArrayPrototype$, TAG, {
    get: function () { return this[TYPED_ARRAY]; }
  });

  // eslint-disable-next-line max-statements
  module.exports = function (KEY, BYTES, wrapper, CLAMPED) {
    CLAMPED = !!CLAMPED;
    var NAME = KEY + (CLAMPED ? 'Clamped' : '') + 'Array';
    var GETTER = 'get' + KEY;
    var SETTER = 'set' + KEY;
    var TypedArray = global[NAME];
    var Base = TypedArray || {};
    var TAC = TypedArray && getPrototypeOf(TypedArray);
    var FORCED = !TypedArray || !$typed.ABV;
    var O = {};
    var TypedArrayPrototype = TypedArray && TypedArray[PROTOTYPE];
    var getter = function (that, index) {
      var data = that._d;
      return data.v[GETTER](index * BYTES + data.o, LITTLE_ENDIAN);
    };
    var setter = function (that, index, value) {
      var data = that._d;
      if (CLAMPED) value = (value = Math.round(value)) < 0 ? 0 : value > 0xff ? 0xff : value & 0xff;
      data.v[SETTER](index * BYTES + data.o, value, LITTLE_ENDIAN);
    };
    var addElement = function (that, index) {
      dP(that, index, {
        get: function () {
          return getter(this, index);
        },
        set: function (value) {
          return setter(this, index, value);
        },
        enumerable: true
      });
    };
    if (FORCED) {
      TypedArray = wrapper(function (that, data, $offset, $length) {
        anInstance(that, TypedArray, NAME, '_d');
        var index = 0;
        var offset = 0;
        var buffer, byteLength, length, klass;
        if (!isObject(data)) {
          length = toIndex(data);
          byteLength = length * BYTES;
          buffer = new $ArrayBuffer(byteLength);
        } else if (data instanceof $ArrayBuffer || (klass = classof(data)) == ARRAY_BUFFER || klass == SHARED_BUFFER) {
          buffer = data;
          offset = toOffset($offset, BYTES);
          var $len = data.byteLength;
          if ($length === undefined) {
            if ($len % BYTES) throw RangeError(WRONG_LENGTH);
            byteLength = $len - offset;
            if (byteLength < 0) throw RangeError(WRONG_LENGTH);
          } else {
            byteLength = toLength($length) * BYTES;
            if (byteLength + offset > $len) throw RangeError(WRONG_LENGTH);
          }
          length = byteLength / BYTES;
        } else if (TYPED_ARRAY in data) {
          return fromList(TypedArray, data);
        } else {
          return $from.call(TypedArray, data);
        }
        hide(that, '_d', {
          b: buffer,
          o: offset,
          l: byteLength,
          e: length,
          v: new $DataView(buffer)
        });
        while (index < length) addElement(that, index++);
      });
      TypedArrayPrototype = TypedArray[PROTOTYPE] = create($TypedArrayPrototype$);
      hide(TypedArrayPrototype, 'constructor', TypedArray);
    } else if (!fails(function () {
      TypedArray(1);
    }) || !fails(function () {
      new TypedArray(-1); // eslint-disable-line no-new
    }) || !$iterDetect(function (iter) {
      new TypedArray(); // eslint-disable-line no-new
      new TypedArray(null); // eslint-disable-line no-new
      new TypedArray(1.5); // eslint-disable-line no-new
      new TypedArray(iter); // eslint-disable-line no-new
    }, true)) {
      TypedArray = wrapper(function (that, data, $offset, $length) {
        anInstance(that, TypedArray, NAME);
        var klass;
        // `ws` module bug, temporarily remove validation length for Uint8Array
        // https://github.com/websockets/ws/pull/645
        if (!isObject(data)) return new Base(toIndex(data));
        if (data instanceof $ArrayBuffer || (klass = classof(data)) == ARRAY_BUFFER || klass == SHARED_BUFFER) {
          return $length !== undefined
            ? new Base(data, toOffset($offset, BYTES), $length)
            : $offset !== undefined
              ? new Base(data, toOffset($offset, BYTES))
              : new Base(data);
        }
        if (TYPED_ARRAY in data) return fromList(TypedArray, data);
        return $from.call(TypedArray, data);
      });
      arrayForEach(TAC !== Function.prototype ? gOPN(Base).concat(gOPN(TAC)) : gOPN(Base), function (key) {
        if (!(key in TypedArray)) hide(TypedArray, key, Base[key]);
      });
      TypedArray[PROTOTYPE] = TypedArrayPrototype;
      if (!LIBRARY) TypedArrayPrototype.constructor = TypedArray;
    }
    var $nativeIterator = TypedArrayPrototype[ITERATOR];
    var CORRECT_ITER_NAME = !!$nativeIterator
      && ($nativeIterator.name == 'values' || $nativeIterator.name == undefined);
    var $iterator = $iterators.values;
    hide(TypedArray, TYPED_CONSTRUCTOR, true);
    hide(TypedArrayPrototype, TYPED_ARRAY, NAME);
    hide(TypedArrayPrototype, VIEW, true);
    hide(TypedArrayPrototype, DEF_CONSTRUCTOR, TypedArray);

    if (CLAMPED ? new TypedArray(1)[TAG] != NAME : !(TAG in TypedArrayPrototype)) {
      dP(TypedArrayPrototype, TAG, {
        get: function () { return NAME; }
      });
    }

    O[NAME] = TypedArray;

    $export($export.G + $export.W + $export.F * (TypedArray != Base), O);

    $export($export.S, NAME, {
      BYTES_PER_ELEMENT: BYTES
    });

    $export($export.S + $export.F * fails(function () { Base.of.call(TypedArray, 1); }), NAME, {
      from: $from,
      of: $of
    });

    if (!(BYTES_PER_ELEMENT in TypedArrayPrototype)) hide(TypedArrayPrototype, BYTES_PER_ELEMENT, BYTES);

    $export($export.P, NAME, proto);

    setSpecies(NAME);

    $export($export.P + $export.F * FORCED_SET, NAME, { set: $set });

    $export($export.P + $export.F * !CORRECT_ITER_NAME, NAME, $iterators);

    if (!LIBRARY && TypedArrayPrototype.toString != arrayToString) TypedArrayPrototype.toString = arrayToString;

    $export($export.P + $export.F * fails(function () {
      new TypedArray(1).slice();
    }), NAME, { slice: $slice });

    $export($export.P + $export.F * (fails(function () {
      return [1, 2].toLocaleString() != new TypedArray([1, 2]).toLocaleString();
    }) || !fails(function () {
      TypedArrayPrototype.toLocaleString.call([1, 2]);
    })), NAME, { toLocaleString: $toLocaleString });

    Iterators[NAME] = CORRECT_ITER_NAME ? $nativeIterator : $iterator;
    if (!LIBRARY && !CORRECT_ITER_NAME) hide(TypedArrayPrototype, ITERATOR, $iterator);
  };
} else module.exports = function () { /* empty */ };


/***/ }),
/* 39 */
/***/ (function(module, exports, __webpack_require__) {

var Map = __webpack_require__(200);
var $export = __webpack_require__(0);
var shared = __webpack_require__(82)('metadata');
var store = shared.store || (shared.store = new (__webpack_require__(203))());

var getOrCreateMetadataMap = function (target, targetKey, create) {
  var targetMetadata = store.get(target);
  if (!targetMetadata) {
    if (!create) return undefined;
    store.set(target, targetMetadata = new Map());
  }
  var keyMetadata = targetMetadata.get(targetKey);
  if (!keyMetadata) {
    if (!create) return undefined;
    targetMetadata.set(targetKey, keyMetadata = new Map());
  } return keyMetadata;
};
var ordinaryHasOwnMetadata = function (MetadataKey, O, P) {
  var metadataMap = getOrCreateMetadataMap(O, P, false);
  return metadataMap === undefined ? false : metadataMap.has(MetadataKey);
};
var ordinaryGetOwnMetadata = function (MetadataKey, O, P) {
  var metadataMap = getOrCreateMetadataMap(O, P, false);
  return metadataMap === undefined ? undefined : metadataMap.get(MetadataKey);
};
var ordinaryDefineOwnMetadata = function (MetadataKey, MetadataValue, O, P) {
  getOrCreateMetadataMap(O, P, true).set(MetadataKey, MetadataValue);
};
var ordinaryOwnMetadataKeys = function (target, targetKey) {
  var metadataMap = getOrCreateMetadataMap(target, targetKey, false);
  var keys = [];
  if (metadataMap) metadataMap.forEach(function (_, key) { keys.push(key); });
  return keys;
};
var toMetaKey = function (it) {
  return it === undefined || typeof it == 'symbol' ? it : String(it);
};
var exp = function (O) {
  $export($export.S, 'Reflect', O);
};

module.exports = {
  store: store,
  map: getOrCreateMetadataMap,
  has: ordinaryHasOwnMetadata,
  get: ordinaryGetOwnMetadata,
  set: ordinaryDefineOwnMetadata,
  keys: ordinaryOwnMetadataKeys,
  key: toMetaKey,
  exp: exp
};


/***/ }),
/* 40 */
/***/ (function(module, exports, __webpack_require__) {

var Converter = __webpack_require__(36);

/**
**      Cryptographic related functions to IOTA's Curl (sponge function)
**/

var NUMBER_OF_ROUNDS = 81;
var HASH_LENGTH = 243;
var STATE_LENGTH = 3 * HASH_LENGTH;

function Curl(rounds) {
    if (rounds) {
      this.rounds = rounds;
    } else {
      this.rounds = NUMBER_OF_ROUNDS;
    }
    // truth table
    this.truthTable = [1, 0, -1, 2, 1, -1, 0, 2, -1, 1, 0];
}

Curl.HASH_LENGTH = HASH_LENGTH;

/**
*   Initializes the state with STATE_LENGTH trits
*
*   @method initialize
**/
Curl.prototype.initialize = function(state, length) {

    if (state) {

        this.state = state;

    } else {

        this.state = [];

        for (var i = 0; i < STATE_LENGTH; i++) {

            this.state[i] = 0;

        }
    }
}

/**
*   Sponge absorb function
*
*   @method absorb
**/
Curl.prototype.absorb = function(trits, offset, length) {

    do {

        var i = 0;
        var limit = (length < HASH_LENGTH ? length : HASH_LENGTH);

        while (i < limit) {

            this.state[i++] = trits[offset++];
        }

        this.transform();

    } while (( length -= HASH_LENGTH ) > 0)

}

/**
*   Sponge squeeze function
*
*   @method squeeze
**/
Curl.prototype.squeeze = function(trits, offset, length) {

    do {

        var i = 0;
        var limit = (length < HASH_LENGTH ? length : HASH_LENGTH);

        while (i < limit) {

            trits[offset++] = this.state[i++];
        }

        this.transform();

    } while (( length -= HASH_LENGTH ) > 0)
}

/**
*   Sponge transform function
*
*   @method transform
**/
Curl.prototype.transform = function() {

    var stateCopy = [], index = 0;

    for (var round = 0; round < this.rounds; round++) {

        stateCopy = this.state.slice();

        for (var i = 0; i < STATE_LENGTH; i++) {

            this.state[i] = this.truthTable[stateCopy[index] + (stateCopy[index += (index < 365 ? 364 : -365)] << 2) + 5];
        }
    }
}

module.exports = Curl


/***/ }),
/* 41 */
/***/ (function(module, exports) {

// shim for using process in browser
var process = module.exports = {};

// cached from whatever global is present so that test runners that stub it
// don't break things.  But we need to wrap it in a try catch in case it is
// wrapped in strict mode code which doesn't define any globals.  It's inside a
// function because try/catches deoptimize in certain engines.

var cachedSetTimeout;
var cachedClearTimeout;

function defaultSetTimout() {
    throw new Error('setTimeout has not been defined');
}
function defaultClearTimeout () {
    throw new Error('clearTimeout has not been defined');
}
(function () {
    try {
        if (typeof setTimeout === 'function') {
            cachedSetTimeout = setTimeout;
        } else {
            cachedSetTimeout = defaultSetTimout;
        }
    } catch (e) {
        cachedSetTimeout = defaultSetTimout;
    }
    try {
        if (typeof clearTimeout === 'function') {
            cachedClearTimeout = clearTimeout;
        } else {
            cachedClearTimeout = defaultClearTimeout;
        }
    } catch (e) {
        cachedClearTimeout = defaultClearTimeout;
    }
} ())
function runTimeout(fun) {
    if (cachedSetTimeout === setTimeout) {
        //normal enviroments in sane situations
        return setTimeout(fun, 0);
    }
    // if setTimeout wasn't available but was latter defined
    if ((cachedSetTimeout === defaultSetTimout || !cachedSetTimeout) && setTimeout) {
        cachedSetTimeout = setTimeout;
        return setTimeout(fun, 0);
    }
    try {
        // when when somebody has screwed with setTimeout but no I.E. maddness
        return cachedSetTimeout(fun, 0);
    } catch(e){
        try {
            // When we are in I.E. but the script has been evaled so I.E. doesn't trust the global object when called normally
            return cachedSetTimeout.call(null, fun, 0);
        } catch(e){
            // same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error
            return cachedSetTimeout.call(this, fun, 0);
        }
    }


}
function runClearTimeout(marker) {
    if (cachedClearTimeout === clearTimeout) {
        //normal enviroments in sane situations
        return clearTimeout(marker);
    }
    // if clearTimeout wasn't available but was latter defined
    if ((cachedClearTimeout === defaultClearTimeout || !cachedClearTimeout) && clearTimeout) {
        cachedClearTimeout = clearTimeout;
        return clearTimeout(marker);
    }
    try {
        // when when somebody has screwed with setTimeout but no I.E. maddness
        return cachedClearTimeout(marker);
    } catch (e){
        try {
            // When we are in I.E. but the script has been evaled so I.E. doesn't  trust the global object when called normally
            return cachedClearTimeout.call(null, marker);
        } catch (e){
            // same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error.
            // Some versions of I.E. have different rules for clearTimeout vs setTimeout
            return cachedClearTimeout.call(this, marker);
        }
    }



}
var queue = [];
var draining = false;
var currentQueue;
var queueIndex = -1;

function cleanUpNextTick() {
    if (!draining || !currentQueue) {
        return;
    }
    draining = false;
    if (currentQueue.length) {
        queue = currentQueue.concat(queue);
    } else {
        queueIndex = -1;
    }
    if (queue.length) {
        drainQueue();
    }
}

function drainQueue() {
    if (draining) {
        return;
    }
    var timeout = runTimeout(cleanUpNextTick);
    draining = true;

    var len = queue.length;
    while(len) {
        currentQueue = queue;
        queue = [];
        while (++queueIndex < len) {
            if (currentQueue) {
                currentQueue[queueIndex].run();
            }
        }
        queueIndex = -1;
        len = queue.length;
    }
    currentQueue = null;
    draining = false;
    runClearTimeout(timeout);
}

process.nextTick = function (fun) {
    var args = new Array(arguments.length - 1);
    if (arguments.length > 1) {
        for (var i = 1; i < arguments.length; i++) {
            args[i - 1] = arguments[i];
        }
    }
    queue.push(new Item(fun, args));
    if (queue.length === 1 && !draining) {
        runTimeout(drainQueue);
    }
};

// v8 likes predictible objects
function Item(fun, array) {
    this.fun = fun;
    this.array = array;
}
Item.prototype.run = function () {
    this.fun.apply(null, this.array);
};
process.title = 'browser';
process.browser = true;
process.env = {};
process.argv = [];
process.version = ''; // empty string to avoid regexp issues
process.versions = {};

function noop() {}

process.on = noop;
process.addListener = noop;
process.once = noop;
process.off = noop;
process.removeListener = noop;
process.removeAllListeners = noop;
process.emit = noop;
process.prependListener = noop;
process.prependOnceListener = noop;

process.listeners = function (name) { return [] }

process.binding = function (name) {
    throw new Error('process.binding is not supported');
};

process.cwd = function () { return '/' };
process.chdir = function (dir) {
    throw new Error('process.chdir is not supported');
};
process.umask = function() { return 0; };


/***/ }),
/* 42 */
/***/ (function(module, exports, __webpack_require__) {

var Buffer = __webpack_require__(8).Buffer
var Transform = __webpack_require__(102).Transform
var StringDecoder = __webpack_require__(106).StringDecoder
var inherits = __webpack_require__(1)

function CipherBase (hashMode) {
  Transform.call(this)
  this.hashMode = typeof hashMode === 'string'
  if (this.hashMode) {
    this[hashMode] = this._finalOrDigest
  } else {
    this.final = this._finalOrDigest
  }
  if (this._final) {
    this.__final = this._final
    this._final = null
  }
  this._decoder = null
  this._encoding = null
}
inherits(CipherBase, Transform)

CipherBase.prototype.update = function (data, inputEnc, outputEnc) {
  if (typeof data === 'string') {
    data = Buffer.from(data, inputEnc)
  }

  var outData = this._update(data)
  if (this.hashMode) return this

  if (outputEnc) {
    outData = this._toString(outData, outputEnc)
  }

  return outData
}

CipherBase.prototype.setAutoPadding = function () {}
CipherBase.prototype.getAuthTag = function () {
  throw new Error('trying to get auth tag in unsupported state')
}

CipherBase.prototype.setAuthTag = function () {
  throw new Error('trying to set auth tag in unsupported state')
}

CipherBase.prototype.setAAD = function () {
  throw new Error('trying to set aad in unsupported state')
}

CipherBase.prototype._transform = function (data, _, next) {
  var err
  try {
    if (this.hashMode) {
      this._update(data)
    } else {
      this.push(this._update(data))
    }
  } catch (e) {
    err = e
  } finally {
    next(err)
  }
}
CipherBase.prototype._flush = function (done) {
  var err
  try {
    this.push(this.__final())
  } catch (e) {
    err = e
  }

  done(err)
}
CipherBase.prototype._finalOrDigest = function (outputEnc) {
  var outData = this.__final() || Buffer.alloc(0)
  if (outputEnc) {
    outData = this._toString(outData, outputEnc, true)
  }
  return outData
}

CipherBase.prototype._toString = function (value, enc, fin) {
  if (!this._decoder) {
    this._decoder = new StringDecoder(enc)
    this._encoding = enc
  }

  if (this._encoding !== enc) throw new Error('can\'t switch encodings')

  var out = this._decoder.write(value)
  if (fin) {
    out += this._decoder.end()
  }

  return out
}

module.exports = CipherBase


/***/ }),
/* 43 */
/***/ (function(module, exports, __webpack_require__) {

var META = __webpack_require__(47)('meta');
var isObject = __webpack_require__(7);
var has = __webpack_require__(18);
var setDesc = __webpack_require__(11).f;
var id = 0;
var isExtensible = Object.isExtensible || function () {
  return true;
};
var FREEZE = !__webpack_require__(5)(function () {
  return isExtensible(Object.preventExtensions({}));
});
var setMeta = function (it) {
  setDesc(it, META, { value: {
    i: 'O' + ++id, // object ID
    w: {}          // weak collections IDs
  } });
};
var fastKey = function (it, create) {
  // return primitive with prefix
  if (!isObject(it)) return typeof it == 'symbol' ? it : (typeof it == 'string' ? 'S' : 'P') + it;
  if (!has(it, META)) {
    // can't set metadata to uncaught frozen object
    if (!isExtensible(it)) return 'F';
    // not necessary to add metadata
    if (!create) return 'E';
    // add missing metadata
    setMeta(it);
  // return object ID
  } return it[META].i;
};
var getWeak = function (it, create) {
  if (!has(it, META)) {
    // can't set metadata to uncaught frozen object
    if (!isExtensible(it)) return true;
    // not necessary to add metadata
    if (!create) return false;
    // add missing metadata
    setMeta(it);
  // return hash weak collections IDs
  } return it[META].w;
};
// add metadata on freeze-family methods calling
var onFreeze = function (it) {
  if (FREEZE && meta.NEED && isExtensible(it) && !has(it, META)) setMeta(it);
  return it;
};
var meta = module.exports = {
  KEY: META,
  NEED: false,
  fastKey: fastKey,
  getWeak: getWeak,
  onFreeze: onFreeze
};


/***/ }),
/* 44 */
/***/ (function(module, exports, __webpack_require__) {

// 22.1.3.31 Array.prototype[@@unscopables]
var UNSCOPABLES = __webpack_require__(9)('unscopables');
var ArrayProto = Array.prototype;
if (ArrayProto[UNSCOPABLES] == undefined) __webpack_require__(19)(ArrayProto, UNSCOPABLES, {});
module.exports = function (key) {
  ArrayProto[UNSCOPABLES][key] = true;
};


/***/ }),
/* 45 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";
// Copyright Joyent, Inc. and other Node contributors.
//
// Permission is hereby granted, free of charge, to any person obtaining a
// copy of this software and associated documentation files (the
// "Software"), to deal in the Software without restriction, including
// without limitation the rights to use, copy, modify, merge, publish,
// distribute, sublicense, and/or sell copies of the Software, and to permit
// persons to whom the Software is furnished to do so, subject to the
// following conditions:
//
// The above copyright notice and this permission notice shall be included
// in all copies or substantial portions of the Software.
//
// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
// USE OR OTHER DEALINGS IN THE SOFTWARE.

// a duplex stream is just a stream that is both readable and writable.
// Since JS doesn't have multiple prototypal inheritance, this class
// prototypally inherits from Readable, and then parasitically from
// Writable.



/*<replacement>*/

var processNextTick = __webpack_require__(77);
/*</replacement>*/

/*<replacement>*/
var objectKeys = Object.keys || function (obj) {
  var keys = [];
  for (var key in obj) {
    keys.push(key);
  }return keys;
};
/*</replacement>*/

module.exports = Duplex;

/*<replacement>*/
var util = __webpack_require__(68);
util.inherits = __webpack_require__(1);
/*</replacement>*/

var Readable = __webpack_require__(147);
var Writable = __webpack_require__(105);

util.inherits(Duplex, Readable);

var keys = objectKeys(Writable.prototype);
for (var v = 0; v < keys.length; v++) {
  var method = keys[v];
  if (!Duplex.prototype[method]) Duplex.prototype[method] = Writable.prototype[method];
}

function Duplex(options) {
  if (!(this instanceof Duplex)) return new Duplex(options);

  Readable.call(this, options);
  Writable.call(this, options);

  if (options && options.readable === false) this.readable = false;

  if (options && options.writable === false) this.writable = false;

  this.allowHalfOpen = true;
  if (options && options.allowHalfOpen === false) this.allowHalfOpen = false;

  this.once('end', onend);
}

// the no-half-open enforcer
function onend() {
  // if we allow half-open state, or if the writable side ended,
  // then we're ok.
  if (this.allowHalfOpen || this._writableState.ended) return;

  // no more data can be written.
  // But allow more writes to happen in this tick.
  processNextTick(onEndNT, this);
}

function onEndNT(self) {
  self.end();
}

Object.defineProperty(Duplex.prototype, 'destroyed', {
  get: function () {
    if (this._readableState === undefined || this._writableState === undefined) {
      return false;
    }
    return this._readableState.destroyed && this._writableState.destroyed;
  },
  set: function (value) {
    // we ignore the value if the stream
    // has not been initialized yet
    if (this._readableState === undefined || this._writableState === undefined) {
      return;
    }

    // backward compatibility, the user is explicitly
    // managing destroyed
    this._readableState.destroyed = value;
    this._writableState.destroyed = value;
  }
});

Duplex.prototype._destroy = function (err, cb) {
  this.push(null);
  this.end();

  processNextTick(cb, err);
};

function forEach(xs, f) {
  for (var i = 0, l = xs.length; i < l; i++) {
    f(xs[i], i);
  }
}

/***/ }),
/* 46 */
/***/ (function(module, exports) {

module.exports = function (bitmap, value) {
  return {
    enumerable: !(bitmap & 1),
    configurable: !(bitmap & 2),
    writable: !(bitmap & 4),
    value: value
  };
};


/***/ }),
/* 47 */
/***/ (function(module, exports) {

var id = 0;
var px = Math.random();
module.exports = function (key) {
  return 'Symbol('.concat(key === undefined ? '' : key, ')_', (++id + px).toString(36));
};


/***/ }),
/* 48 */
/***/ (function(module, exports) {

module.exports = false;


/***/ }),
/* 49 */
/***/ (function(module, exports, __webpack_require__) {

// 19.1.2.14 / 15.2.3.14 Object.keys(O)
var $keys = __webpack_require__(181);
var enumBugKeys = __webpack_require__(116);

module.exports = Object.keys || function keys(O) {
  return $keys(O, enumBugKeys);
};


/***/ }),
/* 50 */
/***/ (function(module, exports, __webpack_require__) {

var toInteger = __webpack_require__(33);
var max = Math.max;
var min = Math.min;
module.exports = function (index, length) {
  index = toInteger(index);
  return index < 0 ? max(index + length, 0) : min(index, length);
};


/***/ }),
/* 51 */
/***/ (function(module, exports, __webpack_require__) {

// 19.1.2.2 / 15.2.3.5 Object.create(O [, Properties])
var anObject = __webpack_require__(2);
var dPs = __webpack_require__(182);
var enumBugKeys = __webpack_require__(116);
var IE_PROTO = __webpack_require__(115)('IE_PROTO');
var Empty = function () { /* empty */ };
var PROTOTYPE = 'prototype';

// Create object with fake `null` prototype: use iframe Object with cleared prototype
var createDict = function () {
  // Thrash, waste and sodomy: IE GC bug
  var iframe = __webpack_require__(113)('iframe');
  var i = enumBugKeys.length;
  var lt = '<';
  var gt = '>';
  var iframeDocument;
  iframe.style.display = 'none';
  __webpack_require__(117).appendChild(iframe);
  iframe.src = 'javascript:'; // eslint-disable-line no-script-url
  // createDict = iframe.contentWindow.Object;
  // html.removeChild(iframe);
  iframeDocument = iframe.contentWindow.document;
  iframeDocument.open();
  iframeDocument.write(lt + 'script' + gt + 'document.F=Object' + lt + '/script' + gt);
  iframeDocument.close();
  createDict = iframeDocument.F;
  while (i--) delete createDict[PROTOTYPE][enumBugKeys[i]];
  return createDict();
};

module.exports = Object.create || function create(O, Properties) {
  var result;
  if (O !== null) {
    Empty[PROTOTYPE] = anObject(O);
    result = new Empty();
    Empty[PROTOTYPE] = null;
    // add "__proto__" for Object.getPrototypeOf polyfill
    result[IE_PROTO] = O;
  } else result = createDict();
  return Properties === undefined ? result : dPs(result, Properties);
};


/***/ }),
/* 52 */
/***/ (function(module, exports, __webpack_require__) {

// 19.1.2.7 / 15.2.3.4 Object.getOwnPropertyNames(O)
var $keys = __webpack_require__(181);
var hiddenKeys = __webpack_require__(116).concat('length', 'prototype');

exports.f = Object.getOwnPropertyNames || function getOwnPropertyNames(O) {
  return $keys(O, hiddenKeys);
};


/***/ }),
/* 53 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var global = __webpack_require__(3);
var dP = __webpack_require__(11);
var DESCRIPTORS = __webpack_require__(10);
var SPECIES = __webpack_require__(9)('species');

module.exports = function (KEY) {
  var C = global[KEY];
  if (DESCRIPTORS && C && !C[SPECIES]) dP.f(C, SPECIES, {
    configurable: true,
    get: function () { return this; }
  });
};


/***/ }),
/* 54 */
/***/ (function(module, exports) {

module.exports = function (it, Constructor, name, forbiddenField) {
  if (!(it instanceof Constructor) || (forbiddenField !== undefined && forbiddenField in it)) {
    throw TypeError(name + ': incorrect invocation!');
  } return it;
};


/***/ }),
/* 55 */
/***/ (function(module, exports, __webpack_require__) {

var ctx = __webpack_require__(26);
var call = __webpack_require__(193);
var isArrayIter = __webpack_require__(129);
var anObject = __webpack_require__(2);
var toLength = __webpack_require__(12);
var getIterFn = __webpack_require__(131);
var BREAK = {};
var RETURN = {};
var exports = module.exports = function (iterable, entries, fn, that, ITERATOR) {
  var iterFn = ITERATOR ? function () { return iterable; } : getIterFn(iterable);
  var f = ctx(fn, that, entries ? 2 : 1);
  var index = 0;
  var length, step, iterator, result;
  if (typeof iterFn != 'function') throw TypeError(iterable + ' is not iterable!');
  // fast case for arrays with default iterator
  if (isArrayIter(iterFn)) for (length = toLength(iterable.length); length > index; index++) {
    result = entries ? f(anObject(step = iterable[index])[0], step[1]) : f(iterable[index]);
    if (result === BREAK || result === RETURN) return result;
  } else for (iterator = iterFn.call(iterable); !(step = iterator.next()).done;) {
    result = call(iterator, f, step.value, entries);
    if (result === BREAK || result === RETURN) return result;
  }
};
exports.BREAK = BREAK;
exports.RETURN = RETURN;


/***/ }),
/* 56 */
/***/ (function(module, exports, __webpack_require__) {

var redefine = __webpack_require__(20);
module.exports = function (target, src, safe) {
  for (var key in src) redefine(target, key, src[key], safe);
  return target;
};


/***/ }),
/* 57 */
/***/ (function(module, exports, __webpack_require__) {

;(function (root, factory, undef) {
	if (true) {
		// CommonJS
		module.exports = exports = factory(__webpack_require__(4), __webpack_require__(139), __webpack_require__(140));
	}
	else if (typeof define === "function" && define.amd) {
		// AMD
		define(["./core", "./sha1", "./hmac"], factory);
	}
	else {
		// Global (browser)
		factory(root.CryptoJS);
	}
}(this, function (CryptoJS) {

	(function () {
	    // Shortcuts
	    var C = CryptoJS;
	    var C_lib = C.lib;
	    var Base = C_lib.Base;
	    var WordArray = C_lib.WordArray;
	    var C_algo = C.algo;
	    var MD5 = C_algo.MD5;

	    /**
	     * This key derivation function is meant to conform with EVP_BytesToKey.
	     * www.openssl.org/docs/crypto/EVP_BytesToKey.html
	     */
	    var EvpKDF = C_algo.EvpKDF = Base.extend({
	        /**
	         * Configuration options.
	         *
	         * @property {number} keySize The key size in words to generate. Default: 4 (128 bits)
	         * @property {Hasher} hasher The hash algorithm to use. Default: MD5
	         * @property {number} iterations The number of iterations to perform. Default: 1
	         */
	        cfg: Base.extend({
	            keySize: 128/32,
	            hasher: MD5,
	            iterations: 1
	        }),

	        /**
	         * Initializes a newly created key derivation function.
	         *
	         * @param {Object} cfg (Optional) The configuration options to use for the derivation.
	         *
	         * @example
	         *
	         *     var kdf = CryptoJS.algo.EvpKDF.create();
	         *     var kdf = CryptoJS.algo.EvpKDF.create({ keySize: 8 });
	         *     var kdf = CryptoJS.algo.EvpKDF.create({ keySize: 8, iterations: 1000 });
	         */
	        init: function (cfg) {
	            this.cfg = this.cfg.extend(cfg);
	        },

	        /**
	         * Derives a key from a password.
	         *
	         * @param {WordArray|string} password The password.
	         * @param {WordArray|string} salt A salt.
	         *
	         * @return {WordArray} The derived key.
	         *
	         * @example
	         *
	         *     var key = kdf.compute(password, salt);
	         */
	        compute: function (password, salt) {
	            // Shortcut
	            var cfg = this.cfg;

	            // Init hasher
	            var hasher = cfg.hasher.create();

	            // Initial values
	            var derivedKey = WordArray.create();

	            // Shortcuts
	            var derivedKeyWords = derivedKey.words;
	            var keySize = cfg.keySize;
	            var iterations = cfg.iterations;

	            // Generate key
	            while (derivedKeyWords.length < keySize) {
	                if (block) {
	                    hasher.update(block);
	                }
	                var block = hasher.update(password).finalize(salt);
	                hasher.reset();

	                // Iterations
	                for (var i = 1; i < iterations; i++) {
	                    block = hasher.finalize(block);
	                    hasher.reset();
	                }

	                derivedKey.concat(block);
	            }
	            derivedKey.sigBytes = keySize * 4;

	            return derivedKey;
	        }
	    });

	    /**
	     * Derives a key from a password.
	     *
	     * @param {WordArray|string} password The password.
	     * @param {WordArray|string} salt A salt.
	     * @param {Object} cfg (Optional) The configuration options to use for this computation.
	     *
	     * @return {WordArray} The derived key.
	     *
	     * @static
	     *
	     * @example
	     *
	     *     var key = CryptoJS.EvpKDF(password, salt);
	     *     var key = CryptoJS.EvpKDF(password, salt, { keySize: 8 });
	     *     var key = CryptoJS.EvpKDF(password, salt, { keySize: 8, iterations: 1000 });
	     */
	    C.EvpKDF = function (password, salt, cfg) {
	        return EvpKDF.create(cfg).compute(password, salt);
	    };
	}());


	return CryptoJS.EvpKDF;

}));

/***/ }),
/* 58 */
/***/ (function(module, exports, __webpack_require__) {

var Buffer = __webpack_require__(8).Buffer

// prototype class for hash functions
function Hash (blockSize, finalSize) {
  this._block = Buffer.alloc(blockSize)
  this._finalSize = finalSize
  this._blockSize = blockSize
  this._len = 0
}

Hash.prototype.update = function (data, enc) {
  if (typeof data === 'string') {
    enc = enc || 'utf8'
    data = Buffer.from(data, enc)
  }

  var block = this._block
  var blockSize = this._blockSize
  var length = data.length
  var accum = this._len

  for (var offset = 0; offset < length;) {
    var assigned = accum % blockSize
    var remainder = Math.min(length - offset, blockSize - assigned)

    for (var i = 0; i < remainder; i++) {
      block[assigned + i] = data[offset + i]
    }

    accum += remainder
    offset += remainder

    if ((accum % blockSize) === 0) {
      this._update(block)
    }
  }

  this._len += length
  return this
}

Hash.prototype.digest = function (enc) {
  var rem = this._len % this._blockSize

  this._block[rem] = 0x80

  // zero (rem + 1) trailing bits, where (rem + 1) is the smallest
  // non-negative solution to the equation (length + 1 + (rem + 1)) === finalSize mod blockSize
  this._block.fill(0, rem + 1)

  if (rem >= this._finalSize) {
    this._update(this._block)
    this._block.fill(0)
  }

  var bits = this._len * 8

  // uint32
  if (bits <= 0xffffffff) {
    this._block.writeUInt32BE(bits, this._blockSize - 4)

  // uint64
  } else {
    var lowBits = bits & 0xffffffff
    var highBits = (bits - lowBits) / 0x100000000

    this._block.writeUInt32BE(highBits, this._blockSize - 8)
    this._block.writeUInt32BE(lowBits, this._blockSize - 4)
  }

  this._update(this._block)
  var hash = this._hash()

  return enc ? hash.toString(enc) : hash
}

Hash.prototype._update = function () {
  throw new Error('_update must be implemented by subclass')
}

module.exports = Hash


/***/ }),
/* 59 */
/***/ (function(module, exports, __webpack_require__) {

var def = __webpack_require__(11).f;
var has = __webpack_require__(18);
var TAG = __webpack_require__(9)('toStringTag');

module.exports = function (it, tag, stat) {
  if (it && !has(it = stat ? it : it.prototype, TAG)) def(it, TAG, { configurable: true, value: tag });
};


/***/ }),
/* 60 */
/***/ (function(module, exports, __webpack_require__) {

var $export = __webpack_require__(0);
var defined = __webpack_require__(32);
var fails = __webpack_require__(5);
var spaces = __webpack_require__(119);
var space = '[' + spaces + ']';
var non = '\u200b\u0085';
var ltrim = RegExp('^' + space + space + '*');
var rtrim = RegExp(space + space + '*$');

var exporter = function (KEY, exec, ALIAS) {
  var exp = {};
  var FORCE = fails(function () {
    return !!spaces[KEY]() || non[KEY]() != non;
  });
  var fn = exp[KEY] = FORCE ? exec(trim) : spaces[KEY];
  if (ALIAS) exp[ALIAS] = fn;
  $export($export.P + $export.F * FORCE, 'String', exp);
};

// 1 -> String#trimLeft
// 2 -> String#trimRight
// 3 -> String#trim
var trim = exporter.trim = function (string, TYPE) {
  string = String(defined(string));
  if (TYPE & 1) string = string.replace(ltrim, '');
  if (TYPE & 2) string = string.replace(rtrim, '');
  return string;
};

module.exports = exporter;


/***/ }),
/* 61 */
/***/ (function(module, exports) {

module.exports = {};


/***/ }),
/* 62 */
/***/ (function(module, exports, __webpack_require__) {

var isObject = __webpack_require__(7);
module.exports = function (it, TYPE) {
  if (!isObject(it) || it._t !== TYPE) throw TypeError('Incompatible receiver, ' + TYPE + ' required!');
  return it;
};


/***/ }),
/* 63 */
/***/ (function(module, exports, __webpack_require__) {

var CryptoJS = __webpack_require__(214);
var Converter = __webpack_require__(36);
var Curl = __webpack_require__(40);
var WConverter = __webpack_require__(532);

var BIT_HASH_LENGTH = 384;

function Kerl() {


    this.k = CryptoJS.algo.SHA3.create();
    this.k.init({
        outputLength: BIT_HASH_LENGTH
    });
}

Kerl.BIT_HASH_LENGTH = BIT_HASH_LENGTH;
Kerl.HASH_LENGTH = Curl.HASH_LENGTH;

Kerl.prototype.initialize = function(state) {}

Kerl.prototype.reset = function() {

    this.k.reset();

}

Kerl.prototype.absorb = function(trits, offset, length) {


    if (length && ((length % 243) !== 0)) {

        throw new Error('Illegal length provided');

    }

    do {
        var limit = (length < Curl.HASH_LENGTH ? length : Curl.HASH_LENGTH);

        var trit_state = trits.slice(offset, offset + limit);
        offset += limit;

        // convert trit state to words
        var wordsToAbsorb = WConverter.trits_to_words(trit_state);

        // absorb the trit stat as wordarray
        this.k.update(
            CryptoJS.lib.WordArray.create(wordsToAbsorb));

    } while ((length -= Curl.HASH_LENGTH) > 0);

}



Kerl.prototype.squeeze = function(trits, offset, length) {

    if (length && ((length % 243) !== 0)) {

        throw new Error('Illegal length provided');

    }
    do {

        // get the hash digest
        var kCopy = this.k.clone();
        var final = kCopy.finalize();

        // Convert words to trits and then map it into the internal state
        var trit_state = WConverter.words_to_trits(final.words);

        var i = 0;
        var limit = (length < Curl.HASH_LENGTH ? length : Curl.HASH_LENGTH);

        while (i < limit) {
            trits[offset++] = trit_state[i++];
        }

        this.reset();

        for (i = 0; i < final.words.length; i++) {
            final.words[i] = final.words[i] ^ 0xFFFFFFFF;
        }

        this.k.update(final);

    } while ((length -= Curl.HASH_LENGTH) > 0);
}

module.exports = Kerl;


/***/ }),
/* 64 */
/***/ (function(module, exports, __webpack_require__) {

;(function (root, factory) {
	if (true) {
		// CommonJS
		module.exports = exports = factory(__webpack_require__(4));
	}
	else if (typeof define === "function" && define.amd) {
		// AMD
		define(["./core"], factory);
	}
	else {
		// Global (browser)
		factory(root.CryptoJS);
	}
}(this, function (CryptoJS) {

	(function () {
	    // Shortcuts
	    var C = CryptoJS;
	    var C_lib = C.lib;
	    var WordArray = C_lib.WordArray;
	    var C_enc = C.enc;

	    /**
	     * Base64 encoding strategy.
	     */
	    var Base64 = C_enc.Base64 = {
	        /**
	         * Converts a word array to a Base64 string.
	         *
	         * @param {WordArray} wordArray The word array.
	         *
	         * @return {string} The Base64 string.
	         *
	         * @static
	         *
	         * @example
	         *
	         *     var base64String = CryptoJS.enc.Base64.stringify(wordArray);
	         */
	        stringify: function (wordArray) {
	            // Shortcuts
	            var words = wordArray.words;
	            var sigBytes = wordArray.sigBytes;
	            var map = this._map;

	            // Clamp excess bits
	            wordArray.clamp();

	            // Convert
	            var base64Chars = [];
	            for (var i = 0; i < sigBytes; i += 3) {
	                var byte1 = (words[i >>> 2]       >>> (24 - (i % 4) * 8))       & 0xff;
	                var byte2 = (words[(i + 1) >>> 2] >>> (24 - ((i + 1) % 4) * 8)) & 0xff;
	                var byte3 = (words[(i + 2) >>> 2] >>> (24 - ((i + 2) % 4) * 8)) & 0xff;

	                var triplet = (byte1 << 16) | (byte2 << 8) | byte3;

	                for (var j = 0; (j < 4) && (i + j * 0.75 < sigBytes); j++) {
	                    base64Chars.push(map.charAt((triplet >>> (6 * (3 - j))) & 0x3f));
	                }
	            }

	            // Add padding
	            var paddingChar = map.charAt(64);
	            if (paddingChar) {
	                while (base64Chars.length % 4) {
	                    base64Chars.push(paddingChar);
	                }
	            }

	            return base64Chars.join('');
	        },

	        /**
	         * Converts a Base64 string to a word array.
	         *
	         * @param {string} base64Str The Base64 string.
	         *
	         * @return {WordArray} The word array.
	         *
	         * @static
	         *
	         * @example
	         *
	         *     var wordArray = CryptoJS.enc.Base64.parse(base64String);
	         */
	        parse: function (base64Str) {
	            // Shortcuts
	            var base64StrLength = base64Str.length;
	            var map = this._map;
	            var reverseMap = this._reverseMap;

	            if (!reverseMap) {
	                    reverseMap = this._reverseMap = [];
	                    for (var j = 0; j < map.length; j++) {
	                        reverseMap[map.charCodeAt(j)] = j;
	                    }
	            }

	            // Ignore padding
	            var paddingChar = map.charAt(64);
	            if (paddingChar) {
	                var paddingIndex = base64Str.indexOf(paddingChar);
	                if (paddingIndex !== -1) {
	                    base64StrLength = paddingIndex;
	                }
	            }

	            // Convert
	            return parseLoop(base64Str, base64StrLength, reverseMap);

	        },

	        _map: 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/='
	    };

	    function parseLoop(base64Str, base64StrLength, reverseMap) {
	      var words = [];
	      var nBytes = 0;
	      for (var i = 0; i < base64StrLength; i++) {
	          if (i % 4) {
	              var bits1 = reverseMap[base64Str.charCodeAt(i - 1)] << ((i % 4) * 2);
	              var bits2 = reverseMap[base64Str.charCodeAt(i)] >>> (6 - (i % 4) * 2);
	              words[nBytes >>> 2] |= (bits1 | bits2) << (24 - (nBytes % 4) * 8);
	              nBytes++;
	          }
	      }
	      return WordArray.create(words, nBytes);
	    }
	}());


	return CryptoJS.enc.Base64;

}));

/***/ }),
/* 65 */
/***/ (function(module, exports, __webpack_require__) {

;(function (root, factory) {
	if (true) {
		// CommonJS
		module.exports = exports = factory(__webpack_require__(4));
	}
	else if (typeof define === "function" && define.amd) {
		// AMD
		define(["./core"], factory);
	}
	else {
		// Global (browser)
		factory(root.CryptoJS);
	}
}(this, function (CryptoJS) {

	(function (Math) {
	    // Shortcuts
	    var C = CryptoJS;
	    var C_lib = C.lib;
	    var WordArray = C_lib.WordArray;
	    var Hasher = C_lib.Hasher;
	    var C_algo = C.algo;

	    // Constants table
	    var T = [];

	    // Compute constants
	    (function () {
	        for (var i = 0; i < 64; i++) {
	            T[i] = (Math.abs(Math.sin(i + 1)) * 0x100000000) | 0;
	        }
	    }());

	    /**
	     * MD5 hash algorithm.
	     */
	    var MD5 = C_algo.MD5 = Hasher.extend({
	        _doReset: function () {
	            this._hash = new WordArray.init([
	                0x67452301, 0xefcdab89,
	                0x98badcfe, 0x10325476
	            ]);
	        },

	        _doProcessBlock: function (M, offset) {
	            // Swap endian
	            for (var i = 0; i < 16; i++) {
	                // Shortcuts
	                var offset_i = offset + i;
	                var M_offset_i = M[offset_i];

	                M[offset_i] = (
	                    (((M_offset_i << 8)  | (M_offset_i >>> 24)) & 0x00ff00ff) |
	                    (((M_offset_i << 24) | (M_offset_i >>> 8))  & 0xff00ff00)
	                );
	            }

	            // Shortcuts
	            var H = this._hash.words;

	            var M_offset_0  = M[offset + 0];
	            var M_offset_1  = M[offset + 1];
	            var M_offset_2  = M[offset + 2];
	            var M_offset_3  = M[offset + 3];
	            var M_offset_4  = M[offset + 4];
	            var M_offset_5  = M[offset + 5];
	            var M_offset_6  = M[offset + 6];
	            var M_offset_7  = M[offset + 7];
	            var M_offset_8  = M[offset + 8];
	            var M_offset_9  = M[offset + 9];
	            var M_offset_10 = M[offset + 10];
	            var M_offset_11 = M[offset + 11];
	            var M_offset_12 = M[offset + 12];
	            var M_offset_13 = M[offset + 13];
	            var M_offset_14 = M[offset + 14];
	            var M_offset_15 = M[offset + 15];

	            // Working varialbes
	            var a = H[0];
	            var b = H[1];
	            var c = H[2];
	            var d = H[3];

	            // Computation
	            a = FF(a, b, c, d, M_offset_0,  7,  T[0]);
	            d = FF(d, a, b, c, M_offset_1,  12, T[1]);
	            c = FF(c, d, a, b, M_offset_2,  17, T[2]);
	            b = FF(b, c, d, a, M_offset_3,  22, T[3]);
	            a = FF(a, b, c, d, M_offset_4,  7,  T[4]);
	            d = FF(d, a, b, c, M_offset_5,  12, T[5]);
	            c = FF(c, d, a, b, M_offset_6,  17, T[6]);
	            b = FF(b, c, d, a, M_offset_7,  22, T[7]);
	            a = FF(a, b, c, d, M_offset_8,  7,  T[8]);
	            d = FF(d, a, b, c, M_offset_9,  12, T[9]);
	            c = FF(c, d, a, b, M_offset_10, 17, T[10]);
	            b = FF(b, c, d, a, M_offset_11, 22, T[11]);
	            a = FF(a, b, c, d, M_offset_12, 7,  T[12]);
	            d = FF(d, a, b, c, M_offset_13, 12, T[13]);
	            c = FF(c, d, a, b, M_offset_14, 17, T[14]);
	            b = FF(b, c, d, a, M_offset_15, 22, T[15]);

	            a = GG(a, b, c, d, M_offset_1,  5,  T[16]);
	            d = GG(d, a, b, c, M_offset_6,  9,  T[17]);
	            c = GG(c, d, a, b, M_offset_11, 14, T[18]);
	            b = GG(b, c, d, a, M_offset_0,  20, T[19]);
	            a = GG(a, b, c, d, M_offset_5,  5,  T[20]);
	            d = GG(d, a, b, c, M_offset_10, 9,  T[21]);
	            c = GG(c, d, a, b, M_offset_15, 14, T[22]);
	            b = GG(b, c, d, a, M_offset_4,  20, T[23]);
	            a = GG(a, b, c, d, M_offset_9,  5,  T[24]);
	            d = GG(d, a, b, c, M_offset_14, 9,  T[25]);
	            c = GG(c, d, a, b, M_offset_3,  14, T[26]);
	            b = GG(b, c, d, a, M_offset_8,  20, T[27]);
	            a = GG(a, b, c, d, M_offset_13, 5,  T[28]);
	            d = GG(d, a, b, c, M_offset_2,  9,  T[29]);
	            c = GG(c, d, a, b, M_offset_7,  14, T[30]);
	            b = GG(b, c, d, a, M_offset_12, 20, T[31]);

	            a = HH(a, b, c, d, M_offset_5,  4,  T[32]);
	            d = HH(d, a, b, c, M_offset_8,  11, T[33]);
	            c = HH(c, d, a, b, M_offset_11, 16, T[34]);
	            b = HH(b, c, d, a, M_offset_14, 23, T[35]);
	            a = HH(a, b, c, d, M_offset_1,  4,  T[36]);
	            d = HH(d, a, b, c, M_offset_4,  11, T[37]);
	            c = HH(c, d, a, b, M_offset_7,  16, T[38]);
	            b = HH(b, c, d, a, M_offset_10, 23, T[39]);
	            a = HH(a, b, c, d, M_offset_13, 4,  T[40]);
	            d = HH(d, a, b, c, M_offset_0,  11, T[41]);
	            c = HH(c, d, a, b, M_offset_3,  16, T[42]);
	            b = HH(b, c, d, a, M_offset_6,  23, T[43]);
	            a = HH(a, b, c, d, M_offset_9,  4,  T[44]);
	            d = HH(d, a, b, c, M_offset_12, 11, T[45]);
	            c = HH(c, d, a, b, M_offset_15, 16, T[46]);
	            b = HH(b, c, d, a, M_offset_2,  23, T[47]);

	            a = II(a, b, c, d, M_offset_0,  6,  T[48]);
	            d = II(d, a, b, c, M_offset_7,  10, T[49]);
	            c = II(c, d, a, b, M_offset_14, 15, T[50]);
	            b = II(b, c, d, a, M_offset_5,  21, T[51]);
	            a = II(a, b, c, d, M_offset_12, 6,  T[52]);
	            d = II(d, a, b, c, M_offset_3,  10, T[53]);
	            c = II(c, d, a, b, M_offset_10, 15, T[54]);
	            b = II(b, c, d, a, M_offset_1,  21, T[55]);
	            a = II(a, b, c, d, M_offset_8,  6,  T[56]);
	            d = II(d, a, b, c, M_offset_15, 10, T[57]);
	            c = II(c, d, a, b, M_offset_6,  15, T[58]);
	            b = II(b, c, d, a, M_offset_13, 21, T[59]);
	            a = II(a, b, c, d, M_offset_4,  6,  T[60]);
	            d = II(d, a, b, c, M_offset_11, 10, T[61]);
	            c = II(c, d, a, b, M_offset_2,  15, T[62]);
	            b = II(b, c, d, a, M_offset_9,  21, T[63]);

	            // Intermediate hash value
	            H[0] = (H[0] + a) | 0;
	            H[1] = (H[1] + b) | 0;
	            H[2] = (H[2] + c) | 0;
	            H[3] = (H[3] + d) | 0;
	        },

	        _doFinalize: function () {
	            // Shortcuts
	            var data = this._data;
	            var dataWords = data.words;

	            var nBitsTotal = this._nDataBytes * 8;
	            var nBitsLeft = data.sigBytes * 8;

	            // Add padding
	            dataWords[nBitsLeft >>> 5] |= 0x80 << (24 - nBitsLeft % 32);

	            var nBitsTotalH = Math.floor(nBitsTotal / 0x100000000);
	            var nBitsTotalL = nBitsTotal;
	            dataWords[(((nBitsLeft + 64) >>> 9) << 4) + 15] = (
	                (((nBitsTotalH << 8)  | (nBitsTotalH >>> 24)) & 0x00ff00ff) |
	                (((nBitsTotalH << 24) | (nBitsTotalH >>> 8))  & 0xff00ff00)
	            );
	            dataWords[(((nBitsLeft + 64) >>> 9) << 4) + 14] = (
	                (((nBitsTotalL << 8)  | (nBitsTotalL >>> 24)) & 0x00ff00ff) |
	                (((nBitsTotalL << 24) | (nBitsTotalL >>> 8))  & 0xff00ff00)
	            );

	            data.sigBytes = (dataWords.length + 1) * 4;

	            // Hash final blocks
	            this._process();

	            // Shortcuts
	            var hash = this._hash;
	            var H = hash.words;

	            // Swap endian
	            for (var i = 0; i < 4; i++) {
	                // Shortcut
	                var H_i = H[i];

	                H[i] = (((H_i << 8)  | (H_i >>> 24)) & 0x00ff00ff) |
	                       (((H_i << 24) | (H_i >>> 8))  & 0xff00ff00);
	            }

	            // Return final computed hash
	            return hash;
	        },

	        clone: function () {
	            var clone = Hasher.clone.call(this);
	            clone._hash = this._hash.clone();

	            return clone;
	        }
	    });

	    function FF(a, b, c, d, x, s, t) {
	        var n = a + ((b & c) | (~b & d)) + x + t;
	        return ((n << s) | (n >>> (32 - s))) + b;
	    }

	    function GG(a, b, c, d, x, s, t) {
	        var n = a + ((b & d) | (c & ~d)) + x + t;
	        return ((n << s) | (n >>> (32 - s))) + b;
	    }

	    function HH(a, b, c, d, x, s, t) {
	        var n = a + (b ^ c ^ d) + x + t;
	        return ((n << s) | (n >>> (32 - s))) + b;
	    }

	    function II(a, b, c, d, x, s, t) {
	        var n = a + (c ^ (b | ~d)) + x + t;
	        return ((n << s) | (n >>> (32 - s))) + b;
	    }

	    /**
	     * Shortcut function to the hasher's object interface.
	     *
	     * @param {WordArray|string} message The message to hash.
	     *
	     * @return {WordArray} The hash.
	     *
	     * @static
	     *
	     * @example
	     *
	     *     var hash = CryptoJS.MD5('message');
	     *     var hash = CryptoJS.MD5(wordArray);
	     */
	    C.MD5 = Hasher._createHelper(MD5);

	    /**
	     * Shortcut function to the HMAC's object interface.
	     *
	     * @param {WordArray|string} message The message to hash.
	     * @param {WordArray|string} key The secret key.
	     *
	     * @return {WordArray} The HMAC.
	     *
	     * @static
	     *
	     * @example
	     *
	     *     var hmac = CryptoJS.HmacMD5(message, key);
	     */
	    C.HmacMD5 = Hasher._createHmacHelper(MD5);
	}(Math));


	return CryptoJS.MD5;

}));

/***/ }),
/* 66 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";
/* WEBPACK VAR INJECTION */(function(global, process) {

function oldBrowser () {
  throw new Error('secure random number generation not supported by this browser\nuse chrome, FireFox or Internet Explorer 11')
}

var Buffer = __webpack_require__(8).Buffer
var crypto = global.crypto || global.msCrypto

if (crypto && crypto.getRandomValues) {
  module.exports = randomBytes
} else {
  module.exports = oldBrowser
}

function randomBytes (size, cb) {
  // phantomjs needs to throw
  if (size > 65536) throw new Error('requested too many random bytes')
  // in case browserify  isn't using the Uint8Array version
  var rawBytes = new global.Uint8Array(size)

  // This will not work in older browsers.
  // See https://developer.mozilla.org/en-US/docs/Web/API/window.crypto.getRandomValues
  if (size > 0) {  // getRandomValues fails on IE if size == 0
    crypto.getRandomValues(rawBytes)
  }

  // XXX: phantomjs doesn't like a buffer being passed here
  var bytes = Buffer.from(rawBytes.buffer)

  if (typeof cb === 'function') {
    return process.nextTick(function () {
      cb(null, bytes)
    })
  }

  return bytes
}

/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(37), __webpack_require__(41)))

/***/ }),
/* 67 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";
/* WEBPACK VAR INJECTION */(function(Buffer) {
var inherits = __webpack_require__(1)
var md5 = __webpack_require__(100)
var RIPEMD160 = __webpack_require__(101)
var sha = __webpack_require__(107)

var Base = __webpack_require__(42)

function HashNoConstructor (hash) {
  Base.call(this, 'digest')

  this._hash = hash
  this.buffers = []
}

inherits(HashNoConstructor, Base)

HashNoConstructor.prototype._update = function (data) {
  this.buffers.push(data)
}

HashNoConstructor.prototype._final = function () {
  var buf = Buffer.concat(this.buffers)
  var r = this._hash(buf)
  this.buffers = null

  return r
}

function Hash (hash) {
  Base.call(this, 'digest')

  this._hash = hash
}

inherits(Hash, Base)

Hash.prototype._update = function (data) {
  this._hash.update(data)
}

Hash.prototype._final = function () {
  return this._hash.digest()
}

module.exports = function createHash (alg) {
  alg = alg.toLowerCase()
  if (alg === 'md5') return new HashNoConstructor(md5)
  if (alg === 'rmd160' || alg === 'ripemd160') return new Hash(new RIPEMD160())

  return new Hash(sha(alg))
}

/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(6).Buffer))

/***/ }),
/* 68 */
/***/ (function(module, exports, __webpack_require__) {

/* WEBPACK VAR INJECTION */(function(Buffer) {// Copyright Joyent, Inc. and other Node contributors.
//
// Permission is hereby granted, free of charge, to any person obtaining a
// copy of this software and associated documentation files (the
// "Software"), to deal in the Software without restriction, including
// without limitation the rights to use, copy, modify, merge, publish,
// distribute, sublicense, and/or sell copies of the Software, and to permit
// persons to whom the Software is furnished to do so, subject to the
// following conditions:
//
// The above copyright notice and this permission notice shall be included
// in all copies or substantial portions of the Software.
//
// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
// USE OR OTHER DEALINGS IN THE SOFTWARE.

// NOTE: These type checking functions intentionally don't use `instanceof`
// because it is fragile and can be easily faked with `Object.create()`.

function isArray(arg) {
  if (Array.isArray) {
    return Array.isArray(arg);
  }
  return objectToString(arg) === '[object Array]';
}
exports.isArray = isArray;

function isBoolean(arg) {
  return typeof arg === 'boolean';
}
exports.isBoolean = isBoolean;

function isNull(arg) {
  return arg === null;
}
exports.isNull = isNull;

function isNullOrUndefined(arg) {
  return arg == null;
}
exports.isNullOrUndefined = isNullOrUndefined;

function isNumber(arg) {
  return typeof arg === 'number';
}
exports.isNumber = isNumber;

function isString(arg) {
  return typeof arg === 'string';
}
exports.isString = isString;

function isSymbol(arg) {
  return typeof arg === 'symbol';
}
exports.isSymbol = isSymbol;

function isUndefined(arg) {
  return arg === void 0;
}
exports.isUndefined = isUndefined;

function isRegExp(re) {
  return objectToString(re) === '[object RegExp]';
}
exports.isRegExp = isRegExp;

function isObject(arg) {
  return typeof arg === 'object' && arg !== null;
}
exports.isObject = isObject;

function isDate(d) {
  return objectToString(d) === '[object Date]';
}
exports.isDate = isDate;

function isError(e) {
  return (objectToString(e) === '[object Error]' || e instanceof Error);
}
exports.isError = isError;

function isFunction(arg) {
  return typeof arg === 'function';
}
exports.isFunction = isFunction;

function isPrimitive(arg) {
  return arg === null ||
         typeof arg === 'boolean' ||
         typeof arg === 'number' ||
         typeof arg === 'string' ||
         typeof arg === 'symbol' ||  // ES6 symbol
         typeof arg === 'undefined';
}
exports.isPrimitive = isPrimitive;

exports.isBuffer = Buffer.isBuffer;

function objectToString(o) {
  return Object.prototype.toString.call(o);
}

/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(6).Buffer))

/***/ }),
/* 69 */
/***/ (function(module, exports, __webpack_require__) {

/* WEBPACK VAR INJECTION */(function(Buffer) {module.exports = function xor (a, b) {
  var length = Math.min(a.length, b.length)
  var buffer = new Buffer(length)

  for (var i = 0; i < length; ++i) {
    buffer[i] = a[i] ^ b[i]
  }

  return buffer
}

/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(6).Buffer))

/***/ }),
/* 70 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var utils = __webpack_require__(29);
var assert = __webpack_require__(22);

function BlockHash() {
  this.pending = null;
  this.pendingTotal = 0;
  this.blockSize = this.constructor.blockSize;
  this.outSize = this.constructor.outSize;
  this.hmacStrength = this.constructor.hmacStrength;
  this.padLength = this.constructor.padLength / 8;
  this.endian = 'big';

  this._delta8 = this.blockSize / 8;
  this._delta32 = this.blockSize / 32;
}
exports.BlockHash = BlockHash;

BlockHash.prototype.update = function update(msg, enc) {
  // Convert message to array, pad it, and join into 32bit blocks
  msg = utils.toArray(msg, enc);
  if (!this.pending)
    this.pending = msg;
  else
    this.pending = this.pending.concat(msg);
  this.pendingTotal += msg.length;

  // Enough data, try updating
  if (this.pending.length >= this._delta8) {
    msg = this.pending;

    // Process pending data in blocks
    var r = msg.length % this._delta8;
    this.pending = msg.slice(msg.length - r, msg.length);
    if (this.pending.length === 0)
      this.pending = null;

    msg = utils.join32(msg, 0, msg.length - r, this.endian);
    for (var i = 0; i < msg.length; i += this._delta32)
      this._update(msg, i, i + this._delta32);
  }

  return this;
};

BlockHash.prototype.digest = function digest(enc) {
  this.update(this._pad());
  assert(this.pending === null);

  return this._digest(enc);
};

BlockHash.prototype._pad = function pad() {
  var len = this.pendingTotal;
  var bytes = this._delta8;
  var k = bytes - ((len + this.padLength) % bytes);
  var res = new Array(k + this.padLength);
  res[0] = 0x80;
  for (var i = 1; i < k; i++)
    res[i] = 0;

  // Append length
  len <<= 3;
  if (this.endian === 'big') {
    for (var t = 8; t < this.padLength; t++)
      res[i++] = 0;

    res[i++] = 0;
    res[i++] = 0;
    res[i++] = 0;
    res[i++] = 0;
    res[i++] = (len >>> 24) & 0xff;
    res[i++] = (len >>> 16) & 0xff;
    res[i++] = (len >>> 8) & 0xff;
    res[i++] = len & 0xff;
  } else {
    res[i++] = len & 0xff;
    res[i++] = (len >>> 8) & 0xff;
    res[i++] = (len >>> 16) & 0xff;
    res[i++] = (len >>> 24) & 0xff;
    res[i++] = 0;
    res[i++] = 0;
    res[i++] = 0;
    res[i++] = 0;

    for (t = 8; t < this.padLength; t++)
      res[i++] = 0;
  }

  return res;
};


/***/ }),
/* 71 */
/***/ (function(module, exports, __webpack_require__) {

var asn1 = exports;

asn1.bignum = __webpack_require__(13);

asn1.define = __webpack_require__(288).define;
asn1.base = __webpack_require__(72);
asn1.constants = __webpack_require__(172);
asn1.decoders = __webpack_require__(294);
asn1.encoders = __webpack_require__(296);


/***/ }),
/* 72 */
/***/ (function(module, exports, __webpack_require__) {

var base = exports;

base.Reporter = __webpack_require__(291).Reporter;
base.DecoderBuffer = __webpack_require__(171).DecoderBuffer;
base.EncoderBuffer = __webpack_require__(171).EncoderBuffer;
base.Node = __webpack_require__(292);


/***/ }),
/* 73 */
/***/ (function(module, exports, __webpack_require__) {

// fallback for non-array-like ES3 and non-enumerable old V8 strings
var cof = __webpack_require__(27);
// eslint-disable-next-line no-prototype-builtins
module.exports = Object('z').propertyIsEnumerable(0) ? Object : function (it) {
  return cof(it) == 'String' ? it.split('') : Object(it);
};


/***/ }),
/* 74 */
/***/ (function(module, exports) {

exports.f = {}.propertyIsEnumerable;


/***/ }),
/* 75 */
/***/ (function(module, exports, __webpack_require__) {

// getting tag from 19.1.3.6 Object.prototype.toString()
var cof = __webpack_require__(27);
var TAG = __webpack_require__(9)('toStringTag');
// ES3 wrong here
var ARG = cof(function () { return arguments; }()) == 'Arguments';

// fallback for IE11 Script Access Denied error
var tryGet = function (it, key) {
  try {
    return it[key];
  } catch (e) { /* empty */ }
};

module.exports = function (it) {
  var O, T, B;
  return it === undefined ? 'Undefined' : it === null ? 'Null'
    // @@toStringTag case
    : typeof (T = tryGet(O = Object(it), TAG)) == 'string' ? T
    // builtinTag case
    : ARG ? cof(O)
    // ES3 arguments fallback
    : (B = cof(O)) == 'Object' && typeof O.callee == 'function' ? 'Arguments' : B;
};


/***/ }),
/* 76 */
/***/ (function(module, exports) {



/***/ }),
/* 77 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";
/* WEBPACK VAR INJECTION */(function(process) {

if (!process.version ||
    process.version.indexOf('v0.') === 0 ||
    process.version.indexOf('v1.') === 0 && process.version.indexOf('v1.8.') !== 0) {
  module.exports = nextTick;
} else {
  module.exports = process.nextTick;
}

function nextTick(fn, arg1, arg2, arg3) {
  if (typeof fn !== 'function') {
    throw new TypeError('"callback" argument must be a function');
  }
  var len = arguments.length;
  var args, i;
  switch (len) {
  case 0:
  case 1:
    return process.nextTick(fn);
  case 2:
    return process.nextTick(function afterTickOne() {
      fn.call(null, arg1);
    });
  case 3:
    return process.nextTick(function afterTickTwo() {
      fn.call(null, arg1, arg2);
    });
  case 4:
    return process.nextTick(function afterTickThree() {
      fn.call(null, arg1, arg2, arg3);
    });
  default:
    args = new Array(len - 1);
    i = 0;
    while (i < args.length) {
      args[i++] = arguments[i];
    }
    return process.nextTick(function afterTick() {
      fn.apply(null, args);
    });
  }
}

/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(41)))

/***/ }),
/* 78 */
/***/ (function(module, exports, __webpack_require__) {

var Buffer = __webpack_require__(8).Buffer
var MD5 = __webpack_require__(241)

/* eslint-disable camelcase */
function EVP_BytesToKey (password, salt, keyBits, ivLen) {
  if (!Buffer.isBuffer(password)) password = Buffer.from(password, 'binary')
  if (salt) {
    if (!Buffer.isBuffer(salt)) salt = Buffer.from(salt, 'binary')
    if (salt.length !== 8) throw new RangeError('salt should be Buffer with 8 byte length')
  }

  var keyLen = keyBits / 8
  var key = Buffer.alloc(keyLen)
  var iv = Buffer.alloc(ivLen || 0)
  var tmp = Buffer.alloc(0)

  while (keyLen > 0 || ivLen > 0) {
    var hash = new MD5()
    hash.update(tmp)
    hash.update(password)
    if (salt) hash.update(salt)
    tmp = hash.digest()

    var used = 0

    if (keyLen > 0) {
      var keyStart = key.length - keyLen
      used = Math.min(keyLen, tmp.length)
      tmp.copy(key, keyStart, 0, used)
      keyLen -= used
    }

    if (used < tmp.length && ivLen > 0) {
      var ivStart = iv.length - ivLen
      var length = Math.min(ivLen, tmp.length - used)
      tmp.copy(iv, ivStart, used, used + length)
      ivLen -= length
    }
  }

  tmp.fill(0)
  return { key: key, iv: iv }
}

module.exports = EVP_BytesToKey


/***/ }),
/* 79 */
/***/ (function(module, exports, __webpack_require__) {

// based on the aes implimentation in triple sec
// https://github.com/keybase/triplesec
// which is in turn based on the one from crypto-js
// https://code.google.com/p/crypto-js/

var Buffer = __webpack_require__(8).Buffer

function asUInt32Array (buf) {
  if (!Buffer.isBuffer(buf)) buf = Buffer.from(buf)

  var len = (buf.length / 4) | 0
  var out = new Array(len)

  for (var i = 0; i < len; i++) {
    out[i] = buf.readUInt32BE(i * 4)
  }

  return out
}

function scrubVec (v) {
  for (var i = 0; i < v.length; v++) {
    v[i] = 0
  }
}

function cryptBlock (M, keySchedule, SUB_MIX, SBOX, nRounds) {
  var SUB_MIX0 = SUB_MIX[0]
  var SUB_MIX1 = SUB_MIX[1]
  var SUB_MIX2 = SUB_MIX[2]
  var SUB_MIX3 = SUB_MIX[3]

  var s0 = M[0] ^ keySchedule[0]
  var s1 = M[1] ^ keySchedule[1]
  var s2 = M[2] ^ keySchedule[2]
  var s3 = M[3] ^ keySchedule[3]
  var t0, t1, t2, t3
  var ksRow = 4

  for (var round = 1; round < nRounds; round++) {
    t0 = SUB_MIX0[s0 >>> 24] ^ SUB_MIX1[(s1 >>> 16) & 0xff] ^ SUB_MIX2[(s2 >>> 8) & 0xff] ^ SUB_MIX3[s3 & 0xff] ^ keySchedule[ksRow++]
    t1 = SUB_MIX0[s1 >>> 24] ^ SUB_MIX1[(s2 >>> 16) & 0xff] ^ SUB_MIX2[(s3 >>> 8) & 0xff] ^ SUB_MIX3[s0 & 0xff] ^ keySchedule[ksRow++]
    t2 = SUB_MIX0[s2 >>> 24] ^ SUB_MIX1[(s3 >>> 16) & 0xff] ^ SUB_MIX2[(s0 >>> 8) & 0xff] ^ SUB_MIX3[s1 & 0xff] ^ keySchedule[ksRow++]
    t3 = SUB_MIX0[s3 >>> 24] ^ SUB_MIX1[(s0 >>> 16) & 0xff] ^ SUB_MIX2[(s1 >>> 8) & 0xff] ^ SUB_MIX3[s2 & 0xff] ^ keySchedule[ksRow++]
    s0 = t0
    s1 = t1
    s2 = t2
    s3 = t3
  }

  t0 = ((SBOX[s0 >>> 24] << 24) | (SBOX[(s1 >>> 16) & 0xff] << 16) | (SBOX[(s2 >>> 8) & 0xff] << 8) | SBOX[s3 & 0xff]) ^ keySchedule[ksRow++]
  t1 = ((SBOX[s1 >>> 24] << 24) | (SBOX[(s2 >>> 16) & 0xff] << 16) | (SBOX[(s3 >>> 8) & 0xff] << 8) | SBOX[s0 & 0xff]) ^ keySchedule[ksRow++]
  t2 = ((SBOX[s2 >>> 24] << 24) | (SBOX[(s3 >>> 16) & 0xff] << 16) | (SBOX[(s0 >>> 8) & 0xff] << 8) | SBOX[s1 & 0xff]) ^ keySchedule[ksRow++]
  t3 = ((SBOX[s3 >>> 24] << 24) | (SBOX[(s0 >>> 16) & 0xff] << 16) | (SBOX[(s1 >>> 8) & 0xff] << 8) | SBOX[s2 & 0xff]) ^ keySchedule[ksRow++]
  t0 = t0 >>> 0
  t1 = t1 >>> 0
  t2 = t2 >>> 0
  t3 = t3 >>> 0

  return [t0, t1, t2, t3]
}

// AES constants
var RCON = [0x00, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20, 0x40, 0x80, 0x1b, 0x36]
var G = (function () {
  // Compute double table
  var d = new Array(256)
  for (var j = 0; j < 256; j++) {
    if (j < 128) {
      d[j] = j << 1
    } else {
      d[j] = (j << 1) ^ 0x11b
    }
  }

  var SBOX = []
  var INV_SBOX = []
  var SUB_MIX = [[], [], [], []]
  var INV_SUB_MIX = [[], [], [], []]

  // Walk GF(2^8)
  var x = 0
  var xi = 0
  for (var i = 0; i < 256; ++i) {
    // Compute sbox
    var sx = xi ^ (xi << 1) ^ (xi << 2) ^ (xi << 3) ^ (xi << 4)
    sx = (sx >>> 8) ^ (sx & 0xff) ^ 0x63
    SBOX[x] = sx
    INV_SBOX[sx] = x

    // Compute multiplication
    var x2 = d[x]
    var x4 = d[x2]
    var x8 = d[x4]

    // Compute sub bytes, mix columns tables
    var t = (d[sx] * 0x101) ^ (sx * 0x1010100)
    SUB_MIX[0][x] = (t << 24) | (t >>> 8)
    SUB_MIX[1][x] = (t << 16) | (t >>> 16)
    SUB_MIX[2][x] = (t << 8) | (t >>> 24)
    SUB_MIX[3][x] = t

    // Compute inv sub bytes, inv mix columns tables
    t = (x8 * 0x1010101) ^ (x4 * 0x10001) ^ (x2 * 0x101) ^ (x * 0x1010100)
    INV_SUB_MIX[0][sx] = (t << 24) | (t >>> 8)
    INV_SUB_MIX[1][sx] = (t << 16) | (t >>> 16)
    INV_SUB_MIX[2][sx] = (t << 8) | (t >>> 24)
    INV_SUB_MIX[3][sx] = t

    if (x === 0) {
      x = xi = 1
    } else {
      x = x2 ^ d[d[d[x8 ^ x2]]]
      xi ^= d[d[xi]]
    }
  }

  return {
    SBOX: SBOX,
    INV_SBOX: INV_SBOX,
    SUB_MIX: SUB_MIX,
    INV_SUB_MIX: INV_SUB_MIX
  }
})()

function AES (key) {
  this._key = asUInt32Array(key)
  this._reset()
}

AES.blockSize = 4 * 4
AES.keySize = 256 / 8
AES.prototype.blockSize = AES.blockSize
AES.prototype.keySize = AES.keySize
AES.prototype._reset = function () {
  var keyWords = this._key
  var keySize = keyWords.length
  var nRounds = keySize + 6
  var ksRows = (nRounds + 1) * 4

  var keySchedule = []
  for (var k = 0; k < keySize; k++) {
    keySchedule[k] = keyWords[k]
  }

  for (k = keySize; k < ksRows; k++) {
    var t = keySchedule[k - 1]

    if (k % keySize === 0) {
      t = (t << 8) | (t >>> 24)
      t =
        (G.SBOX[t >>> 24] << 24) |
        (G.SBOX[(t >>> 16) & 0xff] << 16) |
        (G.SBOX[(t >>> 8) & 0xff] << 8) |
        (G.SBOX[t & 0xff])

      t ^= RCON[(k / keySize) | 0] << 24
    } else if (keySize > 6 && k % keySize === 4) {
      t =
        (G.SBOX[t >>> 24] << 24) |
        (G.SBOX[(t >>> 16) & 0xff] << 16) |
        (G.SBOX[(t >>> 8) & 0xff] << 8) |
        (G.SBOX[t & 0xff])
    }

    keySchedule[k] = keySchedule[k - keySize] ^ t
  }

  var invKeySchedule = []
  for (var ik = 0; ik < ksRows; ik++) {
    var ksR = ksRows - ik
    var tt = keySchedule[ksR - (ik % 4 ? 0 : 4)]

    if (ik < 4 || ksR <= 4) {
      invKeySchedule[ik] = tt
    } else {
      invKeySchedule[ik] =
        G.INV_SUB_MIX[0][G.SBOX[tt >>> 24]] ^
        G.INV_SUB_MIX[1][G.SBOX[(tt >>> 16) & 0xff]] ^
        G.INV_SUB_MIX[2][G.SBOX[(tt >>> 8) & 0xff]] ^
        G.INV_SUB_MIX[3][G.SBOX[tt & 0xff]]
    }
  }

  this._nRounds = nRounds
  this._keySchedule = keySchedule
  this._invKeySchedule = invKeySchedule
}

AES.prototype.encryptBlockRaw = function (M) {
  M = asUInt32Array(M)
  return cryptBlock(M, this._keySchedule, G.SUB_MIX, G.SBOX, this._nRounds)
}

AES.prototype.encryptBlock = function (M) {
  var out = this.encryptBlockRaw(M)
  var buf = Buffer.allocUnsafe(16)
  buf.writeUInt32BE(out[0], 0)
  buf.writeUInt32BE(out[1], 4)
  buf.writeUInt32BE(out[2], 8)
  buf.writeUInt32BE(out[3], 12)
  return buf
}

AES.prototype.decryptBlock = function (M) {
  M = asUInt32Array(M)

  // swap
  var m1 = M[1]
  M[1] = M[3]
  M[3] = m1

  var out = cryptBlock(M, this._invKeySchedule, G.INV_SUB_MIX, G.INV_SBOX, this._nRounds)
  var buf = Buffer.allocUnsafe(16)
  buf.writeUInt32BE(out[0], 0)
  buf.writeUInt32BE(out[3], 4)
  buf.writeUInt32BE(out[2], 8)
  buf.writeUInt32BE(out[1], 12)
  return buf
}

AES.prototype.scrub = function () {
  scrubVec(this._keySchedule)
  scrubVec(this._invKeySchedule)
  scrubVec(this._key)
}

module.exports.AES = AES


/***/ }),
/* 80 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var curve = exports;

curve.base = __webpack_require__(268);
curve.short = __webpack_require__(269);
curve.mont = __webpack_require__(270);
curve.edwards = __webpack_require__(271);


/***/ }),
/* 81 */
/***/ (function(module, exports, __webpack_require__) {

/* WEBPACK VAR INJECTION */(function(Buffer) {var asn1 = __webpack_require__(287)
var aesid = __webpack_require__(299)
var fixProc = __webpack_require__(300)
var ciphers = __webpack_require__(108)
var compat = __webpack_require__(155)
module.exports = parseKeys

function parseKeys (buffer) {
  var password
  if (typeof buffer === 'object' && !Buffer.isBuffer(buffer)) {
    password = buffer.passphrase
    buffer = buffer.key
  }
  if (typeof buffer === 'string') {
    buffer = new Buffer(buffer)
  }

  var stripped = fixProc(buffer, password)

  var type = stripped.tag
  var data = stripped.data
  var subtype, ndata
  switch (type) {
    case 'CERTIFICATE':
      ndata = asn1.certificate.decode(data, 'der').tbsCertificate.subjectPublicKeyInfo
      // falls through
    case 'PUBLIC KEY':
      if (!ndata) {
        ndata = asn1.PublicKey.decode(data, 'der')
      }
      subtype = ndata.algorithm.algorithm.join('.')
      switch (subtype) {
        case '1.2.840.113549.1.1.1':
          return asn1.RSAPublicKey.decode(ndata.subjectPublicKey.data, 'der')
        case '1.2.840.10045.2.1':
          ndata.subjectPrivateKey = ndata.subjectPublicKey
          return {
            type: 'ec',
            data: ndata
          }
        case '1.2.840.10040.4.1':
          ndata.algorithm.params.pub_key = asn1.DSAparam.decode(ndata.subjectPublicKey.data, 'der')
          return {
            type: 'dsa',
            data: ndata.algorithm.params
          }
        default: throw new Error('unknown key id ' + subtype)
      }
      throw new Error('unknown key type ' + type)
    case 'ENCRYPTED PRIVATE KEY':
      data = asn1.EncryptedPrivateKey.decode(data, 'der')
      data = decrypt(data, password)
      // falls through
    case 'PRIVATE KEY':
      ndata = asn1.PrivateKey.decode(data, 'der')
      subtype = ndata.algorithm.algorithm.join('.')
      switch (subtype) {
        case '1.2.840.113549.1.1.1':
          return asn1.RSAPrivateKey.decode(ndata.subjectPrivateKey, 'der')
        case '1.2.840.10045.2.1':
          return {
            curve: ndata.algorithm.curve,
            privateKey: asn1.ECPrivateKey.decode(ndata.subjectPrivateKey, 'der').privateKey
          }
        case '1.2.840.10040.4.1':
          ndata.algorithm.params.priv_key = asn1.DSAparam.decode(ndata.subjectPrivateKey, 'der')
          return {
            type: 'dsa',
            params: ndata.algorithm.params
          }
        default: throw new Error('unknown key id ' + subtype)
      }
      throw new Error('unknown key type ' + type)
    case 'RSA PUBLIC KEY':
      return asn1.RSAPublicKey.decode(data, 'der')
    case 'RSA PRIVATE KEY':
      return asn1.RSAPrivateKey.decode(data, 'der')
    case 'DSA PRIVATE KEY':
      return {
        type: 'dsa',
        params: asn1.DSAPrivateKey.decode(data, 'der')
      }
    case 'EC PRIVATE KEY':
      data = asn1.ECPrivateKey.decode(data, 'der')
      return {
        curve: data.parameters.value,
        privateKey: data.privateKey
      }
    default: throw new Error('unknown key type ' + type)
  }
}
parseKeys.signature = asn1.signature
function decrypt (data, password) {
  var salt = data.algorithm.decrypt.kde.kdeparams.salt
  var iters = parseInt(data.algorithm.decrypt.kde.kdeparams.iters.toString(), 10)
  var algo = aesid[data.algorithm.decrypt.cipher.algo.join('.')]
  var iv = data.algorithm.decrypt.cipher.iv
  var cipherText = data.subjectPrivateKey
  var keylen = parseInt(algo.split('-')[1], 10) / 8
  var key = compat.pbkdf2Sync(password, salt, iters, keylen)
  var cipher = ciphers.createDecipheriv(algo, key, iv)
  var out = []
  out.push(cipher.update(cipherText))
  out.push(cipher.final())
  return Buffer.concat(out)
}

/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(6).Buffer))

/***/ }),
/* 82 */
/***/ (function(module, exports, __webpack_require__) {

var global = __webpack_require__(3);
var SHARED = '__core-js_shared__';
var store = global[SHARED] || (global[SHARED] = {});
module.exports = function (key) {
  return store[key] || (store[key] = {});
};


/***/ }),
/* 83 */
/***/ (function(module, exports, __webpack_require__) {

// false -> Array#indexOf
// true  -> Array#includes
var toIObject = __webpack_require__(23);
var toLength = __webpack_require__(12);
var toAbsoluteIndex = __webpack_require__(50);
module.exports = function (IS_INCLUDES) {
  return function ($this, el, fromIndex) {
    var O = toIObject($this);
    var length = toLength(O.length);
    var index = toAbsoluteIndex(fromIndex, length);
    var value;
    // Array#includes uses SameValueZero equality algorithm
    // eslint-disable-next-line no-self-compare
    if (IS_INCLUDES && el != el) while (length > index) {
      value = O[index++];
      // eslint-disable-next-line no-self-compare
      if (value != value) return true;
    // Array#indexOf ignores holes, Array#includes - not
    } else for (;length > index; index++) if (IS_INCLUDES || index in O) {
      if (O[index] === el) return IS_INCLUDES || index || 0;
    } return !IS_INCLUDES && -1;
  };
};


/***/ }),
/* 84 */
/***/ (function(module, exports) {

exports.f = Object.getOwnPropertySymbols;


/***/ }),
/* 85 */
/***/ (function(module, exports, __webpack_require__) {

// 7.2.2 IsArray(argument)
var cof = __webpack_require__(27);
module.exports = Array.isArray || function isArray(arg) {
  return cof(arg) == 'Array';
};


/***/ }),
/* 86 */
/***/ (function(module, exports, __webpack_require__) {

// 7.2.8 IsRegExp(argument)
var isObject = __webpack_require__(7);
var cof = __webpack_require__(27);
var MATCH = __webpack_require__(9)('match');
module.exports = function (it) {
  var isRegExp;
  return isObject(it) && ((isRegExp = it[MATCH]) !== undefined ? !!isRegExp : cof(it) == 'RegExp');
};


/***/ }),
/* 87 */
/***/ (function(module, exports, __webpack_require__) {

var ITERATOR = __webpack_require__(9)('iterator');
var SAFE_CLOSING = false;

try {
  var riter = [7][ITERATOR]();
  riter['return'] = function () { SAFE_CLOSING = true; };
  // eslint-disable-next-line no-throw-literal
  Array.from(riter, function () { throw 2; });
} catch (e) { /* empty */ }

module.exports = function (exec, skipClosing) {
  if (!skipClosing && !SAFE_CLOSING) return false;
  var safe = false;
  try {
    var arr = [7];
    var iter = arr[ITERATOR]();
    iter.next = function () { return { done: safe = true }; };
    arr[ITERATOR] = function () { return iter; };
    exec(arr);
  } catch (e) { /* empty */ }
  return safe;
};


/***/ }),
/* 88 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// 21.2.5.3 get RegExp.prototype.flags
var anObject = __webpack_require__(2);
module.exports = function () {
  var that = anObject(this);
  var result = '';
  if (that.global) result += 'g';
  if (that.ignoreCase) result += 'i';
  if (that.multiline) result += 'm';
  if (that.unicode) result += 'u';
  if (that.sticky) result += 'y';
  return result;
};


/***/ }),
/* 89 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var hide = __webpack_require__(19);
var redefine = __webpack_require__(20);
var fails = __webpack_require__(5);
var defined = __webpack_require__(32);
var wks = __webpack_require__(9);

module.exports = function (KEY, length, exec) {
  var SYMBOL = wks(KEY);
  var fns = exec(defined, SYMBOL, ''[KEY]);
  var strfn = fns[0];
  var rxfn = fns[1];
  if (fails(function () {
    var O = {};
    O[SYMBOL] = function () { return 7; };
    return ''[KEY](O) != 7;
  })) {
    redefine(String.prototype, KEY, strfn);
    hide(RegExp.prototype, SYMBOL, length == 2
      // 21.2.5.8 RegExp.prototype[@@replace](string, replaceValue)
      // 21.2.5.11 RegExp.prototype[@@split](string, limit)
      ? function (string, arg) { return rxfn.call(string, this, arg); }
      // 21.2.5.6 RegExp.prototype[@@match](string)
      // 21.2.5.9 RegExp.prototype[@@search](string)
      : function (string) { return rxfn.call(string, this); }
    );
  }
};


/***/ }),
/* 90 */
/***/ (function(module, exports, __webpack_require__) {

// 7.3.20 SpeciesConstructor(O, defaultConstructor)
var anObject = __webpack_require__(2);
var aFunction = __webpack_require__(16);
var SPECIES = __webpack_require__(9)('species');
module.exports = function (O, D) {
  var C = anObject(O).constructor;
  var S;
  return C === undefined || (S = anObject(C)[SPECIES]) == undefined ? D : aFunction(S);
};


/***/ }),
/* 91 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var global = __webpack_require__(3);
var $export = __webpack_require__(0);
var redefine = __webpack_require__(20);
var redefineAll = __webpack_require__(56);
var meta = __webpack_require__(43);
var forOf = __webpack_require__(55);
var anInstance = __webpack_require__(54);
var isObject = __webpack_require__(7);
var fails = __webpack_require__(5);
var $iterDetect = __webpack_require__(87);
var setToStringTag = __webpack_require__(59);
var inheritIfRequired = __webpack_require__(120);

module.exports = function (NAME, wrapper, methods, common, IS_MAP, IS_WEAK) {
  var Base = global[NAME];
  var C = Base;
  var ADDER = IS_MAP ? 'set' : 'add';
  var proto = C && C.prototype;
  var O = {};
  var fixMethod = function (KEY) {
    var fn = proto[KEY];
    redefine(proto, KEY,
      KEY == 'delete' ? function (a) {
        return IS_WEAK && !isObject(a) ? false : fn.call(this, a === 0 ? 0 : a);
      } : KEY == 'has' ? function has(a) {
        return IS_WEAK && !isObject(a) ? false : fn.call(this, a === 0 ? 0 : a);
      } : KEY == 'get' ? function get(a) {
        return IS_WEAK && !isObject(a) ? undefined : fn.call(this, a === 0 ? 0 : a);
      } : KEY == 'add' ? function add(a) { fn.call(this, a === 0 ? 0 : a); return this; }
        : function set(a, b) { fn.call(this, a === 0 ? 0 : a, b); return this; }
    );
  };
  if (typeof C != 'function' || !(IS_WEAK || proto.forEach && !fails(function () {
    new C().entries().next();
  }))) {
    // create collection constructor
    C = common.getConstructor(wrapper, NAME, IS_MAP, ADDER);
    redefineAll(C.prototype, methods);
    meta.NEED = true;
  } else {
    var instance = new C();
    // early implementations not supports chaining
    var HASNT_CHAINING = instance[ADDER](IS_WEAK ? {} : -0, 1) != instance;
    // V8 ~  Chromium 40- weak-collections throws on primitives, but should return false
    var THROWS_ON_PRIMITIVES = fails(function () { instance.has(1); });
    // most early implementations doesn't supports iterables, most modern - not close it correctly
    var ACCEPT_ITERABLES = $iterDetect(function (iter) { new C(iter); }); // eslint-disable-line no-new
    // for early implementations -0 and +0 not the same
    var BUGGY_ZERO = !IS_WEAK && fails(function () {
      // V8 ~ Chromium 42- fails only with 5+ elements
      var $instance = new C();
      var index = 5;
      while (index--) $instance[ADDER](index, index);
      return !$instance.has(-0);
    });
    if (!ACCEPT_ITERABLES) {
      C = wrapper(function (target, iterable) {
        anInstance(target, C, NAME);
        var that = inheritIfRequired(new Base(), target, C);
        if (iterable != undefined) forOf(iterable, IS_MAP, that[ADDER], that);
        return that;
      });
      C.prototype = proto;
      proto.constructor = C;
    }
    if (THROWS_ON_PRIMITIVES || BUGGY_ZERO) {
      fixMethod('delete');
      fixMethod('has');
      IS_MAP && fixMethod('get');
    }
    if (BUGGY_ZERO || HASNT_CHAINING) fixMethod(ADDER);
    // weak collections should not contains .clear method
    if (IS_WEAK && proto.clear) delete proto.clear;
  }

  setToStringTag(C, NAME);

  O[NAME] = C;
  $export($export.G + $export.W + $export.F * (C != Base), O);

  if (!IS_WEAK) common.setStrong(C, NAME, IS_MAP);

  return C;
};


/***/ }),
/* 92 */
/***/ (function(module, exports, __webpack_require__) {

var global = __webpack_require__(3);
var hide = __webpack_require__(19);
var uid = __webpack_require__(47);
var TYPED = uid('typed_array');
var VIEW = uid('view');
var ABV = !!(global.ArrayBuffer && global.DataView);
var CONSTR = ABV;
var i = 0;
var l = 9;
var Typed;

var TypedArrayConstructors = (
  'Int8Array,Uint8Array,Uint8ClampedArray,Int16Array,Uint16Array,Int32Array,Uint32Array,Float32Array,Float64Array'
).split(',');

while (i < l) {
  if (Typed = global[TypedArrayConstructors[i++]]) {
    hide(Typed.prototype, TYPED, true);
    hide(Typed.prototype, VIEW, true);
  } else CONSTR = false;
}

module.exports = {
  ABV: ABV,
  CONSTR: CONSTR,
  TYPED: TYPED,
  VIEW: VIEW
};


/***/ }),
/* 93 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// Forced replacement prototype accessors methods
module.exports = __webpack_require__(48) || !__webpack_require__(5)(function () {
  var K = Math.random();
  // In FF throws only define methods
  // eslint-disable-next-line no-undef, no-useless-call
  __defineSetter__.call(null, K, function () { /* empty */ });
  delete __webpack_require__(3)[K];
});


/***/ }),
/* 94 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// https://tc39.github.io/proposal-setmap-offrom/
var $export = __webpack_require__(0);

module.exports = function (COLLECTION) {
  $export($export.S, COLLECTION, { of: function of() {
    var length = arguments.length;
    var A = Array(length);
    while (length--) A[length] = arguments[length];
    return new this(A);
  } });
};


/***/ }),
/* 95 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// https://tc39.github.io/proposal-setmap-offrom/
var $export = __webpack_require__(0);
var aFunction = __webpack_require__(16);
var ctx = __webpack_require__(26);
var forOf = __webpack_require__(55);

module.exports = function (COLLECTION) {
  $export($export.S, COLLECTION, { from: function from(source /* , mapFn, thisArg */) {
    var mapFn = arguments[1];
    var mapping, A, n, cb;
    aFunction(this);
    mapping = mapFn !== undefined;
    if (mapping) aFunction(mapFn);
    if (source == undefined) return new this();
    A = [];
    if (mapping) {
      n = 0;
      cb = ctx(mapFn, arguments[2], 2);
      forOf(source, false, function (nextItem) {
        A.push(cb(nextItem, n++));
      });
    } else {
      forOf(source, false, A.push, A);
    }
    return new this(A);
  } });
};


/***/ }),
/* 96 */
/***/ (function(module, exports, __webpack_require__) {

;(function (root, factory) {
	if (true) {
		// CommonJS
		module.exports = exports = factory(__webpack_require__(4));
	}
	else if (typeof define === "function" && define.amd) {
		// AMD
		define(["./core"], factory);
	}
	else {
		// Global (browser)
		factory(root.CryptoJS);
	}
}(this, function (CryptoJS) {

	(function (undefined) {
	    // Shortcuts
	    var C = CryptoJS;
	    var C_lib = C.lib;
	    var Base = C_lib.Base;
	    var X32WordArray = C_lib.WordArray;

	    /**
	     * x64 namespace.
	     */
	    var C_x64 = C.x64 = {};

	    /**
	     * A 64-bit word.
	     */
	    var X64Word = C_x64.Word = Base.extend({
	        /**
	         * Initializes a newly created 64-bit word.
	         *
	         * @param {number} high The high 32 bits.
	         * @param {number} low The low 32 bits.
	         *
	         * @example
	         *
	         *     var x64Word = CryptoJS.x64.Word.create(0x00010203, 0x04050607);
	         */
	        init: function (high, low) {
	            this.high = high;
	            this.low = low;
	        }

	        /**
	         * Bitwise NOTs this word.
	         *
	         * @return {X64Word} A new x64-Word object after negating.
	         *
	         * @example
	         *
	         *     var negated = x64Word.not();
	         */
	        // not: function () {
	            // var high = ~this.high;
	            // var low = ~this.low;

	            // return X64Word.create(high, low);
	        // },

	        /**
	         * Bitwise ANDs this word with the passed word.
	         *
	         * @param {X64Word} word The x64-Word to AND with this word.
	         *
	         * @return {X64Word} A new x64-Word object after ANDing.
	         *
	         * @example
	         *
	         *     var anded = x64Word.and(anotherX64Word);
	         */
	        // and: function (word) {
	            // var high = this.high & word.high;
	            // var low = this.low & word.low;

	            // return X64Word.create(high, low);
	        // },

	        /**
	         * Bitwise ORs this word with the passed word.
	         *
	         * @param {X64Word} word The x64-Word to OR with this word.
	         *
	         * @return {X64Word} A new x64-Word object after ORing.
	         *
	         * @example
	         *
	         *     var ored = x64Word.or(anotherX64Word);
	         */
	        // or: function (word) {
	            // var high = this.high | word.high;
	            // var low = this.low | word.low;

	            // return X64Word.create(high, low);
	        // },

	        /**
	         * Bitwise XORs this word with the passed word.
	         *
	         * @param {X64Word} word The x64-Word to XOR with this word.
	         *
	         * @return {X64Word} A new x64-Word object after XORing.
	         *
	         * @example
	         *
	         *     var xored = x64Word.xor(anotherX64Word);
	         */
	        // xor: function (word) {
	            // var high = this.high ^ word.high;
	            // var low = this.low ^ word.low;

	            // return X64Word.create(high, low);
	        // },

	        /**
	         * Shifts this word n bits to the left.
	         *
	         * @param {number} n The number of bits to shift.
	         *
	         * @return {X64Word} A new x64-Word object after shifting.
	         *
	         * @example
	         *
	         *     var shifted = x64Word.shiftL(25);
	         */
	        // shiftL: function (n) {
	            // if (n < 32) {
	                // var high = (this.high << n) | (this.low >>> (32 - n));
	                // var low = this.low << n;
	            // } else {
	                // var high = this.low << (n - 32);
	                // var low = 0;
	            // }

	            // return X64Word.create(high, low);
	        // },

	        /**
	         * Shifts this word n bits to the right.
	         *
	         * @param {number} n The number of bits to shift.
	         *
	         * @return {X64Word} A new x64-Word object after shifting.
	         *
	         * @example
	         *
	         *     var shifted = x64Word.shiftR(7);
	         */
	        // shiftR: function (n) {
	            // if (n < 32) {
	                // var low = (this.low >>> n) | (this.high << (32 - n));
	                // var high = this.high >>> n;
	            // } else {
	                // var low = this.high >>> (n - 32);
	                // var high = 0;
	            // }

	            // return X64Word.create(high, low);
	        // },

	        /**
	         * Rotates this word n bits to the left.
	         *
	         * @param {number} n The number of bits to rotate.
	         *
	         * @return {X64Word} A new x64-Word object after rotating.
	         *
	         * @example
	         *
	         *     var rotated = x64Word.rotL(25);
	         */
	        // rotL: function (n) {
	            // return this.shiftL(n).or(this.shiftR(64 - n));
	        // },

	        /**
	         * Rotates this word n bits to the right.
	         *
	         * @param {number} n The number of bits to rotate.
	         *
	         * @return {X64Word} A new x64-Word object after rotating.
	         *
	         * @example
	         *
	         *     var rotated = x64Word.rotR(7);
	         */
	        // rotR: function (n) {
	            // return this.shiftR(n).or(this.shiftL(64 - n));
	        // },

	        /**
	         * Adds this word with the passed word.
	         *
	         * @param {X64Word} word The x64-Word to add with this word.
	         *
	         * @return {X64Word} A new x64-Word object after adding.
	         *
	         * @example
	         *
	         *     var added = x64Word.add(anotherX64Word);
	         */
	        // add: function (word) {
	            // var low = (this.low + word.low) | 0;
	            // var carry = (low >>> 0) < (this.low >>> 0) ? 1 : 0;
	            // var high = (this.high + word.high + carry) | 0;

	            // return X64Word.create(high, low);
	        // }
	    });

	    /**
	     * An array of 64-bit words.
	     *
	     * @property {Array} words The array of CryptoJS.x64.Word objects.
	     * @property {number} sigBytes The number of significant bytes in this word array.
	     */
	    var X64WordArray = C_x64.WordArray = Base.extend({
	        /**
	         * Initializes a newly created word array.
	         *
	         * @param {Array} words (Optional) An array of CryptoJS.x64.Word objects.
	         * @param {number} sigBytes (Optional) The number of significant bytes in the words.
	         *
	         * @example
	         *
	         *     var wordArray = CryptoJS.x64.WordArray.create();
	         *
	         *     var wordArray = CryptoJS.x64.WordArray.create([
	         *         CryptoJS.x64.Word.create(0x00010203, 0x04050607),
	         *         CryptoJS.x64.Word.create(0x18191a1b, 0x1c1d1e1f)
	         *     ]);
	         *
	         *     var wordArray = CryptoJS.x64.WordArray.create([
	         *         CryptoJS.x64.Word.create(0x00010203, 0x04050607),
	         *         CryptoJS.x64.Word.create(0x18191a1b, 0x1c1d1e1f)
	         *     ], 10);
	         */
	        init: function (words, sigBytes) {
	            words = this.words = words || [];

	            if (sigBytes != undefined) {
	                this.sigBytes = sigBytes;
	            } else {
	                this.sigBytes = words.length * 8;
	            }
	        },

	        /**
	         * Converts this 64-bit word array to a 32-bit word array.
	         *
	         * @return {CryptoJS.lib.WordArray} This word array's data as a 32-bit word array.
	         *
	         * @example
	         *
	         *     var x32WordArray = x64WordArray.toX32();
	         */
	        toX32: function () {
	            // Shortcuts
	            var x64Words = this.words;
	            var x64WordsLength = x64Words.length;

	            // Convert
	            var x32Words = [];
	            for (var i = 0; i < x64WordsLength; i++) {
	                var x64Word = x64Words[i];
	                x32Words.push(x64Word.high);
	                x32Words.push(x64Word.low);
	            }

	            return X32WordArray.create(x32Words, this.sigBytes);
	        },

	        /**
	         * Creates a copy of this word array.
	         *
	         * @return {X64WordArray} The clone.
	         *
	         * @example
	         *
	         *     var clone = x64WordArray.clone();
	         */
	        clone: function () {
	            var clone = Base.clone.call(this);

	            // Clone "words" array
	            var words = clone.words = this.words.slice(0);

	            // Clone each X64Word object
	            var wordsLength = words.length;
	            for (var i = 0; i < wordsLength; i++) {
	                words[i] = words[i].clone();
	            }

	            return clone;
	        }
	    });
	}());


	return CryptoJS;

}));

/***/ }),
/* 97 */
/***/ (function(module, exports, __webpack_require__) {

var Curl = __webpack_require__(40);
var Kerl = __webpack_require__(63);
var Converter = __webpack_require__(36);

/**
*
*   @constructor bundle
**/
function Bundle() {

    // Declare empty bundle
    this.bundle = [];
}

/**
*
*
**/

Bundle.prototype.addEntry = function(signatureMessageLength, address, value, tag, timestamp, index) {

    for (var i = 0; i < signatureMessageLength; i++) {

        var transactionObject = new Object();
        transactionObject.address = address;
        transactionObject.value = i == 0 ? value : 0;
        transactionObject.tag = tag;
        transactionObject.timestamp = timestamp;

        this.bundle[this.bundle.length] = transactionObject;
    }
}

/**
*
*
**/
Bundle.prototype.addTrytes = function(signatureFragments) {

    var emptySignatureFragment = '';
    var emptyHash = '999999999999999999999999999999999999999999999999999999999999999999999999999999999';

    for (var j = 0; emptySignatureFragment.length < 2187; j++) {
        emptySignatureFragment += '9';
    }

    for (var i = 0; i < this.bundle.length; i++) {

        // Fill empty signatureMessageFragment
        this.bundle[i].signatureMessageFragment = signatureFragments[i] ? signatureFragments[i] : emptySignatureFragment;

        // Fill empty trunkTransaction
        this.bundle[i].trunkTransaction = emptyHash;

        // Fill empty branchTransaction
        this.bundle[i].branchTransaction = emptyHash;

        // Fill empty nonce
        this.bundle[i].nonce = emptyHash;
    }
}


/**
*
*
**/
Bundle.prototype.finalize = function() {

    var kerl = new Kerl();
    kerl.initialize();

    for (var i = 0; i < this.bundle.length; i++) {

        var valueTrits = Converter.trits(this.bundle[i].value);
        while (valueTrits.length < 81) {
            valueTrits[valueTrits.length] = 0;
        }

        var timestampTrits = Converter.trits(this.bundle[i].timestamp);
        while (timestampTrits.length < 27) {
            timestampTrits[timestampTrits.length] = 0;
        }

        var currentIndexTrits = Converter.trits(this.bundle[i].currentIndex = i);
        while (currentIndexTrits.length < 27) {
            currentIndexTrits[currentIndexTrits.length] = 0;
        }

        var lastIndexTrits = Converter.trits(this.bundle[i].lastIndex = this.bundle.length - 1);
        while (lastIndexTrits.length < 27) {
            lastIndexTrits[lastIndexTrits.length] = 0;
        }

        var bundleEssence = Converter.trits(this.bundle[i].address + Converter.trytes(valueTrits) + this.bundle[i].tag + Converter.trytes(timestampTrits) + Converter.trytes(currentIndexTrits) + Converter.trytes(lastIndexTrits));
        kerl.absorb(bundleEssence, 0, bundleEssence.length);
    }

    var hash = [];
    kerl.squeeze(hash, 0, Curl.HASH_LENGTH);
    hash = Converter.trytes(hash);

    for (var i = 0; i < this.bundle.length; i++) {

        this.bundle[i].bundle = hash;
    }
}

/**
*   Normalizes the bundle hash
*
**/
Bundle.prototype.normalizedBundle = function(bundleHash) {

    var normalizedBundle = [];

    for (var i = 0; i < 3; i++) {

        var sum = 0;
        for (var j = 0; j < 27; j++) {

            sum += (normalizedBundle[i * 27 + j] = Converter.value(Converter.trits(bundleHash.charAt(i * 27 + j))));
        }

        if (sum >= 0) {

            while (sum-- > 0) {

                for (var j = 0; j < 27; j++) {

                    if (normalizedBundle[i * 27 + j] > -13) {

                        normalizedBundle[i * 27 + j]--;
                        break;
                    }
                }
            }
        } else {

            while (sum++ < 0) {

                for (var j = 0; j < 27; j++) {

                    if (normalizedBundle[i * 27 + j] < 13) {

                        normalizedBundle[i * 27 + j]++;
                        break;
                    }
                }
            }
        }
    }

    return normalizedBundle;
}

module.exports = Bundle;


/***/ }),
/* 98 */
/***/ (function(module, exports, __webpack_require__) {

var Curl = __webpack_require__(40);
var Kerl = __webpack_require__(63);
var Converter = __webpack_require__(36);
var Bundle = __webpack_require__(97);
var add = __webpack_require__(141);
var oldSigning = __webpack_require__(533);
var errors = __webpack_require__(142);

/**
*           Signing related functions
*
**/
var key = function(seed, index, length) {

    while ((seed.length % 243) !== 0) {
      seed.push(0);
    }

    var indexTrits = Converter.fromValue( index );
    var subseed = add( seed.slice( ), indexTrits );

    var kerl = new Kerl( );

    kerl.initialize( );
    kerl.absorb(subseed, 0, subseed.length);
    kerl.squeeze(subseed, 0, subseed.length);

    kerl.reset( );
    kerl.absorb(subseed, 0, subseed.length);

    var key = [], offset = 0, buffer = [];

    while (length-- > 0) {

        for (var i = 0; i < 27; i++) {

            kerl.squeeze(buffer, 0, subseed.length);
            for (var j = 0; j < 243; j++) {

                key[offset++] = buffer[j];
            }
        }
    }
    return key;
}

/**
*
*
**/
var digests = function(key) {

    var digests = [], buffer = [];

    for (var i = 0; i < Math.floor(key.length / 6561); i++) {

        var keyFragment = key.slice(i * 6561, (i + 1) * 6561);

        for (var j = 0; j < 27; j++) {

            buffer = keyFragment.slice(j * 243, (j + 1) * 243);

            for (var k = 0; k < 26; k++) {

                var kKerl = new Kerl();
                kKerl.initialize();
                kKerl.absorb(buffer, 0, buffer.length);
                kKerl.squeeze(buffer, 0, Curl.HASH_LENGTH);
            }

            for (var k = 0; k < 243; k++) {

                keyFragment[j * 243 + k] = buffer[k];
            }
        }

        var kerl = new Kerl()

        kerl.initialize();
        kerl.absorb(keyFragment, 0, keyFragment.length);
        kerl.squeeze(buffer, 0, Curl.HASH_LENGTH);

        for (var j = 0; j < 243; j++) {

            digests[i * 243 + j] = buffer[j];
        }
    }
    return digests;
}

/**
*
*
**/
var address = function(digests) {

    var addressTrits = [];

    var kerl = new Kerl();

    kerl.initialize();
    kerl.absorb(digests, 0, digests.length);
    kerl.squeeze(addressTrits, 0, Curl.HASH_LENGTH);

    return addressTrits;
}

/**
*
*
**/
var digest = function(normalizedBundleFragment, signatureFragment) {

    var buffer = []

    var kerl = new Kerl();

    kerl.initialize();

    for (var i = 0; i< 27; i++) {
        buffer = signatureFragment.slice(i * 243, (i + 1) * 243);

        for (var j = normalizedBundleFragment[i] + 13; j-- > 0; ) {

            var jKerl = new Kerl();

            jKerl.initialize();
            jKerl.absorb(buffer, 0, buffer.length);
            jKerl.squeeze(buffer, 0, Curl.HASH_LENGTH);
        }

        kerl.absorb(buffer, 0, buffer.length);
    }

    kerl.squeeze(buffer, 0, Curl.HASH_LENGTH);
    return buffer;
}

/**
*
*
**/
var signatureFragment = function(normalizedBundleFragment, keyFragment) {

    var signatureFragment = keyFragment.slice(), hash = [];

    var kerl = new Kerl();

    for (var i = 0; i < 27; i++) {

        hash = signatureFragment.slice(i * 243, (i + 1) * 243);

        for (var j = 0; j < 13 - normalizedBundleFragment[i]; j++) {

            kerl.initialize();
            kerl.reset();
            kerl.absorb(hash, 0, hash.length);
            kerl.squeeze(hash, 0, Curl.HASH_LENGTH);
        }

        for (var j = 0; j < 243; j++) {

            signatureFragment[i * 243 + j] = hash[j];
        }
    }

    return signatureFragment;
}

/**
*
*
**/
var validateSignatures = function(expectedAddress, signatureFragments, bundleHash) {
    if (!bundleHash) {
        throw errors.invalidBundleHash();
    }

    var self = this;
    var bundle = new Bundle();

    var normalizedBundleFragments = [];
    var normalizedBundleHash = bundle.normalizedBundle(bundleHash);

    // Split hash into 3 fragments
    for (var i = 0; i < 3; i++) {
        normalizedBundleFragments[i] = normalizedBundleHash.slice(i * 27, (i + 1) * 27);
    }

    // Get digests
    var digests = [];

    for (var i = 0; i < signatureFragments.length; i++) {

        var digestBuffer = digest(normalizedBundleFragments[i % 3], Converter.trits(signatureFragments[i]));

        for (var j = 0; j < 243; j++) {

            digests[i * 243 + j] = digestBuffer[j]
        }
    }

    var address = Converter.trytes(self.address(digests));

    return (expectedAddress === address);
}


module.exports = {
    key                 : key,
    digests             : digests,
    address             : address,
    digest              : digest,
    signatureFragment   : signatureFragment,
    validateSignatures  : validateSignatures
}


/***/ }),
/* 99 */
/***/ (function(module, exports) {

/**
*   checks if input is correct address
*
*   @method isAddress
*   @param {string} address
*   @returns {boolean}
**/
var isAddress = function(address) {
    // TODO: In the future check checksum

    // Check if address with checksum
    if (address.length === 90) {

        if (!isTrytes(address, 90)) {
            return false;
        }
    } else {

        if (!isTrytes(address, 81)) {
            return false;
        }
    }

    return true;
}

/**
*   checks if input is correct trytes consisting of A-Z9
*   optionally validate length
*
*   @method isTrytes
*   @param {string} trytes
*   @param {integer} length optional
*   @returns {boolean}
**/
var isTrytes = function(trytes, length) {

    // If no length specified, just validate the trytes
    if (!length) length = "0,"

    var regexTrytes = new RegExp("^[9A-Z]{" + length +"}$");
    return regexTrytes.test(trytes) && isString(trytes);
}

/**
*   checks if input is correct trytes consisting of A-Z9
*   optionally validate length
*
*   @method isNinesTrytes
*   @param {string} trytes
*   @returns {boolean}
**/
var isNinesTrytes = function(trytes) {

    return /^[9]+$/.test(trytes) && isString(trytes);
}

/**
*   checks if integer value
*
*   @method isValue
*   @param {string} value
*   @returns {boolean}
**/
var isValue = function(value) {

    // check if correct number
    return Number.isInteger(value)
}

/**
*   checks whether input is a value or not. Can be a string, float or integer
*
*   @method isNum
*   @param {int}
*   @returns {boolean}
**/
var isNum = function(input) {

    return /^(\d+\.?\d{0,15}|\.\d{0,15})$/.test(input);
}

/**
*   checks if input is correct hash
*
*   @method isHash
*   @param {string} hash
*   @returns {boolean}
**/
var isHash = function(hash) {

    // Check if valid, 81 trytes
    if (!isTrytes(hash, 81)) {

        return false;
    }

    return true;
}

/**
*   checks whether input is a string or not
*
*   @method isString
*   @param {string}
*   @returns {boolean}
**/
var isString = function(string) {

    return typeof string === 'string';
}


/**
*   checks whether input is an array or not
*
*   @method isArray
*   @param {object}
*   @returns {boolean}
**/
var isArray = function(array) {

    return array instanceof Array;
}


/**
*   checks whether input is object or not
*
*   @method isObject
*   @param {object}
*   @returns {boolean}
**/
var isObject = function(object) {

    return typeof object === 'object';
}



/**
*   checks if input is correct hash
*
*   @method isTransfersArray
*   @param {array} hash
*   @returns {boolean}
**/
var isTransfersArray = function(transfersArray) {

    if (!isArray(transfersArray)) return false;

    for (var i = 0; i < transfersArray.length; i++) {

        var transfer = transfersArray[i];

        // Check if valid address
        var address = transfer.address;
        if (!isAddress(address)) {
            return false;
        }

        // Validity check for value
        var value = transfer.value;
        if (!isValue(value)) {
            return false;
        }

        // Check if message is correct trytes of any length
        var message = transfer.message;
        if (!isTrytes(message, "0,")) {
            return false;
        }

        // Check if tag is correct trytes of {0,27} trytes
        var tag = transfer.tag;
        if (!isTrytes(tag, "0,27")) {
            return false;
        }

    }

    return true;
}

/**
*   checks if input is list of correct trytes
*
*   @method isArrayOfHashes
*   @param {list} hashesArray
*   @returns {boolean}
**/
var isArrayOfHashes = function(hashesArray) {

    if (!isArray(hashesArray)) return false;

    for (var i = 0; i < hashesArray.length; i++) {

        var hash = hashesArray[i];

        // Check if address with checksum
        if (hash.length === 90) {

            if (!isTrytes(hash, 90)) {
                return false;
            }
        } else {

            if (!isTrytes(hash, 81)) {
                return false;
            }
        }
    }

    return true;
}

/**
*   checks if input is list of correct trytes
*
*   @method isArrayOfTrytes
*   @param {list} trytesArray
*   @returns {boolean}
**/
var isArrayOfTrytes = function(trytesArray) {

    if (!isArray(trytesArray)) return false;

    for (var i = 0; i < trytesArray.length; i++) {

        var tryteValue = trytesArray[i];

        // Check if correct 2673 trytes
        if (!isTrytes(tryteValue, 2673)) {
            return false;
        }
    }

    return true;
}

/**
*   checks if attached trytes if last 241 trytes are non-zero
*
*   @method isArrayOfAttachedTrytes
*   @param {array} trytesArray
*   @returns {boolean}
**/
var isArrayOfAttachedTrytes = function(trytesArray) {

    if (!isArray(trytesArray)) return false;

    for (var i = 0; i < trytesArray.length; i++) {

        var tryteValue = trytesArray[i];

        // Check if correct 2673 trytes
        if (!isTrytes(tryteValue, 2673)) {
            return false;
        }

        var lastTrytes = tryteValue.slice(2673 - (3 * 81));

        if (/^[9]+$/.test(lastTrytes)) {
            return false;
        }
    }

    return true;
}

/**
*   checks if correct bundle with transaction object
*
*   @method isArrayOfTxObjects
*   @param {array} bundle
*   @returns {boolean}
**/
var isArrayOfTxObjects = function(bundle) {

    if (!isArray(bundle) || bundle.length === 0) return false;

    var validArray = true;

    bundle.forEach(function(txObject) {

        var keysToValidate = [
            {
                key: 'hash',
                validator: isHash,
                args: null
            }, {
                key: 'signatureMessageFragment',
                validator: isTrytes,
                args: 2187
            }, {
                key: 'address',
                validator: isHash,
                args: null
            }, {
                key: 'value',
                validator: isValue,
                args: null
            }, {
                key: 'obsoleteTag',
                validator: isTrytes,
                args: 27
            }, {
                key: 'timestamp',
                validator: isValue,
                args: null
            }, {
                key: 'currentIndex',
                validator: isValue,
                args: null
            },{
                key: 'lastIndex',
                validator: isValue,
                args: null
            }, {
                key: 'bundle',
                validator: isHash,
                args: null
            }, {
                key: 'trunkTransaction',
                validator: isHash,
                args: null
            }, {
                key: 'branchTransaction',
                validator: isHash,
                args: null
            }, {
                key: 'tag',
                validator: isTrytes,
                args: 27
            }, {
                key: 'attachmentTimestamp',
                validator: isValue,
                args: null
            }, {
                key: 'attachmentTimestampLowerBound',
                validator: isValue,
                args: null
            }, {
                key: 'attachmentTimestampUpperBound',
                validator: isValue,
                args: null
            }, {
                key: 'nonce',
                validator: isTrytes,
                args: 27
            }
        ]

        for (var i = 0; i < keysToValidate.length; i++) {

            var key = keysToValidate[i].key;
            var validator = keysToValidate[i].validator;
            var args = keysToValidate[i].args

            // If input does not have keyIndex and address, return false
            if (!txObject.hasOwnProperty(key)) {
                validArray = false;
                break;
            }

            // If input validator function does not return true, exit
            if (!validator(txObject[key], args)) {
                validArray = false;
                break;
            }
        }
    })

    return validArray;
}

/**
*   checks if correct inputs list
*
*   @method isInputs
*   @param {array} inputs
*   @returns {boolean}
**/
var isInputs = function(inputs) {

    if (!isArray(inputs)) return false;

    for (var i = 0; i < inputs.length; i++) {

        var input = inputs[i];

        // If input does not have keyIndex and address, return false
        if (!input.hasOwnProperty('security') || !input.hasOwnProperty('keyIndex') || !input.hasOwnProperty('address')) return false;

        if (!isAddress(input.address)) {
            return false;
        }

        if (!isValue(input.security)) {
            return false;
        }

        if (!isValue(input.keyIndex)) {
            return false;
        }
    }

    return true;
}

/**
*   Checks that a given uri is valid
*
*   Valid Examples:
*   udp://[2001:db8:a0b:12f0::1]:14265
*   udp://[2001:db8:a0b:12f0::1]
*   udp://8.8.8.8:14265
*   udp://domain.com
*   udp://domain2.com:14265
*
*   @method isUri
*   @param {string} node
*   @returns {bool} valid
**/
var isUri = function(node) {

    var getInside = /^(udp|tcp):\/\/([\[][^\]\.]*[\]]|[^\[\]:]*)[:]{0,1}([0-9]{1,}$|$)/i;

    var stripBrackets = /[\[]{0,1}([^\[\]]*)[\]]{0,1}/;

    var uriTest = /((^\s*((([0-9]|[1-9][0-9]|1[0-9]{2}|2[0-4][0-9]|25[0-5])\.){3}([0-9]|[1-9][0-9]|1[0-9]{2}|2[0-4][0-9]|25[0-5]))\s*$)|(^\s*((([0-9A-Fa-f]{1,4}:){7}([0-9A-Fa-f]{1,4}|:))|(([0-9A-Fa-f]{1,4}:){6}(:[0-9A-Fa-f]{1,4}|((25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(\.(25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(([0-9A-Fa-f]{1,4}:){5}(((:[0-9A-Fa-f]{1,4}){1,2})|:((25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(\.(25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(([0-9A-Fa-f]{1,4}:){4}(((:[0-9A-Fa-f]{1,4}){1,3})|((:[0-9A-Fa-f]{1,4})?:((25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(\.(25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(([0-9A-Fa-f]{1,4}:){3}(((:[0-9A-Fa-f]{1,4}){1,4})|((:[0-9A-Fa-f]{1,4}){0,2}:((25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(\.(25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(([0-9A-Fa-f]{1,4}:){2}(((:[0-9A-Fa-f]{1,4}){1,5})|((:[0-9A-Fa-f]{1,4}){0,3}:((25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(\.(25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(([0-9A-Fa-f]{1,4}:){1}(((:[0-9A-Fa-f]{1,4}){1,6})|((:[0-9A-Fa-f]{1,4}){0,4}:((25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(\.(25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(:(((:[0-9A-Fa-f]{1,4}){1,7})|((:[0-9A-Fa-f]{1,4}){0,5}:((25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(\.(25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:)))(%.+)?\s*$))|(^\s*((?=.{1,255}$)(?=.*[A-Za-z].*)[0-9A-Za-z](?:(?:[0-9A-Za-z]|\b-){0,61}[0-9A-Za-z])?(?:\.[0-9A-Za-z](?:(?:[0-9A-Za-z]|\b-){0,61}[0-9A-Za-z])?)*)\s*$)/;

    if(!getInside.test(node)) {
        return false;
    }

    return uriTest.test(stripBrackets.exec(getInside.exec(node)[1])[1]);
}

module.exports = {
    isAddress: isAddress,
    isTrytes: isTrytes,
    isNinesTrytes: isNinesTrytes,
    isValue: isValue,
    isHash: isHash,
    isTransfersArray: isTransfersArray,
    isArrayOfHashes: isArrayOfHashes,
    isArrayOfTrytes: isArrayOfTrytes,
    isArrayOfAttachedTrytes: isArrayOfAttachedTrytes,
    isArrayOfTxObjects: isArrayOfTxObjects,
    isInputs: isInputs,
    isString: isString,
    isNum: isNum,
    isArray: isArray,
    isObject: isObject,
    isUri: isUri
}


/***/ }),
/* 100 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

/*
 * A JavaScript implementation of the RSA Data Security, Inc. MD5 Message
 * Digest Algorithm, as defined in RFC 1321.
 * Version 2.1 Copyright (C) Paul Johnston 1999 - 2002.
 * Other contributors: Greg Holt, Andrew Kepert, Ydnar, Lostinet
 * Distributed under the BSD License
 * See http://pajhome.org.uk/crypt/md5 for more info.
 */

var makeHash = __webpack_require__(222)

/*
 * Calculate the MD5 of an array of little-endian words, and a bit length
 */
function core_md5 (x, len) {
  /* append padding */
  x[len >> 5] |= 0x80 << ((len) % 32)
  x[(((len + 64) >>> 9) << 4) + 14] = len

  var a = 1732584193
  var b = -271733879
  var c = -1732584194
  var d = 271733878

  for (var i = 0; i < x.length; i += 16) {
    var olda = a
    var oldb = b
    var oldc = c
    var oldd = d

    a = md5_ff(a, b, c, d, x[i + 0], 7, -680876936)
    d = md5_ff(d, a, b, c, x[i + 1], 12, -389564586)
    c = md5_ff(c, d, a, b, x[i + 2], 17, 606105819)
    b = md5_ff(b, c, d, a, x[i + 3], 22, -1044525330)
    a = md5_ff(a, b, c, d, x[i + 4], 7, -176418897)
    d = md5_ff(d, a, b, c, x[i + 5], 12, 1200080426)
    c = md5_ff(c, d, a, b, x[i + 6], 17, -1473231341)
    b = md5_ff(b, c, d, a, x[i + 7], 22, -45705983)
    a = md5_ff(a, b, c, d, x[i + 8], 7, 1770035416)
    d = md5_ff(d, a, b, c, x[i + 9], 12, -1958414417)
    c = md5_ff(c, d, a, b, x[i + 10], 17, -42063)
    b = md5_ff(b, c, d, a, x[i + 11], 22, -1990404162)
    a = md5_ff(a, b, c, d, x[i + 12], 7, 1804603682)
    d = md5_ff(d, a, b, c, x[i + 13], 12, -40341101)
    c = md5_ff(c, d, a, b, x[i + 14], 17, -1502002290)
    b = md5_ff(b, c, d, a, x[i + 15], 22, 1236535329)

    a = md5_gg(a, b, c, d, x[i + 1], 5, -165796510)
    d = md5_gg(d, a, b, c, x[i + 6], 9, -1069501632)
    c = md5_gg(c, d, a, b, x[i + 11], 14, 643717713)
    b = md5_gg(b, c, d, a, x[i + 0], 20, -373897302)
    a = md5_gg(a, b, c, d, x[i + 5], 5, -701558691)
    d = md5_gg(d, a, b, c, x[i + 10], 9, 38016083)
    c = md5_gg(c, d, a, b, x[i + 15], 14, -660478335)
    b = md5_gg(b, c, d, a, x[i + 4], 20, -405537848)
    a = md5_gg(a, b, c, d, x[i + 9], 5, 568446438)
    d = md5_gg(d, a, b, c, x[i + 14], 9, -1019803690)
    c = md5_gg(c, d, a, b, x[i + 3], 14, -187363961)
    b = md5_gg(b, c, d, a, x[i + 8], 20, 1163531501)
    a = md5_gg(a, b, c, d, x[i + 13], 5, -1444681467)
    d = md5_gg(d, a, b, c, x[i + 2], 9, -51403784)
    c = md5_gg(c, d, a, b, x[i + 7], 14, 1735328473)
    b = md5_gg(b, c, d, a, x[i + 12], 20, -1926607734)

    a = md5_hh(a, b, c, d, x[i + 5], 4, -378558)
    d = md5_hh(d, a, b, c, x[i + 8], 11, -2022574463)
    c = md5_hh(c, d, a, b, x[i + 11], 16, 1839030562)
    b = md5_hh(b, c, d, a, x[i + 14], 23, -35309556)
    a = md5_hh(a, b, c, d, x[i + 1], 4, -1530992060)
    d = md5_hh(d, a, b, c, x[i + 4], 11, 1272893353)
    c = md5_hh(c, d, a, b, x[i + 7], 16, -155497632)
    b = md5_hh(b, c, d, a, x[i + 10], 23, -1094730640)
    a = md5_hh(a, b, c, d, x[i + 13], 4, 681279174)
    d = md5_hh(d, a, b, c, x[i + 0], 11, -358537222)
    c = md5_hh(c, d, a, b, x[i + 3], 16, -722521979)
    b = md5_hh(b, c, d, a, x[i + 6], 23, 76029189)
    a = md5_hh(a, b, c, d, x[i + 9], 4, -640364487)
    d = md5_hh(d, a, b, c, x[i + 12], 11, -421815835)
    c = md5_hh(c, d, a, b, x[i + 15], 16, 530742520)
    b = md5_hh(b, c, d, a, x[i + 2], 23, -995338651)

    a = md5_ii(a, b, c, d, x[i + 0], 6, -198630844)
    d = md5_ii(d, a, b, c, x[i + 7], 10, 1126891415)
    c = md5_ii(c, d, a, b, x[i + 14], 15, -1416354905)
    b = md5_ii(b, c, d, a, x[i + 5], 21, -57434055)
    a = md5_ii(a, b, c, d, x[i + 12], 6, 1700485571)
    d = md5_ii(d, a, b, c, x[i + 3], 10, -1894986606)
    c = md5_ii(c, d, a, b, x[i + 10], 15, -1051523)
    b = md5_ii(b, c, d, a, x[i + 1], 21, -2054922799)
    a = md5_ii(a, b, c, d, x[i + 8], 6, 1873313359)
    d = md5_ii(d, a, b, c, x[i + 15], 10, -30611744)
    c = md5_ii(c, d, a, b, x[i + 6], 15, -1560198380)
    b = md5_ii(b, c, d, a, x[i + 13], 21, 1309151649)
    a = md5_ii(a, b, c, d, x[i + 4], 6, -145523070)
    d = md5_ii(d, a, b, c, x[i + 11], 10, -1120210379)
    c = md5_ii(c, d, a, b, x[i + 2], 15, 718787259)
    b = md5_ii(b, c, d, a, x[i + 9], 21, -343485551)

    a = safe_add(a, olda)
    b = safe_add(b, oldb)
    c = safe_add(c, oldc)
    d = safe_add(d, oldd)
  }

  return [a, b, c, d]
}

/*
 * These functions implement the four basic operations the algorithm uses.
 */
function md5_cmn (q, a, b, x, s, t) {
  return safe_add(bit_rol(safe_add(safe_add(a, q), safe_add(x, t)), s), b)
}

function md5_ff (a, b, c, d, x, s, t) {
  return md5_cmn((b & c) | ((~b) & d), a, b, x, s, t)
}

function md5_gg (a, b, c, d, x, s, t) {
  return md5_cmn((b & d) | (c & (~d)), a, b, x, s, t)
}

function md5_hh (a, b, c, d, x, s, t) {
  return md5_cmn(b ^ c ^ d, a, b, x, s, t)
}

function md5_ii (a, b, c, d, x, s, t) {
  return md5_cmn(c ^ (b | (~d)), a, b, x, s, t)
}

/*
 * Add integers, wrapping at 2^32. This uses 16-bit operations internally
 * to work around bugs in some JS interpreters.
 */
function safe_add (x, y) {
  var lsw = (x & 0xFFFF) + (y & 0xFFFF)
  var msw = (x >> 16) + (y >> 16) + (lsw >> 16)
  return (msw << 16) | (lsw & 0xFFFF)
}

/*
 * Bitwise rotate a 32-bit number to the left.
 */
function bit_rol (num, cnt) {
  return (num << cnt) | (num >>> (32 - cnt))
}

module.exports = function md5 (buf) {
  return makeHash(buf, core_md5)
}


/***/ }),
/* 101 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";
/* WEBPACK VAR INJECTION */(function(Buffer) {
var inherits = __webpack_require__(1)
var HashBase = __webpack_require__(146)

function RIPEMD160 () {
  HashBase.call(this, 64)

  // state
  this._a = 0x67452301
  this._b = 0xefcdab89
  this._c = 0x98badcfe
  this._d = 0x10325476
  this._e = 0xc3d2e1f0
}

inherits(RIPEMD160, HashBase)

RIPEMD160.prototype._update = function () {
  var m = new Array(16)
  for (var i = 0; i < 16; ++i) m[i] = this._block.readInt32LE(i * 4)

  var al = this._a
  var bl = this._b
  var cl = this._c
  var dl = this._d
  var el = this._e

  // Mj = 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15
  // K = 0x00000000
  // Sj = 11, 14, 15, 12, 5, 8, 7, 9, 11, 13, 14, 15, 6, 7, 9, 8
  al = fn1(al, bl, cl, dl, el, m[0], 0x00000000, 11); cl = rotl(cl, 10)
  el = fn1(el, al, bl, cl, dl, m[1], 0x00000000, 14); bl = rotl(bl, 10)
  dl = fn1(dl, el, al, bl, cl, m[2], 0x00000000, 15); al = rotl(al, 10)
  cl = fn1(cl, dl, el, al, bl, m[3], 0x00000000, 12); el = rotl(el, 10)
  bl = fn1(bl, cl, dl, el, al, m[4], 0x00000000, 5); dl = rotl(dl, 10)
  al = fn1(al, bl, cl, dl, el, m[5], 0x00000000, 8); cl = rotl(cl, 10)
  el = fn1(el, al, bl, cl, dl, m[6], 0x00000000, 7); bl = rotl(bl, 10)
  dl = fn1(dl, el, al, bl, cl, m[7], 0x00000000, 9); al = rotl(al, 10)
  cl = fn1(cl, dl, el, al, bl, m[8], 0x00000000, 11); el = rotl(el, 10)
  bl = fn1(bl, cl, dl, el, al, m[9], 0x00000000, 13); dl = rotl(dl, 10)
  al = fn1(al, bl, cl, dl, el, m[10], 0x00000000, 14); cl = rotl(cl, 10)
  el = fn1(el, al, bl, cl, dl, m[11], 0x00000000, 15); bl = rotl(bl, 10)
  dl = fn1(dl, el, al, bl, cl, m[12], 0x00000000, 6); al = rotl(al, 10)
  cl = fn1(cl, dl, el, al, bl, m[13], 0x00000000, 7); el = rotl(el, 10)
  bl = fn1(bl, cl, dl, el, al, m[14], 0x00000000, 9); dl = rotl(dl, 10)
  al = fn1(al, bl, cl, dl, el, m[15], 0x00000000, 8); cl = rotl(cl, 10)

  // Mj = 7, 4, 13, 1, 10, 6, 15, 3, 12, 0, 9, 5, 2, 14, 11, 8
  // K = 0x5a827999
  // Sj = 7, 6, 8, 13, 11, 9, 7, 15, 7, 12, 15, 9, 11, 7, 13, 12
  el = fn2(el, al, bl, cl, dl, m[7], 0x5a827999, 7); bl = rotl(bl, 10)
  dl = fn2(dl, el, al, bl, cl, m[4], 0x5a827999, 6); al = rotl(al, 10)
  cl = fn2(cl, dl, el, al, bl, m[13], 0x5a827999, 8); el = rotl(el, 10)
  bl = fn2(bl, cl, dl, el, al, m[1], 0x5a827999, 13); dl = rotl(dl, 10)
  al = fn2(al, bl, cl, dl, el, m[10], 0x5a827999, 11); cl = rotl(cl, 10)
  el = fn2(el, al, bl, cl, dl, m[6], 0x5a827999, 9); bl = rotl(bl, 10)
  dl = fn2(dl, el, al, bl, cl, m[15], 0x5a827999, 7); al = rotl(al, 10)
  cl = fn2(cl, dl, el, al, bl, m[3], 0x5a827999, 15); el = rotl(el, 10)
  bl = fn2(bl, cl, dl, el, al, m[12], 0x5a827999, 7); dl = rotl(dl, 10)
  al = fn2(al, bl, cl, dl, el, m[0], 0x5a827999, 12); cl = rotl(cl, 10)
  el = fn2(el, al, bl, cl, dl, m[9], 0x5a827999, 15); bl = rotl(bl, 10)
  dl = fn2(dl, el, al, bl, cl, m[5], 0x5a827999, 9); al = rotl(al, 10)
  cl = fn2(cl, dl, el, al, bl, m[2], 0x5a827999, 11); el = rotl(el, 10)
  bl = fn2(bl, cl, dl, el, al, m[14], 0x5a827999, 7); dl = rotl(dl, 10)
  al = fn2(al, bl, cl, dl, el, m[11], 0x5a827999, 13); cl = rotl(cl, 10)
  el = fn2(el, al, bl, cl, dl, m[8], 0x5a827999, 12); bl = rotl(bl, 10)

  // Mj = 3, 10, 14, 4, 9, 15, 8, 1, 2, 7, 0, 6, 13, 11, 5, 12
  // K = 0x6ed9eba1
  // Sj = 11, 13, 6, 7, 14, 9, 13, 15, 14, 8, 13, 6, 5, 12, 7, 5
  dl = fn3(dl, el, al, bl, cl, m[3], 0x6ed9eba1, 11); al = rotl(al, 10)
  cl = fn3(cl, dl, el, al, bl, m[10], 0x6ed9eba1, 13); el = rotl(el, 10)
  bl = fn3(bl, cl, dl, el, al, m[14], 0x6ed9eba1, 6); dl = rotl(dl, 10)
  al = fn3(al, bl, cl, dl, el, m[4], 0x6ed9eba1, 7); cl = rotl(cl, 10)
  el = fn3(el, al, bl, cl, dl, m[9], 0x6ed9eba1, 14); bl = rotl(bl, 10)
  dl = fn3(dl, el, al, bl, cl, m[15], 0x6ed9eba1, 9); al = rotl(al, 10)
  cl = fn3(cl, dl, el, al, bl, m[8], 0x6ed9eba1, 13); el = rotl(el, 10)
  bl = fn3(bl, cl, dl, el, al, m[1], 0x6ed9eba1, 15); dl = rotl(dl, 10)
  al = fn3(al, bl, cl, dl, el, m[2], 0x6ed9eba1, 14); cl = rotl(cl, 10)
  el = fn3(el, al, bl, cl, dl, m[7], 0x6ed9eba1, 8); bl = rotl(bl, 10)
  dl = fn3(dl, el, al, bl, cl, m[0], 0x6ed9eba1, 13); al = rotl(al, 10)
  cl = fn3(cl, dl, el, al, bl, m[6], 0x6ed9eba1, 6); el = rotl(el, 10)
  bl = fn3(bl, cl, dl, el, al, m[13], 0x6ed9eba1, 5); dl = rotl(dl, 10)
  al = fn3(al, bl, cl, dl, el, m[11], 0x6ed9eba1, 12); cl = rotl(cl, 10)
  el = fn3(el, al, bl, cl, dl, m[5], 0x6ed9eba1, 7); bl = rotl(bl, 10)
  dl = fn3(dl, el, al, bl, cl, m[12], 0x6ed9eba1, 5); al = rotl(al, 10)

  // Mj = 1, 9, 11, 10, 0, 8, 12, 4, 13, 3, 7, 15, 14, 5, 6, 2
  // K = 0x8f1bbcdc
  // Sj = 11, 12, 14, 15, 14, 15, 9, 8, 9, 14, 5, 6, 8, 6, 5, 12
  cl = fn4(cl, dl, el, al, bl, m[1], 0x8f1bbcdc, 11); el = rotl(el, 10)
  bl = fn4(bl, cl, dl, el, al, m[9], 0x8f1bbcdc, 12); dl = rotl(dl, 10)
  al = fn4(al, bl, cl, dl, el, m[11], 0x8f1bbcdc, 14); cl = rotl(cl, 10)
  el = fn4(el, al, bl, cl, dl, m[10], 0x8f1bbcdc, 15); bl = rotl(bl, 10)
  dl = fn4(dl, el, al, bl, cl, m[0], 0x8f1bbcdc, 14); al = rotl(al, 10)
  cl = fn4(cl, dl, el, al, bl, m[8], 0x8f1bbcdc, 15); el = rotl(el, 10)
  bl = fn4(bl, cl, dl, el, al, m[12], 0x8f1bbcdc, 9); dl = rotl(dl, 10)
  al = fn4(al, bl, cl, dl, el, m[4], 0x8f1bbcdc, 8); cl = rotl(cl, 10)
  el = fn4(el, al, bl, cl, dl, m[13], 0x8f1bbcdc, 9); bl = rotl(bl, 10)
  dl = fn4(dl, el, al, bl, cl, m[3], 0x8f1bbcdc, 14); al = rotl(al, 10)
  cl = fn4(cl, dl, el, al, bl, m[7], 0x8f1bbcdc, 5); el = rotl(el, 10)
  bl = fn4(bl, cl, dl, el, al, m[15], 0x8f1bbcdc, 6); dl = rotl(dl, 10)
  al = fn4(al, bl, cl, dl, el, m[14], 0x8f1bbcdc, 8); cl = rotl(cl, 10)
  el = fn4(el, al, bl, cl, dl, m[5], 0x8f1bbcdc, 6); bl = rotl(bl, 10)
  dl = fn4(dl, el, al, bl, cl, m[6], 0x8f1bbcdc, 5); al = rotl(al, 10)
  cl = fn4(cl, dl, el, al, bl, m[2], 0x8f1bbcdc, 12); el = rotl(el, 10)

  // Mj = 4, 0, 5, 9, 7, 12, 2, 10, 14, 1, 3, 8, 11, 6, 15, 13
  // K = 0xa953fd4e
  // Sj = 9, 15, 5, 11, 6, 8, 13, 12, 5, 12, 13, 14, 11, 8, 5, 6
  bl = fn5(bl, cl, dl, el, al, m[4], 0xa953fd4e, 9); dl = rotl(dl, 10)
  al = fn5(al, bl, cl, dl, el, m[0], 0xa953fd4e, 15); cl = rotl(cl, 10)
  el = fn5(el, al, bl, cl, dl, m[5], 0xa953fd4e, 5); bl = rotl(bl, 10)
  dl = fn5(dl, el, al, bl, cl, m[9], 0xa953fd4e, 11); al = rotl(al, 10)
  cl = fn5(cl, dl, el, al, bl, m[7], 0xa953fd4e, 6); el = rotl(el, 10)
  bl = fn5(bl, cl, dl, el, al, m[12], 0xa953fd4e, 8); dl = rotl(dl, 10)
  al = fn5(al, bl, cl, dl, el, m[2], 0xa953fd4e, 13); cl = rotl(cl, 10)
  el = fn5(el, al, bl, cl, dl, m[10], 0xa953fd4e, 12); bl = rotl(bl, 10)
  dl = fn5(dl, el, al, bl, cl, m[14], 0xa953fd4e, 5); al = rotl(al, 10)
  cl = fn5(cl, dl, el, al, bl, m[1], 0xa953fd4e, 12); el = rotl(el, 10)
  bl = fn5(bl, cl, dl, el, al, m[3], 0xa953fd4e, 13); dl = rotl(dl, 10)
  al = fn5(al, bl, cl, dl, el, m[8], 0xa953fd4e, 14); cl = rotl(cl, 10)
  el = fn5(el, al, bl, cl, dl, m[11], 0xa953fd4e, 11); bl = rotl(bl, 10)
  dl = fn5(dl, el, al, bl, cl, m[6], 0xa953fd4e, 8); al = rotl(al, 10)
  cl = fn5(cl, dl, el, al, bl, m[15], 0xa953fd4e, 5); el = rotl(el, 10)
  bl = fn5(bl, cl, dl, el, al, m[13], 0xa953fd4e, 6); dl = rotl(dl, 10)

  var ar = this._a
  var br = this._b
  var cr = this._c
  var dr = this._d
  var er = this._e

  // M'j = 5, 14, 7, 0, 9, 2, 11, 4, 13, 6, 15, 8, 1, 10, 3, 12
  // K' = 0x50a28be6
  // S'j = 8, 9, 9, 11, 13, 15, 15, 5, 7, 7, 8, 11, 14, 14, 12, 6
  ar = fn5(ar, br, cr, dr, er, m[5], 0x50a28be6, 8); cr = rotl(cr, 10)
  er = fn5(er, ar, br, cr, dr, m[14], 0x50a28be6, 9); br = rotl(br, 10)
  dr = fn5(dr, er, ar, br, cr, m[7], 0x50a28be6, 9); ar = rotl(ar, 10)
  cr = fn5(cr, dr, er, ar, br, m[0], 0x50a28be6, 11); er = rotl(er, 10)
  br = fn5(br, cr, dr, er, ar, m[9], 0x50a28be6, 13); dr = rotl(dr, 10)
  ar = fn5(ar, br, cr, dr, er, m[2], 0x50a28be6, 15); cr = rotl(cr, 10)
  er = fn5(er, ar, br, cr, dr, m[11], 0x50a28be6, 15); br = rotl(br, 10)
  dr = fn5(dr, er, ar, br, cr, m[4], 0x50a28be6, 5); ar = rotl(ar, 10)
  cr = fn5(cr, dr, er, ar, br, m[13], 0x50a28be6, 7); er = rotl(er, 10)
  br = fn5(br, cr, dr, er, ar, m[6], 0x50a28be6, 7); dr = rotl(dr, 10)
  ar = fn5(ar, br, cr, dr, er, m[15], 0x50a28be6, 8); cr = rotl(cr, 10)
  er = fn5(er, ar, br, cr, dr, m[8], 0x50a28be6, 11); br = rotl(br, 10)
  dr = fn5(dr, er, ar, br, cr, m[1], 0x50a28be6, 14); ar = rotl(ar, 10)
  cr = fn5(cr, dr, er, ar, br, m[10], 0x50a28be6, 14); er = rotl(er, 10)
  br = fn5(br, cr, dr, er, ar, m[3], 0x50a28be6, 12); dr = rotl(dr, 10)
  ar = fn5(ar, br, cr, dr, er, m[12], 0x50a28be6, 6); cr = rotl(cr, 10)

  // M'j = 6, 11, 3, 7, 0, 13, 5, 10, 14, 15, 8, 12, 4, 9, 1, 2
  // K' = 0x5c4dd124
  // S'j = 9, 13, 15, 7, 12, 8, 9, 11, 7, 7, 12, 7, 6, 15, 13, 11
  er = fn4(er, ar, br, cr, dr, m[6], 0x5c4dd124, 9); br = rotl(br, 10)
  dr = fn4(dr, er, ar, br, cr, m[11], 0x5c4dd124, 13); ar = rotl(ar, 10)
  cr = fn4(cr, dr, er, ar, br, m[3], 0x5c4dd124, 15); er = rotl(er, 10)
  br = fn4(br, cr, dr, er, ar, m[7], 0x5c4dd124, 7); dr = rotl(dr, 10)
  ar = fn4(ar, br, cr, dr, er, m[0], 0x5c4dd124, 12); cr = rotl(cr, 10)
  er = fn4(er, ar, br, cr, dr, m[13], 0x5c4dd124, 8); br = rotl(br, 10)
  dr = fn4(dr, er, ar, br, cr, m[5], 0x5c4dd124, 9); ar = rotl(ar, 10)
  cr = fn4(cr, dr, er, ar, br, m[10], 0x5c4dd124, 11); er = rotl(er, 10)
  br = fn4(br, cr, dr, er, ar, m[14], 0x5c4dd124, 7); dr = rotl(dr, 10)
  ar = fn4(ar, br, cr, dr, er, m[15], 0x5c4dd124, 7); cr = rotl(cr, 10)
  er = fn4(er, ar, br, cr, dr, m[8], 0x5c4dd124, 12); br = rotl(br, 10)
  dr = fn4(dr, er, ar, br, cr, m[12], 0x5c4dd124, 7); ar = rotl(ar, 10)
  cr = fn4(cr, dr, er, ar, br, m[4], 0x5c4dd124, 6); er = rotl(er, 10)
  br = fn4(br, cr, dr, er, ar, m[9], 0x5c4dd124, 15); dr = rotl(dr, 10)
  ar = fn4(ar, br, cr, dr, er, m[1], 0x5c4dd124, 13); cr = rotl(cr, 10)
  er = fn4(er, ar, br, cr, dr, m[2], 0x5c4dd124, 11); br = rotl(br, 10)

  // M'j = 15, 5, 1, 3, 7, 14, 6, 9, 11, 8, 12, 2, 10, 0, 4, 13
  // K' = 0x6d703ef3
  // S'j = 9, 7, 15, 11, 8, 6, 6, 14, 12, 13, 5, 14, 13, 13, 7, 5
  dr = fn3(dr, er, ar, br, cr, m[15], 0x6d703ef3, 9); ar = rotl(ar, 10)
  cr = fn3(cr, dr, er, ar, br, m[5], 0x6d703ef3, 7); er = rotl(er, 10)
  br = fn3(br, cr, dr, er, ar, m[1], 0x6d703ef3, 15); dr = rotl(dr, 10)
  ar = fn3(ar, br, cr, dr, er, m[3], 0x6d703ef3, 11); cr = rotl(cr, 10)
  er = fn3(er, ar, br, cr, dr, m[7], 0x6d703ef3, 8); br = rotl(br, 10)
  dr = fn3(dr, er, ar, br, cr, m[14], 0x6d703ef3, 6); ar = rotl(ar, 10)
  cr = fn3(cr, dr, er, ar, br, m[6], 0x6d703ef3, 6); er = rotl(er, 10)
  br = fn3(br, cr, dr, er, ar, m[9], 0x6d703ef3, 14); dr = rotl(dr, 10)
  ar = fn3(ar, br, cr, dr, er, m[11], 0x6d703ef3, 12); cr = rotl(cr, 10)
  er = fn3(er, ar, br, cr, dr, m[8], 0x6d703ef3, 13); br = rotl(br, 10)
  dr = fn3(dr, er, ar, br, cr, m[12], 0x6d703ef3, 5); ar = rotl(ar, 10)
  cr = fn3(cr, dr, er, ar, br, m[2], 0x6d703ef3, 14); er = rotl(er, 10)
  br = fn3(br, cr, dr, er, ar, m[10], 0x6d703ef3, 13); dr = rotl(dr, 10)
  ar = fn3(ar, br, cr, dr, er, m[0], 0x6d703ef3, 13); cr = rotl(cr, 10)
  er = fn3(er, ar, br, cr, dr, m[4], 0x6d703ef3, 7); br = rotl(br, 10)
  dr = fn3(dr, er, ar, br, cr, m[13], 0x6d703ef3, 5); ar = rotl(ar, 10)

  // M'j = 8, 6, 4, 1, 3, 11, 15, 0, 5, 12, 2, 13, 9, 7, 10, 14
  // K' = 0x7a6d76e9
  // S'j = 15, 5, 8, 11, 14, 14, 6, 14, 6, 9, 12, 9, 12, 5, 15, 8
  cr = fn2(cr, dr, er, ar, br, m[8], 0x7a6d76e9, 15); er = rotl(er, 10)
  br = fn2(br, cr, dr, er, ar, m[6], 0x7a6d76e9, 5); dr = rotl(dr, 10)
  ar = fn2(ar, br, cr, dr, er, m[4], 0x7a6d76e9, 8); cr = rotl(cr, 10)
  er = fn2(er, ar, br, cr, dr, m[1], 0x7a6d76e9, 11); br = rotl(br, 10)
  dr = fn2(dr, er, ar, br, cr, m[3], 0x7a6d76e9, 14); ar = rotl(ar, 10)
  cr = fn2(cr, dr, er, ar, br, m[11], 0x7a6d76e9, 14); er = rotl(er, 10)
  br = fn2(br, cr, dr, er, ar, m[15], 0x7a6d76e9, 6); dr = rotl(dr, 10)
  ar = fn2(ar, br, cr, dr, er, m[0], 0x7a6d76e9, 14); cr = rotl(cr, 10)
  er = fn2(er, ar, br, cr, dr, m[5], 0x7a6d76e9, 6); br = rotl(br, 10)
  dr = fn2(dr, er, ar, br, cr, m[12], 0x7a6d76e9, 9); ar = rotl(ar, 10)
  cr = fn2(cr, dr, er, ar, br, m[2], 0x7a6d76e9, 12); er = rotl(er, 10)
  br = fn2(br, cr, dr, er, ar, m[13], 0x7a6d76e9, 9); dr = rotl(dr, 10)
  ar = fn2(ar, br, cr, dr, er, m[9], 0x7a6d76e9, 12); cr = rotl(cr, 10)
  er = fn2(er, ar, br, cr, dr, m[7], 0x7a6d76e9, 5); br = rotl(br, 10)
  dr = fn2(dr, er, ar, br, cr, m[10], 0x7a6d76e9, 15); ar = rotl(ar, 10)
  cr = fn2(cr, dr, er, ar, br, m[14], 0x7a6d76e9, 8); er = rotl(er, 10)

  // M'j = 12, 15, 10, 4, 1, 5, 8, 7, 6, 2, 13, 14, 0, 3, 9, 11
  // K' = 0x00000000
  // S'j = 8, 5, 12, 9, 12, 5, 14, 6, 8, 13, 6, 5, 15, 13, 11, 11
  br = fn1(br, cr, dr, er, ar, m[12], 0x00000000, 8); dr = rotl(dr, 10)
  ar = fn1(ar, br, cr, dr, er, m[15], 0x00000000, 5); cr = rotl(cr, 10)
  er = fn1(er, ar, br, cr, dr, m[10], 0x00000000, 12); br = rotl(br, 10)
  dr = fn1(dr, er, ar, br, cr, m[4], 0x00000000, 9); ar = rotl(ar, 10)
  cr = fn1(cr, dr, er, ar, br, m[1], 0x00000000, 12); er = rotl(er, 10)
  br = fn1(br, cr, dr, er, ar, m[5], 0x00000000, 5); dr = rotl(dr, 10)
  ar = fn1(ar, br, cr, dr, er, m[8], 0x00000000, 14); cr = rotl(cr, 10)
  er = fn1(er, ar, br, cr, dr, m[7], 0x00000000, 6); br = rotl(br, 10)
  dr = fn1(dr, er, ar, br, cr, m[6], 0x00000000, 8); ar = rotl(ar, 10)
  cr = fn1(cr, dr, er, ar, br, m[2], 0x00000000, 13); er = rotl(er, 10)
  br = fn1(br, cr, dr, er, ar, m[13], 0x00000000, 6); dr = rotl(dr, 10)
  ar = fn1(ar, br, cr, dr, er, m[14], 0x00000000, 5); cr = rotl(cr, 10)
  er = fn1(er, ar, br, cr, dr, m[0], 0x00000000, 15); br = rotl(br, 10)
  dr = fn1(dr, er, ar, br, cr, m[3], 0x00000000, 13); ar = rotl(ar, 10)
  cr = fn1(cr, dr, er, ar, br, m[9], 0x00000000, 11); er = rotl(er, 10)
  br = fn1(br, cr, dr, er, ar, m[11], 0x00000000, 11); dr = rotl(dr, 10)

  // change state
  var t = (this._b + cl + dr) | 0
  this._b = (this._c + dl + er) | 0
  this._c = (this._d + el + ar) | 0
  this._d = (this._e + al + br) | 0
  this._e = (this._a + bl + cr) | 0
  this._a = t
}

RIPEMD160.prototype._digest = function () {
  // create padding and handle blocks
  this._block[this._blockOffset++] = 0x80
  if (this._blockOffset > 56) {
    this._block.fill(0, this._blockOffset, 64)
    this._update()
    this._blockOffset = 0
  }

  this._block.fill(0, this._blockOffset, 56)
  this._block.writeUInt32LE(this._length[0], 56)
  this._block.writeUInt32LE(this._length[1], 60)
  this._update()

  // produce result
  var buffer = new Buffer(20)
  buffer.writeInt32LE(this._a, 0)
  buffer.writeInt32LE(this._b, 4)
  buffer.writeInt32LE(this._c, 8)
  buffer.writeInt32LE(this._d, 12)
  buffer.writeInt32LE(this._e, 16)
  return buffer
}

function rotl (x, n) {
  return (x << n) | (x >>> (32 - n))
}

function fn1 (a, b, c, d, e, m, k, s) {
  return (rotl((a + (b ^ c ^ d) + m + k) | 0, s) + e) | 0
}

function fn2 (a, b, c, d, e, m, k, s) {
  return (rotl((a + ((b & c) | ((~b) & d)) + m + k) | 0, s) + e) | 0
}

function fn3 (a, b, c, d, e, m, k, s) {
  return (rotl((a + ((b | (~c)) ^ d) + m + k) | 0, s) + e) | 0
}

function fn4 (a, b, c, d, e, m, k, s) {
  return (rotl((a + ((b & d) | (c & (~d))) + m + k) | 0, s) + e) | 0
}

function fn5 (a, b, c, d, e, m, k, s) {
  return (rotl((a + (b ^ (c | (~d))) + m + k) | 0, s) + e) | 0
}

module.exports = RIPEMD160

/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(6).Buffer))

/***/ }),
/* 102 */
/***/ (function(module, exports, __webpack_require__) {

// Copyright Joyent, Inc. and other Node contributors.
//
// Permission is hereby granted, free of charge, to any person obtaining a
// copy of this software and associated documentation files (the
// "Software"), to deal in the Software without restriction, including
// without limitation the rights to use, copy, modify, merge, publish,
// distribute, sublicense, and/or sell copies of the Software, and to permit
// persons to whom the Software is furnished to do so, subject to the
// following conditions:
//
// The above copyright notice and this permission notice shall be included
// in all copies or substantial portions of the Software.
//
// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
// USE OR OTHER DEALINGS IN THE SOFTWARE.

module.exports = Stream;

var EE = __webpack_require__(103).EventEmitter;
var inherits = __webpack_require__(1);

inherits(Stream, EE);
Stream.Readable = __webpack_require__(104);
Stream.Writable = __webpack_require__(229);
Stream.Duplex = __webpack_require__(230);
Stream.Transform = __webpack_require__(231);
Stream.PassThrough = __webpack_require__(232);

// Backwards-compat with node 0.4.x
Stream.Stream = Stream;



// old-style streams.  Note that the pipe method (the only relevant
// part of this class) is overridden in the Readable class.

function Stream() {
  EE.call(this);
}

Stream.prototype.pipe = function(dest, options) {
  var source = this;

  function ondata(chunk) {
    if (dest.writable) {
      if (false === dest.write(chunk) && source.pause) {
        source.pause();
      }
    }
  }

  source.on('data', ondata);

  function ondrain() {
    if (source.readable && source.resume) {
      source.resume();
    }
  }

  dest.on('drain', ondrain);

  // If the 'end' option is not supplied, dest.end() will be called when
  // source gets the 'end' or 'close' events.  Only dest.end() once.
  if (!dest._isStdio && (!options || options.end !== false)) {
    source.on('end', onend);
    source.on('close', onclose);
  }

  var didOnEnd = false;
  function onend() {
    if (didOnEnd) return;
    didOnEnd = true;

    dest.end();
  }


  function onclose() {
    if (didOnEnd) return;
    didOnEnd = true;

    if (typeof dest.destroy === 'function') dest.destroy();
  }

  // don't leave dangling pipes when there are errors.
  function onerror(er) {
    cleanup();
    if (EE.listenerCount(this, 'error') === 0) {
      throw er; // Unhandled stream error in pipe.
    }
  }

  source.on('error', onerror);
  dest.on('error', onerror);

  // remove all the event listeners that were added.
  function cleanup() {
    source.removeListener('data', ondata);
    dest.removeListener('drain', ondrain);

    source.removeListener('end', onend);
    source.removeListener('close', onclose);

    source.removeListener('error', onerror);
    dest.removeListener('error', onerror);

    source.removeListener('end', cleanup);
    source.removeListener('close', cleanup);

    dest.removeListener('close', cleanup);
  }

  source.on('end', cleanup);
  source.on('close', cleanup);

  dest.on('close', cleanup);

  dest.emit('pipe', source);

  // Allow for unix-like usage: A.pipe(B).pipe(C)
  return dest;
};


/***/ }),
/* 103 */
/***/ (function(module, exports) {

// Copyright Joyent, Inc. and other Node contributors.
//
// Permission is hereby granted, free of charge, to any person obtaining a
// copy of this software and associated documentation files (the
// "Software"), to deal in the Software without restriction, including
// without limitation the rights to use, copy, modify, merge, publish,
// distribute, sublicense, and/or sell copies of the Software, and to permit
// persons to whom the Software is furnished to do so, subject to the
// following conditions:
//
// The above copyright notice and this permission notice shall be included
// in all copies or substantial portions of the Software.
//
// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
// USE OR OTHER DEALINGS IN THE SOFTWARE.

function EventEmitter() {
  this._events = this._events || {};
  this._maxListeners = this._maxListeners || undefined;
}
module.exports = EventEmitter;

// Backwards-compat with node 0.10.x
EventEmitter.EventEmitter = EventEmitter;

EventEmitter.prototype._events = undefined;
EventEmitter.prototype._maxListeners = undefined;

// By default EventEmitters will print a warning if more than 10 listeners are
// added to it. This is a useful default which helps finding memory leaks.
EventEmitter.defaultMaxListeners = 10;

// Obviously not all Emitters should be limited to 10. This function allows
// that to be increased. Set to zero for unlimited.
EventEmitter.prototype.setMaxListeners = function(n) {
  if (!isNumber(n) || n < 0 || isNaN(n))
    throw TypeError('n must be a positive number');
  this._maxListeners = n;
  return this;
};

EventEmitter.prototype.emit = function(type) {
  var er, handler, len, args, i, listeners;

  if (!this._events)
    this._events = {};

  // If there is no 'error' event listener then throw.
  if (type === 'error') {
    if (!this._events.error ||
        (isObject(this._events.error) && !this._events.error.length)) {
      er = arguments[1];
      if (er instanceof Error) {
        throw er; // Unhandled 'error' event
      } else {
        // At least give some kind of context to the user
        var err = new Error('Uncaught, unspecified "error" event. (' + er + ')');
        err.context = er;
        throw err;
      }
    }
  }

  handler = this._events[type];

  if (isUndefined(handler))
    return false;

  if (isFunction(handler)) {
    switch (arguments.length) {
      // fast cases
      case 1:
        handler.call(this);
        break;
      case 2:
        handler.call(this, arguments[1]);
        break;
      case 3:
        handler.call(this, arguments[1], arguments[2]);
        break;
      // slower
      default:
        args = Array.prototype.slice.call(arguments, 1);
        handler.apply(this, args);
    }
  } else if (isObject(handler)) {
    args = Array.prototype.slice.call(arguments, 1);
    listeners = handler.slice();
    len = listeners.length;
    for (i = 0; i < len; i++)
      listeners[i].apply(this, args);
  }

  return true;
};

EventEmitter.prototype.addListener = function(type, listener) {
  var m;

  if (!isFunction(listener))
    throw TypeError('listener must be a function');

  if (!this._events)
    this._events = {};

  // To avoid recursion in the case that type === "newListener"! Before
  // adding it to the listeners, first emit "newListener".
  if (this._events.newListener)
    this.emit('newListener', type,
              isFunction(listener.listener) ?
              listener.listener : listener);

  if (!this._events[type])
    // Optimize the case of one listener. Don't need the extra array object.
    this._events[type] = listener;
  else if (isObject(this._events[type]))
    // If we've already got an array, just append.
    this._events[type].push(listener);
  else
    // Adding the second element, need to change to array.
    this._events[type] = [this._events[type], listener];

  // Check for listener leak
  if (isObject(this._events[type]) && !this._events[type].warned) {
    if (!isUndefined(this._maxListeners)) {
      m = this._maxListeners;
    } else {
      m = EventEmitter.defaultMaxListeners;
    }

    if (m && m > 0 && this._events[type].length > m) {
      this._events[type].warned = true;
      console.error('(node) warning: possible EventEmitter memory ' +
                    'leak detected. %d listeners added. ' +
                    'Use emitter.setMaxListeners() to increase limit.',
                    this._events[type].length);
      if (typeof console.trace === 'function') {
        // not supported in IE 10
        console.trace();
      }
    }
  }

  return this;
};

EventEmitter.prototype.on = EventEmitter.prototype.addListener;

EventEmitter.prototype.once = function(type, listener) {
  if (!isFunction(listener))
    throw TypeError('listener must be a function');

  var fired = false;

  function g() {
    this.removeListener(type, g);

    if (!fired) {
      fired = true;
      listener.apply(this, arguments);
    }
  }

  g.listener = listener;
  this.on(type, g);

  return this;
};

// emits a 'removeListener' event iff the listener was removed
EventEmitter.prototype.removeListener = function(type, listener) {
  var list, position, length, i;

  if (!isFunction(listener))
    throw TypeError('listener must be a function');

  if (!this._events || !this._events[type])
    return this;

  list = this._events[type];
  length = list.length;
  position = -1;

  if (list === listener ||
      (isFunction(list.listener) && list.listener === listener)) {
    delete this._events[type];
    if (this._events.removeListener)
      this.emit('removeListener', type, listener);

  } else if (isObject(list)) {
    for (i = length; i-- > 0;) {
      if (list[i] === listener ||
          (list[i].listener && list[i].listener === listener)) {
        position = i;
        break;
      }
    }

    if (position < 0)
      return this;

    if (list.length === 1) {
      list.length = 0;
      delete this._events[type];
    } else {
      list.splice(position, 1);
    }

    if (this._events.removeListener)
      this.emit('removeListener', type, listener);
  }

  return this;
};

EventEmitter.prototype.removeAllListeners = function(type) {
  var key, listeners;

  if (!this._events)
    return this;

  // not listening for removeListener, no need to emit
  if (!this._events.removeListener) {
    if (arguments.length === 0)
      this._events = {};
    else if (this._events[type])
      delete this._events[type];
    return this;
  }

  // emit removeListener for all listeners on all events
  if (arguments.length === 0) {
    for (key in this._events) {
      if (key === 'removeListener') continue;
      this.removeAllListeners(key);
    }
    this.removeAllListeners('removeListener');
    this._events = {};
    return this;
  }

  listeners = this._events[type];

  if (isFunction(listeners)) {
    this.removeListener(type, listeners);
  } else if (listeners) {
    // LIFO order
    while (listeners.length)
      this.removeListener(type, listeners[listeners.length - 1]);
  }
  delete this._events[type];

  return this;
};

EventEmitter.prototype.listeners = function(type) {
  var ret;
  if (!this._events || !this._events[type])
    ret = [];
  else if (isFunction(this._events[type]))
    ret = [this._events[type]];
  else
    ret = this._events[type].slice();
  return ret;
};

EventEmitter.prototype.listenerCount = function(type) {
  if (this._events) {
    var evlistener = this._events[type];

    if (isFunction(evlistener))
      return 1;
    else if (evlistener)
      return evlistener.length;
  }
  return 0;
};

EventEmitter.listenerCount = function(emitter, type) {
  return emitter.listenerCount(type);
};

function isFunction(arg) {
  return typeof arg === 'function';
}

function isNumber(arg) {
  return typeof arg === 'number';
}

function isObject(arg) {
  return typeof arg === 'object' && arg !== null;
}

function isUndefined(arg) {
  return arg === void 0;
}


/***/ }),
/* 104 */
/***/ (function(module, exports, __webpack_require__) {

exports = module.exports = __webpack_require__(147);
exports.Stream = exports;
exports.Readable = exports;
exports.Writable = __webpack_require__(105);
exports.Duplex = __webpack_require__(45);
exports.Transform = __webpack_require__(150);
exports.PassThrough = __webpack_require__(228);


/***/ }),
/* 105 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";
/* WEBPACK VAR INJECTION */(function(process, setImmediate, global) {// Copyright Joyent, Inc. and other Node contributors.
//
// Permission is hereby granted, free of charge, to any person obtaining a
// copy of this software and associated documentation files (the
// "Software"), to deal in the Software without restriction, including
// without limitation the rights to use, copy, modify, merge, publish,
// distribute, sublicense, and/or sell copies of the Software, and to permit
// persons to whom the Software is furnished to do so, subject to the
// following conditions:
//
// The above copyright notice and this permission notice shall be included
// in all copies or substantial portions of the Software.
//
// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
// USE OR OTHER DEALINGS IN THE SOFTWARE.

// A bit simpler than readable streams.
// Implement an async ._write(chunk, encoding, cb), and it'll handle all
// the drain event emission and buffering.



/*<replacement>*/

var processNextTick = __webpack_require__(77);
/*</replacement>*/

module.exports = Writable;

/* <replacement> */
function WriteReq(chunk, encoding, cb) {
  this.chunk = chunk;
  this.encoding = encoding;
  this.callback = cb;
  this.next = null;
}

// It seems a linked list but it is not
// there will be only 2 of these for each stream
function CorkedRequest(state) {
  var _this = this;

  this.next = null;
  this.entry = null;
  this.finish = function () {
    onCorkedFinish(_this, state);
  };
}
/* </replacement> */

/*<replacement>*/
var asyncWrite = !process.browser && ['v0.10', 'v0.9.'].indexOf(process.version.slice(0, 5)) > -1 ? setImmediate : processNextTick;
/*</replacement>*/

/*<replacement>*/
var Duplex;
/*</replacement>*/

Writable.WritableState = WritableState;

/*<replacement>*/
var util = __webpack_require__(68);
util.inherits = __webpack_require__(1);
/*</replacement>*/

/*<replacement>*/
var internalUtil = {
  deprecate: __webpack_require__(227)
};
/*</replacement>*/

/*<replacement>*/
var Stream = __webpack_require__(148);
/*</replacement>*/

/*<replacement>*/
var Buffer = __webpack_require__(8).Buffer;
var OurUint8Array = global.Uint8Array || function () {};
function _uint8ArrayToBuffer(chunk) {
  return Buffer.from(chunk);
}
function _isUint8Array(obj) {
  return Buffer.isBuffer(obj) || obj instanceof OurUint8Array;
}
/*</replacement>*/

var destroyImpl = __webpack_require__(149);

util.inherits(Writable, Stream);

function nop() {}

function WritableState(options, stream) {
  Duplex = Duplex || __webpack_require__(45);

  options = options || {};

  // object stream flag to indicate whether or not this stream
  // contains buffers or objects.
  this.objectMode = !!options.objectMode;

  if (stream instanceof Duplex) this.objectMode = this.objectMode || !!options.writableObjectMode;

  // the point at which write() starts returning false
  // Note: 0 is a valid value, means that we always return false if
  // the entire buffer is not flushed immediately on write()
  var hwm = options.highWaterMark;
  var defaultHwm = this.objectMode ? 16 : 16 * 1024;
  this.highWaterMark = hwm || hwm === 0 ? hwm : defaultHwm;

  // cast to ints.
  this.highWaterMark = Math.floor(this.highWaterMark);

  // if _final has been called
  this.finalCalled = false;

  // drain event flag.
  this.needDrain = false;
  // at the start of calling end()
  this.ending = false;
  // when end() has been called, and returned
  this.ended = false;
  // when 'finish' is emitted
  this.finished = false;

  // has it been destroyed
  this.destroyed = false;

  // should we decode strings into buffers before passing to _write?
  // this is here so that some node-core streams can optimize string
  // handling at a lower level.
  var noDecode = options.decodeStrings === false;
  this.decodeStrings = !noDecode;

  // Crypto is kind of old and crusty.  Historically, its default string
  // encoding is 'binary' so we have to make this configurable.
  // Everything else in the universe uses 'utf8', though.
  this.defaultEncoding = options.defaultEncoding || 'utf8';

  // not an actual buffer we keep track of, but a measurement
  // of how much we're waiting to get pushed to some underlying
  // socket or file.
  this.length = 0;

  // a flag to see when we're in the middle of a write.
  this.writing = false;

  // when true all writes will be buffered until .uncork() call
  this.corked = 0;

  // a flag to be able to tell if the onwrite cb is called immediately,
  // or on a later tick.  We set this to true at first, because any
  // actions that shouldn't happen until "later" should generally also
  // not happen before the first write call.
  this.sync = true;

  // a flag to know if we're processing previously buffered items, which
  // may call the _write() callback in the same tick, so that we don't
  // end up in an overlapped onwrite situation.
  this.bufferProcessing = false;

  // the callback that's passed to _write(chunk,cb)
  this.onwrite = function (er) {
    onwrite(stream, er);
  };

  // the callback that the user supplies to write(chunk,encoding,cb)
  this.writecb = null;

  // the amount that is being written when _write is called.
  this.writelen = 0;

  this.bufferedRequest = null;
  this.lastBufferedRequest = null;

  // number of pending user-supplied write callbacks
  // this must be 0 before 'finish' can be emitted
  this.pendingcb = 0;

  // emit prefinish if the only thing we're waiting for is _write cbs
  // This is relevant for synchronous Transform streams
  this.prefinished = false;

  // True if the error was already emitted and should not be thrown again
  this.errorEmitted = false;

  // count buffered requests
  this.bufferedRequestCount = 0;

  // allocate the first CorkedRequest, there is always
  // one allocated and free to use, and we maintain at most two
  this.corkedRequestsFree = new CorkedRequest(this);
}

WritableState.prototype.getBuffer = function getBuffer() {
  var current = this.bufferedRequest;
  var out = [];
  while (current) {
    out.push(current);
    current = current.next;
  }
  return out;
};

(function () {
  try {
    Object.defineProperty(WritableState.prototype, 'buffer', {
      get: internalUtil.deprecate(function () {
        return this.getBuffer();
      }, '_writableState.buffer is deprecated. Use _writableState.getBuffer ' + 'instead.', 'DEP0003')
    });
  } catch (_) {}
})();

// Test _writableState for inheritance to account for Duplex streams,
// whose prototype chain only points to Readable.
var realHasInstance;
if (typeof Symbol === 'function' && Symbol.hasInstance && typeof Function.prototype[Symbol.hasInstance] === 'function') {
  realHasInstance = Function.prototype[Symbol.hasInstance];
  Object.defineProperty(Writable, Symbol.hasInstance, {
    value: function (object) {
      if (realHasInstance.call(this, object)) return true;

      return object && object._writableState instanceof WritableState;
    }
  });
} else {
  realHasInstance = function (object) {
    return object instanceof this;
  };
}

function Writable(options) {
  Duplex = Duplex || __webpack_require__(45);

  // Writable ctor is applied to Duplexes, too.
  // `realHasInstance` is necessary because using plain `instanceof`
  // would return false, as no `_writableState` property is attached.

  // Trying to use the custom `instanceof` for Writable here will also break the
  // Node.js LazyTransform implementation, which has a non-trivial getter for
  // `_writableState` that would lead to infinite recursion.
  if (!realHasInstance.call(Writable, this) && !(this instanceof Duplex)) {
    return new Writable(options);
  }

  this._writableState = new WritableState(options, this);

  // legacy.
  this.writable = true;

  if (options) {
    if (typeof options.write === 'function') this._write = options.write;

    if (typeof options.writev === 'function') this._writev = options.writev;

    if (typeof options.destroy === 'function') this._destroy = options.destroy;

    if (typeof options.final === 'function') this._final = options.final;
  }

  Stream.call(this);
}

// Otherwise people can pipe Writable streams, which is just wrong.
Writable.prototype.pipe = function () {
  this.emit('error', new Error('Cannot pipe, not readable'));
};

function writeAfterEnd(stream, cb) {
  var er = new Error('write after end');
  // TODO: defer error events consistently everywhere, not just the cb
  stream.emit('error', er);
  processNextTick(cb, er);
}

// Checks that a user-supplied chunk is valid, especially for the particular
// mode the stream is in. Currently this means that `null` is never accepted
// and undefined/non-string values are only allowed in object mode.
function validChunk(stream, state, chunk, cb) {
  var valid = true;
  var er = false;

  if (chunk === null) {
    er = new TypeError('May not write null values to stream');
  } else if (typeof chunk !== 'string' && chunk !== undefined && !state.objectMode) {
    er = new TypeError('Invalid non-string/buffer chunk');
  }
  if (er) {
    stream.emit('error', er);
    processNextTick(cb, er);
    valid = false;
  }
  return valid;
}

Writable.prototype.write = function (chunk, encoding, cb) {
  var state = this._writableState;
  var ret = false;
  var isBuf = _isUint8Array(chunk) && !state.objectMode;

  if (isBuf && !Buffer.isBuffer(chunk)) {
    chunk = _uint8ArrayToBuffer(chunk);
  }

  if (typeof encoding === 'function') {
    cb = encoding;
    encoding = null;
  }

  if (isBuf) encoding = 'buffer';else if (!encoding) encoding = state.defaultEncoding;

  if (typeof cb !== 'function') cb = nop;

  if (state.ended) writeAfterEnd(this, cb);else if (isBuf || validChunk(this, state, chunk, cb)) {
    state.pendingcb++;
    ret = writeOrBuffer(this, state, isBuf, chunk, encoding, cb);
  }

  return ret;
};

Writable.prototype.cork = function () {
  var state = this._writableState;

  state.corked++;
};

Writable.prototype.uncork = function () {
  var state = this._writableState;

  if (state.corked) {
    state.corked--;

    if (!state.writing && !state.corked && !state.finished && !state.bufferProcessing && state.bufferedRequest) clearBuffer(this, state);
  }
};

Writable.prototype.setDefaultEncoding = function setDefaultEncoding(encoding) {
  // node::ParseEncoding() requires lower case.
  if (typeof encoding === 'string') encoding = encoding.toLowerCase();
  if (!(['hex', 'utf8', 'utf-8', 'ascii', 'binary', 'base64', 'ucs2', 'ucs-2', 'utf16le', 'utf-16le', 'raw'].indexOf((encoding + '').toLowerCase()) > -1)) throw new TypeError('Unknown encoding: ' + encoding);
  this._writableState.defaultEncoding = encoding;
  return this;
};

function decodeChunk(state, chunk, encoding) {
  if (!state.objectMode && state.decodeStrings !== false && typeof chunk === 'string') {
    chunk = Buffer.from(chunk, encoding);
  }
  return chunk;
}

// if we're already writing something, then just put this
// in the queue, and wait our turn.  Otherwise, call _write
// If we return false, then we need a drain event, so set that flag.
function writeOrBuffer(stream, state, isBuf, chunk, encoding, cb) {
  if (!isBuf) {
    var newChunk = decodeChunk(state, chunk, encoding);
    if (chunk !== newChunk) {
      isBuf = true;
      encoding = 'buffer';
      chunk = newChunk;
    }
  }
  var len = state.objectMode ? 1 : chunk.length;

  state.length += len;

  var ret = state.length < state.highWaterMark;
  // we must ensure that previous needDrain will not be reset to false.
  if (!ret) state.needDrain = true;

  if (state.writing || state.corked) {
    var last = state.lastBufferedRequest;
    state.lastBufferedRequest = {
      chunk: chunk,
      encoding: encoding,
      isBuf: isBuf,
      callback: cb,
      next: null
    };
    if (last) {
      last.next = state.lastBufferedRequest;
    } else {
      state.bufferedRequest = state.lastBufferedRequest;
    }
    state.bufferedRequestCount += 1;
  } else {
    doWrite(stream, state, false, len, chunk, encoding, cb);
  }

  return ret;
}

function doWrite(stream, state, writev, len, chunk, encoding, cb) {
  state.writelen = len;
  state.writecb = cb;
  state.writing = true;
  state.sync = true;
  if (writev) stream._writev(chunk, state.onwrite);else stream._write(chunk, encoding, state.onwrite);
  state.sync = false;
}

function onwriteError(stream, state, sync, er, cb) {
  --state.pendingcb;

  if (sync) {
    // defer the callback if we are being called synchronously
    // to avoid piling up things on the stack
    processNextTick(cb, er);
    // this can emit finish, and it will always happen
    // after error
    processNextTick(finishMaybe, stream, state);
    stream._writableState.errorEmitted = true;
    stream.emit('error', er);
  } else {
    // the caller expect this to happen before if
    // it is async
    cb(er);
    stream._writableState.errorEmitted = true;
    stream.emit('error', er);
    // this can emit finish, but finish must
    // always follow error
    finishMaybe(stream, state);
  }
}

function onwriteStateUpdate(state) {
  state.writing = false;
  state.writecb = null;
  state.length -= state.writelen;
  state.writelen = 0;
}

function onwrite(stream, er) {
  var state = stream._writableState;
  var sync = state.sync;
  var cb = state.writecb;

  onwriteStateUpdate(state);

  if (er) onwriteError(stream, state, sync, er, cb);else {
    // Check if we're actually ready to finish, but don't emit yet
    var finished = needFinish(state);

    if (!finished && !state.corked && !state.bufferProcessing && state.bufferedRequest) {
      clearBuffer(stream, state);
    }

    if (sync) {
      /*<replacement>*/
      asyncWrite(afterWrite, stream, state, finished, cb);
      /*</replacement>*/
    } else {
      afterWrite(stream, state, finished, cb);
    }
  }
}

function afterWrite(stream, state, finished, cb) {
  if (!finished) onwriteDrain(stream, state);
  state.pendingcb--;
  cb();
  finishMaybe(stream, state);
}

// Must force callback to be called on nextTick, so that we don't
// emit 'drain' before the write() consumer gets the 'false' return
// value, and has a chance to attach a 'drain' listener.
function onwriteDrain(stream, state) {
  if (state.length === 0 && state.needDrain) {
    state.needDrain = false;
    stream.emit('drain');
  }
}

// if there's something in the buffer waiting, then process it
function clearBuffer(stream, state) {
  state.bufferProcessing = true;
  var entry = state.bufferedRequest;

  if (stream._writev && entry && entry.next) {
    // Fast case, write everything using _writev()
    var l = state.bufferedRequestCount;
    var buffer = new Array(l);
    var holder = state.corkedRequestsFree;
    holder.entry = entry;

    var count = 0;
    var allBuffers = true;
    while (entry) {
      buffer[count] = entry;
      if (!entry.isBuf) allBuffers = false;
      entry = entry.next;
      count += 1;
    }
    buffer.allBuffers = allBuffers;

    doWrite(stream, state, true, state.length, buffer, '', holder.finish);

    // doWrite is almost always async, defer these to save a bit of time
    // as the hot path ends with doWrite
    state.pendingcb++;
    state.lastBufferedRequest = null;
    if (holder.next) {
      state.corkedRequestsFree = holder.next;
      holder.next = null;
    } else {
      state.corkedRequestsFree = new CorkedRequest(state);
    }
  } else {
    // Slow case, write chunks one-by-one
    while (entry) {
      var chunk = entry.chunk;
      var encoding = entry.encoding;
      var cb = entry.callback;
      var len = state.objectMode ? 1 : chunk.length;

      doWrite(stream, state, false, len, chunk, encoding, cb);
      entry = entry.next;
      // if we didn't call the onwrite immediately, then
      // it means that we need to wait until it does.
      // also, that means that the chunk and cb are currently
      // being processed, so move the buffer counter past them.
      if (state.writing) {
        break;
      }
    }

    if (entry === null) state.lastBufferedRequest = null;
  }

  state.bufferedRequestCount = 0;
  state.bufferedRequest = entry;
  state.bufferProcessing = false;
}

Writable.prototype._write = function (chunk, encoding, cb) {
  cb(new Error('_write() is not implemented'));
};

Writable.prototype._writev = null;

Writable.prototype.end = function (chunk, encoding, cb) {
  var state = this._writableState;

  if (typeof chunk === 'function') {
    cb = chunk;
    chunk = null;
    encoding = null;
  } else if (typeof encoding === 'function') {
    cb = encoding;
    encoding = null;
  }

  if (chunk !== null && chunk !== undefined) this.write(chunk, encoding);

  // .end() fully uncorks
  if (state.corked) {
    state.corked = 1;
    this.uncork();
  }

  // ignore unnecessary end() calls.
  if (!state.ending && !state.finished) endWritable(this, state, cb);
};

function needFinish(state) {
  return state.ending && state.length === 0 && state.bufferedRequest === null && !state.finished && !state.writing;
}
function callFinal(stream, state) {
  stream._final(function (err) {
    state.pendingcb--;
    if (err) {
      stream.emit('error', err);
    }
    state.prefinished = true;
    stream.emit('prefinish');
    finishMaybe(stream, state);
  });
}
function prefinish(stream, state) {
  if (!state.prefinished && !state.finalCalled) {
    if (typeof stream._final === 'function') {
      state.pendingcb++;
      state.finalCalled = true;
      processNextTick(callFinal, stream, state);
    } else {
      state.prefinished = true;
      stream.emit('prefinish');
    }
  }
}

function finishMaybe(stream, state) {
  var need = needFinish(state);
  if (need) {
    prefinish(stream, state);
    if (state.pendingcb === 0) {
      state.finished = true;
      stream.emit('finish');
    }
  }
  return need;
}

function endWritable(stream, state, cb) {
  state.ending = true;
  finishMaybe(stream, state);
  if (cb) {
    if (state.finished) processNextTick(cb);else stream.once('finish', cb);
  }
  state.ended = true;
  stream.writable = false;
}

function onCorkedFinish(corkReq, state, err) {
  var entry = corkReq.entry;
  corkReq.entry = null;
  while (entry) {
    var cb = entry.callback;
    state.pendingcb--;
    cb(err);
    entry = entry.next;
  }
  if (state.corkedRequestsFree) {
    state.corkedRequestsFree.next = corkReq;
  } else {
    state.corkedRequestsFree = corkReq;
  }
}

Object.defineProperty(Writable.prototype, 'destroyed', {
  get: function () {
    if (this._writableState === undefined) {
      return false;
    }
    return this._writableState.destroyed;
  },
  set: function (value) {
    // we ignore the value if the stream
    // has not been initialized yet
    if (!this._writableState) {
      return;
    }

    // backward compatibility, the user is explicitly
    // managing destroyed
    this._writableState.destroyed = value;
  }
});

Writable.prototype.destroy = destroyImpl.destroy;
Writable.prototype._undestroy = destroyImpl.undestroy;
Writable.prototype._destroy = function (err, cb) {
  this.end();
  cb(err);
};
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(41), __webpack_require__(225).setImmediate, __webpack_require__(37)))

/***/ }),
/* 106 */
/***/ (function(module, exports, __webpack_require__) {

// Copyright Joyent, Inc. and other Node contributors.
//
// Permission is hereby granted, free of charge, to any person obtaining a
// copy of this software and associated documentation files (the
// "Software"), to deal in the Software without restriction, including
// without limitation the rights to use, copy, modify, merge, publish,
// distribute, sublicense, and/or sell copies of the Software, and to permit
// persons to whom the Software is furnished to do so, subject to the
// following conditions:
//
// The above copyright notice and this permission notice shall be included
// in all copies or substantial portions of the Software.
//
// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
// USE OR OTHER DEALINGS IN THE SOFTWARE.

var Buffer = __webpack_require__(6).Buffer;

var isBufferEncoding = Buffer.isEncoding
  || function(encoding) {
       switch (encoding && encoding.toLowerCase()) {
         case 'hex': case 'utf8': case 'utf-8': case 'ascii': case 'binary': case 'base64': case 'ucs2': case 'ucs-2': case 'utf16le': case 'utf-16le': case 'raw': return true;
         default: return false;
       }
     }


function assertEncoding(encoding) {
  if (encoding && !isBufferEncoding(encoding)) {
    throw new Error('Unknown encoding: ' + encoding);
  }
}

// StringDecoder provides an interface for efficiently splitting a series of
// buffers into a series of JS strings without breaking apart multi-byte
// characters. CESU-8 is handled as part of the UTF-8 encoding.
//
// @TODO Handling all encodings inside a single object makes it very difficult
// to reason about this code, so it should be split up in the future.
// @TODO There should be a utf8-strict encoding that rejects invalid UTF-8 code
// points as used by CESU-8.
var StringDecoder = exports.StringDecoder = function(encoding) {
  this.encoding = (encoding || 'utf8').toLowerCase().replace(/[-_]/, '');
  assertEncoding(encoding);
  switch (this.encoding) {
    case 'utf8':
      // CESU-8 represents each of Surrogate Pair by 3-bytes
      this.surrogateSize = 3;
      break;
    case 'ucs2':
    case 'utf16le':
      // UTF-16 represents each of Surrogate Pair by 2-bytes
      this.surrogateSize = 2;
      this.detectIncompleteChar = utf16DetectIncompleteChar;
      break;
    case 'base64':
      // Base-64 stores 3 bytes in 4 chars, and pads the remainder.
      this.surrogateSize = 3;
      this.detectIncompleteChar = base64DetectIncompleteChar;
      break;
    default:
      this.write = passThroughWrite;
      return;
  }

  // Enough space to store all bytes of a single character. UTF-8 needs 4
  // bytes, but CESU-8 may require up to 6 (3 bytes per surrogate).
  this.charBuffer = new Buffer(6);
  // Number of bytes received for the current incomplete multi-byte character.
  this.charReceived = 0;
  // Number of bytes expected for the current incomplete multi-byte character.
  this.charLength = 0;
};


// write decodes the given buffer and returns it as JS string that is
// guaranteed to not contain any partial multi-byte characters. Any partial
// character found at the end of the buffer is buffered up, and will be
// returned when calling write again with the remaining bytes.
//
// Note: Converting a Buffer containing an orphan surrogate to a String
// currently works, but converting a String to a Buffer (via `new Buffer`, or
// Buffer#write) will replace incomplete surrogates with the unicode
// replacement character. See https://codereview.chromium.org/121173009/ .
StringDecoder.prototype.write = function(buffer) {
  var charStr = '';
  // if our last write ended with an incomplete multibyte character
  while (this.charLength) {
    // determine how many remaining bytes this buffer has to offer for this char
    var available = (buffer.length >= this.charLength - this.charReceived) ?
        this.charLength - this.charReceived :
        buffer.length;

    // add the new bytes to the char buffer
    buffer.copy(this.charBuffer, this.charReceived, 0, available);
    this.charReceived += available;

    if (this.charReceived < this.charLength) {
      // still not enough chars in this buffer? wait for more ...
      return '';
    }

    // remove bytes belonging to the current character from the buffer
    buffer = buffer.slice(available, buffer.length);

    // get the character that was split
    charStr = this.charBuffer.slice(0, this.charLength).toString(this.encoding);

    // CESU-8: lead surrogate (D800-DBFF) is also the incomplete character
    var charCode = charStr.charCodeAt(charStr.length - 1);
    if (charCode >= 0xD800 && charCode <= 0xDBFF) {
      this.charLength += this.surrogateSize;
      charStr = '';
      continue;
    }
    this.charReceived = this.charLength = 0;

    // if there are no more bytes in this buffer, just emit our char
    if (buffer.length === 0) {
      return charStr;
    }
    break;
  }

  // determine and set charLength / charReceived
  this.detectIncompleteChar(buffer);

  var end = buffer.length;
  if (this.charLength) {
    // buffer the incomplete character bytes we got
    buffer.copy(this.charBuffer, 0, buffer.length - this.charReceived, end);
    end -= this.charReceived;
  }

  charStr += buffer.toString(this.encoding, 0, end);

  var end = charStr.length - 1;
  var charCode = charStr.charCodeAt(end);
  // CESU-8: lead surrogate (D800-DBFF) is also the incomplete character
  if (charCode >= 0xD800 && charCode <= 0xDBFF) {
    var size = this.surrogateSize;
    this.charLength += size;
    this.charReceived += size;
    this.charBuffer.copy(this.charBuffer, size, 0, size);
    buffer.copy(this.charBuffer, 0, 0, size);
    return charStr.substring(0, end);
  }

  // or just emit the charStr
  return charStr;
};

// detectIncompleteChar determines if there is an incomplete UTF-8 character at
// the end of the given buffer. If so, it sets this.charLength to the byte
// length that character, and sets this.charReceived to the number of bytes
// that are available for this character.
StringDecoder.prototype.detectIncompleteChar = function(buffer) {
  // determine how many bytes we have to check at the end of this buffer
  var i = (buffer.length >= 3) ? 3 : buffer.length;

  // Figure out if one of the last i bytes of our buffer announces an
  // incomplete char.
  for (; i > 0; i--) {
    var c = buffer[buffer.length - i];

    // See http://en.wikipedia.org/wiki/UTF-8#Description

    // 110XXXXX
    if (i == 1 && c >> 5 == 0x06) {
      this.charLength = 2;
      break;
    }

    // 1110XXXX
    if (i <= 2 && c >> 4 == 0x0E) {
      this.charLength = 3;
      break;
    }

    // 11110XXX
    if (i <= 3 && c >> 3 == 0x1E) {
      this.charLength = 4;
      break;
    }
  }
  this.charReceived = i;
};

StringDecoder.prototype.end = function(buffer) {
  var res = '';
  if (buffer && buffer.length)
    res = this.write(buffer);

  if (this.charReceived) {
    var cr = this.charReceived;
    var buf = this.charBuffer;
    var enc = this.encoding;
    res += buf.slice(0, cr).toString(enc);
  }

  return res;
};

function passThroughWrite(buffer) {
  return buffer.toString(this.encoding);
}

function utf16DetectIncompleteChar(buffer) {
  this.charReceived = buffer.length % 2;
  this.charLength = this.charReceived ? 2 : 0;
}

function base64DetectIncompleteChar(buffer) {
  this.charReceived = buffer.length % 3;
  this.charLength = this.charReceived ? 3 : 0;
}


/***/ }),
/* 107 */
/***/ (function(module, exports, __webpack_require__) {

var exports = module.exports = function SHA (algorithm) {
  algorithm = algorithm.toLowerCase()

  var Algorithm = exports[algorithm]
  if (!Algorithm) throw new Error(algorithm + ' is not supported (we accept pull requests)')

  return new Algorithm()
}

exports.sha = __webpack_require__(233)
exports.sha1 = __webpack_require__(234)
exports.sha224 = __webpack_require__(235)
exports.sha256 = __webpack_require__(151)
exports.sha384 = __webpack_require__(236)
exports.sha512 = __webpack_require__(152)


/***/ }),
/* 108 */
/***/ (function(module, exports, __webpack_require__) {

var ciphers = __webpack_require__(242)
var deciphers = __webpack_require__(250)
var modes = __webpack_require__(161)

function getCiphers () {
  return Object.keys(modes)
}

exports.createCipher = exports.Cipher = ciphers.createCipher
exports.createCipheriv = exports.Cipheriv = ciphers.createCipheriv
exports.createDecipher = exports.Decipher = deciphers.createDecipher
exports.createDecipheriv = exports.Decipheriv = deciphers.createDecipheriv
exports.listCiphers = exports.getCiphers = getCiphers


/***/ }),
/* 109 */
/***/ (function(module, exports, __webpack_require__) {

var modeModules = {
  ECB: __webpack_require__(243),
  CBC: __webpack_require__(244),
  CFB: __webpack_require__(245),
  CFB8: __webpack_require__(246),
  CFB1: __webpack_require__(247),
  OFB: __webpack_require__(248),
  CTR: __webpack_require__(159),
  GCM: __webpack_require__(159)
}

var modes = __webpack_require__(161)

for (var key in modes) {
  modes[key].module = modeModules[modes[key].mode]
}

module.exports = modes


/***/ }),
/* 110 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


exports.utils = __webpack_require__(252);
exports.Cipher = __webpack_require__(253);
exports.DES = __webpack_require__(254);
exports.CBC = __webpack_require__(255);
exports.EDE = __webpack_require__(256);


/***/ }),
/* 111 */
/***/ (function(module, exports, __webpack_require__) {

/* WEBPACK VAR INJECTION */(function(Buffer) {var bn = __webpack_require__(13);
var randomBytes = __webpack_require__(66);
module.exports = crt;
function blind(priv) {
  var r = getr(priv);
  var blinder = r.toRed(bn.mont(priv.modulus))
  .redPow(new bn(priv.publicExponent)).fromRed();
  return {
    blinder: blinder,
    unblinder:r.invm(priv.modulus)
  };
}
function crt(msg, priv) {
  var blinds = blind(priv);
  var len = priv.modulus.byteLength();
  var mod = bn.mont(priv.modulus);
  var blinded = new bn(msg).mul(blinds.blinder).umod(priv.modulus);
  var c1 = blinded.toRed(bn.mont(priv.prime1));
  var c2 = blinded.toRed(bn.mont(priv.prime2));
  var qinv = priv.coefficient;
  var p = priv.prime1;
  var q = priv.prime2;
  var m1 = c1.redPow(priv.exponent1);
  var m2 = c2.redPow(priv.exponent2);
  m1 = m1.fromRed();
  m2 = m2.fromRed();
  var h = m1.isub(m2).imul(qinv).umod(p);
  h.imul(q);
  m2.iadd(h);
  return new Buffer(m2.imul(blinds.unblinder).umod(priv.modulus).toArray(false, len));
}
crt.getr = getr;
function getr(priv) {
  var len = priv.modulus.byteLength();
  var r = new bn(randomBytes(len));
  while (r.cmp(priv.modulus) >=  0 || !r.umod(priv.prime1) || !r.umod(priv.prime2)) {
    r = new bn(randomBytes(len));
  }
  return r;
}

/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(6).Buffer))

/***/ }),
/* 112 */
/***/ (function(module, exports, __webpack_require__) {

var hash = exports;

hash.utils = __webpack_require__(29);
hash.common = __webpack_require__(70);
hash.sha = __webpack_require__(273);
hash.ripemd = __webpack_require__(277);
hash.hmac = __webpack_require__(278);

// Proxy hash functions to the main object
hash.sha1 = hash.sha.sha1;
hash.sha256 = hash.sha.sha256;
hash.sha224 = hash.sha.sha224;
hash.sha384 = hash.sha.sha384;
hash.sha512 = hash.sha.sha512;
hash.ripemd160 = hash.ripemd.ripemd160;


/***/ }),
/* 113 */
/***/ (function(module, exports, __webpack_require__) {

var isObject = __webpack_require__(7);
var document = __webpack_require__(3).document;
// typeof document.createElement is 'object' in old IE
var is = isObject(document) && isObject(document.createElement);
module.exports = function (it) {
  return is ? document.createElement(it) : {};
};


/***/ }),
/* 114 */
/***/ (function(module, exports, __webpack_require__) {

var global = __webpack_require__(3);
var core = __webpack_require__(30);
var LIBRARY = __webpack_require__(48);
var wksExt = __webpack_require__(180);
var defineProperty = __webpack_require__(11).f;
module.exports = function (name) {
  var $Symbol = core.Symbol || (core.Symbol = LIBRARY ? {} : global.Symbol || {});
  if (name.charAt(0) != '_' && !(name in $Symbol)) defineProperty($Symbol, name, { value: wksExt.f(name) });
};


/***/ }),
/* 115 */
/***/ (function(module, exports, __webpack_require__) {

var shared = __webpack_require__(82)('keys');
var uid = __webpack_require__(47);
module.exports = function (key) {
  return shared[key] || (shared[key] = uid(key));
};


/***/ }),
/* 116 */
/***/ (function(module, exports) {

// IE 8- don't enum bug keys
module.exports = (
  'constructor,hasOwnProperty,isPrototypeOf,propertyIsEnumerable,toLocaleString,toString,valueOf'
).split(',');


/***/ }),
/* 117 */
/***/ (function(module, exports, __webpack_require__) {

var document = __webpack_require__(3).document;
module.exports = document && document.documentElement;


/***/ }),
/* 118 */
/***/ (function(module, exports, __webpack_require__) {

// Works with __proto__ only. Old v8 can't work with null proto objects.
/* eslint-disable no-proto */
var isObject = __webpack_require__(7);
var anObject = __webpack_require__(2);
var check = function (O, proto) {
  anObject(O);
  if (!isObject(proto) && proto !== null) throw TypeError(proto + ": can't set as prototype!");
};
module.exports = {
  set: Object.setPrototypeOf || ('__proto__' in {} ? // eslint-disable-line
    function (test, buggy, set) {
      try {
        set = __webpack_require__(26)(Function.call, __webpack_require__(24).f(Object.prototype, '__proto__').set, 2);
        set(test, []);
        buggy = !(test instanceof Array);
      } catch (e) { buggy = true; }
      return function setPrototypeOf(O, proto) {
        check(O, proto);
        if (buggy) O.__proto__ = proto;
        else set(O, proto);
        return O;
      };
    }({}, false) : undefined),
  check: check
};


/***/ }),
/* 119 */
/***/ (function(module, exports) {

module.exports = '\x09\x0A\x0B\x0C\x0D\x20\xA0\u1680\u180E\u2000\u2001\u2002\u2003' +
  '\u2004\u2005\u2006\u2007\u2008\u2009\u200A\u202F\u205F\u3000\u2028\u2029\uFEFF';


/***/ }),
/* 120 */
/***/ (function(module, exports, __webpack_require__) {

var isObject = __webpack_require__(7);
var setPrototypeOf = __webpack_require__(118).set;
module.exports = function (that, target, C) {
  var S = target.constructor;
  var P;
  if (S !== C && typeof S == 'function' && (P = S.prototype) !== C.prototype && isObject(P) && setPrototypeOf) {
    setPrototypeOf(that, P);
  } return that;
};


/***/ }),
/* 121 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var toInteger = __webpack_require__(33);
var defined = __webpack_require__(32);

module.exports = function repeat(count) {
  var str = String(defined(this));
  var res = '';
  var n = toInteger(count);
  if (n < 0 || n == Infinity) throw RangeError("Count can't be negative");
  for (;n > 0; (n >>>= 1) && (str += str)) if (n & 1) res += str;
  return res;
};


/***/ }),
/* 122 */
/***/ (function(module, exports) {

// 20.2.2.28 Math.sign(x)
module.exports = Math.sign || function sign(x) {
  // eslint-disable-next-line no-self-compare
  return (x = +x) == 0 || x != x ? x : x < 0 ? -1 : 1;
};


/***/ }),
/* 123 */
/***/ (function(module, exports) {

// 20.2.2.14 Math.expm1(x)
var $expm1 = Math.expm1;
module.exports = (!$expm1
  // Old FF bug
  || $expm1(10) > 22025.465794806719 || $expm1(10) < 22025.4657948067165168
  // Tor Browser bug
  || $expm1(-2e-17) != -2e-17
) ? function expm1(x) {
  return (x = +x) == 0 ? x : x > -1e-6 && x < 1e-6 ? x + x * x / 2 : Math.exp(x) - 1;
} : $expm1;


/***/ }),
/* 124 */
/***/ (function(module, exports, __webpack_require__) {

var toInteger = __webpack_require__(33);
var defined = __webpack_require__(32);
// true  -> String#at
// false -> String#codePointAt
module.exports = function (TO_STRING) {
  return function (that, pos) {
    var s = String(defined(that));
    var i = toInteger(pos);
    var l = s.length;
    var a, b;
    if (i < 0 || i >= l) return TO_STRING ? '' : undefined;
    a = s.charCodeAt(i);
    return a < 0xd800 || a > 0xdbff || i + 1 === l || (b = s.charCodeAt(i + 1)) < 0xdc00 || b > 0xdfff
      ? TO_STRING ? s.charAt(i) : a
      : TO_STRING ? s.slice(i, i + 2) : (a - 0xd800 << 10) + (b - 0xdc00) + 0x10000;
  };
};


/***/ }),
/* 125 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var LIBRARY = __webpack_require__(48);
var $export = __webpack_require__(0);
var redefine = __webpack_require__(20);
var hide = __webpack_require__(19);
var has = __webpack_require__(18);
var Iterators = __webpack_require__(61);
var $iterCreate = __webpack_require__(126);
var setToStringTag = __webpack_require__(59);
var getPrototypeOf = __webpack_require__(25);
var ITERATOR = __webpack_require__(9)('iterator');
var BUGGY = !([].keys && 'next' in [].keys()); // Safari has buggy iterators w/o `next`
var FF_ITERATOR = '@@iterator';
var KEYS = 'keys';
var VALUES = 'values';

var returnThis = function () { return this; };

module.exports = function (Base, NAME, Constructor, next, DEFAULT, IS_SET, FORCED) {
  $iterCreate(Constructor, NAME, next);
  var getMethod = function (kind) {
    if (!BUGGY && kind in proto) return proto[kind];
    switch (kind) {
      case KEYS: return function keys() { return new Constructor(this, kind); };
      case VALUES: return function values() { return new Constructor(this, kind); };
    } return function entries() { return new Constructor(this, kind); };
  };
  var TAG = NAME + ' Iterator';
  var DEF_VALUES = DEFAULT == VALUES;
  var VALUES_BUG = false;
  var proto = Base.prototype;
  var $native = proto[ITERATOR] || proto[FF_ITERATOR] || DEFAULT && proto[DEFAULT];
  var $default = $native || getMethod(DEFAULT);
  var $entries = DEFAULT ? !DEF_VALUES ? $default : getMethod('entries') : undefined;
  var $anyNative = NAME == 'Array' ? proto.entries || $native : $native;
  var methods, key, IteratorPrototype;
  // Fix native
  if ($anyNative) {
    IteratorPrototype = getPrototypeOf($anyNative.call(new Base()));
    if (IteratorPrototype !== Object.prototype && IteratorPrototype.next) {
      // Set @@toStringTag to native iterators
      setToStringTag(IteratorPrototype, TAG, true);
      // fix for some old engines
      if (!LIBRARY && !has(IteratorPrototype, ITERATOR)) hide(IteratorPrototype, ITERATOR, returnThis);
    }
  }
  // fix Array#{values, @@iterator}.name in V8 / FF
  if (DEF_VALUES && $native && $native.name !== VALUES) {
    VALUES_BUG = true;
    $default = function values() { return $native.call(this); };
  }
  // Define iterator
  if ((!LIBRARY || FORCED) && (BUGGY || VALUES_BUG || !proto[ITERATOR])) {
    hide(proto, ITERATOR, $default);
  }
  // Plug for library
  Iterators[NAME] = $default;
  Iterators[TAG] = returnThis;
  if (DEFAULT) {
    methods = {
      values: DEF_VALUES ? $default : getMethod(VALUES),
      keys: IS_SET ? $default : getMethod(KEYS),
      entries: $entries
    };
    if (FORCED) for (key in methods) {
      if (!(key in proto)) redefine(proto, key, methods[key]);
    } else $export($export.P + $export.F * (BUGGY || VALUES_BUG), NAME, methods);
  }
  return methods;
};


/***/ }),
/* 126 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var create = __webpack_require__(51);
var descriptor = __webpack_require__(46);
var setToStringTag = __webpack_require__(59);
var IteratorPrototype = {};

// 25.1.2.1.1 %IteratorPrototype%[@@iterator]()
__webpack_require__(19)(IteratorPrototype, __webpack_require__(9)('iterator'), function () { return this; });

module.exports = function (Constructor, NAME, next) {
  Constructor.prototype = create(IteratorPrototype, { next: descriptor(1, next) });
  setToStringTag(Constructor, NAME + ' Iterator');
};


/***/ }),
/* 127 */
/***/ (function(module, exports, __webpack_require__) {

// helper for String#{startsWith, endsWith, includes}
var isRegExp = __webpack_require__(86);
var defined = __webpack_require__(32);

module.exports = function (that, searchString, NAME) {
  if (isRegExp(searchString)) throw TypeError('String#' + NAME + " doesn't accept regex!");
  return String(defined(that));
};


/***/ }),
/* 128 */
/***/ (function(module, exports, __webpack_require__) {

var MATCH = __webpack_require__(9)('match');
module.exports = function (KEY) {
  var re = /./;
  try {
    '/./'[KEY](re);
  } catch (e) {
    try {
      re[MATCH] = false;
      return !'/./'[KEY](re);
    } catch (f) { /* empty */ }
  } return true;
};


/***/ }),
/* 129 */
/***/ (function(module, exports, __webpack_require__) {

// check on default Array iterator
var Iterators = __webpack_require__(61);
var ITERATOR = __webpack_require__(9)('iterator');
var ArrayProto = Array.prototype;

module.exports = function (it) {
  return it !== undefined && (Iterators.Array === it || ArrayProto[ITERATOR] === it);
};


/***/ }),
/* 130 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var $defineProperty = __webpack_require__(11);
var createDesc = __webpack_require__(46);

module.exports = function (object, index, value) {
  if (index in object) $defineProperty.f(object, index, createDesc(0, value));
  else object[index] = value;
};


/***/ }),
/* 131 */
/***/ (function(module, exports, __webpack_require__) {

var classof = __webpack_require__(75);
var ITERATOR = __webpack_require__(9)('iterator');
var Iterators = __webpack_require__(61);
module.exports = __webpack_require__(30).getIteratorMethod = function (it) {
  if (it != undefined) return it[ITERATOR]
    || it['@@iterator']
    || Iterators[classof(it)];
};


/***/ }),
/* 132 */
/***/ (function(module, exports, __webpack_require__) {

// 9.4.2.3 ArraySpeciesCreate(originalArray, length)
var speciesConstructor = __webpack_require__(399);

module.exports = function (original, length) {
  return new (speciesConstructor(original))(length);
};


/***/ }),
/* 133 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";
// 22.1.3.6 Array.prototype.fill(value, start = 0, end = this.length)

var toObject = __webpack_require__(14);
var toAbsoluteIndex = __webpack_require__(50);
var toLength = __webpack_require__(12);
module.exports = function fill(value /* , start = 0, end = @length */) {
  var O = toObject(this);
  var length = toLength(O.length);
  var aLen = arguments.length;
  var index = toAbsoluteIndex(aLen > 1 ? arguments[1] : undefined, length);
  var end = aLen > 2 ? arguments[2] : undefined;
  var endPos = end === undefined ? length : toAbsoluteIndex(end, length);
  while (endPos > index) O[index++] = value;
  return O;
};


/***/ }),
/* 134 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var addToUnscopables = __webpack_require__(44);
var step = __webpack_require__(196);
var Iterators = __webpack_require__(61);
var toIObject = __webpack_require__(23);

// 22.1.3.4 Array.prototype.entries()
// 22.1.3.13 Array.prototype.keys()
// 22.1.3.29 Array.prototype.values()
// 22.1.3.30 Array.prototype[@@iterator]()
module.exports = __webpack_require__(125)(Array, 'Array', function (iterated, kind) {
  this._t = toIObject(iterated); // target
  this._i = 0;                   // next index
  this._k = kind;                // kind
// 22.1.5.2.1 %ArrayIteratorPrototype%.next()
}, function () {
  var O = this._t;
  var kind = this._k;
  var index = this._i++;
  if (!O || index >= O.length) {
    this._t = undefined;
    return step(1);
  }
  if (kind == 'keys') return step(0, index);
  if (kind == 'values') return step(0, O[index]);
  return step(0, [index, O[index]]);
}, 'values');

// argumentsList[@@iterator] is %ArrayProto_values% (9.4.4.6, 9.4.4.7)
Iterators.Arguments = Iterators.Array;

addToUnscopables('keys');
addToUnscopables('values');
addToUnscopables('entries');


/***/ }),
/* 135 */
/***/ (function(module, exports, __webpack_require__) {

var ctx = __webpack_require__(26);
var invoke = __webpack_require__(186);
var html = __webpack_require__(117);
var cel = __webpack_require__(113);
var global = __webpack_require__(3);
var process = global.process;
var setTask = global.setImmediate;
var clearTask = global.clearImmediate;
var MessageChannel = global.MessageChannel;
var Dispatch = global.Dispatch;
var counter = 0;
var queue = {};
var ONREADYSTATECHANGE = 'onreadystatechange';
var defer, channel, port;
var run = function () {
  var id = +this;
  // eslint-disable-next-line no-prototype-builtins
  if (queue.hasOwnProperty(id)) {
    var fn = queue[id];
    delete queue[id];
    fn();
  }
};
var listener = function (event) {
  run.call(event.data);
};
// Node.js 0.9+ & IE10+ has setImmediate, otherwise:
if (!setTask || !clearTask) {
  setTask = function setImmediate(fn) {
    var args = [];
    var i = 1;
    while (arguments.length > i) args.push(arguments[i++]);
    queue[++counter] = function () {
      // eslint-disable-next-line no-new-func
      invoke(typeof fn == 'function' ? fn : Function(fn), args);
    };
    defer(counter);
    return counter;
  };
  clearTask = function clearImmediate(id) {
    delete queue[id];
  };
  // Node.js 0.8-
  if (__webpack_require__(27)(process) == 'process') {
    defer = function (id) {
      process.nextTick(ctx(run, id, 1));
    };
  // Sphere (JS game engine) Dispatch API
  } else if (Dispatch && Dispatch.now) {
    defer = function (id) {
      Dispatch.now(ctx(run, id, 1));
    };
  // Browsers with MessageChannel, includes WebWorkers
  } else if (MessageChannel) {
    channel = new MessageChannel();
    port = channel.port2;
    channel.port1.onmessage = listener;
    defer = ctx(port.postMessage, port, 1);
  // Browsers with postMessage, skip WebWorkers
  // IE8 has postMessage, but it's sync & typeof its postMessage is 'object'
  } else if (global.addEventListener && typeof postMessage == 'function' && !global.importScripts) {
    defer = function (id) {
      global.postMessage(id + '', '*');
    };
    global.addEventListener('message', listener, false);
  // IE8-
  } else if (ONREADYSTATECHANGE in cel('script')) {
    defer = function (id) {
      html.appendChild(cel('script'))[ONREADYSTATECHANGE] = function () {
        html.removeChild(this);
        run.call(id);
      };
    };
  // Rest old browsers
  } else {
    defer = function (id) {
      setTimeout(ctx(run, id, 1), 0);
    };
  }
}
module.exports = {
  set: setTask,
  clear: clearTask
};


/***/ }),
/* 136 */
/***/ (function(module, exports, __webpack_require__) {

var global = __webpack_require__(3);
var macrotask = __webpack_require__(135).set;
var Observer = global.MutationObserver || global.WebKitMutationObserver;
var process = global.process;
var Promise = global.Promise;
var isNode = __webpack_require__(27)(process) == 'process';

module.exports = function () {
  var head, last, notify;

  var flush = function () {
    var parent, fn;
    if (isNode && (parent = process.domain)) parent.exit();
    while (head) {
      fn = head.fn;
      head = head.next;
      try {
        fn();
      } catch (e) {
        if (head) notify();
        else last = undefined;
        throw e;
      }
    } last = undefined;
    if (parent) parent.enter();
  };

  // Node.js
  if (isNode) {
    notify = function () {
      process.nextTick(flush);
    };
  // browsers with MutationObserver
  } else if (Observer) {
    var toggle = true;
    var node = document.createTextNode('');
    new Observer(flush).observe(node, { characterData: true }); // eslint-disable-line no-new
    notify = function () {
      node.data = toggle = !toggle;
    };
  // environments with maybe non-completely correct, but existent Promise
  } else if (Promise && Promise.resolve) {
    var promise = Promise.resolve();
    notify = function () {
      promise.then(flush);
    };
  // for other environments - macrotask based on:
  // - setImmediate
  // - MessageChannel
  // - window.postMessag
  // - onreadystatechange
  // - setTimeout
  } else {
    notify = function () {
      // strange IE + webpack dev server bug - use .call(global)
      macrotask.call(global, flush);
    };
  }

  return function (fn) {
    var task = { fn: fn, next: undefined };
    if (last) last.next = task;
    if (!head) {
      head = task;
      notify();
    } last = task;
  };
};


/***/ }),
/* 137 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// 25.4.1.5 NewPromiseCapability(C)
var aFunction = __webpack_require__(16);

function PromiseCapability(C) {
  var resolve, reject;
  this.promise = new C(function ($$resolve, $$reject) {
    if (resolve !== undefined || reject !== undefined) throw TypeError('Bad Promise constructor');
    resolve = $$resolve;
    reject = $$reject;
  });
  this.resolve = aFunction(resolve);
  this.reject = aFunction(reject);
}

module.exports.f = function (C) {
  return new PromiseCapability(C);
};


/***/ }),
/* 138 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var global = __webpack_require__(3);
var DESCRIPTORS = __webpack_require__(10);
var LIBRARY = __webpack_require__(48);
var $typed = __webpack_require__(92);
var hide = __webpack_require__(19);
var redefineAll = __webpack_require__(56);
var fails = __webpack_require__(5);
var anInstance = __webpack_require__(54);
var toInteger = __webpack_require__(33);
var toLength = __webpack_require__(12);
var toIndex = __webpack_require__(205);
var gOPN = __webpack_require__(52).f;
var dP = __webpack_require__(11).f;
var arrayFill = __webpack_require__(133);
var setToStringTag = __webpack_require__(59);
var ARRAY_BUFFER = 'ArrayBuffer';
var DATA_VIEW = 'DataView';
var PROTOTYPE = 'prototype';
var WRONG_LENGTH = 'Wrong length!';
var WRONG_INDEX = 'Wrong index!';
var $ArrayBuffer = global[ARRAY_BUFFER];
var $DataView = global[DATA_VIEW];
var Math = global.Math;
var RangeError = global.RangeError;
// eslint-disable-next-line no-shadow-restricted-names
var Infinity = global.Infinity;
var BaseBuffer = $ArrayBuffer;
var abs = Math.abs;
var pow = Math.pow;
var floor = Math.floor;
var log = Math.log;
var LN2 = Math.LN2;
var BUFFER = 'buffer';
var BYTE_LENGTH = 'byteLength';
var BYTE_OFFSET = 'byteOffset';
var $BUFFER = DESCRIPTORS ? '_b' : BUFFER;
var $LENGTH = DESCRIPTORS ? '_l' : BYTE_LENGTH;
var $OFFSET = DESCRIPTORS ? '_o' : BYTE_OFFSET;

// IEEE754 conversions based on https://github.com/feross/ieee754
function packIEEE754(value, mLen, nBytes) {
  var buffer = Array(nBytes);
  var eLen = nBytes * 8 - mLen - 1;
  var eMax = (1 << eLen) - 1;
  var eBias = eMax >> 1;
  var rt = mLen === 23 ? pow(2, -24) - pow(2, -77) : 0;
  var i = 0;
  var s = value < 0 || value === 0 && 1 / value < 0 ? 1 : 0;
  var e, m, c;
  value = abs(value);
  // eslint-disable-next-line no-self-compare
  if (value != value || value === Infinity) {
    // eslint-disable-next-line no-self-compare
    m = value != value ? 1 : 0;
    e = eMax;
  } else {
    e = floor(log(value) / LN2);
    if (value * (c = pow(2, -e)) < 1) {
      e--;
      c *= 2;
    }
    if (e + eBias >= 1) {
      value += rt / c;
    } else {
      value += rt * pow(2, 1 - eBias);
    }
    if (value * c >= 2) {
      e++;
      c /= 2;
    }
    if (e + eBias >= eMax) {
      m = 0;
      e = eMax;
    } else if (e + eBias >= 1) {
      m = (value * c - 1) * pow(2, mLen);
      e = e + eBias;
    } else {
      m = value * pow(2, eBias - 1) * pow(2, mLen);
      e = 0;
    }
  }
  for (; mLen >= 8; buffer[i++] = m & 255, m /= 256, mLen -= 8);
  e = e << mLen | m;
  eLen += mLen;
  for (; eLen > 0; buffer[i++] = e & 255, e /= 256, eLen -= 8);
  buffer[--i] |= s * 128;
  return buffer;
}
function unpackIEEE754(buffer, mLen, nBytes) {
  var eLen = nBytes * 8 - mLen - 1;
  var eMax = (1 << eLen) - 1;
  var eBias = eMax >> 1;
  var nBits = eLen - 7;
  var i = nBytes - 1;
  var s = buffer[i--];
  var e = s & 127;
  var m;
  s >>= 7;
  for (; nBits > 0; e = e * 256 + buffer[i], i--, nBits -= 8);
  m = e & (1 << -nBits) - 1;
  e >>= -nBits;
  nBits += mLen;
  for (; nBits > 0; m = m * 256 + buffer[i], i--, nBits -= 8);
  if (e === 0) {
    e = 1 - eBias;
  } else if (e === eMax) {
    return m ? NaN : s ? -Infinity : Infinity;
  } else {
    m = m + pow(2, mLen);
    e = e - eBias;
  } return (s ? -1 : 1) * m * pow(2, e - mLen);
}

function unpackI32(bytes) {
  return bytes[3] << 24 | bytes[2] << 16 | bytes[1] << 8 | bytes[0];
}
function packI8(it) {
  return [it & 0xff];
}
function packI16(it) {
  return [it & 0xff, it >> 8 & 0xff];
}
function packI32(it) {
  return [it & 0xff, it >> 8 & 0xff, it >> 16 & 0xff, it >> 24 & 0xff];
}
function packF64(it) {
  return packIEEE754(it, 52, 8);
}
function packF32(it) {
  return packIEEE754(it, 23, 4);
}

function addGetter(C, key, internal) {
  dP(C[PROTOTYPE], key, { get: function () { return this[internal]; } });
}

function get(view, bytes, index, isLittleEndian) {
  var numIndex = +index;
  var intIndex = toIndex(numIndex);
  if (intIndex + bytes > view[$LENGTH]) throw RangeError(WRONG_INDEX);
  var store = view[$BUFFER]._b;
  var start = intIndex + view[$OFFSET];
  var pack = store.slice(start, start + bytes);
  return isLittleEndian ? pack : pack.reverse();
}
function set(view, bytes, index, conversion, value, isLittleEndian) {
  var numIndex = +index;
  var intIndex = toIndex(numIndex);
  if (intIndex + bytes > view[$LENGTH]) throw RangeError(WRONG_INDEX);
  var store = view[$BUFFER]._b;
  var start = intIndex + view[$OFFSET];
  var pack = conversion(+value);
  for (var i = 0; i < bytes; i++) store[start + i] = pack[isLittleEndian ? i : bytes - i - 1];
}

if (!$typed.ABV) {
  $ArrayBuffer = function ArrayBuffer(length) {
    anInstance(this, $ArrayBuffer, ARRAY_BUFFER);
    var byteLength = toIndex(length);
    this._b = arrayFill.call(Array(byteLength), 0);
    this[$LENGTH] = byteLength;
  };

  $DataView = function DataView(buffer, byteOffset, byteLength) {
    anInstance(this, $DataView, DATA_VIEW);
    anInstance(buffer, $ArrayBuffer, DATA_VIEW);
    var bufferLength = buffer[$LENGTH];
    var offset = toInteger(byteOffset);
    if (offset < 0 || offset > bufferLength) throw RangeError('Wrong offset!');
    byteLength = byteLength === undefined ? bufferLength - offset : toLength(byteLength);
    if (offset + byteLength > bufferLength) throw RangeError(WRONG_LENGTH);
    this[$BUFFER] = buffer;
    this[$OFFSET] = offset;
    this[$LENGTH] = byteLength;
  };

  if (DESCRIPTORS) {
    addGetter($ArrayBuffer, BYTE_LENGTH, '_l');
    addGetter($DataView, BUFFER, '_b');
    addGetter($DataView, BYTE_LENGTH, '_l');
    addGetter($DataView, BYTE_OFFSET, '_o');
  }

  redefineAll($DataView[PROTOTYPE], {
    getInt8: function getInt8(byteOffset) {
      return get(this, 1, byteOffset)[0] << 24 >> 24;
    },
    getUint8: function getUint8(byteOffset) {
      return get(this, 1, byteOffset)[0];
    },
    getInt16: function getInt16(byteOffset /* , littleEndian */) {
      var bytes = get(this, 2, byteOffset, arguments[1]);
      return (bytes[1] << 8 | bytes[0]) << 16 >> 16;
    },
    getUint16: function getUint16(byteOffset /* , littleEndian */) {
      var bytes = get(this, 2, byteOffset, arguments[1]);
      return bytes[1] << 8 | bytes[0];
    },
    getInt32: function getInt32(byteOffset /* , littleEndian */) {
      return unpackI32(get(this, 4, byteOffset, arguments[1]));
    },
    getUint32: function getUint32(byteOffset /* , littleEndian */) {
      return unpackI32(get(this, 4, byteOffset, arguments[1])) >>> 0;
    },
    getFloat32: function getFloat32(byteOffset /* , littleEndian */) {
      return unpackIEEE754(get(this, 4, byteOffset, arguments[1]), 23, 4);
    },
    getFloat64: function getFloat64(byteOffset /* , littleEndian */) {
      return unpackIEEE754(get(this, 8, byteOffset, arguments[1]), 52, 8);
    },
    setInt8: function setInt8(byteOffset, value) {
      set(this, 1, byteOffset, packI8, value);
    },
    setUint8: function setUint8(byteOffset, value) {
      set(this, 1, byteOffset, packI8, value);
    },
    setInt16: function setInt16(byteOffset, value /* , littleEndian */) {
      set(this, 2, byteOffset, packI16, value, arguments[2]);
    },
    setUint16: function setUint16(byteOffset, value /* , littleEndian */) {
      set(this, 2, byteOffset, packI16, value, arguments[2]);
    },
    setInt32: function setInt32(byteOffset, value /* , littleEndian */) {
      set(this, 4, byteOffset, packI32, value, arguments[2]);
    },
    setUint32: function setUint32(byteOffset, value /* , littleEndian */) {
      set(this, 4, byteOffset, packI32, value, arguments[2]);
    },
    setFloat32: function setFloat32(byteOffset, value /* , littleEndian */) {
      set(this, 4, byteOffset, packF32, value, arguments[2]);
    },
    setFloat64: function setFloat64(byteOffset, value /* , littleEndian */) {
      set(this, 8, byteOffset, packF64, value, arguments[2]);
    }
  });
} else {
  if (!fails(function () {
    $ArrayBuffer(1);
  }) || !fails(function () {
    new $ArrayBuffer(-1); // eslint-disable-line no-new
  }) || fails(function () {
    new $ArrayBuffer(); // eslint-disable-line no-new
    new $ArrayBuffer(1.5); // eslint-disable-line no-new
    new $ArrayBuffer(NaN); // eslint-disable-line no-new
    return $ArrayBuffer.name != ARRAY_BUFFER;
  })) {
    $ArrayBuffer = function ArrayBuffer(length) {
      anInstance(this, $ArrayBuffer);
      return new BaseBuffer(toIndex(length));
    };
    var ArrayBufferProto = $ArrayBuffer[PROTOTYPE] = BaseBuffer[PROTOTYPE];
    for (var keys = gOPN(BaseBuffer), j = 0, key; keys.length > j;) {
      if (!((key = keys[j++]) in $ArrayBuffer)) hide($ArrayBuffer, key, BaseBuffer[key]);
    }
    if (!LIBRARY) ArrayBufferProto.constructor = $ArrayBuffer;
  }
  // iOS Safari 7.x bug
  var view = new $DataView(new $ArrayBuffer(2));
  var $setInt8 = $DataView[PROTOTYPE].setInt8;
  view.setInt8(0, 2147483648);
  view.setInt8(1, 2147483649);
  if (view.getInt8(0) || !view.getInt8(1)) redefineAll($DataView[PROTOTYPE], {
    setInt8: function setInt8(byteOffset, value) {
      $setInt8.call(this, byteOffset, value << 24 >> 24);
    },
    setUint8: function setUint8(byteOffset, value) {
      $setInt8.call(this, byteOffset, value << 24 >> 24);
    }
  }, true);
}
setToStringTag($ArrayBuffer, ARRAY_BUFFER);
setToStringTag($DataView, DATA_VIEW);
hide($DataView[PROTOTYPE], $typed.VIEW, true);
exports[ARRAY_BUFFER] = $ArrayBuffer;
exports[DATA_VIEW] = $DataView;


/***/ }),
/* 139 */
/***/ (function(module, exports, __webpack_require__) {

;(function (root, factory) {
	if (true) {
		// CommonJS
		module.exports = exports = factory(__webpack_require__(4));
	}
	else if (typeof define === "function" && define.amd) {
		// AMD
		define(["./core"], factory);
	}
	else {
		// Global (browser)
		factory(root.CryptoJS);
	}
}(this, function (CryptoJS) {

	(function () {
	    // Shortcuts
	    var C = CryptoJS;
	    var C_lib = C.lib;
	    var WordArray = C_lib.WordArray;
	    var Hasher = C_lib.Hasher;
	    var C_algo = C.algo;

	    // Reusable object
	    var W = [];

	    /**
	     * SHA-1 hash algorithm.
	     */
	    var SHA1 = C_algo.SHA1 = Hasher.extend({
	        _doReset: function () {
	            this._hash = new WordArray.init([
	                0x67452301, 0xefcdab89,
	                0x98badcfe, 0x10325476,
	                0xc3d2e1f0
	            ]);
	        },

	        _doProcessBlock: function (M, offset) {
	            // Shortcut
	            var H = this._hash.words;

	            // Working variables
	            var a = H[0];
	            var b = H[1];
	            var c = H[2];
	            var d = H[3];
	            var e = H[4];

	            // Computation
	            for (var i = 0; i < 80; i++) {
	                if (i < 16) {
	                    W[i] = M[offset + i] | 0;
	                } else {
	                    var n = W[i - 3] ^ W[i - 8] ^ W[i - 14] ^ W[i - 16];
	                    W[i] = (n << 1) | (n >>> 31);
	                }

	                var t = ((a << 5) | (a >>> 27)) + e + W[i];
	                if (i < 20) {
	                    t += ((b & c) | (~b & d)) + 0x5a827999;
	                } else if (i < 40) {
	                    t += (b ^ c ^ d) + 0x6ed9eba1;
	                } else if (i < 60) {
	                    t += ((b & c) | (b & d) | (c & d)) - 0x70e44324;
	                } else /* if (i < 80) */ {
	                    t += (b ^ c ^ d) - 0x359d3e2a;
	                }

	                e = d;
	                d = c;
	                c = (b << 30) | (b >>> 2);
	                b = a;
	                a = t;
	            }

	            // Intermediate hash value
	            H[0] = (H[0] + a) | 0;
	            H[1] = (H[1] + b) | 0;
	            H[2] = (H[2] + c) | 0;
	            H[3] = (H[3] + d) | 0;
	            H[4] = (H[4] + e) | 0;
	        },

	        _doFinalize: function () {
	            // Shortcuts
	            var data = this._data;
	            var dataWords = data.words;

	            var nBitsTotal = this._nDataBytes * 8;
	            var nBitsLeft = data.sigBytes * 8;

	            // Add padding
	            dataWords[nBitsLeft >>> 5] |= 0x80 << (24 - nBitsLeft % 32);
	            dataWords[(((nBitsLeft + 64) >>> 9) << 4) + 14] = Math.floor(nBitsTotal / 0x100000000);
	            dataWords[(((nBitsLeft + 64) >>> 9) << 4) + 15] = nBitsTotal;
	            data.sigBytes = dataWords.length * 4;

	            // Hash final blocks
	            this._process();

	            // Return final computed hash
	            return this._hash;
	        },

	        clone: function () {
	            var clone = Hasher.clone.call(this);
	            clone._hash = this._hash.clone();

	            return clone;
	        }
	    });

	    /**
	     * Shortcut function to the hasher's object interface.
	     *
	     * @param {WordArray|string} message The message to hash.
	     *
	     * @return {WordArray} The hash.
	     *
	     * @static
	     *
	     * @example
	     *
	     *     var hash = CryptoJS.SHA1('message');
	     *     var hash = CryptoJS.SHA1(wordArray);
	     */
	    C.SHA1 = Hasher._createHelper(SHA1);

	    /**
	     * Shortcut function to the HMAC's object interface.
	     *
	     * @param {WordArray|string} message The message to hash.
	     * @param {WordArray|string} key The secret key.
	     *
	     * @return {WordArray} The HMAC.
	     *
	     * @static
	     *
	     * @example
	     *
	     *     var hmac = CryptoJS.HmacSHA1(message, key);
	     */
	    C.HmacSHA1 = Hasher._createHmacHelper(SHA1);
	}());


	return CryptoJS.SHA1;

}));

/***/ }),
/* 140 */
/***/ (function(module, exports, __webpack_require__) {

;(function (root, factory) {
	if (true) {
		// CommonJS
		module.exports = exports = factory(__webpack_require__(4));
	}
	else if (typeof define === "function" && define.amd) {
		// AMD
		define(["./core"], factory);
	}
	else {
		// Global (browser)
		factory(root.CryptoJS);
	}
}(this, function (CryptoJS) {

	(function () {
	    // Shortcuts
	    var C = CryptoJS;
	    var C_lib = C.lib;
	    var Base = C_lib.Base;
	    var C_enc = C.enc;
	    var Utf8 = C_enc.Utf8;
	    var C_algo = C.algo;

	    /**
	     * HMAC algorithm.
	     */
	    var HMAC = C_algo.HMAC = Base.extend({
	        /**
	         * Initializes a newly created HMAC.
	         *
	         * @param {Hasher} hasher The hash algorithm to use.
	         * @param {WordArray|string} key The secret key.
	         *
	         * @example
	         *
	         *     var hmacHasher = CryptoJS.algo.HMAC.create(CryptoJS.algo.SHA256, key);
	         */
	        init: function (hasher, key) {
	            // Init hasher
	            hasher = this._hasher = new hasher.init();

	            // Convert string to WordArray, else assume WordArray already
	            if (typeof key == 'string') {
	                key = Utf8.parse(key);
	            }

	            // Shortcuts
	            var hasherBlockSize = hasher.blockSize;
	            var hasherBlockSizeBytes = hasherBlockSize * 4;

	            // Allow arbitrary length keys
	            if (key.sigBytes > hasherBlockSizeBytes) {
	                key = hasher.finalize(key);
	            }

	            // Clamp excess bits
	            key.clamp();

	            // Clone key for inner and outer pads
	            var oKey = this._oKey = key.clone();
	            var iKey = this._iKey = key.clone();

	            // Shortcuts
	            var oKeyWords = oKey.words;
	            var iKeyWords = iKey.words;

	            // XOR keys with pad constants
	            for (var i = 0; i < hasherBlockSize; i++) {
	                oKeyWords[i] ^= 0x5c5c5c5c;
	                iKeyWords[i] ^= 0x36363636;
	            }
	            oKey.sigBytes = iKey.sigBytes = hasherBlockSizeBytes;

	            // Set initial values
	            this.reset();
	        },

	        /**
	         * Resets this HMAC to its initial state.
	         *
	         * @example
	         *
	         *     hmacHasher.reset();
	         */
	        reset: function () {
	            // Shortcut
	            var hasher = this._hasher;

	            // Reset
	            hasher.reset();
	            hasher.update(this._iKey);
	        },

	        /**
	         * Updates this HMAC with a message.
	         *
	         * @param {WordArray|string} messageUpdate The message to append.
	         *
	         * @return {HMAC} This HMAC instance.
	         *
	         * @example
	         *
	         *     hmacHasher.update('message');
	         *     hmacHasher.update(wordArray);
	         */
	        update: function (messageUpdate) {
	            this._hasher.update(messageUpdate);

	            // Chainable
	            return this;
	        },

	        /**
	         * Finalizes the HMAC computation.
	         * Note that the finalize operation is effectively a destructive, read-once operation.
	         *
	         * @param {WordArray|string} messageUpdate (Optional) A final message update.
	         *
	         * @return {WordArray} The HMAC.
	         *
	         * @example
	         *
	         *     var hmac = hmacHasher.finalize();
	         *     var hmac = hmacHasher.finalize('message');
	         *     var hmac = hmacHasher.finalize(wordArray);
	         */
	        finalize: function (messageUpdate) {
	            // Shortcut
	            var hasher = this._hasher;

	            // Compute HMAC
	            var innerHash = hasher.finalize(messageUpdate);
	            hasher.reset();
	            var hmac = hasher.finalize(this._oKey.clone().concat(innerHash));

	            return hmac;
	        }
	    });
	}());


}));

/***/ }),
/* 141 */
/***/ (function(module, exports) {

/* copyright Paul Handy, 2017 */

function sum( a, b ) {

    var s = a + b;

    switch( s ) {

        case 2: return -1;
        case -2: return 1;
        default: return s;

    }
}

function cons( a, b ) {

    if( a === b ) {

        return a;

    }

    return 0;
}

function any( a, b ) {

    var s = a + b;

    if ( s > 0 ) {

        return 1;

    } else if ( s < 0 ) {

        return -1;

    }

    return 0;
}

function full_add( a, b, c ) {

    var s_a     =   sum( a, b );
    var c_a     =   cons( a, b );
    var c_b     =   cons( s_a, c );
    var c_out   =   any( c_a, c_b );
    var s_out   =   sum( s_a, c );

    return [ s_out, c_out ];

}

function add( a, b ) {

    var out = new Array( Math.max( a.length, b.length ) );
    var carry = 0;
    var a_i, b_i;

    for( var i = 0; i < out.length; i++ ) {

        a_i = i < a.length ? a[ i ] : 0;
        b_i = i < b.length ? b[ i ] : 0;
        var f_a = full_add( a_i, b_i, carry );
        out[ i ] = f_a[ 0 ];
        carry = f_a[ 1 ];

    }

    return out;

}

module.exports = add;


/***/ }),
/* 142 */
/***/ (function(module, exports) {


module.exports = {

    invalidTrytes: function() {
        return new Error("Invalid Trytes provided");
    },
    invalidSeed: function() {
        return new Error("Invalid Seed provided");
    },
    invalidIndex: function() {
        return new Error("Invalid Index option provided");
    }, 
    invalidSecurity: function() {
        return new Error("Invalid Security option provided");
    },
    invalidChecksum: function(address) {
        return new Error("Invalid Checksum supplied for address: " + address)
    },
    invalidAttachedTrytes: function() {
        return new Error("Invalid attached Trytes provided");
    },
    invalidTransfers: function() {
        return new Error("Invalid transfers object");
    },
    invalidKey: function() {
        return new Error("You have provided an invalid key value");
    },
    invalidTrunkOrBranch: function(hash) {
        return new Error("You have provided an invalid hash as a trunk/branch: " + hash);
    },
    invalidUri: function(uri) {
        return new Error("You have provided an invalid URI for your Neighbor: " + uri)
    },
    notInt: function() {
        return new Error("One of your inputs is not an integer");
    },
    invalidInputs: function() {
        return new Error("Invalid inputs provided");
    }
}


/***/ }),
/* 143 */
/***/ (function(module, exports, __webpack_require__) {

var inputValidator  =   __webpack_require__(99);
var Curl            =   __webpack_require__(40);
var Kerl            =   __webpack_require__(63);
var Converter       =   __webpack_require__(36);
var Signing         =   __webpack_require__(98);
var CryptoJS        =   __webpack_require__(214);
var ascii           =   __webpack_require__(217);
var extractJson     =   __webpack_require__(536);


/**
*   Table of IOTA Units based off of the standard System of Units
**/
var unitMap = {
    'i'   :   1,
    'Ki'  :   1000,
    'Mi'  :   1000000,
    'Gi'  :   1000000000,
    'Ti'  :   1000000000000,
    'Pi'  :   1000000000000000  // For the very, very rich
}

/**
*   converts IOTA units
*
*   @method convertUnits
*   @param {string || int || float} value
*   @param {string} fromUnit
*   @param {string} toUnit
*   @returns {integer} converted
**/
var convertUnits = function(value, fromUnit, toUnit) {

    // Check if wrong unit provided
    if (unitMap[fromUnit] === undefined || unitMap[toUnit] === undefined) {

        throw new Error("Invalid unit provided");
    }

    var afterComma = String(value).match(/\.([\d]+)$/);

    if (afterComma && afterComma[1].length > String(unitMap[fromUnit]).length - 1) {

        throw new Error("Too many digits after comma");
    }

    // If not valid value, throw error
    if (!inputValidator.isNum(value)) {

        throw new Error("Invalid value");
    }


    var floatValue = parseFloat(value);

    var converted = (floatValue * unitMap[fromUnit]) / unitMap[toUnit];

    return converted;
}

/**
*   Generates the 9-tryte checksum of an address
*
*   @method addChecksum
*   @param {string | list} inputValue
*   @param {int} checksumLength
@   @param {bool} isAddress default is true
*   @returns {string | list} address (with checksum)
**/
var addChecksum = function(inputValue, checksumLength, isAddress) {

    // checksum length is either user defined, or 9 trytes
    var checksumLength = checksumLength || 9;
    var isAddress = (isAddress !== false);

    // the length of the trytes to be validated
    var validationLength = isAddress ? 81 : null;

    var isSingleInput = inputValidator.isString( inputValue );

    // If only single address, turn it into an array
    if ( isSingleInput ) inputValue = new Array( inputValue );

    var inputsWithChecksum = [];

    inputValue.forEach(function(thisValue) {

        // check if correct trytes
        if (!inputValidator.isTrytes(thisValue, validationLength)) {
            throw new Error("Invalid input");
        }

        var kerl = new Kerl();
        kerl.initialize();

        // Address trits
        var addressTrits = Converter.trits(thisValue);

        // Checksum trits
        var checksumTrits = [];

        // Absorb address trits
        kerl.absorb(addressTrits, 0, addressTrits.length);

        // Squeeze checksum trits
        kerl.squeeze(checksumTrits, 0, Curl.HASH_LENGTH);

        // First 9 trytes as checksum
        var checksum = Converter.trytes( checksumTrits ).substring( 81 - checksumLength, 81 );
        inputsWithChecksum.push( thisValue + checksum );
    });

    if (isSingleInput) {

        return inputsWithChecksum[ 0 ];

    } else {

        return inputsWithChecksum;

    }
}

/**
*   Removes the 9-tryte checksum of an address
*
*   @method noChecksum
*   @param {string | list} address
*   @returns {string | list} address (without checksum)
**/
var noChecksum = function(address) {

    var isSingleAddress = inputValidator.isString(address)

    // If only single address, turn it into an array
    if (isSingleAddress) address = new Array(address);

    var addressesWithChecksum = [];

    address.forEach(function(thisAddress) {
        addressesWithChecksum.push(thisAddress.slice(0, 81))
    })

    // return either string or the list
    if (isSingleAddress) {

        return addressesWithChecksum[0];

    } else {

        return addressesWithChecksum;

    }
}

/**
*   Validates the checksum of an address
*
*   @method isValidChecksum
*   @param {string} addressWithChecksum
*   @returns {bool}
**/
var isValidChecksum = function(addressWithChecksum) {

    var addressWithoutChecksum = noChecksum(addressWithChecksum);

    var newChecksum = addChecksum(addressWithoutChecksum);

    return newChecksum === addressWithChecksum;
}

/**
*   Converts transaction trytes of 2673 trytes into a transaction object
*
*   @method transactionObject
*   @param {string} trytes
*   @returns {String} transactionObject
**/
var transactionObject = function(trytes) {

    if (!trytes) return;

    // validity check
    for (var i = 2279; i < 2295; i++) {

        if (trytes.charAt(i) !== "9") {

            return null;

        }
    }

    var thisTransaction = {};
    var transactionTrits = Converter.trits(trytes);
    var hash = [];

    var curl = new Curl();

    // generate the correct transaction hash
    curl.initialize();
    curl.absorb(transactionTrits, 0, transactionTrits.length);
    curl.squeeze(hash, 0, 243);

    thisTransaction.hash = Converter.trytes(hash);
    thisTransaction.signatureMessageFragment = trytes.slice(0, 2187);
    thisTransaction.address = trytes.slice(2187, 2268);
    thisTransaction.value = Converter.value(transactionTrits.slice(6804, 6837));
    thisTransaction.obsoleteTag = trytes.slice(2295, 2322);
    thisTransaction.timestamp = Converter.value(transactionTrits.slice(6966, 6993));
    thisTransaction.currentIndex = Converter.value(transactionTrits.slice(6993, 7020));
    thisTransaction.lastIndex = Converter.value(transactionTrits.slice(7020, 7047));
    thisTransaction.bundle = trytes.slice(2349, 2430);
    thisTransaction.trunkTransaction = trytes.slice(2430, 2511);
    thisTransaction.branchTransaction = trytes.slice(2511, 2592);

    thisTransaction.tag = trytes.slice(2592, 2619);
    thisTransaction.attachmentTimestamp = Converter.value(transactionTrits.slice(7857, 7884));
    thisTransaction.attachmentTimestampLowerBound = Converter.value(transactionTrits.slice(7884, 7911));
    thisTransaction.attachmentTimestampUpperBound = Converter.value(transactionTrits.slice(7911, 7938));
    thisTransaction.nonce = trytes.slice(2646, 2673);

    return thisTransaction;
}

/**
*   Converts a transaction object into trytes
*
*   @method transactionTrytes
*   @param {object} transactionTrytes
*   @returns {String} trytes
**/
var transactionTrytes = function(transaction) {

    var valueTrits = Converter.trits(transaction.value);
    while (valueTrits.length < 81) {
        valueTrits[valueTrits.length] = 0;
    }

    var timestampTrits = Converter.trits(transaction.timestamp);
    while (timestampTrits.length < 27) {
        timestampTrits[timestampTrits.length] = 0;
    }

    var currentIndexTrits = Converter.trits(transaction.currentIndex);
    while (currentIndexTrits.length < 27) {
        currentIndexTrits[currentIndexTrits.length] = 0;
    }

    var lastIndexTrits = Converter.trits(transaction.lastIndex);
    while (lastIndexTrits.length < 27) {
        lastIndexTrits[lastIndexTrits.length] = 0;
    }

    var attachmentTimestampTrits = Converter.trits(transaction.attachmentTimestamp);
    while (attachmentTimestampTrits.length < 27) {
        attachmentTimestampTrits[attachmentTimestampTrits.length] = 0;
    }

    var attachmentTimestampLowerBoundTrits = Converter.trits(transaction.attachmentTimestampLowerBound);
    while (attachmentTimestampLowerBoundTrits.length < 27) {
        attachmentTimestampLowerBoundTrits[attachmentTimestampLowerBoundTrits.length] = 0;
    }

    var attachmentTimestampUpperBoundTrits = Converter.trits(transaction.attachmentTimestampUpperBound);
    while (attachmentTimestampUpperBoundTrits.length < 27) {
        attachmentTimestampUpperBoundTrits[attachmentTimestampUpperBoundTrits.length] = 0;
    }

    return transaction.signatureMessageFragment
    + transaction.address
    + Converter.trytes(valueTrits)
    + transaction.obsoleteTag
    + Converter.trytes(timestampTrits)
    + Converter.trytes(currentIndexTrits)
    + Converter.trytes(lastIndexTrits)
    + transaction.bundle
    + transaction.trunkTransaction
    + transaction.branchTransaction
    + transaction.tag
    + Converter.trytes(attachmentTimestampTrits)
    + Converter.trytes(attachmentTimestampLowerBoundTrits)
    + Converter.trytes(attachmentTimestampUpperBoundTrits)
    + transaction.nonce;
}

/**
*   Categorizes a list of transfers between sent and received
*
*   @method categorizeTransfers
*   @param {object} transfers Transfers (bundles)
*   @param {list} addresses List of addresses that belong to the user
*   @returns {String} trytes
**/
var categorizeTransfers = function(transfers, addresses) {

    var categorized = {
        'sent'      : [],
        'received'  : []
    }

    // Iterate over all bundles and sort them between incoming and outgoing transfers
    transfers.forEach(function(bundle) {

        var spentAlreadyAdded = false;

        // Iterate over every bundle entry
        bundle.forEach(function(bundleEntry, bundleIndex) {

            // If bundle address in the list of addresses associated with the seed
            // add the bundle to the
            if (addresses.indexOf(bundleEntry.address) > -1) {

                // Check if it's a remainder address
                var isRemainder = (bundleEntry.currentIndex === bundleEntry.lastIndex) && bundleEntry.lastIndex !== 0;

                // check if sent transaction
                if (bundleEntry.value < 0 && !spentAlreadyAdded && !isRemainder) {

                    categorized.sent.push(bundle);

                    // too make sure we do not add transactions twice
                    spentAlreadyAdded = true;
                }
                // check if received transaction, or 0 value (message)
                // also make sure that this is not a 2nd tx for spent inputs
                else if (bundleEntry.value >= 0 && !spentAlreadyAdded && !isRemainder) {

                    categorized.received.push(bundle);
                }
            }
        })
    })

    return categorized;
}


/**
*   Validates the signatures
*
*   @method validateSignatures
*   @param {array} signedBundle
*   @param {string} inputAddress
*   @returns {bool}
**/
var validateSignatures = function(signedBundle, inputAddress) {


    var bundleHash;
    var signatureFragments = [];

    for (var i = 0; i < signedBundle.length; i++) {

        if (signedBundle[i].address === inputAddress) {

            bundleHash = signedBundle[i].bundle;

            // if we reached remainder bundle
            if (inputValidator.isNinesTrytes(signedBundle[i].signatureMessageFragment)) {
                break;
            }

            signatureFragments.push(signedBundle[i].signatureMessageFragment)
        }
    }

    if (!bundleHash) {
        return false;
    }

    return Signing.validateSignatures(inputAddress, signatureFragments, bundleHash);
}


/**
*   Checks is a Bundle is valid. Validates signatures and overall structure. Has to be tail tx first.
*
*   @method isValidBundle
*   @param {array} bundle
*   @returns {bool} valid
**/
var isBundle = function(bundle) {

    // If not correct bundle
    if (!inputValidator.isArrayOfTxObjects(bundle)) return false;

    var totalSum = 0, lastIndex, bundleHash = bundle[0].bundle;

    // Prepare to absorb txs and get bundleHash
    var bundleFromTxs = [];

    var kerl = new Kerl();
    kerl.initialize();

    // Prepare for signature validation
    var signaturesToValidate = [];

    bundle.forEach(function(bundleTx, index) {

        totalSum += bundleTx.value;

        // currentIndex has to be equal to the index in the array
        if (bundleTx.currentIndex !== index) return false;

        // Get the transaction trytes
        var thisTxTrytes = transactionTrytes(bundleTx);

        // Absorb bundle hash + value + timestamp + lastIndex + currentIndex trytes.
        var thisTxTrits = Converter.trits(thisTxTrytes.slice(2187, 2187 + 162));
        kerl.absorb(thisTxTrits, 0, thisTxTrits.length);

        // Check if input transaction
        if (bundleTx.value < 0) {
            var thisAddress = bundleTx.address;

            var newSignatureToValidate = {
                'address': thisAddress,
                'signatureFragments': Array(bundleTx.signatureMessageFragment)
            }

            // Find the subsequent txs with the remaining signature fragment
            for (var i = index; i < bundle.length - 1; i++) {
                var newBundleTx = bundle[i + 1];

                // Check if new tx is part of the signature fragment
                if (newBundleTx.address === thisAddress && newBundleTx.value === 0) {
                    newSignatureToValidate.signatureFragments.push(newBundleTx.signatureMessageFragment);
                }
            }

            signaturesToValidate.push(newSignatureToValidate);
        }
    });

    // Check for total sum, if not equal 0 return error
    if (totalSum !== 0) return false;

    // get the bundle hash from the bundle transactions
    kerl.squeeze(bundleFromTxs, 0, Curl.HASH_LENGTH);
    var bundleFromTxs = Converter.trytes(bundleFromTxs);

    // Check if bundle hash is the same as returned by tx object
    if (bundleFromTxs !== bundleHash) return false;

    // Last tx in the bundle should have currentIndex === lastIndex
    if (bundle[bundle.length - 1].currentIndex !== bundle[bundle.length - 1].lastIndex) return false;

    // Validate the signatures
    for (var i = 0; i < signaturesToValidate.length; i++) {

        var isValidSignature = Signing.validateSignatures(signaturesToValidate[i].address, signaturesToValidate[i].signatureFragments, bundleHash);

        if (!isValidSignature) return false;
    }

    return true;
}

module.exports = {
    convertUnits        : convertUnits,
    addChecksum         : addChecksum,
    noChecksum          : noChecksum,
    isValidChecksum     : isValidChecksum,
    transactionObject   : transactionObject,
    transactionTrytes   : transactionTrytes,
    categorizeTransfers : categorizeTransfers,
    toTrytes            : ascii.toTrytes,
    fromTrytes          : ascii.fromTrytes,
    extractJson         : extractJson,
    validateSignatures  : validateSignatures,
    isBundle            : isBundle,
    inputValidator      : inputValidator
}


/***/ }),
/* 144 */
/***/ (function(module, exports) {

var toString = {}.toString;

module.exports = Array.isArray || function (arr) {
  return toString.call(arr) == '[object Array]';
};


/***/ }),
/* 145 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


exports.randomBytes = exports.rng = exports.pseudoRandomBytes = exports.prng = __webpack_require__(66)
exports.createHash = exports.Hash = __webpack_require__(67)
exports.createHmac = exports.Hmac = __webpack_require__(153)

var algos = __webpack_require__(238)
var algoKeys = Object.keys(algos)
var hashes = ['sha1', 'sha224', 'sha256', 'sha384', 'sha512', 'md5', 'rmd160'].concat(algoKeys)
exports.getHashes = function () {
  return hashes
}

var p = __webpack_require__(155)
exports.pbkdf2 = p.pbkdf2
exports.pbkdf2Sync = p.pbkdf2Sync

var aes = __webpack_require__(240)

exports.Cipher = aes.Cipher
exports.createCipher = aes.createCipher
exports.Cipheriv = aes.Cipheriv
exports.createCipheriv = aes.createCipheriv
exports.Decipher = aes.Decipher
exports.createDecipher = aes.createDecipher
exports.Decipheriv = aes.Decipheriv
exports.createDecipheriv = aes.createDecipheriv
exports.getCiphers = aes.getCiphers
exports.listCiphers = aes.listCiphers

var dh = __webpack_require__(258)

exports.DiffieHellmanGroup = dh.DiffieHellmanGroup
exports.createDiffieHellmanGroup = dh.createDiffieHellmanGroup
exports.getDiffieHellman = dh.getDiffieHellman
exports.createDiffieHellman = dh.createDiffieHellman
exports.DiffieHellman = dh.DiffieHellman

var sign = __webpack_require__(264)

exports.createSign = sign.createSign
exports.Sign = sign.Sign
exports.createVerify = sign.createVerify
exports.Verify = sign.Verify

exports.createECDH = __webpack_require__(302)

var publicEncrypt = __webpack_require__(303)

exports.publicEncrypt = publicEncrypt.publicEncrypt
exports.privateEncrypt = publicEncrypt.privateEncrypt
exports.publicDecrypt = publicEncrypt.publicDecrypt
exports.privateDecrypt = publicEncrypt.privateDecrypt

// the least I can do is make error messages for the rest of the node.js/crypto api.
// ;[
//   'createCredentials'
// ].forEach(function (name) {
//   exports[name] = function () {
//     throw new Error([
//       'sorry, ' + name + ' is not implemented yet',
//       'we accept pull requests',
//       'https://github.com/crypto-browserify/crypto-browserify'
//     ].join('\n'))
//   }
// })

exports.createCredentials = function () {
  throw new Error([
    'sorry, createCredentials is not implemented yet',
    'we accept pull requests',
    'https://github.com/crypto-browserify/crypto-browserify'
  ].join('\n'))
}

exports.constants = {
  'DH_CHECK_P_NOT_SAFE_PRIME': 2,
  'DH_CHECK_P_NOT_PRIME': 1,
  'DH_UNABLE_TO_CHECK_GENERATOR': 4,
  'DH_NOT_SUITABLE_GENERATOR': 8,
  'NPN_ENABLED': 1,
  'ALPN_ENABLED': 1,
  'RSA_PKCS1_PADDING': 1,
  'RSA_SSLV23_PADDING': 2,
  'RSA_NO_PADDING': 3,
  'RSA_PKCS1_OAEP_PADDING': 4,
  'RSA_X931_PADDING': 5,
  'RSA_PKCS1_PSS_PADDING': 6,
  'POINT_CONVERSION_COMPRESSED': 2,
  'POINT_CONVERSION_UNCOMPRESSED': 4,
  'POINT_CONVERSION_HYBRID': 6
}


/***/ }),
/* 146 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";
/* WEBPACK VAR INJECTION */(function(Buffer) {
var Transform = __webpack_require__(102).Transform
var inherits = __webpack_require__(1)

function HashBase (blockSize) {
  Transform.call(this)

  this._block = new Buffer(blockSize)
  this._blockSize = blockSize
  this._blockOffset = 0
  this._length = [0, 0, 0, 0]

  this._finalized = false
}

inherits(HashBase, Transform)

HashBase.prototype._transform = function (chunk, encoding, callback) {
  var error = null
  try {
    if (encoding !== 'buffer') chunk = new Buffer(chunk, encoding)
    this.update(chunk)
  } catch (err) {
    error = err
  }

  callback(error)
}

HashBase.prototype._flush = function (callback) {
  var error = null
  try {
    this.push(this._digest())
  } catch (err) {
    error = err
  }

  callback(error)
}

HashBase.prototype.update = function (data, encoding) {
  if (!Buffer.isBuffer(data) && typeof data !== 'string') throw new TypeError('Data must be a string or a buffer')
  if (this._finalized) throw new Error('Digest already called')
  if (!Buffer.isBuffer(data)) data = new Buffer(data, encoding || 'binary')

  // consume data
  var block = this._block
  var offset = 0
  while (this._blockOffset + data.length - offset >= this._blockSize) {
    for (var i = this._blockOffset; i < this._blockSize;) block[i++] = data[offset++]
    this._update()
    this._blockOffset = 0
  }
  while (offset < data.length) block[this._blockOffset++] = data[offset++]

  // update length
  for (var j = 0, carry = data.length * 8; carry > 0; ++j) {
    this._length[j] += carry
    carry = (this._length[j] / 0x0100000000) | 0
    if (carry > 0) this._length[j] -= 0x0100000000 * carry
  }

  return this
}

HashBase.prototype._update = function (data) {
  throw new Error('_update is not implemented')
}

HashBase.prototype.digest = function (encoding) {
  if (this._finalized) throw new Error('Digest already called')
  this._finalized = true

  var digest = this._digest()
  if (encoding !== undefined) digest = digest.toString(encoding)
  return digest
}

HashBase.prototype._digest = function () {
  throw new Error('_digest is not implemented')
}

module.exports = HashBase

/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(6).Buffer))

/***/ }),
/* 147 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";
/* WEBPACK VAR INJECTION */(function(global, process) {// Copyright Joyent, Inc. and other Node contributors.
//
// Permission is hereby granted, free of charge, to any person obtaining a
// copy of this software and associated documentation files (the
// "Software"), to deal in the Software without restriction, including
// without limitation the rights to use, copy, modify, merge, publish,
// distribute, sublicense, and/or sell copies of the Software, and to permit
// persons to whom the Software is furnished to do so, subject to the
// following conditions:
//
// The above copyright notice and this permission notice shall be included
// in all copies or substantial portions of the Software.
//
// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
// USE OR OTHER DEALINGS IN THE SOFTWARE.



/*<replacement>*/

var processNextTick = __webpack_require__(77);
/*</replacement>*/

module.exports = Readable;

/*<replacement>*/
var isArray = __webpack_require__(144);
/*</replacement>*/

/*<replacement>*/
var Duplex;
/*</replacement>*/

Readable.ReadableState = ReadableState;

/*<replacement>*/
var EE = __webpack_require__(103).EventEmitter;

var EElistenerCount = function (emitter, type) {
  return emitter.listeners(type).length;
};
/*</replacement>*/

/*<replacement>*/
var Stream = __webpack_require__(148);
/*</replacement>*/

// TODO(bmeurer): Change this back to const once hole checks are
// properly optimized away early in Ignition+TurboFan.
/*<replacement>*/
var Buffer = __webpack_require__(8).Buffer;
var OurUint8Array = global.Uint8Array || function () {};
function _uint8ArrayToBuffer(chunk) {
  return Buffer.from(chunk);
}
function _isUint8Array(obj) {
  return Buffer.isBuffer(obj) || obj instanceof OurUint8Array;
}
/*</replacement>*/

/*<replacement>*/
var util = __webpack_require__(68);
util.inherits = __webpack_require__(1);
/*</replacement>*/

/*<replacement>*/
var debugUtil = __webpack_require__(223);
var debug = void 0;
if (debugUtil && debugUtil.debuglog) {
  debug = debugUtil.debuglog('stream');
} else {
  debug = function () {};
}
/*</replacement>*/

var BufferList = __webpack_require__(224);
var destroyImpl = __webpack_require__(149);
var StringDecoder;

util.inherits(Readable, Stream);

var kProxyEvents = ['error', 'close', 'destroy', 'pause', 'resume'];

function prependListener(emitter, event, fn) {
  // Sadly this is not cacheable as some libraries bundle their own
  // event emitter implementation with them.
  if (typeof emitter.prependListener === 'function') {
    return emitter.prependListener(event, fn);
  } else {
    // This is a hack to make sure that our error handler is attached before any
    // userland ones.  NEVER DO THIS. This is here only because this code needs
    // to continue to work with older versions of Node.js that do not include
    // the prependListener() method. The goal is to eventually remove this hack.
    if (!emitter._events || !emitter._events[event]) emitter.on(event, fn);else if (isArray(emitter._events[event])) emitter._events[event].unshift(fn);else emitter._events[event] = [fn, emitter._events[event]];
  }
}

function ReadableState(options, stream) {
  Duplex = Duplex || __webpack_require__(45);

  options = options || {};

  // object stream flag. Used to make read(n) ignore n and to
  // make all the buffer merging and length checks go away
  this.objectMode = !!options.objectMode;

  if (stream instanceof Duplex) this.objectMode = this.objectMode || !!options.readableObjectMode;

  // the point at which it stops calling _read() to fill the buffer
  // Note: 0 is a valid value, means "don't call _read preemptively ever"
  var hwm = options.highWaterMark;
  var defaultHwm = this.objectMode ? 16 : 16 * 1024;
  this.highWaterMark = hwm || hwm === 0 ? hwm : defaultHwm;

  // cast to ints.
  this.highWaterMark = Math.floor(this.highWaterMark);

  // A linked list is used to store data chunks instead of an array because the
  // linked list can remove elements from the beginning faster than
  // array.shift()
  this.buffer = new BufferList();
  this.length = 0;
  this.pipes = null;
  this.pipesCount = 0;
  this.flowing = null;
  this.ended = false;
  this.endEmitted = false;
  this.reading = false;

  // a flag to be able to tell if the event 'readable'/'data' is emitted
  // immediately, or on a later tick.  We set this to true at first, because
  // any actions that shouldn't happen until "later" should generally also
  // not happen before the first read call.
  this.sync = true;

  // whenever we return null, then we set a flag to say
  // that we're awaiting a 'readable' event emission.
  this.needReadable = false;
  this.emittedReadable = false;
  this.readableListening = false;
  this.resumeScheduled = false;

  // has it been destroyed
  this.destroyed = false;

  // Crypto is kind of old and crusty.  Historically, its default string
  // encoding is 'binary' so we have to make this configurable.
  // Everything else in the universe uses 'utf8', though.
  this.defaultEncoding = options.defaultEncoding || 'utf8';

  // the number of writers that are awaiting a drain event in .pipe()s
  this.awaitDrain = 0;

  // if true, a maybeReadMore has been scheduled
  this.readingMore = false;

  this.decoder = null;
  this.encoding = null;
  if (options.encoding) {
    if (!StringDecoder) StringDecoder = __webpack_require__(106).StringDecoder;
    this.decoder = new StringDecoder(options.encoding);
    this.encoding = options.encoding;
  }
}

function Readable(options) {
  Duplex = Duplex || __webpack_require__(45);

  if (!(this instanceof Readable)) return new Readable(options);

  this._readableState = new ReadableState(options, this);

  // legacy
  this.readable = true;

  if (options) {
    if (typeof options.read === 'function') this._read = options.read;

    if (typeof options.destroy === 'function') this._destroy = options.destroy;
  }

  Stream.call(this);
}

Object.defineProperty(Readable.prototype, 'destroyed', {
  get: function () {
    if (this._readableState === undefined) {
      return false;
    }
    return this._readableState.destroyed;
  },
  set: function (value) {
    // we ignore the value if the stream
    // has not been initialized yet
    if (!this._readableState) {
      return;
    }

    // backward compatibility, the user is explicitly
    // managing destroyed
    this._readableState.destroyed = value;
  }
});

Readable.prototype.destroy = destroyImpl.destroy;
Readable.prototype._undestroy = destroyImpl.undestroy;
Readable.prototype._destroy = function (err, cb) {
  this.push(null);
  cb(err);
};

// Manually shove something into the read() buffer.
// This returns true if the highWaterMark has not been hit yet,
// similar to how Writable.write() returns true if you should
// write() some more.
Readable.prototype.push = function (chunk, encoding) {
  var state = this._readableState;
  var skipChunkCheck;

  if (!state.objectMode) {
    if (typeof chunk === 'string') {
      encoding = encoding || state.defaultEncoding;
      if (encoding !== state.encoding) {
        chunk = Buffer.from(chunk, encoding);
        encoding = '';
      }
      skipChunkCheck = true;
    }
  } else {
    skipChunkCheck = true;
  }

  return readableAddChunk(this, chunk, encoding, false, skipChunkCheck);
};

// Unshift should *always* be something directly out of read()
Readable.prototype.unshift = function (chunk) {
  return readableAddChunk(this, chunk, null, true, false);
};

function readableAddChunk(stream, chunk, encoding, addToFront, skipChunkCheck) {
  var state = stream._readableState;
  if (chunk === null) {
    state.reading = false;
    onEofChunk(stream, state);
  } else {
    var er;
    if (!skipChunkCheck) er = chunkInvalid(state, chunk);
    if (er) {
      stream.emit('error', er);
    } else if (state.objectMode || chunk && chunk.length > 0) {
      if (typeof chunk !== 'string' && !state.objectMode && Object.getPrototypeOf(chunk) !== Buffer.prototype) {
        chunk = _uint8ArrayToBuffer(chunk);
      }

      if (addToFront) {
        if (state.endEmitted) stream.emit('error', new Error('stream.unshift() after end event'));else addChunk(stream, state, chunk, true);
      } else if (state.ended) {
        stream.emit('error', new Error('stream.push() after EOF'));
      } else {
        state.reading = false;
        if (state.decoder && !encoding) {
          chunk = state.decoder.write(chunk);
          if (state.objectMode || chunk.length !== 0) addChunk(stream, state, chunk, false);else maybeReadMore(stream, state);
        } else {
          addChunk(stream, state, chunk, false);
        }
      }
    } else if (!addToFront) {
      state.reading = false;
    }
  }

  return needMoreData(state);
}

function addChunk(stream, state, chunk, addToFront) {
  if (state.flowing && state.length === 0 && !state.sync) {
    stream.emit('data', chunk);
    stream.read(0);
  } else {
    // update the buffer info.
    state.length += state.objectMode ? 1 : chunk.length;
    if (addToFront) state.buffer.unshift(chunk);else state.buffer.push(chunk);

    if (state.needReadable) emitReadable(stream);
  }
  maybeReadMore(stream, state);
}

function chunkInvalid(state, chunk) {
  var er;
  if (!_isUint8Array(chunk) && typeof chunk !== 'string' && chunk !== undefined && !state.objectMode) {
    er = new TypeError('Invalid non-string/buffer chunk');
  }
  return er;
}

// if it's past the high water mark, we can push in some more.
// Also, if we have no data yet, we can stand some
// more bytes.  This is to work around cases where hwm=0,
// such as the repl.  Also, if the push() triggered a
// readable event, and the user called read(largeNumber) such that
// needReadable was set, then we ought to push more, so that another
// 'readable' event will be triggered.
function needMoreData(state) {
  return !state.ended && (state.needReadable || state.length < state.highWaterMark || state.length === 0);
}

Readable.prototype.isPaused = function () {
  return this._readableState.flowing === false;
};

// backwards compatibility.
Readable.prototype.setEncoding = function (enc) {
  if (!StringDecoder) StringDecoder = __webpack_require__(106).StringDecoder;
  this._readableState.decoder = new StringDecoder(enc);
  this._readableState.encoding = enc;
  return this;
};

// Don't raise the hwm > 8MB
var MAX_HWM = 0x800000;
function computeNewHighWaterMark(n) {
  if (n >= MAX_HWM) {
    n = MAX_HWM;
  } else {
    // Get the next highest power of 2 to prevent increasing hwm excessively in
    // tiny amounts
    n--;
    n |= n >>> 1;
    n |= n >>> 2;
    n |= n >>> 4;
    n |= n >>> 8;
    n |= n >>> 16;
    n++;
  }
  return n;
}

// This function is designed to be inlinable, so please take care when making
// changes to the function body.
function howMuchToRead(n, state) {
  if (n <= 0 || state.length === 0 && state.ended) return 0;
  if (state.objectMode) return 1;
  if (n !== n) {
    // Only flow one buffer at a time
    if (state.flowing && state.length) return state.buffer.head.data.length;else return state.length;
  }
  // If we're asking for more than the current hwm, then raise the hwm.
  if (n > state.highWaterMark) state.highWaterMark = computeNewHighWaterMark(n);
  if (n <= state.length) return n;
  // Don't have enough
  if (!state.ended) {
    state.needReadable = true;
    return 0;
  }
  return state.length;
}

// you can override either this method, or the async _read(n) below.
Readable.prototype.read = function (n) {
  debug('read', n);
  n = parseInt(n, 10);
  var state = this._readableState;
  var nOrig = n;

  if (n !== 0) state.emittedReadable = false;

  // if we're doing read(0) to trigger a readable event, but we
  // already have a bunch of data in the buffer, then just trigger
  // the 'readable' event and move on.
  if (n === 0 && state.needReadable && (state.length >= state.highWaterMark || state.ended)) {
    debug('read: emitReadable', state.length, state.ended);
    if (state.length === 0 && state.ended) endReadable(this);else emitReadable(this);
    return null;
  }

  n = howMuchToRead(n, state);

  // if we've ended, and we're now clear, then finish it up.
  if (n === 0 && state.ended) {
    if (state.length === 0) endReadable(this);
    return null;
  }

  // All the actual chunk generation logic needs to be
  // *below* the call to _read.  The reason is that in certain
  // synthetic stream cases, such as passthrough streams, _read
  // may be a completely synchronous operation which may change
  // the state of the read buffer, providing enough data when
  // before there was *not* enough.
  //
  // So, the steps are:
  // 1. Figure out what the state of things will be after we do
  // a read from the buffer.
  //
  // 2. If that resulting state will trigger a _read, then call _read.
  // Note that this may be asynchronous, or synchronous.  Yes, it is
  // deeply ugly to write APIs this way, but that still doesn't mean
  // that the Readable class should behave improperly, as streams are
  // designed to be sync/async agnostic.
  // Take note if the _read call is sync or async (ie, if the read call
  // has returned yet), so that we know whether or not it's safe to emit
  // 'readable' etc.
  //
  // 3. Actually pull the requested chunks out of the buffer and return.

  // if we need a readable event, then we need to do some reading.
  var doRead = state.needReadable;
  debug('need readable', doRead);

  // if we currently have less than the highWaterMark, then also read some
  if (state.length === 0 || state.length - n < state.highWaterMark) {
    doRead = true;
    debug('length less than watermark', doRead);
  }

  // however, if we've ended, then there's no point, and if we're already
  // reading, then it's unnecessary.
  if (state.ended || state.reading) {
    doRead = false;
    debug('reading or ended', doRead);
  } else if (doRead) {
    debug('do read');
    state.reading = true;
    state.sync = true;
    // if the length is currently zero, then we *need* a readable event.
    if (state.length === 0) state.needReadable = true;
    // call internal read method
    this._read(state.highWaterMark);
    state.sync = false;
    // If _read pushed data synchronously, then `reading` will be false,
    // and we need to re-evaluate how much data we can return to the user.
    if (!state.reading) n = howMuchToRead(nOrig, state);
  }

  var ret;
  if (n > 0) ret = fromList(n, state);else ret = null;

  if (ret === null) {
    state.needReadable = true;
    n = 0;
  } else {
    state.length -= n;
  }

  if (state.length === 0) {
    // If we have nothing in the buffer, then we want to know
    // as soon as we *do* get something into the buffer.
    if (!state.ended) state.needReadable = true;

    // If we tried to read() past the EOF, then emit end on the next tick.
    if (nOrig !== n && state.ended) endReadable(this);
  }

  if (ret !== null) this.emit('data', ret);

  return ret;
};

function onEofChunk(stream, state) {
  if (state.ended) return;
  if (state.decoder) {
    var chunk = state.decoder.end();
    if (chunk && chunk.length) {
      state.buffer.push(chunk);
      state.length += state.objectMode ? 1 : chunk.length;
    }
  }
  state.ended = true;

  // emit 'readable' now to make sure it gets picked up.
  emitReadable(stream);
}

// Don't emit readable right away in sync mode, because this can trigger
// another read() call => stack overflow.  This way, it might trigger
// a nextTick recursion warning, but that's not so bad.
function emitReadable(stream) {
  var state = stream._readableState;
  state.needReadable = false;
  if (!state.emittedReadable) {
    debug('emitReadable', state.flowing);
    state.emittedReadable = true;
    if (state.sync) processNextTick(emitReadable_, stream);else emitReadable_(stream);
  }
}

function emitReadable_(stream) {
  debug('emit readable');
  stream.emit('readable');
  flow(stream);
}

// at this point, the user has presumably seen the 'readable' event,
// and called read() to consume some data.  that may have triggered
// in turn another _read(n) call, in which case reading = true if
// it's in progress.
// However, if we're not ended, or reading, and the length < hwm,
// then go ahead and try to read some more preemptively.
function maybeReadMore(stream, state) {
  if (!state.readingMore) {
    state.readingMore = true;
    processNextTick(maybeReadMore_, stream, state);
  }
}

function maybeReadMore_(stream, state) {
  var len = state.length;
  while (!state.reading && !state.flowing && !state.ended && state.length < state.highWaterMark) {
    debug('maybeReadMore read 0');
    stream.read(0);
    if (len === state.length)
      // didn't get any data, stop spinning.
      break;else len = state.length;
  }
  state.readingMore = false;
}

// abstract method.  to be overridden in specific implementation classes.
// call cb(er, data) where data is <= n in length.
// for virtual (non-string, non-buffer) streams, "length" is somewhat
// arbitrary, and perhaps not very meaningful.
Readable.prototype._read = function (n) {
  this.emit('error', new Error('_read() is not implemented'));
};

Readable.prototype.pipe = function (dest, pipeOpts) {
  var src = this;
  var state = this._readableState;

  switch (state.pipesCount) {
    case 0:
      state.pipes = dest;
      break;
    case 1:
      state.pipes = [state.pipes, dest];
      break;
    default:
      state.pipes.push(dest);
      break;
  }
  state.pipesCount += 1;
  debug('pipe count=%d opts=%j', state.pipesCount, pipeOpts);

  var doEnd = (!pipeOpts || pipeOpts.end !== false) && dest !== process.stdout && dest !== process.stderr;

  var endFn = doEnd ? onend : unpipe;
  if (state.endEmitted) processNextTick(endFn);else src.once('end', endFn);

  dest.on('unpipe', onunpipe);
  function onunpipe(readable, unpipeInfo) {
    debug('onunpipe');
    if (readable === src) {
      if (unpipeInfo && unpipeInfo.hasUnpiped === false) {
        unpipeInfo.hasUnpiped = true;
        cleanup();
      }
    }
  }

  function onend() {
    debug('onend');
    dest.end();
  }

  // when the dest drains, it reduces the awaitDrain counter
  // on the source.  This would be more elegant with a .once()
  // handler in flow(), but adding and removing repeatedly is
  // too slow.
  var ondrain = pipeOnDrain(src);
  dest.on('drain', ondrain);

  var cleanedUp = false;
  function cleanup() {
    debug('cleanup');
    // cleanup event handlers once the pipe is broken
    dest.removeListener('close', onclose);
    dest.removeListener('finish', onfinish);
    dest.removeListener('drain', ondrain);
    dest.removeListener('error', onerror);
    dest.removeListener('unpipe', onunpipe);
    src.removeListener('end', onend);
    src.removeListener('end', unpipe);
    src.removeListener('data', ondata);

    cleanedUp = true;

    // if the reader is waiting for a drain event from this
    // specific writer, then it would cause it to never start
    // flowing again.
    // So, if this is awaiting a drain, then we just call it now.
    // If we don't know, then assume that we are waiting for one.
    if (state.awaitDrain && (!dest._writableState || dest._writableState.needDrain)) ondrain();
  }

  // If the user pushes more data while we're writing to dest then we'll end up
  // in ondata again. However, we only want to increase awaitDrain once because
  // dest will only emit one 'drain' event for the multiple writes.
  // => Introduce a guard on increasing awaitDrain.
  var increasedAwaitDrain = false;
  src.on('data', ondata);
  function ondata(chunk) {
    debug('ondata');
    increasedAwaitDrain = false;
    var ret = dest.write(chunk);
    if (false === ret && !increasedAwaitDrain) {
      // If the user unpiped during `dest.write()`, it is possible
      // to get stuck in a permanently paused state if that write
      // also returned false.
      // => Check whether `dest` is still a piping destination.
      if ((state.pipesCount === 1 && state.pipes === dest || state.pipesCount > 1 && indexOf(state.pipes, dest) !== -1) && !cleanedUp) {
        debug('false write response, pause', src._readableState.awaitDrain);
        src._readableState.awaitDrain++;
        increasedAwaitDrain = true;
      }
      src.pause();
    }
  }

  // if the dest has an error, then stop piping into it.
  // however, don't suppress the throwing behavior for this.
  function onerror(er) {
    debug('onerror', er);
    unpipe();
    dest.removeListener('error', onerror);
    if (EElistenerCount(dest, 'error') === 0) dest.emit('error', er);
  }

  // Make sure our error handler is attached before userland ones.
  prependListener(dest, 'error', onerror);

  // Both close and finish should trigger unpipe, but only once.
  function onclose() {
    dest.removeListener('finish', onfinish);
    unpipe();
  }
  dest.once('close', onclose);
  function onfinish() {
    debug('onfinish');
    dest.removeListener('close', onclose);
    unpipe();
  }
  dest.once('finish', onfinish);

  function unpipe() {
    debug('unpipe');
    src.unpipe(dest);
  }

  // tell the dest that it's being piped to
  dest.emit('pipe', src);

  // start the flow if it hasn't been started already.
  if (!state.flowing) {
    debug('pipe resume');
    src.resume();
  }

  return dest;
};

function pipeOnDrain(src) {
  return function () {
    var state = src._readableState;
    debug('pipeOnDrain', state.awaitDrain);
    if (state.awaitDrain) state.awaitDrain--;
    if (state.awaitDrain === 0 && EElistenerCount(src, 'data')) {
      state.flowing = true;
      flow(src);
    }
  };
}

Readable.prototype.unpipe = function (dest) {
  var state = this._readableState;
  var unpipeInfo = { hasUnpiped: false };

  // if we're not piping anywhere, then do nothing.
  if (state.pipesCount === 0) return this;

  // just one destination.  most common case.
  if (state.pipesCount === 1) {
    // passed in one, but it's not the right one.
    if (dest && dest !== state.pipes) return this;

    if (!dest) dest = state.pipes;

    // got a match.
    state.pipes = null;
    state.pipesCount = 0;
    state.flowing = false;
    if (dest) dest.emit('unpipe', this, unpipeInfo);
    return this;
  }

  // slow case. multiple pipe destinations.

  if (!dest) {
    // remove all.
    var dests = state.pipes;
    var len = state.pipesCount;
    state.pipes = null;
    state.pipesCount = 0;
    state.flowing = false;

    for (var i = 0; i < len; i++) {
      dests[i].emit('unpipe', this, unpipeInfo);
    }return this;
  }

  // try to find the right one.
  var index = indexOf(state.pipes, dest);
  if (index === -1) return this;

  state.pipes.splice(index, 1);
  state.pipesCount -= 1;
  if (state.pipesCount === 1) state.pipes = state.pipes[0];

  dest.emit('unpipe', this, unpipeInfo);

  return this;
};

// set up data events if they are asked for
// Ensure readable listeners eventually get something
Readable.prototype.on = function (ev, fn) {
  var res = Stream.prototype.on.call(this, ev, fn);

  if (ev === 'data') {
    // Start flowing on next tick if stream isn't explicitly paused
    if (this._readableState.flowing !== false) this.resume();
  } else if (ev === 'readable') {
    var state = this._readableState;
    if (!state.endEmitted && !state.readableListening) {
      state.readableListening = state.needReadable = true;
      state.emittedReadable = false;
      if (!state.reading) {
        processNextTick(nReadingNextTick, this);
      } else if (state.length) {
        emitReadable(this);
      }
    }
  }

  return res;
};
Readable.prototype.addListener = Readable.prototype.on;

function nReadingNextTick(self) {
  debug('readable nexttick read 0');
  self.read(0);
}

// pause() and resume() are remnants of the legacy readable stream API
// If the user uses them, then switch into old mode.
Readable.prototype.resume = function () {
  var state = this._readableState;
  if (!state.flowing) {
    debug('resume');
    state.flowing = true;
    resume(this, state);
  }
  return this;
};

function resume(stream, state) {
  if (!state.resumeScheduled) {
    state.resumeScheduled = true;
    processNextTick(resume_, stream, state);
  }
}

function resume_(stream, state) {
  if (!state.reading) {
    debug('resume read 0');
    stream.read(0);
  }

  state.resumeScheduled = false;
  state.awaitDrain = 0;
  stream.emit('resume');
  flow(stream);
  if (state.flowing && !state.reading) stream.read(0);
}

Readable.prototype.pause = function () {
  debug('call pause flowing=%j', this._readableState.flowing);
  if (false !== this._readableState.flowing) {
    debug('pause');
    this._readableState.flowing = false;
    this.emit('pause');
  }
  return this;
};

function flow(stream) {
  var state = stream._readableState;
  debug('flow', state.flowing);
  while (state.flowing && stream.read() !== null) {}
}

// wrap an old-style stream as the async data source.
// This is *not* part of the readable stream interface.
// It is an ugly unfortunate mess of history.
Readable.prototype.wrap = function (stream) {
  var state = this._readableState;
  var paused = false;

  var self = this;
  stream.on('end', function () {
    debug('wrapped end');
    if (state.decoder && !state.ended) {
      var chunk = state.decoder.end();
      if (chunk && chunk.length) self.push(chunk);
    }

    self.push(null);
  });

  stream.on('data', function (chunk) {
    debug('wrapped data');
    if (state.decoder) chunk = state.decoder.write(chunk);

    // don't skip over falsy values in objectMode
    if (state.objectMode && (chunk === null || chunk === undefined)) return;else if (!state.objectMode && (!chunk || !chunk.length)) return;

    var ret = self.push(chunk);
    if (!ret) {
      paused = true;
      stream.pause();
    }
  });

  // proxy all the other methods.
  // important when wrapping filters and duplexes.
  for (var i in stream) {
    if (this[i] === undefined && typeof stream[i] === 'function') {
      this[i] = function (method) {
        return function () {
          return stream[method].apply(stream, arguments);
        };
      }(i);
    }
  }

  // proxy certain important events.
  for (var n = 0; n < kProxyEvents.length; n++) {
    stream.on(kProxyEvents[n], self.emit.bind(self, kProxyEvents[n]));
  }

  // when we try to consume some more bytes, simply unpause the
  // underlying stream.
  self._read = function (n) {
    debug('wrapped _read', n);
    if (paused) {
      paused = false;
      stream.resume();
    }
  };

  return self;
};

// exposed for testing purposes only.
Readable._fromList = fromList;

// Pluck off n bytes from an array of buffers.
// Length is the combined lengths of all the buffers in the list.
// This function is designed to be inlinable, so please take care when making
// changes to the function body.
function fromList(n, state) {
  // nothing buffered
  if (state.length === 0) return null;

  var ret;
  if (state.objectMode) ret = state.buffer.shift();else if (!n || n >= state.length) {
    // read it all, truncate the list
    if (state.decoder) ret = state.buffer.join('');else if (state.buffer.length === 1) ret = state.buffer.head.data;else ret = state.buffer.concat(state.length);
    state.buffer.clear();
  } else {
    // read part of list
    ret = fromListPartial(n, state.buffer, state.decoder);
  }

  return ret;
}

// Extracts only enough buffered data to satisfy the amount requested.
// This function is designed to be inlinable, so please take care when making
// changes to the function body.
function fromListPartial(n, list, hasStrings) {
  var ret;
  if (n < list.head.data.length) {
    // slice is the same for buffers and strings
    ret = list.head.data.slice(0, n);
    list.head.data = list.head.data.slice(n);
  } else if (n === list.head.data.length) {
    // first chunk is a perfect match
    ret = list.shift();
  } else {
    // result spans more than one buffer
    ret = hasStrings ? copyFromBufferString(n, list) : copyFromBuffer(n, list);
  }
  return ret;
}

// Copies a specified amount of characters from the list of buffered data
// chunks.
// This function is designed to be inlinable, so please take care when making
// changes to the function body.
function copyFromBufferString(n, list) {
  var p = list.head;
  var c = 1;
  var ret = p.data;
  n -= ret.length;
  while (p = p.next) {
    var str = p.data;
    var nb = n > str.length ? str.length : n;
    if (nb === str.length) ret += str;else ret += str.slice(0, n);
    n -= nb;
    if (n === 0) {
      if (nb === str.length) {
        ++c;
        if (p.next) list.head = p.next;else list.head = list.tail = null;
      } else {
        list.head = p;
        p.data = str.slice(nb);
      }
      break;
    }
    ++c;
  }
  list.length -= c;
  return ret;
}

// Copies a specified amount of bytes from the list of buffered data chunks.
// This function is designed to be inlinable, so please take care when making
// changes to the function body.
function copyFromBuffer(n, list) {
  var ret = Buffer.allocUnsafe(n);
  var p = list.head;
  var c = 1;
  p.data.copy(ret);
  n -= p.data.length;
  while (p = p.next) {
    var buf = p.data;
    var nb = n > buf.length ? buf.length : n;
    buf.copy(ret, ret.length - n, 0, nb);
    n -= nb;
    if (n === 0) {
      if (nb === buf.length) {
        ++c;
        if (p.next) list.head = p.next;else list.head = list.tail = null;
      } else {
        list.head = p;
        p.data = buf.slice(nb);
      }
      break;
    }
    ++c;
  }
  list.length -= c;
  return ret;
}

function endReadable(stream) {
  var state = stream._readableState;

  // If we get here before consuming all the bytes, then that is a
  // bug in node.  Should never happen.
  if (state.length > 0) throw new Error('"endReadable()" called on non-empty stream');

  if (!state.endEmitted) {
    state.ended = true;
    processNextTick(endReadableNT, state, stream);
  }
}

function endReadableNT(state, stream) {
  // Check that we didn't get one last unshift.
  if (!state.endEmitted && state.length === 0) {
    state.endEmitted = true;
    stream.readable = false;
    stream.emit('end');
  }
}

function forEach(xs, f) {
  for (var i = 0, l = xs.length; i < l; i++) {
    f(xs[i], i);
  }
}

function indexOf(xs, x) {
  for (var i = 0, l = xs.length; i < l; i++) {
    if (xs[i] === x) return i;
  }
  return -1;
}
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(37), __webpack_require__(41)))

/***/ }),
/* 148 */
/***/ (function(module, exports, __webpack_require__) {

module.exports = __webpack_require__(103).EventEmitter;


/***/ }),
/* 149 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


/*<replacement>*/

var processNextTick = __webpack_require__(77);
/*</replacement>*/

// undocumented cb() API, needed for core, not for public API
function destroy(err, cb) {
  var _this = this;

  var readableDestroyed = this._readableState && this._readableState.destroyed;
  var writableDestroyed = this._writableState && this._writableState.destroyed;

  if (readableDestroyed || writableDestroyed) {
    if (cb) {
      cb(err);
    } else if (err && (!this._writableState || !this._writableState.errorEmitted)) {
      processNextTick(emitErrorNT, this, err);
    }
    return;
  }

  // we set destroyed to true before firing error callbacks in order
  // to make it re-entrance safe in case destroy() is called within callbacks

  if (this._readableState) {
    this._readableState.destroyed = true;
  }

  // if this is a duplex stream mark the writable part as destroyed as well
  if (this._writableState) {
    this._writableState.destroyed = true;
  }

  this._destroy(err || null, function (err) {
    if (!cb && err) {
      processNextTick(emitErrorNT, _this, err);
      if (_this._writableState) {
        _this._writableState.errorEmitted = true;
      }
    } else if (cb) {
      cb(err);
    }
  });
}

function undestroy() {
  if (this._readableState) {
    this._readableState.destroyed = false;
    this._readableState.reading = false;
    this._readableState.ended = false;
    this._readableState.endEmitted = false;
  }

  if (this._writableState) {
    this._writableState.destroyed = false;
    this._writableState.ended = false;
    this._writableState.ending = false;
    this._writableState.finished = false;
    this._writableState.errorEmitted = false;
  }
}

function emitErrorNT(self, err) {
  self.emit('error', err);
}

module.exports = {
  destroy: destroy,
  undestroy: undestroy
};

/***/ }),
/* 150 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";
// Copyright Joyent, Inc. and other Node contributors.
//
// Permission is hereby granted, free of charge, to any person obtaining a
// copy of this software and associated documentation files (the
// "Software"), to deal in the Software without restriction, including
// without limitation the rights to use, copy, modify, merge, publish,
// distribute, sublicense, and/or sell copies of the Software, and to permit
// persons to whom the Software is furnished to do so, subject to the
// following conditions:
//
// The above copyright notice and this permission notice shall be included
// in all copies or substantial portions of the Software.
//
// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
// USE OR OTHER DEALINGS IN THE SOFTWARE.

// a transform stream is a readable/writable stream where you do
// something with the data.  Sometimes it's called a "filter",
// but that's not a great name for it, since that implies a thing where
// some bits pass through, and others are simply ignored.  (That would
// be a valid example of a transform, of course.)
//
// While the output is causally related to the input, it's not a
// necessarily symmetric or synchronous transformation.  For example,
// a zlib stream might take multiple plain-text writes(), and then
// emit a single compressed chunk some time in the future.
//
// Here's how this works:
//
// The Transform stream has all the aspects of the readable and writable
// stream classes.  When you write(chunk), that calls _write(chunk,cb)
// internally, and returns false if there's a lot of pending writes
// buffered up.  When you call read(), that calls _read(n) until
// there's enough pending readable data buffered up.
//
// In a transform stream, the written data is placed in a buffer.  When
// _read(n) is called, it transforms the queued up data, calling the
// buffered _write cb's as it consumes chunks.  If consuming a single
// written chunk would result in multiple output chunks, then the first
// outputted bit calls the readcb, and subsequent chunks just go into
// the read buffer, and will cause it to emit 'readable' if necessary.
//
// This way, back-pressure is actually determined by the reading side,
// since _read has to be called to start processing a new chunk.  However,
// a pathological inflate type of transform can cause excessive buffering
// here.  For example, imagine a stream where every byte of input is
// interpreted as an integer from 0-255, and then results in that many
// bytes of output.  Writing the 4 bytes {ff,ff,ff,ff} would result in
// 1kb of data being output.  In this case, you could write a very small
// amount of input, and end up with a very large amount of output.  In
// such a pathological inflating mechanism, there'd be no way to tell
// the system to stop doing the transform.  A single 4MB write could
// cause the system to run out of memory.
//
// However, even in such a pathological case, only a single written chunk
// would be consumed, and then the rest would wait (un-transformed) until
// the results of the previous transformed chunk were consumed.



module.exports = Transform;

var Duplex = __webpack_require__(45);

/*<replacement>*/
var util = __webpack_require__(68);
util.inherits = __webpack_require__(1);
/*</replacement>*/

util.inherits(Transform, Duplex);

function TransformState(stream) {
  this.afterTransform = function (er, data) {
    return afterTransform(stream, er, data);
  };

  this.needTransform = false;
  this.transforming = false;
  this.writecb = null;
  this.writechunk = null;
  this.writeencoding = null;
}

function afterTransform(stream, er, data) {
  var ts = stream._transformState;
  ts.transforming = false;

  var cb = ts.writecb;

  if (!cb) {
    return stream.emit('error', new Error('write callback called multiple times'));
  }

  ts.writechunk = null;
  ts.writecb = null;

  if (data !== null && data !== undefined) stream.push(data);

  cb(er);

  var rs = stream._readableState;
  rs.reading = false;
  if (rs.needReadable || rs.length < rs.highWaterMark) {
    stream._read(rs.highWaterMark);
  }
}

function Transform(options) {
  if (!(this instanceof Transform)) return new Transform(options);

  Duplex.call(this, options);

  this._transformState = new TransformState(this);

  var stream = this;

  // start out asking for a readable event once data is transformed.
  this._readableState.needReadable = true;

  // we have implemented the _read method, and done the other things
  // that Readable wants before the first _read call, so unset the
  // sync guard flag.
  this._readableState.sync = false;

  if (options) {
    if (typeof options.transform === 'function') this._transform = options.transform;

    if (typeof options.flush === 'function') this._flush = options.flush;
  }

  // When the writable side finishes, then flush out anything remaining.
  this.once('prefinish', function () {
    if (typeof this._flush === 'function') this._flush(function (er, data) {
      done(stream, er, data);
    });else done(stream);
  });
}

Transform.prototype.push = function (chunk, encoding) {
  this._transformState.needTransform = false;
  return Duplex.prototype.push.call(this, chunk, encoding);
};

// This is the part where you do stuff!
// override this function in implementation classes.
// 'chunk' is an input chunk.
//
// Call `push(newChunk)` to pass along transformed output
// to the readable side.  You may call 'push' zero or more times.
//
// Call `cb(err)` when you are done with this chunk.  If you pass
// an error, then that'll put the hurt on the whole operation.  If you
// never call cb(), then you'll never get another chunk.
Transform.prototype._transform = function (chunk, encoding, cb) {
  throw new Error('_transform() is not implemented');
};

Transform.prototype._write = function (chunk, encoding, cb) {
  var ts = this._transformState;
  ts.writecb = cb;
  ts.writechunk = chunk;
  ts.writeencoding = encoding;
  if (!ts.transforming) {
    var rs = this._readableState;
    if (ts.needTransform || rs.needReadable || rs.length < rs.highWaterMark) this._read(rs.highWaterMark);
  }
};

// Doesn't matter what the args are here.
// _transform does all the work.
// That we got here means that the readable side wants more data.
Transform.prototype._read = function (n) {
  var ts = this._transformState;

  if (ts.writechunk !== null && ts.writecb && !ts.transforming) {
    ts.transforming = true;
    this._transform(ts.writechunk, ts.writeencoding, ts.afterTransform);
  } else {
    // mark that we need a transform, so that any data that comes in
    // will get processed, now that we've asked for it.
    ts.needTransform = true;
  }
};

Transform.prototype._destroy = function (err, cb) {
  var _this = this;

  Duplex.prototype._destroy.call(this, err, function (err2) {
    cb(err2);
    _this.emit('close');
  });
};

function done(stream, er, data) {
  if (er) return stream.emit('error', er);

  if (data !== null && data !== undefined) stream.push(data);

  // if there's nothing in the write buffer, then that means
  // that nothing more will ever be provided
  var ws = stream._writableState;
  var ts = stream._transformState;

  if (ws.length) throw new Error('Calling transform done when ws.length != 0');

  if (ts.transforming) throw new Error('Calling transform done when still transforming');

  return stream.push(null);
}

/***/ }),
/* 151 */
/***/ (function(module, exports, __webpack_require__) {

/**
 * A JavaScript implementation of the Secure Hash Algorithm, SHA-256, as defined
 * in FIPS 180-2
 * Version 2.2-beta Copyright Angel Marin, Paul Johnston 2000 - 2009.
 * Other contributors: Greg Holt, Andrew Kepert, Ydnar, Lostinet
 *
 */

var inherits = __webpack_require__(1)
var Hash = __webpack_require__(58)
var Buffer = __webpack_require__(8).Buffer

var K = [
  0x428A2F98, 0x71374491, 0xB5C0FBCF, 0xE9B5DBA5,
  0x3956C25B, 0x59F111F1, 0x923F82A4, 0xAB1C5ED5,
  0xD807AA98, 0x12835B01, 0x243185BE, 0x550C7DC3,
  0x72BE5D74, 0x80DEB1FE, 0x9BDC06A7, 0xC19BF174,
  0xE49B69C1, 0xEFBE4786, 0x0FC19DC6, 0x240CA1CC,
  0x2DE92C6F, 0x4A7484AA, 0x5CB0A9DC, 0x76F988DA,
  0x983E5152, 0xA831C66D, 0xB00327C8, 0xBF597FC7,
  0xC6E00BF3, 0xD5A79147, 0x06CA6351, 0x14292967,
  0x27B70A85, 0x2E1B2138, 0x4D2C6DFC, 0x53380D13,
  0x650A7354, 0x766A0ABB, 0x81C2C92E, 0x92722C85,
  0xA2BFE8A1, 0xA81A664B, 0xC24B8B70, 0xC76C51A3,
  0xD192E819, 0xD6990624, 0xF40E3585, 0x106AA070,
  0x19A4C116, 0x1E376C08, 0x2748774C, 0x34B0BCB5,
  0x391C0CB3, 0x4ED8AA4A, 0x5B9CCA4F, 0x682E6FF3,
  0x748F82EE, 0x78A5636F, 0x84C87814, 0x8CC70208,
  0x90BEFFFA, 0xA4506CEB, 0xBEF9A3F7, 0xC67178F2
]

var W = new Array(64)

function Sha256 () {
  this.init()

  this._w = W // new Array(64)

  Hash.call(this, 64, 56)
}

inherits(Sha256, Hash)

Sha256.prototype.init = function () {
  this._a = 0x6a09e667
  this._b = 0xbb67ae85
  this._c = 0x3c6ef372
  this._d = 0xa54ff53a
  this._e = 0x510e527f
  this._f = 0x9b05688c
  this._g = 0x1f83d9ab
  this._h = 0x5be0cd19

  return this
}

function ch (x, y, z) {
  return z ^ (x & (y ^ z))
}

function maj (x, y, z) {
  return (x & y) | (z & (x | y))
}

function sigma0 (x) {
  return (x >>> 2 | x << 30) ^ (x >>> 13 | x << 19) ^ (x >>> 22 | x << 10)
}

function sigma1 (x) {
  return (x >>> 6 | x << 26) ^ (x >>> 11 | x << 21) ^ (x >>> 25 | x << 7)
}

function gamma0 (x) {
  return (x >>> 7 | x << 25) ^ (x >>> 18 | x << 14) ^ (x >>> 3)
}

function gamma1 (x) {
  return (x >>> 17 | x << 15) ^ (x >>> 19 | x << 13) ^ (x >>> 10)
}

Sha256.prototype._update = function (M) {
  var W = this._w

  var a = this._a | 0
  var b = this._b | 0
  var c = this._c | 0
  var d = this._d | 0
  var e = this._e | 0
  var f = this._f | 0
  var g = this._g | 0
  var h = this._h | 0

  for (var i = 0; i < 16; ++i) W[i] = M.readInt32BE(i * 4)
  for (; i < 64; ++i) W[i] = (gamma1(W[i - 2]) + W[i - 7] + gamma0(W[i - 15]) + W[i - 16]) | 0

  for (var j = 0; j < 64; ++j) {
    var T1 = (h + sigma1(e) + ch(e, f, g) + K[j] + W[j]) | 0
    var T2 = (sigma0(a) + maj(a, b, c)) | 0

    h = g
    g = f
    f = e
    e = (d + T1) | 0
    d = c
    c = b
    b = a
    a = (T1 + T2) | 0
  }

  this._a = (a + this._a) | 0
  this._b = (b + this._b) | 0
  this._c = (c + this._c) | 0
  this._d = (d + this._d) | 0
  this._e = (e + this._e) | 0
  this._f = (f + this._f) | 0
  this._g = (g + this._g) | 0
  this._h = (h + this._h) | 0
}

Sha256.prototype._hash = function () {
  var H = Buffer.allocUnsafe(32)

  H.writeInt32BE(this._a, 0)
  H.writeInt32BE(this._b, 4)
  H.writeInt32BE(this._c, 8)
  H.writeInt32BE(this._d, 12)
  H.writeInt32BE(this._e, 16)
  H.writeInt32BE(this._f, 20)
  H.writeInt32BE(this._g, 24)
  H.writeInt32BE(this._h, 28)

  return H
}

module.exports = Sha256


/***/ }),
/* 152 */
/***/ (function(module, exports, __webpack_require__) {

var inherits = __webpack_require__(1)
var Hash = __webpack_require__(58)
var Buffer = __webpack_require__(8).Buffer

var K = [
  0x428a2f98, 0xd728ae22, 0x71374491, 0x23ef65cd,
  0xb5c0fbcf, 0xec4d3b2f, 0xe9b5dba5, 0x8189dbbc,
  0x3956c25b, 0xf348b538, 0x59f111f1, 0xb605d019,
  0x923f82a4, 0xaf194f9b, 0xab1c5ed5, 0xda6d8118,
  0xd807aa98, 0xa3030242, 0x12835b01, 0x45706fbe,
  0x243185be, 0x4ee4b28c, 0x550c7dc3, 0xd5ffb4e2,
  0x72be5d74, 0xf27b896f, 0x80deb1fe, 0x3b1696b1,
  0x9bdc06a7, 0x25c71235, 0xc19bf174, 0xcf692694,
  0xe49b69c1, 0x9ef14ad2, 0xefbe4786, 0x384f25e3,
  0x0fc19dc6, 0x8b8cd5b5, 0x240ca1cc, 0x77ac9c65,
  0x2de92c6f, 0x592b0275, 0x4a7484aa, 0x6ea6e483,
  0x5cb0a9dc, 0xbd41fbd4, 0x76f988da, 0x831153b5,
  0x983e5152, 0xee66dfab, 0xa831c66d, 0x2db43210,
  0xb00327c8, 0x98fb213f, 0xbf597fc7, 0xbeef0ee4,
  0xc6e00bf3, 0x3da88fc2, 0xd5a79147, 0x930aa725,
  0x06ca6351, 0xe003826f, 0x14292967, 0x0a0e6e70,
  0x27b70a85, 0x46d22ffc, 0x2e1b2138, 0x5c26c926,
  0x4d2c6dfc, 0x5ac42aed, 0x53380d13, 0x9d95b3df,
  0x650a7354, 0x8baf63de, 0x766a0abb, 0x3c77b2a8,
  0x81c2c92e, 0x47edaee6, 0x92722c85, 0x1482353b,
  0xa2bfe8a1, 0x4cf10364, 0xa81a664b, 0xbc423001,
  0xc24b8b70, 0xd0f89791, 0xc76c51a3, 0x0654be30,
  0xd192e819, 0xd6ef5218, 0xd6990624, 0x5565a910,
  0xf40e3585, 0x5771202a, 0x106aa070, 0x32bbd1b8,
  0x19a4c116, 0xb8d2d0c8, 0x1e376c08, 0x5141ab53,
  0x2748774c, 0xdf8eeb99, 0x34b0bcb5, 0xe19b48a8,
  0x391c0cb3, 0xc5c95a63, 0x4ed8aa4a, 0xe3418acb,
  0x5b9cca4f, 0x7763e373, 0x682e6ff3, 0xd6b2b8a3,
  0x748f82ee, 0x5defb2fc, 0x78a5636f, 0x43172f60,
  0x84c87814, 0xa1f0ab72, 0x8cc70208, 0x1a6439ec,
  0x90befffa, 0x23631e28, 0xa4506ceb, 0xde82bde9,
  0xbef9a3f7, 0xb2c67915, 0xc67178f2, 0xe372532b,
  0xca273ece, 0xea26619c, 0xd186b8c7, 0x21c0c207,
  0xeada7dd6, 0xcde0eb1e, 0xf57d4f7f, 0xee6ed178,
  0x06f067aa, 0x72176fba, 0x0a637dc5, 0xa2c898a6,
  0x113f9804, 0xbef90dae, 0x1b710b35, 0x131c471b,
  0x28db77f5, 0x23047d84, 0x32caab7b, 0x40c72493,
  0x3c9ebe0a, 0x15c9bebc, 0x431d67c4, 0x9c100d4c,
  0x4cc5d4be, 0xcb3e42b6, 0x597f299c, 0xfc657e2a,
  0x5fcb6fab, 0x3ad6faec, 0x6c44198c, 0x4a475817
]

var W = new Array(160)

function Sha512 () {
  this.init()
  this._w = W

  Hash.call(this, 128, 112)
}

inherits(Sha512, Hash)

Sha512.prototype.init = function () {
  this._ah = 0x6a09e667
  this._bh = 0xbb67ae85
  this._ch = 0x3c6ef372
  this._dh = 0xa54ff53a
  this._eh = 0x510e527f
  this._fh = 0x9b05688c
  this._gh = 0x1f83d9ab
  this._hh = 0x5be0cd19

  this._al = 0xf3bcc908
  this._bl = 0x84caa73b
  this._cl = 0xfe94f82b
  this._dl = 0x5f1d36f1
  this._el = 0xade682d1
  this._fl = 0x2b3e6c1f
  this._gl = 0xfb41bd6b
  this._hl = 0x137e2179

  return this
}

function Ch (x, y, z) {
  return z ^ (x & (y ^ z))
}

function maj (x, y, z) {
  return (x & y) | (z & (x | y))
}

function sigma0 (x, xl) {
  return (x >>> 28 | xl << 4) ^ (xl >>> 2 | x << 30) ^ (xl >>> 7 | x << 25)
}

function sigma1 (x, xl) {
  return (x >>> 14 | xl << 18) ^ (x >>> 18 | xl << 14) ^ (xl >>> 9 | x << 23)
}

function Gamma0 (x, xl) {
  return (x >>> 1 | xl << 31) ^ (x >>> 8 | xl << 24) ^ (x >>> 7)
}

function Gamma0l (x, xl) {
  return (x >>> 1 | xl << 31) ^ (x >>> 8 | xl << 24) ^ (x >>> 7 | xl << 25)
}

function Gamma1 (x, xl) {
  return (x >>> 19 | xl << 13) ^ (xl >>> 29 | x << 3) ^ (x >>> 6)
}

function Gamma1l (x, xl) {
  return (x >>> 19 | xl << 13) ^ (xl >>> 29 | x << 3) ^ (x >>> 6 | xl << 26)
}

function getCarry (a, b) {
  return (a >>> 0) < (b >>> 0) ? 1 : 0
}

Sha512.prototype._update = function (M) {
  var W = this._w

  var ah = this._ah | 0
  var bh = this._bh | 0
  var ch = this._ch | 0
  var dh = this._dh | 0
  var eh = this._eh | 0
  var fh = this._fh | 0
  var gh = this._gh | 0
  var hh = this._hh | 0

  var al = this._al | 0
  var bl = this._bl | 0
  var cl = this._cl | 0
  var dl = this._dl | 0
  var el = this._el | 0
  var fl = this._fl | 0
  var gl = this._gl | 0
  var hl = this._hl | 0

  for (var i = 0; i < 32; i += 2) {
    W[i] = M.readInt32BE(i * 4)
    W[i + 1] = M.readInt32BE(i * 4 + 4)
  }
  for (; i < 160; i += 2) {
    var xh = W[i - 15 * 2]
    var xl = W[i - 15 * 2 + 1]
    var gamma0 = Gamma0(xh, xl)
    var gamma0l = Gamma0l(xl, xh)

    xh = W[i - 2 * 2]
    xl = W[i - 2 * 2 + 1]
    var gamma1 = Gamma1(xh, xl)
    var gamma1l = Gamma1l(xl, xh)

    // W[i] = gamma0 + W[i - 7] + gamma1 + W[i - 16]
    var Wi7h = W[i - 7 * 2]
    var Wi7l = W[i - 7 * 2 + 1]

    var Wi16h = W[i - 16 * 2]
    var Wi16l = W[i - 16 * 2 + 1]

    var Wil = (gamma0l + Wi7l) | 0
    var Wih = (gamma0 + Wi7h + getCarry(Wil, gamma0l)) | 0
    Wil = (Wil + gamma1l) | 0
    Wih = (Wih + gamma1 + getCarry(Wil, gamma1l)) | 0
    Wil = (Wil + Wi16l) | 0
    Wih = (Wih + Wi16h + getCarry(Wil, Wi16l)) | 0

    W[i] = Wih
    W[i + 1] = Wil
  }

  for (var j = 0; j < 160; j += 2) {
    Wih = W[j]
    Wil = W[j + 1]

    var majh = maj(ah, bh, ch)
    var majl = maj(al, bl, cl)

    var sigma0h = sigma0(ah, al)
    var sigma0l = sigma0(al, ah)
    var sigma1h = sigma1(eh, el)
    var sigma1l = sigma1(el, eh)

    // t1 = h + sigma1 + ch + K[j] + W[j]
    var Kih = K[j]
    var Kil = K[j + 1]

    var chh = Ch(eh, fh, gh)
    var chl = Ch(el, fl, gl)

    var t1l = (hl + sigma1l) | 0
    var t1h = (hh + sigma1h + getCarry(t1l, hl)) | 0
    t1l = (t1l + chl) | 0
    t1h = (t1h + chh + getCarry(t1l, chl)) | 0
    t1l = (t1l + Kil) | 0
    t1h = (t1h + Kih + getCarry(t1l, Kil)) | 0
    t1l = (t1l + Wil) | 0
    t1h = (t1h + Wih + getCarry(t1l, Wil)) | 0

    // t2 = sigma0 + maj
    var t2l = (sigma0l + majl) | 0
    var t2h = (sigma0h + majh + getCarry(t2l, sigma0l)) | 0

    hh = gh
    hl = gl
    gh = fh
    gl = fl
    fh = eh
    fl = el
    el = (dl + t1l) | 0
    eh = (dh + t1h + getCarry(el, dl)) | 0
    dh = ch
    dl = cl
    ch = bh
    cl = bl
    bh = ah
    bl = al
    al = (t1l + t2l) | 0
    ah = (t1h + t2h + getCarry(al, t1l)) | 0
  }

  this._al = (this._al + al) | 0
  this._bl = (this._bl + bl) | 0
  this._cl = (this._cl + cl) | 0
  this._dl = (this._dl + dl) | 0
  this._el = (this._el + el) | 0
  this._fl = (this._fl + fl) | 0
  this._gl = (this._gl + gl) | 0
  this._hl = (this._hl + hl) | 0

  this._ah = (this._ah + ah + getCarry(this._al, al)) | 0
  this._bh = (this._bh + bh + getCarry(this._bl, bl)) | 0
  this._ch = (this._ch + ch + getCarry(this._cl, cl)) | 0
  this._dh = (this._dh + dh + getCarry(this._dl, dl)) | 0
  this._eh = (this._eh + eh + getCarry(this._el, el)) | 0
  this._fh = (this._fh + fh + getCarry(this._fl, fl)) | 0
  this._gh = (this._gh + gh + getCarry(this._gl, gl)) | 0
  this._hh = (this._hh + hh + getCarry(this._hl, hl)) | 0
}

Sha512.prototype._hash = function () {
  var H = Buffer.allocUnsafe(64)

  function writeInt64BE (h, l, offset) {
    H.writeInt32BE(h, offset)
    H.writeInt32BE(l, offset + 4)
  }

  writeInt64BE(this._ah, this._al, 0)
  writeInt64BE(this._bh, this._bl, 8)
  writeInt64BE(this._ch, this._cl, 16)
  writeInt64BE(this._dh, this._dl, 24)
  writeInt64BE(this._eh, this._el, 32)
  writeInt64BE(this._fh, this._fl, 40)
  writeInt64BE(this._gh, this._gl, 48)
  writeInt64BE(this._hh, this._hl, 56)

  return H
}

module.exports = Sha512


/***/ }),
/* 153 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var inherits = __webpack_require__(1)
var Legacy = __webpack_require__(237)
var Base = __webpack_require__(42)
var Buffer = __webpack_require__(8).Buffer
var md5 = __webpack_require__(100)
var RIPEMD160 = __webpack_require__(101)

var sha = __webpack_require__(107)

var ZEROS = Buffer.alloc(128)

function Hmac (alg, key) {
  Base.call(this, 'digest')
  if (typeof key === 'string') {
    key = Buffer.from(key)
  }

  var blocksize = (alg === 'sha512' || alg === 'sha384') ? 128 : 64

  this._alg = alg
  this._key = key
  if (key.length > blocksize) {
    var hash = alg === 'rmd160' ? new RIPEMD160() : sha(alg)
    key = hash.update(key).digest()
  } else if (key.length < blocksize) {
    key = Buffer.concat([key, ZEROS], blocksize)
  }

  var ipad = this._ipad = Buffer.allocUnsafe(blocksize)
  var opad = this._opad = Buffer.allocUnsafe(blocksize)

  for (var i = 0; i < blocksize; i++) {
    ipad[i] = key[i] ^ 0x36
    opad[i] = key[i] ^ 0x5C
  }
  this._hash = alg === 'rmd160' ? new RIPEMD160() : sha(alg)
  this._hash.update(ipad)
}

inherits(Hmac, Base)

Hmac.prototype._update = function (data) {
  this._hash.update(data)
}

Hmac.prototype._final = function () {
  var h = this._hash.digest()
  var hash = this._alg === 'rmd160' ? new RIPEMD160() : sha(this._alg)
  return hash.update(this._opad).update(h).digest()
}

module.exports = function createHmac (alg, key) {
  alg = alg.toLowerCase()
  if (alg === 'rmd160' || alg === 'ripemd160') {
    return new Hmac('rmd160', key)
  }
  if (alg === 'md5') {
    return new Legacy(md5, key)
  }
  return new Hmac(alg, key)
}


/***/ }),
/* 154 */
/***/ (function(module, exports) {

module.exports = {"sha224WithRSAEncryption":{"sign":"rsa","hash":"sha224","id":"302d300d06096086480165030402040500041c"},"RSA-SHA224":{"sign":"ecdsa/rsa","hash":"sha224","id":"302d300d06096086480165030402040500041c"},"sha256WithRSAEncryption":{"sign":"rsa","hash":"sha256","id":"3031300d060960864801650304020105000420"},"RSA-SHA256":{"sign":"ecdsa/rsa","hash":"sha256","id":"3031300d060960864801650304020105000420"},"sha384WithRSAEncryption":{"sign":"rsa","hash":"sha384","id":"3041300d060960864801650304020205000430"},"RSA-SHA384":{"sign":"ecdsa/rsa","hash":"sha384","id":"3041300d060960864801650304020205000430"},"sha512WithRSAEncryption":{"sign":"rsa","hash":"sha512","id":"3051300d060960864801650304020305000440"},"RSA-SHA512":{"sign":"ecdsa/rsa","hash":"sha512","id":"3051300d060960864801650304020305000440"},"RSA-SHA1":{"sign":"rsa","hash":"sha1","id":"3021300906052b0e03021a05000414"},"ecdsa-with-SHA1":{"sign":"ecdsa","hash":"sha1","id":""},"sha256":{"sign":"ecdsa","hash":"sha256","id":""},"sha224":{"sign":"ecdsa","hash":"sha224","id":""},"sha384":{"sign":"ecdsa","hash":"sha384","id":""},"sha512":{"sign":"ecdsa","hash":"sha512","id":""},"DSA-SHA":{"sign":"dsa","hash":"sha1","id":""},"DSA-SHA1":{"sign":"dsa","hash":"sha1","id":""},"DSA":{"sign":"dsa","hash":"sha1","id":""},"DSA-WITH-SHA224":{"sign":"dsa","hash":"sha224","id":""},"DSA-SHA224":{"sign":"dsa","hash":"sha224","id":""},"DSA-WITH-SHA256":{"sign":"dsa","hash":"sha256","id":""},"DSA-SHA256":{"sign":"dsa","hash":"sha256","id":""},"DSA-WITH-SHA384":{"sign":"dsa","hash":"sha384","id":""},"DSA-SHA384":{"sign":"dsa","hash":"sha384","id":""},"DSA-WITH-SHA512":{"sign":"dsa","hash":"sha512","id":""},"DSA-SHA512":{"sign":"dsa","hash":"sha512","id":""},"DSA-RIPEMD160":{"sign":"dsa","hash":"rmd160","id":""},"ripemd160WithRSA":{"sign":"rsa","hash":"rmd160","id":"3021300906052b2403020105000414"},"RSA-RIPEMD160":{"sign":"rsa","hash":"rmd160","id":"3021300906052b2403020105000414"},"md5WithRSAEncryption":{"sign":"rsa","hash":"md5","id":"3020300c06082a864886f70d020505000410"},"RSA-MD5":{"sign":"rsa","hash":"md5","id":"3020300c06082a864886f70d020505000410"}}

/***/ }),
/* 155 */
/***/ (function(module, exports, __webpack_require__) {


exports.pbkdf2 = __webpack_require__(239)

exports.pbkdf2Sync = __webpack_require__(158)


/***/ }),
/* 156 */
/***/ (function(module, exports) {

var MAX_ALLOC = Math.pow(2, 30) - 1 // default in iojs
module.exports = function (iterations, keylen) {
  if (typeof iterations !== 'number') {
    throw new TypeError('Iterations not a number')
  }

  if (iterations < 0) {
    throw new TypeError('Bad iterations')
  }

  if (typeof keylen !== 'number') {
    throw new TypeError('Key length not a number')
  }

  if (keylen < 0 || keylen > MAX_ALLOC || keylen !== keylen) { /* eslint no-self-compare: 0 */
    throw new TypeError('Bad key length')
  }
}


/***/ }),
/* 157 */
/***/ (function(module, exports, __webpack_require__) {

/* WEBPACK VAR INJECTION */(function(process) {var defaultEncoding
/* istanbul ignore next */
if (process.browser) {
  defaultEncoding = 'utf-8'
} else {
  var pVersionMajor = parseInt(process.version.split('.')[0].slice(1), 10)

  defaultEncoding = pVersionMajor >= 6 ? 'utf-8' : 'binary'
}
module.exports = defaultEncoding

/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(41)))

/***/ }),
/* 158 */
/***/ (function(module, exports, __webpack_require__) {

var md5 = __webpack_require__(100)
var rmd160 = __webpack_require__(101)
var sha = __webpack_require__(107)

var checkParameters = __webpack_require__(156)
var defaultEncoding = __webpack_require__(157)
var Buffer = __webpack_require__(8).Buffer
var ZEROS = Buffer.alloc(128)
var sizes = {
  md5: 16,
  sha1: 20,
  sha224: 28,
  sha256: 32,
  sha384: 48,
  sha512: 64,
  rmd160: 20,
  ripemd160: 20
}

function Hmac (alg, key, saltLen) {
  var hash = getDigest(alg)
  var blocksize = (alg === 'sha512' || alg === 'sha384') ? 128 : 64

  if (key.length > blocksize) {
    key = hash(key)
  } else if (key.length < blocksize) {
    key = Buffer.concat([key, ZEROS], blocksize)
  }

  var ipad = Buffer.allocUnsafe(blocksize + sizes[alg])
  var opad = Buffer.allocUnsafe(blocksize + sizes[alg])
  for (var i = 0; i < blocksize; i++) {
    ipad[i] = key[i] ^ 0x36
    opad[i] = key[i] ^ 0x5C
  }

  var ipad1 = Buffer.allocUnsafe(blocksize + saltLen + 4)
  ipad.copy(ipad1, 0, 0, blocksize)
  this.ipad1 = ipad1
  this.ipad2 = ipad
  this.opad = opad
  this.alg = alg
  this.blocksize = blocksize
  this.hash = hash
  this.size = sizes[alg]
}

Hmac.prototype.run = function (data, ipad) {
  data.copy(ipad, this.blocksize)
  var h = this.hash(ipad)
  h.copy(this.opad, this.blocksize)
  return this.hash(this.opad)
}

function getDigest (alg) {
  function shaFunc (data) {
    return sha(alg).update(data).digest()
  }

  if (alg === 'rmd160' || alg === 'ripemd160') return rmd160
  if (alg === 'md5') return md5
  return shaFunc
}

function pbkdf2 (password, salt, iterations, keylen, digest) {
  if (!Buffer.isBuffer(password)) password = Buffer.from(password, defaultEncoding)
  if (!Buffer.isBuffer(salt)) salt = Buffer.from(salt, defaultEncoding)

  checkParameters(iterations, keylen)

  digest = digest || 'sha1'

  var hmac = new Hmac(digest, password, salt.length)

  var DK = Buffer.allocUnsafe(keylen)
  var block1 = Buffer.allocUnsafe(salt.length + 4)
  salt.copy(block1, 0, 0, salt.length)

  var destPos = 0
  var hLen = sizes[digest]
  var l = Math.ceil(keylen / hLen)

  for (var i = 1; i <= l; i++) {
    block1.writeUInt32BE(i, salt.length)

    var T = hmac.run(block1, hmac.ipad1)
    var U = T

    for (var j = 1; j < iterations; j++) {
      U = hmac.run(U, hmac.ipad2)
      for (var k = 0; k < hLen; k++) T[k] ^= U[k]
    }

    T.copy(DK, destPos)
    destPos += hLen
  }

  return DK
}

module.exports = pbkdf2


/***/ }),
/* 159 */
/***/ (function(module, exports, __webpack_require__) {

/* WEBPACK VAR INJECTION */(function(Buffer) {var xor = __webpack_require__(69)

var incr32 = __webpack_require__(160)

function getBlock (self) {
  var out = self._cipher.encryptBlockRaw(self._prev)
  incr32(self._prev)
  return out
}

var blockSize = 16
exports.encrypt = function (self, chunk) {
  var chunkNum = Math.ceil(chunk.length / blockSize)
  var start = self._cache.length
  self._cache = Buffer.concat([
    self._cache,
    Buffer.allocUnsafe(chunkNum * blockSize)
  ])
  for (var i = 0; i < chunkNum; i++) {
    var out = getBlock(self)
    var offset = start + i * blockSize
    self._cache.writeUInt32BE(out[0], offset + 0)
    self._cache.writeUInt32BE(out[1], offset + 4)
    self._cache.writeUInt32BE(out[2], offset + 8)
    self._cache.writeUInt32BE(out[3], offset + 12)
  }
  var pad = self._cache.slice(0, chunk.length)
  self._cache = self._cache.slice(chunk.length)
  return xor(chunk, pad)
}

/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(6).Buffer))

/***/ }),
/* 160 */
/***/ (function(module, exports) {

function incr32 (iv) {
  var len = iv.length
  var item
  while (len--) {
    item = iv.readUInt8(len)
    if (item === 255) {
      iv.writeUInt8(0, len)
    } else {
      item++
      iv.writeUInt8(item, len)
      break
    }
  }
}
module.exports = incr32


/***/ }),
/* 161 */
/***/ (function(module, exports) {

module.exports = {"aes-128-ecb":{"cipher":"AES","key":128,"iv":0,"mode":"ECB","type":"block"},"aes-192-ecb":{"cipher":"AES","key":192,"iv":0,"mode":"ECB","type":"block"},"aes-256-ecb":{"cipher":"AES","key":256,"iv":0,"mode":"ECB","type":"block"},"aes-128-cbc":{"cipher":"AES","key":128,"iv":16,"mode":"CBC","type":"block"},"aes-192-cbc":{"cipher":"AES","key":192,"iv":16,"mode":"CBC","type":"block"},"aes-256-cbc":{"cipher":"AES","key":256,"iv":16,"mode":"CBC","type":"block"},"aes128":{"cipher":"AES","key":128,"iv":16,"mode":"CBC","type":"block"},"aes192":{"cipher":"AES","key":192,"iv":16,"mode":"CBC","type":"block"},"aes256":{"cipher":"AES","key":256,"iv":16,"mode":"CBC","type":"block"},"aes-128-cfb":{"cipher":"AES","key":128,"iv":16,"mode":"CFB","type":"stream"},"aes-192-cfb":{"cipher":"AES","key":192,"iv":16,"mode":"CFB","type":"stream"},"aes-256-cfb":{"cipher":"AES","key":256,"iv":16,"mode":"CFB","type":"stream"},"aes-128-cfb8":{"cipher":"AES","key":128,"iv":16,"mode":"CFB8","type":"stream"},"aes-192-cfb8":{"cipher":"AES","key":192,"iv":16,"mode":"CFB8","type":"stream"},"aes-256-cfb8":{"cipher":"AES","key":256,"iv":16,"mode":"CFB8","type":"stream"},"aes-128-cfb1":{"cipher":"AES","key":128,"iv":16,"mode":"CFB1","type":"stream"},"aes-192-cfb1":{"cipher":"AES","key":192,"iv":16,"mode":"CFB1","type":"stream"},"aes-256-cfb1":{"cipher":"AES","key":256,"iv":16,"mode":"CFB1","type":"stream"},"aes-128-ofb":{"cipher":"AES","key":128,"iv":16,"mode":"OFB","type":"stream"},"aes-192-ofb":{"cipher":"AES","key":192,"iv":16,"mode":"OFB","type":"stream"},"aes-256-ofb":{"cipher":"AES","key":256,"iv":16,"mode":"OFB","type":"stream"},"aes-128-ctr":{"cipher":"AES","key":128,"iv":16,"mode":"CTR","type":"stream"},"aes-192-ctr":{"cipher":"AES","key":192,"iv":16,"mode":"CTR","type":"stream"},"aes-256-ctr":{"cipher":"AES","key":256,"iv":16,"mode":"CTR","type":"stream"},"aes-128-gcm":{"cipher":"AES","key":128,"iv":12,"mode":"GCM","type":"auth"},"aes-192-gcm":{"cipher":"AES","key":192,"iv":12,"mode":"GCM","type":"auth"},"aes-256-gcm":{"cipher":"AES","key":256,"iv":12,"mode":"GCM","type":"auth"}}

/***/ }),
/* 162 */
/***/ (function(module, exports, __webpack_require__) {

var aes = __webpack_require__(79)
var Buffer = __webpack_require__(8).Buffer
var Transform = __webpack_require__(42)
var inherits = __webpack_require__(1)
var GHASH = __webpack_require__(249)
var xor = __webpack_require__(69)
var incr32 = __webpack_require__(160)

function xorTest (a, b) {
  var out = 0
  if (a.length !== b.length) out++

  var len = Math.min(a.length, b.length)
  for (var i = 0; i < len; ++i) {
    out += (a[i] ^ b[i])
  }

  return out
}

function calcIv (self, iv, ck) {
  if (iv.length === 12) {
    self._finID = Buffer.concat([iv, Buffer.from([0, 0, 0, 1])])
    return Buffer.concat([iv, Buffer.from([0, 0, 0, 2])])
  }
  var ghash = new GHASH(ck)
  var len = iv.length
  var toPad = len % 16
  ghash.update(iv)
  if (toPad) {
    toPad = 16 - toPad
    ghash.update(Buffer.alloc(toPad, 0))
  }
  ghash.update(Buffer.alloc(8, 0))
  var ivBits = len * 8
  var tail = Buffer.alloc(8)
  tail.writeUIntBE(ivBits, 0, 8)
  ghash.update(tail)
  self._finID = ghash.state
  var out = Buffer.from(self._finID)
  incr32(out)
  return out
}
function StreamCipher (mode, key, iv, decrypt) {
  Transform.call(this)

  var h = Buffer.alloc(4, 0)

  this._cipher = new aes.AES(key)
  var ck = this._cipher.encryptBlock(h)
  this._ghash = new GHASH(ck)
  iv = calcIv(this, iv, ck)

  this._prev = Buffer.from(iv)
  this._cache = Buffer.allocUnsafe(0)
  this._secCache = Buffer.allocUnsafe(0)
  this._decrypt = decrypt
  this._alen = 0
  this._len = 0
  this._mode = mode

  this._authTag = null
  this._called = false
}

inherits(StreamCipher, Transform)

StreamCipher.prototype._update = function (chunk) {
  if (!this._called && this._alen) {
    var rump = 16 - (this._alen % 16)
    if (rump < 16) {
      rump = Buffer.alloc(rump, 0)
      this._ghash.update(rump)
    }
  }

  this._called = true
  var out = this._mode.encrypt(this, chunk)
  if (this._decrypt) {
    this._ghash.update(chunk)
  } else {
    this._ghash.update(out)
  }
  this._len += chunk.length
  return out
}

StreamCipher.prototype._final = function () {
  if (this._decrypt && !this._authTag) throw new Error('Unsupported state or unable to authenticate data')

  var tag = xor(this._ghash.final(this._alen * 8, this._len * 8), this._cipher.encryptBlock(this._finID))
  if (this._decrypt && xorTest(tag, this._authTag)) throw new Error('Unsupported state or unable to authenticate data')

  this._authTag = tag
  this._cipher.scrub()
}

StreamCipher.prototype.getAuthTag = function getAuthTag () {
  if (this._decrypt || !Buffer.isBuffer(this._authTag)) throw new Error('Attempting to get auth tag in unsupported state')

  return this._authTag
}

StreamCipher.prototype.setAuthTag = function setAuthTag (tag) {
  if (!this._decrypt) throw new Error('Attempting to set auth tag in unsupported state')

  this._authTag = tag
}

StreamCipher.prototype.setAAD = function setAAD (buf) {
  if (this._called) throw new Error('Attempting to set AAD in unsupported state')

  this._ghash.update(buf)
  this._alen += buf.length
}

module.exports = StreamCipher


/***/ }),
/* 163 */
/***/ (function(module, exports, __webpack_require__) {

var aes = __webpack_require__(79)
var Buffer = __webpack_require__(8).Buffer
var Transform = __webpack_require__(42)
var inherits = __webpack_require__(1)

function StreamCipher (mode, key, iv, decrypt) {
  Transform.call(this)

  this._cipher = new aes.AES(key)
  this._prev = Buffer.from(iv)
  this._cache = Buffer.allocUnsafe(0)
  this._secCache = Buffer.allocUnsafe(0)
  this._decrypt = decrypt
  this._mode = mode
}

inherits(StreamCipher, Transform)

StreamCipher.prototype._update = function (chunk) {
  return this._mode.encrypt(this, chunk, this._decrypt)
}

StreamCipher.prototype._final = function () {
  this._cipher.scrub()
}

module.exports = StreamCipher


/***/ }),
/* 164 */
/***/ (function(module, exports, __webpack_require__) {

var randomBytes = __webpack_require__(66);
module.exports = findPrime;
findPrime.simpleSieve = simpleSieve;
findPrime.fermatTest = fermatTest;
var BN = __webpack_require__(13);
var TWENTYFOUR = new BN(24);
var MillerRabin = __webpack_require__(165);
var millerRabin = new MillerRabin();
var ONE = new BN(1);
var TWO = new BN(2);
var FIVE = new BN(5);
var SIXTEEN = new BN(16);
var EIGHT = new BN(8);
var TEN = new BN(10);
var THREE = new BN(3);
var SEVEN = new BN(7);
var ELEVEN = new BN(11);
var FOUR = new BN(4);
var TWELVE = new BN(12);
var primes = null;

function _getPrimes() {
  if (primes !== null)
    return primes;

  var limit = 0x100000;
  var res = [];
  res[0] = 2;
  for (var i = 1, k = 3; k < limit; k += 2) {
    var sqrt = Math.ceil(Math.sqrt(k));
    for (var j = 0; j < i && res[j] <= sqrt; j++)
      if (k % res[j] === 0)
        break;

    if (i !== j && res[j] <= sqrt)
      continue;

    res[i++] = k;
  }
  primes = res;
  return res;
}

function simpleSieve(p) {
  var primes = _getPrimes();

  for (var i = 0; i < primes.length; i++)
    if (p.modn(primes[i]) === 0) {
      if (p.cmpn(primes[i]) === 0) {
        return true;
      } else {
        return false;
      }
    }

  return true;
}

function fermatTest(p) {
  var red = BN.mont(p);
  return TWO.toRed(red).redPow(p.subn(1)).fromRed().cmpn(1) === 0;
}

function findPrime(bits, gen) {
  if (bits < 16) {
    // this is what openssl does
    if (gen === 2 || gen === 5) {
      return new BN([0x8c, 0x7b]);
    } else {
      return new BN([0x8c, 0x27]);
    }
  }
  gen = new BN(gen);

  var num, n2;

  while (true) {
    num = new BN(randomBytes(Math.ceil(bits / 8)));
    while (num.bitLength() > bits) {
      num.ishrn(1);
    }
    if (num.isEven()) {
      num.iadd(ONE);
    }
    if (!num.testn(1)) {
      num.iadd(TWO);
    }
    if (!gen.cmp(TWO)) {
      while (num.mod(TWENTYFOUR).cmp(ELEVEN)) {
        num.iadd(FOUR);
      }
    } else if (!gen.cmp(FIVE)) {
      while (num.mod(TEN).cmp(THREE)) {
        num.iadd(FOUR);
      }
    }
    n2 = num.shrn(1);
    if (simpleSieve(n2) && simpleSieve(num) &&
      fermatTest(n2) && fermatTest(num) &&
      millerRabin.test(n2) && millerRabin.test(num)) {
      return num;
    }
  }

}


/***/ }),
/* 165 */
/***/ (function(module, exports, __webpack_require__) {

var bn = __webpack_require__(13);
var brorand = __webpack_require__(166);

function MillerRabin(rand) {
  this.rand = rand || new brorand.Rand();
}
module.exports = MillerRabin;

MillerRabin.create = function create(rand) {
  return new MillerRabin(rand);
};

MillerRabin.prototype._randbelow = function _randbelow(n) {
  var len = n.bitLength();
  var min_bytes = Math.ceil(len / 8);

  // Generage random bytes until a number less than n is found.
  // This ensures that 0..n-1 have an equal probability of being selected.
  do
    var a = new bn(this.rand.generate(min_bytes));
  while (a.cmp(n) >= 0);

  return a;
};

MillerRabin.prototype._randrange = function _randrange(start, stop) {
  // Generate a random number greater than or equal to start and less than stop.
  var size = stop.sub(start);
  return start.add(this._randbelow(size));
};

MillerRabin.prototype.test = function test(n, k, cb) {
  var len = n.bitLength();
  var red = bn.mont(n);
  var rone = new bn(1).toRed(red);

  if (!k)
    k = Math.max(1, (len / 48) | 0);

  // Find d and s, (n - 1) = (2 ^ s) * d;
  var n1 = n.subn(1);
  for (var s = 0; !n1.testn(s); s++) {}
  var d = n.shrn(s);

  var rn1 = n1.toRed(red);

  var prime = true;
  for (; k > 0; k--) {
    var a = this._randrange(new bn(2), n1);
    if (cb)
      cb(a);

    var x = a.toRed(red).redPow(d);
    if (x.cmp(rone) === 0 || x.cmp(rn1) === 0)
      continue;

    for (var i = 1; i < s; i++) {
      x = x.redSqr();

      if (x.cmp(rone) === 0)
        return false;
      if (x.cmp(rn1) === 0)
        break;
    }

    if (i === s)
      return false;
  }

  return prime;
};

MillerRabin.prototype.getDivisor = function getDivisor(n, k) {
  var len = n.bitLength();
  var red = bn.mont(n);
  var rone = new bn(1).toRed(red);

  if (!k)
    k = Math.max(1, (len / 48) | 0);

  // Find d and s, (n - 1) = (2 ^ s) * d;
  var n1 = n.subn(1);
  for (var s = 0; !n1.testn(s); s++) {}
  var d = n.shrn(s);

  var rn1 = n1.toRed(red);

  for (; k > 0; k--) {
    var a = this._randrange(new bn(2), n1);

    var g = n.gcd(a);
    if (g.cmpn(1) !== 0)
      return g;

    var x = a.toRed(red).redPow(d);
    if (x.cmp(rone) === 0 || x.cmp(rn1) === 0)
      continue;

    for (var i = 1; i < s; i++) {
      x = x.redSqr();

      if (x.cmp(rone) === 0)
        return x.fromRed().subn(1).gcd(n);
      if (x.cmp(rn1) === 0)
        break;
    }

    if (i === s) {
      x = x.redSqr();
      return x.fromRed().subn(1).gcd(n);
    }
  }

  return false;
};


/***/ }),
/* 166 */
/***/ (function(module, exports, __webpack_require__) {

var r;

module.exports = function rand(len) {
  if (!r)
    r = new Rand(null);

  return r.generate(len);
};

function Rand(rand) {
  this.rand = rand;
}
module.exports.Rand = Rand;

Rand.prototype.generate = function generate(len) {
  return this._rand(len);
};

// Emulate crypto API using randy
Rand.prototype._rand = function _rand(n) {
  if (this.rand.getBytes)
    return this.rand.getBytes(n);

  var res = new Uint8Array(n);
  for (var i = 0; i < res.length; i++)
    res[i] = this.rand.getByte();
  return res;
};

if (typeof self === 'object') {
  if (self.crypto && self.crypto.getRandomValues) {
    // Modern browsers
    Rand.prototype._rand = function _rand(n) {
      var arr = new Uint8Array(n);
      self.crypto.getRandomValues(arr);
      return arr;
    };
  } else if (self.msCrypto && self.msCrypto.getRandomValues) {
    // IE
    Rand.prototype._rand = function _rand(n) {
      var arr = new Uint8Array(n);
      self.msCrypto.getRandomValues(arr);
      return arr;
    };

  // Safari's WebWorkers do not have `crypto`
  } else if (typeof window === 'object') {
    // Old junk
    Rand.prototype._rand = function() {
      throw new Error('Not implemented yet');
    };
  }
} else {
  // Node.js or Web worker with no crypto support
  try {
    var crypto = __webpack_require__(261);
    if (typeof crypto.randomBytes !== 'function')
      throw new Error('Not supported');

    Rand.prototype._rand = function _rand(n) {
      return crypto.randomBytes(n);
    };
  } catch (e) {
  }
}


/***/ }),
/* 167 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var utils = exports;

function toArray(msg, enc) {
  if (Array.isArray(msg))
    return msg.slice();
  if (!msg)
    return [];
  var res = [];
  if (typeof msg !== 'string') {
    for (var i = 0; i < msg.length; i++)
      res[i] = msg[i] | 0;
    return res;
  }
  if (enc === 'hex') {
    msg = msg.replace(/[^a-z0-9]+/ig, '');
    if (msg.length % 2 !== 0)
      msg = '0' + msg;
    for (var i = 0; i < msg.length; i += 2)
      res.push(parseInt(msg[i] + msg[i + 1], 16));
  } else {
    for (var i = 0; i < msg.length; i++) {
      var c = msg.charCodeAt(i);
      var hi = c >> 8;
      var lo = c & 0xff;
      if (hi)
        res.push(hi, lo);
      else
        res.push(lo);
    }
  }
  return res;
}
utils.toArray = toArray;

function zero2(word) {
  if (word.length === 1)
    return '0' + word;
  else
    return word;
}
utils.zero2 = zero2;

function toHex(msg) {
  var res = '';
  for (var i = 0; i < msg.length; i++)
    res += zero2(msg[i].toString(16));
  return res;
}
utils.toHex = toHex;

utils.encode = function encode(arr, enc) {
  if (enc === 'hex')
    return toHex(arr);
  else
    return arr;
};


/***/ }),
/* 168 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var utils = __webpack_require__(29);
var rotr32 = utils.rotr32;

function ft_1(s, x, y, z) {
  if (s === 0)
    return ch32(x, y, z);
  if (s === 1 || s === 3)
    return p32(x, y, z);
  if (s === 2)
    return maj32(x, y, z);
}
exports.ft_1 = ft_1;

function ch32(x, y, z) {
  return (x & y) ^ ((~x) & z);
}
exports.ch32 = ch32;

function maj32(x, y, z) {
  return (x & y) ^ (x & z) ^ (y & z);
}
exports.maj32 = maj32;

function p32(x, y, z) {
  return x ^ y ^ z;
}
exports.p32 = p32;

function s0_256(x) {
  return rotr32(x, 2) ^ rotr32(x, 13) ^ rotr32(x, 22);
}
exports.s0_256 = s0_256;

function s1_256(x) {
  return rotr32(x, 6) ^ rotr32(x, 11) ^ rotr32(x, 25);
}
exports.s1_256 = s1_256;

function g0_256(x) {
  return rotr32(x, 7) ^ rotr32(x, 18) ^ (x >>> 3);
}
exports.g0_256 = g0_256;

function g1_256(x) {
  return rotr32(x, 17) ^ rotr32(x, 19) ^ (x >>> 10);
}
exports.g1_256 = g1_256;


/***/ }),
/* 169 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var utils = __webpack_require__(29);
var common = __webpack_require__(70);
var shaCommon = __webpack_require__(168);
var assert = __webpack_require__(22);

var sum32 = utils.sum32;
var sum32_4 = utils.sum32_4;
var sum32_5 = utils.sum32_5;
var ch32 = shaCommon.ch32;
var maj32 = shaCommon.maj32;
var s0_256 = shaCommon.s0_256;
var s1_256 = shaCommon.s1_256;
var g0_256 = shaCommon.g0_256;
var g1_256 = shaCommon.g1_256;

var BlockHash = common.BlockHash;

var sha256_K = [
  0x428a2f98, 0x71374491, 0xb5c0fbcf, 0xe9b5dba5,
  0x3956c25b, 0x59f111f1, 0x923f82a4, 0xab1c5ed5,
  0xd807aa98, 0x12835b01, 0x243185be, 0x550c7dc3,
  0x72be5d74, 0x80deb1fe, 0x9bdc06a7, 0xc19bf174,
  0xe49b69c1, 0xefbe4786, 0x0fc19dc6, 0x240ca1cc,
  0x2de92c6f, 0x4a7484aa, 0x5cb0a9dc, 0x76f988da,
  0x983e5152, 0xa831c66d, 0xb00327c8, 0xbf597fc7,
  0xc6e00bf3, 0xd5a79147, 0x06ca6351, 0x14292967,
  0x27b70a85, 0x2e1b2138, 0x4d2c6dfc, 0x53380d13,
  0x650a7354, 0x766a0abb, 0x81c2c92e, 0x92722c85,
  0xa2bfe8a1, 0xa81a664b, 0xc24b8b70, 0xc76c51a3,
  0xd192e819, 0xd6990624, 0xf40e3585, 0x106aa070,
  0x19a4c116, 0x1e376c08, 0x2748774c, 0x34b0bcb5,
  0x391c0cb3, 0x4ed8aa4a, 0x5b9cca4f, 0x682e6ff3,
  0x748f82ee, 0x78a5636f, 0x84c87814, 0x8cc70208,
  0x90befffa, 0xa4506ceb, 0xbef9a3f7, 0xc67178f2
];

function SHA256() {
  if (!(this instanceof SHA256))
    return new SHA256();

  BlockHash.call(this);
  this.h = [
    0x6a09e667, 0xbb67ae85, 0x3c6ef372, 0xa54ff53a,
    0x510e527f, 0x9b05688c, 0x1f83d9ab, 0x5be0cd19
  ];
  this.k = sha256_K;
  this.W = new Array(64);
}
utils.inherits(SHA256, BlockHash);
module.exports = SHA256;

SHA256.blockSize = 512;
SHA256.outSize = 256;
SHA256.hmacStrength = 192;
SHA256.padLength = 64;

SHA256.prototype._update = function _update(msg, start) {
  var W = this.W;

  for (var i = 0; i < 16; i++)
    W[i] = msg[start + i];
  for (; i < W.length; i++)
    W[i] = sum32_4(g1_256(W[i - 2]), W[i - 7], g0_256(W[i - 15]), W[i - 16]);

  var a = this.h[0];
  var b = this.h[1];
  var c = this.h[2];
  var d = this.h[3];
  var e = this.h[4];
  var f = this.h[5];
  var g = this.h[6];
  var h = this.h[7];

  assert(this.k.length === W.length);
  for (i = 0; i < W.length; i++) {
    var T1 = sum32_5(h, s1_256(e), ch32(e, f, g), this.k[i], W[i]);
    var T2 = sum32(s0_256(a), maj32(a, b, c));
    h = g;
    g = f;
    f = e;
    e = sum32(d, T1);
    d = c;
    c = b;
    b = a;
    a = sum32(T1, T2);
  }

  this.h[0] = sum32(this.h[0], a);
  this.h[1] = sum32(this.h[1], b);
  this.h[2] = sum32(this.h[2], c);
  this.h[3] = sum32(this.h[3], d);
  this.h[4] = sum32(this.h[4], e);
  this.h[5] = sum32(this.h[5], f);
  this.h[6] = sum32(this.h[6], g);
  this.h[7] = sum32(this.h[7], h);
};

SHA256.prototype._digest = function digest(enc) {
  if (enc === 'hex')
    return utils.toHex32(this.h, 'big');
  else
    return utils.split32(this.h, 'big');
};


/***/ }),
/* 170 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var utils = __webpack_require__(29);
var common = __webpack_require__(70);
var assert = __webpack_require__(22);

var rotr64_hi = utils.rotr64_hi;
var rotr64_lo = utils.rotr64_lo;
var shr64_hi = utils.shr64_hi;
var shr64_lo = utils.shr64_lo;
var sum64 = utils.sum64;
var sum64_hi = utils.sum64_hi;
var sum64_lo = utils.sum64_lo;
var sum64_4_hi = utils.sum64_4_hi;
var sum64_4_lo = utils.sum64_4_lo;
var sum64_5_hi = utils.sum64_5_hi;
var sum64_5_lo = utils.sum64_5_lo;

var BlockHash = common.BlockHash;

var sha512_K = [
  0x428a2f98, 0xd728ae22, 0x71374491, 0x23ef65cd,
  0xb5c0fbcf, 0xec4d3b2f, 0xe9b5dba5, 0x8189dbbc,
  0x3956c25b, 0xf348b538, 0x59f111f1, 0xb605d019,
  0x923f82a4, 0xaf194f9b, 0xab1c5ed5, 0xda6d8118,
  0xd807aa98, 0xa3030242, 0x12835b01, 0x45706fbe,
  0x243185be, 0x4ee4b28c, 0x550c7dc3, 0xd5ffb4e2,
  0x72be5d74, 0xf27b896f, 0x80deb1fe, 0x3b1696b1,
  0x9bdc06a7, 0x25c71235, 0xc19bf174, 0xcf692694,
  0xe49b69c1, 0x9ef14ad2, 0xefbe4786, 0x384f25e3,
  0x0fc19dc6, 0x8b8cd5b5, 0x240ca1cc, 0x77ac9c65,
  0x2de92c6f, 0x592b0275, 0x4a7484aa, 0x6ea6e483,
  0x5cb0a9dc, 0xbd41fbd4, 0x76f988da, 0x831153b5,
  0x983e5152, 0xee66dfab, 0xa831c66d, 0x2db43210,
  0xb00327c8, 0x98fb213f, 0xbf597fc7, 0xbeef0ee4,
  0xc6e00bf3, 0x3da88fc2, 0xd5a79147, 0x930aa725,
  0x06ca6351, 0xe003826f, 0x14292967, 0x0a0e6e70,
  0x27b70a85, 0x46d22ffc, 0x2e1b2138, 0x5c26c926,
  0x4d2c6dfc, 0x5ac42aed, 0x53380d13, 0x9d95b3df,
  0x650a7354, 0x8baf63de, 0x766a0abb, 0x3c77b2a8,
  0x81c2c92e, 0x47edaee6, 0x92722c85, 0x1482353b,
  0xa2bfe8a1, 0x4cf10364, 0xa81a664b, 0xbc423001,
  0xc24b8b70, 0xd0f89791, 0xc76c51a3, 0x0654be30,
  0xd192e819, 0xd6ef5218, 0xd6990624, 0x5565a910,
  0xf40e3585, 0x5771202a, 0x106aa070, 0x32bbd1b8,
  0x19a4c116, 0xb8d2d0c8, 0x1e376c08, 0x5141ab53,
  0x2748774c, 0xdf8eeb99, 0x34b0bcb5, 0xe19b48a8,
  0x391c0cb3, 0xc5c95a63, 0x4ed8aa4a, 0xe3418acb,
  0x5b9cca4f, 0x7763e373, 0x682e6ff3, 0xd6b2b8a3,
  0x748f82ee, 0x5defb2fc, 0x78a5636f, 0x43172f60,
  0x84c87814, 0xa1f0ab72, 0x8cc70208, 0x1a6439ec,
  0x90befffa, 0x23631e28, 0xa4506ceb, 0xde82bde9,
  0xbef9a3f7, 0xb2c67915, 0xc67178f2, 0xe372532b,
  0xca273ece, 0xea26619c, 0xd186b8c7, 0x21c0c207,
  0xeada7dd6, 0xcde0eb1e, 0xf57d4f7f, 0xee6ed178,
  0x06f067aa, 0x72176fba, 0x0a637dc5, 0xa2c898a6,
  0x113f9804, 0xbef90dae, 0x1b710b35, 0x131c471b,
  0x28db77f5, 0x23047d84, 0x32caab7b, 0x40c72493,
  0x3c9ebe0a, 0x15c9bebc, 0x431d67c4, 0x9c100d4c,
  0x4cc5d4be, 0xcb3e42b6, 0x597f299c, 0xfc657e2a,
  0x5fcb6fab, 0x3ad6faec, 0x6c44198c, 0x4a475817
];

function SHA512() {
  if (!(this instanceof SHA512))
    return new SHA512();

  BlockHash.call(this);
  this.h = [
    0x6a09e667, 0xf3bcc908,
    0xbb67ae85, 0x84caa73b,
    0x3c6ef372, 0xfe94f82b,
    0xa54ff53a, 0x5f1d36f1,
    0x510e527f, 0xade682d1,
    0x9b05688c, 0x2b3e6c1f,
    0x1f83d9ab, 0xfb41bd6b,
    0x5be0cd19, 0x137e2179 ];
  this.k = sha512_K;
  this.W = new Array(160);
}
utils.inherits(SHA512, BlockHash);
module.exports = SHA512;

SHA512.blockSize = 1024;
SHA512.outSize = 512;
SHA512.hmacStrength = 192;
SHA512.padLength = 128;

SHA512.prototype._prepareBlock = function _prepareBlock(msg, start) {
  var W = this.W;

  // 32 x 32bit words
  for (var i = 0; i < 32; i++)
    W[i] = msg[start + i];
  for (; i < W.length; i += 2) {
    var c0_hi = g1_512_hi(W[i - 4], W[i - 3]);  // i - 2
    var c0_lo = g1_512_lo(W[i - 4], W[i - 3]);
    var c1_hi = W[i - 14];  // i - 7
    var c1_lo = W[i - 13];
    var c2_hi = g0_512_hi(W[i - 30], W[i - 29]);  // i - 15
    var c2_lo = g0_512_lo(W[i - 30], W[i - 29]);
    var c3_hi = W[i - 32];  // i - 16
    var c3_lo = W[i - 31];

    W[i] = sum64_4_hi(
      c0_hi, c0_lo,
      c1_hi, c1_lo,
      c2_hi, c2_lo,
      c3_hi, c3_lo);
    W[i + 1] = sum64_4_lo(
      c0_hi, c0_lo,
      c1_hi, c1_lo,
      c2_hi, c2_lo,
      c3_hi, c3_lo);
  }
};

SHA512.prototype._update = function _update(msg, start) {
  this._prepareBlock(msg, start);

  var W = this.W;

  var ah = this.h[0];
  var al = this.h[1];
  var bh = this.h[2];
  var bl = this.h[3];
  var ch = this.h[4];
  var cl = this.h[5];
  var dh = this.h[6];
  var dl = this.h[7];
  var eh = this.h[8];
  var el = this.h[9];
  var fh = this.h[10];
  var fl = this.h[11];
  var gh = this.h[12];
  var gl = this.h[13];
  var hh = this.h[14];
  var hl = this.h[15];

  assert(this.k.length === W.length);
  for (var i = 0; i < W.length; i += 2) {
    var c0_hi = hh;
    var c0_lo = hl;
    var c1_hi = s1_512_hi(eh, el);
    var c1_lo = s1_512_lo(eh, el);
    var c2_hi = ch64_hi(eh, el, fh, fl, gh, gl);
    var c2_lo = ch64_lo(eh, el, fh, fl, gh, gl);
    var c3_hi = this.k[i];
    var c3_lo = this.k[i + 1];
    var c4_hi = W[i];
    var c4_lo = W[i + 1];

    var T1_hi = sum64_5_hi(
      c0_hi, c0_lo,
      c1_hi, c1_lo,
      c2_hi, c2_lo,
      c3_hi, c3_lo,
      c4_hi, c4_lo);
    var T1_lo = sum64_5_lo(
      c0_hi, c0_lo,
      c1_hi, c1_lo,
      c2_hi, c2_lo,
      c3_hi, c3_lo,
      c4_hi, c4_lo);

    c0_hi = s0_512_hi(ah, al);
    c0_lo = s0_512_lo(ah, al);
    c1_hi = maj64_hi(ah, al, bh, bl, ch, cl);
    c1_lo = maj64_lo(ah, al, bh, bl, ch, cl);

    var T2_hi = sum64_hi(c0_hi, c0_lo, c1_hi, c1_lo);
    var T2_lo = sum64_lo(c0_hi, c0_lo, c1_hi, c1_lo);

    hh = gh;
    hl = gl;

    gh = fh;
    gl = fl;

    fh = eh;
    fl = el;

    eh = sum64_hi(dh, dl, T1_hi, T1_lo);
    el = sum64_lo(dl, dl, T1_hi, T1_lo);

    dh = ch;
    dl = cl;

    ch = bh;
    cl = bl;

    bh = ah;
    bl = al;

    ah = sum64_hi(T1_hi, T1_lo, T2_hi, T2_lo);
    al = sum64_lo(T1_hi, T1_lo, T2_hi, T2_lo);
  }

  sum64(this.h, 0, ah, al);
  sum64(this.h, 2, bh, bl);
  sum64(this.h, 4, ch, cl);
  sum64(this.h, 6, dh, dl);
  sum64(this.h, 8, eh, el);
  sum64(this.h, 10, fh, fl);
  sum64(this.h, 12, gh, gl);
  sum64(this.h, 14, hh, hl);
};

SHA512.prototype._digest = function digest(enc) {
  if (enc === 'hex')
    return utils.toHex32(this.h, 'big');
  else
    return utils.split32(this.h, 'big');
};

function ch64_hi(xh, xl, yh, yl, zh) {
  var r = (xh & yh) ^ ((~xh) & zh);
  if (r < 0)
    r += 0x100000000;
  return r;
}

function ch64_lo(xh, xl, yh, yl, zh, zl) {
  var r = (xl & yl) ^ ((~xl) & zl);
  if (r < 0)
    r += 0x100000000;
  return r;
}

function maj64_hi(xh, xl, yh, yl, zh) {
  var r = (xh & yh) ^ (xh & zh) ^ (yh & zh);
  if (r < 0)
    r += 0x100000000;
  return r;
}

function maj64_lo(xh, xl, yh, yl, zh, zl) {
  var r = (xl & yl) ^ (xl & zl) ^ (yl & zl);
  if (r < 0)
    r += 0x100000000;
  return r;
}

function s0_512_hi(xh, xl) {
  var c0_hi = rotr64_hi(xh, xl, 28);
  var c1_hi = rotr64_hi(xl, xh, 2);  // 34
  var c2_hi = rotr64_hi(xl, xh, 7);  // 39

  var r = c0_hi ^ c1_hi ^ c2_hi;
  if (r < 0)
    r += 0x100000000;
  return r;
}

function s0_512_lo(xh, xl) {
  var c0_lo = rotr64_lo(xh, xl, 28);
  var c1_lo = rotr64_lo(xl, xh, 2);  // 34
  var c2_lo = rotr64_lo(xl, xh, 7);  // 39

  var r = c0_lo ^ c1_lo ^ c2_lo;
  if (r < 0)
    r += 0x100000000;
  return r;
}

function s1_512_hi(xh, xl) {
  var c0_hi = rotr64_hi(xh, xl, 14);
  var c1_hi = rotr64_hi(xh, xl, 18);
  var c2_hi = rotr64_hi(xl, xh, 9);  // 41

  var r = c0_hi ^ c1_hi ^ c2_hi;
  if (r < 0)
    r += 0x100000000;
  return r;
}

function s1_512_lo(xh, xl) {
  var c0_lo = rotr64_lo(xh, xl, 14);
  var c1_lo = rotr64_lo(xh, xl, 18);
  var c2_lo = rotr64_lo(xl, xh, 9);  // 41

  var r = c0_lo ^ c1_lo ^ c2_lo;
  if (r < 0)
    r += 0x100000000;
  return r;
}

function g0_512_hi(xh, xl) {
  var c0_hi = rotr64_hi(xh, xl, 1);
  var c1_hi = rotr64_hi(xh, xl, 8);
  var c2_hi = shr64_hi(xh, xl, 7);

  var r = c0_hi ^ c1_hi ^ c2_hi;
  if (r < 0)
    r += 0x100000000;
  return r;
}

function g0_512_lo(xh, xl) {
  var c0_lo = rotr64_lo(xh, xl, 1);
  var c1_lo = rotr64_lo(xh, xl, 8);
  var c2_lo = shr64_lo(xh, xl, 7);

  var r = c0_lo ^ c1_lo ^ c2_lo;
  if (r < 0)
    r += 0x100000000;
  return r;
}

function g1_512_hi(xh, xl) {
  var c0_hi = rotr64_hi(xh, xl, 19);
  var c1_hi = rotr64_hi(xl, xh, 29);  // 61
  var c2_hi = shr64_hi(xh, xl, 6);

  var r = c0_hi ^ c1_hi ^ c2_hi;
  if (r < 0)
    r += 0x100000000;
  return r;
}

function g1_512_lo(xh, xl) {
  var c0_lo = rotr64_lo(xh, xl, 19);
  var c1_lo = rotr64_lo(xl, xh, 29);  // 61
  var c2_lo = shr64_lo(xh, xl, 6);

  var r = c0_lo ^ c1_lo ^ c2_lo;
  if (r < 0)
    r += 0x100000000;
  return r;
}


/***/ }),
/* 171 */
/***/ (function(module, exports, __webpack_require__) {

var inherits = __webpack_require__(1);
var Reporter = __webpack_require__(72).Reporter;
var Buffer = __webpack_require__(6).Buffer;

function DecoderBuffer(base, options) {
  Reporter.call(this, options);
  if (!Buffer.isBuffer(base)) {
    this.error('Input not Buffer');
    return;
  }

  this.base = base;
  this.offset = 0;
  this.length = base.length;
}
inherits(DecoderBuffer, Reporter);
exports.DecoderBuffer = DecoderBuffer;

DecoderBuffer.prototype.save = function save() {
  return { offset: this.offset, reporter: Reporter.prototype.save.call(this) };
};

DecoderBuffer.prototype.restore = function restore(save) {
  // Return skipped data
  var res = new DecoderBuffer(this.base);
  res.offset = save.offset;
  res.length = this.offset;

  this.offset = save.offset;
  Reporter.prototype.restore.call(this, save.reporter);

  return res;
};

DecoderBuffer.prototype.isEmpty = function isEmpty() {
  return this.offset === this.length;
};

DecoderBuffer.prototype.readUInt8 = function readUInt8(fail) {
  if (this.offset + 1 <= this.length)
    return this.base.readUInt8(this.offset++, true);
  else
    return this.error(fail || 'DecoderBuffer overrun');
}

DecoderBuffer.prototype.skip = function skip(bytes, fail) {
  if (!(this.offset + bytes <= this.length))
    return this.error(fail || 'DecoderBuffer overrun');

  var res = new DecoderBuffer(this.base);

  // Share reporter state
  res._reporterState = this._reporterState;

  res.offset = this.offset;
  res.length = this.offset + bytes;
  this.offset += bytes;
  return res;
}

DecoderBuffer.prototype.raw = function raw(save) {
  return this.base.slice(save ? save.offset : this.offset, this.length);
}

function EncoderBuffer(value, reporter) {
  if (Array.isArray(value)) {
    this.length = 0;
    this.value = value.map(function(item) {
      if (!(item instanceof EncoderBuffer))
        item = new EncoderBuffer(item, reporter);
      this.length += item.length;
      return item;
    }, this);
  } else if (typeof value === 'number') {
    if (!(0 <= value && value <= 0xff))
      return reporter.error('non-byte EncoderBuffer value');
    this.value = value;
    this.length = 1;
  } else if (typeof value === 'string') {
    this.value = value;
    this.length = Buffer.byteLength(value);
  } else if (Buffer.isBuffer(value)) {
    this.value = value;
    this.length = value.length;
  } else {
    return reporter.error('Unsupported type: ' + typeof value);
  }
}
exports.EncoderBuffer = EncoderBuffer;

EncoderBuffer.prototype.join = function join(out, offset) {
  if (!out)
    out = new Buffer(this.length);
  if (!offset)
    offset = 0;

  if (this.length === 0)
    return out;

  if (Array.isArray(this.value)) {
    this.value.forEach(function(item) {
      item.join(out, offset);
      offset += item.length;
    });
  } else {
    if (typeof this.value === 'number')
      out[offset] = this.value;
    else if (typeof this.value === 'string')
      out.write(this.value, offset);
    else if (Buffer.isBuffer(this.value))
      this.value.copy(out, offset);
    offset += this.length;
  }

  return out;
};


/***/ }),
/* 172 */
/***/ (function(module, exports, __webpack_require__) {

var constants = exports;

// Helper
constants._reverse = function reverse(map) {
  var res = {};

  Object.keys(map).forEach(function(key) {
    // Convert key to integer if it is stringified
    if ((key | 0) == key)
      key = key | 0;

    var value = map[key];
    res[value] = key;
  });

  return res;
};

constants.der = __webpack_require__(293);


/***/ }),
/* 173 */
/***/ (function(module, exports, __webpack_require__) {

var inherits = __webpack_require__(1);

var asn1 = __webpack_require__(71);
var base = asn1.base;
var bignum = asn1.bignum;

// Import DER constants
var der = asn1.constants.der;

function DERDecoder(entity) {
  this.enc = 'der';
  this.name = entity.name;
  this.entity = entity;

  // Construct base tree
  this.tree = new DERNode();
  this.tree._init(entity.body);
};
module.exports = DERDecoder;

DERDecoder.prototype.decode = function decode(data, options) {
  if (!(data instanceof base.DecoderBuffer))
    data = new base.DecoderBuffer(data, options);

  return this.tree._decode(data, options);
};

// Tree methods

function DERNode(parent) {
  base.Node.call(this, 'der', parent);
}
inherits(DERNode, base.Node);

DERNode.prototype._peekTag = function peekTag(buffer, tag, any) {
  if (buffer.isEmpty())
    return false;

  var state = buffer.save();
  var decodedTag = derDecodeTag(buffer, 'Failed to peek tag: "' + tag + '"');
  if (buffer.isError(decodedTag))
    return decodedTag;

  buffer.restore(state);

  return decodedTag.tag === tag || decodedTag.tagStr === tag ||
    (decodedTag.tagStr + 'of') === tag || any;
};

DERNode.prototype._decodeTag = function decodeTag(buffer, tag, any) {
  var decodedTag = derDecodeTag(buffer,
                                'Failed to decode tag of "' + tag + '"');
  if (buffer.isError(decodedTag))
    return decodedTag;

  var len = derDecodeLen(buffer,
                         decodedTag.primitive,
                         'Failed to get length of "' + tag + '"');

  // Failure
  if (buffer.isError(len))
    return len;

  if (!any &&
      decodedTag.tag !== tag &&
      decodedTag.tagStr !== tag &&
      decodedTag.tagStr + 'of' !== tag) {
    return buffer.error('Failed to match tag: "' + tag + '"');
  }

  if (decodedTag.primitive || len !== null)
    return buffer.skip(len, 'Failed to match body of: "' + tag + '"');

  // Indefinite length... find END tag
  var state = buffer.save();
  var res = this._skipUntilEnd(
      buffer,
      'Failed to skip indefinite length body: "' + this.tag + '"');
  if (buffer.isError(res))
    return res;

  len = buffer.offset - state.offset;
  buffer.restore(state);
  return buffer.skip(len, 'Failed to match body of: "' + tag + '"');
};

DERNode.prototype._skipUntilEnd = function skipUntilEnd(buffer, fail) {
  while (true) {
    var tag = derDecodeTag(buffer, fail);
    if (buffer.isError(tag))
      return tag;
    var len = derDecodeLen(buffer, tag.primitive, fail);
    if (buffer.isError(len))
      return len;

    var res;
    if (tag.primitive || len !== null)
      res = buffer.skip(len)
    else
      res = this._skipUntilEnd(buffer, fail);

    // Failure
    if (buffer.isError(res))
      return res;

    if (tag.tagStr === 'end')
      break;
  }
};

DERNode.prototype._decodeList = function decodeList(buffer, tag, decoder,
                                                    options) {
  var result = [];
  while (!buffer.isEmpty()) {
    var possibleEnd = this._peekTag(buffer, 'end');
    if (buffer.isError(possibleEnd))
      return possibleEnd;

    var res = decoder.decode(buffer, 'der', options);
    if (buffer.isError(res) && possibleEnd)
      break;
    result.push(res);
  }
  return result;
};

DERNode.prototype._decodeStr = function decodeStr(buffer, tag) {
  if (tag === 'bitstr') {
    var unused = buffer.readUInt8();
    if (buffer.isError(unused))
      return unused;
    return { unused: unused, data: buffer.raw() };
  } else if (tag === 'bmpstr') {
    var raw = buffer.raw();
    if (raw.length % 2 === 1)
      return buffer.error('Decoding of string type: bmpstr length mismatch');

    var str = '';
    for (var i = 0; i < raw.length / 2; i++) {
      str += String.fromCharCode(raw.readUInt16BE(i * 2));
    }
    return str;
  } else if (tag === 'numstr') {
    var numstr = buffer.raw().toString('ascii');
    if (!this._isNumstr(numstr)) {
      return buffer.error('Decoding of string type: ' +
                          'numstr unsupported characters');
    }
    return numstr;
  } else if (tag === 'octstr') {
    return buffer.raw();
  } else if (tag === 'objDesc') {
    return buffer.raw();
  } else if (tag === 'printstr') {
    var printstr = buffer.raw().toString('ascii');
    if (!this._isPrintstr(printstr)) {
      return buffer.error('Decoding of string type: ' +
                          'printstr unsupported characters');
    }
    return printstr;
  } else if (/str$/.test(tag)) {
    return buffer.raw().toString();
  } else {
    return buffer.error('Decoding of string type: ' + tag + ' unsupported');
  }
};

DERNode.prototype._decodeObjid = function decodeObjid(buffer, values, relative) {
  var result;
  var identifiers = [];
  var ident = 0;
  while (!buffer.isEmpty()) {
    var subident = buffer.readUInt8();
    ident <<= 7;
    ident |= subident & 0x7f;
    if ((subident & 0x80) === 0) {
      identifiers.push(ident);
      ident = 0;
    }
  }
  if (subident & 0x80)
    identifiers.push(ident);

  var first = (identifiers[0] / 40) | 0;
  var second = identifiers[0] % 40;

  if (relative)
    result = identifiers;
  else
    result = [first, second].concat(identifiers.slice(1));

  if (values) {
    var tmp = values[result.join(' ')];
    if (tmp === undefined)
      tmp = values[result.join('.')];
    if (tmp !== undefined)
      result = tmp;
  }

  return result;
};

DERNode.prototype._decodeTime = function decodeTime(buffer, tag) {
  var str = buffer.raw().toString();
  if (tag === 'gentime') {
    var year = str.slice(0, 4) | 0;
    var mon = str.slice(4, 6) | 0;
    var day = str.slice(6, 8) | 0;
    var hour = str.slice(8, 10) | 0;
    var min = str.slice(10, 12) | 0;
    var sec = str.slice(12, 14) | 0;
  } else if (tag === 'utctime') {
    var year = str.slice(0, 2) | 0;
    var mon = str.slice(2, 4) | 0;
    var day = str.slice(4, 6) | 0;
    var hour = str.slice(6, 8) | 0;
    var min = str.slice(8, 10) | 0;
    var sec = str.slice(10, 12) | 0;
    if (year < 70)
      year = 2000 + year;
    else
      year = 1900 + year;
  } else {
    return buffer.error('Decoding ' + tag + ' time is not supported yet');
  }

  return Date.UTC(year, mon - 1, day, hour, min, sec, 0);
};

DERNode.prototype._decodeNull = function decodeNull(buffer) {
  return null;
};

DERNode.prototype._decodeBool = function decodeBool(buffer) {
  var res = buffer.readUInt8();
  if (buffer.isError(res))
    return res;
  else
    return res !== 0;
};

DERNode.prototype._decodeInt = function decodeInt(buffer, values) {
  // Bigint, return as it is (assume big endian)
  var raw = buffer.raw();
  var res = new bignum(raw);

  if (values)
    res = values[res.toString(10)] || res;

  return res;
};

DERNode.prototype._use = function use(entity, obj) {
  if (typeof entity === 'function')
    entity = entity(obj);
  return entity._getDecoder('der').tree;
};

// Utility methods

function derDecodeTag(buf, fail) {
  var tag = buf.readUInt8(fail);
  if (buf.isError(tag))
    return tag;

  var cls = der.tagClass[tag >> 6];
  var primitive = (tag & 0x20) === 0;

  // Multi-octet tag - load
  if ((tag & 0x1f) === 0x1f) {
    var oct = tag;
    tag = 0;
    while ((oct & 0x80) === 0x80) {
      oct = buf.readUInt8(fail);
      if (buf.isError(oct))
        return oct;

      tag <<= 7;
      tag |= oct & 0x7f;
    }
  } else {
    tag &= 0x1f;
  }
  var tagStr = der.tag[tag];

  return {
    cls: cls,
    primitive: primitive,
    tag: tag,
    tagStr: tagStr
  };
}

function derDecodeLen(buf, primitive, fail) {
  var len = buf.readUInt8(fail);
  if (buf.isError(len))
    return len;

  // Indefinite form
  if (!primitive && len === 0x80)
    return null;

  // Definite form
  if ((len & 0x80) === 0) {
    // Short form
    return len;
  }

  // Long form
  var num = len & 0x7f;
  if (num > 4)
    return buf.error('length octect is too long');

  len = 0;
  for (var i = 0; i < num; i++) {
    len <<= 8;
    var j = buf.readUInt8(fail);
    if (buf.isError(j))
      return j;
    len |= j;
  }

  return len;
}


/***/ }),
/* 174 */
/***/ (function(module, exports, __webpack_require__) {

var inherits = __webpack_require__(1);
var Buffer = __webpack_require__(6).Buffer;

var asn1 = __webpack_require__(71);
var base = asn1.base;

// Import DER constants
var der = asn1.constants.der;

function DEREncoder(entity) {
  this.enc = 'der';
  this.name = entity.name;
  this.entity = entity;

  // Construct base tree
  this.tree = new DERNode();
  this.tree._init(entity.body);
};
module.exports = DEREncoder;

DEREncoder.prototype.encode = function encode(data, reporter) {
  return this.tree._encode(data, reporter).join();
};

// Tree methods

function DERNode(parent) {
  base.Node.call(this, 'der', parent);
}
inherits(DERNode, base.Node);

DERNode.prototype._encodeComposite = function encodeComposite(tag,
                                                              primitive,
                                                              cls,
                                                              content) {
  var encodedTag = encodeTag(tag, primitive, cls, this.reporter);

  // Short form
  if (content.length < 0x80) {
    var header = new Buffer(2);
    header[0] = encodedTag;
    header[1] = content.length;
    return this._createEncoderBuffer([ header, content ]);
  }

  // Long form
  // Count octets required to store length
  var lenOctets = 1;
  for (var i = content.length; i >= 0x100; i >>= 8)
    lenOctets++;

  var header = new Buffer(1 + 1 + lenOctets);
  header[0] = encodedTag;
  header[1] = 0x80 | lenOctets;

  for (var i = 1 + lenOctets, j = content.length; j > 0; i--, j >>= 8)
    header[i] = j & 0xff;

  return this._createEncoderBuffer([ header, content ]);
};

DERNode.prototype._encodeStr = function encodeStr(str, tag) {
  if (tag === 'bitstr') {
    return this._createEncoderBuffer([ str.unused | 0, str.data ]);
  } else if (tag === 'bmpstr') {
    var buf = new Buffer(str.length * 2);
    for (var i = 0; i < str.length; i++) {
      buf.writeUInt16BE(str.charCodeAt(i), i * 2);
    }
    return this._createEncoderBuffer(buf);
  } else if (tag === 'numstr') {
    if (!this._isNumstr(str)) {
      return this.reporter.error('Encoding of string type: numstr supports ' +
                                 'only digits and space');
    }
    return this._createEncoderBuffer(str);
  } else if (tag === 'printstr') {
    if (!this._isPrintstr(str)) {
      return this.reporter.error('Encoding of string type: printstr supports ' +
                                 'only latin upper and lower case letters, ' +
                                 'digits, space, apostrophe, left and rigth ' +
                                 'parenthesis, plus sign, comma, hyphen, ' +
                                 'dot, slash, colon, equal sign, ' +
                                 'question mark');
    }
    return this._createEncoderBuffer(str);
  } else if (/str$/.test(tag)) {
    return this._createEncoderBuffer(str);
  } else if (tag === 'objDesc') {
    return this._createEncoderBuffer(str);
  } else {
    return this.reporter.error('Encoding of string type: ' + tag +
                               ' unsupported');
  }
};

DERNode.prototype._encodeObjid = function encodeObjid(id, values, relative) {
  if (typeof id === 'string') {
    if (!values)
      return this.reporter.error('string objid given, but no values map found');
    if (!values.hasOwnProperty(id))
      return this.reporter.error('objid not found in values map');
    id = values[id].split(/[\s\.]+/g);
    for (var i = 0; i < id.length; i++)
      id[i] |= 0;
  } else if (Array.isArray(id)) {
    id = id.slice();
    for (var i = 0; i < id.length; i++)
      id[i] |= 0;
  }

  if (!Array.isArray(id)) {
    return this.reporter.error('objid() should be either array or string, ' +
                               'got: ' + JSON.stringify(id));
  }

  if (!relative) {
    if (id[1] >= 40)
      return this.reporter.error('Second objid identifier OOB');
    id.splice(0, 2, id[0] * 40 + id[1]);
  }

  // Count number of octets
  var size = 0;
  for (var i = 0; i < id.length; i++) {
    var ident = id[i];
    for (size++; ident >= 0x80; ident >>= 7)
      size++;
  }

  var objid = new Buffer(size);
  var offset = objid.length - 1;
  for (var i = id.length - 1; i >= 0; i--) {
    var ident = id[i];
    objid[offset--] = ident & 0x7f;
    while ((ident >>= 7) > 0)
      objid[offset--] = 0x80 | (ident & 0x7f);
  }

  return this._createEncoderBuffer(objid);
};

function two(num) {
  if (num < 10)
    return '0' + num;
  else
    return num;
}

DERNode.prototype._encodeTime = function encodeTime(time, tag) {
  var str;
  var date = new Date(time);

  if (tag === 'gentime') {
    str = [
      two(date.getFullYear()),
      two(date.getUTCMonth() + 1),
      two(date.getUTCDate()),
      two(date.getUTCHours()),
      two(date.getUTCMinutes()),
      two(date.getUTCSeconds()),
      'Z'
    ].join('');
  } else if (tag === 'utctime') {
    str = [
      two(date.getFullYear() % 100),
      two(date.getUTCMonth() + 1),
      two(date.getUTCDate()),
      two(date.getUTCHours()),
      two(date.getUTCMinutes()),
      two(date.getUTCSeconds()),
      'Z'
    ].join('');
  } else {
    this.reporter.error('Encoding ' + tag + ' time is not supported yet');
  }

  return this._encodeStr(str, 'octstr');
};

DERNode.prototype._encodeNull = function encodeNull() {
  return this._createEncoderBuffer('');
};

DERNode.prototype._encodeInt = function encodeInt(num, values) {
  if (typeof num === 'string') {
    if (!values)
      return this.reporter.error('String int or enum given, but no values map');
    if (!values.hasOwnProperty(num)) {
      return this.reporter.error('Values map doesn\'t contain: ' +
                                 JSON.stringify(num));
    }
    num = values[num];
  }

  // Bignum, assume big endian
  if (typeof num !== 'number' && !Buffer.isBuffer(num)) {
    var numArray = num.toArray();
    if (!num.sign && numArray[0] & 0x80) {
      numArray.unshift(0);
    }
    num = new Buffer(numArray);
  }

  if (Buffer.isBuffer(num)) {
    var size = num.length;
    if (num.length === 0)
      size++;

    var out = new Buffer(size);
    num.copy(out);
    if (num.length === 0)
      out[0] = 0
    return this._createEncoderBuffer(out);
  }

  if (num < 0x80)
    return this._createEncoderBuffer(num);

  if (num < 0x100)
    return this._createEncoderBuffer([0, num]);

  var size = 1;
  for (var i = num; i >= 0x100; i >>= 8)
    size++;

  var out = new Array(size);
  for (var i = out.length - 1; i >= 0; i--) {
    out[i] = num & 0xff;
    num >>= 8;
  }
  if(out[0] & 0x80) {
    out.unshift(0);
  }

  return this._createEncoderBuffer(new Buffer(out));
};

DERNode.prototype._encodeBool = function encodeBool(value) {
  return this._createEncoderBuffer(value ? 0xff : 0);
};

DERNode.prototype._use = function use(entity, obj) {
  if (typeof entity === 'function')
    entity = entity(obj);
  return entity._getEncoder('der').tree;
};

DERNode.prototype._skipDefault = function skipDefault(dataBuffer, reporter, parent) {
  var state = this._baseState;
  var i;
  if (state['default'] === null)
    return false;

  var data = dataBuffer.join();
  if (state.defaultBuffer === undefined)
    state.defaultBuffer = this._encodeValue(state['default'], reporter, parent).join();

  if (data.length !== state.defaultBuffer.length)
    return false;

  for (i=0; i < data.length; i++)
    if (data[i] !== state.defaultBuffer[i])
      return false;

  return true;
};

// Utility methods

function encodeTag(tag, primitive, cls, reporter) {
  var res;

  if (tag === 'seqof')
    tag = 'seq';
  else if (tag === 'setof')
    tag = 'set';

  if (der.tagByName.hasOwnProperty(tag))
    res = der.tagByName[tag];
  else if (typeof tag === 'number' && (tag | 0) === tag)
    res = tag;
  else
    return reporter.error('Unknown tag: ' + tag);

  if (res >= 0x1f)
    return reporter.error('Multi-octet tag encoding unsupported');

  if (!primitive)
    res |= 0x20;

  res |= (der.tagClassByName[cls || 'universal'] << 6);

  return res;
}


/***/ }),
/* 175 */
/***/ (function(module, exports) {

module.exports = {"1.3.132.0.10":"secp256k1","1.3.132.0.33":"p224","1.2.840.10045.3.1.1":"p192","1.2.840.10045.3.1.7":"p256","1.3.132.0.34":"p384","1.3.132.0.35":"p521"}

/***/ }),
/* 176 */
/***/ (function(module, exports, __webpack_require__) {

/* WEBPACK VAR INJECTION */(function(Buffer) {var createHash = __webpack_require__(67);
module.exports = function (seed, len) {
  var t = new Buffer('');
  var  i = 0, c;
  while (t.length < len) {
    c = i2ops(i++);
    t = Buffer.concat([t, createHash('sha1').update(seed).update(c).digest()]);
  }
  return t.slice(0, len);
};

function i2ops(c) {
  var out = new Buffer(4);
  out.writeUInt32BE(c,0);
  return out;
}
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(6).Buffer))

/***/ }),
/* 177 */
/***/ (function(module, exports) {

module.exports = function xor(a, b) {
  var len = a.length;
  var i = -1;
  while (++i < len) {
    a[i] ^= b[i];
  }
  return a
};

/***/ }),
/* 178 */
/***/ (function(module, exports, __webpack_require__) {

/* WEBPACK VAR INJECTION */(function(Buffer) {var bn = __webpack_require__(13);
function withPublic(paddedMsg, key) {
  return new Buffer(paddedMsg
    .toRed(bn.mont(key.modulus))
    .redPow(new bn(key.publicExponent))
    .fromRed()
    .toArray());
}

module.exports = withPublic;
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(6).Buffer))

/***/ }),
/* 179 */
/***/ (function(module, exports, __webpack_require__) {

module.exports = !__webpack_require__(10) && !__webpack_require__(5)(function () {
  return Object.defineProperty(__webpack_require__(113)('div'), 'a', { get: function () { return 7; } }).a != 7;
});


/***/ }),
/* 180 */
/***/ (function(module, exports, __webpack_require__) {

exports.f = __webpack_require__(9);


/***/ }),
/* 181 */
/***/ (function(module, exports, __webpack_require__) {

var has = __webpack_require__(18);
var toIObject = __webpack_require__(23);
var arrayIndexOf = __webpack_require__(83)(false);
var IE_PROTO = __webpack_require__(115)('IE_PROTO');

module.exports = function (object, names) {
  var O = toIObject(object);
  var i = 0;
  var result = [];
  var key;
  for (key in O) if (key != IE_PROTO) has(O, key) && result.push(key);
  // Don't enum bug & hidden keys
  while (names.length > i) if (has(O, key = names[i++])) {
    ~arrayIndexOf(result, key) || result.push(key);
  }
  return result;
};


/***/ }),
/* 182 */
/***/ (function(module, exports, __webpack_require__) {

var dP = __webpack_require__(11);
var anObject = __webpack_require__(2);
var getKeys = __webpack_require__(49);

module.exports = __webpack_require__(10) ? Object.defineProperties : function defineProperties(O, Properties) {
  anObject(O);
  var keys = getKeys(Properties);
  var length = keys.length;
  var i = 0;
  var P;
  while (length > i) dP.f(O, P = keys[i++], Properties[P]);
  return O;
};


/***/ }),
/* 183 */
/***/ (function(module, exports, __webpack_require__) {

// fallback for IE11 buggy Object.getOwnPropertyNames with iframe and window
var toIObject = __webpack_require__(23);
var gOPN = __webpack_require__(52).f;
var toString = {}.toString;

var windowNames = typeof window == 'object' && window && Object.getOwnPropertyNames
  ? Object.getOwnPropertyNames(window) : [];

var getWindowNames = function (it) {
  try {
    return gOPN(it);
  } catch (e) {
    return windowNames.slice();
  }
};

module.exports.f = function getOwnPropertyNames(it) {
  return windowNames && toString.call(it) == '[object Window]' ? getWindowNames(it) : gOPN(toIObject(it));
};


/***/ }),
/* 184 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// 19.1.2.1 Object.assign(target, source, ...)
var getKeys = __webpack_require__(49);
var gOPS = __webpack_require__(84);
var pIE = __webpack_require__(74);
var toObject = __webpack_require__(14);
var IObject = __webpack_require__(73);
var $assign = Object.assign;

// should work with symbols and should have deterministic property order (V8 bug)
module.exports = !$assign || __webpack_require__(5)(function () {
  var A = {};
  var B = {};
  // eslint-disable-next-line no-undef
  var S = Symbol();
  var K = 'abcdefghijklmnopqrst';
  A[S] = 7;
  K.split('').forEach(function (k) { B[k] = k; });
  return $assign({}, A)[S] != 7 || Object.keys($assign({}, B)).join('') != K;
}) ? function assign(target, source) { // eslint-disable-line no-unused-vars
  var T = toObject(target);
  var aLen = arguments.length;
  var index = 1;
  var getSymbols = gOPS.f;
  var isEnum = pIE.f;
  while (aLen > index) {
    var S = IObject(arguments[index++]);
    var keys = getSymbols ? getKeys(S).concat(getSymbols(S)) : getKeys(S);
    var length = keys.length;
    var j = 0;
    var key;
    while (length > j) if (isEnum.call(S, key = keys[j++])) T[key] = S[key];
  } return T;
} : $assign;


/***/ }),
/* 185 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var aFunction = __webpack_require__(16);
var isObject = __webpack_require__(7);
var invoke = __webpack_require__(186);
var arraySlice = [].slice;
var factories = {};

var construct = function (F, len, args) {
  if (!(len in factories)) {
    for (var n = [], i = 0; i < len; i++) n[i] = 'a[' + i + ']';
    // eslint-disable-next-line no-new-func
    factories[len] = Function('F,a', 'return new F(' + n.join(',') + ')');
  } return factories[len](F, args);
};

module.exports = Function.bind || function bind(that /* , ...args */) {
  var fn = aFunction(this);
  var partArgs = arraySlice.call(arguments, 1);
  var bound = function (/* args... */) {
    var args = partArgs.concat(arraySlice.call(arguments));
    return this instanceof bound ? construct(fn, args.length, args) : invoke(fn, args, that);
  };
  if (isObject(fn.prototype)) bound.prototype = fn.prototype;
  return bound;
};


/***/ }),
/* 186 */
/***/ (function(module, exports) {

// fast apply, http://jsperf.lnkit.com/fast-apply/5
module.exports = function (fn, args, that) {
  var un = that === undefined;
  switch (args.length) {
    case 0: return un ? fn()
                      : fn.call(that);
    case 1: return un ? fn(args[0])
                      : fn.call(that, args[0]);
    case 2: return un ? fn(args[0], args[1])
                      : fn.call(that, args[0], args[1]);
    case 3: return un ? fn(args[0], args[1], args[2])
                      : fn.call(that, args[0], args[1], args[2]);
    case 4: return un ? fn(args[0], args[1], args[2], args[3])
                      : fn.call(that, args[0], args[1], args[2], args[3]);
  } return fn.apply(that, args);
};


/***/ }),
/* 187 */
/***/ (function(module, exports, __webpack_require__) {

var $parseInt = __webpack_require__(3).parseInt;
var $trim = __webpack_require__(60).trim;
var ws = __webpack_require__(119);
var hex = /^[-+]?0[xX]/;

module.exports = $parseInt(ws + '08') !== 8 || $parseInt(ws + '0x16') !== 22 ? function parseInt(str, radix) {
  var string = $trim(String(str), 3);
  return $parseInt(string, (radix >>> 0) || (hex.test(string) ? 16 : 10));
} : $parseInt;


/***/ }),
/* 188 */
/***/ (function(module, exports, __webpack_require__) {

var $parseFloat = __webpack_require__(3).parseFloat;
var $trim = __webpack_require__(60).trim;

module.exports = 1 / $parseFloat(__webpack_require__(119) + '-0') !== -Infinity ? function parseFloat(str) {
  var string = $trim(String(str), 3);
  var result = $parseFloat(string);
  return result === 0 && string.charAt(0) == '-' ? -0 : result;
} : $parseFloat;


/***/ }),
/* 189 */
/***/ (function(module, exports, __webpack_require__) {

var cof = __webpack_require__(27);
module.exports = function (it, msg) {
  if (typeof it != 'number' && cof(it) != 'Number') throw TypeError(msg);
  return +it;
};


/***/ }),
/* 190 */
/***/ (function(module, exports, __webpack_require__) {

// 20.1.2.3 Number.isInteger(number)
var isObject = __webpack_require__(7);
var floor = Math.floor;
module.exports = function isInteger(it) {
  return !isObject(it) && isFinite(it) && floor(it) === it;
};


/***/ }),
/* 191 */
/***/ (function(module, exports) {

// 20.2.2.20 Math.log1p(x)
module.exports = Math.log1p || function log1p(x) {
  return (x = +x) > -1e-8 && x < 1e-8 ? x - x * x / 2 : Math.log(1 + x);
};


/***/ }),
/* 192 */
/***/ (function(module, exports, __webpack_require__) {

// 20.2.2.16 Math.fround(x)
var sign = __webpack_require__(122);
var pow = Math.pow;
var EPSILON = pow(2, -52);
var EPSILON32 = pow(2, -23);
var MAX32 = pow(2, 127) * (2 - EPSILON32);
var MIN32 = pow(2, -126);

var roundTiesToEven = function (n) {
  return n + 1 / EPSILON - 1 / EPSILON;
};

module.exports = Math.fround || function fround(x) {
  var $abs = Math.abs(x);
  var $sign = sign(x);
  var a, result;
  if ($abs < MIN32) return $sign * roundTiesToEven($abs / MIN32 / EPSILON32) * MIN32 * EPSILON32;
  a = (1 + EPSILON32 / EPSILON) * $abs;
  result = a - (a - $abs);
  // eslint-disable-next-line no-self-compare
  if (result > MAX32 || result != result) return $sign * Infinity;
  return $sign * result;
};


/***/ }),
/* 193 */
/***/ (function(module, exports, __webpack_require__) {

// call something on iterator step with safe closing on error
var anObject = __webpack_require__(2);
module.exports = function (iterator, fn, value, entries) {
  try {
    return entries ? fn(anObject(value)[0], value[1]) : fn(value);
  // 7.4.6 IteratorClose(iterator, completion)
  } catch (e) {
    var ret = iterator['return'];
    if (ret !== undefined) anObject(ret.call(iterator));
    throw e;
  }
};


/***/ }),
/* 194 */
/***/ (function(module, exports, __webpack_require__) {

var aFunction = __webpack_require__(16);
var toObject = __webpack_require__(14);
var IObject = __webpack_require__(73);
var toLength = __webpack_require__(12);

module.exports = function (that, callbackfn, aLen, memo, isRight) {
  aFunction(callbackfn);
  var O = toObject(that);
  var self = IObject(O);
  var length = toLength(O.length);
  var index = isRight ? length - 1 : 0;
  var i = isRight ? -1 : 1;
  if (aLen < 2) for (;;) {
    if (index in self) {
      memo = self[index];
      index += i;
      break;
    }
    index += i;
    if (isRight ? index < 0 : length <= index) {
      throw TypeError('Reduce of empty array with no initial value');
    }
  }
  for (;isRight ? index >= 0 : length > index; index += i) if (index in self) {
    memo = callbackfn(memo, self[index], index, O);
  }
  return memo;
};


/***/ }),
/* 195 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";
// 22.1.3.3 Array.prototype.copyWithin(target, start, end = this.length)

var toObject = __webpack_require__(14);
var toAbsoluteIndex = __webpack_require__(50);
var toLength = __webpack_require__(12);

module.exports = [].copyWithin || function copyWithin(target /* = 0 */, start /* = 0, end = @length */) {
  var O = toObject(this);
  var len = toLength(O.length);
  var to = toAbsoluteIndex(target, len);
  var from = toAbsoluteIndex(start, len);
  var end = arguments.length > 2 ? arguments[2] : undefined;
  var count = Math.min((end === undefined ? len : toAbsoluteIndex(end, len)) - from, len - to);
  var inc = 1;
  if (from < to && to < from + count) {
    inc = -1;
    from += count - 1;
    to += count - 1;
  }
  while (count-- > 0) {
    if (from in O) O[to] = O[from];
    else delete O[to];
    to += inc;
    from += inc;
  } return O;
};


/***/ }),
/* 196 */
/***/ (function(module, exports) {

module.exports = function (done, value) {
  return { value: value, done: !!done };
};


/***/ }),
/* 197 */
/***/ (function(module, exports, __webpack_require__) {

// 21.2.5.3 get RegExp.prototype.flags()
if (__webpack_require__(10) && /./g.flags != 'g') __webpack_require__(11).f(RegExp.prototype, 'flags', {
  configurable: true,
  get: __webpack_require__(88)
});


/***/ }),
/* 198 */
/***/ (function(module, exports) {

module.exports = function (exec) {
  try {
    return { e: false, v: exec() };
  } catch (e) {
    return { e: true, v: e };
  }
};


/***/ }),
/* 199 */
/***/ (function(module, exports, __webpack_require__) {

var anObject = __webpack_require__(2);
var isObject = __webpack_require__(7);
var newPromiseCapability = __webpack_require__(137);

module.exports = function (C, x) {
  anObject(C);
  if (isObject(x) && x.constructor === C) return x;
  var promiseCapability = newPromiseCapability.f(C);
  var resolve = promiseCapability.resolve;
  resolve(x);
  return promiseCapability.promise;
};


/***/ }),
/* 200 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var strong = __webpack_require__(201);
var validate = __webpack_require__(62);
var MAP = 'Map';

// 23.1 Map Objects
module.exports = __webpack_require__(91)(MAP, function (get) {
  return function Map() { return get(this, arguments.length > 0 ? arguments[0] : undefined); };
}, {
  // 23.1.3.6 Map.prototype.get(key)
  get: function get(key) {
    var entry = strong.getEntry(validate(this, MAP), key);
    return entry && entry.v;
  },
  // 23.1.3.9 Map.prototype.set(key, value)
  set: function set(key, value) {
    return strong.def(validate(this, MAP), key === 0 ? 0 : key, value);
  }
}, strong, true);


/***/ }),
/* 201 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var dP = __webpack_require__(11).f;
var create = __webpack_require__(51);
var redefineAll = __webpack_require__(56);
var ctx = __webpack_require__(26);
var anInstance = __webpack_require__(54);
var forOf = __webpack_require__(55);
var $iterDefine = __webpack_require__(125);
var step = __webpack_require__(196);
var setSpecies = __webpack_require__(53);
var DESCRIPTORS = __webpack_require__(10);
var fastKey = __webpack_require__(43).fastKey;
var validate = __webpack_require__(62);
var SIZE = DESCRIPTORS ? '_s' : 'size';

var getEntry = function (that, key) {
  // fast case
  var index = fastKey(key);
  var entry;
  if (index !== 'F') return that._i[index];
  // frozen object case
  for (entry = that._f; entry; entry = entry.n) {
    if (entry.k == key) return entry;
  }
};

module.exports = {
  getConstructor: function (wrapper, NAME, IS_MAP, ADDER) {
    var C = wrapper(function (that, iterable) {
      anInstance(that, C, NAME, '_i');
      that._t = NAME;         // collection type
      that._i = create(null); // index
      that._f = undefined;    // first entry
      that._l = undefined;    // last entry
      that[SIZE] = 0;         // size
      if (iterable != undefined) forOf(iterable, IS_MAP, that[ADDER], that);
    });
    redefineAll(C.prototype, {
      // 23.1.3.1 Map.prototype.clear()
      // 23.2.3.2 Set.prototype.clear()
      clear: function clear() {
        for (var that = validate(this, NAME), data = that._i, entry = that._f; entry; entry = entry.n) {
          entry.r = true;
          if (entry.p) entry.p = entry.p.n = undefined;
          delete data[entry.i];
        }
        that._f = that._l = undefined;
        that[SIZE] = 0;
      },
      // 23.1.3.3 Map.prototype.delete(key)
      // 23.2.3.4 Set.prototype.delete(value)
      'delete': function (key) {
        var that = validate(this, NAME);
        var entry = getEntry(that, key);
        if (entry) {
          var next = entry.n;
          var prev = entry.p;
          delete that._i[entry.i];
          entry.r = true;
          if (prev) prev.n = next;
          if (next) next.p = prev;
          if (that._f == entry) that._f = next;
          if (that._l == entry) that._l = prev;
          that[SIZE]--;
        } return !!entry;
      },
      // 23.2.3.6 Set.prototype.forEach(callbackfn, thisArg = undefined)
      // 23.1.3.5 Map.prototype.forEach(callbackfn, thisArg = undefined)
      forEach: function forEach(callbackfn /* , that = undefined */) {
        validate(this, NAME);
        var f = ctx(callbackfn, arguments.length > 1 ? arguments[1] : undefined, 3);
        var entry;
        while (entry = entry ? entry.n : this._f) {
          f(entry.v, entry.k, this);
          // revert to the last existing entry
          while (entry && entry.r) entry = entry.p;
        }
      },
      // 23.1.3.7 Map.prototype.has(key)
      // 23.2.3.7 Set.prototype.has(value)
      has: function has(key) {
        return !!getEntry(validate(this, NAME), key);
      }
    });
    if (DESCRIPTORS) dP(C.prototype, 'size', {
      get: function () {
        return validate(this, NAME)[SIZE];
      }
    });
    return C;
  },
  def: function (that, key, value) {
    var entry = getEntry(that, key);
    var prev, index;
    // change existing entry
    if (entry) {
      entry.v = value;
    // create new entry
    } else {
      that._l = entry = {
        i: index = fastKey(key, true), // <- index
        k: key,                        // <- key
        v: value,                      // <- value
        p: prev = that._l,             // <- previous entry
        n: undefined,                  // <- next entry
        r: false                       // <- removed
      };
      if (!that._f) that._f = entry;
      if (prev) prev.n = entry;
      that[SIZE]++;
      // add to index
      if (index !== 'F') that._i[index] = entry;
    } return that;
  },
  getEntry: getEntry,
  setStrong: function (C, NAME, IS_MAP) {
    // add .keys, .values, .entries, [@@iterator]
    // 23.1.3.4, 23.1.3.8, 23.1.3.11, 23.1.3.12, 23.2.3.5, 23.2.3.8, 23.2.3.10, 23.2.3.11
    $iterDefine(C, NAME, function (iterated, kind) {
      this._t = validate(iterated, NAME); // target
      this._k = kind;                     // kind
      this._l = undefined;                // previous
    }, function () {
      var that = this;
      var kind = that._k;
      var entry = that._l;
      // revert to the last existing entry
      while (entry && entry.r) entry = entry.p;
      // get next entry
      if (!that._t || !(that._l = entry = entry ? entry.n : that._t._f)) {
        // or finish the iteration
        that._t = undefined;
        return step(1);
      }
      // return step by kind
      if (kind == 'keys') return step(0, entry.k);
      if (kind == 'values') return step(0, entry.v);
      return step(0, [entry.k, entry.v]);
    }, IS_MAP ? 'entries' : 'values', !IS_MAP, true);

    // add [@@species], 23.1.2.2, 23.2.2.2
    setSpecies(NAME);
  }
};


/***/ }),
/* 202 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var strong = __webpack_require__(201);
var validate = __webpack_require__(62);
var SET = 'Set';

// 23.2 Set Objects
module.exports = __webpack_require__(91)(SET, function (get) {
  return function Set() { return get(this, arguments.length > 0 ? arguments[0] : undefined); };
}, {
  // 23.2.3.1 Set.prototype.add(value)
  add: function add(value) {
    return strong.def(validate(this, SET), value = value === 0 ? 0 : value, value);
  }
}, strong);


/***/ }),
/* 203 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var each = __webpack_require__(35)(0);
var redefine = __webpack_require__(20);
var meta = __webpack_require__(43);
var assign = __webpack_require__(184);
var weak = __webpack_require__(204);
var isObject = __webpack_require__(7);
var fails = __webpack_require__(5);
var validate = __webpack_require__(62);
var WEAK_MAP = 'WeakMap';
var getWeak = meta.getWeak;
var isExtensible = Object.isExtensible;
var uncaughtFrozenStore = weak.ufstore;
var tmp = {};
var InternalMap;

var wrapper = function (get) {
  return function WeakMap() {
    return get(this, arguments.length > 0 ? arguments[0] : undefined);
  };
};

var methods = {
  // 23.3.3.3 WeakMap.prototype.get(key)
  get: function get(key) {
    if (isObject(key)) {
      var data = getWeak(key);
      if (data === true) return uncaughtFrozenStore(validate(this, WEAK_MAP)).get(key);
      return data ? data[this._i] : undefined;
    }
  },
  // 23.3.3.5 WeakMap.prototype.set(key, value)
  set: function set(key, value) {
    return weak.def(validate(this, WEAK_MAP), key, value);
  }
};

// 23.3 WeakMap Objects
var $WeakMap = module.exports = __webpack_require__(91)(WEAK_MAP, wrapper, methods, weak, true, true);

// IE11 WeakMap frozen keys fix
if (fails(function () { return new $WeakMap().set((Object.freeze || Object)(tmp), 7).get(tmp) != 7; })) {
  InternalMap = weak.getConstructor(wrapper, WEAK_MAP);
  assign(InternalMap.prototype, methods);
  meta.NEED = true;
  each(['delete', 'has', 'get', 'set'], function (key) {
    var proto = $WeakMap.prototype;
    var method = proto[key];
    redefine(proto, key, function (a, b) {
      // store frozen objects on internal weakmap shim
      if (isObject(a) && !isExtensible(a)) {
        if (!this._f) this._f = new InternalMap();
        var result = this._f[key](a, b);
        return key == 'set' ? this : result;
      // store all the rest on native weakmap
      } return method.call(this, a, b);
    });
  });
}


/***/ }),
/* 204 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var redefineAll = __webpack_require__(56);
var getWeak = __webpack_require__(43).getWeak;
var anObject = __webpack_require__(2);
var isObject = __webpack_require__(7);
var anInstance = __webpack_require__(54);
var forOf = __webpack_require__(55);
var createArrayMethod = __webpack_require__(35);
var $has = __webpack_require__(18);
var validate = __webpack_require__(62);
var arrayFind = createArrayMethod(5);
var arrayFindIndex = createArrayMethod(6);
var id = 0;

// fallback for uncaught frozen keys
var uncaughtFrozenStore = function (that) {
  return that._l || (that._l = new UncaughtFrozenStore());
};
var UncaughtFrozenStore = function () {
  this.a = [];
};
var findUncaughtFrozen = function (store, key) {
  return arrayFind(store.a, function (it) {
    return it[0] === key;
  });
};
UncaughtFrozenStore.prototype = {
  get: function (key) {
    var entry = findUncaughtFrozen(this, key);
    if (entry) return entry[1];
  },
  has: function (key) {
    return !!findUncaughtFrozen(this, key);
  },
  set: function (key, value) {
    var entry = findUncaughtFrozen(this, key);
    if (entry) entry[1] = value;
    else this.a.push([key, value]);
  },
  'delete': function (key) {
    var index = arrayFindIndex(this.a, function (it) {
      return it[0] === key;
    });
    if (~index) this.a.splice(index, 1);
    return !!~index;
  }
};

module.exports = {
  getConstructor: function (wrapper, NAME, IS_MAP, ADDER) {
    var C = wrapper(function (that, iterable) {
      anInstance(that, C, NAME, '_i');
      that._t = NAME;      // collection type
      that._i = id++;      // collection id
      that._l = undefined; // leak store for uncaught frozen objects
      if (iterable != undefined) forOf(iterable, IS_MAP, that[ADDER], that);
    });
    redefineAll(C.prototype, {
      // 23.3.3.2 WeakMap.prototype.delete(key)
      // 23.4.3.3 WeakSet.prototype.delete(value)
      'delete': function (key) {
        if (!isObject(key)) return false;
        var data = getWeak(key);
        if (data === true) return uncaughtFrozenStore(validate(this, NAME))['delete'](key);
        return data && $has(data, this._i) && delete data[this._i];
      },
      // 23.3.3.4 WeakMap.prototype.has(key)
      // 23.4.3.4 WeakSet.prototype.has(value)
      has: function has(key) {
        if (!isObject(key)) return false;
        var data = getWeak(key);
        if (data === true) return uncaughtFrozenStore(validate(this, NAME)).has(key);
        return data && $has(data, this._i);
      }
    });
    return C;
  },
  def: function (that, key, value) {
    var data = getWeak(anObject(key), true);
    if (data === true) uncaughtFrozenStore(that).set(key, value);
    else data[that._i] = value;
    return that;
  },
  ufstore: uncaughtFrozenStore
};


/***/ }),
/* 205 */
/***/ (function(module, exports, __webpack_require__) {

// https://tc39.github.io/ecma262/#sec-toindex
var toInteger = __webpack_require__(33);
var toLength = __webpack_require__(12);
module.exports = function (it) {
  if (it === undefined) return 0;
  var number = toInteger(it);
  var length = toLength(number);
  if (number !== length) throw RangeError('Wrong length!');
  return length;
};


/***/ }),
/* 206 */
/***/ (function(module, exports, __webpack_require__) {

// all object keys, includes non-enumerable and symbols
var gOPN = __webpack_require__(52);
var gOPS = __webpack_require__(84);
var anObject = __webpack_require__(2);
var Reflect = __webpack_require__(3).Reflect;
module.exports = Reflect && Reflect.ownKeys || function ownKeys(it) {
  var keys = gOPN.f(anObject(it));
  var getSymbols = gOPS.f;
  return getSymbols ? keys.concat(getSymbols(it)) : keys;
};


/***/ }),
/* 207 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// https://tc39.github.io/proposal-flatMap/#sec-FlattenIntoArray
var isArray = __webpack_require__(85);
var isObject = __webpack_require__(7);
var toLength = __webpack_require__(12);
var ctx = __webpack_require__(26);
var IS_CONCAT_SPREADABLE = __webpack_require__(9)('isConcatSpreadable');

function flattenIntoArray(target, original, source, sourceLen, start, depth, mapper, thisArg) {
  var targetIndex = start;
  var sourceIndex = 0;
  var mapFn = mapper ? ctx(mapper, thisArg, 3) : false;
  var element, spreadable;

  while (sourceIndex < sourceLen) {
    if (sourceIndex in source) {
      element = mapFn ? mapFn(source[sourceIndex], sourceIndex, original) : source[sourceIndex];

      spreadable = false;
      if (isObject(element)) {
        spreadable = element[IS_CONCAT_SPREADABLE];
        spreadable = spreadable !== undefined ? !!spreadable : isArray(element);
      }

      if (spreadable && depth > 0) {
        targetIndex = flattenIntoArray(target, original, element, toLength(element.length), targetIndex, depth - 1) - 1;
      } else {
        if (targetIndex >= 0x1fffffffffffff) throw TypeError();
        target[targetIndex] = element;
      }

      targetIndex++;
    }
    sourceIndex++;
  }
  return targetIndex;
}

module.exports = flattenIntoArray;


/***/ }),
/* 208 */
/***/ (function(module, exports, __webpack_require__) {

// https://github.com/tc39/proposal-string-pad-start-end
var toLength = __webpack_require__(12);
var repeat = __webpack_require__(121);
var defined = __webpack_require__(32);

module.exports = function (that, maxLength, fillString, left) {
  var S = String(defined(that));
  var stringLength = S.length;
  var fillStr = fillString === undefined ? ' ' : String(fillString);
  var intMaxLength = toLength(maxLength);
  if (intMaxLength <= stringLength || fillStr == '') return S;
  var fillLen = intMaxLength - stringLength;
  var stringFiller = repeat.call(fillStr, Math.ceil(fillLen / fillStr.length));
  if (stringFiller.length > fillLen) stringFiller = stringFiller.slice(0, fillLen);
  return left ? stringFiller + S : S + stringFiller;
};


/***/ }),
/* 209 */
/***/ (function(module, exports, __webpack_require__) {

var getKeys = __webpack_require__(49);
var toIObject = __webpack_require__(23);
var isEnum = __webpack_require__(74).f;
module.exports = function (isEntries) {
  return function (it) {
    var O = toIObject(it);
    var keys = getKeys(O);
    var length = keys.length;
    var i = 0;
    var result = [];
    var key;
    while (length > i) if (isEnum.call(O, key = keys[i++])) {
      result.push(isEntries ? [key, O[key]] : O[key]);
    } return result;
  };
};


/***/ }),
/* 210 */
/***/ (function(module, exports, __webpack_require__) {

// https://github.com/DavidBruant/Map-Set.prototype.toJSON
var classof = __webpack_require__(75);
var from = __webpack_require__(211);
module.exports = function (NAME) {
  return function toJSON() {
    if (classof(this) != NAME) throw TypeError(NAME + "#toJSON isn't generic");
    return from(this);
  };
};


/***/ }),
/* 211 */
/***/ (function(module, exports, __webpack_require__) {

var forOf = __webpack_require__(55);

module.exports = function (iter, ITERATOR) {
  var result = [];
  forOf(iter, false, result.push, result, ITERATOR);
  return result;
};


/***/ }),
/* 212 */
/***/ (function(module, exports) {

// https://rwaldron.github.io/proposal-math-extensions/
module.exports = Math.scale || function scale(x, inLow, inHigh, outLow, outHigh) {
  if (
    arguments.length === 0
      // eslint-disable-next-line no-self-compare
      || x != x
      // eslint-disable-next-line no-self-compare
      || inLow != inLow
      // eslint-disable-next-line no-self-compare
      || inHigh != inHigh
      // eslint-disable-next-line no-self-compare
      || outLow != outLow
      // eslint-disable-next-line no-self-compare
      || outHigh != outHigh
  ) return NaN;
  if (x === Infinity || x === -Infinity) return x;
  return (x - inLow) * (outHigh - outLow) / (inHigh - inLow) + outLow;
};


/***/ }),
/* 213 */
/***/ (function(module, exports, __webpack_require__) {

module.exports = {
  curl: __webpack_require__(40),
  kerl: __webpack_require__(63),
  bundle: __webpack_require__(97),
  converter: __webpack_require__(36),
  signing: __webpack_require__(98),
  hmac: __webpack_require__(534),
  multisig: __webpack_require__(535),
  utils: __webpack_require__(143),
  valid: __webpack_require__(142),
  add: __webpack_require__(141)
}


/***/ }),
/* 214 */
/***/ (function(module, exports, __webpack_require__) {

;(function (root, factory, undef) {
	if (true) {
		// CommonJS
		module.exports = exports = factory(__webpack_require__(4), __webpack_require__(96), __webpack_require__(509), __webpack_require__(510), __webpack_require__(64), __webpack_require__(65), __webpack_require__(139), __webpack_require__(215), __webpack_require__(511), __webpack_require__(216), __webpack_require__(512), __webpack_require__(513), __webpack_require__(514), __webpack_require__(140), __webpack_require__(515), __webpack_require__(57), __webpack_require__(15), __webpack_require__(516), __webpack_require__(517), __webpack_require__(518), __webpack_require__(519), __webpack_require__(520), __webpack_require__(521), __webpack_require__(522), __webpack_require__(523), __webpack_require__(524), __webpack_require__(525), __webpack_require__(526), __webpack_require__(527), __webpack_require__(528), __webpack_require__(529), __webpack_require__(530), __webpack_require__(531));
	}
	else if (typeof define === "function" && define.amd) {
		// AMD
		define(["./core", "./x64-core", "./lib-typedarrays", "./enc-utf16", "./enc-base64", "./md5", "./sha1", "./sha256", "./sha224", "./sha512", "./sha384", "./sha3", "./ripemd160", "./hmac", "./pbkdf2", "./evpkdf", "./cipher-core", "./mode-cfb", "./mode-ctr", "./mode-ctr-gladman", "./mode-ofb", "./mode-ecb", "./pad-ansix923", "./pad-iso10126", "./pad-iso97971", "./pad-zeropadding", "./pad-nopadding", "./format-hex", "./aes", "./tripledes", "./rc4", "./rabbit", "./rabbit-legacy"], factory);
	}
	else {
		// Global (browser)
		root.CryptoJS = factory(root.CryptoJS);
	}
}(this, function (CryptoJS) {

	return CryptoJS;

}));

/***/ }),
/* 215 */
/***/ (function(module, exports, __webpack_require__) {

;(function (root, factory) {
	if (true) {
		// CommonJS
		module.exports = exports = factory(__webpack_require__(4));
	}
	else if (typeof define === "function" && define.amd) {
		// AMD
		define(["./core"], factory);
	}
	else {
		// Global (browser)
		factory(root.CryptoJS);
	}
}(this, function (CryptoJS) {

	(function (Math) {
	    // Shortcuts
	    var C = CryptoJS;
	    var C_lib = C.lib;
	    var WordArray = C_lib.WordArray;
	    var Hasher = C_lib.Hasher;
	    var C_algo = C.algo;

	    // Initialization and round constants tables
	    var H = [];
	    var K = [];

	    // Compute constants
	    (function () {
	        function isPrime(n) {
	            var sqrtN = Math.sqrt(n);
	            for (var factor = 2; factor <= sqrtN; factor++) {
	                if (!(n % factor)) {
	                    return false;
	                }
	            }

	            return true;
	        }

	        function getFractionalBits(n) {
	            return ((n - (n | 0)) * 0x100000000) | 0;
	        }

	        var n = 2;
	        var nPrime = 0;
	        while (nPrime < 64) {
	            if (isPrime(n)) {
	                if (nPrime < 8) {
	                    H[nPrime] = getFractionalBits(Math.pow(n, 1 / 2));
	                }
	                K[nPrime] = getFractionalBits(Math.pow(n, 1 / 3));

	                nPrime++;
	            }

	            n++;
	        }
	    }());

	    // Reusable object
	    var W = [];

	    /**
	     * SHA-256 hash algorithm.
	     */
	    var SHA256 = C_algo.SHA256 = Hasher.extend({
	        _doReset: function () {
	            this._hash = new WordArray.init(H.slice(0));
	        },

	        _doProcessBlock: function (M, offset) {
	            // Shortcut
	            var H = this._hash.words;

	            // Working variables
	            var a = H[0];
	            var b = H[1];
	            var c = H[2];
	            var d = H[3];
	            var e = H[4];
	            var f = H[5];
	            var g = H[6];
	            var h = H[7];

	            // Computation
	            for (var i = 0; i < 64; i++) {
	                if (i < 16) {
	                    W[i] = M[offset + i] | 0;
	                } else {
	                    var gamma0x = W[i - 15];
	                    var gamma0  = ((gamma0x << 25) | (gamma0x >>> 7))  ^
	                                  ((gamma0x << 14) | (gamma0x >>> 18)) ^
	                                   (gamma0x >>> 3);

	                    var gamma1x = W[i - 2];
	                    var gamma1  = ((gamma1x << 15) | (gamma1x >>> 17)) ^
	                                  ((gamma1x << 13) | (gamma1x >>> 19)) ^
	                                   (gamma1x >>> 10);

	                    W[i] = gamma0 + W[i - 7] + gamma1 + W[i - 16];
	                }

	                var ch  = (e & f) ^ (~e & g);
	                var maj = (a & b) ^ (a & c) ^ (b & c);

	                var sigma0 = ((a << 30) | (a >>> 2)) ^ ((a << 19) | (a >>> 13)) ^ ((a << 10) | (a >>> 22));
	                var sigma1 = ((e << 26) | (e >>> 6)) ^ ((e << 21) | (e >>> 11)) ^ ((e << 7)  | (e >>> 25));

	                var t1 = h + sigma1 + ch + K[i] + W[i];
	                var t2 = sigma0 + maj;

	                h = g;
	                g = f;
	                f = e;
	                e = (d + t1) | 0;
	                d = c;
	                c = b;
	                b = a;
	                a = (t1 + t2) | 0;
	            }

	            // Intermediate hash value
	            H[0] = (H[0] + a) | 0;
	            H[1] = (H[1] + b) | 0;
	            H[2] = (H[2] + c) | 0;
	            H[3] = (H[3] + d) | 0;
	            H[4] = (H[4] + e) | 0;
	            H[5] = (H[5] + f) | 0;
	            H[6] = (H[6] + g) | 0;
	            H[7] = (H[7] + h) | 0;
	        },

	        _doFinalize: function () {
	            // Shortcuts
	            var data = this._data;
	            var dataWords = data.words;

	            var nBitsTotal = this._nDataBytes * 8;
	            var nBitsLeft = data.sigBytes * 8;

	            // Add padding
	            dataWords[nBitsLeft >>> 5] |= 0x80 << (24 - nBitsLeft % 32);
	            dataWords[(((nBitsLeft + 64) >>> 9) << 4) + 14] = Math.floor(nBitsTotal / 0x100000000);
	            dataWords[(((nBitsLeft + 64) >>> 9) << 4) + 15] = nBitsTotal;
	            data.sigBytes = dataWords.length * 4;

	            // Hash final blocks
	            this._process();

	            // Return final computed hash
	            return this._hash;
	        },

	        clone: function () {
	            var clone = Hasher.clone.call(this);
	            clone._hash = this._hash.clone();

	            return clone;
	        }
	    });

	    /**
	     * Shortcut function to the hasher's object interface.
	     *
	     * @param {WordArray|string} message The message to hash.
	     *
	     * @return {WordArray} The hash.
	     *
	     * @static
	     *
	     * @example
	     *
	     *     var hash = CryptoJS.SHA256('message');
	     *     var hash = CryptoJS.SHA256(wordArray);
	     */
	    C.SHA256 = Hasher._createHelper(SHA256);

	    /**
	     * Shortcut function to the HMAC's object interface.
	     *
	     * @param {WordArray|string} message The message to hash.
	     * @param {WordArray|string} key The secret key.
	     *
	     * @return {WordArray} The HMAC.
	     *
	     * @static
	     *
	     * @example
	     *
	     *     var hmac = CryptoJS.HmacSHA256(message, key);
	     */
	    C.HmacSHA256 = Hasher._createHmacHelper(SHA256);
	}(Math));


	return CryptoJS.SHA256;

}));

/***/ }),
/* 216 */
/***/ (function(module, exports, __webpack_require__) {

;(function (root, factory, undef) {
	if (true) {
		// CommonJS
		module.exports = exports = factory(__webpack_require__(4), __webpack_require__(96));
	}
	else if (typeof define === "function" && define.amd) {
		// AMD
		define(["./core", "./x64-core"], factory);
	}
	else {
		// Global (browser)
		factory(root.CryptoJS);
	}
}(this, function (CryptoJS) {

	(function () {
	    // Shortcuts
	    var C = CryptoJS;
	    var C_lib = C.lib;
	    var Hasher = C_lib.Hasher;
	    var C_x64 = C.x64;
	    var X64Word = C_x64.Word;
	    var X64WordArray = C_x64.WordArray;
	    var C_algo = C.algo;

	    function X64Word_create() {
	        return X64Word.create.apply(X64Word, arguments);
	    }

	    // Constants
	    var K = [
	        X64Word_create(0x428a2f98, 0xd728ae22), X64Word_create(0x71374491, 0x23ef65cd),
	        X64Word_create(0xb5c0fbcf, 0xec4d3b2f), X64Word_create(0xe9b5dba5, 0x8189dbbc),
	        X64Word_create(0x3956c25b, 0xf348b538), X64Word_create(0x59f111f1, 0xb605d019),
	        X64Word_create(0x923f82a4, 0xaf194f9b), X64Word_create(0xab1c5ed5, 0xda6d8118),
	        X64Word_create(0xd807aa98, 0xa3030242), X64Word_create(0x12835b01, 0x45706fbe),
	        X64Word_create(0x243185be, 0x4ee4b28c), X64Word_create(0x550c7dc3, 0xd5ffb4e2),
	        X64Word_create(0x72be5d74, 0xf27b896f), X64Word_create(0x80deb1fe, 0x3b1696b1),
	        X64Word_create(0x9bdc06a7, 0x25c71235), X64Word_create(0xc19bf174, 0xcf692694),
	        X64Word_create(0xe49b69c1, 0x9ef14ad2), X64Word_create(0xefbe4786, 0x384f25e3),
	        X64Word_create(0x0fc19dc6, 0x8b8cd5b5), X64Word_create(0x240ca1cc, 0x77ac9c65),
	        X64Word_create(0x2de92c6f, 0x592b0275), X64Word_create(0x4a7484aa, 0x6ea6e483),
	        X64Word_create(0x5cb0a9dc, 0xbd41fbd4), X64Word_create(0x76f988da, 0x831153b5),
	        X64Word_create(0x983e5152, 0xee66dfab), X64Word_create(0xa831c66d, 0x2db43210),
	        X64Word_create(0xb00327c8, 0x98fb213f), X64Word_create(0xbf597fc7, 0xbeef0ee4),
	        X64Word_create(0xc6e00bf3, 0x3da88fc2), X64Word_create(0xd5a79147, 0x930aa725),
	        X64Word_create(0x06ca6351, 0xe003826f), X64Word_create(0x14292967, 0x0a0e6e70),
	        X64Word_create(0x27b70a85, 0x46d22ffc), X64Word_create(0x2e1b2138, 0x5c26c926),
	        X64Word_create(0x4d2c6dfc, 0x5ac42aed), X64Word_create(0x53380d13, 0x9d95b3df),
	        X64Word_create(0x650a7354, 0x8baf63de), X64Word_create(0x766a0abb, 0x3c77b2a8),
	        X64Word_create(0x81c2c92e, 0x47edaee6), X64Word_create(0x92722c85, 0x1482353b),
	        X64Word_create(0xa2bfe8a1, 0x4cf10364), X64Word_create(0xa81a664b, 0xbc423001),
	        X64Word_create(0xc24b8b70, 0xd0f89791), X64Word_create(0xc76c51a3, 0x0654be30),
	        X64Word_create(0xd192e819, 0xd6ef5218), X64Word_create(0xd6990624, 0x5565a910),
	        X64Word_create(0xf40e3585, 0x5771202a), X64Word_create(0x106aa070, 0x32bbd1b8),
	        X64Word_create(0x19a4c116, 0xb8d2d0c8), X64Word_create(0x1e376c08, 0x5141ab53),
	        X64Word_create(0x2748774c, 0xdf8eeb99), X64Word_create(0x34b0bcb5, 0xe19b48a8),
	        X64Word_create(0x391c0cb3, 0xc5c95a63), X64Word_create(0x4ed8aa4a, 0xe3418acb),
	        X64Word_create(0x5b9cca4f, 0x7763e373), X64Word_create(0x682e6ff3, 0xd6b2b8a3),
	        X64Word_create(0x748f82ee, 0x5defb2fc), X64Word_create(0x78a5636f, 0x43172f60),
	        X64Word_create(0x84c87814, 0xa1f0ab72), X64Word_create(0x8cc70208, 0x1a6439ec),
	        X64Word_create(0x90befffa, 0x23631e28), X64Word_create(0xa4506ceb, 0xde82bde9),
	        X64Word_create(0xbef9a3f7, 0xb2c67915), X64Word_create(0xc67178f2, 0xe372532b),
	        X64Word_create(0xca273ece, 0xea26619c), X64Word_create(0xd186b8c7, 0x21c0c207),
	        X64Word_create(0xeada7dd6, 0xcde0eb1e), X64Word_create(0xf57d4f7f, 0xee6ed178),
	        X64Word_create(0x06f067aa, 0x72176fba), X64Word_create(0x0a637dc5, 0xa2c898a6),
	        X64Word_create(0x113f9804, 0xbef90dae), X64Word_create(0x1b710b35, 0x131c471b),
	        X64Word_create(0x28db77f5, 0x23047d84), X64Word_create(0x32caab7b, 0x40c72493),
	        X64Word_create(0x3c9ebe0a, 0x15c9bebc), X64Word_create(0x431d67c4, 0x9c100d4c),
	        X64Word_create(0x4cc5d4be, 0xcb3e42b6), X64Word_create(0x597f299c, 0xfc657e2a),
	        X64Word_create(0x5fcb6fab, 0x3ad6faec), X64Word_create(0x6c44198c, 0x4a475817)
	    ];

	    // Reusable objects
	    var W = [];
	    (function () {
	        for (var i = 0; i < 80; i++) {
	            W[i] = X64Word_create();
	        }
	    }());

	    /**
	     * SHA-512 hash algorithm.
	     */
	    var SHA512 = C_algo.SHA512 = Hasher.extend({
	        _doReset: function () {
	            this._hash = new X64WordArray.init([
	                new X64Word.init(0x6a09e667, 0xf3bcc908), new X64Word.init(0xbb67ae85, 0x84caa73b),
	                new X64Word.init(0x3c6ef372, 0xfe94f82b), new X64Word.init(0xa54ff53a, 0x5f1d36f1),
	                new X64Word.init(0x510e527f, 0xade682d1), new X64Word.init(0x9b05688c, 0x2b3e6c1f),
	                new X64Word.init(0x1f83d9ab, 0xfb41bd6b), new X64Word.init(0x5be0cd19, 0x137e2179)
	            ]);
	        },

	        _doProcessBlock: function (M, offset) {
	            // Shortcuts
	            var H = this._hash.words;

	            var H0 = H[0];
	            var H1 = H[1];
	            var H2 = H[2];
	            var H3 = H[3];
	            var H4 = H[4];
	            var H5 = H[5];
	            var H6 = H[6];
	            var H7 = H[7];

	            var H0h = H0.high;
	            var H0l = H0.low;
	            var H1h = H1.high;
	            var H1l = H1.low;
	            var H2h = H2.high;
	            var H2l = H2.low;
	            var H3h = H3.high;
	            var H3l = H3.low;
	            var H4h = H4.high;
	            var H4l = H4.low;
	            var H5h = H5.high;
	            var H5l = H5.low;
	            var H6h = H6.high;
	            var H6l = H6.low;
	            var H7h = H7.high;
	            var H7l = H7.low;

	            // Working variables
	            var ah = H0h;
	            var al = H0l;
	            var bh = H1h;
	            var bl = H1l;
	            var ch = H2h;
	            var cl = H2l;
	            var dh = H3h;
	            var dl = H3l;
	            var eh = H4h;
	            var el = H4l;
	            var fh = H5h;
	            var fl = H5l;
	            var gh = H6h;
	            var gl = H6l;
	            var hh = H7h;
	            var hl = H7l;

	            // Rounds
	            for (var i = 0; i < 80; i++) {
	                // Shortcut
	                var Wi = W[i];

	                // Extend message
	                if (i < 16) {
	                    var Wih = Wi.high = M[offset + i * 2]     | 0;
	                    var Wil = Wi.low  = M[offset + i * 2 + 1] | 0;
	                } else {
	                    // Gamma0
	                    var gamma0x  = W[i - 15];
	                    var gamma0xh = gamma0x.high;
	                    var gamma0xl = gamma0x.low;
	                    var gamma0h  = ((gamma0xh >>> 1) | (gamma0xl << 31)) ^ ((gamma0xh >>> 8) | (gamma0xl << 24)) ^ (gamma0xh >>> 7);
	                    var gamma0l  = ((gamma0xl >>> 1) | (gamma0xh << 31)) ^ ((gamma0xl >>> 8) | (gamma0xh << 24)) ^ ((gamma0xl >>> 7) | (gamma0xh << 25));

	                    // Gamma1
	                    var gamma1x  = W[i - 2];
	                    var gamma1xh = gamma1x.high;
	                    var gamma1xl = gamma1x.low;
	                    var gamma1h  = ((gamma1xh >>> 19) | (gamma1xl << 13)) ^ ((gamma1xh << 3) | (gamma1xl >>> 29)) ^ (gamma1xh >>> 6);
	                    var gamma1l  = ((gamma1xl >>> 19) | (gamma1xh << 13)) ^ ((gamma1xl << 3) | (gamma1xh >>> 29)) ^ ((gamma1xl >>> 6) | (gamma1xh << 26));

	                    // W[i] = gamma0 + W[i - 7] + gamma1 + W[i - 16]
	                    var Wi7  = W[i - 7];
	                    var Wi7h = Wi7.high;
	                    var Wi7l = Wi7.low;

	                    var Wi16  = W[i - 16];
	                    var Wi16h = Wi16.high;
	                    var Wi16l = Wi16.low;

	                    var Wil = gamma0l + Wi7l;
	                    var Wih = gamma0h + Wi7h + ((Wil >>> 0) < (gamma0l >>> 0) ? 1 : 0);
	                    var Wil = Wil + gamma1l;
	                    var Wih = Wih + gamma1h + ((Wil >>> 0) < (gamma1l >>> 0) ? 1 : 0);
	                    var Wil = Wil + Wi16l;
	                    var Wih = Wih + Wi16h + ((Wil >>> 0) < (Wi16l >>> 0) ? 1 : 0);

	                    Wi.high = Wih;
	                    Wi.low  = Wil;
	                }

	                var chh  = (eh & fh) ^ (~eh & gh);
	                var chl  = (el & fl) ^ (~el & gl);
	                var majh = (ah & bh) ^ (ah & ch) ^ (bh & ch);
	                var majl = (al & bl) ^ (al & cl) ^ (bl & cl);

	                var sigma0h = ((ah >>> 28) | (al << 4))  ^ ((ah << 30)  | (al >>> 2)) ^ ((ah << 25) | (al >>> 7));
	                var sigma0l = ((al >>> 28) | (ah << 4))  ^ ((al << 30)  | (ah >>> 2)) ^ ((al << 25) | (ah >>> 7));
	                var sigma1h = ((eh >>> 14) | (el << 18)) ^ ((eh >>> 18) | (el << 14)) ^ ((eh << 23) | (el >>> 9));
	                var sigma1l = ((el >>> 14) | (eh << 18)) ^ ((el >>> 18) | (eh << 14)) ^ ((el << 23) | (eh >>> 9));

	                // t1 = h + sigma1 + ch + K[i] + W[i]
	                var Ki  = K[i];
	                var Kih = Ki.high;
	                var Kil = Ki.low;

	                var t1l = hl + sigma1l;
	                var t1h = hh + sigma1h + ((t1l >>> 0) < (hl >>> 0) ? 1 : 0);
	                var t1l = t1l + chl;
	                var t1h = t1h + chh + ((t1l >>> 0) < (chl >>> 0) ? 1 : 0);
	                var t1l = t1l + Kil;
	                var t1h = t1h + Kih + ((t1l >>> 0) < (Kil >>> 0) ? 1 : 0);
	                var t1l = t1l + Wil;
	                var t1h = t1h + Wih + ((t1l >>> 0) < (Wil >>> 0) ? 1 : 0);

	                // t2 = sigma0 + maj
	                var t2l = sigma0l + majl;
	                var t2h = sigma0h + majh + ((t2l >>> 0) < (sigma0l >>> 0) ? 1 : 0);

	                // Update working variables
	                hh = gh;
	                hl = gl;
	                gh = fh;
	                gl = fl;
	                fh = eh;
	                fl = el;
	                el = (dl + t1l) | 0;
	                eh = (dh + t1h + ((el >>> 0) < (dl >>> 0) ? 1 : 0)) | 0;
	                dh = ch;
	                dl = cl;
	                ch = bh;
	                cl = bl;
	                bh = ah;
	                bl = al;
	                al = (t1l + t2l) | 0;
	                ah = (t1h + t2h + ((al >>> 0) < (t1l >>> 0) ? 1 : 0)) | 0;
	            }

	            // Intermediate hash value
	            H0l = H0.low  = (H0l + al);
	            H0.high = (H0h + ah + ((H0l >>> 0) < (al >>> 0) ? 1 : 0));
	            H1l = H1.low  = (H1l + bl);
	            H1.high = (H1h + bh + ((H1l >>> 0) < (bl >>> 0) ? 1 : 0));
	            H2l = H2.low  = (H2l + cl);
	            H2.high = (H2h + ch + ((H2l >>> 0) < (cl >>> 0) ? 1 : 0));
	            H3l = H3.low  = (H3l + dl);
	            H3.high = (H3h + dh + ((H3l >>> 0) < (dl >>> 0) ? 1 : 0));
	            H4l = H4.low  = (H4l + el);
	            H4.high = (H4h + eh + ((H4l >>> 0) < (el >>> 0) ? 1 : 0));
	            H5l = H5.low  = (H5l + fl);
	            H5.high = (H5h + fh + ((H5l >>> 0) < (fl >>> 0) ? 1 : 0));
	            H6l = H6.low  = (H6l + gl);
	            H6.high = (H6h + gh + ((H6l >>> 0) < (gl >>> 0) ? 1 : 0));
	            H7l = H7.low  = (H7l + hl);
	            H7.high = (H7h + hh + ((H7l >>> 0) < (hl >>> 0) ? 1 : 0));
	        },

	        _doFinalize: function () {
	            // Shortcuts
	            var data = this._data;
	            var dataWords = data.words;

	            var nBitsTotal = this._nDataBytes * 8;
	            var nBitsLeft = data.sigBytes * 8;

	            // Add padding
	            dataWords[nBitsLeft >>> 5] |= 0x80 << (24 - nBitsLeft % 32);
	            dataWords[(((nBitsLeft + 128) >>> 10) << 5) + 30] = Math.floor(nBitsTotal / 0x100000000);
	            dataWords[(((nBitsLeft + 128) >>> 10) << 5) + 31] = nBitsTotal;
	            data.sigBytes = dataWords.length * 4;

	            // Hash final blocks
	            this._process();

	            // Convert hash to 32-bit word array before returning
	            var hash = this._hash.toX32();

	            // Return final computed hash
	            return hash;
	        },

	        clone: function () {
	            var clone = Hasher.clone.call(this);
	            clone._hash = this._hash.clone();

	            return clone;
	        },

	        blockSize: 1024/32
	    });

	    /**
	     * Shortcut function to the hasher's object interface.
	     *
	     * @param {WordArray|string} message The message to hash.
	     *
	     * @return {WordArray} The hash.
	     *
	     * @static
	     *
	     * @example
	     *
	     *     var hash = CryptoJS.SHA512('message');
	     *     var hash = CryptoJS.SHA512(wordArray);
	     */
	    C.SHA512 = Hasher._createHelper(SHA512);

	    /**
	     * Shortcut function to the HMAC's object interface.
	     *
	     * @param {WordArray|string} message The message to hash.
	     * @param {WordArray|string} key The secret key.
	     *
	     * @return {WordArray} The HMAC.
	     *
	     * @static
	     *
	     * @example
	     *
	     *     var hmac = CryptoJS.HmacSHA512(message, key);
	     */
	    C.HmacSHA512 = Hasher._createHmacHelper(SHA512);
	}());


	return CryptoJS.SHA512;

}));

/***/ }),
/* 217 */
/***/ (function(module, exports) {

//
//  Conversion of ascii encoded bytes to trytes.
//  Input is a string (can be stringified JSON object), return value is Trytes
//
//  How the conversion works:
//    2 Trytes === 1 Byte
//    There are a total of 27 different tryte values: 9ABCDEFGHIJKLMNOPQRSTUVWXYZ
//
//    1. We get the decimal value of an individual ASCII character
//    2. From the decimal value, we then derive the two tryte values by basically calculating the tryte equivalent (e.g. 100 === 19 + 3 * 27)
//      a. The first tryte value is the decimal value modulo 27 (27 trytes)
//      b. The second value is the remainder (decimal value - first value), divided by 27
//    3. The two values returned from Step 2. are then input as indices into the available values list ('9ABCDEFGHIJKLMNOPQRSTUVWXYZ') to get the correct tryte value
//
//   EXAMPLES
//      Lets say we want to convert the ASCII character "Z".
//        1. 'Z' has a decimal value of 90.
//        2. 90 can be represented as 9 + 3 * 27. To make it simpler:
//           a. First value: 90 modulo 27 is 9. This is now our first value
//           b. Second value: (90 - 9) / 27 is 3. This is our second value.
//        3. Our two values are now 9 and 3. To get the tryte value now we simply insert it as indices into '9ABCDEFGHIJKLMNOPQRSTUVWXYZ'
//           a. The first tryte value is '9ABCDEFGHIJKLMNOPQRSTUVWXYZ'[9] === "I"
//           b. The second tryte value is '9ABCDEFGHIJKLMNOPQRSTUVWXYZ'[3] === "C"
//        Our tryte pair is "IC"
//
//      RESULT:
//        The ASCII char "Z" is represented as "IC" in trytes.
//
function toTrytes(input) {

    // If input is not a string, return null
    if ( typeof input !== 'string' ) return null

    var TRYTE_VALUES = "9ABCDEFGHIJKLMNOPQRSTUVWXYZ";
    var trytes = "";

    for (var i = 0; i < input.length; i++) {
        var char = input[i];
        var asciiValue = char.charCodeAt(0);

        // If not recognizable ASCII character, return null
        if (asciiValue > 255) {
            //asciiValue = 32
            return null;
        }

        var firstValue = asciiValue % 27;
        var secondValue = (asciiValue - firstValue) / 27;

        var trytesValue = TRYTE_VALUES[firstValue] + TRYTE_VALUES[secondValue];

        trytes += trytesValue;
    }

    return trytes;
}


//
//  Trytes to bytes
//  Reverse operation from the byteToTrytes function in send.js
//  2 Trytes == 1 Byte
//  We assume that the trytes are a JSON encoded object thus for our encoding:
//    First character = {
//    Last character = }
//    Everything after that is 9's padding
//
function fromTrytes(inputTrytes) {

    // If input is not a string, return null
    if ( typeof inputTrytes !== 'string' ) return null

    // If input length is odd, return null
    if ( inputTrytes.length % 2 ) return null

    var TRYTE_VALUES = "9ABCDEFGHIJKLMNOPQRSTUVWXYZ";
    var outputString = "";

    for (var i = 0; i < inputTrytes.length; i += 2) {
        // get a trytes pair
        var trytes = inputTrytes[i] + inputTrytes[i + 1];

        var firstValue = TRYTE_VALUES.indexOf(trytes[0]);
        var secondValue = TRYTE_VALUES.indexOf(trytes[1]);

        var decimalValue = firstValue + secondValue * 27;

        var character = String.fromCharCode(decimalValue);

        outputString += character;
    }

    return outputString;
}

module.exports = {
    toTrytes: toTrytes,
    fromTrytes: fromTrytes
}


/***/ }),
/* 218 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var wasm = __webpack_require__(219);
wasm.initialize({ noExitRuntime: true }).then(function (IOTA) {
  var Main = __webpack_require__(306);
  //////////////////////////////////////////////////////////////////
  /* ======= CTrits bindings ======= */
  var TritEncoding = {
    BYTE: 1,
    TRIT: 2,
    TRYTE: 3

    /* ======= Rust bindings ======= */

  };var iota_ctrits_drop = IOTA.cwrap('iota_ctrits_drop', '', ['number']);
  var iota_ctrits_convert = IOTA.cwrap('iota_ctrits_convert', 'number', ['number', 'number']);
  var iota_ctrits_ctrits_from_trytes = IOTA.cwrap('iota_ctrits_ctrits_from_trytes', 'number', ['string', 'number']);
  var iota_ctrits_ctrits_from_bytes = IOTA.cwrap('iota_ctrits_ctrits_from_bytes', 'number', ['number', 'number']);
  var iota_ctrits_ctrits_from_trits = IOTA.cwrap('iota_ctrits_ctrits_from_trits', 'number', ['number', 'number']);

  // For accessing the struct members
  var iota_ctrits_ctrits_encoding = IOTA.cwrap('iota_ctrits_ctrits_encoding', 'number', ['number']);
  var iota_ctrits_ctrits_length = IOTA.cwrap('iota_ctrits_ctrits_length', 'number', ['number']);
  var iota_ctrits_ctrits_data = IOTA.cwrap('iota_ctrits_ctrits_data', 'number', ['number']);
  var iota_ctrits_ctrits_byte_length = IOTA.cwrap('iota_ctrits_ctrits_byte_length', 'number', ['number']);

  // (seed, message, key, root, siblings, next_root, start, index, security) -> encoded_message
  var iota_mam_create = IOTA.cwrap('iota_mam_create', 'number', ['number', 'number', 'number', 'number', 'number', 'number', 'number', 'number', 'number']);
  // (encoded_message, key, root, index) -> message
  var iota_mam_parse = IOTA.cwrap('iota_mam_parse', 'number', ['number', 'number', 'number', 'number']);

  // (seed, index, count, securit) -> MerkleTree instance
  var iota_merkle_create = IOTA.cwrap('iota_merkle_create', 'number', ['number', 'number', 'number', 'number']);
  // (MerkleTree instance) -> ()
  var iota_merkle_drop = IOTA.cwrap('iota_merkle_drop', '', ['number']);
  // (MerkleTree instance) -> (siblings as number)
  var iota_merkle_siblings = IOTA.cwrap('iota_merkle_siblings', 'number', ['number']);
  // (MerkleTree instance, index) -> (MerkleBranch instance)
  var iota_merkle_branch = IOTA.cwrap('iota_merkle_branch', 'number', ['number', 'number']);
  // (MerkleBranch instance) -> ()
  var iota_merkle_branch_drop = IOTA.cwrap('iota_merkle_branch_drop', '', ['number']);
  // (MerkleBranch instance) -> (number)
  var iota_merkle_branch_len = IOTA.cwrap('iota_merkle_branch_len', '', ['number']);
  // (address, siblings, index) -> (root as number)
  var iota_merkle_root = IOTA.cwrap('iota_merkle_root', 'number', ['number', 'number', 'number']);
  // (MerkleTree instance) -> root hash
  var iota_merkle_slice = IOTA.cwrap('iota_merkle_slice', 'number', ['number']);

  var string_to_ctrits_trits = function string_to_ctrits_trits(str) {
    var strin = iota_ctrits_ctrits_from_trytes(str, str.length);
    var out = iota_ctrits_convert(strin, TritEncoding.TRIT);
    iota_ctrits_drop(strin);
    return out;
  };

  var ctrits_trits_to_string = function ctrits_trits_to_string(ctrits) {
    var str_trits = iota_ctrits_convert(ctrits, TritEncoding.TRYTE);
    var ptr = iota_ctrits_ctrits_data(str_trits);
    var len = iota_ctrits_ctrits_length(str_trits);
    var out = IOTA.Pointer_stringify(ptr, len);
    iota_ctrits_drop(str_trits);
    return out;
  };

  function getMamRoot(SEED, CHANNEL) {
    var SEED_trits = string_to_ctrits_trits(SEED);
    var root_merkle = iota_merkle_create(SEED_trits, CHANNEL.start, CHANNEL.count, CHANNEL.security);
    return ctrits_trits_to_string(iota_merkle_slice(root_merkle));
  }

  function createMessage(SEED, MESSAGE, SIDE_KEY, CHANNEL) {
    if (!SIDE_KEY) SIDE_KEY = `999999999999999999999999999999999999999999999999999999999999999999999999999999999`;
    // MAM settings
    var SEED_trits = string_to_ctrits_trits(SEED);
    var MESSAGE_trits = string_to_ctrits_trits(MESSAGE);
    var SIDE_KEY_trits = string_to_ctrits_trits(SIDE_KEY);

    var SECURITY = CHANNEL.security;
    var START = CHANNEL.start;
    var COUNT = CHANNEL.count;
    var NEXT_START = START + COUNT;
    var NEXT_COUNT = CHANNEL.next_count;
    var INDEX = CHANNEL.index;

    var HASH_LENGTH = 81;

    // set up merkle tree
    var root_merkle = iota_merkle_create(SEED_trits, START, COUNT, SECURITY);
    var next_root_merkle = iota_merkle_create(SEED_trits, NEXT_START, NEXT_COUNT, SECURITY);

    var root_branch = iota_merkle_branch(root_merkle, INDEX);
    var root_siblings = iota_merkle_siblings(root_branch);

    var next_root_branch = iota_merkle_branch(next_root_merkle, INDEX);
    var next_root_siblings = iota_merkle_siblings(next_root_branch);

    var root = iota_merkle_slice(root_merkle);
    var next_root = iota_merkle_slice(next_root_merkle);

    var masked_payload = iota_mam_create(SEED_trits, MESSAGE_trits, SIDE_KEY_trits, root, root_siblings, next_root, START, INDEX, SECURITY);

    var response = {
      payload: ctrits_trits_to_string(masked_payload),
      root: ctrits_trits_to_string(root),
      next_root: ctrits_trits_to_string(next_root),
      side_key: SIDE_KEY
      // Clean up memory. Unneccessary for this example script, but should be done when running in a production
      // environment.
    };iota_merkle_branch_drop(root_branch);
    iota_merkle_branch_drop(next_root_branch);
    iota_merkle_drop(root_merkle);
    iota_merkle_drop(next_root_merkle);[SEED_trits, MESSAGE_trits, SIDE_KEY_trits, root, next_root].forEach(iota_ctrits_drop);
    return response;
  }

  function decodeMessage(PAYLOAD, SIDE_KEY, ROOT) {
    if (!SIDE_KEY) SIDE_KEY = `999999999999999999999999999999999999999999999999999999999999999999999999999999999`;

    var PAYLOAD_trits = string_to_ctrits_trits(PAYLOAD);
    var SIDE_KEY_trits = string_to_ctrits_trits(SIDE_KEY);
    var ROOT_trits = string_to_ctrits_trits(ROOT);

    var parse_result = iota_mam_parse(PAYLOAD_trits, SIDE_KEY_trits, ROOT_trits);
    var unmasked_payload_ctrits = IOTA.getValue(parse_result, 'i32');
    var unmasked_payload = ctrits_trits_to_string(unmasked_payload_ctrits);
    iota_ctrits_drop(unmasked_payload_ctrits);

    var unmasked_next_root_ctrits = IOTA.getValue(parse_result + 4, 'i32');
    var unmasked_next_root = ctrits_trits_to_string(unmasked_next_root_ctrits);
    iota_ctrits_drop(unmasked_next_root_ctrits);
    IOTA._free(parse_result);
    return { payload: unmasked_payload, next_root: unmasked_next_root };
  }
  var Mam = {
    decodeMessage: decodeMessage,
    createMessage: createMessage,
    getMamRoot: getMamRoot
    // Feed Mam functions into the main file
  };Main.setupEnv(Mam);
  // Export to window
  window.Mam = module.exports = Main;
});

/***/ }),
/* 219 */
/***/ (function(module, exports, __webpack_require__) {

/* WEBPACK VAR INJECTION */(function(process, Buffer) {module.exports = (function(existingModule){
      return {
        // Returns a promise that resolves when the wasm runtime is initialized and ready for use
        initialize: function(userDefinedModule) {
          return new Promise((resolve, reject) => {
            if (!userDefinedModule) {
              userDefinedModule = {}
            }
            var Module = Object.assign({}, userDefinedModule, existingModule);
            Module['onRuntimeInitialized'] = () => resolve(Module);
            
var Module;if(!Module)Module=(typeof Module!=="undefined"?Module:null)||{};var moduleOverrides={};for(var key in Module){if(Module.hasOwnProperty(key)){moduleOverrides[key]=Module[key]}}var ENVIRONMENT_IS_WEB=false;var ENVIRONMENT_IS_WORKER=false;var ENVIRONMENT_IS_NODE=false;var ENVIRONMENT_IS_SHELL=false;if(Module["ENVIRONMENT"]){if(Module["ENVIRONMENT"]==="WEB"){ENVIRONMENT_IS_WEB=true}else if(Module["ENVIRONMENT"]==="WORKER"){ENVIRONMENT_IS_WORKER=true}else if(Module["ENVIRONMENT"]==="NODE"){ENVIRONMENT_IS_NODE=true}else if(Module["ENVIRONMENT"]==="SHELL"){ENVIRONMENT_IS_SHELL=true}else{throw new Error("The provided Module['ENVIRONMENT'] value is not valid. It must be one of: WEB|WORKER|NODE|SHELL.")}}else{ENVIRONMENT_IS_WEB=typeof window==="object";ENVIRONMENT_IS_WORKER=typeof importScripts==="function";ENVIRONMENT_IS_NODE=typeof process==="object"&&"function"==="function"&&!ENVIRONMENT_IS_WEB&&!ENVIRONMENT_IS_WORKER;ENVIRONMENT_IS_SHELL=!ENVIRONMENT_IS_WEB&&!ENVIRONMENT_IS_NODE&&!ENVIRONMENT_IS_WORKER}if(ENVIRONMENT_IS_NODE){if(!Module["print"])Module["print"]=console.log;if(!Module["printErr"])Module["printErr"]=console.warn;var nodeFS;var nodePath;Module["read"]=function shell_read(filename,binary){if(!nodeFS)nodeFS=__webpack_require__(76);if(!nodePath)nodePath=__webpack_require__(76);filename=nodePath["normalize"](filename);var ret=nodeFS["readFileSync"](filename);return binary?ret:ret.toString()};Module["readBinary"]=function readBinary(filename){var ret=Module["read"](filename,true);if(!ret.buffer){ret=new Uint8Array(ret)}assert(ret.buffer);return ret};Module["load"]=function load(f){globalEval(read(f))};if(!Module["thisProgram"]){if(process["argv"].length>1){Module["thisProgram"]=process["argv"][1].replace(/\\/g,"/")}else{Module["thisProgram"]="unknown-program"}}Module["arguments"]=process["argv"].slice(2);if(true){module["exports"]=Module}process["on"]("uncaughtException",(function(ex){if(!(ex instanceof ExitStatus)){throw ex}}));Module["inspect"]=(function(){return"[Emscripten Module object]"})}else if(ENVIRONMENT_IS_SHELL){if(!Module["print"])Module["print"]=print;if(typeof printErr!="undefined")Module["printErr"]=printErr;if(typeof read!="undefined"){Module["read"]=read}else{Module["read"]=function shell_read(){throw"no read() available"}}Module["readBinary"]=function readBinary(f){if(typeof readbuffer==="function"){return new Uint8Array(readbuffer(f))}var data=read(f,"binary");assert(typeof data==="object");return data};if(typeof scriptArgs!="undefined"){Module["arguments"]=scriptArgs}else if(typeof arguments!="undefined"){Module["arguments"]=arguments}if(typeof quit==="function"){Module["quit"]=(function(status,toThrow){quit(status)})}}else if(ENVIRONMENT_IS_WEB||ENVIRONMENT_IS_WORKER){Module["read"]=function shell_read(url){var xhr=new XMLHttpRequest;xhr.open("GET",url,false);xhr.send(null);return xhr.responseText};if(ENVIRONMENT_IS_WORKER){Module["readBinary"]=function readBinary(url){var xhr=new XMLHttpRequest;xhr.open("GET",url,false);xhr.responseType="arraybuffer";xhr.send(null);return new Uint8Array(xhr.response)}}Module["readAsync"]=function readAsync(url,onload,onerror){var xhr=new XMLHttpRequest;xhr.open("GET",url,true);xhr.responseType="arraybuffer";xhr.onload=function xhr_onload(){if(xhr.status==200||xhr.status==0&&xhr.response){onload(xhr.response)}else{onerror()}};xhr.onerror=onerror;xhr.send(null)};if(typeof arguments!="undefined"){Module["arguments"]=arguments}if(typeof console!=="undefined"){if(!Module["print"])Module["print"]=function shell_print(x){console.log(x)};if(!Module["printErr"])Module["printErr"]=function shell_printErr(x){console.warn(x)}}else{var TRY_USE_DUMP=false;if(!Module["print"])Module["print"]=TRY_USE_DUMP&&typeof dump!=="undefined"?(function(x){dump(x)}):(function(x){})}if(ENVIRONMENT_IS_WORKER){Module["load"]=importScripts}if(typeof Module["setWindowTitle"]==="undefined"){Module["setWindowTitle"]=(function(title){document.title=title})}}else{throw"Unknown runtime environment. Where are we?"}function globalEval(x){eval.call(null,x)}if(!Module["load"]&&Module["read"]){Module["load"]=function load(f){globalEval(Module["read"](f))}}if(!Module["print"]){Module["print"]=(function(){})}if(!Module["printErr"]){Module["printErr"]=Module["print"]}if(!Module["arguments"]){Module["arguments"]=[]}if(!Module["thisProgram"]){Module["thisProgram"]="./this.program"}if(!Module["quit"]){Module["quit"]=(function(status,toThrow){throw toThrow})}Module.print=Module["print"];Module.printErr=Module["printErr"];Module["preRun"]=[];Module["postRun"]=[];for(var key in moduleOverrides){if(moduleOverrides.hasOwnProperty(key)){Module[key]=moduleOverrides[key]}}moduleOverrides=undefined;var Runtime={setTempRet0:(function(value){tempRet0=value;return value}),getTempRet0:(function(){return tempRet0}),stackSave:(function(){return STACKTOP}),stackRestore:(function(stackTop){STACKTOP=stackTop}),getNativeTypeSize:(function(type){switch(type){case"i1":case"i8":return 1;case"i16":return 2;case"i32":return 4;case"i64":return 8;case"float":return 4;case"double":return 8;default:{if(type[type.length-1]==="*"){return Runtime.QUANTUM_SIZE}else if(type[0]==="i"){var bits=parseInt(type.substr(1));assert(bits%8===0);return bits/8}else{return 0}}}}),getNativeFieldSize:(function(type){return Math.max(Runtime.getNativeTypeSize(type),Runtime.QUANTUM_SIZE)}),STACK_ALIGN:16,prepVararg:(function(ptr,type){if(type==="double"||type==="i64"){if(ptr&7){assert((ptr&7)===4);ptr+=4}}else{assert((ptr&3)===0)}return ptr}),getAlignSize:(function(type,size,vararg){if(!vararg&&(type=="i64"||type=="double"))return 8;if(!type)return Math.min(size,8);return Math.min(size||(type?Runtime.getNativeFieldSize(type):0),Runtime.QUANTUM_SIZE)}),dynCall:(function(sig,ptr,args){if(args&&args.length){return Module["dynCall_"+sig].apply(null,[ptr].concat(args))}else{return Module["dynCall_"+sig].call(null,ptr)}}),functionPointers:[],addFunction:(function(func){for(var i=0;i<Runtime.functionPointers.length;i++){if(!Runtime.functionPointers[i]){Runtime.functionPointers[i]=func;return 2*(1+i)}}throw"Finished up all reserved function pointers. Use a higher value for RESERVED_FUNCTION_POINTERS."}),removeFunction:(function(index){Runtime.functionPointers[(index-2)/2]=null}),warnOnce:(function(text){if(!Runtime.warnOnce.shown)Runtime.warnOnce.shown={};if(!Runtime.warnOnce.shown[text]){Runtime.warnOnce.shown[text]=1;Module.printErr(text)}}),funcWrappers:{},getFuncWrapper:(function(func,sig){if(!func)return;assert(sig);if(!Runtime.funcWrappers[sig]){Runtime.funcWrappers[sig]={}}var sigCache=Runtime.funcWrappers[sig];if(!sigCache[func]){if(sig.length===1){sigCache[func]=function dynCall_wrapper(){return Runtime.dynCall(sig,func)}}else if(sig.length===2){sigCache[func]=function dynCall_wrapper(arg){return Runtime.dynCall(sig,func,[arg])}}else{sigCache[func]=function dynCall_wrapper(){return Runtime.dynCall(sig,func,Array.prototype.slice.call(arguments))}}}return sigCache[func]}),getCompilerSetting:(function(name){throw"You must build with -s RETAIN_COMPILER_SETTINGS=1 for Runtime.getCompilerSetting or emscripten_get_compiler_setting to work"}),stackAlloc:(function(size){var ret=STACKTOP;STACKTOP=STACKTOP+size|0;STACKTOP=STACKTOP+15&-16;return ret}),staticAlloc:(function(size){var ret=STATICTOP;STATICTOP=STATICTOP+size|0;STATICTOP=STATICTOP+15&-16;return ret}),dynamicAlloc:(function(size){var ret=HEAP32[DYNAMICTOP_PTR>>2];var end=(ret+size+15|0)&-16;HEAP32[DYNAMICTOP_PTR>>2]=end;if(end>=TOTAL_MEMORY){var success=enlargeMemory();if(!success){HEAP32[DYNAMICTOP_PTR>>2]=ret;return 0}}return ret}),alignMemory:(function(size,quantum){var ret=size=Math.ceil(size/(quantum?quantum:16))*(quantum?quantum:16);return ret}),makeBigInt:(function(low,high,unsigned){var ret=unsigned?+(low>>>0)+ +(high>>>0)*4294967296:+(low>>>0)+ +(high|0)*4294967296;return ret}),GLOBAL_BASE:1024,QUANTUM_SIZE:4,__dummy__:0};Module["Runtime"]=Runtime;var ABORT=0;var EXITSTATUS=0;function assert(condition,text){if(!condition){abort("Assertion failed: "+text)}}function getCFunc(ident){var func=Module["_"+ident];if(!func){try{func=eval("_"+ident)}catch(e){}}assert(func,"Cannot call unknown function "+ident+" (perhaps LLVM optimizations or closure removed it?)");return func}var cwrap,ccall;((function(){var JSfuncs={"stackSave":(function(){Runtime.stackSave()}),"stackRestore":(function(){Runtime.stackRestore()}),"arrayToC":(function(arr){var ret=Runtime.stackAlloc(arr.length);writeArrayToMemory(arr,ret);return ret}),"stringToC":(function(str){var ret=0;if(str!==null&&str!==undefined&&str!==0){var len=(str.length<<2)+1;ret=Runtime.stackAlloc(len);stringToUTF8(str,ret,len)}return ret})};var toC={"string":JSfuncs["stringToC"],"array":JSfuncs["arrayToC"]};ccall=function ccallFunc(ident,returnType,argTypes,args,opts){var func=getCFunc(ident);var cArgs=[];var stack=0;if(args){for(var i=0;i<args.length;i++){var converter=toC[argTypes[i]];if(converter){if(stack===0)stack=Runtime.stackSave();cArgs[i]=converter(args[i])}else{cArgs[i]=args[i]}}}var ret=func.apply(null,cArgs);if(returnType==="string")ret=Pointer_stringify(ret);if(stack!==0){if(opts&&opts.async){EmterpreterAsync.asyncFinalizers.push((function(){Runtime.stackRestore(stack)}));return}Runtime.stackRestore(stack)}return ret};var sourceRegex=/^function\s*[a-zA-Z$_0-9]*\s*\(([^)]*)\)\s*{\s*([^*]*?)[\s;]*(?:return\s*(.*?)[;\s]*)?}$/;function parseJSFunc(jsfunc){var parsed=jsfunc.toString().match(sourceRegex).slice(1);return{arguments:parsed[0],body:parsed[1],returnValue:parsed[2]}}var JSsource=null;function ensureJSsource(){if(!JSsource){JSsource={};for(var fun in JSfuncs){if(JSfuncs.hasOwnProperty(fun)){JSsource[fun]=parseJSFunc(JSfuncs[fun])}}}}cwrap=function cwrap(ident,returnType,argTypes){argTypes=argTypes||[];var cfunc=getCFunc(ident);var numericArgs=argTypes.every((function(type){return type==="number"}));var numericRet=returnType!=="string";if(numericRet&&numericArgs){return cfunc}var argNames=argTypes.map((function(x,i){return"$"+i}));var funcstr="(function("+argNames.join(",")+") {";var nargs=argTypes.length;if(!numericArgs){ensureJSsource();funcstr+="var stack = "+JSsource["stackSave"].body+";";for(var i=0;i<nargs;i++){var arg=argNames[i],type=argTypes[i];if(type==="number")continue;var convertCode=JSsource[type+"ToC"];funcstr+="var "+convertCode.arguments+" = "+arg+";";funcstr+=convertCode.body+";";funcstr+=arg+"=("+convertCode.returnValue+");"}}var cfuncname=parseJSFunc((function(){return cfunc})).returnValue;funcstr+="var ret = "+cfuncname+"("+argNames.join(",")+");";if(!numericRet){var strgfy=parseJSFunc((function(){return Pointer_stringify})).returnValue;funcstr+="ret = "+strgfy+"(ret);"}if(!numericArgs){ensureJSsource();funcstr+=JSsource["stackRestore"].body.replace("()","(stack)")+";"}funcstr+="return ret})";return eval(funcstr)}}))();Module["ccall"]=ccall;Module["cwrap"]=cwrap;function setValue(ptr,value,type,noSafe){type=type||"i8";if(type.charAt(type.length-1)==="*")type="i32";switch(type){case"i1":HEAP8[ptr>>0]=value;break;case"i8":HEAP8[ptr>>0]=value;break;case"i16":HEAP16[ptr>>1]=value;break;case"i32":HEAP32[ptr>>2]=value;break;case"i64":tempI64=[value>>>0,(tempDouble=value,+Math_abs(tempDouble)>=1?tempDouble>0?(Math_min(+Math_floor(tempDouble/4294967296),4294967295)|0)>>>0:~~+Math_ceil((tempDouble- +(~~tempDouble>>>0))/4294967296)>>>0:0)],HEAP32[ptr>>2]=tempI64[0],HEAP32[ptr+4>>2]=tempI64[1];break;case"float":HEAPF32[ptr>>2]=value;break;case"double":HEAPF64[ptr>>3]=value;break;default:abort("invalid type for setValue: "+type)}}Module["setValue"]=setValue;function getValue(ptr,type,noSafe){type=type||"i8";if(type.charAt(type.length-1)==="*")type="i32";switch(type){case"i1":return HEAP8[ptr>>0];case"i8":return HEAP8[ptr>>0];case"i16":return HEAP16[ptr>>1];case"i32":return HEAP32[ptr>>2];case"i64":return HEAP32[ptr>>2];case"float":return HEAPF32[ptr>>2];case"double":return HEAPF64[ptr>>3];default:abort("invalid type for setValue: "+type)}return null}Module["getValue"]=getValue;var ALLOC_NORMAL=0;var ALLOC_STACK=1;var ALLOC_STATIC=2;var ALLOC_DYNAMIC=3;var ALLOC_NONE=4;Module["ALLOC_NORMAL"]=ALLOC_NORMAL;Module["ALLOC_STACK"]=ALLOC_STACK;Module["ALLOC_STATIC"]=ALLOC_STATIC;Module["ALLOC_DYNAMIC"]=ALLOC_DYNAMIC;Module["ALLOC_NONE"]=ALLOC_NONE;function allocate(slab,types,allocator,ptr){var zeroinit,size;if(typeof slab==="number"){zeroinit=true;size=slab}else{zeroinit=false;size=slab.length}var singleType=typeof types==="string"?types:null;var ret;if(allocator==ALLOC_NONE){ret=ptr}else{ret=[typeof _malloc==="function"?_malloc:Runtime.staticAlloc,Runtime.stackAlloc,Runtime.staticAlloc,Runtime.dynamicAlloc][allocator===undefined?ALLOC_STATIC:allocator](Math.max(size,singleType?1:types.length))}if(zeroinit){var ptr=ret,stop;assert((ret&3)==0);stop=ret+(size&~3);for(;ptr<stop;ptr+=4){HEAP32[ptr>>2]=0}stop=ret+size;while(ptr<stop){HEAP8[ptr++>>0]=0}return ret}if(singleType==="i8"){if(slab.subarray||slab.slice){HEAPU8.set(slab,ret)}else{HEAPU8.set(new Uint8Array(slab),ret)}return ret}var i=0,type,typeSize,previousType;while(i<size){var curr=slab[i];if(typeof curr==="function"){curr=Runtime.getFunctionIndex(curr)}type=singleType||types[i];if(type===0){i++;continue}if(type=="i64")type="i32";setValue(ret+i,curr,type);if(previousType!==type){typeSize=Runtime.getNativeTypeSize(type);previousType=type}i+=typeSize}return ret}Module["allocate"]=allocate;function getMemory(size){if(!staticSealed)return Runtime.staticAlloc(size);if(!runtimeInitialized)return Runtime.dynamicAlloc(size);return _malloc(size)}Module["getMemory"]=getMemory;function Pointer_stringify(ptr,length){if(length===0||!ptr)return"";var hasUtf=0;var t;var i=0;while(1){t=HEAPU8[ptr+i>>0];hasUtf|=t;if(t==0&&!length)break;i++;if(length&&i==length)break}if(!length)length=i;var ret="";if(hasUtf<128){var MAX_CHUNK=1024;var curr;while(length>0){curr=String.fromCharCode.apply(String,HEAPU8.subarray(ptr,ptr+Math.min(length,MAX_CHUNK)));ret=ret?ret+curr:curr;ptr+=MAX_CHUNK;length-=MAX_CHUNK}return ret}return Module["UTF8ToString"](ptr)}Module["Pointer_stringify"]=Pointer_stringify;function AsciiToString(ptr){var str="";while(1){var ch=HEAP8[ptr++>>0];if(!ch)return str;str+=String.fromCharCode(ch)}}Module["AsciiToString"]=AsciiToString;function stringToAscii(str,outPtr){return writeAsciiToMemory(str,outPtr,false)}Module["stringToAscii"]=stringToAscii;var UTF8Decoder=typeof TextDecoder!=="undefined"?new TextDecoder("utf8"):undefined;function UTF8ArrayToString(u8Array,idx){var endPtr=idx;while(u8Array[endPtr])++endPtr;if(endPtr-idx>16&&u8Array.subarray&&UTF8Decoder){return UTF8Decoder.decode(u8Array.subarray(idx,endPtr))}else{var u0,u1,u2,u3,u4,u5;var str="";while(1){u0=u8Array[idx++];if(!u0)return str;if(!(u0&128)){str+=String.fromCharCode(u0);continue}u1=u8Array[idx++]&63;if((u0&224)==192){str+=String.fromCharCode((u0&31)<<6|u1);continue}u2=u8Array[idx++]&63;if((u0&240)==224){u0=(u0&15)<<12|u1<<6|u2}else{u3=u8Array[idx++]&63;if((u0&248)==240){u0=(u0&7)<<18|u1<<12|u2<<6|u3}else{u4=u8Array[idx++]&63;if((u0&252)==248){u0=(u0&3)<<24|u1<<18|u2<<12|u3<<6|u4}else{u5=u8Array[idx++]&63;u0=(u0&1)<<30|u1<<24|u2<<18|u3<<12|u4<<6|u5}}}if(u0<65536){str+=String.fromCharCode(u0)}else{var ch=u0-65536;str+=String.fromCharCode(55296|ch>>10,56320|ch&1023)}}}}Module["UTF8ArrayToString"]=UTF8ArrayToString;function UTF8ToString(ptr){return UTF8ArrayToString(HEAPU8,ptr)}Module["UTF8ToString"]=UTF8ToString;function stringToUTF8Array(str,outU8Array,outIdx,maxBytesToWrite){if(!(maxBytesToWrite>0))return 0;var startIdx=outIdx;var endIdx=outIdx+maxBytesToWrite-1;for(var i=0;i<str.length;++i){var u=str.charCodeAt(i);if(u>=55296&&u<=57343)u=65536+((u&1023)<<10)|str.charCodeAt(++i)&1023;if(u<=127){if(outIdx>=endIdx)break;outU8Array[outIdx++]=u}else if(u<=2047){if(outIdx+1>=endIdx)break;outU8Array[outIdx++]=192|u>>6;outU8Array[outIdx++]=128|u&63}else if(u<=65535){if(outIdx+2>=endIdx)break;outU8Array[outIdx++]=224|u>>12;outU8Array[outIdx++]=128|u>>6&63;outU8Array[outIdx++]=128|u&63}else if(u<=2097151){if(outIdx+3>=endIdx)break;outU8Array[outIdx++]=240|u>>18;outU8Array[outIdx++]=128|u>>12&63;outU8Array[outIdx++]=128|u>>6&63;outU8Array[outIdx++]=128|u&63}else if(u<=67108863){if(outIdx+4>=endIdx)break;outU8Array[outIdx++]=248|u>>24;outU8Array[outIdx++]=128|u>>18&63;outU8Array[outIdx++]=128|u>>12&63;outU8Array[outIdx++]=128|u>>6&63;outU8Array[outIdx++]=128|u&63}else{if(outIdx+5>=endIdx)break;outU8Array[outIdx++]=252|u>>30;outU8Array[outIdx++]=128|u>>24&63;outU8Array[outIdx++]=128|u>>18&63;outU8Array[outIdx++]=128|u>>12&63;outU8Array[outIdx++]=128|u>>6&63;outU8Array[outIdx++]=128|u&63}}outU8Array[outIdx]=0;return outIdx-startIdx}Module["stringToUTF8Array"]=stringToUTF8Array;function stringToUTF8(str,outPtr,maxBytesToWrite){return stringToUTF8Array(str,HEAPU8,outPtr,maxBytesToWrite)}Module["stringToUTF8"]=stringToUTF8;function lengthBytesUTF8(str){var len=0;for(var i=0;i<str.length;++i){var u=str.charCodeAt(i);if(u>=55296&&u<=57343)u=65536+((u&1023)<<10)|str.charCodeAt(++i)&1023;if(u<=127){++len}else if(u<=2047){len+=2}else if(u<=65535){len+=3}else if(u<=2097151){len+=4}else if(u<=67108863){len+=5}else{len+=6}}return len}Module["lengthBytesUTF8"]=lengthBytesUTF8;var UTF16Decoder=typeof TextDecoder!=="undefined"?new TextDecoder("utf-16le"):undefined;function demangle(func){var __cxa_demangle_func=Module["___cxa_demangle"]||Module["__cxa_demangle"];if(__cxa_demangle_func){try{var s=func.substr(1);var len=lengthBytesUTF8(s)+1;var buf=_malloc(len);stringToUTF8(s,buf,len);var status=_malloc(4);var ret=__cxa_demangle_func(buf,0,0,status);if(getValue(status,"i32")===0&&ret){return Pointer_stringify(ret)}}catch(e){}finally{if(buf)_free(buf);if(status)_free(status);if(ret)_free(ret)}return func}Runtime.warnOnce("warning: build with  -s DEMANGLE_SUPPORT=1  to link in libcxxabi demangling");return func}function demangleAll(text){var regex=/__Z[\w\d_]+/g;return text.replace(regex,(function(x){var y=demangle(x);return x===y?x:x+" ["+y+"]"}))}function jsStackTrace(){var err=new Error;if(!err.stack){try{throw new Error(0)}catch(e){err=e}if(!err.stack){return"(no stack trace available)"}}return err.stack.toString()}function stackTrace(){var js=jsStackTrace();if(Module["extraStackTrace"])js+="\n"+Module["extraStackTrace"]();return demangleAll(js)}Module["stackTrace"]=stackTrace;var WASM_PAGE_SIZE=65536;var ASMJS_PAGE_SIZE=16777216;function alignUp(x,multiple){if(x%multiple>0){x+=multiple-x%multiple}return x}var HEAP,buffer,HEAP8,HEAPU8,HEAP16,HEAPU16,HEAP32,HEAPU32,HEAPF32,HEAPF64;function updateGlobalBuffer(buf){Module["buffer"]=buffer=buf}function updateGlobalBufferViews(){Module["HEAP8"]=HEAP8=new Int8Array(buffer);Module["HEAP16"]=HEAP16=new Int16Array(buffer);Module["HEAP32"]=HEAP32=new Int32Array(buffer);Module["HEAPU8"]=HEAPU8=new Uint8Array(buffer);Module["HEAPU16"]=HEAPU16=new Uint16Array(buffer);Module["HEAPU32"]=HEAPU32=new Uint32Array(buffer);Module["HEAPF32"]=HEAPF32=new Float32Array(buffer);Module["HEAPF64"]=HEAPF64=new Float64Array(buffer)}var STATIC_BASE,STATICTOP,staticSealed;var STACK_BASE,STACKTOP,STACK_MAX;var DYNAMIC_BASE,DYNAMICTOP_PTR;STATIC_BASE=STATICTOP=STACK_BASE=STACKTOP=STACK_MAX=DYNAMIC_BASE=DYNAMICTOP_PTR=0;staticSealed=false;function abortOnCannotGrowMemory(){abort("Cannot enlarge memory arrays. Either (1) compile with  -s TOTAL_MEMORY=X  with X higher than the current value "+TOTAL_MEMORY+", (2) compile with  -s ALLOW_MEMORY_GROWTH=1  which allows increasing the size at runtime, or (3) if you want malloc to return NULL (0) instead of this abort, compile with  -s ABORTING_MALLOC=0 ")}function enlargeMemory(){abortOnCannotGrowMemory()}var TOTAL_STACK=Module["TOTAL_STACK"]||5242880;var TOTAL_MEMORY=Module["TOTAL_MEMORY"]||16777216;if(TOTAL_MEMORY<TOTAL_STACK)Module.printErr("TOTAL_MEMORY should be larger than TOTAL_STACK, was "+TOTAL_MEMORY+"! (TOTAL_STACK="+TOTAL_STACK+")");if(Module["buffer"]){buffer=Module["buffer"]}else{if(typeof WebAssembly==="object"&&typeof WebAssembly.Memory==="function"){Module["wasmMemory"]=new WebAssembly.Memory({"initial":TOTAL_MEMORY/WASM_PAGE_SIZE,"maximum":TOTAL_MEMORY/WASM_PAGE_SIZE});buffer=Module["wasmMemory"].buffer}else{buffer=new ArrayBuffer(TOTAL_MEMORY)}}updateGlobalBufferViews();function getTotalMemory(){return TOTAL_MEMORY}HEAP32[0]=1668509029;HEAP16[1]=25459;if(HEAPU8[2]!==115||HEAPU8[3]!==99)throw"Runtime error: expected the system to be little-endian!";Module["HEAP"]=HEAP;Module["buffer"]=buffer;Module["HEAP8"]=HEAP8;Module["HEAP16"]=HEAP16;Module["HEAP32"]=HEAP32;Module["HEAPU8"]=HEAPU8;Module["HEAPU16"]=HEAPU16;Module["HEAPU32"]=HEAPU32;Module["HEAPF32"]=HEAPF32;Module["HEAPF64"]=HEAPF64;function callRuntimeCallbacks(callbacks){while(callbacks.length>0){var callback=callbacks.shift();if(typeof callback=="function"){callback();continue}var func=callback.func;if(typeof func==="number"){if(callback.arg===undefined){Module["dynCall_v"](func)}else{Module["dynCall_vi"](func,callback.arg)}}else{func(callback.arg===undefined?null:callback.arg)}}}var __ATPRERUN__=[];var __ATINIT__=[];var __ATMAIN__=[];var __ATEXIT__=[];var __ATPOSTRUN__=[];var runtimeInitialized=false;var runtimeExited=false;function preRun(){if(Module["preRun"]){if(typeof Module["preRun"]=="function")Module["preRun"]=[Module["preRun"]];while(Module["preRun"].length){addOnPreRun(Module["preRun"].shift())}}callRuntimeCallbacks(__ATPRERUN__)}function ensureInitRuntime(){if(runtimeInitialized)return;runtimeInitialized=true;callRuntimeCallbacks(__ATINIT__)}function preMain(){callRuntimeCallbacks(__ATMAIN__)}function exitRuntime(){callRuntimeCallbacks(__ATEXIT__);runtimeExited=true}function postRun(){if(Module["postRun"]){if(typeof Module["postRun"]=="function")Module["postRun"]=[Module["postRun"]];while(Module["postRun"].length){addOnPostRun(Module["postRun"].shift())}}callRuntimeCallbacks(__ATPOSTRUN__)}function addOnPreRun(cb){__ATPRERUN__.unshift(cb)}Module["addOnPreRun"]=addOnPreRun;function addOnInit(cb){__ATINIT__.unshift(cb)}Module["addOnInit"]=addOnInit;function addOnPreMain(cb){__ATMAIN__.unshift(cb)}Module["addOnPreMain"]=addOnPreMain;function addOnExit(cb){__ATEXIT__.unshift(cb)}Module["addOnExit"]=addOnExit;function addOnPostRun(cb){__ATPOSTRUN__.unshift(cb)}Module["addOnPostRun"]=addOnPostRun;function intArrayFromString(stringy,dontAddNull,length){var len=length>0?length:lengthBytesUTF8(stringy)+1;var u8array=new Array(len);var numBytesWritten=stringToUTF8Array(stringy,u8array,0,u8array.length);if(dontAddNull)u8array.length=numBytesWritten;return u8array}Module["intArrayFromString"]=intArrayFromString;function intArrayToString(array){var ret=[];for(var i=0;i<array.length;i++){var chr=array[i];if(chr>255){chr&=255}ret.push(String.fromCharCode(chr))}return ret.join("")}Module["intArrayToString"]=intArrayToString;function writeStringToMemory(string,buffer,dontAddNull){Runtime.warnOnce("writeStringToMemory is deprecated and should not be called! Use stringToUTF8() instead!");var lastChar,end;if(dontAddNull){end=buffer+lengthBytesUTF8(string);lastChar=HEAP8[end]}stringToUTF8(string,buffer,Infinity);if(dontAddNull)HEAP8[end]=lastChar}Module["writeStringToMemory"]=writeStringToMemory;function writeArrayToMemory(array,buffer){HEAP8.set(array,buffer)}Module["writeArrayToMemory"]=writeArrayToMemory;function writeAsciiToMemory(str,buffer,dontAddNull){for(var i=0;i<str.length;++i){HEAP8[buffer++>>0]=str.charCodeAt(i)}if(!dontAddNull)HEAP8[buffer>>0]=0}Module["writeAsciiToMemory"]=writeAsciiToMemory;if(!Math["imul"]||Math["imul"](4294967295,5)!==-5)Math["imul"]=function imul(a,b){var ah=a>>>16;var al=a&65535;var bh=b>>>16;var bl=b&65535;return al*bl+(ah*bl+al*bh<<16)|0};Math.imul=Math["imul"];if(!Math["fround"]){var froundBuffer=new Float32Array(1);Math["fround"]=(function(x){froundBuffer[0]=x;return froundBuffer[0]})}Math.fround=Math["fround"];if(!Math["clz32"])Math["clz32"]=(function(x){x=x>>>0;for(var i=0;i<32;i++){if(x&1<<31-i)return i}return 32});Math.clz32=Math["clz32"];if(!Math["trunc"])Math["trunc"]=(function(x){return x<0?Math.ceil(x):Math.floor(x)});Math.trunc=Math["trunc"];var Math_abs=Math.abs;var Math_cos=Math.cos;var Math_sin=Math.sin;var Math_tan=Math.tan;var Math_acos=Math.acos;var Math_asin=Math.asin;var Math_atan=Math.atan;var Math_atan2=Math.atan2;var Math_exp=Math.exp;var Math_log=Math.log;var Math_sqrt=Math.sqrt;var Math_ceil=Math.ceil;var Math_floor=Math.floor;var Math_pow=Math.pow;var Math_imul=Math.imul;var Math_fround=Math.fround;var Math_round=Math.round;var Math_min=Math.min;var Math_clz32=Math.clz32;var Math_trunc=Math.trunc;var runDependencies=0;var runDependencyWatcher=null;var dependenciesFulfilled=null;function getUniqueRunDependency(id){return id}function addRunDependency(id){runDependencies++;if(Module["monitorRunDependencies"]){Module["monitorRunDependencies"](runDependencies)}}Module["addRunDependency"]=addRunDependency;function removeRunDependency(id){runDependencies--;if(Module["monitorRunDependencies"]){Module["monitorRunDependencies"](runDependencies)}if(runDependencies==0){if(runDependencyWatcher!==null){clearInterval(runDependencyWatcher);runDependencyWatcher=null}if(dependenciesFulfilled){var callback=dependenciesFulfilled;dependenciesFulfilled=null;callback()}}}Module["removeRunDependency"]=removeRunDependency;Module["preloadedImages"]={};Module["preloadedAudios"]={};var memoryInitializer=null;function integrateWasmJS(){var method=Module["wasmJSMethod"]||"native-wasm";Module["wasmJSMethod"]=method;var wasmTextFile=Module["wasmTextFile"]||"iota_bindings_emscripten-94c05393fd734924.wast";var wasmBinaryFile=Module["wasmBinaryFile"]||"iota_bindings_emscripten-94c05393fd734924.wasm";var asmjsCodeFile=Module["asmjsCodeFile"]||"iota_bindings_emscripten-94c05393fd734924.temp.asm.js";if(typeof Module["locateFile"]==="function"){wasmTextFile=Module["locateFile"](wasmTextFile);wasmBinaryFile=Module["locateFile"](wasmBinaryFile);asmjsCodeFile=Module["locateFile"](asmjsCodeFile)}var wasmPageSize=64*1024;var asm2wasmImports={"f64-rem":(function(x,y){return x%y}),"f64-to-int":(function(x){return x|0}),"i32s-div":(function(x,y){return(x|0)/(y|0)|0}),"i32u-div":(function(x,y){return(x>>>0)/(y>>>0)>>>0}),"i32s-rem":(function(x,y){return(x|0)%(y|0)|0}),"i32u-rem":(function(x,y){return(x>>>0)%(y>>>0)>>>0}),"debugger":(function(){debugger})};var info={"global":null,"env":null,"asm2wasm":asm2wasmImports,"parent":Module};var exports=null;function lookupImport(mod,base){var lookup=info;if(mod.indexOf(".")<0){lookup=(lookup||{})[mod]}else{var parts=mod.split(".");lookup=(lookup||{})[parts[0]];lookup=(lookup||{})[parts[1]]}if(base){lookup=(lookup||{})[base]}if(lookup===undefined){abort("bad lookupImport to ("+mod+")."+base)}return lookup}function mergeMemory(newBuffer){var oldBuffer=Module["buffer"];if(newBuffer.byteLength<oldBuffer.byteLength){Module["printErr"]("the new buffer in mergeMemory is smaller than the previous one. in native wasm, we should grow memory here")}var oldView=new Int8Array(oldBuffer);var newView=new Int8Array(newBuffer);if(!memoryInitializer){oldView.set(newView.subarray(Module["STATIC_BASE"],Module["STATIC_BASE"]+Module["STATIC_BUMP"]),Module["STATIC_BASE"])}newView.set(oldView);updateGlobalBuffer(newBuffer);updateGlobalBufferViews()}var WasmTypes={none:0,i32:1,i64:2,f32:3,f64:4};function fixImports(imports){if(true)return imports;var ret={};for(var i in imports){var fixed=i;if(fixed[0]=="_")fixed=fixed.substr(1);ret[fixed]=imports[i]}return ret}function getBinary(){try{var binary;if(Module["wasmBinary"]){binary=Module["wasmBinary"];binary=new Uint8Array(binary)}else if(Module["readBinary"]){binary=Module["readBinary"](wasmBinaryFile)}else{throw"on the web, we need the wasm binary to be preloaded and set on Module['wasmBinary']. emcc.py will do that for you when generating HTML (but not JS)"}return binary}catch(err){abort(err)}}function getBinaryPromise(){if(!Module["wasmBinary"]&&(ENVIRONMENT_IS_WEB||ENVIRONMENT_IS_WORKER)&&typeof fetch==="function"){return fetch(wasmBinaryFile,{credentials:"same-origin"}).then((function(response){if(!response["ok"]){throw"failed to load wasm binary file at '"+wasmBinaryFile+"'"}return response["arrayBuffer"]()}))}return new Promise((function(resolve,reject){resolve(getBinary())}))}function doNativeWasm(global,env,providedBuffer){if(typeof WebAssembly!=="object"){Module["printErr"]("no native wasm support detected");return false}if(!(Module["wasmMemory"]instanceof WebAssembly.Memory)){Module["printErr"]("no native wasm Memory in use");return false}env["memory"]=Module["wasmMemory"];info["global"]={"NaN":NaN,"Infinity":Infinity};info["global.Math"]=global.Math;info["env"]=env;function receiveInstance(instance){exports=instance.exports;if(exports.memory)mergeMemory(exports.memory);Module["asm"]=exports;Module["usingWasm"]=true;removeRunDependency("wasm-instantiate")}addRunDependency("wasm-instantiate");if(Module["instantiateWasm"]){try{return Module["instantiateWasm"](info,receiveInstance)}catch(e){Module["printErr"]("Module.instantiateWasm callback failed with error: "+e);return false}}function receiveInstantiatedSource(output){receiveInstance(output["instance"])}function instantiateArrayBuffer(receiver){getBinaryPromise().then((function(binary){return WebAssembly.instantiate(binary,info)})).then(receiver).catch((function(reason){Module["printErr"]("failed to asynchronously prepare wasm: "+reason);abort(reason)}))}if(!Module["wasmBinary"]&&typeof WebAssembly.instantiateStreaming==="function"){WebAssembly.instantiateStreaming(fetch(wasmBinaryFile,{credentials:"same-origin"}),info).then(receiveInstantiatedSource).catch((function(reason){Module["printErr"]("wasm streaming compile failed: "+reason);Module["printErr"]("falling back to ArrayBuffer instantiation");instantiateArrayBuffer(receiveInstantiatedSource)}))}else{instantiateArrayBuffer(receiveInstantiatedSource)}return{}}Module["asmPreload"]=Module["asm"];var asmjsReallocBuffer=Module["reallocBuffer"];var wasmReallocBuffer=(function(size){var PAGE_MULTIPLE=Module["usingWasm"]?WASM_PAGE_SIZE:ASMJS_PAGE_SIZE;size=alignUp(size,PAGE_MULTIPLE);var old=Module["buffer"];var oldSize=old.byteLength;if(Module["usingWasm"]){try{var result=Module["wasmMemory"].grow((size-oldSize)/wasmPageSize);if(result!==(-1|0)){return Module["buffer"]=Module["wasmMemory"].buffer}else{return null}}catch(e){return null}}else{exports["__growWasmMemory"]((size-oldSize)/wasmPageSize);return Module["buffer"]!==old?Module["buffer"]:null}});Module["reallocBuffer"]=(function(size){if(finalMethod==="asmjs"){return asmjsReallocBuffer(size)}else{return wasmReallocBuffer(size)}});var finalMethod="";Module["asm"]=(function(global,env,providedBuffer){global=fixImports(global);env=fixImports(env);if(!env["table"]){var TABLE_SIZE=Module["wasmTableSize"];if(TABLE_SIZE===undefined)TABLE_SIZE=1024;var MAX_TABLE_SIZE=Module["wasmMaxTableSize"];if(typeof WebAssembly==="object"&&typeof WebAssembly.Table==="function"){if(MAX_TABLE_SIZE!==undefined){env["table"]=new WebAssembly.Table({"initial":TABLE_SIZE,"maximum":MAX_TABLE_SIZE,"element":"anyfunc"})}else{env["table"]=new WebAssembly.Table({"initial":TABLE_SIZE,element:"anyfunc"})}}else{env["table"]=new Array(TABLE_SIZE)}Module["wasmTable"]=env["table"]}if(!env["memoryBase"]){env["memoryBase"]=Module["STATIC_BASE"]}if(!env["tableBase"]){env["tableBase"]=0}var exports;exports=doNativeWasm(global,env,providedBuffer);if(!exports)abort("no binaryen method succeeded. consider enabling more options, like interpreting, if you want that: https://github.com/kripken/emscripten/wiki/WebAssembly#binaryen-methods");return exports});var methodHandler=Module["asm"]}integrateWasmJS();var ASM_CONSTS=[];STATIC_BASE=Runtime.GLOBAL_BASE;STATICTOP=STATIC_BASE+31216;__ATINIT__.push();memoryInitializer=Module["wasmJSMethod"].indexOf("asmjs")>=0||Module["wasmJSMethod"].indexOf("interpret-asm2wasm")>=0?"iota_bindings_emscripten-94c05393fd734924.js.mem":null;var STATIC_BUMP=31216;Module["STATIC_BASE"]=STATIC_BASE;Module["STATIC_BUMP"]=STATIC_BUMP;var tempDoublePtr=STATICTOP;STATICTOP+=16;function __ZSt18uncaught_exceptionv(){return!!__ZSt18uncaught_exceptionv.uncaught_exception}var EXCEPTIONS={last:0,caught:[],infos:{},deAdjust:(function(adjusted){if(!adjusted||EXCEPTIONS.infos[adjusted])return adjusted;for(var ptr in EXCEPTIONS.infos){var info=EXCEPTIONS.infos[ptr];if(info.adjusted===adjusted){return ptr}}return adjusted}),addRef:(function(ptr){if(!ptr)return;var info=EXCEPTIONS.infos[ptr];info.refcount++}),decRef:(function(ptr){if(!ptr)return;var info=EXCEPTIONS.infos[ptr];assert(info.refcount>0);info.refcount--;if(info.refcount===0&&!info.rethrown){if(info.destructor){Module["dynCall_vi"](info.destructor,ptr)}delete EXCEPTIONS.infos[ptr];___cxa_free_exception(ptr)}}),clearRef:(function(ptr){if(!ptr)return;var info=EXCEPTIONS.infos[ptr];info.refcount=0})};function ___resumeException(ptr){if(!EXCEPTIONS.last){EXCEPTIONS.last=ptr}throw ptr}function ___cxa_find_matching_catch(){var thrown=EXCEPTIONS.last;if(!thrown){return(Runtime.setTempRet0(0),0)|0}var info=EXCEPTIONS.infos[thrown];var throwntype=info.type;if(!throwntype){return(Runtime.setTempRet0(0),thrown)|0}var typeArray=Array.prototype.slice.call(arguments);var pointer=Module["___cxa_is_pointer_type"](throwntype);if(!___cxa_find_matching_catch.buffer)___cxa_find_matching_catch.buffer=_malloc(4);HEAP32[___cxa_find_matching_catch.buffer>>2]=thrown;thrown=___cxa_find_matching_catch.buffer;for(var i=0;i<typeArray.length;i++){if(typeArray[i]&&Module["___cxa_can_catch"](typeArray[i],throwntype,thrown)){thrown=HEAP32[thrown>>2];info.adjusted=thrown;return(Runtime.setTempRet0(typeArray[i]),thrown)|0}}thrown=HEAP32[thrown>>2];return(Runtime.setTempRet0(throwntype),thrown)|0}function ___cxa_throw(ptr,type,destructor){EXCEPTIONS.infos[ptr]={ptr:ptr,adjusted:ptr,type:type,destructor:destructor,refcount:0,caught:false,rethrown:false};EXCEPTIONS.last=ptr;if(!("uncaught_exception"in __ZSt18uncaught_exceptionv)){__ZSt18uncaught_exceptionv.uncaught_exception=1}else{__ZSt18uncaught_exceptionv.uncaught_exception++}throw ptr}function __Unwind_FindEnclosingFunction(){return 0}function _pthread_mutexattr_settype(){}function _abort(){Module["abort"]()}function _pthread_cond_destroy(){return 0}function _pthread_condattr_destroy(){return 0}function ___lock(){}function ___unlock(){}var PTHREAD_SPECIFIC={};function _pthread_getspecific(key){return PTHREAD_SPECIFIC[key]||0}var PTHREAD_SPECIFIC_NEXT_KEY=1;var ERRNO_CODES={EPERM:1,ENOENT:2,ESRCH:3,EINTR:4,EIO:5,ENXIO:6,E2BIG:7,ENOEXEC:8,EBADF:9,ECHILD:10,EAGAIN:11,EWOULDBLOCK:11,ENOMEM:12,EACCES:13,EFAULT:14,ENOTBLK:15,EBUSY:16,EEXIST:17,EXDEV:18,ENODEV:19,ENOTDIR:20,EISDIR:21,EINVAL:22,ENFILE:23,EMFILE:24,ENOTTY:25,ETXTBSY:26,EFBIG:27,ENOSPC:28,ESPIPE:29,EROFS:30,EMLINK:31,EPIPE:32,EDOM:33,ERANGE:34,ENOMSG:42,EIDRM:43,ECHRNG:44,EL2NSYNC:45,EL3HLT:46,EL3RST:47,ELNRNG:48,EUNATCH:49,ENOCSI:50,EL2HLT:51,EDEADLK:35,ENOLCK:37,EBADE:52,EBADR:53,EXFULL:54,ENOANO:55,EBADRQC:56,EBADSLT:57,EDEADLOCK:35,EBFONT:59,ENOSTR:60,ENODATA:61,ETIME:62,ENOSR:63,ENONET:64,ENOPKG:65,EREMOTE:66,ENOLINK:67,EADV:68,ESRMNT:69,ECOMM:70,EPROTO:71,EMULTIHOP:72,EDOTDOT:73,EBADMSG:74,ENOTUNIQ:76,EBADFD:77,EREMCHG:78,ELIBACC:79,ELIBBAD:80,ELIBSCN:81,ELIBMAX:82,ELIBEXEC:83,ENOSYS:38,ENOTEMPTY:39,ENAMETOOLONG:36,ELOOP:40,EOPNOTSUPP:95,EPFNOSUPPORT:96,ECONNRESET:104,ENOBUFS:105,EAFNOSUPPORT:97,EPROTOTYPE:91,ENOTSOCK:88,ENOPROTOOPT:92,ESHUTDOWN:108,ECONNREFUSED:111,EADDRINUSE:98,ECONNABORTED:103,ENETUNREACH:101,ENETDOWN:100,ETIMEDOUT:110,EHOSTDOWN:112,EHOSTUNREACH:113,EINPROGRESS:115,EALREADY:114,EDESTADDRREQ:89,EMSGSIZE:90,EPROTONOSUPPORT:93,ESOCKTNOSUPPORT:94,EADDRNOTAVAIL:99,ENETRESET:102,EISCONN:106,ENOTCONN:107,ETOOMANYREFS:109,EUSERS:87,EDQUOT:122,ESTALE:116,ENOTSUP:95,ENOMEDIUM:123,EILSEQ:84,EOVERFLOW:75,ECANCELED:125,ENOTRECOVERABLE:131,EOWNERDEAD:130,ESTRPIPE:86};function _pthread_key_create(key,destructor){if(key==0){return ERRNO_CODES.EINVAL}HEAP32[key>>2]=PTHREAD_SPECIFIC_NEXT_KEY;PTHREAD_SPECIFIC[PTHREAD_SPECIFIC_NEXT_KEY]=0;PTHREAD_SPECIFIC_NEXT_KEY++;return 0}function _pthread_mutex_init(){}function _pthread_key_delete(key){if(key in PTHREAD_SPECIFIC){delete PTHREAD_SPECIFIC[key];return 0}return ERRNO_CODES.EINVAL}function _pthread_setspecific(key,value){if(!(key in PTHREAD_SPECIFIC)){return ERRNO_CODES.EINVAL}PTHREAD_SPECIFIC[key]=value;return 0}function _pthread_mutexattr_destroy(){}function ___cxa_allocate_exception(size){return _malloc(size)}var ERRNO_MESSAGES={0:"Success",1:"Not super-user",2:"No such file or directory",3:"No such process",4:"Interrupted system call",5:"I/O error",6:"No such device or address",7:"Arg list too long",8:"Exec format error",9:"Bad file number",10:"No children",11:"No more processes",12:"Not enough core",13:"Permission denied",14:"Bad address",15:"Block device required",16:"Mount device busy",17:"File exists",18:"Cross-device link",19:"No such device",20:"Not a directory",21:"Is a directory",22:"Invalid argument",23:"Too many open files in system",24:"Too many open files",25:"Not a typewriter",26:"Text file busy",27:"File too large",28:"No space left on device",29:"Illegal seek",30:"Read only file system",31:"Too many links",32:"Broken pipe",33:"Math arg out of domain of func",34:"Math result not representable",35:"File locking deadlock error",36:"File or path name too long",37:"No record locks available",38:"Function not implemented",39:"Directory not empty",40:"Too many symbolic links",42:"No message of desired type",43:"Identifier removed",44:"Channel number out of range",45:"Level 2 not synchronized",46:"Level 3 halted",47:"Level 3 reset",48:"Link number out of range",49:"Protocol driver not attached",50:"No CSI structure available",51:"Level 2 halted",52:"Invalid exchange",53:"Invalid request descriptor",54:"Exchange full",55:"No anode",56:"Invalid request code",57:"Invalid slot",59:"Bad font file fmt",60:"Device not a stream",61:"No data (for no delay io)",62:"Timer expired",63:"Out of streams resources",64:"Machine is not on the network",65:"Package not installed",66:"The object is remote",67:"The link has been severed",68:"Advertise error",69:"Srmount error",70:"Communication error on send",71:"Protocol error",72:"Multihop attempted",73:"Cross mount point (not really error)",74:"Trying to read unreadable message",75:"Value too large for defined data type",76:"Given log. name not unique",77:"f.d. invalid for this operation",78:"Remote address changed",79:"Can   access a needed shared lib",80:"Accessing a corrupted shared lib",81:".lib section in a.out corrupted",82:"Attempting to link in too many libs",83:"Attempting to exec a shared library",84:"Illegal byte sequence",86:"Streams pipe error",87:"Too many users",88:"Socket operation on non-socket",89:"Destination address required",90:"Message too long",91:"Protocol wrong type for socket",92:"Protocol not available",93:"Unknown protocol",94:"Socket type not supported",95:"Not supported",96:"Protocol family not supported",97:"Address family not supported by protocol family",98:"Address already in use",99:"Address not available",100:"Network interface is not configured",101:"Network is unreachable",102:"Connection reset by network",103:"Connection aborted",104:"Connection reset by peer",105:"No buffer space available",106:"Socket is already connected",107:"Socket is not connected",108:"Can't send after socket shutdown",109:"Too many references",110:"Connection timed out",111:"Connection refused",112:"Host is down",113:"Host is unreachable",114:"Socket already connected",115:"Connection already in progress",116:"Stale file handle",122:"Quota exceeded",123:"No medium (in tape drive)",125:"Operation canceled",130:"Previous owner died",131:"State not recoverable"};function ___setErrNo(value){if(Module["___errno_location"])HEAP32[Module["___errno_location"]()>>2]=value;return value}var PATH={splitPath:(function(filename){var splitPathRe=/^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/;return splitPathRe.exec(filename).slice(1)}),normalizeArray:(function(parts,allowAboveRoot){var up=0;for(var i=parts.length-1;i>=0;i--){var last=parts[i];if(last==="."){parts.splice(i,1)}else if(last===".."){parts.splice(i,1);up++}else if(up){parts.splice(i,1);up--}}if(allowAboveRoot){for(;up;up--){parts.unshift("..")}}return parts}),normalize:(function(path){var isAbsolute=path.charAt(0)==="/",trailingSlash=path.substr(-1)==="/";path=PATH.normalizeArray(path.split("/").filter((function(p){return!!p})),!isAbsolute).join("/");if(!path&&!isAbsolute){path="."}if(path&&trailingSlash){path+="/"}return(isAbsolute?"/":"")+path}),dirname:(function(path){var result=PATH.splitPath(path),root=result[0],dir=result[1];if(!root&&!dir){return"."}if(dir){dir=dir.substr(0,dir.length-1)}return root+dir}),basename:(function(path){if(path==="/")return"/";var lastSlash=path.lastIndexOf("/");if(lastSlash===-1)return path;return path.substr(lastSlash+1)}),extname:(function(path){return PATH.splitPath(path)[3]}),join:(function(){var paths=Array.prototype.slice.call(arguments,0);return PATH.normalize(paths.join("/"))}),join2:(function(l,r){return PATH.normalize(l+"/"+r)}),resolve:(function(){var resolvedPath="",resolvedAbsolute=false;for(var i=arguments.length-1;i>=-1&&!resolvedAbsolute;i--){var path=i>=0?arguments[i]:FS.cwd();if(typeof path!=="string"){throw new TypeError("Arguments to path.resolve must be strings")}else if(!path){return""}resolvedPath=path+"/"+resolvedPath;resolvedAbsolute=path.charAt(0)==="/"}resolvedPath=PATH.normalizeArray(resolvedPath.split("/").filter((function(p){return!!p})),!resolvedAbsolute).join("/");return(resolvedAbsolute?"/":"")+resolvedPath||"."}),relative:(function(from,to){from=PATH.resolve(from).substr(1);to=PATH.resolve(to).substr(1);function trim(arr){var start=0;for(;start<arr.length;start++){if(arr[start]!=="")break}var end=arr.length-1;for(;end>=0;end--){if(arr[end]!=="")break}if(start>end)return[];return arr.slice(start,end-start+1)}var fromParts=trim(from.split("/"));var toParts=trim(to.split("/"));var length=Math.min(fromParts.length,toParts.length);var samePartsLength=length;for(var i=0;i<length;i++){if(fromParts[i]!==toParts[i]){samePartsLength=i;break}}var outputParts=[];for(var i=samePartsLength;i<fromParts.length;i++){outputParts.push("..")}outputParts=outputParts.concat(toParts.slice(samePartsLength));return outputParts.join("/")})};var TTY={ttys:[],init:(function(){}),shutdown:(function(){}),register:(function(dev,ops){TTY.ttys[dev]={input:[],output:[],ops:ops};FS.registerDevice(dev,TTY.stream_ops)}),stream_ops:{open:(function(stream){var tty=TTY.ttys[stream.node.rdev];if(!tty){throw new FS.ErrnoError(ERRNO_CODES.ENODEV)}stream.tty=tty;stream.seekable=false}),close:(function(stream){stream.tty.ops.flush(stream.tty)}),flush:(function(stream){stream.tty.ops.flush(stream.tty)}),read:(function(stream,buffer,offset,length,pos){if(!stream.tty||!stream.tty.ops.get_char){throw new FS.ErrnoError(ERRNO_CODES.ENXIO)}var bytesRead=0;for(var i=0;i<length;i++){var result;try{result=stream.tty.ops.get_char(stream.tty)}catch(e){throw new FS.ErrnoError(ERRNO_CODES.EIO)}if(result===undefined&&bytesRead===0){throw new FS.ErrnoError(ERRNO_CODES.EAGAIN)}if(result===null||result===undefined)break;bytesRead++;buffer[offset+i]=result}if(bytesRead){stream.node.timestamp=Date.now()}return bytesRead}),write:(function(stream,buffer,offset,length,pos){if(!stream.tty||!stream.tty.ops.put_char){throw new FS.ErrnoError(ERRNO_CODES.ENXIO)}for(var i=0;i<length;i++){try{stream.tty.ops.put_char(stream.tty,buffer[offset+i])}catch(e){throw new FS.ErrnoError(ERRNO_CODES.EIO)}}if(length){stream.node.timestamp=Date.now()}return i})},default_tty_ops:{get_char:(function(tty){if(!tty.input.length){var result=null;if(ENVIRONMENT_IS_NODE){var BUFSIZE=256;var buf=new Buffer(BUFSIZE);var bytesRead=0;var isPosixPlatform=process.platform!="win32";var fd=process.stdin.fd;if(isPosixPlatform){var usingDevice=false;try{fd=fs.openSync("/dev/stdin","r");usingDevice=true}catch(e){}}try{bytesRead=fs.readSync(fd,buf,0,BUFSIZE,null)}catch(e){if(e.toString().indexOf("EOF")!=-1)bytesRead=0;else throw e}if(usingDevice){fs.closeSync(fd)}if(bytesRead>0){result=buf.slice(0,bytesRead).toString("utf-8")}else{result=null}}else if(typeof window!="undefined"&&typeof window.prompt=="function"){result=window.prompt("Input: ");if(result!==null){result+="\n"}}else if(typeof readline=="function"){result=readline();if(result!==null){result+="\n"}}if(!result){return null}tty.input=intArrayFromString(result,true)}return tty.input.shift()}),put_char:(function(tty,val){if(val===null||val===10){Module["print"](UTF8ArrayToString(tty.output,0));tty.output=[]}else{if(val!=0)tty.output.push(val)}}),flush:(function(tty){if(tty.output&&tty.output.length>0){Module["print"](UTF8ArrayToString(tty.output,0));tty.output=[]}})},default_tty1_ops:{put_char:(function(tty,val){if(val===null||val===10){Module["printErr"](UTF8ArrayToString(tty.output,0));tty.output=[]}else{if(val!=0)tty.output.push(val)}}),flush:(function(tty){if(tty.output&&tty.output.length>0){Module["printErr"](UTF8ArrayToString(tty.output,0));tty.output=[]}})}};var MEMFS={ops_table:null,mount:(function(mount){return MEMFS.createNode(null,"/",16384|511,0)}),createNode:(function(parent,name,mode,dev){if(FS.isBlkdev(mode)||FS.isFIFO(mode)){throw new FS.ErrnoError(ERRNO_CODES.EPERM)}if(!MEMFS.ops_table){MEMFS.ops_table={dir:{node:{getattr:MEMFS.node_ops.getattr,setattr:MEMFS.node_ops.setattr,lookup:MEMFS.node_ops.lookup,mknod:MEMFS.node_ops.mknod,rename:MEMFS.node_ops.rename,unlink:MEMFS.node_ops.unlink,rmdir:MEMFS.node_ops.rmdir,readdir:MEMFS.node_ops.readdir,symlink:MEMFS.node_ops.symlink},stream:{llseek:MEMFS.stream_ops.llseek}},file:{node:{getattr:MEMFS.node_ops.getattr,setattr:MEMFS.node_ops.setattr},stream:{llseek:MEMFS.stream_ops.llseek,read:MEMFS.stream_ops.read,write:MEMFS.stream_ops.write,allocate:MEMFS.stream_ops.allocate,mmap:MEMFS.stream_ops.mmap,msync:MEMFS.stream_ops.msync}},link:{node:{getattr:MEMFS.node_ops.getattr,setattr:MEMFS.node_ops.setattr,readlink:MEMFS.node_ops.readlink},stream:{}},chrdev:{node:{getattr:MEMFS.node_ops.getattr,setattr:MEMFS.node_ops.setattr},stream:FS.chrdev_stream_ops}}}var node=FS.createNode(parent,name,mode,dev);if(FS.isDir(node.mode)){node.node_ops=MEMFS.ops_table.dir.node;node.stream_ops=MEMFS.ops_table.dir.stream;node.contents={}}else if(FS.isFile(node.mode)){node.node_ops=MEMFS.ops_table.file.node;node.stream_ops=MEMFS.ops_table.file.stream;node.usedBytes=0;node.contents=null}else if(FS.isLink(node.mode)){node.node_ops=MEMFS.ops_table.link.node;node.stream_ops=MEMFS.ops_table.link.stream}else if(FS.isChrdev(node.mode)){node.node_ops=MEMFS.ops_table.chrdev.node;node.stream_ops=MEMFS.ops_table.chrdev.stream}node.timestamp=Date.now();if(parent){parent.contents[name]=node}return node}),getFileDataAsRegularArray:(function(node){if(node.contents&&node.contents.subarray){var arr=[];for(var i=0;i<node.usedBytes;++i)arr.push(node.contents[i]);return arr}return node.contents}),getFileDataAsTypedArray:(function(node){if(!node.contents)return new Uint8Array;if(node.contents.subarray)return node.contents.subarray(0,node.usedBytes);return new Uint8Array(node.contents)}),expandFileStorage:(function(node,newCapacity){if(node.contents&&node.contents.subarray&&newCapacity>node.contents.length){node.contents=MEMFS.getFileDataAsRegularArray(node);node.usedBytes=node.contents.length}if(!node.contents||node.contents.subarray){var prevCapacity=node.contents?node.contents.length:0;if(prevCapacity>=newCapacity)return;var CAPACITY_DOUBLING_MAX=1024*1024;newCapacity=Math.max(newCapacity,prevCapacity*(prevCapacity<CAPACITY_DOUBLING_MAX?2:1.125)|0);if(prevCapacity!=0)newCapacity=Math.max(newCapacity,256);var oldContents=node.contents;node.contents=new Uint8Array(newCapacity);if(node.usedBytes>0)node.contents.set(oldContents.subarray(0,node.usedBytes),0);return}if(!node.contents&&newCapacity>0)node.contents=[];while(node.contents.length<newCapacity)node.contents.push(0)}),resizeFileStorage:(function(node,newSize){if(node.usedBytes==newSize)return;if(newSize==0){node.contents=null;node.usedBytes=0;return}if(!node.contents||node.contents.subarray){var oldContents=node.contents;node.contents=new Uint8Array(new ArrayBuffer(newSize));if(oldContents){node.contents.set(oldContents.subarray(0,Math.min(newSize,node.usedBytes)))}node.usedBytes=newSize;return}if(!node.contents)node.contents=[];if(node.contents.length>newSize)node.contents.length=newSize;else while(node.contents.length<newSize)node.contents.push(0);node.usedBytes=newSize}),node_ops:{getattr:(function(node){var attr={};attr.dev=FS.isChrdev(node.mode)?node.id:1;attr.ino=node.id;attr.mode=node.mode;attr.nlink=1;attr.uid=0;attr.gid=0;attr.rdev=node.rdev;if(FS.isDir(node.mode)){attr.size=4096}else if(FS.isFile(node.mode)){attr.size=node.usedBytes}else if(FS.isLink(node.mode)){attr.size=node.link.length}else{attr.size=0}attr.atime=new Date(node.timestamp);attr.mtime=new Date(node.timestamp);attr.ctime=new Date(node.timestamp);attr.blksize=4096;attr.blocks=Math.ceil(attr.size/attr.blksize);return attr}),setattr:(function(node,attr){if(attr.mode!==undefined){node.mode=attr.mode}if(attr.timestamp!==undefined){node.timestamp=attr.timestamp}if(attr.size!==undefined){MEMFS.resizeFileStorage(node,attr.size)}}),lookup:(function(parent,name){throw FS.genericErrors[ERRNO_CODES.ENOENT]}),mknod:(function(parent,name,mode,dev){return MEMFS.createNode(parent,name,mode,dev)}),rename:(function(old_node,new_dir,new_name){if(FS.isDir(old_node.mode)){var new_node;try{new_node=FS.lookupNode(new_dir,new_name)}catch(e){}if(new_node){for(var i in new_node.contents){throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY)}}}delete old_node.parent.contents[old_node.name];old_node.name=new_name;new_dir.contents[new_name]=old_node;old_node.parent=new_dir}),unlink:(function(parent,name){delete parent.contents[name]}),rmdir:(function(parent,name){var node=FS.lookupNode(parent,name);for(var i in node.contents){throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY)}delete parent.contents[name]}),readdir:(function(node){var entries=[".",".."];for(var key in node.contents){if(!node.contents.hasOwnProperty(key)){continue}entries.push(key)}return entries}),symlink:(function(parent,newname,oldpath){var node=MEMFS.createNode(parent,newname,511|40960,0);node.link=oldpath;return node}),readlink:(function(node){if(!FS.isLink(node.mode)){throw new FS.ErrnoError(ERRNO_CODES.EINVAL)}return node.link})},stream_ops:{read:(function(stream,buffer,offset,length,position){var contents=stream.node.contents;if(position>=stream.node.usedBytes)return 0;var size=Math.min(stream.node.usedBytes-position,length);assert(size>=0);if(size>8&&contents.subarray){buffer.set(contents.subarray(position,position+size),offset)}else{for(var i=0;i<size;i++)buffer[offset+i]=contents[position+i]}return size}),write:(function(stream,buffer,offset,length,position,canOwn){if(!length)return 0;var node=stream.node;node.timestamp=Date.now();if(buffer.subarray&&(!node.contents||node.contents.subarray)){if(canOwn){node.contents=buffer.subarray(offset,offset+length);node.usedBytes=length;return length}else if(node.usedBytes===0&&position===0){node.contents=new Uint8Array(buffer.subarray(offset,offset+length));node.usedBytes=length;return length}else if(position+length<=node.usedBytes){node.contents.set(buffer.subarray(offset,offset+length),position);return length}}MEMFS.expandFileStorage(node,position+length);if(node.contents.subarray&&buffer.subarray)node.contents.set(buffer.subarray(offset,offset+length),position);else{for(var i=0;i<length;i++){node.contents[position+i]=buffer[offset+i]}}node.usedBytes=Math.max(node.usedBytes,position+length);return length}),llseek:(function(stream,offset,whence){var position=offset;if(whence===1){position+=stream.position}else if(whence===2){if(FS.isFile(stream.node.mode)){position+=stream.node.usedBytes}}if(position<0){throw new FS.ErrnoError(ERRNO_CODES.EINVAL)}return position}),allocate:(function(stream,offset,length){MEMFS.expandFileStorage(stream.node,offset+length);stream.node.usedBytes=Math.max(stream.node.usedBytes,offset+length)}),mmap:(function(stream,buffer,offset,length,position,prot,flags){if(!FS.isFile(stream.node.mode)){throw new FS.ErrnoError(ERRNO_CODES.ENODEV)}var ptr;var allocated;var contents=stream.node.contents;if(!(flags&2)&&(contents.buffer===buffer||contents.buffer===buffer.buffer)){allocated=false;ptr=contents.byteOffset}else{if(position>0||position+length<stream.node.usedBytes){if(contents.subarray){contents=contents.subarray(position,position+length)}else{contents=Array.prototype.slice.call(contents,position,position+length)}}allocated=true;ptr=_malloc(length);if(!ptr){throw new FS.ErrnoError(ERRNO_CODES.ENOMEM)}buffer.set(contents,ptr)}return{ptr:ptr,allocated:allocated}}),msync:(function(stream,buffer,offset,length,mmapFlags){if(!FS.isFile(stream.node.mode)){throw new FS.ErrnoError(ERRNO_CODES.ENODEV)}if(mmapFlags&2){return 0}var bytesWritten=MEMFS.stream_ops.write(stream,buffer,0,length,offset,false);return 0})}};var IDBFS={dbs:{},indexedDB:(function(){if(typeof indexedDB!=="undefined")return indexedDB;var ret=null;if(typeof window==="object")ret=window.indexedDB||window.mozIndexedDB||window.webkitIndexedDB||window.msIndexedDB;assert(ret,"IDBFS used, but indexedDB not supported");return ret}),DB_VERSION:21,DB_STORE_NAME:"FILE_DATA",mount:(function(mount){return MEMFS.mount.apply(null,arguments)}),syncfs:(function(mount,populate,callback){IDBFS.getLocalSet(mount,(function(err,local){if(err)return callback(err);IDBFS.getRemoteSet(mount,(function(err,remote){if(err)return callback(err);var src=populate?remote:local;var dst=populate?local:remote;IDBFS.reconcile(src,dst,callback)}))}))}),getDB:(function(name,callback){var db=IDBFS.dbs[name];if(db){return callback(null,db)}var req;try{req=IDBFS.indexedDB().open(name,IDBFS.DB_VERSION)}catch(e){return callback(e)}if(!req){return callback("Unable to connect to IndexedDB")}req.onupgradeneeded=(function(e){var db=e.target.result;var transaction=e.target.transaction;var fileStore;if(db.objectStoreNames.contains(IDBFS.DB_STORE_NAME)){fileStore=transaction.objectStore(IDBFS.DB_STORE_NAME)}else{fileStore=db.createObjectStore(IDBFS.DB_STORE_NAME)}if(!fileStore.indexNames.contains("timestamp")){fileStore.createIndex("timestamp","timestamp",{unique:false})}});req.onsuccess=(function(){db=req.result;IDBFS.dbs[name]=db;callback(null,db)});req.onerror=(function(e){callback(this.error);e.preventDefault()})}),getLocalSet:(function(mount,callback){var entries={};function isRealDir(p){return p!=="."&&p!==".."}function toAbsolute(root){return(function(p){return PATH.join2(root,p)})}var check=FS.readdir(mount.mountpoint).filter(isRealDir).map(toAbsolute(mount.mountpoint));while(check.length){var path=check.pop();var stat;try{stat=FS.stat(path)}catch(e){return callback(e)}if(FS.isDir(stat.mode)){check.push.apply(check,FS.readdir(path).filter(isRealDir).map(toAbsolute(path)))}entries[path]={timestamp:stat.mtime}}return callback(null,{type:"local",entries:entries})}),getRemoteSet:(function(mount,callback){var entries={};IDBFS.getDB(mount.mountpoint,(function(err,db){if(err)return callback(err);var transaction=db.transaction([IDBFS.DB_STORE_NAME],"readonly");transaction.onerror=(function(e){callback(this.error);e.preventDefault()});var store=transaction.objectStore(IDBFS.DB_STORE_NAME);var index=store.index("timestamp");index.openKeyCursor().onsuccess=(function(event){var cursor=event.target.result;if(!cursor){return callback(null,{type:"remote",db:db,entries:entries})}entries[cursor.primaryKey]={timestamp:cursor.key};cursor.continue()})}))}),loadLocalEntry:(function(path,callback){var stat,node;try{var lookup=FS.lookupPath(path);node=lookup.node;stat=FS.stat(path)}catch(e){return callback(e)}if(FS.isDir(stat.mode)){return callback(null,{timestamp:stat.mtime,mode:stat.mode})}else if(FS.isFile(stat.mode)){node.contents=MEMFS.getFileDataAsTypedArray(node);return callback(null,{timestamp:stat.mtime,mode:stat.mode,contents:node.contents})}else{return callback(new Error("node type not supported"))}}),storeLocalEntry:(function(path,entry,callback){try{if(FS.isDir(entry.mode)){FS.mkdir(path,entry.mode)}else if(FS.isFile(entry.mode)){FS.writeFile(path,entry.contents,{encoding:"binary",canOwn:true})}else{return callback(new Error("node type not supported"))}FS.chmod(path,entry.mode);FS.utime(path,entry.timestamp,entry.timestamp)}catch(e){return callback(e)}callback(null)}),removeLocalEntry:(function(path,callback){try{var lookup=FS.lookupPath(path);var stat=FS.stat(path);if(FS.isDir(stat.mode)){FS.rmdir(path)}else if(FS.isFile(stat.mode)){FS.unlink(path)}}catch(e){return callback(e)}callback(null)}),loadRemoteEntry:(function(store,path,callback){var req=store.get(path);req.onsuccess=(function(event){callback(null,event.target.result)});req.onerror=(function(e){callback(this.error);e.preventDefault()})}),storeRemoteEntry:(function(store,path,entry,callback){var req=store.put(entry,path);req.onsuccess=(function(){callback(null)});req.onerror=(function(e){callback(this.error);e.preventDefault()})}),removeRemoteEntry:(function(store,path,callback){var req=store.delete(path);req.onsuccess=(function(){callback(null)});req.onerror=(function(e){callback(this.error);e.preventDefault()})}),reconcile:(function(src,dst,callback){var total=0;var create=[];Object.keys(src.entries).forEach((function(key){var e=src.entries[key];var e2=dst.entries[key];if(!e2||e.timestamp>e2.timestamp){create.push(key);total++}}));var remove=[];Object.keys(dst.entries).forEach((function(key){var e=dst.entries[key];var e2=src.entries[key];if(!e2){remove.push(key);total++}}));if(!total){return callback(null)}var completed=0;var db=src.type==="remote"?src.db:dst.db;var transaction=db.transaction([IDBFS.DB_STORE_NAME],"readwrite");var store=transaction.objectStore(IDBFS.DB_STORE_NAME);function done(err){if(err){if(!done.errored){done.errored=true;return callback(err)}return}if(++completed>=total){return callback(null)}}transaction.onerror=(function(e){done(this.error);e.preventDefault()});create.sort().forEach((function(path){if(dst.type==="local"){IDBFS.loadRemoteEntry(store,path,(function(err,entry){if(err)return done(err);IDBFS.storeLocalEntry(path,entry,done)}))}else{IDBFS.loadLocalEntry(path,(function(err,entry){if(err)return done(err);IDBFS.storeRemoteEntry(store,path,entry,done)}))}}));remove.sort().reverse().forEach((function(path){if(dst.type==="local"){IDBFS.removeLocalEntry(path,done)}else{IDBFS.removeRemoteEntry(store,path,done)}}))})};var NODEFS={isWindows:false,staticInit:(function(){NODEFS.isWindows=!!process.platform.match(/^win/)}),mount:(function(mount){assert(ENVIRONMENT_IS_NODE);return NODEFS.createNode(null,"/",NODEFS.getMode(mount.opts.root),0)}),createNode:(function(parent,name,mode,dev){if(!FS.isDir(mode)&&!FS.isFile(mode)&&!FS.isLink(mode)){throw new FS.ErrnoError(ERRNO_CODES.EINVAL)}var node=FS.createNode(parent,name,mode);node.node_ops=NODEFS.node_ops;node.stream_ops=NODEFS.stream_ops;return node}),getMode:(function(path){var stat;try{stat=fs.lstatSync(path);if(NODEFS.isWindows){stat.mode=stat.mode|(stat.mode&146)>>1}}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(ERRNO_CODES[e.code])}return stat.mode}),realPath:(function(node){var parts=[];while(node.parent!==node){parts.push(node.name);node=node.parent}parts.push(node.mount.opts.root);parts.reverse();return PATH.join.apply(null,parts)}),flagsToPermissionStringMap:{0:"r",1:"r+",2:"r+",64:"r",65:"r+",66:"r+",129:"rx+",193:"rx+",514:"w+",577:"w",578:"w+",705:"wx",706:"wx+",1024:"a",1025:"a",1026:"a+",1089:"a",1090:"a+",1153:"ax",1154:"ax+",1217:"ax",1218:"ax+",4096:"rs",4098:"rs+"},flagsToPermissionString:(function(flags){flags&=~2097152;flags&=~2048;flags&=~32768;flags&=~524288;if(flags in NODEFS.flagsToPermissionStringMap){return NODEFS.flagsToPermissionStringMap[flags]}else{throw new FS.ErrnoError(ERRNO_CODES.EINVAL)}}),node_ops:{getattr:(function(node){var path=NODEFS.realPath(node);var stat;try{stat=fs.lstatSync(path)}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(ERRNO_CODES[e.code])}if(NODEFS.isWindows&&!stat.blksize){stat.blksize=4096}if(NODEFS.isWindows&&!stat.blocks){stat.blocks=(stat.size+stat.blksize-1)/stat.blksize|0}return{dev:stat.dev,ino:stat.ino,mode:stat.mode,nlink:stat.nlink,uid:stat.uid,gid:stat.gid,rdev:stat.rdev,size:stat.size,atime:stat.atime,mtime:stat.mtime,ctime:stat.ctime,blksize:stat.blksize,blocks:stat.blocks}}),setattr:(function(node,attr){var path=NODEFS.realPath(node);try{if(attr.mode!==undefined){fs.chmodSync(path,attr.mode);node.mode=attr.mode}if(attr.timestamp!==undefined){var date=new Date(attr.timestamp);fs.utimesSync(path,date,date)}if(attr.size!==undefined){fs.truncateSync(path,attr.size)}}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(ERRNO_CODES[e.code])}}),lookup:(function(parent,name){var path=PATH.join2(NODEFS.realPath(parent),name);var mode=NODEFS.getMode(path);return NODEFS.createNode(parent,name,mode)}),mknod:(function(parent,name,mode,dev){var node=NODEFS.createNode(parent,name,mode,dev);var path=NODEFS.realPath(node);try{if(FS.isDir(node.mode)){fs.mkdirSync(path,node.mode)}else{fs.writeFileSync(path,"",{mode:node.mode})}}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(ERRNO_CODES[e.code])}return node}),rename:(function(oldNode,newDir,newName){var oldPath=NODEFS.realPath(oldNode);var newPath=PATH.join2(NODEFS.realPath(newDir),newName);try{fs.renameSync(oldPath,newPath)}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(ERRNO_CODES[e.code])}}),unlink:(function(parent,name){var path=PATH.join2(NODEFS.realPath(parent),name);try{fs.unlinkSync(path)}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(ERRNO_CODES[e.code])}}),rmdir:(function(parent,name){var path=PATH.join2(NODEFS.realPath(parent),name);try{fs.rmdirSync(path)}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(ERRNO_CODES[e.code])}}),readdir:(function(node){var path=NODEFS.realPath(node);try{return fs.readdirSync(path)}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(ERRNO_CODES[e.code])}}),symlink:(function(parent,newName,oldPath){var newPath=PATH.join2(NODEFS.realPath(parent),newName);try{fs.symlinkSync(oldPath,newPath)}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(ERRNO_CODES[e.code])}}),readlink:(function(node){var path=NODEFS.realPath(node);try{path=fs.readlinkSync(path);path=NODEJS_PATH.relative(NODEJS_PATH.resolve(node.mount.opts.root),path);return path}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(ERRNO_CODES[e.code])}})},stream_ops:{open:(function(stream){var path=NODEFS.realPath(stream.node);try{if(FS.isFile(stream.node.mode)){stream.nfd=fs.openSync(path,NODEFS.flagsToPermissionString(stream.flags))}}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(ERRNO_CODES[e.code])}}),close:(function(stream){try{if(FS.isFile(stream.node.mode)&&stream.nfd){fs.closeSync(stream.nfd)}}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(ERRNO_CODES[e.code])}}),read:(function(stream,buffer,offset,length,position){if(length===0)return 0;var nbuffer=new Buffer(length);var res;try{res=fs.readSync(stream.nfd,nbuffer,0,length,position)}catch(e){throw new FS.ErrnoError(ERRNO_CODES[e.code])}if(res>0){for(var i=0;i<res;i++){buffer[offset+i]=nbuffer[i]}}return res}),write:(function(stream,buffer,offset,length,position){var nbuffer=new Buffer(buffer.subarray(offset,offset+length));var res;try{res=fs.writeSync(stream.nfd,nbuffer,0,length,position)}catch(e){throw new FS.ErrnoError(ERRNO_CODES[e.code])}return res}),llseek:(function(stream,offset,whence){var position=offset;if(whence===1){position+=stream.position}else if(whence===2){if(FS.isFile(stream.node.mode)){try{var stat=fs.fstatSync(stream.nfd);position+=stat.size}catch(e){throw new FS.ErrnoError(ERRNO_CODES[e.code])}}}if(position<0){throw new FS.ErrnoError(ERRNO_CODES.EINVAL)}return position})}};var WORKERFS={DIR_MODE:16895,FILE_MODE:33279,reader:null,mount:(function(mount){assert(ENVIRONMENT_IS_WORKER);if(!WORKERFS.reader)WORKERFS.reader=new FileReaderSync;var root=WORKERFS.createNode(null,"/",WORKERFS.DIR_MODE,0);var createdParents={};function ensureParent(path){var parts=path.split("/");var parent=root;for(var i=0;i<parts.length-1;i++){var curr=parts.slice(0,i+1).join("/");if(!createdParents[curr]){createdParents[curr]=WORKERFS.createNode(parent,parts[i],WORKERFS.DIR_MODE,0)}parent=createdParents[curr]}return parent}function base(path){var parts=path.split("/");return parts[parts.length-1]}Array.prototype.forEach.call(mount.opts["files"]||[],(function(file){WORKERFS.createNode(ensureParent(file.name),base(file.name),WORKERFS.FILE_MODE,0,file,file.lastModifiedDate)}));(mount.opts["blobs"]||[]).forEach((function(obj){WORKERFS.createNode(ensureParent(obj["name"]),base(obj["name"]),WORKERFS.FILE_MODE,0,obj["data"])}));(mount.opts["packages"]||[]).forEach((function(pack){pack["metadata"].files.forEach((function(file){var name=file.filename.substr(1);WORKERFS.createNode(ensureParent(name),base(name),WORKERFS.FILE_MODE,0,pack["blob"].slice(file.start,file.end))}))}));return root}),createNode:(function(parent,name,mode,dev,contents,mtime){var node=FS.createNode(parent,name,mode);node.mode=mode;node.node_ops=WORKERFS.node_ops;node.stream_ops=WORKERFS.stream_ops;node.timestamp=(mtime||new Date).getTime();assert(WORKERFS.FILE_MODE!==WORKERFS.DIR_MODE);if(mode===WORKERFS.FILE_MODE){node.size=contents.size;node.contents=contents}else{node.size=4096;node.contents={}}if(parent){parent.contents[name]=node}return node}),node_ops:{getattr:(function(node){return{dev:1,ino:undefined,mode:node.mode,nlink:1,uid:0,gid:0,rdev:undefined,size:node.size,atime:new Date(node.timestamp),mtime:new Date(node.timestamp),ctime:new Date(node.timestamp),blksize:4096,blocks:Math.ceil(node.size/4096)}}),setattr:(function(node,attr){if(attr.mode!==undefined){node.mode=attr.mode}if(attr.timestamp!==undefined){node.timestamp=attr.timestamp}}),lookup:(function(parent,name){throw new FS.ErrnoError(ERRNO_CODES.ENOENT)}),mknod:(function(parent,name,mode,dev){throw new FS.ErrnoError(ERRNO_CODES.EPERM)}),rename:(function(oldNode,newDir,newName){throw new FS.ErrnoError(ERRNO_CODES.EPERM)}),unlink:(function(parent,name){throw new FS.ErrnoError(ERRNO_CODES.EPERM)}),rmdir:(function(parent,name){throw new FS.ErrnoError(ERRNO_CODES.EPERM)}),readdir:(function(node){var entries=[".",".."];for(var key in node.contents){if(!node.contents.hasOwnProperty(key)){continue}entries.push(key)}return entries}),symlink:(function(parent,newName,oldPath){throw new FS.ErrnoError(ERRNO_CODES.EPERM)}),readlink:(function(node){throw new FS.ErrnoError(ERRNO_CODES.EPERM)})},stream_ops:{read:(function(stream,buffer,offset,length,position){if(position>=stream.node.size)return 0;var chunk=stream.node.contents.slice(position,position+length);var ab=WORKERFS.reader.readAsArrayBuffer(chunk);buffer.set(new Uint8Array(ab),offset);return chunk.size}),write:(function(stream,buffer,offset,length,position){throw new FS.ErrnoError(ERRNO_CODES.EIO)}),llseek:(function(stream,offset,whence){var position=offset;if(whence===1){position+=stream.position}else if(whence===2){if(FS.isFile(stream.node.mode)){position+=stream.node.size}}if(position<0){throw new FS.ErrnoError(ERRNO_CODES.EINVAL)}return position})}};STATICTOP+=16;STATICTOP+=16;STATICTOP+=16;var FS={root:null,mounts:[],devices:[null],streams:[],nextInode:1,nameTable:null,currentPath:"/",initialized:false,ignorePermissions:true,trackingDelegate:{},tracking:{openFlags:{READ:1,WRITE:2}},ErrnoError:null,genericErrors:{},filesystems:null,syncFSRequests:0,handleFSError:(function(e){if(!(e instanceof FS.ErrnoError))throw e+" : "+stackTrace();return ___setErrNo(e.errno)}),lookupPath:(function(path,opts){path=PATH.resolve(FS.cwd(),path);opts=opts||{};if(!path)return{path:"",node:null};var defaults={follow_mount:true,recurse_count:0};for(var key in defaults){if(opts[key]===undefined){opts[key]=defaults[key]}}if(opts.recurse_count>8){throw new FS.ErrnoError(ERRNO_CODES.ELOOP)}var parts=PATH.normalizeArray(path.split("/").filter((function(p){return!!p})),false);var current=FS.root;var current_path="/";for(var i=0;i<parts.length;i++){var islast=i===parts.length-1;if(islast&&opts.parent){break}current=FS.lookupNode(current,parts[i]);current_path=PATH.join2(current_path,parts[i]);if(FS.isMountpoint(current)){if(!islast||islast&&opts.follow_mount){current=current.mounted.root}}if(!islast||opts.follow){var count=0;while(FS.isLink(current.mode)){var link=FS.readlink(current_path);current_path=PATH.resolve(PATH.dirname(current_path),link);var lookup=FS.lookupPath(current_path,{recurse_count:opts.recurse_count});current=lookup.node;if(count++>40){throw new FS.ErrnoError(ERRNO_CODES.ELOOP)}}}}return{path:current_path,node:current}}),getPath:(function(node){var path;while(true){if(FS.isRoot(node)){var mount=node.mount.mountpoint;if(!path)return mount;return mount[mount.length-1]!=="/"?mount+"/"+path:mount+path}path=path?node.name+"/"+path:node.name;node=node.parent}}),hashName:(function(parentid,name){var hash=0;for(var i=0;i<name.length;i++){hash=(hash<<5)-hash+name.charCodeAt(i)|0}return(parentid+hash>>>0)%FS.nameTable.length}),hashAddNode:(function(node){var hash=FS.hashName(node.parent.id,node.name);node.name_next=FS.nameTable[hash];FS.nameTable[hash]=node}),hashRemoveNode:(function(node){var hash=FS.hashName(node.parent.id,node.name);if(FS.nameTable[hash]===node){FS.nameTable[hash]=node.name_next}else{var current=FS.nameTable[hash];while(current){if(current.name_next===node){current.name_next=node.name_next;break}current=current.name_next}}}),lookupNode:(function(parent,name){var err=FS.mayLookup(parent);if(err){throw new FS.ErrnoError(err,parent)}var hash=FS.hashName(parent.id,name);for(var node=FS.nameTable[hash];node;node=node.name_next){var nodeName=node.name;if(node.parent.id===parent.id&&nodeName===name){return node}}return FS.lookup(parent,name)}),createNode:(function(parent,name,mode,rdev){if(!FS.FSNode){FS.FSNode=(function(parent,name,mode,rdev){if(!parent){parent=this}this.parent=parent;this.mount=parent.mount;this.mounted=null;this.id=FS.nextInode++;this.name=name;this.mode=mode;this.node_ops={};this.stream_ops={};this.rdev=rdev});FS.FSNode.prototype={};var readMode=292|73;var writeMode=146;Object.defineProperties(FS.FSNode.prototype,{read:{get:(function(){return(this.mode&readMode)===readMode}),set:(function(val){val?this.mode|=readMode:this.mode&=~readMode})},write:{get:(function(){return(this.mode&writeMode)===writeMode}),set:(function(val){val?this.mode|=writeMode:this.mode&=~writeMode})},isFolder:{get:(function(){return FS.isDir(this.mode)})},isDevice:{get:(function(){return FS.isChrdev(this.mode)})}})}var node=new FS.FSNode(parent,name,mode,rdev);FS.hashAddNode(node);return node}),destroyNode:(function(node){FS.hashRemoveNode(node)}),isRoot:(function(node){return node===node.parent}),isMountpoint:(function(node){return!!node.mounted}),isFile:(function(mode){return(mode&61440)===32768}),isDir:(function(mode){return(mode&61440)===16384}),isLink:(function(mode){return(mode&61440)===40960}),isChrdev:(function(mode){return(mode&61440)===8192}),isBlkdev:(function(mode){return(mode&61440)===24576}),isFIFO:(function(mode){return(mode&61440)===4096}),isSocket:(function(mode){return(mode&49152)===49152}),flagModes:{"r":0,"rs":1052672,"r+":2,"w":577,"wx":705,"xw":705,"w+":578,"wx+":706,"xw+":706,"a":1089,"ax":1217,"xa":1217,"a+":1090,"ax+":1218,"xa+":1218},modeStringToFlags:(function(str){var flags=FS.flagModes[str];if(typeof flags==="undefined"){throw new Error("Unknown file open mode: "+str)}return flags}),flagsToPermissionString:(function(flag){var perms=["r","w","rw"][flag&3];if(flag&512){perms+="w"}return perms}),nodePermissions:(function(node,perms){if(FS.ignorePermissions){return 0}if(perms.indexOf("r")!==-1&&!(node.mode&292)){return ERRNO_CODES.EACCES}else if(perms.indexOf("w")!==-1&&!(node.mode&146)){return ERRNO_CODES.EACCES}else if(perms.indexOf("x")!==-1&&!(node.mode&73)){return ERRNO_CODES.EACCES}return 0}),mayLookup:(function(dir){var err=FS.nodePermissions(dir,"x");if(err)return err;if(!dir.node_ops.lookup)return ERRNO_CODES.EACCES;return 0}),mayCreate:(function(dir,name){try{var node=FS.lookupNode(dir,name);return ERRNO_CODES.EEXIST}catch(e){}return FS.nodePermissions(dir,"wx")}),mayDelete:(function(dir,name,isdir){var node;try{node=FS.lookupNode(dir,name)}catch(e){return e.errno}var err=FS.nodePermissions(dir,"wx");if(err){return err}if(isdir){if(!FS.isDir(node.mode)){return ERRNO_CODES.ENOTDIR}if(FS.isRoot(node)||FS.getPath(node)===FS.cwd()){return ERRNO_CODES.EBUSY}}else{if(FS.isDir(node.mode)){return ERRNO_CODES.EISDIR}}return 0}),mayOpen:(function(node,flags){if(!node){return ERRNO_CODES.ENOENT}if(FS.isLink(node.mode)){return ERRNO_CODES.ELOOP}else if(FS.isDir(node.mode)){if(FS.flagsToPermissionString(flags)!=="r"||flags&512){return ERRNO_CODES.EISDIR}}return FS.nodePermissions(node,FS.flagsToPermissionString(flags))}),MAX_OPEN_FDS:4096,nextfd:(function(fd_start,fd_end){fd_start=fd_start||0;fd_end=fd_end||FS.MAX_OPEN_FDS;for(var fd=fd_start;fd<=fd_end;fd++){if(!FS.streams[fd]){return fd}}throw new FS.ErrnoError(ERRNO_CODES.EMFILE)}),getStream:(function(fd){return FS.streams[fd]}),createStream:(function(stream,fd_start,fd_end){if(!FS.FSStream){FS.FSStream=(function(){});FS.FSStream.prototype={};Object.defineProperties(FS.FSStream.prototype,{object:{get:(function(){return this.node}),set:(function(val){this.node=val})},isRead:{get:(function(){return(this.flags&2097155)!==1})},isWrite:{get:(function(){return(this.flags&2097155)!==0})},isAppend:{get:(function(){return this.flags&1024})}})}var newStream=new FS.FSStream;for(var p in stream){newStream[p]=stream[p]}stream=newStream;var fd=FS.nextfd(fd_start,fd_end);stream.fd=fd;FS.streams[fd]=stream;return stream}),closeStream:(function(fd){FS.streams[fd]=null}),chrdev_stream_ops:{open:(function(stream){var device=FS.getDevice(stream.node.rdev);stream.stream_ops=device.stream_ops;if(stream.stream_ops.open){stream.stream_ops.open(stream)}}),llseek:(function(){throw new FS.ErrnoError(ERRNO_CODES.ESPIPE)})},major:(function(dev){return dev>>8}),minor:(function(dev){return dev&255}),makedev:(function(ma,mi){return ma<<8|mi}),registerDevice:(function(dev,ops){FS.devices[dev]={stream_ops:ops}}),getDevice:(function(dev){return FS.devices[dev]}),getMounts:(function(mount){var mounts=[];var check=[mount];while(check.length){var m=check.pop();mounts.push(m);check.push.apply(check,m.mounts)}return mounts}),syncfs:(function(populate,callback){if(typeof populate==="function"){callback=populate;populate=false}FS.syncFSRequests++;if(FS.syncFSRequests>1){console.log("warning: "+FS.syncFSRequests+" FS.syncfs operations in flight at once, probably just doing extra work")}var mounts=FS.getMounts(FS.root.mount);var completed=0;function doCallback(err){assert(FS.syncFSRequests>0);FS.syncFSRequests--;return callback(err)}function done(err){if(err){if(!done.errored){done.errored=true;return doCallback(err)}return}if(++completed>=mounts.length){doCallback(null)}}mounts.forEach((function(mount){if(!mount.type.syncfs){return done(null)}mount.type.syncfs(mount,populate,done)}))}),mount:(function(type,opts,mountpoint){var root=mountpoint==="/";var pseudo=!mountpoint;var node;if(root&&FS.root){throw new FS.ErrnoError(ERRNO_CODES.EBUSY)}else if(!root&&!pseudo){var lookup=FS.lookupPath(mountpoint,{follow_mount:false});mountpoint=lookup.path;node=lookup.node;if(FS.isMountpoint(node)){throw new FS.ErrnoError(ERRNO_CODES.EBUSY)}if(!FS.isDir(node.mode)){throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR)}}var mount={type:type,opts:opts,mountpoint:mountpoint,mounts:[]};var mountRoot=type.mount(mount);mountRoot.mount=mount;mount.root=mountRoot;if(root){FS.root=mountRoot}else if(node){node.mounted=mount;if(node.mount){node.mount.mounts.push(mount)}}return mountRoot}),unmount:(function(mountpoint){var lookup=FS.lookupPath(mountpoint,{follow_mount:false});if(!FS.isMountpoint(lookup.node)){throw new FS.ErrnoError(ERRNO_CODES.EINVAL)}var node=lookup.node;var mount=node.mounted;var mounts=FS.getMounts(mount);Object.keys(FS.nameTable).forEach((function(hash){var current=FS.nameTable[hash];while(current){var next=current.name_next;if(mounts.indexOf(current.mount)!==-1){FS.destroyNode(current)}current=next}}));node.mounted=null;var idx=node.mount.mounts.indexOf(mount);assert(idx!==-1);node.mount.mounts.splice(idx,1)}),lookup:(function(parent,name){return parent.node_ops.lookup(parent,name)}),mknod:(function(path,mode,dev){var lookup=FS.lookupPath(path,{parent:true});var parent=lookup.node;var name=PATH.basename(path);if(!name||name==="."||name===".."){throw new FS.ErrnoError(ERRNO_CODES.EINVAL)}var err=FS.mayCreate(parent,name);if(err){throw new FS.ErrnoError(err)}if(!parent.node_ops.mknod){throw new FS.ErrnoError(ERRNO_CODES.EPERM)}return parent.node_ops.mknod(parent,name,mode,dev)}),create:(function(path,mode){mode=mode!==undefined?mode:438;mode&=4095;mode|=32768;return FS.mknod(path,mode,0)}),mkdir:(function(path,mode){mode=mode!==undefined?mode:511;mode&=511|512;mode|=16384;return FS.mknod(path,mode,0)}),mkdirTree:(function(path,mode){var dirs=path.split("/");var d="";for(var i=0;i<dirs.length;++i){if(!dirs[i])continue;d+="/"+dirs[i];try{FS.mkdir(d,mode)}catch(e){if(e.errno!=ERRNO_CODES.EEXIST)throw e}}}),mkdev:(function(path,mode,dev){if(typeof dev==="undefined"){dev=mode;mode=438}mode|=8192;return FS.mknod(path,mode,dev)}),symlink:(function(oldpath,newpath){if(!PATH.resolve(oldpath)){throw new FS.ErrnoError(ERRNO_CODES.ENOENT)}var lookup=FS.lookupPath(newpath,{parent:true});var parent=lookup.node;if(!parent){throw new FS.ErrnoError(ERRNO_CODES.ENOENT)}var newname=PATH.basename(newpath);var err=FS.mayCreate(parent,newname);if(err){throw new FS.ErrnoError(err)}if(!parent.node_ops.symlink){throw new FS.ErrnoError(ERRNO_CODES.EPERM)}return parent.node_ops.symlink(parent,newname,oldpath)}),rename:(function(old_path,new_path){var old_dirname=PATH.dirname(old_path);var new_dirname=PATH.dirname(new_path);var old_name=PATH.basename(old_path);var new_name=PATH.basename(new_path);var lookup,old_dir,new_dir;try{lookup=FS.lookupPath(old_path,{parent:true});old_dir=lookup.node;lookup=FS.lookupPath(new_path,{parent:true});new_dir=lookup.node}catch(e){throw new FS.ErrnoError(ERRNO_CODES.EBUSY)}if(!old_dir||!new_dir)throw new FS.ErrnoError(ERRNO_CODES.ENOENT);if(old_dir.mount!==new_dir.mount){throw new FS.ErrnoError(ERRNO_CODES.EXDEV)}var old_node=FS.lookupNode(old_dir,old_name);var relative=PATH.relative(old_path,new_dirname);if(relative.charAt(0)!=="."){throw new FS.ErrnoError(ERRNO_CODES.EINVAL)}relative=PATH.relative(new_path,old_dirname);if(relative.charAt(0)!=="."){throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY)}var new_node;try{new_node=FS.lookupNode(new_dir,new_name)}catch(e){}if(old_node===new_node){return}var isdir=FS.isDir(old_node.mode);var err=FS.mayDelete(old_dir,old_name,isdir);if(err){throw new FS.ErrnoError(err)}err=new_node?FS.mayDelete(new_dir,new_name,isdir):FS.mayCreate(new_dir,new_name);if(err){throw new FS.ErrnoError(err)}if(!old_dir.node_ops.rename){throw new FS.ErrnoError(ERRNO_CODES.EPERM)}if(FS.isMountpoint(old_node)||new_node&&FS.isMountpoint(new_node)){throw new FS.ErrnoError(ERRNO_CODES.EBUSY)}if(new_dir!==old_dir){err=FS.nodePermissions(old_dir,"w");if(err){throw new FS.ErrnoError(err)}}try{if(FS.trackingDelegate["willMovePath"]){FS.trackingDelegate["willMovePath"](old_path,new_path)}}catch(e){console.log("FS.trackingDelegate['willMovePath']('"+old_path+"', '"+new_path+"') threw an exception: "+e.message)}FS.hashRemoveNode(old_node);try{old_dir.node_ops.rename(old_node,new_dir,new_name)}catch(e){throw e}finally{FS.hashAddNode(old_node)}try{if(FS.trackingDelegate["onMovePath"])FS.trackingDelegate["onMovePath"](old_path,new_path)}catch(e){console.log("FS.trackingDelegate['onMovePath']('"+old_path+"', '"+new_path+"') threw an exception: "+e.message)}}),rmdir:(function(path){var lookup=FS.lookupPath(path,{parent:true});var parent=lookup.node;var name=PATH.basename(path);var node=FS.lookupNode(parent,name);var err=FS.mayDelete(parent,name,true);if(err){throw new FS.ErrnoError(err)}if(!parent.node_ops.rmdir){throw new FS.ErrnoError(ERRNO_CODES.EPERM)}if(FS.isMountpoint(node)){throw new FS.ErrnoError(ERRNO_CODES.EBUSY)}try{if(FS.trackingDelegate["willDeletePath"]){FS.trackingDelegate["willDeletePath"](path)}}catch(e){console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: "+e.message)}parent.node_ops.rmdir(parent,name);FS.destroyNode(node);try{if(FS.trackingDelegate["onDeletePath"])FS.trackingDelegate["onDeletePath"](path)}catch(e){console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: "+e.message)}}),readdir:(function(path){var lookup=FS.lookupPath(path,{follow:true});var node=lookup.node;if(!node.node_ops.readdir){throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR)}return node.node_ops.readdir(node)}),unlink:(function(path){var lookup=FS.lookupPath(path,{parent:true});var parent=lookup.node;var name=PATH.basename(path);var node=FS.lookupNode(parent,name);var err=FS.mayDelete(parent,name,false);if(err){throw new FS.ErrnoError(err)}if(!parent.node_ops.unlink){throw new FS.ErrnoError(ERRNO_CODES.EPERM)}if(FS.isMountpoint(node)){throw new FS.ErrnoError(ERRNO_CODES.EBUSY)}try{if(FS.trackingDelegate["willDeletePath"]){FS.trackingDelegate["willDeletePath"](path)}}catch(e){console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: "+e.message)}parent.node_ops.unlink(parent,name);FS.destroyNode(node);try{if(FS.trackingDelegate["onDeletePath"])FS.trackingDelegate["onDeletePath"](path)}catch(e){console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: "+e.message)}}),readlink:(function(path){var lookup=FS.lookupPath(path);var link=lookup.node;if(!link){throw new FS.ErrnoError(ERRNO_CODES.ENOENT)}if(!link.node_ops.readlink){throw new FS.ErrnoError(ERRNO_CODES.EINVAL)}return PATH.resolve(FS.getPath(link.parent),link.node_ops.readlink(link))}),stat:(function(path,dontFollow){var lookup=FS.lookupPath(path,{follow:!dontFollow});var node=lookup.node;if(!node){throw new FS.ErrnoError(ERRNO_CODES.ENOENT)}if(!node.node_ops.getattr){throw new FS.ErrnoError(ERRNO_CODES.EPERM)}return node.node_ops.getattr(node)}),lstat:(function(path){return FS.stat(path,true)}),chmod:(function(path,mode,dontFollow){var node;if(typeof path==="string"){var lookup=FS.lookupPath(path,{follow:!dontFollow});node=lookup.node}else{node=path}if(!node.node_ops.setattr){throw new FS.ErrnoError(ERRNO_CODES.EPERM)}node.node_ops.setattr(node,{mode:mode&4095|node.mode&~4095,timestamp:Date.now()})}),lchmod:(function(path,mode){FS.chmod(path,mode,true)}),fchmod:(function(fd,mode){var stream=FS.getStream(fd);if(!stream){throw new FS.ErrnoError(ERRNO_CODES.EBADF)}FS.chmod(stream.node,mode)}),chown:(function(path,uid,gid,dontFollow){var node;if(typeof path==="string"){var lookup=FS.lookupPath(path,{follow:!dontFollow});node=lookup.node}else{node=path}if(!node.node_ops.setattr){throw new FS.ErrnoError(ERRNO_CODES.EPERM)}node.node_ops.setattr(node,{timestamp:Date.now()})}),lchown:(function(path,uid,gid){FS.chown(path,uid,gid,true)}),fchown:(function(fd,uid,gid){var stream=FS.getStream(fd);if(!stream){throw new FS.ErrnoError(ERRNO_CODES.EBADF)}FS.chown(stream.node,uid,gid)}),truncate:(function(path,len){if(len<0){throw new FS.ErrnoError(ERRNO_CODES.EINVAL)}var node;if(typeof path==="string"){var lookup=FS.lookupPath(path,{follow:true});node=lookup.node}else{node=path}if(!node.node_ops.setattr){throw new FS.ErrnoError(ERRNO_CODES.EPERM)}if(FS.isDir(node.mode)){throw new FS.ErrnoError(ERRNO_CODES.EISDIR)}if(!FS.isFile(node.mode)){throw new FS.ErrnoError(ERRNO_CODES.EINVAL)}var err=FS.nodePermissions(node,"w");if(err){throw new FS.ErrnoError(err)}node.node_ops.setattr(node,{size:len,timestamp:Date.now()})}),ftruncate:(function(fd,len){var stream=FS.getStream(fd);if(!stream){throw new FS.ErrnoError(ERRNO_CODES.EBADF)}if((stream.flags&2097155)===0){throw new FS.ErrnoError(ERRNO_CODES.EINVAL)}FS.truncate(stream.node,len)}),utime:(function(path,atime,mtime){var lookup=FS.lookupPath(path,{follow:true});var node=lookup.node;node.node_ops.setattr(node,{timestamp:Math.max(atime,mtime)})}),open:(function(path,flags,mode,fd_start,fd_end){if(path===""){throw new FS.ErrnoError(ERRNO_CODES.ENOENT)}flags=typeof flags==="string"?FS.modeStringToFlags(flags):flags;mode=typeof mode==="undefined"?438:mode;if(flags&64){mode=mode&4095|32768}else{mode=0}var node;if(typeof path==="object"){node=path}else{path=PATH.normalize(path);try{var lookup=FS.lookupPath(path,{follow:!(flags&131072)});node=lookup.node}catch(e){}}var created=false;if(flags&64){if(node){if(flags&128){throw new FS.ErrnoError(ERRNO_CODES.EEXIST)}}else{node=FS.mknod(path,mode,0);created=true}}if(!node){throw new FS.ErrnoError(ERRNO_CODES.ENOENT)}if(FS.isChrdev(node.mode)){flags&=~512}if(flags&65536&&!FS.isDir(node.mode)){throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR)}if(!created){var err=FS.mayOpen(node,flags);if(err){throw new FS.ErrnoError(err)}}if(flags&512){FS.truncate(node,0)}flags&=~(128|512);var stream=FS.createStream({node:node,path:FS.getPath(node),flags:flags,seekable:true,position:0,stream_ops:node.stream_ops,ungotten:[],error:false},fd_start,fd_end);if(stream.stream_ops.open){stream.stream_ops.open(stream)}if(Module["logReadFiles"]&&!(flags&1)){if(!FS.readFiles)FS.readFiles={};if(!(path in FS.readFiles)){FS.readFiles[path]=1;Module["printErr"]("read file: "+path)}}try{if(FS.trackingDelegate["onOpenFile"]){var trackingFlags=0;if((flags&2097155)!==1){trackingFlags|=FS.tracking.openFlags.READ}if((flags&2097155)!==0){trackingFlags|=FS.tracking.openFlags.WRITE}FS.trackingDelegate["onOpenFile"](path,trackingFlags)}}catch(e){console.log("FS.trackingDelegate['onOpenFile']('"+path+"', flags) threw an exception: "+e.message)}return stream}),close:(function(stream){if(stream.getdents)stream.getdents=null;try{if(stream.stream_ops.close){stream.stream_ops.close(stream)}}catch(e){throw e}finally{FS.closeStream(stream.fd)}}),llseek:(function(stream,offset,whence){if(!stream.seekable||!stream.stream_ops.llseek){throw new FS.ErrnoError(ERRNO_CODES.ESPIPE)}stream.position=stream.stream_ops.llseek(stream,offset,whence);stream.ungotten=[];return stream.position}),read:(function(stream,buffer,offset,length,position){if(length<0||position<0){throw new FS.ErrnoError(ERRNO_CODES.EINVAL)}if((stream.flags&2097155)===1){throw new FS.ErrnoError(ERRNO_CODES.EBADF)}if(FS.isDir(stream.node.mode)){throw new FS.ErrnoError(ERRNO_CODES.EISDIR)}if(!stream.stream_ops.read){throw new FS.ErrnoError(ERRNO_CODES.EINVAL)}var seeking=true;if(typeof position==="undefined"){position=stream.position;seeking=false}else if(!stream.seekable){throw new FS.ErrnoError(ERRNO_CODES.ESPIPE)}var bytesRead=stream.stream_ops.read(stream,buffer,offset,length,position);if(!seeking)stream.position+=bytesRead;return bytesRead}),write:(function(stream,buffer,offset,length,position,canOwn){if(length<0||position<0){throw new FS.ErrnoError(ERRNO_CODES.EINVAL)}if((stream.flags&2097155)===0){throw new FS.ErrnoError(ERRNO_CODES.EBADF)}if(FS.isDir(stream.node.mode)){throw new FS.ErrnoError(ERRNO_CODES.EISDIR)}if(!stream.stream_ops.write){throw new FS.ErrnoError(ERRNO_CODES.EINVAL)}if(stream.flags&1024){FS.llseek(stream,0,2)}var seeking=true;if(typeof position==="undefined"){position=stream.position;seeking=false}else if(!stream.seekable){throw new FS.ErrnoError(ERRNO_CODES.ESPIPE)}var bytesWritten=stream.stream_ops.write(stream,buffer,offset,length,position,canOwn);if(!seeking)stream.position+=bytesWritten;try{if(stream.path&&FS.trackingDelegate["onWriteToFile"])FS.trackingDelegate["onWriteToFile"](stream.path)}catch(e){console.log("FS.trackingDelegate['onWriteToFile']('"+path+"') threw an exception: "+e.message)}return bytesWritten}),allocate:(function(stream,offset,length){if(offset<0||length<=0){throw new FS.ErrnoError(ERRNO_CODES.EINVAL)}if((stream.flags&2097155)===0){throw new FS.ErrnoError(ERRNO_CODES.EBADF)}if(!FS.isFile(stream.node.mode)&&!FS.isDir(stream.node.mode)){throw new FS.ErrnoError(ERRNO_CODES.ENODEV)}if(!stream.stream_ops.allocate){throw new FS.ErrnoError(ERRNO_CODES.EOPNOTSUPP)}stream.stream_ops.allocate(stream,offset,length)}),mmap:(function(stream,buffer,offset,length,position,prot,flags){if((stream.flags&2097155)===1){throw new FS.ErrnoError(ERRNO_CODES.EACCES)}if(!stream.stream_ops.mmap){throw new FS.ErrnoError(ERRNO_CODES.ENODEV)}return stream.stream_ops.mmap(stream,buffer,offset,length,position,prot,flags)}),msync:(function(stream,buffer,offset,length,mmapFlags){if(!stream||!stream.stream_ops.msync){return 0}return stream.stream_ops.msync(stream,buffer,offset,length,mmapFlags)}),munmap:(function(stream){return 0}),ioctl:(function(stream,cmd,arg){if(!stream.stream_ops.ioctl){throw new FS.ErrnoError(ERRNO_CODES.ENOTTY)}return stream.stream_ops.ioctl(stream,cmd,arg)}),readFile:(function(path,opts){opts=opts||{};opts.flags=opts.flags||"r";opts.encoding=opts.encoding||"binary";if(opts.encoding!=="utf8"&&opts.encoding!=="binary"){throw new Error('Invalid encoding type "'+opts.encoding+'"')}var ret;var stream=FS.open(path,opts.flags);var stat=FS.stat(path);var length=stat.size;var buf=new Uint8Array(length);FS.read(stream,buf,0,length,0);if(opts.encoding==="utf8"){ret=UTF8ArrayToString(buf,0)}else if(opts.encoding==="binary"){ret=buf}FS.close(stream);return ret}),writeFile:(function(path,data,opts){opts=opts||{};opts.flags=opts.flags||"w";opts.encoding=opts.encoding||"utf8";if(opts.encoding!=="utf8"&&opts.encoding!=="binary"){throw new Error('Invalid encoding type "'+opts.encoding+'"')}var stream=FS.open(path,opts.flags,opts.mode);if(opts.encoding==="utf8"){var buf=new Uint8Array(lengthBytesUTF8(data)+1);var actualNumBytes=stringToUTF8Array(data,buf,0,buf.length);FS.write(stream,buf,0,actualNumBytes,0,opts.canOwn)}else if(opts.encoding==="binary"){FS.write(stream,data,0,data.length,0,opts.canOwn)}FS.close(stream)}),cwd:(function(){return FS.currentPath}),chdir:(function(path){var lookup=FS.lookupPath(path,{follow:true});if(lookup.node===null){throw new FS.ErrnoError(ERRNO_CODES.ENOENT)}if(!FS.isDir(lookup.node.mode)){throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR)}var err=FS.nodePermissions(lookup.node,"x");if(err){throw new FS.ErrnoError(err)}FS.currentPath=lookup.path}),createDefaultDirectories:(function(){FS.mkdir("/tmp");FS.mkdir("/home");FS.mkdir("/home/web_user")}),createDefaultDevices:(function(){FS.mkdir("/dev");FS.registerDevice(FS.makedev(1,3),{read:(function(){return 0}),write:(function(stream,buffer,offset,length,pos){return length})});FS.mkdev("/dev/null",FS.makedev(1,3));TTY.register(FS.makedev(5,0),TTY.default_tty_ops);TTY.register(FS.makedev(6,0),TTY.default_tty1_ops);FS.mkdev("/dev/tty",FS.makedev(5,0));FS.mkdev("/dev/tty1",FS.makedev(6,0));var random_device;if(typeof crypto!=="undefined"){var randomBuffer=new Uint8Array(1);random_device=(function(){crypto.getRandomValues(randomBuffer);return randomBuffer[0]})}else if(ENVIRONMENT_IS_NODE){random_device=(function(){return __webpack_require__(145).randomBytes(1)[0]})}else{random_device=(function(){return Math.random()*256|0})}FS.createDevice("/dev","random",random_device);FS.createDevice("/dev","urandom",random_device);FS.mkdir("/dev/shm");FS.mkdir("/dev/shm/tmp")}),createSpecialDirectories:(function(){FS.mkdir("/proc");FS.mkdir("/proc/self");FS.mkdir("/proc/self/fd");FS.mount({mount:(function(){var node=FS.createNode("/proc/self","fd",16384|511,73);node.node_ops={lookup:(function(parent,name){var fd=+name;var stream=FS.getStream(fd);if(!stream)throw new FS.ErrnoError(ERRNO_CODES.EBADF);var ret={parent:null,mount:{mountpoint:"fake"},node_ops:{readlink:(function(){return stream.path})}};ret.parent=ret;return ret})};return node})},{},"/proc/self/fd")}),createStandardStreams:(function(){if(Module["stdin"]){FS.createDevice("/dev","stdin",Module["stdin"])}else{FS.symlink("/dev/tty","/dev/stdin")}if(Module["stdout"]){FS.createDevice("/dev","stdout",null,Module["stdout"])}else{FS.symlink("/dev/tty","/dev/stdout")}if(Module["stderr"]){FS.createDevice("/dev","stderr",null,Module["stderr"])}else{FS.symlink("/dev/tty1","/dev/stderr")}var stdin=FS.open("/dev/stdin","r");assert(stdin.fd===0,"invalid handle for stdin ("+stdin.fd+")");var stdout=FS.open("/dev/stdout","w");assert(stdout.fd===1,"invalid handle for stdout ("+stdout.fd+")");var stderr=FS.open("/dev/stderr","w");assert(stderr.fd===2,"invalid handle for stderr ("+stderr.fd+")")}),ensureErrnoError:(function(){if(FS.ErrnoError)return;FS.ErrnoError=function ErrnoError(errno,node){this.node=node;this.setErrno=(function(errno){this.errno=errno;for(var key in ERRNO_CODES){if(ERRNO_CODES[key]===errno){this.code=key;break}}});this.setErrno(errno);this.message=ERRNO_MESSAGES[errno]};FS.ErrnoError.prototype=new Error;FS.ErrnoError.prototype.constructor=FS.ErrnoError;[ERRNO_CODES.ENOENT].forEach((function(code){FS.genericErrors[code]=new FS.ErrnoError(code);FS.genericErrors[code].stack="<generic error, no stack>"}))}),staticInit:(function(){FS.ensureErrnoError();FS.nameTable=new Array(4096);FS.mount(MEMFS,{},"/");FS.createDefaultDirectories();FS.createDefaultDevices();FS.createSpecialDirectories();FS.filesystems={"MEMFS":MEMFS,"IDBFS":IDBFS,"NODEFS":NODEFS,"WORKERFS":WORKERFS}}),init:(function(input,output,error){assert(!FS.init.initialized,"FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)");FS.init.initialized=true;FS.ensureErrnoError();Module["stdin"]=input||Module["stdin"];Module["stdout"]=output||Module["stdout"];Module["stderr"]=error||Module["stderr"];FS.createStandardStreams()}),quit:(function(){FS.init.initialized=false;var fflush=Module["_fflush"];if(fflush)fflush(0);for(var i=0;i<FS.streams.length;i++){var stream=FS.streams[i];if(!stream){continue}FS.close(stream)}}),getMode:(function(canRead,canWrite){var mode=0;if(canRead)mode|=292|73;if(canWrite)mode|=146;return mode}),joinPath:(function(parts,forceRelative){var path=PATH.join.apply(null,parts);if(forceRelative&&path[0]=="/")path=path.substr(1);return path}),absolutePath:(function(relative,base){return PATH.resolve(base,relative)}),standardizePath:(function(path){return PATH.normalize(path)}),findObject:(function(path,dontResolveLastLink){var ret=FS.analyzePath(path,dontResolveLastLink);if(ret.exists){return ret.object}else{___setErrNo(ret.error);return null}}),analyzePath:(function(path,dontResolveLastLink){try{var lookup=FS.lookupPath(path,{follow:!dontResolveLastLink});path=lookup.path}catch(e){}var ret={isRoot:false,exists:false,error:0,name:null,path:null,object:null,parentExists:false,parentPath:null,parentObject:null};try{var lookup=FS.lookupPath(path,{parent:true});ret.parentExists=true;ret.parentPath=lookup.path;ret.parentObject=lookup.node;ret.name=PATH.basename(path);lookup=FS.lookupPath(path,{follow:!dontResolveLastLink});ret.exists=true;ret.path=lookup.path;ret.object=lookup.node;ret.name=lookup.node.name;ret.isRoot=lookup.path==="/"}catch(e){ret.error=e.errno}return ret}),createFolder:(function(parent,name,canRead,canWrite){var path=PATH.join2(typeof parent==="string"?parent:FS.getPath(parent),name);var mode=FS.getMode(canRead,canWrite);return FS.mkdir(path,mode)}),createPath:(function(parent,path,canRead,canWrite){parent=typeof parent==="string"?parent:FS.getPath(parent);var parts=path.split("/").reverse();while(parts.length){var part=parts.pop();if(!part)continue;var current=PATH.join2(parent,part);try{FS.mkdir(current)}catch(e){}parent=current}return current}),createFile:(function(parent,name,properties,canRead,canWrite){var path=PATH.join2(typeof parent==="string"?parent:FS.getPath(parent),name);var mode=FS.getMode(canRead,canWrite);return FS.create(path,mode)}),createDataFile:(function(parent,name,data,canRead,canWrite,canOwn){var path=name?PATH.join2(typeof parent==="string"?parent:FS.getPath(parent),name):parent;var mode=FS.getMode(canRead,canWrite);var node=FS.create(path,mode);if(data){if(typeof data==="string"){var arr=new Array(data.length);for(var i=0,len=data.length;i<len;++i)arr[i]=data.charCodeAt(i);data=arr}FS.chmod(node,mode|146);var stream=FS.open(node,"w");FS.write(stream,data,0,data.length,0,canOwn);FS.close(stream);FS.chmod(node,mode)}return node}),createDevice:(function(parent,name,input,output){var path=PATH.join2(typeof parent==="string"?parent:FS.getPath(parent),name);var mode=FS.getMode(!!input,!!output);if(!FS.createDevice.major)FS.createDevice.major=64;var dev=FS.makedev(FS.createDevice.major++,0);FS.registerDevice(dev,{open:(function(stream){stream.seekable=false}),close:(function(stream){if(output&&output.buffer&&output.buffer.length){output(10)}}),read:(function(stream,buffer,offset,length,pos){var bytesRead=0;for(var i=0;i<length;i++){var result;try{result=input()}catch(e){throw new FS.ErrnoError(ERRNO_CODES.EIO)}if(result===undefined&&bytesRead===0){throw new FS.ErrnoError(ERRNO_CODES.EAGAIN)}if(result===null||result===undefined)break;bytesRead++;buffer[offset+i]=result}if(bytesRead){stream.node.timestamp=Date.now()}return bytesRead}),write:(function(stream,buffer,offset,length,pos){for(var i=0;i<length;i++){try{output(buffer[offset+i])}catch(e){throw new FS.ErrnoError(ERRNO_CODES.EIO)}}if(length){stream.node.timestamp=Date.now()}return i})});return FS.mkdev(path,mode,dev)}),createLink:(function(parent,name,target,canRead,canWrite){var path=PATH.join2(typeof parent==="string"?parent:FS.getPath(parent),name);return FS.symlink(target,path)}),forceLoadFile:(function(obj){if(obj.isDevice||obj.isFolder||obj.link||obj.contents)return true;var success=true;if(typeof XMLHttpRequest!=="undefined"){throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread.")}else if(Module["read"]){try{obj.contents=intArrayFromString(Module["read"](obj.url),true);obj.usedBytes=obj.contents.length}catch(e){success=false}}else{throw new Error("Cannot load without read() or XMLHttpRequest.")}if(!success)___setErrNo(ERRNO_CODES.EIO);return success}),createLazyFile:(function(parent,name,url,canRead,canWrite){function LazyUint8Array(){this.lengthKnown=false;this.chunks=[]}LazyUint8Array.prototype.get=function LazyUint8Array_get(idx){if(idx>this.length-1||idx<0){return undefined}var chunkOffset=idx%this.chunkSize;var chunkNum=idx/this.chunkSize|0;return this.getter(chunkNum)[chunkOffset]};LazyUint8Array.prototype.setDataGetter=function LazyUint8Array_setDataGetter(getter){this.getter=getter};LazyUint8Array.prototype.cacheLength=function LazyUint8Array_cacheLength(){var xhr=new XMLHttpRequest;xhr.open("HEAD",url,false);xhr.send(null);if(!(xhr.status>=200&&xhr.status<300||xhr.status===304))throw new Error("Couldn't load "+url+". Status: "+xhr.status);var datalength=Number(xhr.getResponseHeader("Content-length"));var header;var hasByteServing=(header=xhr.getResponseHeader("Accept-Ranges"))&&header==="bytes";var usesGzip=(header=xhr.getResponseHeader("Content-Encoding"))&&header==="gzip";var chunkSize=1024*1024;if(!hasByteServing)chunkSize=datalength;var doXHR=(function(from,to){if(from>to)throw new Error("invalid range ("+from+", "+to+") or no bytes requested!");if(to>datalength-1)throw new Error("only "+datalength+" bytes available! programmer error!");var xhr=new XMLHttpRequest;xhr.open("GET",url,false);if(datalength!==chunkSize)xhr.setRequestHeader("Range","bytes="+from+"-"+to);if(typeof Uint8Array!="undefined")xhr.responseType="arraybuffer";if(xhr.overrideMimeType){xhr.overrideMimeType("text/plain; charset=x-user-defined")}xhr.send(null);if(!(xhr.status>=200&&xhr.status<300||xhr.status===304))throw new Error("Couldn't load "+url+". Status: "+xhr.status);if(xhr.response!==undefined){return new Uint8Array(xhr.response||[])}else{return intArrayFromString(xhr.responseText||"",true)}});var lazyArray=this;lazyArray.setDataGetter((function(chunkNum){var start=chunkNum*chunkSize;var end=(chunkNum+1)*chunkSize-1;end=Math.min(end,datalength-1);if(typeof lazyArray.chunks[chunkNum]==="undefined"){lazyArray.chunks[chunkNum]=doXHR(start,end)}if(typeof lazyArray.chunks[chunkNum]==="undefined")throw new Error("doXHR failed!");return lazyArray.chunks[chunkNum]}));if(usesGzip||!datalength){chunkSize=datalength=1;datalength=this.getter(0).length;chunkSize=datalength;console.log("LazyFiles on gzip forces download of the whole file when length is accessed")}this._length=datalength;this._chunkSize=chunkSize;this.lengthKnown=true};if(typeof XMLHttpRequest!=="undefined"){if(!ENVIRONMENT_IS_WORKER)throw"Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc";var lazyArray=new LazyUint8Array;Object.defineProperties(lazyArray,{length:{get:(function(){if(!this.lengthKnown){this.cacheLength()}return this._length})},chunkSize:{get:(function(){if(!this.lengthKnown){this.cacheLength()}return this._chunkSize})}});var properties={isDevice:false,contents:lazyArray}}else{var properties={isDevice:false,url:url}}var node=FS.createFile(parent,name,properties,canRead,canWrite);if(properties.contents){node.contents=properties.contents}else if(properties.url){node.contents=null;node.url=properties.url}Object.defineProperties(node,{usedBytes:{get:(function(){return this.contents.length})}});var stream_ops={};var keys=Object.keys(node.stream_ops);keys.forEach((function(key){var fn=node.stream_ops[key];stream_ops[key]=function forceLoadLazyFile(){if(!FS.forceLoadFile(node)){throw new FS.ErrnoError(ERRNO_CODES.EIO)}return fn.apply(null,arguments)}}));stream_ops.read=function stream_ops_read(stream,buffer,offset,length,position){if(!FS.forceLoadFile(node)){throw new FS.ErrnoError(ERRNO_CODES.EIO)}var contents=stream.node.contents;if(position>=contents.length)return 0;var size=Math.min(contents.length-position,length);assert(size>=0);if(contents.slice){for(var i=0;i<size;i++){buffer[offset+i]=contents[position+i]}}else{for(var i=0;i<size;i++){buffer[offset+i]=contents.get(position+i)}}return size};node.stream_ops=stream_ops;return node}),createPreloadedFile:(function(parent,name,url,canRead,canWrite,onload,onerror,dontCreateFile,canOwn,preFinish){Browser.init();var fullname=name?PATH.resolve(PATH.join2(parent,name)):parent;var dep=getUniqueRunDependency("cp "+fullname);function processData(byteArray){function finish(byteArray){if(preFinish)preFinish();if(!dontCreateFile){FS.createDataFile(parent,name,byteArray,canRead,canWrite,canOwn)}if(onload)onload();removeRunDependency(dep)}var handled=false;Module["preloadPlugins"].forEach((function(plugin){if(handled)return;if(plugin["canHandle"](fullname)){plugin["handle"](byteArray,fullname,finish,(function(){if(onerror)onerror();removeRunDependency(dep)}));handled=true}}));if(!handled)finish(byteArray)}addRunDependency(dep);if(typeof url=="string"){Browser.asyncLoad(url,(function(byteArray){processData(byteArray)}),onerror)}else{processData(url)}}),indexedDB:(function(){return window.indexedDB||window.mozIndexedDB||window.webkitIndexedDB||window.msIndexedDB}),DB_NAME:(function(){return"EM_FS_"+window.location.pathname}),DB_VERSION:20,DB_STORE_NAME:"FILE_DATA",saveFilesToDB:(function(paths,onload,onerror){onload=onload||(function(){});onerror=onerror||(function(){});var indexedDB=FS.indexedDB();try{var openRequest=indexedDB.open(FS.DB_NAME(),FS.DB_VERSION)}catch(e){return onerror(e)}openRequest.onupgradeneeded=function openRequest_onupgradeneeded(){console.log("creating db");var db=openRequest.result;db.createObjectStore(FS.DB_STORE_NAME)};openRequest.onsuccess=function openRequest_onsuccess(){var db=openRequest.result;var transaction=db.transaction([FS.DB_STORE_NAME],"readwrite");var files=transaction.objectStore(FS.DB_STORE_NAME);var ok=0,fail=0,total=paths.length;function finish(){if(fail==0)onload();else onerror()}paths.forEach((function(path){var putRequest=files.put(FS.analyzePath(path).object.contents,path);putRequest.onsuccess=function putRequest_onsuccess(){ok++;if(ok+fail==total)finish()};putRequest.onerror=function putRequest_onerror(){fail++;if(ok+fail==total)finish()}}));transaction.onerror=onerror};openRequest.onerror=onerror}),loadFilesFromDB:(function(paths,onload,onerror){onload=onload||(function(){});onerror=onerror||(function(){});var indexedDB=FS.indexedDB();try{var openRequest=indexedDB.open(FS.DB_NAME(),FS.DB_VERSION)}catch(e){return onerror(e)}openRequest.onupgradeneeded=onerror;openRequest.onsuccess=function openRequest_onsuccess(){var db=openRequest.result;try{var transaction=db.transaction([FS.DB_STORE_NAME],"readonly")}catch(e){onerror(e);return}var files=transaction.objectStore(FS.DB_STORE_NAME);var ok=0,fail=0,total=paths.length;function finish(){if(fail==0)onload();else onerror()}paths.forEach((function(path){var getRequest=files.get(path);getRequest.onsuccess=function getRequest_onsuccess(){if(FS.analyzePath(path).exists){FS.unlink(path)}FS.createDataFile(PATH.dirname(path),PATH.basename(path),getRequest.result,true,true,true);ok++;if(ok+fail==total)finish()};getRequest.onerror=function getRequest_onerror(){fail++;if(ok+fail==total)finish()}}));transaction.onerror=onerror};openRequest.onerror=onerror})};var SYSCALLS={DEFAULT_POLLMASK:5,mappings:{},umask:511,calculateAt:(function(dirfd,path){if(path[0]!=="/"){var dir;if(dirfd===-100){dir=FS.cwd()}else{var dirstream=FS.getStream(dirfd);if(!dirstream)throw new FS.ErrnoError(ERRNO_CODES.EBADF);dir=dirstream.path}path=PATH.join2(dir,path)}return path}),doStat:(function(func,path,buf){try{var stat=func(path)}catch(e){if(e&&e.node&&PATH.normalize(path)!==PATH.normalize(FS.getPath(e.node))){return-ERRNO_CODES.ENOTDIR}throw e}HEAP32[buf>>2]=stat.dev;HEAP32[buf+4>>2]=0;HEAP32[buf+8>>2]=stat.ino;HEAP32[buf+12>>2]=stat.mode;HEAP32[buf+16>>2]=stat.nlink;HEAP32[buf+20>>2]=stat.uid;HEAP32[buf+24>>2]=stat.gid;HEAP32[buf+28>>2]=stat.rdev;HEAP32[buf+32>>2]=0;HEAP32[buf+36>>2]=stat.size;HEAP32[buf+40>>2]=4096;HEAP32[buf+44>>2]=stat.blocks;HEAP32[buf+48>>2]=stat.atime.getTime()/1e3|0;HEAP32[buf+52>>2]=0;HEAP32[buf+56>>2]=stat.mtime.getTime()/1e3|0;HEAP32[buf+60>>2]=0;HEAP32[buf+64>>2]=stat.ctime.getTime()/1e3|0;HEAP32[buf+68>>2]=0;HEAP32[buf+72>>2]=stat.ino;return 0}),doMsync:(function(addr,stream,len,flags){var buffer=new Uint8Array(HEAPU8.subarray(addr,addr+len));FS.msync(stream,buffer,0,len,flags)}),doMkdir:(function(path,mode){path=PATH.normalize(path);if(path[path.length-1]==="/")path=path.substr(0,path.length-1);FS.mkdir(path,mode,0);return 0}),doMknod:(function(path,mode,dev){switch(mode&61440){case 32768:case 8192:case 24576:case 4096:case 49152:break;default:return-ERRNO_CODES.EINVAL}FS.mknod(path,mode,dev);return 0}),doReadlink:(function(path,buf,bufsize){if(bufsize<=0)return-ERRNO_CODES.EINVAL;var ret=FS.readlink(path);var len=Math.min(bufsize,lengthBytesUTF8(ret));var endChar=HEAP8[buf+len];stringToUTF8(ret,buf,bufsize+1);HEAP8[buf+len]=endChar;return len}),doAccess:(function(path,amode){if(amode&~7){return-ERRNO_CODES.EINVAL}var node;var lookup=FS.lookupPath(path,{follow:true});node=lookup.node;var perms="";if(amode&4)perms+="r";if(amode&2)perms+="w";if(amode&1)perms+="x";if(perms&&FS.nodePermissions(node,perms)){return-ERRNO_CODES.EACCES}return 0}),doDup:(function(path,flags,suggestFD){var suggest=FS.getStream(suggestFD);if(suggest)FS.close(suggest);return FS.open(path,flags,0,suggestFD,suggestFD).fd}),doReadv:(function(stream,iov,iovcnt,offset){var ret=0;for(var i=0;i<iovcnt;i++){var ptr=HEAP32[iov+i*8>>2];var len=HEAP32[iov+(i*8+4)>>2];var curr=FS.read(stream,HEAP8,ptr,len,offset);if(curr<0)return-1;ret+=curr;if(curr<len)break}return ret}),doWritev:(function(stream,iov,iovcnt,offset){var ret=0;for(var i=0;i<iovcnt;i++){var ptr=HEAP32[iov+i*8>>2];var len=HEAP32[iov+(i*8+4)>>2];var curr=FS.write(stream,HEAP8,ptr,len,offset);if(curr<0)return-1;ret+=curr}return ret}),varargs:0,get:(function(varargs){SYSCALLS.varargs+=4;var ret=HEAP32[SYSCALLS.varargs-4>>2];return ret}),getStr:(function(){var ret=Pointer_stringify(SYSCALLS.get());return ret}),getStreamFromFD:(function(){var stream=FS.getStream(SYSCALLS.get());if(!stream)throw new FS.ErrnoError(ERRNO_CODES.EBADF);return stream}),getSocketFromFD:(function(){var socket=SOCKFS.getSocket(SYSCALLS.get());if(!socket)throw new FS.ErrnoError(ERRNO_CODES.EBADF);return socket}),getSocketAddress:(function(allowNull){var addrp=SYSCALLS.get(),addrlen=SYSCALLS.get();if(allowNull&&addrp===0)return null;var info=__read_sockaddr(addrp,addrlen);if(info.errno)throw new FS.ErrnoError(info.errno);info.addr=DNS.lookup_addr(info.addr)||info.addr;return info}),get64:(function(){var low=SYSCALLS.get(),high=SYSCALLS.get();if(low>=0)assert(high===0);else assert(high===-1);return low}),getZero:(function(){assert(SYSCALLS.get()===0)})};function ___syscall54(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),op=SYSCALLS.get();switch(op){case 21505:{if(!stream.tty)return-ERRNO_CODES.ENOTTY;return 0};case 21506:{if(!stream.tty)return-ERRNO_CODES.ENOTTY;return 0};case 21519:{if(!stream.tty)return-ERRNO_CODES.ENOTTY;var argp=SYSCALLS.get();HEAP32[argp>>2]=0;return 0};case 21520:{if(!stream.tty)return-ERRNO_CODES.ENOTTY;return-ERRNO_CODES.EINVAL};case 21531:{var argp=SYSCALLS.get();return FS.ioctl(stream,op,argp)};case 21523:{if(!stream.tty)return-ERRNO_CODES.ENOTTY;return 0};default:abort("bad ioctl syscall "+op)}}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function __Unwind_GetIPInfo(){abort("Unwind_GetIPInfo")}function _llvm_trap(){abort("trap!")}function _pthread_cond_init(){return 0}function __emscripten_traverse_stack(args){if(!args||!args.callee||!args.callee.name){return[null,"",""]}var funstr=args.callee.toString();var funcname=args.callee.name;var str="(";var first=true;for(i in args){var a=args[i];if(!first){str+=", "}first=false;if(typeof a==="number"||typeof a==="string"){str+=a}else{str+="("+typeof a+")"}}str+=")";var caller=args.callee.caller;args=caller?caller.arguments:[];if(first)str="";return[args,funcname,str]}function _emscripten_get_callstack_js(flags){var callstack=jsStackTrace();var iThisFunc=callstack.lastIndexOf("_emscripten_log");var iThisFunc2=callstack.lastIndexOf("_emscripten_get_callstack");var iNextLine=callstack.indexOf("\n",Math.max(iThisFunc,iThisFunc2))+1;callstack=callstack.slice(iNextLine);if(flags&8&&typeof emscripten_source_map==="undefined"){Runtime.warnOnce('Source map information is not available, emscripten_log with EM_LOG_C_STACK will be ignored. Build with "--pre-js $EMSCRIPTEN/src/emscripten-source-map.min.js" linker flag to add source map loading to code.');flags^=8;flags|=16}var stack_args=null;if(flags&128){var stack_args=__emscripten_traverse_stack(arguments);while(stack_args[1].indexOf("_emscripten_")>=0)stack_args=__emscripten_traverse_stack(stack_args[0])}lines=callstack.split("\n");callstack="";var newFirefoxRe=new RegExp("\\s*(.*?)@(.*?):([0-9]+):([0-9]+)");var firefoxRe=new RegExp("\\s*(.*?)@(.*):(.*)(:(.*))?");var chromeRe=new RegExp("\\s*at (.*?) \\((.*):(.*):(.*)\\)");for(l in lines){var line=lines[l];var jsSymbolName="";var file="";var lineno=0;var column=0;var parts=chromeRe.exec(line);if(parts&&parts.length==5){jsSymbolName=parts[1];file=parts[2];lineno=parts[3];column=parts[4]}else{parts=newFirefoxRe.exec(line);if(!parts)parts=firefoxRe.exec(line);if(parts&&parts.length>=4){jsSymbolName=parts[1];file=parts[2];lineno=parts[3];column=parts[4]|0}else{callstack+=line+"\n";continue}}var cSymbolName=flags&32?demangle(jsSymbolName):jsSymbolName;if(!cSymbolName){cSymbolName=jsSymbolName}var haveSourceMap=false;if(flags&8){var orig=emscripten_source_map.originalPositionFor({line:lineno,column:column});haveSourceMap=orig&&orig.source;if(haveSourceMap){if(flags&64){orig.source=orig.source.substring(orig.source.replace(/\\/g,"/").lastIndexOf("/")+1)}callstack+="    at "+cSymbolName+" ("+orig.source+":"+orig.line+":"+orig.column+")\n"}}if(flags&16||!haveSourceMap){if(flags&64){file=file.substring(file.replace(/\\/g,"/").lastIndexOf("/")+1)}callstack+=(haveSourceMap?"     = "+jsSymbolName:"    at "+cSymbolName)+" ("+file+":"+lineno+":"+column+")\n"}if(flags&128&&stack_args[0]){if(stack_args[1]==jsSymbolName&&stack_args[2].length>0){callstack=callstack.replace(/\s+$/,"");callstack+=" with values: "+stack_args[1]+stack_args[2]+"\n"}stack_args=__emscripten_traverse_stack(stack_args[0])}}callstack=callstack.replace(/\s+$/,"");return callstack}function __Unwind_Backtrace(func,arg){var trace=_emscripten_get_callstack_js();var parts=trace.split("\n");for(var i=0;i<parts.length;i++){var ret=Module["dynCall_iii"](func,0,arg);if(ret!==0)return}}function _pthread_condattr_setclock(){return 0}var _environ=STATICTOP;STATICTOP+=16;function ___buildEnvironment(env){var MAX_ENV_VALUES=64;var TOTAL_ENV_SIZE=1024;var poolPtr;var envPtr;if(!___buildEnvironment.called){___buildEnvironment.called=true;ENV["USER"]=ENV["LOGNAME"]="web_user";ENV["PATH"]="/";ENV["PWD"]="/";ENV["HOME"]="/home/web_user";ENV["LANG"]="C";ENV["_"]=Module["thisProgram"];poolPtr=allocate(TOTAL_ENV_SIZE,"i8",ALLOC_STATIC);envPtr=allocate(MAX_ENV_VALUES*4,"i8*",ALLOC_STATIC);HEAP32[envPtr>>2]=poolPtr;HEAP32[_environ>>2]=envPtr}else{envPtr=HEAP32[_environ>>2];poolPtr=HEAP32[envPtr>>2]}var strings=[];var totalSize=0;for(var key in env){if(typeof env[key]==="string"){var line=key+"="+env[key];strings.push(line);totalSize+=line.length}}if(totalSize>TOTAL_ENV_SIZE){throw new Error("Environment size exceeded TOTAL_ENV_SIZE!")}var ptrSize=4;for(var i=0;i<strings.length;i++){var line=strings[i];writeAsciiToMemory(line,poolPtr);HEAP32[envPtr+i*ptrSize>>2]=poolPtr;poolPtr+=line.length+1}HEAP32[envPtr+strings.length*ptrSize>>2]=0}var ENV={};function _getenv(name){if(name===0)return 0;name=Pointer_stringify(name);if(!ENV.hasOwnProperty(name))return 0;if(_getenv.ret)_free(_getenv.ret);_getenv.ret=allocate(intArrayFromString(ENV[name]),"i8",ALLOC_NORMAL);return _getenv.ret}function _pthread_rwlock_rdlock(){return 0}function _emscripten_memcpy_big(dest,src,num){HEAPU8.set(HEAPU8.subarray(src,src+num),dest);return dest}function ___syscall6(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD();FS.close(stream);return 0}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function _dladdr(addr,info){var fname=allocate(intArrayFromString(Module["thisProgram"]||"./this.program"),"i8",ALLOC_NORMAL);HEAP32[addr>>2]=fname;HEAP32[addr+4>>2]=0;HEAP32[addr+8>>2]=0;HEAP32[addr+12>>2]=0;return 1}function ___gxx_personality_v0(){}function _pthread_mutex_destroy(){}function _pthread_mutexattr_init(){}function ___syscall4(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),buf=SYSCALLS.get(),count=SYSCALLS.get();return FS.write(stream,HEAP8,buf,count)}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function _pthread_condattr_init(){return 0}function ___cxa_find_matching_catch_2(){return ___cxa_find_matching_catch.apply(null,arguments)}function ___syscall140(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),offset_high=SYSCALLS.get(),offset_low=SYSCALLS.get(),result=SYSCALLS.get(),whence=SYSCALLS.get();var offset=offset_low;FS.llseek(stream,offset,whence);HEAP32[result>>2]=stream.position;if(stream.getdents&&offset===0&&whence===0)stream.getdents=null;return 0}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall146(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),iov=SYSCALLS.get(),iovcnt=SYSCALLS.get();return SYSCALLS.doWritev(stream,iov,iovcnt)}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function _pthread_rwlock_unlock(){return 0}FS.staticInit();__ATINIT__.unshift((function(){if(!Module["noFSInit"]&&!FS.init.initialized)FS.init()}));__ATMAIN__.push((function(){FS.ignorePermissions=false}));__ATEXIT__.push((function(){FS.quit()}));Module["FS_createFolder"]=FS.createFolder;Module["FS_createPath"]=FS.createPath;Module["FS_createDataFile"]=FS.createDataFile;Module["FS_createPreloadedFile"]=FS.createPreloadedFile;Module["FS_createLazyFile"]=FS.createLazyFile;Module["FS_createLink"]=FS.createLink;Module["FS_createDevice"]=FS.createDevice;Module["FS_unlink"]=FS.unlink;__ATINIT__.unshift((function(){TTY.init()}));__ATEXIT__.push((function(){TTY.shutdown()}));if(ENVIRONMENT_IS_NODE){var fs=__webpack_require__(76);var NODEJS_PATH=__webpack_require__(76);NODEFS.staticInit()}___buildEnvironment(ENV);DYNAMICTOP_PTR=allocate(1,"i32",ALLOC_STATIC);STACK_BASE=STACKTOP=Runtime.alignMemory(STATICTOP);STACK_MAX=STACK_BASE+TOTAL_STACK;DYNAMIC_BASE=Runtime.alignMemory(STACK_MAX);HEAP32[DYNAMICTOP_PTR>>2]=DYNAMIC_BASE;staticSealed=true;Module["wasmTableSize"]=326;Module["wasmMaxTableSize"]=326;function invoke_iiii(index,a1,a2,a3){try{return Module["dynCall_iiii"](index,a1,a2,a3)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiiiii(index,a1,a2,a3,a4,a5,a6){try{Module["dynCall_viiiiii"](index,a1,a2,a3,a4,a5,a6)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10){try{Module["dynCall_viiiiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiiii(index,a1,a2,a3,a4,a5){try{Module["dynCall_viiiii"](index,a1,a2,a3,a4,a5)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_i(index){try{return Module["dynCall_i"](index)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_vi(index,a1){try{Module["dynCall_vi"](index,a1)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_vii(index,a1,a2){try{Module["dynCall_vii"](index,a1,a2)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_ii(index,a1){try{return Module["dynCall_ii"](index,a1)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_ji(index,a1){try{return Module["dynCall_ji"](index,a1)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_jj(index,a1,a2){try{return Module["dynCall_jj"](index,a1,a2)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_v(index){try{Module["dynCall_v"](index)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9){try{Module["dynCall_viiiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8,a9)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiii(index,a1,a2,a3,a4){try{Module["dynCall_viiii"](index,a1,a2,a3,a4)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_iii(index,a1,a2){try{return Module["dynCall_iii"](index,a1,a2)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8){try{Module["dynCall_viiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viii(index,a1,a2,a3){try{Module["dynCall_viii"](index,a1,a2,a3)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}Module.asmGlobalArg={"Math":Math,"Int8Array":Int8Array,"Int16Array":Int16Array,"Int32Array":Int32Array,"Uint8Array":Uint8Array,"Uint16Array":Uint16Array,"Uint32Array":Uint32Array,"Float32Array":Float32Array,"Float64Array":Float64Array,"NaN":NaN,"Infinity":Infinity};Module.asmLibraryArg={"abort":abort,"assert":assert,"enlargeMemory":enlargeMemory,"getTotalMemory":getTotalMemory,"abortOnCannotGrowMemory":abortOnCannotGrowMemory,"invoke_iiii":invoke_iiii,"invoke_viiiiii":invoke_viiiiii,"invoke_viiiiiiiiii":invoke_viiiiiiiiii,"invoke_viiiii":invoke_viiiii,"invoke_i":invoke_i,"invoke_vi":invoke_vi,"invoke_vii":invoke_vii,"invoke_ii":invoke_ii,"invoke_ji":invoke_ji,"invoke_jj":invoke_jj,"invoke_v":invoke_v,"invoke_viiiiiiiii":invoke_viiiiiiiii,"invoke_viiii":invoke_viiii,"invoke_iii":invoke_iii,"invoke_viiiiiiii":invoke_viiiiiiii,"invoke_viii":invoke_viii,"___syscall54":___syscall54,"__Unwind_FindEnclosingFunction":__Unwind_FindEnclosingFunction,"_emscripten_get_callstack_js":_emscripten_get_callstack_js,"___gxx_personality_v0":___gxx_personality_v0,"_pthread_rwlock_unlock":_pthread_rwlock_unlock,"___cxa_find_matching_catch_2":___cxa_find_matching_catch_2,"___cxa_find_matching_catch":___cxa_find_matching_catch,"___buildEnvironment":___buildEnvironment,"_pthread_cond_init":_pthread_cond_init,"__Unwind_GetIPInfo":__Unwind_GetIPInfo,"_pthread_mutexattr_destroy":_pthread_mutexattr_destroy,"___setErrNo":___setErrNo,"_pthread_key_delete":_pthread_key_delete,"___cxa_allocate_exception":___cxa_allocate_exception,"_emscripten_memcpy_big":_emscripten_memcpy_big,"___resumeException":___resumeException,"__ZSt18uncaught_exceptionv":__ZSt18uncaught_exceptionv,"_pthread_condattr_setclock":_pthread_condattr_setclock,"_pthread_getspecific":_pthread_getspecific,"_pthread_rwlock_rdlock":_pthread_rwlock_rdlock,"__emscripten_traverse_stack":__emscripten_traverse_stack,"_pthread_mutex_destroy":_pthread_mutex_destroy,"_abort":_abort,"_pthread_condattr_init":_pthread_condattr_init,"_pthread_mutexattr_settype":_pthread_mutexattr_settype,"_getenv":_getenv,"_pthread_condattr_destroy":_pthread_condattr_destroy,"_pthread_key_create":_pthread_key_create,"___unlock":___unlock,"___syscall140":___syscall140,"_pthread_mutexattr_init":_pthread_mutexattr_init,"_pthread_setspecific":_pthread_setspecific,"_dladdr":_dladdr,"___cxa_throw":___cxa_throw,"___lock":___lock,"___syscall6":___syscall6,"___syscall4":___syscall4,"_pthread_cond_destroy":_pthread_cond_destroy,"_llvm_trap":_llvm_trap,"_pthread_mutex_init":_pthread_mutex_init,"__Unwind_Backtrace":__Unwind_Backtrace,"___syscall146":___syscall146,"DYNAMICTOP_PTR":DYNAMICTOP_PTR,"tempDoublePtr":tempDoublePtr,"ABORT":ABORT,"STACKTOP":STACKTOP,"STACK_MAX":STACK_MAX};var asm=Module["asm"](Module.asmGlobalArg,Module.asmLibraryArg,buffer);Module["asm"]=asm;var _iota_models_v2_tx_address=Module["_iota_models_v2_tx_address"]=(function(){return Module["asm"]["_iota_models_v2_tx_address"].apply(null,arguments)});var _iota_models_v1_tx_hash=Module["_iota_models_v1_tx_hash"]=(function(){return Module["asm"]["_iota_models_v1_tx_hash"].apply(null,arguments)});var _iota_models_v2_tx_set_value=Module["_iota_models_v2_tx_set_value"]=(function(){return Module["asm"]["_iota_models_v2_tx_set_value"].apply(null,arguments)});var _iota_models_v2_tx_set_obsolete_tag=Module["_iota_models_v2_tx_set_obsolete_tag"]=(function(){return Module["asm"]["_iota_models_v2_tx_set_obsolete_tag"].apply(null,arguments)});var _iota_sign_iss_subseed=Module["_iota_sign_iss_subseed"]=(function(){return Module["asm"]["_iota_sign_iss_subseed"].apply(null,arguments)});var _iota_sign_checksum_validate=Module["_iota_sign_checksum_validate"]=(function(){return Module["asm"]["_iota_sign_checksum_validate"].apply(null,arguments)});var _iota_ctrits_ctrits_data=Module["_iota_ctrits_ctrits_data"]=(function(){return Module["asm"]["_iota_ctrits_ctrits_data"].apply(null,arguments)});var _iota_ctrits_ctrits_encoding=Module["_iota_ctrits_ctrits_encoding"]=(function(){return Module["asm"]["_iota_ctrits_ctrits_encoding"].apply(null,arguments)});var _iota_models_v2_tx_trunk=Module["_iota_models_v2_tx_trunk"]=(function(){return Module["asm"]["_iota_models_v2_tx_trunk"].apply(null,arguments)});var _iota_models_v2_tx_timestamp=Module["_iota_models_v2_tx_timestamp"]=(function(){return Module["asm"]["_iota_models_v2_tx_timestamp"].apply(null,arguments)});var _iota_models_v1_tx_branch=Module["_iota_models_v1_tx_branch"]=(function(){return Module["asm"]["_iota_models_v1_tx_branch"].apply(null,arguments)});var _iota_kerl_trit_reset=Module["_iota_kerl_trit_reset"]=(function(){return Module["asm"]["_iota_kerl_trit_reset"].apply(null,arguments)});var _iota_models_v2_tx_set_signature_or_message=Module["_iota_models_v2_tx_set_signature_or_message"]=(function(){return Module["asm"]["_iota_models_v2_tx_set_signature_or_message"].apply(null,arguments)});var _iota_models_v2_tx_current_index=Module["_iota_models_v2_tx_current_index"]=(function(){return Module["asm"]["_iota_models_v2_tx_current_index"].apply(null,arguments)});var _iota_sign_checksum=Module["_iota_sign_checksum"]=(function(){return Module["asm"]["_iota_sign_checksum"].apply(null,arguments)});var _sbrk=Module["_sbrk"]=(function(){return Module["asm"]["_sbrk"].apply(null,arguments)});var _memcpy=Module["_memcpy"]=(function(){return Module["asm"]["_memcpy"].apply(null,arguments)});var _iota_models_v2_tx_last_index=Module["_iota_models_v2_tx_last_index"]=(function(){return Module["asm"]["_iota_models_v2_tx_last_index"].apply(null,arguments)});var _iota_models_v2_tx_set_attachment_timestamp=Module["_iota_models_v2_tx_set_attachment_timestamp"]=(function(){return Module["asm"]["_iota_models_v2_tx_set_attachment_timestamp"].apply(null,arguments)});var _iota_ctrits_ctrits_from_trits=Module["_iota_ctrits_ctrits_from_trits"]=(function(){return Module["asm"]["_iota_ctrits_ctrits_from_trits"].apply(null,arguments)});var _iota_merkle_siblings=Module["_iota_merkle_siblings"]=(function(){return Module["asm"]["_iota_merkle_siblings"].apply(null,arguments)});var _iota_models_v1_tx_set_branch=Module["_iota_models_v1_tx_set_branch"]=(function(){return Module["asm"]["_iota_models_v1_tx_set_branch"].apply(null,arguments)});var _emscripten_get_global_libc=Module["_emscripten_get_global_libc"]=(function(){return Module["asm"]["_emscripten_get_global_libc"].apply(null,arguments)});var _iota_curl_bctrit_absorb=Module["_iota_curl_bctrit_absorb"]=(function(){return Module["asm"]["_iota_curl_bctrit_absorb"].apply(null,arguments)});var _iota_models_v2_tx_set_attachment_timestamp_lower=Module["_iota_models_v2_tx_set_attachment_timestamp_lower"]=(function(){return Module["asm"]["_iota_models_v2_tx_set_attachment_timestamp_lower"].apply(null,arguments)});var stackSave=Module["stackSave"]=(function(){return Module["asm"]["stackSave"].apply(null,arguments)});var _free=Module["_free"]=(function(){return Module["asm"]["_free"].apply(null,arguments)});var runPostSets=Module["runPostSets"]=(function(){return Module["asm"]["runPostSets"].apply(null,arguments)});var _iota_merkle_root=Module["_iota_merkle_root"]=(function(){return Module["asm"]["_iota_merkle_root"].apply(null,arguments)});var _iota_models_v1_bundle_hash=Module["_iota_models_v1_bundle_hash"]=(function(){return Module["asm"]["_iota_models_v1_bundle_hash"].apply(null,arguments)});var _iota_kerl_trit_delete=Module["_iota_kerl_trit_delete"]=(function(){return Module["asm"]["_iota_kerl_trit_delete"].apply(null,arguments)});var _iota_models_v2_bundle_hash=Module["_iota_models_v2_bundle_hash"]=(function(){return Module["asm"]["_iota_models_v2_bundle_hash"].apply(null,arguments)});var _iota_merkle_slice=Module["_iota_merkle_slice"]=(function(){return Module["asm"]["_iota_merkle_slice"].apply(null,arguments)});var _iota_ctrits_ctrits_length=Module["_iota_ctrits_ctrits_length"]=(function(){return Module["asm"]["_iota_ctrits_ctrits_length"].apply(null,arguments)});var _iota_models_v2_tx_essence=Module["_iota_models_v2_tx_essence"]=(function(){return Module["asm"]["_iota_models_v2_tx_essence"].apply(null,arguments)});var _iota_models_v1_tx_set_timestamp=Module["_iota_models_v1_tx_set_timestamp"]=(function(){return Module["asm"]["_iota_models_v1_tx_set_timestamp"].apply(null,arguments)});var _iota_models_v1_tx_current_index=Module["_iota_models_v1_tx_current_index"]=(function(){return Module["asm"]["_iota_models_v1_tx_current_index"].apply(null,arguments)});var _iota_curl_bctrit_delete=Module["_iota_curl_bctrit_delete"]=(function(){return Module["asm"]["_iota_curl_bctrit_delete"].apply(null,arguments)});var _iota_models_v1_tx_set_value=Module["_iota_models_v1_tx_set_value"]=(function(){return Module["asm"]["_iota_models_v1_tx_set_value"].apply(null,arguments)});var _iota_merkle_branch_drop=Module["_iota_merkle_branch_drop"]=(function(){return Module["asm"]["_iota_merkle_branch_drop"].apply(null,arguments)});var _iota_kerl_trit_new=Module["_iota_kerl_trit_new"]=(function(){return Module["asm"]["_iota_kerl_trit_new"].apply(null,arguments)});var stackAlloc=Module["stackAlloc"]=(function(){return Module["asm"]["stackAlloc"].apply(null,arguments)});var _iota_models_v2_tx_set_bundle=Module["_iota_models_v2_tx_set_bundle"]=(function(){return Module["asm"]["_iota_models_v2_tx_set_bundle"].apply(null,arguments)});var _iota_ctrits_drop=Module["_iota_ctrits_drop"]=(function(){return Module["asm"]["_iota_ctrits_drop"].apply(null,arguments)});var _iota_models_v1_tx_trunk=Module["_iota_models_v1_tx_trunk"]=(function(){return Module["asm"]["_iota_models_v1_tx_trunk"].apply(null,arguments)});var getTempRet0=Module["getTempRet0"]=(function(){return Module["asm"]["getTempRet0"].apply(null,arguments)});var _ntohs=Module["_ntohs"]=(function(){return Module["asm"]["_ntohs"].apply(null,arguments)});var _iota_models_v2_tx_tag=Module["_iota_models_v2_tx_tag"]=(function(){return Module["asm"]["_iota_models_v2_tx_tag"].apply(null,arguments)});var _iota_models_v1_tx_address=Module["_iota_models_v1_tx_address"]=(function(){return Module["asm"]["_iota_models_v1_tx_address"].apply(null,arguments)});var _iota_models_v1_tx_set_tag=Module["_iota_models_v1_tx_set_tag"]=(function(){return Module["asm"]["_iota_models_v1_tx_set_tag"].apply(null,arguments)});var _iota_curl_trit_squeeze=Module["_iota_curl_trit_squeeze"]=(function(){return Module["asm"]["_iota_curl_trit_squeeze"].apply(null,arguments)});var _llvm_bswap_i32=Module["_llvm_bswap_i32"]=(function(){return Module["asm"]["_llvm_bswap_i32"].apply(null,arguments)});var _iota_kerl_trit_squeeze=Module["_iota_kerl_trit_squeeze"]=(function(){return Module["asm"]["_iota_kerl_trit_squeeze"].apply(null,arguments)});var _iota_models_v2_tx_attachment_timestamp_upper=Module["_iota_models_v2_tx_attachment_timestamp_upper"]=(function(){return Module["asm"]["_iota_models_v2_tx_attachment_timestamp_upper"].apply(null,arguments)});var _iota_mam_create=Module["_iota_mam_create"]=(function(){return Module["asm"]["_iota_mam_create"].apply(null,arguments)});var establishStackSpace=Module["establishStackSpace"]=(function(){return Module["asm"]["establishStackSpace"].apply(null,arguments)});var _iota_curl_trit_set_rounds=Module["_iota_curl_trit_set_rounds"]=(function(){return Module["asm"]["_iota_curl_trit_set_rounds"].apply(null,arguments)});var _iota_models_v2_tx_hash=Module["_iota_models_v2_tx_hash"]=(function(){return Module["asm"]["_iota_models_v2_tx_hash"].apply(null,arguments)});var _iota_models_v2_tx_branch=Module["_iota_models_v2_tx_branch"]=(function(){return Module["asm"]["_iota_models_v2_tx_branch"].apply(null,arguments)});var _pthread_mutex_lock=Module["_pthread_mutex_lock"]=(function(){return Module["asm"]["_pthread_mutex_lock"].apply(null,arguments)});var _iota_models_v1_tx_set_last_index=Module["_iota_models_v1_tx_set_last_index"]=(function(){return Module["asm"]["_iota_models_v1_tx_set_last_index"].apply(null,arguments)});var _iota_models_v1_tx_signature_or_message=Module["_iota_models_v1_tx_signature_or_message"]=(function(){return Module["asm"]["_iota_models_v1_tx_signature_or_message"].apply(null,arguments)});var _iota_sign_iss_signature=Module["_iota_sign_iss_signature"]=(function(){return Module["asm"]["_iota_sign_iss_signature"].apply(null,arguments)});var _iota_merkle_create=Module["_iota_merkle_create"]=(function(){return Module["asm"]["_iota_merkle_create"].apply(null,arguments)});var _iota_models_v2_tx_value=Module["_iota_models_v2_tx_value"]=(function(){return Module["asm"]["_iota_models_v2_tx_value"].apply(null,arguments)});var _iota_models_v1_tx_set_current_index=Module["_iota_models_v1_tx_set_current_index"]=(function(){return Module["asm"]["_iota_models_v1_tx_set_current_index"].apply(null,arguments)});var _iota_merkle_count=Module["_iota_merkle_count"]=(function(){return Module["asm"]["_iota_merkle_count"].apply(null,arguments)});var _iota_models_v1_tx_set_trunk=Module["_iota_models_v1_tx_set_trunk"]=(function(){return Module["asm"]["_iota_models_v1_tx_set_trunk"].apply(null,arguments)});var _iota_models_v1_tx_tag=Module["_iota_models_v1_tx_tag"]=(function(){return Module["asm"]["_iota_models_v1_tx_tag"].apply(null,arguments)});var _iota_kerl_trit_state=Module["_iota_kerl_trit_state"]=(function(){return Module["asm"]["_iota_kerl_trit_state"].apply(null,arguments)});var _iota_mam_parse=Module["_iota_mam_parse"]=(function(){return Module["asm"]["_iota_mam_parse"].apply(null,arguments)});var _iota_models_v2_tx_nonce=Module["_iota_models_v2_tx_nonce"]=(function(){return Module["asm"]["_iota_models_v2_tx_nonce"].apply(null,arguments)});var _iota_sign_iss_address=Module["_iota_sign_iss_address"]=(function(){return Module["asm"]["_iota_sign_iss_address"].apply(null,arguments)});var _memset=Module["_memset"]=(function(){return Module["asm"]["_memset"].apply(null,arguments)});var _iota_models_v1_tx_set_signature_or_message=Module["_iota_models_v1_tx_set_signature_or_message"]=(function(){return Module["asm"]["_iota_models_v1_tx_set_signature_or_message"].apply(null,arguments)});var _iota_curl_trit_reset=Module["_iota_curl_trit_reset"]=(function(){return Module["asm"]["_iota_curl_trit_reset"].apply(null,arguments)});var _iota_sign_iss_digest_bundle_signature=Module["_iota_sign_iss_digest_bundle_signature"]=(function(){return Module["asm"]["_iota_sign_iss_digest_bundle_signature"].apply(null,arguments)});var _iota_curl_trit_new=Module["_iota_curl_trit_new"]=(function(){return Module["asm"]["_iota_curl_trit_new"].apply(null,arguments)});var _iota_curl_bctrit_reset=Module["_iota_curl_bctrit_reset"]=(function(){return Module["asm"]["_iota_curl_bctrit_reset"].apply(null,arguments)});var _iota_curl_bctrit_squeeze=Module["_iota_curl_bctrit_squeeze"]=(function(){return Module["asm"]["_iota_curl_bctrit_squeeze"].apply(null,arguments)});var _iota_models_v2_tx_set_trunk=Module["_iota_models_v2_tx_set_trunk"]=(function(){return Module["asm"]["_iota_models_v2_tx_set_trunk"].apply(null,arguments)});var _iota_models_v2_tx_set_nonce=Module["_iota_models_v2_tx_set_nonce"]=(function(){return Module["asm"]["_iota_models_v2_tx_set_nonce"].apply(null,arguments)});var _iota_sign_iss_digest_key=Module["_iota_sign_iss_digest_key"]=(function(){return Module["asm"]["_iota_sign_iss_digest_key"].apply(null,arguments)});var _iota_models_v1_tx_last_index=Module["_iota_models_v1_tx_last_index"]=(function(){return Module["asm"]["_iota_models_v1_tx_last_index"].apply(null,arguments)});var _llvm_bswap_i16=Module["_llvm_bswap_i16"]=(function(){return Module["asm"]["_llvm_bswap_i16"].apply(null,arguments)});var _iota_curl_bctrit_set_rounds=Module["_iota_curl_bctrit_set_rounds"]=(function(){return Module["asm"]["_iota_curl_bctrit_set_rounds"].apply(null,arguments)});var _iota_models_v1_tx_set_bundle=Module["_iota_models_v1_tx_set_bundle"]=(function(){return Module["asm"]["_iota_models_v1_tx_set_bundle"].apply(null,arguments)});var _iota_curl_bctrit_rounds=Module["_iota_curl_bctrit_rounds"]=(function(){return Module["asm"]["_iota_curl_bctrit_rounds"].apply(null,arguments)});var setThrew=Module["setThrew"]=(function(){return Module["asm"]["setThrew"].apply(null,arguments)});var _malloc=Module["_malloc"]=(function(){return Module["asm"]["_malloc"].apply(null,arguments)});var _iota_merkle_branch_len=Module["_iota_merkle_branch_len"]=(function(){return Module["asm"]["_iota_merkle_branch_len"].apply(null,arguments)});var _iota_ctrits_ctrits_from_bytes=Module["_iota_ctrits_ctrits_from_bytes"]=(function(){return Module["asm"]["_iota_ctrits_ctrits_from_bytes"].apply(null,arguments)});var _iota_sign_iss_subseed_to_signature=Module["_iota_sign_iss_subseed_to_signature"]=(function(){return Module["asm"]["_iota_sign_iss_subseed_to_signature"].apply(null,arguments)});var _iota_ctrits_ctrits_from_trytes=Module["_iota_ctrits_ctrits_from_trytes"]=(function(){return Module["asm"]["_iota_ctrits_ctrits_from_trytes"].apply(null,arguments)});var _iota_models_v2_tx_set_address=Module["_iota_models_v2_tx_set_address"]=(function(){return Module["asm"]["_iota_models_v2_tx_set_address"].apply(null,arguments)});var _iota_ctrits_ctrits_byte_length=Module["_iota_ctrits_ctrits_byte_length"]=(function(){return Module["asm"]["_iota_ctrits_ctrits_byte_length"].apply(null,arguments)});var _iota_sign_iss_key=Module["_iota_sign_iss_key"]=(function(){return Module["asm"]["_iota_sign_iss_key"].apply(null,arguments)});var _iota_curl_trit_rounds=Module["_iota_curl_trit_rounds"]=(function(){return Module["asm"]["_iota_curl_trit_rounds"].apply(null,arguments)});var _iota_curl_trit_delete=Module["_iota_curl_trit_delete"]=(function(){return Module["asm"]["_iota_curl_trit_delete"].apply(null,arguments)});var _iota_curl_trit_absorb=Module["_iota_curl_trit_absorb"]=(function(){return Module["asm"]["_iota_curl_trit_absorb"].apply(null,arguments)});var _iota_curl_trit_state=Module["_iota_curl_trit_state"]=(function(){return Module["asm"]["_iota_curl_trit_state"].apply(null,arguments)});var _iota_merkle_drop=Module["_iota_merkle_drop"]=(function(){return Module["asm"]["_iota_merkle_drop"].apply(null,arguments)});var _iota_models_v2_tx_attachment_timestamp=Module["_iota_models_v2_tx_attachment_timestamp"]=(function(){return Module["asm"]["_iota_models_v2_tx_attachment_timestamp"].apply(null,arguments)});var _iota_models_v1_tx_timestamp=Module["_iota_models_v1_tx_timestamp"]=(function(){return Module["asm"]["_iota_models_v1_tx_timestamp"].apply(null,arguments)});var _iota_models_v2_tx_bundle=Module["_iota_models_v2_tx_bundle"]=(function(){return Module["asm"]["_iota_models_v2_tx_bundle"].apply(null,arguments)});var _iota_models_v1_tx_set_nonce=Module["_iota_models_v1_tx_set_nonce"]=(function(){return Module["asm"]["_iota_models_v1_tx_set_nonce"].apply(null,arguments)});var _iota_models_v2_tx_set_attachment_timestamp_upper=Module["_iota_models_v2_tx_set_attachment_timestamp_upper"]=(function(){return Module["asm"]["_iota_models_v2_tx_set_attachment_timestamp_upper"].apply(null,arguments)});var _fflush=Module["_fflush"]=(function(){return Module["asm"]["_fflush"].apply(null,arguments)});var setTempRet0=Module["setTempRet0"]=(function(){return Module["asm"]["setTempRet0"].apply(null,arguments)});var _iota_models_v1_tx_bundle=Module["_iota_models_v1_tx_bundle"]=(function(){return Module["asm"]["_iota_models_v1_tx_bundle"].apply(null,arguments)});var _iota_models_v2_tx_obsolete_tag=Module["_iota_models_v2_tx_obsolete_tag"]=(function(){return Module["asm"]["_iota_models_v2_tx_obsolete_tag"].apply(null,arguments)});var _iota_models_v1_tx_essence=Module["_iota_models_v1_tx_essence"]=(function(){return Module["asm"]["_iota_models_v1_tx_essence"].apply(null,arguments)});var _iota_models_v2_tx_signature_or_message=Module["_iota_models_v2_tx_signature_or_message"]=(function(){return Module["asm"]["_iota_models_v2_tx_signature_or_message"].apply(null,arguments)});var _iota_models_v2_tx_set_tag=Module["_iota_models_v2_tx_set_tag"]=(function(){return Module["asm"]["_iota_models_v2_tx_set_tag"].apply(null,arguments)});var _iota_models_v2_tx_set_current_index=Module["_iota_models_v2_tx_set_current_index"]=(function(){return Module["asm"]["_iota_models_v2_tx_set_current_index"].apply(null,arguments)});var _iota_models_v2_tx_attachment_timestamp_lower=Module["_iota_models_v2_tx_attachment_timestamp_lower"]=(function(){return Module["asm"]["_iota_models_v2_tx_attachment_timestamp_lower"].apply(null,arguments)});var _htonl=Module["_htonl"]=(function(){return Module["asm"]["_htonl"].apply(null,arguments)});var _iota_kerl_trit_absorb=Module["_iota_kerl_trit_absorb"]=(function(){return Module["asm"]["_iota_kerl_trit_absorb"].apply(null,arguments)});var _iota_models_v1_tx_nonce=Module["_iota_models_v1_tx_nonce"]=(function(){return Module["asm"]["_iota_models_v1_tx_nonce"].apply(null,arguments)});var _iota_models_v2_tx_set_last_index=Module["_iota_models_v2_tx_set_last_index"]=(function(){return Module["asm"]["_iota_models_v2_tx_set_last_index"].apply(null,arguments)});var _iota_models_v1_tx_set_address=Module["_iota_models_v1_tx_set_address"]=(function(){return Module["asm"]["_iota_models_v1_tx_set_address"].apply(null,arguments)});var _pthread_mutex_unlock=Module["_pthread_mutex_unlock"]=(function(){return Module["asm"]["_pthread_mutex_unlock"].apply(null,arguments)});var stackRestore=Module["stackRestore"]=(function(){return Module["asm"]["stackRestore"].apply(null,arguments)});var _iota_merkle_depth=Module["_iota_merkle_depth"]=(function(){return Module["asm"]["_iota_merkle_depth"].apply(null,arguments)});var _iota_merkle_branch=Module["_iota_merkle_branch"]=(function(){return Module["asm"]["_iota_merkle_branch"].apply(null,arguments)});var _htons=Module["_htons"]=(function(){return Module["asm"]["_htons"].apply(null,arguments)});var _iota_models_v2_tx_set_branch=Module["_iota_models_v2_tx_set_branch"]=(function(){return Module["asm"]["_iota_models_v2_tx_set_branch"].apply(null,arguments)});var ___errno_location=Module["___errno_location"]=(function(){return Module["asm"]["___errno_location"].apply(null,arguments)});var _iota_merkle_size=Module["_iota_merkle_size"]=(function(){return Module["asm"]["_iota_merkle_size"].apply(null,arguments)});var _iota_curl_bctrit_new=Module["_iota_curl_bctrit_new"]=(function(){return Module["asm"]["_iota_curl_bctrit_new"].apply(null,arguments)});var _iota_models_v2_tx_set_timestamp=Module["_iota_models_v2_tx_set_timestamp"]=(function(){return Module["asm"]["_iota_models_v2_tx_set_timestamp"].apply(null,arguments)});var _iota_models_v1_tx_value=Module["_iota_models_v1_tx_value"]=(function(){return Module["asm"]["_iota_models_v1_tx_value"].apply(null,arguments)});var _iota_ctrits_convert=Module["_iota_ctrits_convert"]=(function(){return Module["asm"]["_iota_ctrits_convert"].apply(null,arguments)});var dynCall_iiii=Module["dynCall_iiii"]=(function(){return Module["asm"]["dynCall_iiii"].apply(null,arguments)});var dynCall_viiiiii=Module["dynCall_viiiiii"]=(function(){return Module["asm"]["dynCall_viiiiii"].apply(null,arguments)});var dynCall_viiiiiiiiii=Module["dynCall_viiiiiiiiii"]=(function(){return Module["asm"]["dynCall_viiiiiiiiii"].apply(null,arguments)});var dynCall_viiiii=Module["dynCall_viiiii"]=(function(){return Module["asm"]["dynCall_viiiii"].apply(null,arguments)});var dynCall_i=Module["dynCall_i"]=(function(){return Module["asm"]["dynCall_i"].apply(null,arguments)});var dynCall_vi=Module["dynCall_vi"]=(function(){return Module["asm"]["dynCall_vi"].apply(null,arguments)});var dynCall_vii=Module["dynCall_vii"]=(function(){return Module["asm"]["dynCall_vii"].apply(null,arguments)});var dynCall_ii=Module["dynCall_ii"]=(function(){return Module["asm"]["dynCall_ii"].apply(null,arguments)});var dynCall_ji=Module["dynCall_ji"]=(function(){return Module["asm"]["dynCall_ji"].apply(null,arguments)});var dynCall_jj=Module["dynCall_jj"]=(function(){return Module["asm"]["dynCall_jj"].apply(null,arguments)});var dynCall_v=Module["dynCall_v"]=(function(){return Module["asm"]["dynCall_v"].apply(null,arguments)});var dynCall_viiiiiiiii=Module["dynCall_viiiiiiiii"]=(function(){return Module["asm"]["dynCall_viiiiiiiii"].apply(null,arguments)});var dynCall_viiii=Module["dynCall_viiii"]=(function(){return Module["asm"]["dynCall_viiii"].apply(null,arguments)});var dynCall_iii=Module["dynCall_iii"]=(function(){return Module["asm"]["dynCall_iii"].apply(null,arguments)});var dynCall_viiiiiiii=Module["dynCall_viiiiiiii"]=(function(){return Module["asm"]["dynCall_viiiiiiii"].apply(null,arguments)});var dynCall_viii=Module["dynCall_viii"]=(function(){return Module["asm"]["dynCall_viii"].apply(null,arguments)});Runtime.stackAlloc=Module["stackAlloc"];Runtime.stackSave=Module["stackSave"];Runtime.stackRestore=Module["stackRestore"];Runtime.establishStackSpace=Module["establishStackSpace"];Runtime.setTempRet0=Module["setTempRet0"];Runtime.getTempRet0=Module["getTempRet0"];Module["asm"]=asm;if(memoryInitializer){if(typeof Module["locateFile"]==="function"){memoryInitializer=Module["locateFile"](memoryInitializer)}else if(Module["memoryInitializerPrefixURL"]){memoryInitializer=Module["memoryInitializerPrefixURL"]+memoryInitializer}if(ENVIRONMENT_IS_NODE||ENVIRONMENT_IS_SHELL){var data=Module["readBinary"](memoryInitializer);HEAPU8.set(data,Runtime.GLOBAL_BASE)}else{addRunDependency("memory initializer");var applyMemoryInitializer=(function(data){if(data.byteLength)data=new Uint8Array(data);HEAPU8.set(data,Runtime.GLOBAL_BASE);if(Module["memoryInitializerRequest"])delete Module["memoryInitializerRequest"].response;removeRunDependency("memory initializer")});function doBrowserLoad(){Module["readAsync"](memoryInitializer,applyMemoryInitializer,(function(){throw"could not load memory initializer "+memoryInitializer}))}if(Module["memoryInitializerRequest"]){function useRequest(){var request=Module["memoryInitializerRequest"];if(request.status!==200&&request.status!==0){console.warn("a problem seems to have happened with Module.memoryInitializerRequest, status: "+request.status+", retrying "+memoryInitializer);doBrowserLoad();return}applyMemoryInitializer(request.response)}if(Module["memoryInitializerRequest"].response){setTimeout(useRequest,0)}else{Module["memoryInitializerRequest"].addEventListener("load",useRequest)}}else{doBrowserLoad()}}}function ExitStatus(status){this.name="ExitStatus";this.message="Program terminated with exit("+status+")";this.status=status}ExitStatus.prototype=new Error;ExitStatus.prototype.constructor=ExitStatus;var initialStackTop;var preloadStartTime=null;var calledMain=false;dependenciesFulfilled=function runCaller(){if(!Module["calledRun"])run();if(!Module["calledRun"])dependenciesFulfilled=runCaller};Module["callMain"]=Module.callMain=function callMain(args){args=args||[];ensureInitRuntime();var argc=args.length+1;function pad(){for(var i=0;i<4-1;i++){argv.push(0)}}var argv=[allocate(intArrayFromString(Module["thisProgram"]),"i8",ALLOC_NORMAL)];pad();for(var i=0;i<argc-1;i=i+1){argv.push(allocate(intArrayFromString(args[i]),"i8",ALLOC_NORMAL));pad()}argv.push(0);argv=allocate(argv,"i32",ALLOC_NORMAL);try{var ret=Module["_main"](argc,argv,0);exit(ret,true)}catch(e){if(e instanceof ExitStatus){return}else if(e=="SimulateInfiniteLoop"){Module["noExitRuntime"]=true;return}else{var toLog=e;if(e&&typeof e==="object"&&e.stack){toLog=[e,e.stack]}Module.printErr("exception thrown: "+toLog);Module["quit"](1,e)}}finally{calledMain=true}};function run(args){args=args||Module["arguments"];if(preloadStartTime===null)preloadStartTime=Date.now();if(runDependencies>0){return}preRun();if(runDependencies>0)return;if(Module["calledRun"])return;function doRun(){if(Module["calledRun"])return;Module["calledRun"]=true;if(ABORT)return;ensureInitRuntime();preMain();if(Module["onRuntimeInitialized"])Module["onRuntimeInitialized"]();if(Module["_main"]&&shouldRunNow)Module["callMain"](args);postRun()}if(Module["setStatus"]){Module["setStatus"]("Running...");setTimeout((function(){setTimeout((function(){Module["setStatus"]("")}),1);doRun()}),1)}else{doRun()}}Module["run"]=Module.run=run;function exit(status,implicit){if(implicit&&Module["noExitRuntime"]){return}if(Module["noExitRuntime"]){}else{ABORT=true;EXITSTATUS=status;STACKTOP=initialStackTop;exitRuntime();if(Module["onExit"])Module["onExit"](status)}if(ENVIRONMENT_IS_NODE){process["exit"](status)}Module["quit"](status,new ExitStatus(status))}Module["exit"]=Module.exit=exit;var abortDecorators=[];function abort(what){if(Module["onAbort"]){Module["onAbort"](what)}if(what!==undefined){Module.print(what);Module.printErr(what);what=JSON.stringify(what)}else{what=""}ABORT=true;EXITSTATUS=1;var extra="\nIf this abort() is unexpected, build with -s ASSERTIONS=1 which can give more information.";var output="abort("+what+") at "+stackTrace()+extra;if(abortDecorators){abortDecorators.forEach((function(decorator){output=decorator(output,what)}))}throw output}Module["abort"]=Module.abort=abort;if(Module["preInit"]){if(typeof Module["preInit"]=="function")Module["preInit"]=[Module["preInit"]];while(Module["preInit"].length>0){Module["preInit"].pop()()}}var shouldRunNow=true;if(Module["noInitialRun"]){shouldRunNow=false}run()





          });
        }
      }
    })({"wasmBinaryFile":"/iota-bindings-emscripten.wasm","ENVIRONMENT":"WEB"})
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(41), __webpack_require__(6).Buffer))

/***/ }),
/* 220 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


exports.byteLength = byteLength
exports.toByteArray = toByteArray
exports.fromByteArray = fromByteArray

var lookup = []
var revLookup = []
var Arr = typeof Uint8Array !== 'undefined' ? Uint8Array : Array

var code = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'
for (var i = 0, len = code.length; i < len; ++i) {
  lookup[i] = code[i]
  revLookup[code.charCodeAt(i)] = i
}

revLookup['-'.charCodeAt(0)] = 62
revLookup['_'.charCodeAt(0)] = 63

function placeHoldersCount (b64) {
  var len = b64.length
  if (len % 4 > 0) {
    throw new Error('Invalid string. Length must be a multiple of 4')
  }

  // the number of equal signs (place holders)
  // if there are two placeholders, than the two characters before it
  // represent one byte
  // if there is only one, then the three characters before it represent 2 bytes
  // this is just a cheap hack to not do indexOf twice
  return b64[len - 2] === '=' ? 2 : b64[len - 1] === '=' ? 1 : 0
}

function byteLength (b64) {
  // base64 is 4/3 + up to two characters of the original data
  return (b64.length * 3 / 4) - placeHoldersCount(b64)
}

function toByteArray (b64) {
  var i, l, tmp, placeHolders, arr
  var len = b64.length
  placeHolders = placeHoldersCount(b64)

  arr = new Arr((len * 3 / 4) - placeHolders)

  // if there are placeholders, only get up to the last complete 4 chars
  l = placeHolders > 0 ? len - 4 : len

  var L = 0

  for (i = 0; i < l; i += 4) {
    tmp = (revLookup[b64.charCodeAt(i)] << 18) | (revLookup[b64.charCodeAt(i + 1)] << 12) | (revLookup[b64.charCodeAt(i + 2)] << 6) | revLookup[b64.charCodeAt(i + 3)]
    arr[L++] = (tmp >> 16) & 0xFF
    arr[L++] = (tmp >> 8) & 0xFF
    arr[L++] = tmp & 0xFF
  }

  if (placeHolders === 2) {
    tmp = (revLookup[b64.charCodeAt(i)] << 2) | (revLookup[b64.charCodeAt(i + 1)] >> 4)
    arr[L++] = tmp & 0xFF
  } else if (placeHolders === 1) {
    tmp = (revLookup[b64.charCodeAt(i)] << 10) | (revLookup[b64.charCodeAt(i + 1)] << 4) | (revLookup[b64.charCodeAt(i + 2)] >> 2)
    arr[L++] = (tmp >> 8) & 0xFF
    arr[L++] = tmp & 0xFF
  }

  return arr
}

function tripletToBase64 (num) {
  return lookup[num >> 18 & 0x3F] + lookup[num >> 12 & 0x3F] + lookup[num >> 6 & 0x3F] + lookup[num & 0x3F]
}

function encodeChunk (uint8, start, end) {
  var tmp
  var output = []
  for (var i = start; i < end; i += 3) {
    tmp = (uint8[i] << 16) + (uint8[i + 1] << 8) + (uint8[i + 2])
    output.push(tripletToBase64(tmp))
  }
  return output.join('')
}

function fromByteArray (uint8) {
  var tmp
  var len = uint8.length
  var extraBytes = len % 3 // if we have 1 byte left, pad 2 bytes
  var output = ''
  var parts = []
  var maxChunkLength = 16383 // must be multiple of 3

  // go through the array every three bytes, we'll deal with trailing stuff later
  for (var i = 0, len2 = len - extraBytes; i < len2; i += maxChunkLength) {
    parts.push(encodeChunk(uint8, i, (i + maxChunkLength) > len2 ? len2 : (i + maxChunkLength)))
  }

  // pad the end with zeros, but make sure to not forget the extra bytes
  if (extraBytes === 1) {
    tmp = uint8[len - 1]
    output += lookup[tmp >> 2]
    output += lookup[(tmp << 4) & 0x3F]
    output += '=='
  } else if (extraBytes === 2) {
    tmp = (uint8[len - 2] << 8) + (uint8[len - 1])
    output += lookup[tmp >> 10]
    output += lookup[(tmp >> 4) & 0x3F]
    output += lookup[(tmp << 2) & 0x3F]
    output += '='
  }

  parts.push(output)

  return parts.join('')
}


/***/ }),
/* 221 */
/***/ (function(module, exports) {

exports.read = function (buffer, offset, isLE, mLen, nBytes) {
  var e, m
  var eLen = nBytes * 8 - mLen - 1
  var eMax = (1 << eLen) - 1
  var eBias = eMax >> 1
  var nBits = -7
  var i = isLE ? (nBytes - 1) : 0
  var d = isLE ? -1 : 1
  var s = buffer[offset + i]

  i += d

  e = s & ((1 << (-nBits)) - 1)
  s >>= (-nBits)
  nBits += eLen
  for (; nBits > 0; e = e * 256 + buffer[offset + i], i += d, nBits -= 8) {}

  m = e & ((1 << (-nBits)) - 1)
  e >>= (-nBits)
  nBits += mLen
  for (; nBits > 0; m = m * 256 + buffer[offset + i], i += d, nBits -= 8) {}

  if (e === 0) {
    e = 1 - eBias
  } else if (e === eMax) {
    return m ? NaN : ((s ? -1 : 1) * Infinity)
  } else {
    m = m + Math.pow(2, mLen)
    e = e - eBias
  }
  return (s ? -1 : 1) * m * Math.pow(2, e - mLen)
}

exports.write = function (buffer, value, offset, isLE, mLen, nBytes) {
  var e, m, c
  var eLen = nBytes * 8 - mLen - 1
  var eMax = (1 << eLen) - 1
  var eBias = eMax >> 1
  var rt = (mLen === 23 ? Math.pow(2, -24) - Math.pow(2, -77) : 0)
  var i = isLE ? 0 : (nBytes - 1)
  var d = isLE ? 1 : -1
  var s = value < 0 || (value === 0 && 1 / value < 0) ? 1 : 0

  value = Math.abs(value)

  if (isNaN(value) || value === Infinity) {
    m = isNaN(value) ? 1 : 0
    e = eMax
  } else {
    e = Math.floor(Math.log(value) / Math.LN2)
    if (value * (c = Math.pow(2, -e)) < 1) {
      e--
      c *= 2
    }
    if (e + eBias >= 1) {
      value += rt / c
    } else {
      value += rt * Math.pow(2, 1 - eBias)
    }
    if (value * c >= 2) {
      e++
      c /= 2
    }

    if (e + eBias >= eMax) {
      m = 0
      e = eMax
    } else if (e + eBias >= 1) {
      m = (value * c - 1) * Math.pow(2, mLen)
      e = e + eBias
    } else {
      m = value * Math.pow(2, eBias - 1) * Math.pow(2, mLen)
      e = 0
    }
  }

  for (; mLen >= 8; buffer[offset + i] = m & 0xff, i += d, m /= 256, mLen -= 8) {}

  e = (e << mLen) | m
  eLen += mLen
  for (; eLen > 0; buffer[offset + i] = e & 0xff, i += d, e /= 256, eLen -= 8) {}

  buffer[offset + i - d] |= s * 128
}


/***/ }),
/* 222 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";
/* WEBPACK VAR INJECTION */(function(Buffer) {
var intSize = 4
var zeroBuffer = new Buffer(intSize)
zeroBuffer.fill(0)

var charSize = 8
var hashSize = 16

function toArray (buf) {
  if ((buf.length % intSize) !== 0) {
    var len = buf.length + (intSize - (buf.length % intSize))
    buf = Buffer.concat([buf, zeroBuffer], len)
  }

  var arr = new Array(buf.length >>> 2)
  for (var i = 0, j = 0; i < buf.length; i += intSize, j++) {
    arr[j] = buf.readInt32LE(i)
  }

  return arr
}

module.exports = function hash (buf, fn) {
  var arr = fn(toArray(buf), buf.length * charSize)
  buf = new Buffer(hashSize)
  for (var i = 0; i < arr.length; i++) {
    buf.writeInt32LE(arr[i], i << 2, true)
  }
  return buf
}

/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(6).Buffer))

/***/ }),
/* 223 */
/***/ (function(module, exports) {

/* (ignored) */

/***/ }),
/* 224 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


/*<replacement>*/

function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } }

var Buffer = __webpack_require__(8).Buffer;
/*</replacement>*/

function copyBuffer(src, target, offset) {
  src.copy(target, offset);
}

module.exports = function () {
  function BufferList() {
    _classCallCheck(this, BufferList);

    this.head = null;
    this.tail = null;
    this.length = 0;
  }

  BufferList.prototype.push = function push(v) {
    var entry = { data: v, next: null };
    if (this.length > 0) this.tail.next = entry;else this.head = entry;
    this.tail = entry;
    ++this.length;
  };

  BufferList.prototype.unshift = function unshift(v) {
    var entry = { data: v, next: this.head };
    if (this.length === 0) this.tail = entry;
    this.head = entry;
    ++this.length;
  };

  BufferList.prototype.shift = function shift() {
    if (this.length === 0) return;
    var ret = this.head.data;
    if (this.length === 1) this.head = this.tail = null;else this.head = this.head.next;
    --this.length;
    return ret;
  };

  BufferList.prototype.clear = function clear() {
    this.head = this.tail = null;
    this.length = 0;
  };

  BufferList.prototype.join = function join(s) {
    if (this.length === 0) return '';
    var p = this.head;
    var ret = '' + p.data;
    while (p = p.next) {
      ret += s + p.data;
    }return ret;
  };

  BufferList.prototype.concat = function concat(n) {
    if (this.length === 0) return Buffer.alloc(0);
    if (this.length === 1) return this.head.data;
    var ret = Buffer.allocUnsafe(n >>> 0);
    var p = this.head;
    var i = 0;
    while (p) {
      copyBuffer(p.data, ret, i);
      i += p.data.length;
      p = p.next;
    }
    return ret;
  };

  return BufferList;
}();

/***/ }),
/* 225 */
/***/ (function(module, exports, __webpack_require__) {

var apply = Function.prototype.apply;

// DOM APIs, for completeness

exports.setTimeout = function() {
  return new Timeout(apply.call(setTimeout, window, arguments), clearTimeout);
};
exports.setInterval = function() {
  return new Timeout(apply.call(setInterval, window, arguments), clearInterval);
};
exports.clearTimeout =
exports.clearInterval = function(timeout) {
  if (timeout) {
    timeout.close();
  }
};

function Timeout(id, clearFn) {
  this._id = id;
  this._clearFn = clearFn;
}
Timeout.prototype.unref = Timeout.prototype.ref = function() {};
Timeout.prototype.close = function() {
  this._clearFn.call(window, this._id);
};

// Does not start the time, just sets up the members needed.
exports.enroll = function(item, msecs) {
  clearTimeout(item._idleTimeoutId);
  item._idleTimeout = msecs;
};

exports.unenroll = function(item) {
  clearTimeout(item._idleTimeoutId);
  item._idleTimeout = -1;
};

exports._unrefActive = exports.active = function(item) {
  clearTimeout(item._idleTimeoutId);

  var msecs = item._idleTimeout;
  if (msecs >= 0) {
    item._idleTimeoutId = setTimeout(function onTimeout() {
      if (item._onTimeout)
        item._onTimeout();
    }, msecs);
  }
};

// setimmediate attaches itself to the global object
__webpack_require__(226);
exports.setImmediate = setImmediate;
exports.clearImmediate = clearImmediate;


/***/ }),
/* 226 */
/***/ (function(module, exports, __webpack_require__) {

/* WEBPACK VAR INJECTION */(function(global, process) {(function (global, undefined) {
    "use strict";

    if (global.setImmediate) {
        return;
    }

    var nextHandle = 1; // Spec says greater than zero
    var tasksByHandle = {};
    var currentlyRunningATask = false;
    var doc = global.document;
    var registerImmediate;

    function setImmediate(callback) {
      // Callback can either be a function or a string
      if (typeof callback !== "function") {
        callback = new Function("" + callback);
      }
      // Copy function arguments
      var args = new Array(arguments.length - 1);
      for (var i = 0; i < args.length; i++) {
          args[i] = arguments[i + 1];
      }
      // Store and register the task
      var task = { callback: callback, args: args };
      tasksByHandle[nextHandle] = task;
      registerImmediate(nextHandle);
      return nextHandle++;
    }

    function clearImmediate(handle) {
        delete tasksByHandle[handle];
    }

    function run(task) {
        var callback = task.callback;
        var args = task.args;
        switch (args.length) {
        case 0:
            callback();
            break;
        case 1:
            callback(args[0]);
            break;
        case 2:
            callback(args[0], args[1]);
            break;
        case 3:
            callback(args[0], args[1], args[2]);
            break;
        default:
            callback.apply(undefined, args);
            break;
        }
    }

    function runIfPresent(handle) {
        // From the spec: "Wait until any invocations of this algorithm started before this one have completed."
        // So if we're currently running a task, we'll need to delay this invocation.
        if (currentlyRunningATask) {
            // Delay by doing a setTimeout. setImmediate was tried instead, but in Firefox 7 it generated a
            // "too much recursion" error.
            setTimeout(runIfPresent, 0, handle);
        } else {
            var task = tasksByHandle[handle];
            if (task) {
                currentlyRunningATask = true;
                try {
                    run(task);
                } finally {
                    clearImmediate(handle);
                    currentlyRunningATask = false;
                }
            }
        }
    }

    function installNextTickImplementation() {
        registerImmediate = function(handle) {
            process.nextTick(function () { runIfPresent(handle); });
        };
    }

    function canUsePostMessage() {
        // The test against `importScripts` prevents this implementation from being installed inside a web worker,
        // where `global.postMessage` means something completely different and can't be used for this purpose.
        if (global.postMessage && !global.importScripts) {
            var postMessageIsAsynchronous = true;
            var oldOnMessage = global.onmessage;
            global.onmessage = function() {
                postMessageIsAsynchronous = false;
            };
            global.postMessage("", "*");
            global.onmessage = oldOnMessage;
            return postMessageIsAsynchronous;
        }
    }

    function installPostMessageImplementation() {
        // Installs an event handler on `global` for the `message` event: see
        // * https://developer.mozilla.org/en/DOM/window.postMessage
        // * http://www.whatwg.org/specs/web-apps/current-work/multipage/comms.html#crossDocumentMessages

        var messagePrefix = "setImmediate$" + Math.random() + "$";
        var onGlobalMessage = function(event) {
            if (event.source === global &&
                typeof event.data === "string" &&
                event.data.indexOf(messagePrefix) === 0) {
                runIfPresent(+event.data.slice(messagePrefix.length));
            }
        };

        if (global.addEventListener) {
            global.addEventListener("message", onGlobalMessage, false);
        } else {
            global.attachEvent("onmessage", onGlobalMessage);
        }

        registerImmediate = function(handle) {
            global.postMessage(messagePrefix + handle, "*");
        };
    }

    function installMessageChannelImplementation() {
        var channel = new MessageChannel();
        channel.port1.onmessage = function(event) {
            var handle = event.data;
            runIfPresent(handle);
        };

        registerImmediate = function(handle) {
            channel.port2.postMessage(handle);
        };
    }

    function installReadyStateChangeImplementation() {
        var html = doc.documentElement;
        registerImmediate = function(handle) {
            // Create a <script> element; its readystatechange event will be fired asynchronously once it is inserted
            // into the document. Do so, thus queuing up the task. Remember to clean up once it's been called.
            var script = doc.createElement("script");
            script.onreadystatechange = function () {
                runIfPresent(handle);
                script.onreadystatechange = null;
                html.removeChild(script);
                script = null;
            };
            html.appendChild(script);
        };
    }

    function installSetTimeoutImplementation() {
        registerImmediate = function(handle) {
            setTimeout(runIfPresent, 0, handle);
        };
    }

    // If supported, we should attach to the prototype of global, since that is where setTimeout et al. live.
    var attachTo = Object.getPrototypeOf && Object.getPrototypeOf(global);
    attachTo = attachTo && attachTo.setTimeout ? attachTo : global;

    // Don't get fooled by e.g. browserify environments.
    if ({}.toString.call(global.process) === "[object process]") {
        // For Node.js before 0.9
        installNextTickImplementation();

    } else if (canUsePostMessage()) {
        // For non-IE10 modern browsers
        installPostMessageImplementation();

    } else if (global.MessageChannel) {
        // For web workers, where supported
        installMessageChannelImplementation();

    } else if (doc && "onreadystatechange" in doc.createElement("script")) {
        // For IE 6–8
        installReadyStateChangeImplementation();

    } else {
        // For older browsers
        installSetTimeoutImplementation();
    }

    attachTo.setImmediate = setImmediate;
    attachTo.clearImmediate = clearImmediate;
}(typeof self === "undefined" ? typeof global === "undefined" ? this : global : self));

/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(37), __webpack_require__(41)))

/***/ }),
/* 227 */
/***/ (function(module, exports, __webpack_require__) {

/* WEBPACK VAR INJECTION */(function(global) {
/**
 * Module exports.
 */

module.exports = deprecate;

/**
 * Mark that a method should not be used.
 * Returns a modified function which warns once by default.
 *
 * If `localStorage.noDeprecation = true` is set, then it is a no-op.
 *
 * If `localStorage.throwDeprecation = true` is set, then deprecated functions
 * will throw an Error when invoked.
 *
 * If `localStorage.traceDeprecation = true` is set, then deprecated functions
 * will invoke `console.trace()` instead of `console.error()`.
 *
 * @param {Function} fn - the function to deprecate
 * @param {String} msg - the string to print to the console when `fn` is invoked
 * @returns {Function} a new "deprecated" version of `fn`
 * @api public
 */

function deprecate (fn, msg) {
  if (config('noDeprecation')) {
    return fn;
  }

  var warned = false;
  function deprecated() {
    if (!warned) {
      if (config('throwDeprecation')) {
        throw new Error(msg);
      } else if (config('traceDeprecation')) {
        console.trace(msg);
      } else {
        console.warn(msg);
      }
      warned = true;
    }
    return fn.apply(this, arguments);
  }

  return deprecated;
}

/**
 * Checks `localStorage` for boolean values for the given `name`.
 *
 * @param {String} name
 * @returns {Boolean}
 * @api private
 */

function config (name) {
  // accessing global.localStorage can trigger a DOMException in sandboxed iframes
  try {
    if (!global.localStorage) return false;
  } catch (_) {
    return false;
  }
  var val = global.localStorage[name];
  if (null == val) return false;
  return String(val).toLowerCase() === 'true';
}

/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(37)))

/***/ }),
/* 228 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";
// Copyright Joyent, Inc. and other Node contributors.
//
// Permission is hereby granted, free of charge, to any person obtaining a
// copy of this software and associated documentation files (the
// "Software"), to deal in the Software without restriction, including
// without limitation the rights to use, copy, modify, merge, publish,
// distribute, sublicense, and/or sell copies of the Software, and to permit
// persons to whom the Software is furnished to do so, subject to the
// following conditions:
//
// The above copyright notice and this permission notice shall be included
// in all copies or substantial portions of the Software.
//
// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
// USE OR OTHER DEALINGS IN THE SOFTWARE.

// a passthrough stream.
// basically just the most minimal sort of Transform stream.
// Every written chunk gets output as-is.



module.exports = PassThrough;

var Transform = __webpack_require__(150);

/*<replacement>*/
var util = __webpack_require__(68);
util.inherits = __webpack_require__(1);
/*</replacement>*/

util.inherits(PassThrough, Transform);

function PassThrough(options) {
  if (!(this instanceof PassThrough)) return new PassThrough(options);

  Transform.call(this, options);
}

PassThrough.prototype._transform = function (chunk, encoding, cb) {
  cb(null, chunk);
};

/***/ }),
/* 229 */
/***/ (function(module, exports, __webpack_require__) {

module.exports = __webpack_require__(105);


/***/ }),
/* 230 */
/***/ (function(module, exports, __webpack_require__) {

module.exports = __webpack_require__(45);


/***/ }),
/* 231 */
/***/ (function(module, exports, __webpack_require__) {

module.exports = __webpack_require__(104).Transform


/***/ }),
/* 232 */
/***/ (function(module, exports, __webpack_require__) {

module.exports = __webpack_require__(104).PassThrough


/***/ }),
/* 233 */
/***/ (function(module, exports, __webpack_require__) {

/*
 * A JavaScript implementation of the Secure Hash Algorithm, SHA-0, as defined
 * in FIPS PUB 180-1
 * This source code is derived from sha1.js of the same repository.
 * The difference between SHA-0 and SHA-1 is just a bitwise rotate left
 * operation was added.
 */

var inherits = __webpack_require__(1)
var Hash = __webpack_require__(58)
var Buffer = __webpack_require__(8).Buffer

var K = [
  0x5a827999, 0x6ed9eba1, 0x8f1bbcdc | 0, 0xca62c1d6 | 0
]

var W = new Array(80)

function Sha () {
  this.init()
  this._w = W

  Hash.call(this, 64, 56)
}

inherits(Sha, Hash)

Sha.prototype.init = function () {
  this._a = 0x67452301
  this._b = 0xefcdab89
  this._c = 0x98badcfe
  this._d = 0x10325476
  this._e = 0xc3d2e1f0

  return this
}

function rotl5 (num) {
  return (num << 5) | (num >>> 27)
}

function rotl30 (num) {
  return (num << 30) | (num >>> 2)
}

function ft (s, b, c, d) {
  if (s === 0) return (b & c) | ((~b) & d)
  if (s === 2) return (b & c) | (b & d) | (c & d)
  return b ^ c ^ d
}

Sha.prototype._update = function (M) {
  var W = this._w

  var a = this._a | 0
  var b = this._b | 0
  var c = this._c | 0
  var d = this._d | 0
  var e = this._e | 0

  for (var i = 0; i < 16; ++i) W[i] = M.readInt32BE(i * 4)
  for (; i < 80; ++i) W[i] = W[i - 3] ^ W[i - 8] ^ W[i - 14] ^ W[i - 16]

  for (var j = 0; j < 80; ++j) {
    var s = ~~(j / 20)
    var t = (rotl5(a) + ft(s, b, c, d) + e + W[j] + K[s]) | 0

    e = d
    d = c
    c = rotl30(b)
    b = a
    a = t
  }

  this._a = (a + this._a) | 0
  this._b = (b + this._b) | 0
  this._c = (c + this._c) | 0
  this._d = (d + this._d) | 0
  this._e = (e + this._e) | 0
}

Sha.prototype._hash = function () {
  var H = Buffer.allocUnsafe(20)

  H.writeInt32BE(this._a | 0, 0)
  H.writeInt32BE(this._b | 0, 4)
  H.writeInt32BE(this._c | 0, 8)
  H.writeInt32BE(this._d | 0, 12)
  H.writeInt32BE(this._e | 0, 16)

  return H
}

module.exports = Sha


/***/ }),
/* 234 */
/***/ (function(module, exports, __webpack_require__) {

/*
 * A JavaScript implementation of the Secure Hash Algorithm, SHA-1, as defined
 * in FIPS PUB 180-1
 * Version 2.1a Copyright Paul Johnston 2000 - 2002.
 * Other contributors: Greg Holt, Andrew Kepert, Ydnar, Lostinet
 * Distributed under the BSD License
 * See http://pajhome.org.uk/crypt/md5 for details.
 */

var inherits = __webpack_require__(1)
var Hash = __webpack_require__(58)
var Buffer = __webpack_require__(8).Buffer

var K = [
  0x5a827999, 0x6ed9eba1, 0x8f1bbcdc | 0, 0xca62c1d6 | 0
]

var W = new Array(80)

function Sha1 () {
  this.init()
  this._w = W

  Hash.call(this, 64, 56)
}

inherits(Sha1, Hash)

Sha1.prototype.init = function () {
  this._a = 0x67452301
  this._b = 0xefcdab89
  this._c = 0x98badcfe
  this._d = 0x10325476
  this._e = 0xc3d2e1f0

  return this
}

function rotl1 (num) {
  return (num << 1) | (num >>> 31)
}

function rotl5 (num) {
  return (num << 5) | (num >>> 27)
}

function rotl30 (num) {
  return (num << 30) | (num >>> 2)
}

function ft (s, b, c, d) {
  if (s === 0) return (b & c) | ((~b) & d)
  if (s === 2) return (b & c) | (b & d) | (c & d)
  return b ^ c ^ d
}

Sha1.prototype._update = function (M) {
  var W = this._w

  var a = this._a | 0
  var b = this._b | 0
  var c = this._c | 0
  var d = this._d | 0
  var e = this._e | 0

  for (var i = 0; i < 16; ++i) W[i] = M.readInt32BE(i * 4)
  for (; i < 80; ++i) W[i] = rotl1(W[i - 3] ^ W[i - 8] ^ W[i - 14] ^ W[i - 16])

  for (var j = 0; j < 80; ++j) {
    var s = ~~(j / 20)
    var t = (rotl5(a) + ft(s, b, c, d) + e + W[j] + K[s]) | 0

    e = d
    d = c
    c = rotl30(b)
    b = a
    a = t
  }

  this._a = (a + this._a) | 0
  this._b = (b + this._b) | 0
  this._c = (c + this._c) | 0
  this._d = (d + this._d) | 0
  this._e = (e + this._e) | 0
}

Sha1.prototype._hash = function () {
  var H = Buffer.allocUnsafe(20)

  H.writeInt32BE(this._a | 0, 0)
  H.writeInt32BE(this._b | 0, 4)
  H.writeInt32BE(this._c | 0, 8)
  H.writeInt32BE(this._d | 0, 12)
  H.writeInt32BE(this._e | 0, 16)

  return H
}

module.exports = Sha1


/***/ }),
/* 235 */
/***/ (function(module, exports, __webpack_require__) {

/**
 * A JavaScript implementation of the Secure Hash Algorithm, SHA-256, as defined
 * in FIPS 180-2
 * Version 2.2-beta Copyright Angel Marin, Paul Johnston 2000 - 2009.
 * Other contributors: Greg Holt, Andrew Kepert, Ydnar, Lostinet
 *
 */

var inherits = __webpack_require__(1)
var Sha256 = __webpack_require__(151)
var Hash = __webpack_require__(58)
var Buffer = __webpack_require__(8).Buffer

var W = new Array(64)

function Sha224 () {
  this.init()

  this._w = W // new Array(64)

  Hash.call(this, 64, 56)
}

inherits(Sha224, Sha256)

Sha224.prototype.init = function () {
  this._a = 0xc1059ed8
  this._b = 0x367cd507
  this._c = 0x3070dd17
  this._d = 0xf70e5939
  this._e = 0xffc00b31
  this._f = 0x68581511
  this._g = 0x64f98fa7
  this._h = 0xbefa4fa4

  return this
}

Sha224.prototype._hash = function () {
  var H = Buffer.allocUnsafe(28)

  H.writeInt32BE(this._a, 0)
  H.writeInt32BE(this._b, 4)
  H.writeInt32BE(this._c, 8)
  H.writeInt32BE(this._d, 12)
  H.writeInt32BE(this._e, 16)
  H.writeInt32BE(this._f, 20)
  H.writeInt32BE(this._g, 24)

  return H
}

module.exports = Sha224


/***/ }),
/* 236 */
/***/ (function(module, exports, __webpack_require__) {

var inherits = __webpack_require__(1)
var SHA512 = __webpack_require__(152)
var Hash = __webpack_require__(58)
var Buffer = __webpack_require__(8).Buffer

var W = new Array(160)

function Sha384 () {
  this.init()
  this._w = W

  Hash.call(this, 128, 112)
}

inherits(Sha384, SHA512)

Sha384.prototype.init = function () {
  this._ah = 0xcbbb9d5d
  this._bh = 0x629a292a
  this._ch = 0x9159015a
  this._dh = 0x152fecd8
  this._eh = 0x67332667
  this._fh = 0x8eb44a87
  this._gh = 0xdb0c2e0d
  this._hh = 0x47b5481d

  this._al = 0xc1059ed8
  this._bl = 0x367cd507
  this._cl = 0x3070dd17
  this._dl = 0xf70e5939
  this._el = 0xffc00b31
  this._fl = 0x68581511
  this._gl = 0x64f98fa7
  this._hl = 0xbefa4fa4

  return this
}

Sha384.prototype._hash = function () {
  var H = Buffer.allocUnsafe(48)

  function writeInt64BE (h, l, offset) {
    H.writeInt32BE(h, offset)
    H.writeInt32BE(l, offset + 4)
  }

  writeInt64BE(this._ah, this._al, 0)
  writeInt64BE(this._bh, this._bl, 8)
  writeInt64BE(this._ch, this._cl, 16)
  writeInt64BE(this._dh, this._dl, 24)
  writeInt64BE(this._eh, this._el, 32)
  writeInt64BE(this._fh, this._fl, 40)

  return H
}

module.exports = Sha384


/***/ }),
/* 237 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var inherits = __webpack_require__(1)
var Buffer = __webpack_require__(8).Buffer

var Base = __webpack_require__(42)

var ZEROS = Buffer.alloc(128)
var blocksize = 64

function Hmac (alg, key) {
  Base.call(this, 'digest')
  if (typeof key === 'string') {
    key = Buffer.from(key)
  }

  this._alg = alg
  this._key = key

  if (key.length > blocksize) {
    key = alg(key)
  } else if (key.length < blocksize) {
    key = Buffer.concat([key, ZEROS], blocksize)
  }

  var ipad = this._ipad = Buffer.allocUnsafe(blocksize)
  var opad = this._opad = Buffer.allocUnsafe(blocksize)

  for (var i = 0; i < blocksize; i++) {
    ipad[i] = key[i] ^ 0x36
    opad[i] = key[i] ^ 0x5C
  }

  this._hash = [ipad]
}

inherits(Hmac, Base)

Hmac.prototype._update = function (data) {
  this._hash.push(data)
}

Hmac.prototype._final = function () {
  var h = this._alg(Buffer.concat(this._hash))
  return this._alg(Buffer.concat([this._opad, h]))
}
module.exports = Hmac


/***/ }),
/* 238 */
/***/ (function(module, exports, __webpack_require__) {

module.exports = __webpack_require__(154)


/***/ }),
/* 239 */
/***/ (function(module, exports, __webpack_require__) {

/* WEBPACK VAR INJECTION */(function(global, process) {var checkParameters = __webpack_require__(156)
var defaultEncoding = __webpack_require__(157)
var sync = __webpack_require__(158)
var Buffer = __webpack_require__(8).Buffer

var ZERO_BUF
var subtle = global.crypto && global.crypto.subtle
var toBrowser = {
  'sha': 'SHA-1',
  'sha-1': 'SHA-1',
  'sha1': 'SHA-1',
  'sha256': 'SHA-256',
  'sha-256': 'SHA-256',
  'sha384': 'SHA-384',
  'sha-384': 'SHA-384',
  'sha-512': 'SHA-512',
  'sha512': 'SHA-512'
}
var checks = []
function checkNative (algo) {
  if (global.process && !global.process.browser) {
    return Promise.resolve(false)
  }
  if (!subtle || !subtle.importKey || !subtle.deriveBits) {
    return Promise.resolve(false)
  }
  if (checks[algo] !== undefined) {
    return checks[algo]
  }
  ZERO_BUF = ZERO_BUF || Buffer.alloc(8)
  var prom = browserPbkdf2(ZERO_BUF, ZERO_BUF, 10, 128, algo)
    .then(function () {
      return true
    }).catch(function () {
      return false
    })
  checks[algo] = prom
  return prom
}
function browserPbkdf2 (password, salt, iterations, length, algo) {
  return subtle.importKey(
    'raw', password, {name: 'PBKDF2'}, false, ['deriveBits']
  ).then(function (key) {
    return subtle.deriveBits({
      name: 'PBKDF2',
      salt: salt,
      iterations: iterations,
      hash: {
        name: algo
      }
    }, key, length << 3)
  }).then(function (res) {
    return Buffer.from(res)
  })
}
function resolvePromise (promise, callback) {
  promise.then(function (out) {
    process.nextTick(function () {
      callback(null, out)
    })
  }, function (e) {
    process.nextTick(function () {
      callback(e)
    })
  })
}
module.exports = function (password, salt, iterations, keylen, digest, callback) {
  if (!Buffer.isBuffer(password)) password = Buffer.from(password, defaultEncoding)
  if (!Buffer.isBuffer(salt)) salt = Buffer.from(salt, defaultEncoding)

  checkParameters(iterations, keylen)
  if (typeof digest === 'function') {
    callback = digest
    digest = undefined
  }
  if (typeof callback !== 'function') throw new Error('No callback provided to pbkdf2')

  digest = digest || 'sha1'
  var algo = toBrowser[digest.toLowerCase()]
  if (!algo || typeof global.Promise !== 'function') {
    return process.nextTick(function () {
      var out
      try {
        out = sync(password, salt, iterations, keylen, digest)
      } catch (e) {
        return callback(e)
      }
      callback(null, out)
    })
  }
  resolvePromise(checkNative(algo).then(function (resp) {
    if (resp) {
      return browserPbkdf2(password, salt, iterations, keylen, algo)
    } else {
      return sync(password, salt, iterations, keylen, digest)
    }
  }), callback)
}

/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(37), __webpack_require__(41)))

/***/ }),
/* 240 */
/***/ (function(module, exports, __webpack_require__) {

var ebtk = __webpack_require__(78)
var aes = __webpack_require__(108)
var DES = __webpack_require__(251)
var desModes = __webpack_require__(257)
var aesModes = __webpack_require__(109)
function createCipher (suite, password) {
  var keyLen, ivLen
  suite = suite.toLowerCase()
  if (aesModes[suite]) {
    keyLen = aesModes[suite].key
    ivLen = aesModes[suite].iv
  } else if (desModes[suite]) {
    keyLen = desModes[suite].key * 8
    ivLen = desModes[suite].iv
  } else {
    throw new TypeError('invalid suite type')
  }
  var keys = ebtk(password, false, keyLen, ivLen)
  return createCipheriv(suite, keys.key, keys.iv)
}
function createDecipher (suite, password) {
  var keyLen, ivLen
  suite = suite.toLowerCase()
  if (aesModes[suite]) {
    keyLen = aesModes[suite].key
    ivLen = aesModes[suite].iv
  } else if (desModes[suite]) {
    keyLen = desModes[suite].key * 8
    ivLen = desModes[suite].iv
  } else {
    throw new TypeError('invalid suite type')
  }
  var keys = ebtk(password, false, keyLen, ivLen)
  return createDecipheriv(suite, keys.key, keys.iv)
}

function createCipheriv (suite, key, iv) {
  suite = suite.toLowerCase()
  if (aesModes[suite]) {
    return aes.createCipheriv(suite, key, iv)
  } else if (desModes[suite]) {
    return new DES({
      key: key,
      iv: iv,
      mode: suite
    })
  } else {
    throw new TypeError('invalid suite type')
  }
}
function createDecipheriv (suite, key, iv) {
  suite = suite.toLowerCase()
  if (aesModes[suite]) {
    return aes.createDecipheriv(suite, key, iv)
  } else if (desModes[suite]) {
    return new DES({
      key: key,
      iv: iv,
      mode: suite,
      decrypt: true
    })
  } else {
    throw new TypeError('invalid suite type')
  }
}
exports.createCipher = exports.Cipher = createCipher
exports.createCipheriv = exports.Cipheriv = createCipheriv
exports.createDecipher = exports.Decipher = createDecipher
exports.createDecipheriv = exports.Decipheriv = createDecipheriv
function getCiphers () {
  return Object.keys(desModes).concat(aes.getCiphers())
}
exports.listCiphers = exports.getCiphers = getCiphers


/***/ }),
/* 241 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";
/* WEBPACK VAR INJECTION */(function(Buffer) {
var inherits = __webpack_require__(1)
var HashBase = __webpack_require__(146)

var ARRAY16 = new Array(16)

function MD5 () {
  HashBase.call(this, 64)

  // state
  this._a = 0x67452301
  this._b = 0xefcdab89
  this._c = 0x98badcfe
  this._d = 0x10325476
}

inherits(MD5, HashBase)

MD5.prototype._update = function () {
  var M = ARRAY16
  for (var i = 0; i < 16; ++i) M[i] = this._block.readInt32LE(i * 4)

  var a = this._a
  var b = this._b
  var c = this._c
  var d = this._d

  a = fnF(a, b, c, d, M[0], 0xd76aa478, 7)
  d = fnF(d, a, b, c, M[1], 0xe8c7b756, 12)
  c = fnF(c, d, a, b, M[2], 0x242070db, 17)
  b = fnF(b, c, d, a, M[3], 0xc1bdceee, 22)
  a = fnF(a, b, c, d, M[4], 0xf57c0faf, 7)
  d = fnF(d, a, b, c, M[5], 0x4787c62a, 12)
  c = fnF(c, d, a, b, M[6], 0xa8304613, 17)
  b = fnF(b, c, d, a, M[7], 0xfd469501, 22)
  a = fnF(a, b, c, d, M[8], 0x698098d8, 7)
  d = fnF(d, a, b, c, M[9], 0x8b44f7af, 12)
  c = fnF(c, d, a, b, M[10], 0xffff5bb1, 17)
  b = fnF(b, c, d, a, M[11], 0x895cd7be, 22)
  a = fnF(a, b, c, d, M[12], 0x6b901122, 7)
  d = fnF(d, a, b, c, M[13], 0xfd987193, 12)
  c = fnF(c, d, a, b, M[14], 0xa679438e, 17)
  b = fnF(b, c, d, a, M[15], 0x49b40821, 22)

  a = fnG(a, b, c, d, M[1], 0xf61e2562, 5)
  d = fnG(d, a, b, c, M[6], 0xc040b340, 9)
  c = fnG(c, d, a, b, M[11], 0x265e5a51, 14)
  b = fnG(b, c, d, a, M[0], 0xe9b6c7aa, 20)
  a = fnG(a, b, c, d, M[5], 0xd62f105d, 5)
  d = fnG(d, a, b, c, M[10], 0x02441453, 9)
  c = fnG(c, d, a, b, M[15], 0xd8a1e681, 14)
  b = fnG(b, c, d, a, M[4], 0xe7d3fbc8, 20)
  a = fnG(a, b, c, d, M[9], 0x21e1cde6, 5)
  d = fnG(d, a, b, c, M[14], 0xc33707d6, 9)
  c = fnG(c, d, a, b, M[3], 0xf4d50d87, 14)
  b = fnG(b, c, d, a, M[8], 0x455a14ed, 20)
  a = fnG(a, b, c, d, M[13], 0xa9e3e905, 5)
  d = fnG(d, a, b, c, M[2], 0xfcefa3f8, 9)
  c = fnG(c, d, a, b, M[7], 0x676f02d9, 14)
  b = fnG(b, c, d, a, M[12], 0x8d2a4c8a, 20)

  a = fnH(a, b, c, d, M[5], 0xfffa3942, 4)
  d = fnH(d, a, b, c, M[8], 0x8771f681, 11)
  c = fnH(c, d, a, b, M[11], 0x6d9d6122, 16)
  b = fnH(b, c, d, a, M[14], 0xfde5380c, 23)
  a = fnH(a, b, c, d, M[1], 0xa4beea44, 4)
  d = fnH(d, a, b, c, M[4], 0x4bdecfa9, 11)
  c = fnH(c, d, a, b, M[7], 0xf6bb4b60, 16)
  b = fnH(b, c, d, a, M[10], 0xbebfbc70, 23)
  a = fnH(a, b, c, d, M[13], 0x289b7ec6, 4)
  d = fnH(d, a, b, c, M[0], 0xeaa127fa, 11)
  c = fnH(c, d, a, b, M[3], 0xd4ef3085, 16)
  b = fnH(b, c, d, a, M[6], 0x04881d05, 23)
  a = fnH(a, b, c, d, M[9], 0xd9d4d039, 4)
  d = fnH(d, a, b, c, M[12], 0xe6db99e5, 11)
  c = fnH(c, d, a, b, M[15], 0x1fa27cf8, 16)
  b = fnH(b, c, d, a, M[2], 0xc4ac5665, 23)

  a = fnI(a, b, c, d, M[0], 0xf4292244, 6)
  d = fnI(d, a, b, c, M[7], 0x432aff97, 10)
  c = fnI(c, d, a, b, M[14], 0xab9423a7, 15)
  b = fnI(b, c, d, a, M[5], 0xfc93a039, 21)
  a = fnI(a, b, c, d, M[12], 0x655b59c3, 6)
  d = fnI(d, a, b, c, M[3], 0x8f0ccc92, 10)
  c = fnI(c, d, a, b, M[10], 0xffeff47d, 15)
  b = fnI(b, c, d, a, M[1], 0x85845dd1, 21)
  a = fnI(a, b, c, d, M[8], 0x6fa87e4f, 6)
  d = fnI(d, a, b, c, M[15], 0xfe2ce6e0, 10)
  c = fnI(c, d, a, b, M[6], 0xa3014314, 15)
  b = fnI(b, c, d, a, M[13], 0x4e0811a1, 21)
  a = fnI(a, b, c, d, M[4], 0xf7537e82, 6)
  d = fnI(d, a, b, c, M[11], 0xbd3af235, 10)
  c = fnI(c, d, a, b, M[2], 0x2ad7d2bb, 15)
  b = fnI(b, c, d, a, M[9], 0xeb86d391, 21)

  this._a = (this._a + a) | 0
  this._b = (this._b + b) | 0
  this._c = (this._c + c) | 0
  this._d = (this._d + d) | 0
}

MD5.prototype._digest = function () {
  // create padding and handle blocks
  this._block[this._blockOffset++] = 0x80
  if (this._blockOffset > 56) {
    this._block.fill(0, this._blockOffset, 64)
    this._update()
    this._blockOffset = 0
  }

  this._block.fill(0, this._blockOffset, 56)
  this._block.writeUInt32LE(this._length[0], 56)
  this._block.writeUInt32LE(this._length[1], 60)
  this._update()

  // produce result
  var buffer = new Buffer(16)
  buffer.writeInt32LE(this._a, 0)
  buffer.writeInt32LE(this._b, 4)
  buffer.writeInt32LE(this._c, 8)
  buffer.writeInt32LE(this._d, 12)
  return buffer
}

function rotl (x, n) {
  return (x << n) | (x >>> (32 - n))
}

function fnF (a, b, c, d, m, k, s) {
  return (rotl((a + ((b & c) | ((~b) & d)) + m + k) | 0, s) + b) | 0
}

function fnG (a, b, c, d, m, k, s) {
  return (rotl((a + ((b & d) | (c & (~d))) + m + k) | 0, s) + b) | 0
}

function fnH (a, b, c, d, m, k, s) {
  return (rotl((a + (b ^ c ^ d) + m + k) | 0, s) + b) | 0
}

function fnI (a, b, c, d, m, k, s) {
  return (rotl((a + ((c ^ (b | (~d)))) + m + k) | 0, s) + b) | 0
}

module.exports = MD5

/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(6).Buffer))

/***/ }),
/* 242 */
/***/ (function(module, exports, __webpack_require__) {

var MODES = __webpack_require__(109)
var AuthCipher = __webpack_require__(162)
var Buffer = __webpack_require__(8).Buffer
var StreamCipher = __webpack_require__(163)
var Transform = __webpack_require__(42)
var aes = __webpack_require__(79)
var ebtk = __webpack_require__(78)
var inherits = __webpack_require__(1)

function Cipher (mode, key, iv) {
  Transform.call(this)

  this._cache = new Splitter()
  this._cipher = new aes.AES(key)
  this._prev = Buffer.from(iv)
  this._mode = mode
  this._autopadding = true
}

inherits(Cipher, Transform)

Cipher.prototype._update = function (data) {
  this._cache.add(data)
  var chunk
  var thing
  var out = []

  while ((chunk = this._cache.get())) {
    thing = this._mode.encrypt(this, chunk)
    out.push(thing)
  }

  return Buffer.concat(out)
}

var PADDING = Buffer.alloc(16, 0x10)

Cipher.prototype._final = function () {
  var chunk = this._cache.flush()
  if (this._autopadding) {
    chunk = this._mode.encrypt(this, chunk)
    this._cipher.scrub()
    return chunk
  }

  if (!chunk.equals(PADDING)) {
    this._cipher.scrub()
    throw new Error('data not multiple of block length')
  }
}

Cipher.prototype.setAutoPadding = function (setTo) {
  this._autopadding = !!setTo
  return this
}

function Splitter () {
  this.cache = Buffer.allocUnsafe(0)
}

Splitter.prototype.add = function (data) {
  this.cache = Buffer.concat([this.cache, data])
}

Splitter.prototype.get = function () {
  if (this.cache.length > 15) {
    var out = this.cache.slice(0, 16)
    this.cache = this.cache.slice(16)
    return out
  }
  return null
}

Splitter.prototype.flush = function () {
  var len = 16 - this.cache.length
  var padBuff = Buffer.allocUnsafe(len)

  var i = -1
  while (++i < len) {
    padBuff.writeUInt8(len, i)
  }

  return Buffer.concat([this.cache, padBuff])
}

function createCipheriv (suite, password, iv) {
  var config = MODES[suite.toLowerCase()]
  if (!config) throw new TypeError('invalid suite type')

  if (typeof password === 'string') password = Buffer.from(password)
  if (password.length !== config.key / 8) throw new TypeError('invalid key length ' + password.length)

  if (typeof iv === 'string') iv = Buffer.from(iv)
  if (config.mode !== 'GCM' && iv.length !== config.iv) throw new TypeError('invalid iv length ' + iv.length)

  if (config.type === 'stream') {
    return new StreamCipher(config.module, password, iv)
  } else if (config.type === 'auth') {
    return new AuthCipher(config.module, password, iv)
  }

  return new Cipher(config.module, password, iv)
}

function createCipher (suite, password) {
  var config = MODES[suite.toLowerCase()]
  if (!config) throw new TypeError('invalid suite type')

  var keys = ebtk(password, false, config.key, config.iv)
  return createCipheriv(suite, keys.key, keys.iv)
}

exports.createCipheriv = createCipheriv
exports.createCipher = createCipher


/***/ }),
/* 243 */
/***/ (function(module, exports) {

exports.encrypt = function (self, block) {
  return self._cipher.encryptBlock(block)
}

exports.decrypt = function (self, block) {
  return self._cipher.decryptBlock(block)
}


/***/ }),
/* 244 */
/***/ (function(module, exports, __webpack_require__) {

var xor = __webpack_require__(69)

exports.encrypt = function (self, block) {
  var data = xor(block, self._prev)

  self._prev = self._cipher.encryptBlock(data)
  return self._prev
}

exports.decrypt = function (self, block) {
  var pad = self._prev

  self._prev = block
  var out = self._cipher.decryptBlock(block)

  return xor(out, pad)
}


/***/ }),
/* 245 */
/***/ (function(module, exports, __webpack_require__) {

var Buffer = __webpack_require__(8).Buffer
var xor = __webpack_require__(69)

function encryptStart (self, data, decrypt) {
  var len = data.length
  var out = xor(data, self._cache)
  self._cache = self._cache.slice(len)
  self._prev = Buffer.concat([self._prev, decrypt ? data : out])
  return out
}

exports.encrypt = function (self, data, decrypt) {
  var out = Buffer.allocUnsafe(0)
  var len

  while (data.length) {
    if (self._cache.length === 0) {
      self._cache = self._cipher.encryptBlock(self._prev)
      self._prev = Buffer.allocUnsafe(0)
    }

    if (self._cache.length <= data.length) {
      len = self._cache.length
      out = Buffer.concat([out, encryptStart(self, data.slice(0, len), decrypt)])
      data = data.slice(len)
    } else {
      out = Buffer.concat([out, encryptStart(self, data, decrypt)])
      break
    }
  }

  return out
}


/***/ }),
/* 246 */
/***/ (function(module, exports, __webpack_require__) {

/* WEBPACK VAR INJECTION */(function(Buffer) {function encryptByte (self, byteParam, decrypt) {
  var pad = self._cipher.encryptBlock(self._prev)
  var out = pad[0] ^ byteParam

  self._prev = Buffer.concat([
    self._prev.slice(1),
    Buffer.from([decrypt ? byteParam : out])
  ])

  return out
}

exports.encrypt = function (self, chunk, decrypt) {
  var len = chunk.length
  var out = Buffer.allocUnsafe(len)
  var i = -1

  while (++i < len) {
    out[i] = encryptByte(self, chunk[i], decrypt)
  }

  return out
}

/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(6).Buffer))

/***/ }),
/* 247 */
/***/ (function(module, exports, __webpack_require__) {

var Buffer = __webpack_require__(8).Buffer

function encryptByte (self, byteParam, decrypt) {
  var pad
  var i = -1
  var len = 8
  var out = 0
  var bit, value
  while (++i < len) {
    pad = self._cipher.encryptBlock(self._prev)
    bit = (byteParam & (1 << (7 - i))) ? 0x80 : 0
    value = pad[0] ^ bit
    out += ((value & 0x80) >> (i % 8))
    self._prev = shiftIn(self._prev, decrypt ? bit : value)
  }
  return out
}

function shiftIn (buffer, value) {
  var len = buffer.length
  var i = -1
  var out = Buffer.allocUnsafe(buffer.length)
  buffer = Buffer.concat([buffer, Buffer.from([value])])

  while (++i < len) {
    out[i] = buffer[i] << 1 | buffer[i + 1] >> (7)
  }

  return out
}

exports.encrypt = function (self, chunk, decrypt) {
  var len = chunk.length
  var out = Buffer.allocUnsafe(len)
  var i = -1

  while (++i < len) {
    out[i] = encryptByte(self, chunk[i], decrypt)
  }

  return out
}


/***/ }),
/* 248 */
/***/ (function(module, exports, __webpack_require__) {

/* WEBPACK VAR INJECTION */(function(Buffer) {var xor = __webpack_require__(69)

function getBlock (self) {
  self._prev = self._cipher.encryptBlock(self._prev)
  return self._prev
}

exports.encrypt = function (self, chunk) {
  while (self._cache.length < chunk.length) {
    self._cache = Buffer.concat([self._cache, getBlock(self)])
  }

  var pad = self._cache.slice(0, chunk.length)
  self._cache = self._cache.slice(chunk.length)
  return xor(chunk, pad)
}

/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(6).Buffer))

/***/ }),
/* 249 */
/***/ (function(module, exports, __webpack_require__) {

var Buffer = __webpack_require__(8).Buffer
var ZEROES = Buffer.alloc(16, 0)

function toArray (buf) {
  return [
    buf.readUInt32BE(0),
    buf.readUInt32BE(4),
    buf.readUInt32BE(8),
    buf.readUInt32BE(12)
  ]
}

function fromArray (out) {
  var buf = Buffer.allocUnsafe(16)
  buf.writeUInt32BE(out[0] >>> 0, 0)
  buf.writeUInt32BE(out[1] >>> 0, 4)
  buf.writeUInt32BE(out[2] >>> 0, 8)
  buf.writeUInt32BE(out[3] >>> 0, 12)
  return buf
}

function GHASH (key) {
  this.h = key
  this.state = Buffer.alloc(16, 0)
  this.cache = Buffer.allocUnsafe(0)
}

// from http://bitwiseshiftleft.github.io/sjcl/doc/symbols/src/core_gcm.js.html
// by Juho Vähä-Herttua
GHASH.prototype.ghash = function (block) {
  var i = -1
  while (++i < block.length) {
    this.state[i] ^= block[i]
  }
  this._multiply()
}

GHASH.prototype._multiply = function () {
  var Vi = toArray(this.h)
  var Zi = [0, 0, 0, 0]
  var j, xi, lsbVi
  var i = -1
  while (++i < 128) {
    xi = (this.state[~~(i / 8)] & (1 << (7 - (i % 8)))) !== 0
    if (xi) {
      // Z_i+1 = Z_i ^ V_i
      Zi[0] ^= Vi[0]
      Zi[1] ^= Vi[1]
      Zi[2] ^= Vi[2]
      Zi[3] ^= Vi[3]
    }

    // Store the value of LSB(V_i)
    lsbVi = (Vi[3] & 1) !== 0

    // V_i+1 = V_i >> 1
    for (j = 3; j > 0; j--) {
      Vi[j] = (Vi[j] >>> 1) | ((Vi[j - 1] & 1) << 31)
    }
    Vi[0] = Vi[0] >>> 1

    // If LSB(V_i) is 1, V_i+1 = (V_i >> 1) ^ R
    if (lsbVi) {
      Vi[0] = Vi[0] ^ (0xe1 << 24)
    }
  }
  this.state = fromArray(Zi)
}

GHASH.prototype.update = function (buf) {
  this.cache = Buffer.concat([this.cache, buf])
  var chunk
  while (this.cache.length >= 16) {
    chunk = this.cache.slice(0, 16)
    this.cache = this.cache.slice(16)
    this.ghash(chunk)
  }
}

GHASH.prototype.final = function (abl, bl) {
  if (this.cache.length) {
    this.ghash(Buffer.concat([this.cache, ZEROES], 16))
  }

  this.ghash(fromArray([0, abl, 0, bl]))
  return this.state
}

module.exports = GHASH


/***/ }),
/* 250 */
/***/ (function(module, exports, __webpack_require__) {

var AuthCipher = __webpack_require__(162)
var Buffer = __webpack_require__(8).Buffer
var MODES = __webpack_require__(109)
var StreamCipher = __webpack_require__(163)
var Transform = __webpack_require__(42)
var aes = __webpack_require__(79)
var ebtk = __webpack_require__(78)
var inherits = __webpack_require__(1)

function Decipher (mode, key, iv) {
  Transform.call(this)

  this._cache = new Splitter()
  this._last = void 0
  this._cipher = new aes.AES(key)
  this._prev = Buffer.from(iv)
  this._mode = mode
  this._autopadding = true
}

inherits(Decipher, Transform)

Decipher.prototype._update = function (data) {
  this._cache.add(data)
  var chunk
  var thing
  var out = []
  while ((chunk = this._cache.get(this._autopadding))) {
    thing = this._mode.decrypt(this, chunk)
    out.push(thing)
  }
  return Buffer.concat(out)
}

Decipher.prototype._final = function () {
  var chunk = this._cache.flush()
  if (this._autopadding) {
    return unpad(this._mode.decrypt(this, chunk))
  } else if (chunk) {
    throw new Error('data not multiple of block length')
  }
}

Decipher.prototype.setAutoPadding = function (setTo) {
  this._autopadding = !!setTo
  return this
}

function Splitter () {
  this.cache = Buffer.allocUnsafe(0)
}

Splitter.prototype.add = function (data) {
  this.cache = Buffer.concat([this.cache, data])
}

Splitter.prototype.get = function (autoPadding) {
  var out
  if (autoPadding) {
    if (this.cache.length > 16) {
      out = this.cache.slice(0, 16)
      this.cache = this.cache.slice(16)
      return out
    }
  } else {
    if (this.cache.length >= 16) {
      out = this.cache.slice(0, 16)
      this.cache = this.cache.slice(16)
      return out
    }
  }

  return null
}

Splitter.prototype.flush = function () {
  if (this.cache.length) return this.cache
}

function unpad (last) {
  var padded = last[15]
  var i = -1
  while (++i < padded) {
    if (last[(i + (16 - padded))] !== padded) {
      throw new Error('unable to decrypt data')
    }
  }
  if (padded === 16) return

  return last.slice(0, 16 - padded)
}

function createDecipheriv (suite, password, iv) {
  var config = MODES[suite.toLowerCase()]
  if (!config) throw new TypeError('invalid suite type')

  if (typeof iv === 'string') iv = Buffer.from(iv)
  if (config.mode !== 'GCM' && iv.length !== config.iv) throw new TypeError('invalid iv length ' + iv.length)

  if (typeof password === 'string') password = Buffer.from(password)
  if (password.length !== config.key / 8) throw new TypeError('invalid key length ' + password.length)

  if (config.type === 'stream') {
    return new StreamCipher(config.module, password, iv, true)
  } else if (config.type === 'auth') {
    return new AuthCipher(config.module, password, iv, true)
  }

  return new Decipher(config.module, password, iv)
}

function createDecipher (suite, password) {
  var config = MODES[suite.toLowerCase()]
  if (!config) throw new TypeError('invalid suite type')

  var keys = ebtk(password, false, config.key, config.iv)
  return createDecipheriv(suite, keys.key, keys.iv)
}

exports.createDecipher = createDecipher
exports.createDecipheriv = createDecipheriv


/***/ }),
/* 251 */
/***/ (function(module, exports, __webpack_require__) {

/* WEBPACK VAR INJECTION */(function(Buffer) {var CipherBase = __webpack_require__(42)
var des = __webpack_require__(110)
var inherits = __webpack_require__(1)

var modes = {
  'des-ede3-cbc': des.CBC.instantiate(des.EDE),
  'des-ede3': des.EDE,
  'des-ede-cbc': des.CBC.instantiate(des.EDE),
  'des-ede': des.EDE,
  'des-cbc': des.CBC.instantiate(des.DES),
  'des-ecb': des.DES
}
modes.des = modes['des-cbc']
modes.des3 = modes['des-ede3-cbc']
module.exports = DES
inherits(DES, CipherBase)
function DES (opts) {
  CipherBase.call(this)
  var modeName = opts.mode.toLowerCase()
  var mode = modes[modeName]
  var type
  if (opts.decrypt) {
    type = 'decrypt'
  } else {
    type = 'encrypt'
  }
  var key = opts.key
  if (modeName === 'des-ede' || modeName === 'des-ede-cbc') {
    key = Buffer.concat([key, key.slice(0, 8)])
  }
  var iv = opts.iv
  this._des = mode.create({
    key: key,
    iv: iv,
    type: type
  })
}
DES.prototype._update = function (data) {
  return new Buffer(this._des.update(data))
}
DES.prototype._final = function () {
  return new Buffer(this._des.final())
}

/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(6).Buffer))

/***/ }),
/* 252 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


exports.readUInt32BE = function readUInt32BE(bytes, off) {
  var res =  (bytes[0 + off] << 24) |
             (bytes[1 + off] << 16) |
             (bytes[2 + off] << 8) |
             bytes[3 + off];
  return res >>> 0;
};

exports.writeUInt32BE = function writeUInt32BE(bytes, value, off) {
  bytes[0 + off] = value >>> 24;
  bytes[1 + off] = (value >>> 16) & 0xff;
  bytes[2 + off] = (value >>> 8) & 0xff;
  bytes[3 + off] = value & 0xff;
};

exports.ip = function ip(inL, inR, out, off) {
  var outL = 0;
  var outR = 0;

  for (var i = 6; i >= 0; i -= 2) {
    for (var j = 0; j <= 24; j += 8) {
      outL <<= 1;
      outL |= (inR >>> (j + i)) & 1;
    }
    for (var j = 0; j <= 24; j += 8) {
      outL <<= 1;
      outL |= (inL >>> (j + i)) & 1;
    }
  }

  for (var i = 6; i >= 0; i -= 2) {
    for (var j = 1; j <= 25; j += 8) {
      outR <<= 1;
      outR |= (inR >>> (j + i)) & 1;
    }
    for (var j = 1; j <= 25; j += 8) {
      outR <<= 1;
      outR |= (inL >>> (j + i)) & 1;
    }
  }

  out[off + 0] = outL >>> 0;
  out[off + 1] = outR >>> 0;
};

exports.rip = function rip(inL, inR, out, off) {
  var outL = 0;
  var outR = 0;

  for (var i = 0; i < 4; i++) {
    for (var j = 24; j >= 0; j -= 8) {
      outL <<= 1;
      outL |= (inR >>> (j + i)) & 1;
      outL <<= 1;
      outL |= (inL >>> (j + i)) & 1;
    }
  }
  for (var i = 4; i < 8; i++) {
    for (var j = 24; j >= 0; j -= 8) {
      outR <<= 1;
      outR |= (inR >>> (j + i)) & 1;
      outR <<= 1;
      outR |= (inL >>> (j + i)) & 1;
    }
  }

  out[off + 0] = outL >>> 0;
  out[off + 1] = outR >>> 0;
};

exports.pc1 = function pc1(inL, inR, out, off) {
  var outL = 0;
  var outR = 0;

  // 7, 15, 23, 31, 39, 47, 55, 63
  // 6, 14, 22, 30, 39, 47, 55, 63
  // 5, 13, 21, 29, 39, 47, 55, 63
  // 4, 12, 20, 28
  for (var i = 7; i >= 5; i--) {
    for (var j = 0; j <= 24; j += 8) {
      outL <<= 1;
      outL |= (inR >> (j + i)) & 1;
    }
    for (var j = 0; j <= 24; j += 8) {
      outL <<= 1;
      outL |= (inL >> (j + i)) & 1;
    }
  }
  for (var j = 0; j <= 24; j += 8) {
    outL <<= 1;
    outL |= (inR >> (j + i)) & 1;
  }

  // 1, 9, 17, 25, 33, 41, 49, 57
  // 2, 10, 18, 26, 34, 42, 50, 58
  // 3, 11, 19, 27, 35, 43, 51, 59
  // 36, 44, 52, 60
  for (var i = 1; i <= 3; i++) {
    for (var j = 0; j <= 24; j += 8) {
      outR <<= 1;
      outR |= (inR >> (j + i)) & 1;
    }
    for (var j = 0; j <= 24; j += 8) {
      outR <<= 1;
      outR |= (inL >> (j + i)) & 1;
    }
  }
  for (var j = 0; j <= 24; j += 8) {
    outR <<= 1;
    outR |= (inL >> (j + i)) & 1;
  }

  out[off + 0] = outL >>> 0;
  out[off + 1] = outR >>> 0;
};

exports.r28shl = function r28shl(num, shift) {
  return ((num << shift) & 0xfffffff) | (num >>> (28 - shift));
};

var pc2table = [
  // inL => outL
  14, 11, 17, 4, 27, 23, 25, 0,
  13, 22, 7, 18, 5, 9, 16, 24,
  2, 20, 12, 21, 1, 8, 15, 26,

  // inR => outR
  15, 4, 25, 19, 9, 1, 26, 16,
  5, 11, 23, 8, 12, 7, 17, 0,
  22, 3, 10, 14, 6, 20, 27, 24
];

exports.pc2 = function pc2(inL, inR, out, off) {
  var outL = 0;
  var outR = 0;

  var len = pc2table.length >>> 1;
  for (var i = 0; i < len; i++) {
    outL <<= 1;
    outL |= (inL >>> pc2table[i]) & 0x1;
  }
  for (var i = len; i < pc2table.length; i++) {
    outR <<= 1;
    outR |= (inR >>> pc2table[i]) & 0x1;
  }

  out[off + 0] = outL >>> 0;
  out[off + 1] = outR >>> 0;
};

exports.expand = function expand(r, out, off) {
  var outL = 0;
  var outR = 0;

  outL = ((r & 1) << 5) | (r >>> 27);
  for (var i = 23; i >= 15; i -= 4) {
    outL <<= 6;
    outL |= (r >>> i) & 0x3f;
  }
  for (var i = 11; i >= 3; i -= 4) {
    outR |= (r >>> i) & 0x3f;
    outR <<= 6;
  }
  outR |= ((r & 0x1f) << 1) | (r >>> 31);

  out[off + 0] = outL >>> 0;
  out[off + 1] = outR >>> 0;
};

var sTable = [
  14, 0, 4, 15, 13, 7, 1, 4, 2, 14, 15, 2, 11, 13, 8, 1,
  3, 10, 10, 6, 6, 12, 12, 11, 5, 9, 9, 5, 0, 3, 7, 8,
  4, 15, 1, 12, 14, 8, 8, 2, 13, 4, 6, 9, 2, 1, 11, 7,
  15, 5, 12, 11, 9, 3, 7, 14, 3, 10, 10, 0, 5, 6, 0, 13,

  15, 3, 1, 13, 8, 4, 14, 7, 6, 15, 11, 2, 3, 8, 4, 14,
  9, 12, 7, 0, 2, 1, 13, 10, 12, 6, 0, 9, 5, 11, 10, 5,
  0, 13, 14, 8, 7, 10, 11, 1, 10, 3, 4, 15, 13, 4, 1, 2,
  5, 11, 8, 6, 12, 7, 6, 12, 9, 0, 3, 5, 2, 14, 15, 9,

  10, 13, 0, 7, 9, 0, 14, 9, 6, 3, 3, 4, 15, 6, 5, 10,
  1, 2, 13, 8, 12, 5, 7, 14, 11, 12, 4, 11, 2, 15, 8, 1,
  13, 1, 6, 10, 4, 13, 9, 0, 8, 6, 15, 9, 3, 8, 0, 7,
  11, 4, 1, 15, 2, 14, 12, 3, 5, 11, 10, 5, 14, 2, 7, 12,

  7, 13, 13, 8, 14, 11, 3, 5, 0, 6, 6, 15, 9, 0, 10, 3,
  1, 4, 2, 7, 8, 2, 5, 12, 11, 1, 12, 10, 4, 14, 15, 9,
  10, 3, 6, 15, 9, 0, 0, 6, 12, 10, 11, 1, 7, 13, 13, 8,
  15, 9, 1, 4, 3, 5, 14, 11, 5, 12, 2, 7, 8, 2, 4, 14,

  2, 14, 12, 11, 4, 2, 1, 12, 7, 4, 10, 7, 11, 13, 6, 1,
  8, 5, 5, 0, 3, 15, 15, 10, 13, 3, 0, 9, 14, 8, 9, 6,
  4, 11, 2, 8, 1, 12, 11, 7, 10, 1, 13, 14, 7, 2, 8, 13,
  15, 6, 9, 15, 12, 0, 5, 9, 6, 10, 3, 4, 0, 5, 14, 3,

  12, 10, 1, 15, 10, 4, 15, 2, 9, 7, 2, 12, 6, 9, 8, 5,
  0, 6, 13, 1, 3, 13, 4, 14, 14, 0, 7, 11, 5, 3, 11, 8,
  9, 4, 14, 3, 15, 2, 5, 12, 2, 9, 8, 5, 12, 15, 3, 10,
  7, 11, 0, 14, 4, 1, 10, 7, 1, 6, 13, 0, 11, 8, 6, 13,

  4, 13, 11, 0, 2, 11, 14, 7, 15, 4, 0, 9, 8, 1, 13, 10,
  3, 14, 12, 3, 9, 5, 7, 12, 5, 2, 10, 15, 6, 8, 1, 6,
  1, 6, 4, 11, 11, 13, 13, 8, 12, 1, 3, 4, 7, 10, 14, 7,
  10, 9, 15, 5, 6, 0, 8, 15, 0, 14, 5, 2, 9, 3, 2, 12,

  13, 1, 2, 15, 8, 13, 4, 8, 6, 10, 15, 3, 11, 7, 1, 4,
  10, 12, 9, 5, 3, 6, 14, 11, 5, 0, 0, 14, 12, 9, 7, 2,
  7, 2, 11, 1, 4, 14, 1, 7, 9, 4, 12, 10, 14, 8, 2, 13,
  0, 15, 6, 12, 10, 9, 13, 0, 15, 3, 3, 5, 5, 6, 8, 11
];

exports.substitute = function substitute(inL, inR) {
  var out = 0;
  for (var i = 0; i < 4; i++) {
    var b = (inL >>> (18 - i * 6)) & 0x3f;
    var sb = sTable[i * 0x40 + b];

    out <<= 4;
    out |= sb;
  }
  for (var i = 0; i < 4; i++) {
    var b = (inR >>> (18 - i * 6)) & 0x3f;
    var sb = sTable[4 * 0x40 + i * 0x40 + b];

    out <<= 4;
    out |= sb;
  }
  return out >>> 0;
};

var permuteTable = [
  16, 25, 12, 11, 3, 20, 4, 15, 31, 17, 9, 6, 27, 14, 1, 22,
  30, 24, 8, 18, 0, 5, 29, 23, 13, 19, 2, 26, 10, 21, 28, 7
];

exports.permute = function permute(num) {
  var out = 0;
  for (var i = 0; i < permuteTable.length; i++) {
    out <<= 1;
    out |= (num >>> permuteTable[i]) & 0x1;
  }
  return out >>> 0;
};

exports.padSplit = function padSplit(num, size, group) {
  var str = num.toString(2);
  while (str.length < size)
    str = '0' + str;

  var out = [];
  for (var i = 0; i < size; i += group)
    out.push(str.slice(i, i + group));
  return out.join(' ');
};


/***/ }),
/* 253 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var assert = __webpack_require__(22);

function Cipher(options) {
  this.options = options;

  this.type = this.options.type;
  this.blockSize = 8;
  this._init();

  this.buffer = new Array(this.blockSize);
  this.bufferOff = 0;
}
module.exports = Cipher;

Cipher.prototype._init = function _init() {
  // Might be overrided
};

Cipher.prototype.update = function update(data) {
  if (data.length === 0)
    return [];

  if (this.type === 'decrypt')
    return this._updateDecrypt(data);
  else
    return this._updateEncrypt(data);
};

Cipher.prototype._buffer = function _buffer(data, off) {
  // Append data to buffer
  var min = Math.min(this.buffer.length - this.bufferOff, data.length - off);
  for (var i = 0; i < min; i++)
    this.buffer[this.bufferOff + i] = data[off + i];
  this.bufferOff += min;

  // Shift next
  return min;
};

Cipher.prototype._flushBuffer = function _flushBuffer(out, off) {
  this._update(this.buffer, 0, out, off);
  this.bufferOff = 0;
  return this.blockSize;
};

Cipher.prototype._updateEncrypt = function _updateEncrypt(data) {
  var inputOff = 0;
  var outputOff = 0;

  var count = ((this.bufferOff + data.length) / this.blockSize) | 0;
  var out = new Array(count * this.blockSize);

  if (this.bufferOff !== 0) {
    inputOff += this._buffer(data, inputOff);

    if (this.bufferOff === this.buffer.length)
      outputOff += this._flushBuffer(out, outputOff);
  }

  // Write blocks
  var max = data.length - ((data.length - inputOff) % this.blockSize);
  for (; inputOff < max; inputOff += this.blockSize) {
    this._update(data, inputOff, out, outputOff);
    outputOff += this.blockSize;
  }

  // Queue rest
  for (; inputOff < data.length; inputOff++, this.bufferOff++)
    this.buffer[this.bufferOff] = data[inputOff];

  return out;
};

Cipher.prototype._updateDecrypt = function _updateDecrypt(data) {
  var inputOff = 0;
  var outputOff = 0;

  var count = Math.ceil((this.bufferOff + data.length) / this.blockSize) - 1;
  var out = new Array(count * this.blockSize);

  // TODO(indutny): optimize it, this is far from optimal
  for (; count > 0; count--) {
    inputOff += this._buffer(data, inputOff);
    outputOff += this._flushBuffer(out, outputOff);
  }

  // Buffer rest of the input
  inputOff += this._buffer(data, inputOff);

  return out;
};

Cipher.prototype.final = function final(buffer) {
  var first;
  if (buffer)
    first = this.update(buffer);

  var last;
  if (this.type === 'encrypt')
    last = this._finalEncrypt();
  else
    last = this._finalDecrypt();

  if (first)
    return first.concat(last);
  else
    return last;
};

Cipher.prototype._pad = function _pad(buffer, off) {
  if (off === 0)
    return false;

  while (off < buffer.length)
    buffer[off++] = 0;

  return true;
};

Cipher.prototype._finalEncrypt = function _finalEncrypt() {
  if (!this._pad(this.buffer, this.bufferOff))
    return [];

  var out = new Array(this.blockSize);
  this._update(this.buffer, 0, out, 0);
  return out;
};

Cipher.prototype._unpad = function _unpad(buffer) {
  return buffer;
};

Cipher.prototype._finalDecrypt = function _finalDecrypt() {
  assert.equal(this.bufferOff, this.blockSize, 'Not enough data to decrypt');
  var out = new Array(this.blockSize);
  this._flushBuffer(out, 0);

  return this._unpad(out);
};


/***/ }),
/* 254 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var assert = __webpack_require__(22);
var inherits = __webpack_require__(1);

var des = __webpack_require__(110);
var utils = des.utils;
var Cipher = des.Cipher;

function DESState() {
  this.tmp = new Array(2);
  this.keys = null;
}

function DES(options) {
  Cipher.call(this, options);

  var state = new DESState();
  this._desState = state;

  this.deriveKeys(state, options.key);
}
inherits(DES, Cipher);
module.exports = DES;

DES.create = function create(options) {
  return new DES(options);
};

var shiftTable = [
  1, 1, 2, 2, 2, 2, 2, 2,
  1, 2, 2, 2, 2, 2, 2, 1
];

DES.prototype.deriveKeys = function deriveKeys(state, key) {
  state.keys = new Array(16 * 2);

  assert.equal(key.length, this.blockSize, 'Invalid key length');

  var kL = utils.readUInt32BE(key, 0);
  var kR = utils.readUInt32BE(key, 4);

  utils.pc1(kL, kR, state.tmp, 0);
  kL = state.tmp[0];
  kR = state.tmp[1];
  for (var i = 0; i < state.keys.length; i += 2) {
    var shift = shiftTable[i >>> 1];
    kL = utils.r28shl(kL, shift);
    kR = utils.r28shl(kR, shift);
    utils.pc2(kL, kR, state.keys, i);
  }
};

DES.prototype._update = function _update(inp, inOff, out, outOff) {
  var state = this._desState;

  var l = utils.readUInt32BE(inp, inOff);
  var r = utils.readUInt32BE(inp, inOff + 4);

  // Initial Permutation
  utils.ip(l, r, state.tmp, 0);
  l = state.tmp[0];
  r = state.tmp[1];

  if (this.type === 'encrypt')
    this._encrypt(state, l, r, state.tmp, 0);
  else
    this._decrypt(state, l, r, state.tmp, 0);

  l = state.tmp[0];
  r = state.tmp[1];

  utils.writeUInt32BE(out, l, outOff);
  utils.writeUInt32BE(out, r, outOff + 4);
};

DES.prototype._pad = function _pad(buffer, off) {
  var value = buffer.length - off;
  for (var i = off; i < buffer.length; i++)
    buffer[i] = value;

  return true;
};

DES.prototype._unpad = function _unpad(buffer) {
  var pad = buffer[buffer.length - 1];
  for (var i = buffer.length - pad; i < buffer.length; i++)
    assert.equal(buffer[i], pad);

  return buffer.slice(0, buffer.length - pad);
};

DES.prototype._encrypt = function _encrypt(state, lStart, rStart, out, off) {
  var l = lStart;
  var r = rStart;

  // Apply f() x16 times
  for (var i = 0; i < state.keys.length; i += 2) {
    var keyL = state.keys[i];
    var keyR = state.keys[i + 1];

    // f(r, k)
    utils.expand(r, state.tmp, 0);

    keyL ^= state.tmp[0];
    keyR ^= state.tmp[1];
    var s = utils.substitute(keyL, keyR);
    var f = utils.permute(s);

    var t = r;
    r = (l ^ f) >>> 0;
    l = t;
  }

  // Reverse Initial Permutation
  utils.rip(r, l, out, off);
};

DES.prototype._decrypt = function _decrypt(state, lStart, rStart, out, off) {
  var l = rStart;
  var r = lStart;

  // Apply f() x16 times
  for (var i = state.keys.length - 2; i >= 0; i -= 2) {
    var keyL = state.keys[i];
    var keyR = state.keys[i + 1];

    // f(r, k)
    utils.expand(l, state.tmp, 0);

    keyL ^= state.tmp[0];
    keyR ^= state.tmp[1];
    var s = utils.substitute(keyL, keyR);
    var f = utils.permute(s);

    var t = l;
    l = (r ^ f) >>> 0;
    r = t;
  }

  // Reverse Initial Permutation
  utils.rip(l, r, out, off);
};


/***/ }),
/* 255 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var assert = __webpack_require__(22);
var inherits = __webpack_require__(1);

var proto = {};

function CBCState(iv) {
  assert.equal(iv.length, 8, 'Invalid IV length');

  this.iv = new Array(8);
  for (var i = 0; i < this.iv.length; i++)
    this.iv[i] = iv[i];
}

function instantiate(Base) {
  function CBC(options) {
    Base.call(this, options);
    this._cbcInit();
  }
  inherits(CBC, Base);

  var keys = Object.keys(proto);
  for (var i = 0; i < keys.length; i++) {
    var key = keys[i];
    CBC.prototype[key] = proto[key];
  }

  CBC.create = function create(options) {
    return new CBC(options);
  };

  return CBC;
}

exports.instantiate = instantiate;

proto._cbcInit = function _cbcInit() {
  var state = new CBCState(this.options.iv);
  this._cbcState = state;
};

proto._update = function _update(inp, inOff, out, outOff) {
  var state = this._cbcState;
  var superProto = this.constructor.super_.prototype;

  var iv = state.iv;
  if (this.type === 'encrypt') {
    for (var i = 0; i < this.blockSize; i++)
      iv[i] ^= inp[inOff + i];

    superProto._update.call(this, iv, 0, out, outOff);

    for (var i = 0; i < this.blockSize; i++)
      iv[i] = out[outOff + i];
  } else {
    superProto._update.call(this, inp, inOff, out, outOff);

    for (var i = 0; i < this.blockSize; i++)
      out[outOff + i] ^= iv[i];

    for (var i = 0; i < this.blockSize; i++)
      iv[i] = inp[inOff + i];
  }
};


/***/ }),
/* 256 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var assert = __webpack_require__(22);
var inherits = __webpack_require__(1);

var des = __webpack_require__(110);
var Cipher = des.Cipher;
var DES = des.DES;

function EDEState(type, key) {
  assert.equal(key.length, 24, 'Invalid key length');

  var k1 = key.slice(0, 8);
  var k2 = key.slice(8, 16);
  var k3 = key.slice(16, 24);

  if (type === 'encrypt') {
    this.ciphers = [
      DES.create({ type: 'encrypt', key: k1 }),
      DES.create({ type: 'decrypt', key: k2 }),
      DES.create({ type: 'encrypt', key: k3 })
    ];
  } else {
    this.ciphers = [
      DES.create({ type: 'decrypt', key: k3 }),
      DES.create({ type: 'encrypt', key: k2 }),
      DES.create({ type: 'decrypt', key: k1 })
    ];
  }
}

function EDE(options) {
  Cipher.call(this, options);

  var state = new EDEState(this.type, this.options.key);
  this._edeState = state;
}
inherits(EDE, Cipher);

module.exports = EDE;

EDE.create = function create(options) {
  return new EDE(options);
};

EDE.prototype._update = function _update(inp, inOff, out, outOff) {
  var state = this._edeState;

  state.ciphers[0]._update(inp, inOff, out, outOff);
  state.ciphers[1]._update(out, outOff, out, outOff);
  state.ciphers[2]._update(out, outOff, out, outOff);
};

EDE.prototype._pad = DES.prototype._pad;
EDE.prototype._unpad = DES.prototype._unpad;


/***/ }),
/* 257 */
/***/ (function(module, exports) {

exports['des-ecb'] = {
  key: 8,
  iv: 0
}
exports['des-cbc'] = exports.des = {
  key: 8,
  iv: 8
}
exports['des-ede3-cbc'] = exports.des3 = {
  key: 24,
  iv: 8
}
exports['des-ede3'] = {
  key: 24,
  iv: 0
}
exports['des-ede-cbc'] = {
  key: 16,
  iv: 8
}
exports['des-ede'] = {
  key: 16,
  iv: 0
}


/***/ }),
/* 258 */
/***/ (function(module, exports, __webpack_require__) {

/* WEBPACK VAR INJECTION */(function(Buffer) {var generatePrime = __webpack_require__(164)
var primes = __webpack_require__(262)

var DH = __webpack_require__(263)

function getDiffieHellman (mod) {
  var prime = new Buffer(primes[mod].prime, 'hex')
  var gen = new Buffer(primes[mod].gen, 'hex')

  return new DH(prime, gen)
}

var ENCODINGS = {
  'binary': true, 'hex': true, 'base64': true
}

function createDiffieHellman (prime, enc, generator, genc) {
  if (Buffer.isBuffer(enc) || ENCODINGS[enc] === undefined) {
    return createDiffieHellman(prime, 'binary', enc, generator)
  }

  enc = enc || 'binary'
  genc = genc || 'binary'
  generator = generator || new Buffer([2])

  if (!Buffer.isBuffer(generator)) {
    generator = new Buffer(generator, genc)
  }

  if (typeof prime === 'number') {
    return new DH(generatePrime(prime, generator), generator, true)
  }

  if (!Buffer.isBuffer(prime)) {
    prime = new Buffer(prime, enc)
  }

  return new DH(prime, generator, true)
}

exports.DiffieHellmanGroup = exports.createDiffieHellmanGroup = exports.getDiffieHellman = getDiffieHellman
exports.createDiffieHellman = exports.DiffieHellman = createDiffieHellman

/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(6).Buffer))

/***/ }),
/* 259 */
/***/ (function(module, exports) {

module.exports = function(module) {
	if(!module.webpackPolyfill) {
		module.deprecate = function() {};
		module.paths = [];
		// module.parent = undefined by default
		if(!module.children) module.children = [];
		Object.defineProperty(module, "loaded", {
			enumerable: true,
			get: function() {
				return module.l;
			}
		});
		Object.defineProperty(module, "id", {
			enumerable: true,
			get: function() {
				return module.i;
			}
		});
		module.webpackPolyfill = 1;
	}
	return module;
};


/***/ }),
/* 260 */
/***/ (function(module, exports) {

/* (ignored) */

/***/ }),
/* 261 */
/***/ (function(module, exports) {

/* (ignored) */

/***/ }),
/* 262 */
/***/ (function(module, exports) {

module.exports = {"modp1":{"gen":"02","prime":"ffffffffffffffffc90fdaa22168c234c4c6628b80dc1cd129024e088a67cc74020bbea63b139b22514a08798e3404ddef9519b3cd3a431b302b0a6df25f14374fe1356d6d51c245e485b576625e7ec6f44c42e9a63a3620ffffffffffffffff"},"modp2":{"gen":"02","prime":"ffffffffffffffffc90fdaa22168c234c4c6628b80dc1cd129024e088a67cc74020bbea63b139b22514a08798e3404ddef9519b3cd3a431b302b0a6df25f14374fe1356d6d51c245e485b576625e7ec6f44c42e9a637ed6b0bff5cb6f406b7edee386bfb5a899fa5ae9f24117c4b1fe649286651ece65381ffffffffffffffff"},"modp5":{"gen":"02","prime":"ffffffffffffffffc90fdaa22168c234c4c6628b80dc1cd129024e088a67cc74020bbea63b139b22514a08798e3404ddef9519b3cd3a431b302b0a6df25f14374fe1356d6d51c245e485b576625e7ec6f44c42e9a637ed6b0bff5cb6f406b7edee386bfb5a899fa5ae9f24117c4b1fe649286651ece45b3dc2007cb8a163bf0598da48361c55d39a69163fa8fd24cf5f83655d23dca3ad961c62f356208552bb9ed529077096966d670c354e4abc9804f1746c08ca237327ffffffffffffffff"},"modp14":{"gen":"02","prime":"ffffffffffffffffc90fdaa22168c234c4c6628b80dc1cd129024e088a67cc74020bbea63b139b22514a08798e3404ddef9519b3cd3a431b302b0a6df25f14374fe1356d6d51c245e485b576625e7ec6f44c42e9a637ed6b0bff5cb6f406b7edee386bfb5a899fa5ae9f24117c4b1fe649286651ece45b3dc2007cb8a163bf0598da48361c55d39a69163fa8fd24cf5f83655d23dca3ad961c62f356208552bb9ed529077096966d670c354e4abc9804f1746c08ca18217c32905e462e36ce3be39e772c180e86039b2783a2ec07a28fb5c55df06f4c52c9de2bcbf6955817183995497cea956ae515d2261898fa051015728e5a8aacaa68ffffffffffffffff"},"modp15":{"gen":"02","prime":"ffffffffffffffffc90fdaa22168c234c4c6628b80dc1cd129024e088a67cc74020bbea63b139b22514a08798e3404ddef9519b3cd3a431b302b0a6df25f14374fe1356d6d51c245e485b576625e7ec6f44c42e9a637ed6b0bff5cb6f406b7edee386bfb5a899fa5ae9f24117c4b1fe649286651ece45b3dc2007cb8a163bf0598da48361c55d39a69163fa8fd24cf5f83655d23dca3ad961c62f356208552bb9ed529077096966d670c354e4abc9804f1746c08ca18217c32905e462e36ce3be39e772c180e86039b2783a2ec07a28fb5c55df06f4c52c9de2bcbf6955817183995497cea956ae515d2261898fa051015728e5a8aaac42dad33170d04507a33a85521abdf1cba64ecfb850458dbef0a8aea71575d060c7db3970f85a6e1e4c7abf5ae8cdb0933d71e8c94e04a25619dcee3d2261ad2ee6bf12ffa06d98a0864d87602733ec86a64521f2b18177b200cbbe117577a615d6c770988c0bad946e208e24fa074e5ab3143db5bfce0fd108e4b82d120a93ad2caffffffffffffffff"},"modp16":{"gen":"02","prime":"ffffffffffffffffc90fdaa22168c234c4c6628b80dc1cd129024e088a67cc74020bbea63b139b22514a08798e3404ddef9519b3cd3a431b302b0a6df25f14374fe1356d6d51c245e485b576625e7ec6f44c42e9a637ed6b0bff5cb6f406b7edee386bfb5a899fa5ae9f24117c4b1fe649286651ece45b3dc2007cb8a163bf0598da48361c55d39a69163fa8fd24cf5f83655d23dca3ad961c62f356208552bb9ed529077096966d670c354e4abc9804f1746c08ca18217c32905e462e36ce3be39e772c180e86039b2783a2ec07a28fb5c55df06f4c52c9de2bcbf6955817183995497cea956ae515d2261898fa051015728e5a8aaac42dad33170d04507a33a85521abdf1cba64ecfb850458dbef0a8aea71575d060c7db3970f85a6e1e4c7abf5ae8cdb0933d71e8c94e04a25619dcee3d2261ad2ee6bf12ffa06d98a0864d87602733ec86a64521f2b18177b200cbbe117577a615d6c770988c0bad946e208e24fa074e5ab3143db5bfce0fd108e4b82d120a92108011a723c12a787e6d788719a10bdba5b2699c327186af4e23c1a946834b6150bda2583e9ca2ad44ce8dbbbc2db04de8ef92e8efc141fbecaa6287c59474e6bc05d99b2964fa090c3a2233ba186515be7ed1f612970cee2d7afb81bdd762170481cd0069127d5b05aa993b4ea988d8fddc186ffb7dc90a6c08f4df435c934063199ffffffffffffffff"},"modp17":{"gen":"02","prime":"ffffffffffffffffc90fdaa22168c234c4c6628b80dc1cd129024e088a67cc74020bbea63b139b22514a08798e3404ddef9519b3cd3a431b302b0a6df25f14374fe1356d6d51c245e485b576625e7ec6f44c42e9a637ed6b0bff5cb6f406b7edee386bfb5a899fa5ae9f24117c4b1fe649286651ece45b3dc2007cb8a163bf0598da48361c55d39a69163fa8fd24cf5f83655d23dca3ad961c62f356208552bb9ed529077096966d670c354e4abc9804f1746c08ca18217c32905e462e36ce3be39e772c180e86039b2783a2ec07a28fb5c55df06f4c52c9de2bcbf6955817183995497cea956ae515d2261898fa051015728e5a8aaac42dad33170d04507a33a85521abdf1cba64ecfb850458dbef0a8aea71575d060c7db3970f85a6e1e4c7abf5ae8cdb0933d71e8c94e04a25619dcee3d2261ad2ee6bf12ffa06d98a0864d87602733ec86a64521f2b18177b200cbbe117577a615d6c770988c0bad946e208e24fa074e5ab3143db5bfce0fd108e4b82d120a92108011a723c12a787e6d788719a10bdba5b2699c327186af4e23c1a946834b6150bda2583e9ca2ad44ce8dbbbc2db04de8ef92e8efc141fbecaa6287c59474e6bc05d99b2964fa090c3a2233ba186515be7ed1f612970cee2d7afb81bdd762170481cd0069127d5b05aa993b4ea988d8fddc186ffb7dc90a6c08f4df435c93402849236c3fab4d27c7026c1d4dcb2602646dec9751e763dba37bdf8ff9406ad9e530ee5db382f413001aeb06a53ed9027d831179727b0865a8918da3edbebcf9b14ed44ce6cbaced4bb1bdb7f1447e6cc254b332051512bd7af426fb8f401378cd2bf5983ca01c64b92ecf032ea15d1721d03f482d7ce6e74fef6d55e702f46980c82b5a84031900b1c9e59e7c97fbec7e8f323a97a7e36cc88be0f1d45b7ff585ac54bd407b22b4154aacc8f6d7ebf48e1d814cc5ed20f8037e0a79715eef29be32806a1d58bb7c5da76f550aa3d8a1fbff0eb19ccb1a313d55cda56c9ec2ef29632387fe8d76e3c0468043e8f663f4860ee12bf2d5b0b7474d6e694f91e6dcc4024ffffffffffffffff"},"modp18":{"gen":"02","prime":"ffffffffffffffffc90fdaa22168c234c4c6628b80dc1cd129024e088a67cc74020bbea63b139b22514a08798e3404ddef9519b3cd3a431b302b0a6df25f14374fe1356d6d51c245e485b576625e7ec6f44c42e9a637ed6b0bff5cb6f406b7edee386bfb5a899fa5ae9f24117c4b1fe649286651ece45b3dc2007cb8a163bf0598da48361c55d39a69163fa8fd24cf5f83655d23dca3ad961c62f356208552bb9ed529077096966d670c354e4abc9804f1746c08ca18217c32905e462e36ce3be39e772c180e86039b2783a2ec07a28fb5c55df06f4c52c9de2bcbf6955817183995497cea956ae515d2261898fa051015728e5a8aaac42dad33170d04507a33a85521abdf1cba64ecfb850458dbef0a8aea71575d060c7db3970f85a6e1e4c7abf5ae8cdb0933d71e8c94e04a25619dcee3d2261ad2ee6bf12ffa06d98a0864d87602733ec86a64521f2b18177b200cbbe117577a615d6c770988c0bad946e208e24fa074e5ab3143db5bfce0fd108e4b82d120a92108011a723c12a787e6d788719a10bdba5b2699c327186af4e23c1a946834b6150bda2583e9ca2ad44ce8dbbbc2db04de8ef92e8efc141fbecaa6287c59474e6bc05d99b2964fa090c3a2233ba186515be7ed1f612970cee2d7afb81bdd762170481cd0069127d5b05aa993b4ea988d8fddc186ffb7dc90a6c08f4df435c93402849236c3fab4d27c7026c1d4dcb2602646dec9751e763dba37bdf8ff9406ad9e530ee5db382f413001aeb06a53ed9027d831179727b0865a8918da3edbebcf9b14ed44ce6cbaced4bb1bdb7f1447e6cc254b332051512bd7af426fb8f401378cd2bf5983ca01c64b92ecf032ea15d1721d03f482d7ce6e74fef6d55e702f46980c82b5a84031900b1c9e59e7c97fbec7e8f323a97a7e36cc88be0f1d45b7ff585ac54bd407b22b4154aacc8f6d7ebf48e1d814cc5ed20f8037e0a79715eef29be32806a1d58bb7c5da76f550aa3d8a1fbff0eb19ccb1a313d55cda56c9ec2ef29632387fe8d76e3c0468043e8f663f4860ee12bf2d5b0b7474d6e694f91e6dbe115974a3926f12fee5e438777cb6a932df8cd8bec4d073b931ba3bc832b68d9dd300741fa7bf8afc47ed2576f6936ba424663aab639c5ae4f5683423b4742bf1c978238f16cbe39d652de3fdb8befc848ad922222e04a4037c0713eb57a81a23f0c73473fc646cea306b4bcbc8862f8385ddfa9d4b7fa2c087e879683303ed5bdd3a062b3cf5b3a278a66d2a13f83f44f82ddf310ee074ab6a364597e899a0255dc164f31cc50846851df9ab48195ded7ea1b1d510bd7ee74d73faf36bc31ecfa268359046f4eb879f924009438b481c6cd7889a002ed5ee382bc9190da6fc026e479558e4475677e9aa9e3050e2765694dfc81f56e880b96e7160c980dd98edd3dfffffffffffffffff"}}

/***/ }),
/* 263 */
/***/ (function(module, exports, __webpack_require__) {

/* WEBPACK VAR INJECTION */(function(Buffer) {var BN = __webpack_require__(13);
var MillerRabin = __webpack_require__(165);
var millerRabin = new MillerRabin();
var TWENTYFOUR = new BN(24);
var ELEVEN = new BN(11);
var TEN = new BN(10);
var THREE = new BN(3);
var SEVEN = new BN(7);
var primes = __webpack_require__(164);
var randomBytes = __webpack_require__(66);
module.exports = DH;

function setPublicKey(pub, enc) {
  enc = enc || 'utf8';
  if (!Buffer.isBuffer(pub)) {
    pub = new Buffer(pub, enc);
  }
  this._pub = new BN(pub);
  return this;
}

function setPrivateKey(priv, enc) {
  enc = enc || 'utf8';
  if (!Buffer.isBuffer(priv)) {
    priv = new Buffer(priv, enc);
  }
  this._priv = new BN(priv);
  return this;
}

var primeCache = {};
function checkPrime(prime, generator) {
  var gen = generator.toString('hex');
  var hex = [gen, prime.toString(16)].join('_');
  if (hex in primeCache) {
    return primeCache[hex];
  }
  var error = 0;

  if (prime.isEven() ||
    !primes.simpleSieve ||
    !primes.fermatTest(prime) ||
    !millerRabin.test(prime)) {
    //not a prime so +1
    error += 1;

    if (gen === '02' || gen === '05') {
      // we'd be able to check the generator
      // it would fail so +8
      error += 8;
    } else {
      //we wouldn't be able to test the generator
      // so +4
      error += 4;
    }
    primeCache[hex] = error;
    return error;
  }
  if (!millerRabin.test(prime.shrn(1))) {
    //not a safe prime
    error += 2;
  }
  var rem;
  switch (gen) {
    case '02':
      if (prime.mod(TWENTYFOUR).cmp(ELEVEN)) {
        // unsuidable generator
        error += 8;
      }
      break;
    case '05':
      rem = prime.mod(TEN);
      if (rem.cmp(THREE) && rem.cmp(SEVEN)) {
        // prime mod 10 needs to equal 3 or 7
        error += 8;
      }
      break;
    default:
      error += 4;
  }
  primeCache[hex] = error;
  return error;
}

function DH(prime, generator, malleable) {
  this.setGenerator(generator);
  this.__prime = new BN(prime);
  this._prime = BN.mont(this.__prime);
  this._primeLen = prime.length;
  this._pub = undefined;
  this._priv = undefined;
  this._primeCode = undefined;
  if (malleable) {
    this.setPublicKey = setPublicKey;
    this.setPrivateKey = setPrivateKey;
  } else {
    this._primeCode = 8;
  }
}
Object.defineProperty(DH.prototype, 'verifyError', {
  enumerable: true,
  get: function () {
    if (typeof this._primeCode !== 'number') {
      this._primeCode = checkPrime(this.__prime, this.__gen);
    }
    return this._primeCode;
  }
});
DH.prototype.generateKeys = function () {
  if (!this._priv) {
    this._priv = new BN(randomBytes(this._primeLen));
  }
  this._pub = this._gen.toRed(this._prime).redPow(this._priv).fromRed();
  return this.getPublicKey();
};

DH.prototype.computeSecret = function (other) {
  other = new BN(other);
  other = other.toRed(this._prime);
  var secret = other.redPow(this._priv).fromRed();
  var out = new Buffer(secret.toArray());
  var prime = this.getPrime();
  if (out.length < prime.length) {
    var front = new Buffer(prime.length - out.length);
    front.fill(0);
    out = Buffer.concat([front, out]);
  }
  return out;
};

DH.prototype.getPublicKey = function getPublicKey(enc) {
  return formatReturnValue(this._pub, enc);
};

DH.prototype.getPrivateKey = function getPrivateKey(enc) {
  return formatReturnValue(this._priv, enc);
};

DH.prototype.getPrime = function (enc) {
  return formatReturnValue(this.__prime, enc);
};

DH.prototype.getGenerator = function (enc) {
  return formatReturnValue(this._gen, enc);
};

DH.prototype.setGenerator = function (gen, enc) {
  enc = enc || 'utf8';
  if (!Buffer.isBuffer(gen)) {
    gen = new Buffer(gen, enc);
  }
  this.__gen = gen;
  this._gen = new BN(gen);
  return this;
};

function formatReturnValue(bn, enc) {
  var buf = new Buffer(bn.toArray());
  if (!enc) {
    return buf;
  } else {
    return buf.toString(enc);
  }
}

/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(6).Buffer))

/***/ }),
/* 264 */
/***/ (function(module, exports, __webpack_require__) {

/* WEBPACK VAR INJECTION */(function(Buffer) {var createHash = __webpack_require__(67)
var stream = __webpack_require__(102)
var inherits = __webpack_require__(1)
var sign = __webpack_require__(265)
var verify = __webpack_require__(301)

var algorithms = __webpack_require__(154)
Object.keys(algorithms).forEach(function (key) {
  algorithms[key].id = new Buffer(algorithms[key].id, 'hex')
  algorithms[key.toLowerCase()] = algorithms[key]
})

function Sign (algorithm) {
  stream.Writable.call(this)

  var data = algorithms[algorithm]
  if (!data) throw new Error('Unknown message digest')

  this._hashType = data.hash
  this._hash = createHash(data.hash)
  this._tag = data.id
  this._signType = data.sign
}
inherits(Sign, stream.Writable)

Sign.prototype._write = function _write (data, _, done) {
  this._hash.update(data)
  done()
}

Sign.prototype.update = function update (data, enc) {
  if (typeof data === 'string') data = new Buffer(data, enc)

  this._hash.update(data)
  return this
}

Sign.prototype.sign = function signMethod (key, enc) {
  this.end()
  var hash = this._hash.digest()
  var sig = sign(hash, key, this._hashType, this._signType, this._tag)

  return enc ? sig.toString(enc) : sig
}

function Verify (algorithm) {
  stream.Writable.call(this)

  var data = algorithms[algorithm]
  if (!data) throw new Error('Unknown message digest')

  this._hash = createHash(data.hash)
  this._tag = data.id
  this._signType = data.sign
}
inherits(Verify, stream.Writable)

Verify.prototype._write = function _write (data, _, done) {
  this._hash.update(data)
  done()
}

Verify.prototype.update = function update (data, enc) {
  if (typeof data === 'string') data = new Buffer(data, enc)

  this._hash.update(data)
  return this
}

Verify.prototype.verify = function verifyMethod (key, sig, enc) {
  if (typeof sig === 'string') sig = new Buffer(sig, enc)

  this.end()
  var hash = this._hash.digest()
  return verify(sig, hash, key, this._signType, this._tag)
}

function createSign (algorithm) {
  return new Sign(algorithm)
}

function createVerify (algorithm) {
  return new Verify(algorithm)
}

module.exports = {
  Sign: createSign,
  Verify: createVerify,
  createSign: createSign,
  createVerify: createVerify
}

/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(6).Buffer))

/***/ }),
/* 265 */
/***/ (function(module, exports, __webpack_require__) {

/* WEBPACK VAR INJECTION */(function(Buffer) {// much of this based on https://github.com/indutny/self-signed/blob/gh-pages/lib/rsa.js
var createHmac = __webpack_require__(153)
var crt = __webpack_require__(111)
var EC = __webpack_require__(17).ec
var BN = __webpack_require__(13)
var parseKeys = __webpack_require__(81)
var curves = __webpack_require__(175)

function sign (hash, key, hashType, signType, tag) {
  var priv = parseKeys(key)
  if (priv.curve) {
    // rsa keys can be interpreted as ecdsa ones in openssl
    if (signType !== 'ecdsa' && signType !== 'ecdsa/rsa') throw new Error('wrong private key type')
    return ecSign(hash, priv)
  } else if (priv.type === 'dsa') {
    if (signType !== 'dsa') throw new Error('wrong private key type')
    return dsaSign(hash, priv, hashType)
  } else {
    if (signType !== 'rsa' && signType !== 'ecdsa/rsa') throw new Error('wrong private key type')
  }
  hash = Buffer.concat([tag, hash])
  var len = priv.modulus.byteLength()
  var pad = [ 0, 1 ]
  while (hash.length + pad.length + 1 < len) pad.push(0xff)
  pad.push(0x00)
  var i = -1
  while (++i < hash.length) pad.push(hash[i])

  var out = crt(pad, priv)
  return out
}

function ecSign (hash, priv) {
  var curveId = curves[priv.curve.join('.')]
  if (!curveId) throw new Error('unknown curve ' + priv.curve.join('.'))

  var curve = new EC(curveId)
  var key = curve.keyFromPrivate(priv.privateKey)
  var out = key.sign(hash)

  return new Buffer(out.toDER())
}

function dsaSign (hash, priv, algo) {
  var x = priv.params.priv_key
  var p = priv.params.p
  var q = priv.params.q
  var g = priv.params.g
  var r = new BN(0)
  var k
  var H = bits2int(hash, q).mod(q)
  var s = false
  var kv = getKey(x, q, hash, algo)
  while (s === false) {
    k = makeKey(q, kv, algo)
    r = makeR(g, k, p, q)
    s = k.invm(q).imul(H.add(x.mul(r))).mod(q)
    if (s.cmpn(0) === 0) {
      s = false
      r = new BN(0)
    }
  }
  return toDER(r, s)
}

function toDER (r, s) {
  r = r.toArray()
  s = s.toArray()

  // Pad values
  if (r[0] & 0x80) r = [ 0 ].concat(r)
  if (s[0] & 0x80) s = [ 0 ].concat(s)

  var total = r.length + s.length + 4
  var res = [ 0x30, total, 0x02, r.length ]
  res = res.concat(r, [ 0x02, s.length ], s)
  return new Buffer(res)
}

function getKey (x, q, hash, algo) {
  x = new Buffer(x.toArray())
  if (x.length < q.byteLength()) {
    var zeros = new Buffer(q.byteLength() - x.length)
    zeros.fill(0)
    x = Buffer.concat([ zeros, x ])
  }
  var hlen = hash.length
  var hbits = bits2octets(hash, q)
  var v = new Buffer(hlen)
  v.fill(1)
  var k = new Buffer(hlen)
  k.fill(0)
  k = createHmac(algo, k).update(v).update(new Buffer([ 0 ])).update(x).update(hbits).digest()
  v = createHmac(algo, k).update(v).digest()
  k = createHmac(algo, k).update(v).update(new Buffer([ 1 ])).update(x).update(hbits).digest()
  v = createHmac(algo, k).update(v).digest()
  return { k: k, v: v }
}

function bits2int (obits, q) {
  var bits = new BN(obits)
  var shift = (obits.length << 3) - q.bitLength()
  if (shift > 0) bits.ishrn(shift)
  return bits
}

function bits2octets (bits, q) {
  bits = bits2int(bits, q)
  bits = bits.mod(q)
  var out = new Buffer(bits.toArray())
  if (out.length < q.byteLength()) {
    var zeros = new Buffer(q.byteLength() - out.length)
    zeros.fill(0)
    out = Buffer.concat([ zeros, out ])
  }
  return out
}

function makeKey (q, kv, algo) {
  var t
  var k

  do {
    t = new Buffer(0)

    while (t.length * 8 < q.bitLength()) {
      kv.v = createHmac(algo, kv.k).update(kv.v).digest()
      t = Buffer.concat([ t, kv.v ])
    }

    k = bits2int(t, q)
    kv.k = createHmac(algo, kv.k).update(kv.v).update(new Buffer([ 0 ])).digest()
    kv.v = createHmac(algo, kv.k).update(kv.v).digest()
  } while (k.cmp(q) !== -1)

  return k
}

function makeR (g, k, p, q) {
  return g.toRed(BN.mont(p)).redPow(k).fromRed().mod(q)
}

module.exports = sign
module.exports.getKey = getKey
module.exports.makeKey = makeKey

/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(6).Buffer))

/***/ }),
/* 266 */
/***/ (function(module, exports) {

module.exports = {"name":"elliptic","version":"6.4.0","description":"EC cryptography","main":"lib/elliptic.js","files":["lib"],"scripts":{"jscs":"jscs benchmarks/*.js lib/*.js lib/**/*.js lib/**/**/*.js test/index.js","jshint":"jscs benchmarks/*.js lib/*.js lib/**/*.js lib/**/**/*.js test/index.js","lint":"npm run jscs && npm run jshint","unit":"istanbul test _mocha --reporter=spec test/index.js","test":"npm run lint && npm run unit","version":"grunt dist && git add dist/"},"repository":{"type":"git","url":"git@github.com:indutny/elliptic"},"keywords":["EC","Elliptic","curve","Cryptography"],"author":"Fedor Indutny <fedor@indutny.com>","license":"MIT","bugs":{"url":"https://github.com/indutny/elliptic/issues"},"homepage":"https://github.com/indutny/elliptic","devDependencies":{"brfs":"^1.4.3","coveralls":"^2.11.3","grunt":"^0.4.5","grunt-browserify":"^5.0.0","grunt-cli":"^1.2.0","grunt-contrib-connect":"^1.0.0","grunt-contrib-copy":"^1.0.0","grunt-contrib-uglify":"^1.0.1","grunt-mocha-istanbul":"^3.0.1","grunt-saucelabs":"^8.6.2","istanbul":"^0.4.2","jscs":"^2.9.0","jshint":"^2.6.0","mocha":"^2.1.0"},"dependencies":{"bn.js":"^4.4.0","brorand":"^1.0.1","hash.js":"^1.0.0","hmac-drbg":"^1.0.0","inherits":"^2.0.1","minimalistic-assert":"^1.0.0","minimalistic-crypto-utils":"^1.0.0"}}

/***/ }),
/* 267 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var utils = exports;
var BN = __webpack_require__(13);
var minAssert = __webpack_require__(22);
var minUtils = __webpack_require__(167);

utils.assert = minAssert;
utils.toArray = minUtils.toArray;
utils.zero2 = minUtils.zero2;
utils.toHex = minUtils.toHex;
utils.encode = minUtils.encode;

// Represent num in a w-NAF form
function getNAF(num, w) {
  var naf = [];
  var ws = 1 << (w + 1);
  var k = num.clone();
  while (k.cmpn(1) >= 0) {
    var z;
    if (k.isOdd()) {
      var mod = k.andln(ws - 1);
      if (mod > (ws >> 1) - 1)
        z = (ws >> 1) - mod;
      else
        z = mod;
      k.isubn(z);
    } else {
      z = 0;
    }
    naf.push(z);

    // Optimization, shift by word if possible
    var shift = (k.cmpn(0) !== 0 && k.andln(ws - 1) === 0) ? (w + 1) : 1;
    for (var i = 1; i < shift; i++)
      naf.push(0);
    k.iushrn(shift);
  }

  return naf;
}
utils.getNAF = getNAF;

// Represent k1, k2 in a Joint Sparse Form
function getJSF(k1, k2) {
  var jsf = [
    [],
    []
  ];

  k1 = k1.clone();
  k2 = k2.clone();
  var d1 = 0;
  var d2 = 0;
  while (k1.cmpn(-d1) > 0 || k2.cmpn(-d2) > 0) {

    // First phase
    var m14 = (k1.andln(3) + d1) & 3;
    var m24 = (k2.andln(3) + d2) & 3;
    if (m14 === 3)
      m14 = -1;
    if (m24 === 3)
      m24 = -1;
    var u1;
    if ((m14 & 1) === 0) {
      u1 = 0;
    } else {
      var m8 = (k1.andln(7) + d1) & 7;
      if ((m8 === 3 || m8 === 5) && m24 === 2)
        u1 = -m14;
      else
        u1 = m14;
    }
    jsf[0].push(u1);

    var u2;
    if ((m24 & 1) === 0) {
      u2 = 0;
    } else {
      var m8 = (k2.andln(7) + d2) & 7;
      if ((m8 === 3 || m8 === 5) && m14 === 2)
        u2 = -m24;
      else
        u2 = m24;
    }
    jsf[1].push(u2);

    // Second phase
    if (2 * d1 === u1 + 1)
      d1 = 1 - d1;
    if (2 * d2 === u2 + 1)
      d2 = 1 - d2;
    k1.iushrn(1);
    k2.iushrn(1);
  }

  return jsf;
}
utils.getJSF = getJSF;

function cachedProperty(obj, name, computer) {
  var key = '_' + name;
  obj.prototype[name] = function cachedProperty() {
    return this[key] !== undefined ? this[key] :
           this[key] = computer.call(this);
  };
}
utils.cachedProperty = cachedProperty;

function parseBytes(bytes) {
  return typeof bytes === 'string' ? utils.toArray(bytes, 'hex') :
                                     bytes;
}
utils.parseBytes = parseBytes;

function intFromLE(bytes) {
  return new BN(bytes, 'hex', 'le');
}
utils.intFromLE = intFromLE;



/***/ }),
/* 268 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var BN = __webpack_require__(13);
var elliptic = __webpack_require__(17);
var utils = elliptic.utils;
var getNAF = utils.getNAF;
var getJSF = utils.getJSF;
var assert = utils.assert;

function BaseCurve(type, conf) {
  this.type = type;
  this.p = new BN(conf.p, 16);

  // Use Montgomery, when there is no fast reduction for the prime
  this.red = conf.prime ? BN.red(conf.prime) : BN.mont(this.p);

  // Useful for many curves
  this.zero = new BN(0).toRed(this.red);
  this.one = new BN(1).toRed(this.red);
  this.two = new BN(2).toRed(this.red);

  // Curve configuration, optional
  this.n = conf.n && new BN(conf.n, 16);
  this.g = conf.g && this.pointFromJSON(conf.g, conf.gRed);

  // Temporary arrays
  this._wnafT1 = new Array(4);
  this._wnafT2 = new Array(4);
  this._wnafT3 = new Array(4);
  this._wnafT4 = new Array(4);

  // Generalized Greg Maxwell's trick
  var adjustCount = this.n && this.p.div(this.n);
  if (!adjustCount || adjustCount.cmpn(100) > 0) {
    this.redN = null;
  } else {
    this._maxwellTrick = true;
    this.redN = this.n.toRed(this.red);
  }
}
module.exports = BaseCurve;

BaseCurve.prototype.point = function point() {
  throw new Error('Not implemented');
};

BaseCurve.prototype.validate = function validate() {
  throw new Error('Not implemented');
};

BaseCurve.prototype._fixedNafMul = function _fixedNafMul(p, k) {
  assert(p.precomputed);
  var doubles = p._getDoubles();

  var naf = getNAF(k, 1);
  var I = (1 << (doubles.step + 1)) - (doubles.step % 2 === 0 ? 2 : 1);
  I /= 3;

  // Translate into more windowed form
  var repr = [];
  for (var j = 0; j < naf.length; j += doubles.step) {
    var nafW = 0;
    for (var k = j + doubles.step - 1; k >= j; k--)
      nafW = (nafW << 1) + naf[k];
    repr.push(nafW);
  }

  var a = this.jpoint(null, null, null);
  var b = this.jpoint(null, null, null);
  for (var i = I; i > 0; i--) {
    for (var j = 0; j < repr.length; j++) {
      var nafW = repr[j];
      if (nafW === i)
        b = b.mixedAdd(doubles.points[j]);
      else if (nafW === -i)
        b = b.mixedAdd(doubles.points[j].neg());
    }
    a = a.add(b);
  }
  return a.toP();
};

BaseCurve.prototype._wnafMul = function _wnafMul(p, k) {
  var w = 4;

  // Precompute window
  var nafPoints = p._getNAFPoints(w);
  w = nafPoints.wnd;
  var wnd = nafPoints.points;

  // Get NAF form
  var naf = getNAF(k, w);

  // Add `this`*(N+1) for every w-NAF index
  var acc = this.jpoint(null, null, null);
  for (var i = naf.length - 1; i >= 0; i--) {
    // Count zeroes
    for (var k = 0; i >= 0 && naf[i] === 0; i--)
      k++;
    if (i >= 0)
      k++;
    acc = acc.dblp(k);

    if (i < 0)
      break;
    var z = naf[i];
    assert(z !== 0);
    if (p.type === 'affine') {
      // J +- P
      if (z > 0)
        acc = acc.mixedAdd(wnd[(z - 1) >> 1]);
      else
        acc = acc.mixedAdd(wnd[(-z - 1) >> 1].neg());
    } else {
      // J +- J
      if (z > 0)
        acc = acc.add(wnd[(z - 1) >> 1]);
      else
        acc = acc.add(wnd[(-z - 1) >> 1].neg());
    }
  }
  return p.type === 'affine' ? acc.toP() : acc;
};

BaseCurve.prototype._wnafMulAdd = function _wnafMulAdd(defW,
                                                       points,
                                                       coeffs,
                                                       len,
                                                       jacobianResult) {
  var wndWidth = this._wnafT1;
  var wnd = this._wnafT2;
  var naf = this._wnafT3;

  // Fill all arrays
  var max = 0;
  for (var i = 0; i < len; i++) {
    var p = points[i];
    var nafPoints = p._getNAFPoints(defW);
    wndWidth[i] = nafPoints.wnd;
    wnd[i] = nafPoints.points;
  }

  // Comb small window NAFs
  for (var i = len - 1; i >= 1; i -= 2) {
    var a = i - 1;
    var b = i;
    if (wndWidth[a] !== 1 || wndWidth[b] !== 1) {
      naf[a] = getNAF(coeffs[a], wndWidth[a]);
      naf[b] = getNAF(coeffs[b], wndWidth[b]);
      max = Math.max(naf[a].length, max);
      max = Math.max(naf[b].length, max);
      continue;
    }

    var comb = [
      points[a], /* 1 */
      null, /* 3 */
      null, /* 5 */
      points[b] /* 7 */
    ];

    // Try to avoid Projective points, if possible
    if (points[a].y.cmp(points[b].y) === 0) {
      comb[1] = points[a].add(points[b]);
      comb[2] = points[a].toJ().mixedAdd(points[b].neg());
    } else if (points[a].y.cmp(points[b].y.redNeg()) === 0) {
      comb[1] = points[a].toJ().mixedAdd(points[b]);
      comb[2] = points[a].add(points[b].neg());
    } else {
      comb[1] = points[a].toJ().mixedAdd(points[b]);
      comb[2] = points[a].toJ().mixedAdd(points[b].neg());
    }

    var index = [
      -3, /* -1 -1 */
      -1, /* -1 0 */
      -5, /* -1 1 */
      -7, /* 0 -1 */
      0, /* 0 0 */
      7, /* 0 1 */
      5, /* 1 -1 */
      1, /* 1 0 */
      3  /* 1 1 */
    ];

    var jsf = getJSF(coeffs[a], coeffs[b]);
    max = Math.max(jsf[0].length, max);
    naf[a] = new Array(max);
    naf[b] = new Array(max);
    for (var j = 0; j < max; j++) {
      var ja = jsf[0][j] | 0;
      var jb = jsf[1][j] | 0;

      naf[a][j] = index[(ja + 1) * 3 + (jb + 1)];
      naf[b][j] = 0;
      wnd[a] = comb;
    }
  }

  var acc = this.jpoint(null, null, null);
  var tmp = this._wnafT4;
  for (var i = max; i >= 0; i--) {
    var k = 0;

    while (i >= 0) {
      var zero = true;
      for (var j = 0; j < len; j++) {
        tmp[j] = naf[j][i] | 0;
        if (tmp[j] !== 0)
          zero = false;
      }
      if (!zero)
        break;
      k++;
      i--;
    }
    if (i >= 0)
      k++;
    acc = acc.dblp(k);
    if (i < 0)
      break;

    for (var j = 0; j < len; j++) {
      var z = tmp[j];
      var p;
      if (z === 0)
        continue;
      else if (z > 0)
        p = wnd[j][(z - 1) >> 1];
      else if (z < 0)
        p = wnd[j][(-z - 1) >> 1].neg();

      if (p.type === 'affine')
        acc = acc.mixedAdd(p);
      else
        acc = acc.add(p);
    }
  }
  // Zeroify references
  for (var i = 0; i < len; i++)
    wnd[i] = null;

  if (jacobianResult)
    return acc;
  else
    return acc.toP();
};

function BasePoint(curve, type) {
  this.curve = curve;
  this.type = type;
  this.precomputed = null;
}
BaseCurve.BasePoint = BasePoint;

BasePoint.prototype.eq = function eq(/*other*/) {
  throw new Error('Not implemented');
};

BasePoint.prototype.validate = function validate() {
  return this.curve.validate(this);
};

BaseCurve.prototype.decodePoint = function decodePoint(bytes, enc) {
  bytes = utils.toArray(bytes, enc);

  var len = this.p.byteLength();

  // uncompressed, hybrid-odd, hybrid-even
  if ((bytes[0] === 0x04 || bytes[0] === 0x06 || bytes[0] === 0x07) &&
      bytes.length - 1 === 2 * len) {
    if (bytes[0] === 0x06)
      assert(bytes[bytes.length - 1] % 2 === 0);
    else if (bytes[0] === 0x07)
      assert(bytes[bytes.length - 1] % 2 === 1);

    var res =  this.point(bytes.slice(1, 1 + len),
                          bytes.slice(1 + len, 1 + 2 * len));

    return res;
  } else if ((bytes[0] === 0x02 || bytes[0] === 0x03) &&
              bytes.length - 1 === len) {
    return this.pointFromX(bytes.slice(1, 1 + len), bytes[0] === 0x03);
  }
  throw new Error('Unknown point format');
};

BasePoint.prototype.encodeCompressed = function encodeCompressed(enc) {
  return this.encode(enc, true);
};

BasePoint.prototype._encode = function _encode(compact) {
  var len = this.curve.p.byteLength();
  var x = this.getX().toArray('be', len);

  if (compact)
    return [ this.getY().isEven() ? 0x02 : 0x03 ].concat(x);

  return [ 0x04 ].concat(x, this.getY().toArray('be', len)) ;
};

BasePoint.prototype.encode = function encode(enc, compact) {
  return utils.encode(this._encode(compact), enc);
};

BasePoint.prototype.precompute = function precompute(power) {
  if (this.precomputed)
    return this;

  var precomputed = {
    doubles: null,
    naf: null,
    beta: null
  };
  precomputed.naf = this._getNAFPoints(8);
  precomputed.doubles = this._getDoubles(4, power);
  precomputed.beta = this._getBeta();
  this.precomputed = precomputed;

  return this;
};

BasePoint.prototype._hasDoubles = function _hasDoubles(k) {
  if (!this.precomputed)
    return false;

  var doubles = this.precomputed.doubles;
  if (!doubles)
    return false;

  return doubles.points.length >= Math.ceil((k.bitLength() + 1) / doubles.step);
};

BasePoint.prototype._getDoubles = function _getDoubles(step, power) {
  if (this.precomputed && this.precomputed.doubles)
    return this.precomputed.doubles;

  var doubles = [ this ];
  var acc = this;
  for (var i = 0; i < power; i += step) {
    for (var j = 0; j < step; j++)
      acc = acc.dbl();
    doubles.push(acc);
  }
  return {
    step: step,
    points: doubles
  };
};

BasePoint.prototype._getNAFPoints = function _getNAFPoints(wnd) {
  if (this.precomputed && this.precomputed.naf)
    return this.precomputed.naf;

  var res = [ this ];
  var max = (1 << wnd) - 1;
  var dbl = max === 1 ? null : this.dbl();
  for (var i = 1; i < max; i++)
    res[i] = res[i - 1].add(dbl);
  return {
    wnd: wnd,
    points: res
  };
};

BasePoint.prototype._getBeta = function _getBeta() {
  return null;
};

BasePoint.prototype.dblp = function dblp(k) {
  var r = this;
  for (var i = 0; i < k; i++)
    r = r.dbl();
  return r;
};


/***/ }),
/* 269 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var curve = __webpack_require__(80);
var elliptic = __webpack_require__(17);
var BN = __webpack_require__(13);
var inherits = __webpack_require__(1);
var Base = curve.base;

var assert = elliptic.utils.assert;

function ShortCurve(conf) {
  Base.call(this, 'short', conf);

  this.a = new BN(conf.a, 16).toRed(this.red);
  this.b = new BN(conf.b, 16).toRed(this.red);
  this.tinv = this.two.redInvm();

  this.zeroA = this.a.fromRed().cmpn(0) === 0;
  this.threeA = this.a.fromRed().sub(this.p).cmpn(-3) === 0;

  // If the curve is endomorphic, precalculate beta and lambda
  this.endo = this._getEndomorphism(conf);
  this._endoWnafT1 = new Array(4);
  this._endoWnafT2 = new Array(4);
}
inherits(ShortCurve, Base);
module.exports = ShortCurve;

ShortCurve.prototype._getEndomorphism = function _getEndomorphism(conf) {
  // No efficient endomorphism
  if (!this.zeroA || !this.g || !this.n || this.p.modn(3) !== 1)
    return;

  // Compute beta and lambda, that lambda * P = (beta * Px; Py)
  var beta;
  var lambda;
  if (conf.beta) {
    beta = new BN(conf.beta, 16).toRed(this.red);
  } else {
    var betas = this._getEndoRoots(this.p);
    // Choose the smallest beta
    beta = betas[0].cmp(betas[1]) < 0 ? betas[0] : betas[1];
    beta = beta.toRed(this.red);
  }
  if (conf.lambda) {
    lambda = new BN(conf.lambda, 16);
  } else {
    // Choose the lambda that is matching selected beta
    var lambdas = this._getEndoRoots(this.n);
    if (this.g.mul(lambdas[0]).x.cmp(this.g.x.redMul(beta)) === 0) {
      lambda = lambdas[0];
    } else {
      lambda = lambdas[1];
      assert(this.g.mul(lambda).x.cmp(this.g.x.redMul(beta)) === 0);
    }
  }

  // Get basis vectors, used for balanced length-two representation
  var basis;
  if (conf.basis) {
    basis = conf.basis.map(function(vec) {
      return {
        a: new BN(vec.a, 16),
        b: new BN(vec.b, 16)
      };
    });
  } else {
    basis = this._getEndoBasis(lambda);
  }

  return {
    beta: beta,
    lambda: lambda,
    basis: basis
  };
};

ShortCurve.prototype._getEndoRoots = function _getEndoRoots(num) {
  // Find roots of for x^2 + x + 1 in F
  // Root = (-1 +- Sqrt(-3)) / 2
  //
  var red = num === this.p ? this.red : BN.mont(num);
  var tinv = new BN(2).toRed(red).redInvm();
  var ntinv = tinv.redNeg();

  var s = new BN(3).toRed(red).redNeg().redSqrt().redMul(tinv);

  var l1 = ntinv.redAdd(s).fromRed();
  var l2 = ntinv.redSub(s).fromRed();
  return [ l1, l2 ];
};

ShortCurve.prototype._getEndoBasis = function _getEndoBasis(lambda) {
  // aprxSqrt >= sqrt(this.n)
  var aprxSqrt = this.n.ushrn(Math.floor(this.n.bitLength() / 2));

  // 3.74
  // Run EGCD, until r(L + 1) < aprxSqrt
  var u = lambda;
  var v = this.n.clone();
  var x1 = new BN(1);
  var y1 = new BN(0);
  var x2 = new BN(0);
  var y2 = new BN(1);

  // NOTE: all vectors are roots of: a + b * lambda = 0 (mod n)
  var a0;
  var b0;
  // First vector
  var a1;
  var b1;
  // Second vector
  var a2;
  var b2;

  var prevR;
  var i = 0;
  var r;
  var x;
  while (u.cmpn(0) !== 0) {
    var q = v.div(u);
    r = v.sub(q.mul(u));
    x = x2.sub(q.mul(x1));
    var y = y2.sub(q.mul(y1));

    if (!a1 && r.cmp(aprxSqrt) < 0) {
      a0 = prevR.neg();
      b0 = x1;
      a1 = r.neg();
      b1 = x;
    } else if (a1 && ++i === 2) {
      break;
    }
    prevR = r;

    v = u;
    u = r;
    x2 = x1;
    x1 = x;
    y2 = y1;
    y1 = y;
  }
  a2 = r.neg();
  b2 = x;

  var len1 = a1.sqr().add(b1.sqr());
  var len2 = a2.sqr().add(b2.sqr());
  if (len2.cmp(len1) >= 0) {
    a2 = a0;
    b2 = b0;
  }

  // Normalize signs
  if (a1.negative) {
    a1 = a1.neg();
    b1 = b1.neg();
  }
  if (a2.negative) {
    a2 = a2.neg();
    b2 = b2.neg();
  }

  return [
    { a: a1, b: b1 },
    { a: a2, b: b2 }
  ];
};

ShortCurve.prototype._endoSplit = function _endoSplit(k) {
  var basis = this.endo.basis;
  var v1 = basis[0];
  var v2 = basis[1];

  var c1 = v2.b.mul(k).divRound(this.n);
  var c2 = v1.b.neg().mul(k).divRound(this.n);

  var p1 = c1.mul(v1.a);
  var p2 = c2.mul(v2.a);
  var q1 = c1.mul(v1.b);
  var q2 = c2.mul(v2.b);

  // Calculate answer
  var k1 = k.sub(p1).sub(p2);
  var k2 = q1.add(q2).neg();
  return { k1: k1, k2: k2 };
};

ShortCurve.prototype.pointFromX = function pointFromX(x, odd) {
  x = new BN(x, 16);
  if (!x.red)
    x = x.toRed(this.red);

  var y2 = x.redSqr().redMul(x).redIAdd(x.redMul(this.a)).redIAdd(this.b);
  var y = y2.redSqrt();
  if (y.redSqr().redSub(y2).cmp(this.zero) !== 0)
    throw new Error('invalid point');

  // XXX Is there any way to tell if the number is odd without converting it
  // to non-red form?
  var isOdd = y.fromRed().isOdd();
  if (odd && !isOdd || !odd && isOdd)
    y = y.redNeg();

  return this.point(x, y);
};

ShortCurve.prototype.validate = function validate(point) {
  if (point.inf)
    return true;

  var x = point.x;
  var y = point.y;

  var ax = this.a.redMul(x);
  var rhs = x.redSqr().redMul(x).redIAdd(ax).redIAdd(this.b);
  return y.redSqr().redISub(rhs).cmpn(0) === 0;
};

ShortCurve.prototype._endoWnafMulAdd =
    function _endoWnafMulAdd(points, coeffs, jacobianResult) {
  var npoints = this._endoWnafT1;
  var ncoeffs = this._endoWnafT2;
  for (var i = 0; i < points.length; i++) {
    var split = this._endoSplit(coeffs[i]);
    var p = points[i];
    var beta = p._getBeta();

    if (split.k1.negative) {
      split.k1.ineg();
      p = p.neg(true);
    }
    if (split.k2.negative) {
      split.k2.ineg();
      beta = beta.neg(true);
    }

    npoints[i * 2] = p;
    npoints[i * 2 + 1] = beta;
    ncoeffs[i * 2] = split.k1;
    ncoeffs[i * 2 + 1] = split.k2;
  }
  var res = this._wnafMulAdd(1, npoints, ncoeffs, i * 2, jacobianResult);

  // Clean-up references to points and coefficients
  for (var j = 0; j < i * 2; j++) {
    npoints[j] = null;
    ncoeffs[j] = null;
  }
  return res;
};

function Point(curve, x, y, isRed) {
  Base.BasePoint.call(this, curve, 'affine');
  if (x === null && y === null) {
    this.x = null;
    this.y = null;
    this.inf = true;
  } else {
    this.x = new BN(x, 16);
    this.y = new BN(y, 16);
    // Force redgomery representation when loading from JSON
    if (isRed) {
      this.x.forceRed(this.curve.red);
      this.y.forceRed(this.curve.red);
    }
    if (!this.x.red)
      this.x = this.x.toRed(this.curve.red);
    if (!this.y.red)
      this.y = this.y.toRed(this.curve.red);
    this.inf = false;
  }
}
inherits(Point, Base.BasePoint);

ShortCurve.prototype.point = function point(x, y, isRed) {
  return new Point(this, x, y, isRed);
};

ShortCurve.prototype.pointFromJSON = function pointFromJSON(obj, red) {
  return Point.fromJSON(this, obj, red);
};

Point.prototype._getBeta = function _getBeta() {
  if (!this.curve.endo)
    return;

  var pre = this.precomputed;
  if (pre && pre.beta)
    return pre.beta;

  var beta = this.curve.point(this.x.redMul(this.curve.endo.beta), this.y);
  if (pre) {
    var curve = this.curve;
    var endoMul = function(p) {
      return curve.point(p.x.redMul(curve.endo.beta), p.y);
    };
    pre.beta = beta;
    beta.precomputed = {
      beta: null,
      naf: pre.naf && {
        wnd: pre.naf.wnd,
        points: pre.naf.points.map(endoMul)
      },
      doubles: pre.doubles && {
        step: pre.doubles.step,
        points: pre.doubles.points.map(endoMul)
      }
    };
  }
  return beta;
};

Point.prototype.toJSON = function toJSON() {
  if (!this.precomputed)
    return [ this.x, this.y ];

  return [ this.x, this.y, this.precomputed && {
    doubles: this.precomputed.doubles && {
      step: this.precomputed.doubles.step,
      points: this.precomputed.doubles.points.slice(1)
    },
    naf: this.precomputed.naf && {
      wnd: this.precomputed.naf.wnd,
      points: this.precomputed.naf.points.slice(1)
    }
  } ];
};

Point.fromJSON = function fromJSON(curve, obj, red) {
  if (typeof obj === 'string')
    obj = JSON.parse(obj);
  var res = curve.point(obj[0], obj[1], red);
  if (!obj[2])
    return res;

  function obj2point(obj) {
    return curve.point(obj[0], obj[1], red);
  }

  var pre = obj[2];
  res.precomputed = {
    beta: null,
    doubles: pre.doubles && {
      step: pre.doubles.step,
      points: [ res ].concat(pre.doubles.points.map(obj2point))
    },
    naf: pre.naf && {
      wnd: pre.naf.wnd,
      points: [ res ].concat(pre.naf.points.map(obj2point))
    }
  };
  return res;
};

Point.prototype.inspect = function inspect() {
  if (this.isInfinity())
    return '<EC Point Infinity>';
  return '<EC Point x: ' + this.x.fromRed().toString(16, 2) +
      ' y: ' + this.y.fromRed().toString(16, 2) + '>';
};

Point.prototype.isInfinity = function isInfinity() {
  return this.inf;
};

Point.prototype.add = function add(p) {
  // O + P = P
  if (this.inf)
    return p;

  // P + O = P
  if (p.inf)
    return this;

  // P + P = 2P
  if (this.eq(p))
    return this.dbl();

  // P + (-P) = O
  if (this.neg().eq(p))
    return this.curve.point(null, null);

  // P + Q = O
  if (this.x.cmp(p.x) === 0)
    return this.curve.point(null, null);

  var c = this.y.redSub(p.y);
  if (c.cmpn(0) !== 0)
    c = c.redMul(this.x.redSub(p.x).redInvm());
  var nx = c.redSqr().redISub(this.x).redISub(p.x);
  var ny = c.redMul(this.x.redSub(nx)).redISub(this.y);
  return this.curve.point(nx, ny);
};

Point.prototype.dbl = function dbl() {
  if (this.inf)
    return this;

  // 2P = O
  var ys1 = this.y.redAdd(this.y);
  if (ys1.cmpn(0) === 0)
    return this.curve.point(null, null);

  var a = this.curve.a;

  var x2 = this.x.redSqr();
  var dyinv = ys1.redInvm();
  var c = x2.redAdd(x2).redIAdd(x2).redIAdd(a).redMul(dyinv);

  var nx = c.redSqr().redISub(this.x.redAdd(this.x));
  var ny = c.redMul(this.x.redSub(nx)).redISub(this.y);
  return this.curve.point(nx, ny);
};

Point.prototype.getX = function getX() {
  return this.x.fromRed();
};

Point.prototype.getY = function getY() {
  return this.y.fromRed();
};

Point.prototype.mul = function mul(k) {
  k = new BN(k, 16);

  if (this._hasDoubles(k))
    return this.curve._fixedNafMul(this, k);
  else if (this.curve.endo)
    return this.curve._endoWnafMulAdd([ this ], [ k ]);
  else
    return this.curve._wnafMul(this, k);
};

Point.prototype.mulAdd = function mulAdd(k1, p2, k2) {
  var points = [ this, p2 ];
  var coeffs = [ k1, k2 ];
  if (this.curve.endo)
    return this.curve._endoWnafMulAdd(points, coeffs);
  else
    return this.curve._wnafMulAdd(1, points, coeffs, 2);
};

Point.prototype.jmulAdd = function jmulAdd(k1, p2, k2) {
  var points = [ this, p2 ];
  var coeffs = [ k1, k2 ];
  if (this.curve.endo)
    return this.curve._endoWnafMulAdd(points, coeffs, true);
  else
    return this.curve._wnafMulAdd(1, points, coeffs, 2, true);
};

Point.prototype.eq = function eq(p) {
  return this === p ||
         this.inf === p.inf &&
             (this.inf || this.x.cmp(p.x) === 0 && this.y.cmp(p.y) === 0);
};

Point.prototype.neg = function neg(_precompute) {
  if (this.inf)
    return this;

  var res = this.curve.point(this.x, this.y.redNeg());
  if (_precompute && this.precomputed) {
    var pre = this.precomputed;
    var negate = function(p) {
      return p.neg();
    };
    res.precomputed = {
      naf: pre.naf && {
        wnd: pre.naf.wnd,
        points: pre.naf.points.map(negate)
      },
      doubles: pre.doubles && {
        step: pre.doubles.step,
        points: pre.doubles.points.map(negate)
      }
    };
  }
  return res;
};

Point.prototype.toJ = function toJ() {
  if (this.inf)
    return this.curve.jpoint(null, null, null);

  var res = this.curve.jpoint(this.x, this.y, this.curve.one);
  return res;
};

function JPoint(curve, x, y, z) {
  Base.BasePoint.call(this, curve, 'jacobian');
  if (x === null && y === null && z === null) {
    this.x = this.curve.one;
    this.y = this.curve.one;
    this.z = new BN(0);
  } else {
    this.x = new BN(x, 16);
    this.y = new BN(y, 16);
    this.z = new BN(z, 16);
  }
  if (!this.x.red)
    this.x = this.x.toRed(this.curve.red);
  if (!this.y.red)
    this.y = this.y.toRed(this.curve.red);
  if (!this.z.red)
    this.z = this.z.toRed(this.curve.red);

  this.zOne = this.z === this.curve.one;
}
inherits(JPoint, Base.BasePoint);

ShortCurve.prototype.jpoint = function jpoint(x, y, z) {
  return new JPoint(this, x, y, z);
};

JPoint.prototype.toP = function toP() {
  if (this.isInfinity())
    return this.curve.point(null, null);

  var zinv = this.z.redInvm();
  var zinv2 = zinv.redSqr();
  var ax = this.x.redMul(zinv2);
  var ay = this.y.redMul(zinv2).redMul(zinv);

  return this.curve.point(ax, ay);
};

JPoint.prototype.neg = function neg() {
  return this.curve.jpoint(this.x, this.y.redNeg(), this.z);
};

JPoint.prototype.add = function add(p) {
  // O + P = P
  if (this.isInfinity())
    return p;

  // P + O = P
  if (p.isInfinity())
    return this;

  // 12M + 4S + 7A
  var pz2 = p.z.redSqr();
  var z2 = this.z.redSqr();
  var u1 = this.x.redMul(pz2);
  var u2 = p.x.redMul(z2);
  var s1 = this.y.redMul(pz2.redMul(p.z));
  var s2 = p.y.redMul(z2.redMul(this.z));

  var h = u1.redSub(u2);
  var r = s1.redSub(s2);
  if (h.cmpn(0) === 0) {
    if (r.cmpn(0) !== 0)
      return this.curve.jpoint(null, null, null);
    else
      return this.dbl();
  }

  var h2 = h.redSqr();
  var h3 = h2.redMul(h);
  var v = u1.redMul(h2);

  var nx = r.redSqr().redIAdd(h3).redISub(v).redISub(v);
  var ny = r.redMul(v.redISub(nx)).redISub(s1.redMul(h3));
  var nz = this.z.redMul(p.z).redMul(h);

  return this.curve.jpoint(nx, ny, nz);
};

JPoint.prototype.mixedAdd = function mixedAdd(p) {
  // O + P = P
  if (this.isInfinity())
    return p.toJ();

  // P + O = P
  if (p.isInfinity())
    return this;

  // 8M + 3S + 7A
  var z2 = this.z.redSqr();
  var u1 = this.x;
  var u2 = p.x.redMul(z2);
  var s1 = this.y;
  var s2 = p.y.redMul(z2).redMul(this.z);

  var h = u1.redSub(u2);
  var r = s1.redSub(s2);
  if (h.cmpn(0) === 0) {
    if (r.cmpn(0) !== 0)
      return this.curve.jpoint(null, null, null);
    else
      return this.dbl();
  }

  var h2 = h.redSqr();
  var h3 = h2.redMul(h);
  var v = u1.redMul(h2);

  var nx = r.redSqr().redIAdd(h3).redISub(v).redISub(v);
  var ny = r.redMul(v.redISub(nx)).redISub(s1.redMul(h3));
  var nz = this.z.redMul(h);

  return this.curve.jpoint(nx, ny, nz);
};

JPoint.prototype.dblp = function dblp(pow) {
  if (pow === 0)
    return this;
  if (this.isInfinity())
    return this;
  if (!pow)
    return this.dbl();

  if (this.curve.zeroA || this.curve.threeA) {
    var r = this;
    for (var i = 0; i < pow; i++)
      r = r.dbl();
    return r;
  }

  // 1M + 2S + 1A + N * (4S + 5M + 8A)
  // N = 1 => 6M + 6S + 9A
  var a = this.curve.a;
  var tinv = this.curve.tinv;

  var jx = this.x;
  var jy = this.y;
  var jz = this.z;
  var jz4 = jz.redSqr().redSqr();

  // Reuse results
  var jyd = jy.redAdd(jy);
  for (var i = 0; i < pow; i++) {
    var jx2 = jx.redSqr();
    var jyd2 = jyd.redSqr();
    var jyd4 = jyd2.redSqr();
    var c = jx2.redAdd(jx2).redIAdd(jx2).redIAdd(a.redMul(jz4));

    var t1 = jx.redMul(jyd2);
    var nx = c.redSqr().redISub(t1.redAdd(t1));
    var t2 = t1.redISub(nx);
    var dny = c.redMul(t2);
    dny = dny.redIAdd(dny).redISub(jyd4);
    var nz = jyd.redMul(jz);
    if (i + 1 < pow)
      jz4 = jz4.redMul(jyd4);

    jx = nx;
    jz = nz;
    jyd = dny;
  }

  return this.curve.jpoint(jx, jyd.redMul(tinv), jz);
};

JPoint.prototype.dbl = function dbl() {
  if (this.isInfinity())
    return this;

  if (this.curve.zeroA)
    return this._zeroDbl();
  else if (this.curve.threeA)
    return this._threeDbl();
  else
    return this._dbl();
};

JPoint.prototype._zeroDbl = function _zeroDbl() {
  var nx;
  var ny;
  var nz;
  // Z = 1
  if (this.zOne) {
    // hyperelliptic.org/EFD/g1p/auto-shortw-jacobian-0.html
    //     #doubling-mdbl-2007-bl
    // 1M + 5S + 14A

    // XX = X1^2
    var xx = this.x.redSqr();
    // YY = Y1^2
    var yy = this.y.redSqr();
    // YYYY = YY^2
    var yyyy = yy.redSqr();
    // S = 2 * ((X1 + YY)^2 - XX - YYYY)
    var s = this.x.redAdd(yy).redSqr().redISub(xx).redISub(yyyy);
    s = s.redIAdd(s);
    // M = 3 * XX + a; a = 0
    var m = xx.redAdd(xx).redIAdd(xx);
    // T = M ^ 2 - 2*S
    var t = m.redSqr().redISub(s).redISub(s);

    // 8 * YYYY
    var yyyy8 = yyyy.redIAdd(yyyy);
    yyyy8 = yyyy8.redIAdd(yyyy8);
    yyyy8 = yyyy8.redIAdd(yyyy8);

    // X3 = T
    nx = t;
    // Y3 = M * (S - T) - 8 * YYYY
    ny = m.redMul(s.redISub(t)).redISub(yyyy8);
    // Z3 = 2*Y1
    nz = this.y.redAdd(this.y);
  } else {
    // hyperelliptic.org/EFD/g1p/auto-shortw-jacobian-0.html
    //     #doubling-dbl-2009-l
    // 2M + 5S + 13A

    // A = X1^2
    var a = this.x.redSqr();
    // B = Y1^2
    var b = this.y.redSqr();
    // C = B^2
    var c = b.redSqr();
    // D = 2 * ((X1 + B)^2 - A - C)
    var d = this.x.redAdd(b).redSqr().redISub(a).redISub(c);
    d = d.redIAdd(d);
    // E = 3 * A
    var e = a.redAdd(a).redIAdd(a);
    // F = E^2
    var f = e.redSqr();

    // 8 * C
    var c8 = c.redIAdd(c);
    c8 = c8.redIAdd(c8);
    c8 = c8.redIAdd(c8);

    // X3 = F - 2 * D
    nx = f.redISub(d).redISub(d);
    // Y3 = E * (D - X3) - 8 * C
    ny = e.redMul(d.redISub(nx)).redISub(c8);
    // Z3 = 2 * Y1 * Z1
    nz = this.y.redMul(this.z);
    nz = nz.redIAdd(nz);
  }

  return this.curve.jpoint(nx, ny, nz);
};

JPoint.prototype._threeDbl = function _threeDbl() {
  var nx;
  var ny;
  var nz;
  // Z = 1
  if (this.zOne) {
    // hyperelliptic.org/EFD/g1p/auto-shortw-jacobian-3.html
    //     #doubling-mdbl-2007-bl
    // 1M + 5S + 15A

    // XX = X1^2
    var xx = this.x.redSqr();
    // YY = Y1^2
    var yy = this.y.redSqr();
    // YYYY = YY^2
    var yyyy = yy.redSqr();
    // S = 2 * ((X1 + YY)^2 - XX - YYYY)
    var s = this.x.redAdd(yy).redSqr().redISub(xx).redISub(yyyy);
    s = s.redIAdd(s);
    // M = 3 * XX + a
    var m = xx.redAdd(xx).redIAdd(xx).redIAdd(this.curve.a);
    // T = M^2 - 2 * S
    var t = m.redSqr().redISub(s).redISub(s);
    // X3 = T
    nx = t;
    // Y3 = M * (S - T) - 8 * YYYY
    var yyyy8 = yyyy.redIAdd(yyyy);
    yyyy8 = yyyy8.redIAdd(yyyy8);
    yyyy8 = yyyy8.redIAdd(yyyy8);
    ny = m.redMul(s.redISub(t)).redISub(yyyy8);
    // Z3 = 2 * Y1
    nz = this.y.redAdd(this.y);
  } else {
    // hyperelliptic.org/EFD/g1p/auto-shortw-jacobian-3.html#doubling-dbl-2001-b
    // 3M + 5S

    // delta = Z1^2
    var delta = this.z.redSqr();
    // gamma = Y1^2
    var gamma = this.y.redSqr();
    // beta = X1 * gamma
    var beta = this.x.redMul(gamma);
    // alpha = 3 * (X1 - delta) * (X1 + delta)
    var alpha = this.x.redSub(delta).redMul(this.x.redAdd(delta));
    alpha = alpha.redAdd(alpha).redIAdd(alpha);
    // X3 = alpha^2 - 8 * beta
    var beta4 = beta.redIAdd(beta);
    beta4 = beta4.redIAdd(beta4);
    var beta8 = beta4.redAdd(beta4);
    nx = alpha.redSqr().redISub(beta8);
    // Z3 = (Y1 + Z1)^2 - gamma - delta
    nz = this.y.redAdd(this.z).redSqr().redISub(gamma).redISub(delta);
    // Y3 = alpha * (4 * beta - X3) - 8 * gamma^2
    var ggamma8 = gamma.redSqr();
    ggamma8 = ggamma8.redIAdd(ggamma8);
    ggamma8 = ggamma8.redIAdd(ggamma8);
    ggamma8 = ggamma8.redIAdd(ggamma8);
    ny = alpha.redMul(beta4.redISub(nx)).redISub(ggamma8);
  }

  return this.curve.jpoint(nx, ny, nz);
};

JPoint.prototype._dbl = function _dbl() {
  var a = this.curve.a;

  // 4M + 6S + 10A
  var jx = this.x;
  var jy = this.y;
  var jz = this.z;
  var jz4 = jz.redSqr().redSqr();

  var jx2 = jx.redSqr();
  var jy2 = jy.redSqr();

  var c = jx2.redAdd(jx2).redIAdd(jx2).redIAdd(a.redMul(jz4));

  var jxd4 = jx.redAdd(jx);
  jxd4 = jxd4.redIAdd(jxd4);
  var t1 = jxd4.redMul(jy2);
  var nx = c.redSqr().redISub(t1.redAdd(t1));
  var t2 = t1.redISub(nx);

  var jyd8 = jy2.redSqr();
  jyd8 = jyd8.redIAdd(jyd8);
  jyd8 = jyd8.redIAdd(jyd8);
  jyd8 = jyd8.redIAdd(jyd8);
  var ny = c.redMul(t2).redISub(jyd8);
  var nz = jy.redAdd(jy).redMul(jz);

  return this.curve.jpoint(nx, ny, nz);
};

JPoint.prototype.trpl = function trpl() {
  if (!this.curve.zeroA)
    return this.dbl().add(this);

  // hyperelliptic.org/EFD/g1p/auto-shortw-jacobian-0.html#tripling-tpl-2007-bl
  // 5M + 10S + ...

  // XX = X1^2
  var xx = this.x.redSqr();
  // YY = Y1^2
  var yy = this.y.redSqr();
  // ZZ = Z1^2
  var zz = this.z.redSqr();
  // YYYY = YY^2
  var yyyy = yy.redSqr();
  // M = 3 * XX + a * ZZ2; a = 0
  var m = xx.redAdd(xx).redIAdd(xx);
  // MM = M^2
  var mm = m.redSqr();
  // E = 6 * ((X1 + YY)^2 - XX - YYYY) - MM
  var e = this.x.redAdd(yy).redSqr().redISub(xx).redISub(yyyy);
  e = e.redIAdd(e);
  e = e.redAdd(e).redIAdd(e);
  e = e.redISub(mm);
  // EE = E^2
  var ee = e.redSqr();
  // T = 16*YYYY
  var t = yyyy.redIAdd(yyyy);
  t = t.redIAdd(t);
  t = t.redIAdd(t);
  t = t.redIAdd(t);
  // U = (M + E)^2 - MM - EE - T
  var u = m.redIAdd(e).redSqr().redISub(mm).redISub(ee).redISub(t);
  // X3 = 4 * (X1 * EE - 4 * YY * U)
  var yyu4 = yy.redMul(u);
  yyu4 = yyu4.redIAdd(yyu4);
  yyu4 = yyu4.redIAdd(yyu4);
  var nx = this.x.redMul(ee).redISub(yyu4);
  nx = nx.redIAdd(nx);
  nx = nx.redIAdd(nx);
  // Y3 = 8 * Y1 * (U * (T - U) - E * EE)
  var ny = this.y.redMul(u.redMul(t.redISub(u)).redISub(e.redMul(ee)));
  ny = ny.redIAdd(ny);
  ny = ny.redIAdd(ny);
  ny = ny.redIAdd(ny);
  // Z3 = (Z1 + E)^2 - ZZ - EE
  var nz = this.z.redAdd(e).redSqr().redISub(zz).redISub(ee);

  return this.curve.jpoint(nx, ny, nz);
};

JPoint.prototype.mul = function mul(k, kbase) {
  k = new BN(k, kbase);

  return this.curve._wnafMul(this, k);
};

JPoint.prototype.eq = function eq(p) {
  if (p.type === 'affine')
    return this.eq(p.toJ());

  if (this === p)
    return true;

  // x1 * z2^2 == x2 * z1^2
  var z2 = this.z.redSqr();
  var pz2 = p.z.redSqr();
  if (this.x.redMul(pz2).redISub(p.x.redMul(z2)).cmpn(0) !== 0)
    return false;

  // y1 * z2^3 == y2 * z1^3
  var z3 = z2.redMul(this.z);
  var pz3 = pz2.redMul(p.z);
  return this.y.redMul(pz3).redISub(p.y.redMul(z3)).cmpn(0) === 0;
};

JPoint.prototype.eqXToP = function eqXToP(x) {
  var zs = this.z.redSqr();
  var rx = x.toRed(this.curve.red).redMul(zs);
  if (this.x.cmp(rx) === 0)
    return true;

  var xc = x.clone();
  var t = this.curve.redN.redMul(zs);
  for (;;) {
    xc.iadd(this.curve.n);
    if (xc.cmp(this.curve.p) >= 0)
      return false;

    rx.redIAdd(t);
    if (this.x.cmp(rx) === 0)
      return true;
  }
  return false;
};

JPoint.prototype.inspect = function inspect() {
  if (this.isInfinity())
    return '<EC JPoint Infinity>';
  return '<EC JPoint x: ' + this.x.toString(16, 2) +
      ' y: ' + this.y.toString(16, 2) +
      ' z: ' + this.z.toString(16, 2) + '>';
};

JPoint.prototype.isInfinity = function isInfinity() {
  // XXX This code assumes that zero is always zero in red
  return this.z.cmpn(0) === 0;
};


/***/ }),
/* 270 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var curve = __webpack_require__(80);
var BN = __webpack_require__(13);
var inherits = __webpack_require__(1);
var Base = curve.base;

var elliptic = __webpack_require__(17);
var utils = elliptic.utils;

function MontCurve(conf) {
  Base.call(this, 'mont', conf);

  this.a = new BN(conf.a, 16).toRed(this.red);
  this.b = new BN(conf.b, 16).toRed(this.red);
  this.i4 = new BN(4).toRed(this.red).redInvm();
  this.two = new BN(2).toRed(this.red);
  this.a24 = this.i4.redMul(this.a.redAdd(this.two));
}
inherits(MontCurve, Base);
module.exports = MontCurve;

MontCurve.prototype.validate = function validate(point) {
  var x = point.normalize().x;
  var x2 = x.redSqr();
  var rhs = x2.redMul(x).redAdd(x2.redMul(this.a)).redAdd(x);
  var y = rhs.redSqrt();

  return y.redSqr().cmp(rhs) === 0;
};

function Point(curve, x, z) {
  Base.BasePoint.call(this, curve, 'projective');
  if (x === null && z === null) {
    this.x = this.curve.one;
    this.z = this.curve.zero;
  } else {
    this.x = new BN(x, 16);
    this.z = new BN(z, 16);
    if (!this.x.red)
      this.x = this.x.toRed(this.curve.red);
    if (!this.z.red)
      this.z = this.z.toRed(this.curve.red);
  }
}
inherits(Point, Base.BasePoint);

MontCurve.prototype.decodePoint = function decodePoint(bytes, enc) {
  return this.point(utils.toArray(bytes, enc), 1);
};

MontCurve.prototype.point = function point(x, z) {
  return new Point(this, x, z);
};

MontCurve.prototype.pointFromJSON = function pointFromJSON(obj) {
  return Point.fromJSON(this, obj);
};

Point.prototype.precompute = function precompute() {
  // No-op
};

Point.prototype._encode = function _encode() {
  return this.getX().toArray('be', this.curve.p.byteLength());
};

Point.fromJSON = function fromJSON(curve, obj) {
  return new Point(curve, obj[0], obj[1] || curve.one);
};

Point.prototype.inspect = function inspect() {
  if (this.isInfinity())
    return '<EC Point Infinity>';
  return '<EC Point x: ' + this.x.fromRed().toString(16, 2) +
      ' z: ' + this.z.fromRed().toString(16, 2) + '>';
};

Point.prototype.isInfinity = function isInfinity() {
  // XXX This code assumes that zero is always zero in red
  return this.z.cmpn(0) === 0;
};

Point.prototype.dbl = function dbl() {
  // http://hyperelliptic.org/EFD/g1p/auto-montgom-xz.html#doubling-dbl-1987-m-3
  // 2M + 2S + 4A

  // A = X1 + Z1
  var a = this.x.redAdd(this.z);
  // AA = A^2
  var aa = a.redSqr();
  // B = X1 - Z1
  var b = this.x.redSub(this.z);
  // BB = B^2
  var bb = b.redSqr();
  // C = AA - BB
  var c = aa.redSub(bb);
  // X3 = AA * BB
  var nx = aa.redMul(bb);
  // Z3 = C * (BB + A24 * C)
  var nz = c.redMul(bb.redAdd(this.curve.a24.redMul(c)));
  return this.curve.point(nx, nz);
};

Point.prototype.add = function add() {
  throw new Error('Not supported on Montgomery curve');
};

Point.prototype.diffAdd = function diffAdd(p, diff) {
  // http://hyperelliptic.org/EFD/g1p/auto-montgom-xz.html#diffadd-dadd-1987-m-3
  // 4M + 2S + 6A

  // A = X2 + Z2
  var a = this.x.redAdd(this.z);
  // B = X2 - Z2
  var b = this.x.redSub(this.z);
  // C = X3 + Z3
  var c = p.x.redAdd(p.z);
  // D = X3 - Z3
  var d = p.x.redSub(p.z);
  // DA = D * A
  var da = d.redMul(a);
  // CB = C * B
  var cb = c.redMul(b);
  // X5 = Z1 * (DA + CB)^2
  var nx = diff.z.redMul(da.redAdd(cb).redSqr());
  // Z5 = X1 * (DA - CB)^2
  var nz = diff.x.redMul(da.redISub(cb).redSqr());
  return this.curve.point(nx, nz);
};

Point.prototype.mul = function mul(k) {
  var t = k.clone();
  var a = this; // (N / 2) * Q + Q
  var b = this.curve.point(null, null); // (N / 2) * Q
  var c = this; // Q

  for (var bits = []; t.cmpn(0) !== 0; t.iushrn(1))
    bits.push(t.andln(1));

  for (var i = bits.length - 1; i >= 0; i--) {
    if (bits[i] === 0) {
      // N * Q + Q = ((N / 2) * Q + Q)) + (N / 2) * Q
      a = a.diffAdd(b, c);
      // N * Q = 2 * ((N / 2) * Q + Q))
      b = b.dbl();
    } else {
      // N * Q = ((N / 2) * Q + Q) + ((N / 2) * Q)
      b = a.diffAdd(b, c);
      // N * Q + Q = 2 * ((N / 2) * Q + Q)
      a = a.dbl();
    }
  }
  return b;
};

Point.prototype.mulAdd = function mulAdd() {
  throw new Error('Not supported on Montgomery curve');
};

Point.prototype.jumlAdd = function jumlAdd() {
  throw new Error('Not supported on Montgomery curve');
};

Point.prototype.eq = function eq(other) {
  return this.getX().cmp(other.getX()) === 0;
};

Point.prototype.normalize = function normalize() {
  this.x = this.x.redMul(this.z.redInvm());
  this.z = this.curve.one;
  return this;
};

Point.prototype.getX = function getX() {
  // Normalize coordinates
  this.normalize();

  return this.x.fromRed();
};


/***/ }),
/* 271 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var curve = __webpack_require__(80);
var elliptic = __webpack_require__(17);
var BN = __webpack_require__(13);
var inherits = __webpack_require__(1);
var Base = curve.base;

var assert = elliptic.utils.assert;

function EdwardsCurve(conf) {
  // NOTE: Important as we are creating point in Base.call()
  this.twisted = (conf.a | 0) !== 1;
  this.mOneA = this.twisted && (conf.a | 0) === -1;
  this.extended = this.mOneA;

  Base.call(this, 'edwards', conf);

  this.a = new BN(conf.a, 16).umod(this.red.m);
  this.a = this.a.toRed(this.red);
  this.c = new BN(conf.c, 16).toRed(this.red);
  this.c2 = this.c.redSqr();
  this.d = new BN(conf.d, 16).toRed(this.red);
  this.dd = this.d.redAdd(this.d);

  assert(!this.twisted || this.c.fromRed().cmpn(1) === 0);
  this.oneC = (conf.c | 0) === 1;
}
inherits(EdwardsCurve, Base);
module.exports = EdwardsCurve;

EdwardsCurve.prototype._mulA = function _mulA(num) {
  if (this.mOneA)
    return num.redNeg();
  else
    return this.a.redMul(num);
};

EdwardsCurve.prototype._mulC = function _mulC(num) {
  if (this.oneC)
    return num;
  else
    return this.c.redMul(num);
};

// Just for compatibility with Short curve
EdwardsCurve.prototype.jpoint = function jpoint(x, y, z, t) {
  return this.point(x, y, z, t);
};

EdwardsCurve.prototype.pointFromX = function pointFromX(x, odd) {
  x = new BN(x, 16);
  if (!x.red)
    x = x.toRed(this.red);

  var x2 = x.redSqr();
  var rhs = this.c2.redSub(this.a.redMul(x2));
  var lhs = this.one.redSub(this.c2.redMul(this.d).redMul(x2));

  var y2 = rhs.redMul(lhs.redInvm());
  var y = y2.redSqrt();
  if (y.redSqr().redSub(y2).cmp(this.zero) !== 0)
    throw new Error('invalid point');

  var isOdd = y.fromRed().isOdd();
  if (odd && !isOdd || !odd && isOdd)
    y = y.redNeg();

  return this.point(x, y);
};

EdwardsCurve.prototype.pointFromY = function pointFromY(y, odd) {
  y = new BN(y, 16);
  if (!y.red)
    y = y.toRed(this.red);

  // x^2 = (y^2 - 1) / (d y^2 + 1)
  var y2 = y.redSqr();
  var lhs = y2.redSub(this.one);
  var rhs = y2.redMul(this.d).redAdd(this.one);
  var x2 = lhs.redMul(rhs.redInvm());

  if (x2.cmp(this.zero) === 0) {
    if (odd)
      throw new Error('invalid point');
    else
      return this.point(this.zero, y);
  }

  var x = x2.redSqrt();
  if (x.redSqr().redSub(x2).cmp(this.zero) !== 0)
    throw new Error('invalid point');

  if (x.isOdd() !== odd)
    x = x.redNeg();

  return this.point(x, y);
};

EdwardsCurve.prototype.validate = function validate(point) {
  if (point.isInfinity())
    return true;

  // Curve: A * X^2 + Y^2 = C^2 * (1 + D * X^2 * Y^2)
  point.normalize();

  var x2 = point.x.redSqr();
  var y2 = point.y.redSqr();
  var lhs = x2.redMul(this.a).redAdd(y2);
  var rhs = this.c2.redMul(this.one.redAdd(this.d.redMul(x2).redMul(y2)));

  return lhs.cmp(rhs) === 0;
};

function Point(curve, x, y, z, t) {
  Base.BasePoint.call(this, curve, 'projective');
  if (x === null && y === null && z === null) {
    this.x = this.curve.zero;
    this.y = this.curve.one;
    this.z = this.curve.one;
    this.t = this.curve.zero;
    this.zOne = true;
  } else {
    this.x = new BN(x, 16);
    this.y = new BN(y, 16);
    this.z = z ? new BN(z, 16) : this.curve.one;
    this.t = t && new BN(t, 16);
    if (!this.x.red)
      this.x = this.x.toRed(this.curve.red);
    if (!this.y.red)
      this.y = this.y.toRed(this.curve.red);
    if (!this.z.red)
      this.z = this.z.toRed(this.curve.red);
    if (this.t && !this.t.red)
      this.t = this.t.toRed(this.curve.red);
    this.zOne = this.z === this.curve.one;

    // Use extended coordinates
    if (this.curve.extended && !this.t) {
      this.t = this.x.redMul(this.y);
      if (!this.zOne)
        this.t = this.t.redMul(this.z.redInvm());
    }
  }
}
inherits(Point, Base.BasePoint);

EdwardsCurve.prototype.pointFromJSON = function pointFromJSON(obj) {
  return Point.fromJSON(this, obj);
};

EdwardsCurve.prototype.point = function point(x, y, z, t) {
  return new Point(this, x, y, z, t);
};

Point.fromJSON = function fromJSON(curve, obj) {
  return new Point(curve, obj[0], obj[1], obj[2]);
};

Point.prototype.inspect = function inspect() {
  if (this.isInfinity())
    return '<EC Point Infinity>';
  return '<EC Point x: ' + this.x.fromRed().toString(16, 2) +
      ' y: ' + this.y.fromRed().toString(16, 2) +
      ' z: ' + this.z.fromRed().toString(16, 2) + '>';
};

Point.prototype.isInfinity = function isInfinity() {
  // XXX This code assumes that zero is always zero in red
  return this.x.cmpn(0) === 0 &&
         this.y.cmp(this.z) === 0;
};

Point.prototype._extDbl = function _extDbl() {
  // hyperelliptic.org/EFD/g1p/auto-twisted-extended-1.html
  //     #doubling-dbl-2008-hwcd
  // 4M + 4S

  // A = X1^2
  var a = this.x.redSqr();
  // B = Y1^2
  var b = this.y.redSqr();
  // C = 2 * Z1^2
  var c = this.z.redSqr();
  c = c.redIAdd(c);
  // D = a * A
  var d = this.curve._mulA(a);
  // E = (X1 + Y1)^2 - A - B
  var e = this.x.redAdd(this.y).redSqr().redISub(a).redISub(b);
  // G = D + B
  var g = d.redAdd(b);
  // F = G - C
  var f = g.redSub(c);
  // H = D - B
  var h = d.redSub(b);
  // X3 = E * F
  var nx = e.redMul(f);
  // Y3 = G * H
  var ny = g.redMul(h);
  // T3 = E * H
  var nt = e.redMul(h);
  // Z3 = F * G
  var nz = f.redMul(g);
  return this.curve.point(nx, ny, nz, nt);
};

Point.prototype._projDbl = function _projDbl() {
  // hyperelliptic.org/EFD/g1p/auto-twisted-projective.html
  //     #doubling-dbl-2008-bbjlp
  //     #doubling-dbl-2007-bl
  // and others
  // Generally 3M + 4S or 2M + 4S

  // B = (X1 + Y1)^2
  var b = this.x.redAdd(this.y).redSqr();
  // C = X1^2
  var c = this.x.redSqr();
  // D = Y1^2
  var d = this.y.redSqr();

  var nx;
  var ny;
  var nz;
  if (this.curve.twisted) {
    // E = a * C
    var e = this.curve._mulA(c);
    // F = E + D
    var f = e.redAdd(d);
    if (this.zOne) {
      // X3 = (B - C - D) * (F - 2)
      nx = b.redSub(c).redSub(d).redMul(f.redSub(this.curve.two));
      // Y3 = F * (E - D)
      ny = f.redMul(e.redSub(d));
      // Z3 = F^2 - 2 * F
      nz = f.redSqr().redSub(f).redSub(f);
    } else {
      // H = Z1^2
      var h = this.z.redSqr();
      // J = F - 2 * H
      var j = f.redSub(h).redISub(h);
      // X3 = (B-C-D)*J
      nx = b.redSub(c).redISub(d).redMul(j);
      // Y3 = F * (E - D)
      ny = f.redMul(e.redSub(d));
      // Z3 = F * J
      nz = f.redMul(j);
    }
  } else {
    // E = C + D
    var e = c.redAdd(d);
    // H = (c * Z1)^2
    var h = this.curve._mulC(this.c.redMul(this.z)).redSqr();
    // J = E - 2 * H
    var j = e.redSub(h).redSub(h);
    // X3 = c * (B - E) * J
    nx = this.curve._mulC(b.redISub(e)).redMul(j);
    // Y3 = c * E * (C - D)
    ny = this.curve._mulC(e).redMul(c.redISub(d));
    // Z3 = E * J
    nz = e.redMul(j);
  }
  return this.curve.point(nx, ny, nz);
};

Point.prototype.dbl = function dbl() {
  if (this.isInfinity())
    return this;

  // Double in extended coordinates
  if (this.curve.extended)
    return this._extDbl();
  else
    return this._projDbl();
};

Point.prototype._extAdd = function _extAdd(p) {
  // hyperelliptic.org/EFD/g1p/auto-twisted-extended-1.html
  //     #addition-add-2008-hwcd-3
  // 8M

  // A = (Y1 - X1) * (Y2 - X2)
  var a = this.y.redSub(this.x).redMul(p.y.redSub(p.x));
  // B = (Y1 + X1) * (Y2 + X2)
  var b = this.y.redAdd(this.x).redMul(p.y.redAdd(p.x));
  // C = T1 * k * T2
  var c = this.t.redMul(this.curve.dd).redMul(p.t);
  // D = Z1 * 2 * Z2
  var d = this.z.redMul(p.z.redAdd(p.z));
  // E = B - A
  var e = b.redSub(a);
  // F = D - C
  var f = d.redSub(c);
  // G = D + C
  var g = d.redAdd(c);
  // H = B + A
  var h = b.redAdd(a);
  // X3 = E * F
  var nx = e.redMul(f);
  // Y3 = G * H
  var ny = g.redMul(h);
  // T3 = E * H
  var nt = e.redMul(h);
  // Z3 = F * G
  var nz = f.redMul(g);
  return this.curve.point(nx, ny, nz, nt);
};

Point.prototype._projAdd = function _projAdd(p) {
  // hyperelliptic.org/EFD/g1p/auto-twisted-projective.html
  //     #addition-add-2008-bbjlp
  //     #addition-add-2007-bl
  // 10M + 1S

  // A = Z1 * Z2
  var a = this.z.redMul(p.z);
  // B = A^2
  var b = a.redSqr();
  // C = X1 * X2
  var c = this.x.redMul(p.x);
  // D = Y1 * Y2
  var d = this.y.redMul(p.y);
  // E = d * C * D
  var e = this.curve.d.redMul(c).redMul(d);
  // F = B - E
  var f = b.redSub(e);
  // G = B + E
  var g = b.redAdd(e);
  // X3 = A * F * ((X1 + Y1) * (X2 + Y2) - C - D)
  var tmp = this.x.redAdd(this.y).redMul(p.x.redAdd(p.y)).redISub(c).redISub(d);
  var nx = a.redMul(f).redMul(tmp);
  var ny;
  var nz;
  if (this.curve.twisted) {
    // Y3 = A * G * (D - a * C)
    ny = a.redMul(g).redMul(d.redSub(this.curve._mulA(c)));
    // Z3 = F * G
    nz = f.redMul(g);
  } else {
    // Y3 = A * G * (D - C)
    ny = a.redMul(g).redMul(d.redSub(c));
    // Z3 = c * F * G
    nz = this.curve._mulC(f).redMul(g);
  }
  return this.curve.point(nx, ny, nz);
};

Point.prototype.add = function add(p) {
  if (this.isInfinity())
    return p;
  if (p.isInfinity())
    return this;

  if (this.curve.extended)
    return this._extAdd(p);
  else
    return this._projAdd(p);
};

Point.prototype.mul = function mul(k) {
  if (this._hasDoubles(k))
    return this.curve._fixedNafMul(this, k);
  else
    return this.curve._wnafMul(this, k);
};

Point.prototype.mulAdd = function mulAdd(k1, p, k2) {
  return this.curve._wnafMulAdd(1, [ this, p ], [ k1, k2 ], 2, false);
};

Point.prototype.jmulAdd = function jmulAdd(k1, p, k2) {
  return this.curve._wnafMulAdd(1, [ this, p ], [ k1, k2 ], 2, true);
};

Point.prototype.normalize = function normalize() {
  if (this.zOne)
    return this;

  // Normalize coordinates
  var zi = this.z.redInvm();
  this.x = this.x.redMul(zi);
  this.y = this.y.redMul(zi);
  if (this.t)
    this.t = this.t.redMul(zi);
  this.z = this.curve.one;
  this.zOne = true;
  return this;
};

Point.prototype.neg = function neg() {
  return this.curve.point(this.x.redNeg(),
                          this.y,
                          this.z,
                          this.t && this.t.redNeg());
};

Point.prototype.getX = function getX() {
  this.normalize();
  return this.x.fromRed();
};

Point.prototype.getY = function getY() {
  this.normalize();
  return this.y.fromRed();
};

Point.prototype.eq = function eq(other) {
  return this === other ||
         this.getX().cmp(other.getX()) === 0 &&
         this.getY().cmp(other.getY()) === 0;
};

Point.prototype.eqXToP = function eqXToP(x) {
  var rx = x.toRed(this.curve.red).redMul(this.z);
  if (this.x.cmp(rx) === 0)
    return true;

  var xc = x.clone();
  var t = this.curve.redN.redMul(this.z);
  for (;;) {
    xc.iadd(this.curve.n);
    if (xc.cmp(this.curve.p) >= 0)
      return false;

    rx.redIAdd(t);
    if (this.x.cmp(rx) === 0)
      return true;
  }
  return false;
};

// Compatibility with BaseCurve
Point.prototype.toP = Point.prototype.normalize;
Point.prototype.mixedAdd = Point.prototype.add;


/***/ }),
/* 272 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var curves = exports;

var hash = __webpack_require__(112);
var elliptic = __webpack_require__(17);

var assert = elliptic.utils.assert;

function PresetCurve(options) {
  if (options.type === 'short')
    this.curve = new elliptic.curve.short(options);
  else if (options.type === 'edwards')
    this.curve = new elliptic.curve.edwards(options);
  else
    this.curve = new elliptic.curve.mont(options);
  this.g = this.curve.g;
  this.n = this.curve.n;
  this.hash = options.hash;

  assert(this.g.validate(), 'Invalid curve');
  assert(this.g.mul(this.n).isInfinity(), 'Invalid curve, G*N != O');
}
curves.PresetCurve = PresetCurve;

function defineCurve(name, options) {
  Object.defineProperty(curves, name, {
    configurable: true,
    enumerable: true,
    get: function() {
      var curve = new PresetCurve(options);
      Object.defineProperty(curves, name, {
        configurable: true,
        enumerable: true,
        value: curve
      });
      return curve;
    }
  });
}

defineCurve('p192', {
  type: 'short',
  prime: 'p192',
  p: 'ffffffff ffffffff ffffffff fffffffe ffffffff ffffffff',
  a: 'ffffffff ffffffff ffffffff fffffffe ffffffff fffffffc',
  b: '64210519 e59c80e7 0fa7e9ab 72243049 feb8deec c146b9b1',
  n: 'ffffffff ffffffff ffffffff 99def836 146bc9b1 b4d22831',
  hash: hash.sha256,
  gRed: false,
  g: [
    '188da80e b03090f6 7cbf20eb 43a18800 f4ff0afd 82ff1012',
    '07192b95 ffc8da78 631011ed 6b24cdd5 73f977a1 1e794811'
  ]
});

defineCurve('p224', {
  type: 'short',
  prime: 'p224',
  p: 'ffffffff ffffffff ffffffff ffffffff 00000000 00000000 00000001',
  a: 'ffffffff ffffffff ffffffff fffffffe ffffffff ffffffff fffffffe',
  b: 'b4050a85 0c04b3ab f5413256 5044b0b7 d7bfd8ba 270b3943 2355ffb4',
  n: 'ffffffff ffffffff ffffffff ffff16a2 e0b8f03e 13dd2945 5c5c2a3d',
  hash: hash.sha256,
  gRed: false,
  g: [
    'b70e0cbd 6bb4bf7f 321390b9 4a03c1d3 56c21122 343280d6 115c1d21',
    'bd376388 b5f723fb 4c22dfe6 cd4375a0 5a074764 44d58199 85007e34'
  ]
});

defineCurve('p256', {
  type: 'short',
  prime: null,
  p: 'ffffffff 00000001 00000000 00000000 00000000 ffffffff ffffffff ffffffff',
  a: 'ffffffff 00000001 00000000 00000000 00000000 ffffffff ffffffff fffffffc',
  b: '5ac635d8 aa3a93e7 b3ebbd55 769886bc 651d06b0 cc53b0f6 3bce3c3e 27d2604b',
  n: 'ffffffff 00000000 ffffffff ffffffff bce6faad a7179e84 f3b9cac2 fc632551',
  hash: hash.sha256,
  gRed: false,
  g: [
    '6b17d1f2 e12c4247 f8bce6e5 63a440f2 77037d81 2deb33a0 f4a13945 d898c296',
    '4fe342e2 fe1a7f9b 8ee7eb4a 7c0f9e16 2bce3357 6b315ece cbb64068 37bf51f5'
  ]
});

defineCurve('p384', {
  type: 'short',
  prime: null,
  p: 'ffffffff ffffffff ffffffff ffffffff ffffffff ffffffff ffffffff ' +
     'fffffffe ffffffff 00000000 00000000 ffffffff',
  a: 'ffffffff ffffffff ffffffff ffffffff ffffffff ffffffff ffffffff ' +
     'fffffffe ffffffff 00000000 00000000 fffffffc',
  b: 'b3312fa7 e23ee7e4 988e056b e3f82d19 181d9c6e fe814112 0314088f ' +
     '5013875a c656398d 8a2ed19d 2a85c8ed d3ec2aef',
  n: 'ffffffff ffffffff ffffffff ffffffff ffffffff ffffffff c7634d81 ' +
     'f4372ddf 581a0db2 48b0a77a ecec196a ccc52973',
  hash: hash.sha384,
  gRed: false,
  g: [
    'aa87ca22 be8b0537 8eb1c71e f320ad74 6e1d3b62 8ba79b98 59f741e0 82542a38 ' +
    '5502f25d bf55296c 3a545e38 72760ab7',
    '3617de4a 96262c6f 5d9e98bf 9292dc29 f8f41dbd 289a147c e9da3113 b5f0b8c0 ' +
    '0a60b1ce 1d7e819d 7a431d7c 90ea0e5f'
  ]
});

defineCurve('p521', {
  type: 'short',
  prime: null,
  p: '000001ff ffffffff ffffffff ffffffff ffffffff ffffffff ' +
     'ffffffff ffffffff ffffffff ffffffff ffffffff ffffffff ' +
     'ffffffff ffffffff ffffffff ffffffff ffffffff',
  a: '000001ff ffffffff ffffffff ffffffff ffffffff ffffffff ' +
     'ffffffff ffffffff ffffffff ffffffff ffffffff ffffffff ' +
     'ffffffff ffffffff ffffffff ffffffff fffffffc',
  b: '00000051 953eb961 8e1c9a1f 929a21a0 b68540ee a2da725b ' +
     '99b315f3 b8b48991 8ef109e1 56193951 ec7e937b 1652c0bd ' +
     '3bb1bf07 3573df88 3d2c34f1 ef451fd4 6b503f00',
  n: '000001ff ffffffff ffffffff ffffffff ffffffff ffffffff ' +
     'ffffffff ffffffff fffffffa 51868783 bf2f966b 7fcc0148 ' +
     'f709a5d0 3bb5c9b8 899c47ae bb6fb71e 91386409',
  hash: hash.sha512,
  gRed: false,
  g: [
    '000000c6 858e06b7 0404e9cd 9e3ecb66 2395b442 9c648139 ' +
    '053fb521 f828af60 6b4d3dba a14b5e77 efe75928 fe1dc127 ' +
    'a2ffa8de 3348b3c1 856a429b f97e7e31 c2e5bd66',
    '00000118 39296a78 9a3bc004 5c8a5fb4 2c7d1bd9 98f54449 ' +
    '579b4468 17afbd17 273e662c 97ee7299 5ef42640 c550b901 ' +
    '3fad0761 353c7086 a272c240 88be9476 9fd16650'
  ]
});

defineCurve('curve25519', {
  type: 'mont',
  prime: 'p25519',
  p: '7fffffffffffffff ffffffffffffffff ffffffffffffffff ffffffffffffffed',
  a: '76d06',
  b: '1',
  n: '1000000000000000 0000000000000000 14def9dea2f79cd6 5812631a5cf5d3ed',
  hash: hash.sha256,
  gRed: false,
  g: [
    '9'
  ]
});

defineCurve('ed25519', {
  type: 'edwards',
  prime: 'p25519',
  p: '7fffffffffffffff ffffffffffffffff ffffffffffffffff ffffffffffffffed',
  a: '-1',
  c: '1',
  // -121665 * (121666^(-1)) (mod P)
  d: '52036cee2b6ffe73 8cc740797779e898 00700a4d4141d8ab 75eb4dca135978a3',
  n: '1000000000000000 0000000000000000 14def9dea2f79cd6 5812631a5cf5d3ed',
  hash: hash.sha256,
  gRed: false,
  g: [
    '216936d3cd6e53fec0a4e231fdd6dc5c692cc7609525a7b2c9562d608f25d51a',

    // 4/5
    '6666666666666666666666666666666666666666666666666666666666666658'
  ]
});

var pre;
try {
  pre = __webpack_require__(279);
} catch (e) {
  pre = undefined;
}

defineCurve('secp256k1', {
  type: 'short',
  prime: 'k256',
  p: 'ffffffff ffffffff ffffffff ffffffff ffffffff ffffffff fffffffe fffffc2f',
  a: '0',
  b: '7',
  n: 'ffffffff ffffffff ffffffff fffffffe baaedce6 af48a03b bfd25e8c d0364141',
  h: '1',
  hash: hash.sha256,

  // Precomputed endomorphism
  beta: '7ae96a2b657c07106e64479eac3434e99cf0497512f58995c1396c28719501ee',
  lambda: '5363ad4cc05c30e0a5261c028812645a122e22ea20816678df02967c1b23bd72',
  basis: [
    {
      a: '3086d221a7d46bcde86c90e49284eb15',
      b: '-e4437ed6010e88286f547fa90abfe4c3'
    },
    {
      a: '114ca50f7a8e2f3f657c1108d9d44cfd8',
      b: '3086d221a7d46bcde86c90e49284eb15'
    }
  ],

  gRed: false,
  g: [
    '79be667ef9dcbbac55a06295ce870b07029bfcdb2dce28d959f2815b16f81798',
    '483ada7726a3c4655da4fbfc0e1108a8fd17b448a68554199c47d08ffb10d4b8',
    pre
  ]
});


/***/ }),
/* 273 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


exports.sha1 = __webpack_require__(274);
exports.sha224 = __webpack_require__(275);
exports.sha256 = __webpack_require__(169);
exports.sha384 = __webpack_require__(276);
exports.sha512 = __webpack_require__(170);


/***/ }),
/* 274 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var utils = __webpack_require__(29);
var common = __webpack_require__(70);
var shaCommon = __webpack_require__(168);

var rotl32 = utils.rotl32;
var sum32 = utils.sum32;
var sum32_5 = utils.sum32_5;
var ft_1 = shaCommon.ft_1;
var BlockHash = common.BlockHash;

var sha1_K = [
  0x5A827999, 0x6ED9EBA1,
  0x8F1BBCDC, 0xCA62C1D6
];

function SHA1() {
  if (!(this instanceof SHA1))
    return new SHA1();

  BlockHash.call(this);
  this.h = [
    0x67452301, 0xefcdab89, 0x98badcfe,
    0x10325476, 0xc3d2e1f0 ];
  this.W = new Array(80);
}

utils.inherits(SHA1, BlockHash);
module.exports = SHA1;

SHA1.blockSize = 512;
SHA1.outSize = 160;
SHA1.hmacStrength = 80;
SHA1.padLength = 64;

SHA1.prototype._update = function _update(msg, start) {
  var W = this.W;

  for (var i = 0; i < 16; i++)
    W[i] = msg[start + i];

  for(; i < W.length; i++)
    W[i] = rotl32(W[i - 3] ^ W[i - 8] ^ W[i - 14] ^ W[i - 16], 1);

  var a = this.h[0];
  var b = this.h[1];
  var c = this.h[2];
  var d = this.h[3];
  var e = this.h[4];

  for (i = 0; i < W.length; i++) {
    var s = ~~(i / 20);
    var t = sum32_5(rotl32(a, 5), ft_1(s, b, c, d), e, W[i], sha1_K[s]);
    e = d;
    d = c;
    c = rotl32(b, 30);
    b = a;
    a = t;
  }

  this.h[0] = sum32(this.h[0], a);
  this.h[1] = sum32(this.h[1], b);
  this.h[2] = sum32(this.h[2], c);
  this.h[3] = sum32(this.h[3], d);
  this.h[4] = sum32(this.h[4], e);
};

SHA1.prototype._digest = function digest(enc) {
  if (enc === 'hex')
    return utils.toHex32(this.h, 'big');
  else
    return utils.split32(this.h, 'big');
};


/***/ }),
/* 275 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var utils = __webpack_require__(29);
var SHA256 = __webpack_require__(169);

function SHA224() {
  if (!(this instanceof SHA224))
    return new SHA224();

  SHA256.call(this);
  this.h = [
    0xc1059ed8, 0x367cd507, 0x3070dd17, 0xf70e5939,
    0xffc00b31, 0x68581511, 0x64f98fa7, 0xbefa4fa4 ];
}
utils.inherits(SHA224, SHA256);
module.exports = SHA224;

SHA224.blockSize = 512;
SHA224.outSize = 224;
SHA224.hmacStrength = 192;
SHA224.padLength = 64;

SHA224.prototype._digest = function digest(enc) {
  // Just truncate output
  if (enc === 'hex')
    return utils.toHex32(this.h.slice(0, 7), 'big');
  else
    return utils.split32(this.h.slice(0, 7), 'big');
};



/***/ }),
/* 276 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var utils = __webpack_require__(29);

var SHA512 = __webpack_require__(170);

function SHA384() {
  if (!(this instanceof SHA384))
    return new SHA384();

  SHA512.call(this);
  this.h = [
    0xcbbb9d5d, 0xc1059ed8,
    0x629a292a, 0x367cd507,
    0x9159015a, 0x3070dd17,
    0x152fecd8, 0xf70e5939,
    0x67332667, 0xffc00b31,
    0x8eb44a87, 0x68581511,
    0xdb0c2e0d, 0x64f98fa7,
    0x47b5481d, 0xbefa4fa4 ];
}
utils.inherits(SHA384, SHA512);
module.exports = SHA384;

SHA384.blockSize = 1024;
SHA384.outSize = 384;
SHA384.hmacStrength = 192;
SHA384.padLength = 128;

SHA384.prototype._digest = function digest(enc) {
  if (enc === 'hex')
    return utils.toHex32(this.h.slice(0, 12), 'big');
  else
    return utils.split32(this.h.slice(0, 12), 'big');
};


/***/ }),
/* 277 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var utils = __webpack_require__(29);
var common = __webpack_require__(70);

var rotl32 = utils.rotl32;
var sum32 = utils.sum32;
var sum32_3 = utils.sum32_3;
var sum32_4 = utils.sum32_4;
var BlockHash = common.BlockHash;

function RIPEMD160() {
  if (!(this instanceof RIPEMD160))
    return new RIPEMD160();

  BlockHash.call(this);

  this.h = [ 0x67452301, 0xefcdab89, 0x98badcfe, 0x10325476, 0xc3d2e1f0 ];
  this.endian = 'little';
}
utils.inherits(RIPEMD160, BlockHash);
exports.ripemd160 = RIPEMD160;

RIPEMD160.blockSize = 512;
RIPEMD160.outSize = 160;
RIPEMD160.hmacStrength = 192;
RIPEMD160.padLength = 64;

RIPEMD160.prototype._update = function update(msg, start) {
  var A = this.h[0];
  var B = this.h[1];
  var C = this.h[2];
  var D = this.h[3];
  var E = this.h[4];
  var Ah = A;
  var Bh = B;
  var Ch = C;
  var Dh = D;
  var Eh = E;
  for (var j = 0; j < 80; j++) {
    var T = sum32(
      rotl32(
        sum32_4(A, f(j, B, C, D), msg[r[j] + start], K(j)),
        s[j]),
      E);
    A = E;
    E = D;
    D = rotl32(C, 10);
    C = B;
    B = T;
    T = sum32(
      rotl32(
        sum32_4(Ah, f(79 - j, Bh, Ch, Dh), msg[rh[j] + start], Kh(j)),
        sh[j]),
      Eh);
    Ah = Eh;
    Eh = Dh;
    Dh = rotl32(Ch, 10);
    Ch = Bh;
    Bh = T;
  }
  T = sum32_3(this.h[1], C, Dh);
  this.h[1] = sum32_3(this.h[2], D, Eh);
  this.h[2] = sum32_3(this.h[3], E, Ah);
  this.h[3] = sum32_3(this.h[4], A, Bh);
  this.h[4] = sum32_3(this.h[0], B, Ch);
  this.h[0] = T;
};

RIPEMD160.prototype._digest = function digest(enc) {
  if (enc === 'hex')
    return utils.toHex32(this.h, 'little');
  else
    return utils.split32(this.h, 'little');
};

function f(j, x, y, z) {
  if (j <= 15)
    return x ^ y ^ z;
  else if (j <= 31)
    return (x & y) | ((~x) & z);
  else if (j <= 47)
    return (x | (~y)) ^ z;
  else if (j <= 63)
    return (x & z) | (y & (~z));
  else
    return x ^ (y | (~z));
}

function K(j) {
  if (j <= 15)
    return 0x00000000;
  else if (j <= 31)
    return 0x5a827999;
  else if (j <= 47)
    return 0x6ed9eba1;
  else if (j <= 63)
    return 0x8f1bbcdc;
  else
    return 0xa953fd4e;
}

function Kh(j) {
  if (j <= 15)
    return 0x50a28be6;
  else if (j <= 31)
    return 0x5c4dd124;
  else if (j <= 47)
    return 0x6d703ef3;
  else if (j <= 63)
    return 0x7a6d76e9;
  else
    return 0x00000000;
}

var r = [
  0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15,
  7, 4, 13, 1, 10, 6, 15, 3, 12, 0, 9, 5, 2, 14, 11, 8,
  3, 10, 14, 4, 9, 15, 8, 1, 2, 7, 0, 6, 13, 11, 5, 12,
  1, 9, 11, 10, 0, 8, 12, 4, 13, 3, 7, 15, 14, 5, 6, 2,
  4, 0, 5, 9, 7, 12, 2, 10, 14, 1, 3, 8, 11, 6, 15, 13
];

var rh = [
  5, 14, 7, 0, 9, 2, 11, 4, 13, 6, 15, 8, 1, 10, 3, 12,
  6, 11, 3, 7, 0, 13, 5, 10, 14, 15, 8, 12, 4, 9, 1, 2,
  15, 5, 1, 3, 7, 14, 6, 9, 11, 8, 12, 2, 10, 0, 4, 13,
  8, 6, 4, 1, 3, 11, 15, 0, 5, 12, 2, 13, 9, 7, 10, 14,
  12, 15, 10, 4, 1, 5, 8, 7, 6, 2, 13, 14, 0, 3, 9, 11
];

var s = [
  11, 14, 15, 12, 5, 8, 7, 9, 11, 13, 14, 15, 6, 7, 9, 8,
  7, 6, 8, 13, 11, 9, 7, 15, 7, 12, 15, 9, 11, 7, 13, 12,
  11, 13, 6, 7, 14, 9, 13, 15, 14, 8, 13, 6, 5, 12, 7, 5,
  11, 12, 14, 15, 14, 15, 9, 8, 9, 14, 5, 6, 8, 6, 5, 12,
  9, 15, 5, 11, 6, 8, 13, 12, 5, 12, 13, 14, 11, 8, 5, 6
];

var sh = [
  8, 9, 9, 11, 13, 15, 15, 5, 7, 7, 8, 11, 14, 14, 12, 6,
  9, 13, 15, 7, 12, 8, 9, 11, 7, 7, 12, 7, 6, 15, 13, 11,
  9, 7, 15, 11, 8, 6, 6, 14, 12, 13, 5, 14, 13, 13, 7, 5,
  15, 5, 8, 11, 14, 14, 6, 14, 6, 9, 12, 9, 12, 5, 15, 8,
  8, 5, 12, 9, 12, 5, 14, 6, 8, 13, 6, 5, 15, 13, 11, 11
];


/***/ }),
/* 278 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var utils = __webpack_require__(29);
var assert = __webpack_require__(22);

function Hmac(hash, key, enc) {
  if (!(this instanceof Hmac))
    return new Hmac(hash, key, enc);
  this.Hash = hash;
  this.blockSize = hash.blockSize / 8;
  this.outSize = hash.outSize / 8;
  this.inner = null;
  this.outer = null;

  this._init(utils.toArray(key, enc));
}
module.exports = Hmac;

Hmac.prototype._init = function init(key) {
  // Shorten key, if needed
  if (key.length > this.blockSize)
    key = new this.Hash().update(key).digest();
  assert(key.length <= this.blockSize);

  // Add padding to key
  for (var i = key.length; i < this.blockSize; i++)
    key.push(0);

  for (i = 0; i < key.length; i++)
    key[i] ^= 0x36;
  this.inner = new this.Hash().update(key);

  // 0x36 ^ 0x5c = 0x6a
  for (i = 0; i < key.length; i++)
    key[i] ^= 0x6a;
  this.outer = new this.Hash().update(key);
};

Hmac.prototype.update = function update(msg, enc) {
  this.inner.update(msg, enc);
  return this;
};

Hmac.prototype.digest = function digest(enc) {
  this.outer.update(this.inner.digest());
  return this.outer.digest(enc);
};


/***/ }),
/* 279 */
/***/ (function(module, exports) {

module.exports = {
  doubles: {
    step: 4,
    points: [
      [
        'e60fce93b59e9ec53011aabc21c23e97b2a31369b87a5ae9c44ee89e2a6dec0a',
        'f7e3507399e595929db99f34f57937101296891e44d23f0be1f32cce69616821'
      ],
      [
        '8282263212c609d9ea2a6e3e172de238d8c39cabd5ac1ca10646e23fd5f51508',
        '11f8a8098557dfe45e8256e830b60ace62d613ac2f7b17bed31b6eaff6e26caf'
      ],
      [
        '175e159f728b865a72f99cc6c6fc846de0b93833fd2222ed73fce5b551e5b739',
        'd3506e0d9e3c79eba4ef97a51ff71f5eacb5955add24345c6efa6ffee9fed695'
      ],
      [
        '363d90d447b00c9c99ceac05b6262ee053441c7e55552ffe526bad8f83ff4640',
        '4e273adfc732221953b445397f3363145b9a89008199ecb62003c7f3bee9de9'
      ],
      [
        '8b4b5f165df3c2be8c6244b5b745638843e4a781a15bcd1b69f79a55dffdf80c',
        '4aad0a6f68d308b4b3fbd7813ab0da04f9e336546162ee56b3eff0c65fd4fd36'
      ],
      [
        '723cbaa6e5db996d6bf771c00bd548c7b700dbffa6c0e77bcb6115925232fcda',
        '96e867b5595cc498a921137488824d6e2660a0653779494801dc069d9eb39f5f'
      ],
      [
        'eebfa4d493bebf98ba5feec812c2d3b50947961237a919839a533eca0e7dd7fa',
        '5d9a8ca3970ef0f269ee7edaf178089d9ae4cdc3a711f712ddfd4fdae1de8999'
      ],
      [
        '100f44da696e71672791d0a09b7bde459f1215a29b3c03bfefd7835b39a48db0',
        'cdd9e13192a00b772ec8f3300c090666b7ff4a18ff5195ac0fbd5cd62bc65a09'
      ],
      [
        'e1031be262c7ed1b1dc9227a4a04c017a77f8d4464f3b3852c8acde6e534fd2d',
        '9d7061928940405e6bb6a4176597535af292dd419e1ced79a44f18f29456a00d'
      ],
      [
        'feea6cae46d55b530ac2839f143bd7ec5cf8b266a41d6af52d5e688d9094696d',
        'e57c6b6c97dce1bab06e4e12bf3ecd5c981c8957cc41442d3155debf18090088'
      ],
      [
        'da67a91d91049cdcb367be4be6ffca3cfeed657d808583de33fa978bc1ec6cb1',
        '9bacaa35481642bc41f463f7ec9780e5dec7adc508f740a17e9ea8e27a68be1d'
      ],
      [
        '53904faa0b334cdda6e000935ef22151ec08d0f7bb11069f57545ccc1a37b7c0',
        '5bc087d0bc80106d88c9eccac20d3c1c13999981e14434699dcb096b022771c8'
      ],
      [
        '8e7bcd0bd35983a7719cca7764ca906779b53a043a9b8bcaeff959f43ad86047',
        '10b7770b2a3da4b3940310420ca9514579e88e2e47fd68b3ea10047e8460372a'
      ],
      [
        '385eed34c1cdff21e6d0818689b81bde71a7f4f18397e6690a841e1599c43862',
        '283bebc3e8ea23f56701de19e9ebf4576b304eec2086dc8cc0458fe5542e5453'
      ],
      [
        '6f9d9b803ecf191637c73a4413dfa180fddf84a5947fbc9c606ed86c3fac3a7',
        '7c80c68e603059ba69b8e2a30e45c4d47ea4dd2f5c281002d86890603a842160'
      ],
      [
        '3322d401243c4e2582a2147c104d6ecbf774d163db0f5e5313b7e0e742d0e6bd',
        '56e70797e9664ef5bfb019bc4ddaf9b72805f63ea2873af624f3a2e96c28b2a0'
      ],
      [
        '85672c7d2de0b7da2bd1770d89665868741b3f9af7643397721d74d28134ab83',
        '7c481b9b5b43b2eb6374049bfa62c2e5e77f17fcc5298f44c8e3094f790313a6'
      ],
      [
        '948bf809b1988a46b06c9f1919413b10f9226c60f668832ffd959af60c82a0a',
        '53a562856dcb6646dc6b74c5d1c3418c6d4dff08c97cd2bed4cb7f88d8c8e589'
      ],
      [
        '6260ce7f461801c34f067ce0f02873a8f1b0e44dfc69752accecd819f38fd8e8',
        'bc2da82b6fa5b571a7f09049776a1ef7ecd292238051c198c1a84e95b2b4ae17'
      ],
      [
        'e5037de0afc1d8d43d8348414bbf4103043ec8f575bfdc432953cc8d2037fa2d',
        '4571534baa94d3b5f9f98d09fb990bddbd5f5b03ec481f10e0e5dc841d755bda'
      ],
      [
        'e06372b0f4a207adf5ea905e8f1771b4e7e8dbd1c6a6c5b725866a0ae4fce725',
        '7a908974bce18cfe12a27bb2ad5a488cd7484a7787104870b27034f94eee31dd'
      ],
      [
        '213c7a715cd5d45358d0bbf9dc0ce02204b10bdde2a3f58540ad6908d0559754',
        '4b6dad0b5ae462507013ad06245ba190bb4850f5f36a7eeddff2c27534b458f2'
      ],
      [
        '4e7c272a7af4b34e8dbb9352a5419a87e2838c70adc62cddf0cc3a3b08fbd53c',
        '17749c766c9d0b18e16fd09f6def681b530b9614bff7dd33e0b3941817dcaae6'
      ],
      [
        'fea74e3dbe778b1b10f238ad61686aa5c76e3db2be43057632427e2840fb27b6',
        '6e0568db9b0b13297cf674deccb6af93126b596b973f7b77701d3db7f23cb96f'
      ],
      [
        '76e64113f677cf0e10a2570d599968d31544e179b760432952c02a4417bdde39',
        'c90ddf8dee4e95cf577066d70681f0d35e2a33d2b56d2032b4b1752d1901ac01'
      ],
      [
        'c738c56b03b2abe1e8281baa743f8f9a8f7cc643df26cbee3ab150242bcbb891',
        '893fb578951ad2537f718f2eacbfbbbb82314eef7880cfe917e735d9699a84c3'
      ],
      [
        'd895626548b65b81e264c7637c972877d1d72e5f3a925014372e9f6588f6c14b',
        'febfaa38f2bc7eae728ec60818c340eb03428d632bb067e179363ed75d7d991f'
      ],
      [
        'b8da94032a957518eb0f6433571e8761ceffc73693e84edd49150a564f676e03',
        '2804dfa44805a1e4d7c99cc9762808b092cc584d95ff3b511488e4e74efdf6e7'
      ],
      [
        'e80fea14441fb33a7d8adab9475d7fab2019effb5156a792f1a11778e3c0df5d',
        'eed1de7f638e00771e89768ca3ca94472d155e80af322ea9fcb4291b6ac9ec78'
      ],
      [
        'a301697bdfcd704313ba48e51d567543f2a182031efd6915ddc07bbcc4e16070',
        '7370f91cfb67e4f5081809fa25d40f9b1735dbf7c0a11a130c0d1a041e177ea1'
      ],
      [
        '90ad85b389d6b936463f9d0512678de208cc330b11307fffab7ac63e3fb04ed4',
        'e507a3620a38261affdcbd9427222b839aefabe1582894d991d4d48cb6ef150'
      ],
      [
        '8f68b9d2f63b5f339239c1ad981f162ee88c5678723ea3351b7b444c9ec4c0da',
        '662a9f2dba063986de1d90c2b6be215dbbea2cfe95510bfdf23cbf79501fff82'
      ],
      [
        'e4f3fb0176af85d65ff99ff9198c36091f48e86503681e3e6686fd5053231e11',
        '1e63633ad0ef4f1c1661a6d0ea02b7286cc7e74ec951d1c9822c38576feb73bc'
      ],
      [
        '8c00fa9b18ebf331eb961537a45a4266c7034f2f0d4e1d0716fb6eae20eae29e',
        'efa47267fea521a1a9dc343a3736c974c2fadafa81e36c54e7d2a4c66702414b'
      ],
      [
        'e7a26ce69dd4829f3e10cec0a9e98ed3143d084f308b92c0997fddfc60cb3e41',
        '2a758e300fa7984b471b006a1aafbb18d0a6b2c0420e83e20e8a9421cf2cfd51'
      ],
      [
        'b6459e0ee3662ec8d23540c223bcbdc571cbcb967d79424f3cf29eb3de6b80ef',
        '67c876d06f3e06de1dadf16e5661db3c4b3ae6d48e35b2ff30bf0b61a71ba45'
      ],
      [
        'd68a80c8280bb840793234aa118f06231d6f1fc67e73c5a5deda0f5b496943e8',
        'db8ba9fff4b586d00c4b1f9177b0e28b5b0e7b8f7845295a294c84266b133120'
      ],
      [
        '324aed7df65c804252dc0270907a30b09612aeb973449cea4095980fc28d3d5d',
        '648a365774b61f2ff130c0c35aec1f4f19213b0c7e332843967224af96ab7c84'
      ],
      [
        '4df9c14919cde61f6d51dfdbe5fee5dceec4143ba8d1ca888e8bd373fd054c96',
        '35ec51092d8728050974c23a1d85d4b5d506cdc288490192ebac06cad10d5d'
      ],
      [
        '9c3919a84a474870faed8a9c1cc66021523489054d7f0308cbfc99c8ac1f98cd',
        'ddb84f0f4a4ddd57584f044bf260e641905326f76c64c8e6be7e5e03d4fc599d'
      ],
      [
        '6057170b1dd12fdf8de05f281d8e06bb91e1493a8b91d4cc5a21382120a959e5',
        '9a1af0b26a6a4807add9a2daf71df262465152bc3ee24c65e899be932385a2a8'
      ],
      [
        'a576df8e23a08411421439a4518da31880cef0fba7d4df12b1a6973eecb94266',
        '40a6bf20e76640b2c92b97afe58cd82c432e10a7f514d9f3ee8be11ae1b28ec8'
      ],
      [
        '7778a78c28dec3e30a05fe9629de8c38bb30d1f5cf9a3a208f763889be58ad71',
        '34626d9ab5a5b22ff7098e12f2ff580087b38411ff24ac563b513fc1fd9f43ac'
      ],
      [
        '928955ee637a84463729fd30e7afd2ed5f96274e5ad7e5cb09eda9c06d903ac',
        'c25621003d3f42a827b78a13093a95eeac3d26efa8a8d83fc5180e935bcd091f'
      ],
      [
        '85d0fef3ec6db109399064f3a0e3b2855645b4a907ad354527aae75163d82751',
        '1f03648413a38c0be29d496e582cf5663e8751e96877331582c237a24eb1f962'
      ],
      [
        'ff2b0dce97eece97c1c9b6041798b85dfdfb6d8882da20308f5404824526087e',
        '493d13fef524ba188af4c4dc54d07936c7b7ed6fb90e2ceb2c951e01f0c29907'
      ],
      [
        '827fbbe4b1e880ea9ed2b2e6301b212b57f1ee148cd6dd28780e5e2cf856e241',
        'c60f9c923c727b0b71bef2c67d1d12687ff7a63186903166d605b68baec293ec'
      ],
      [
        'eaa649f21f51bdbae7be4ae34ce6e5217a58fdce7f47f9aa7f3b58fa2120e2b3',
        'be3279ed5bbbb03ac69a80f89879aa5a01a6b965f13f7e59d47a5305ba5ad93d'
      ],
      [
        'e4a42d43c5cf169d9391df6decf42ee541b6d8f0c9a137401e23632dda34d24f',
        '4d9f92e716d1c73526fc99ccfb8ad34ce886eedfa8d8e4f13a7f7131deba9414'
      ],
      [
        '1ec80fef360cbdd954160fadab352b6b92b53576a88fea4947173b9d4300bf19',
        'aeefe93756b5340d2f3a4958a7abbf5e0146e77f6295a07b671cdc1cc107cefd'
      ],
      [
        '146a778c04670c2f91b00af4680dfa8bce3490717d58ba889ddb5928366642be',
        'b318e0ec3354028add669827f9d4b2870aaa971d2f7e5ed1d0b297483d83efd0'
      ],
      [
        'fa50c0f61d22e5f07e3acebb1aa07b128d0012209a28b9776d76a8793180eef9',
        '6b84c6922397eba9b72cd2872281a68a5e683293a57a213b38cd8d7d3f4f2811'
      ],
      [
        'da1d61d0ca721a11b1a5bf6b7d88e8421a288ab5d5bba5220e53d32b5f067ec2',
        '8157f55a7c99306c79c0766161c91e2966a73899d279b48a655fba0f1ad836f1'
      ],
      [
        'a8e282ff0c9706907215ff98e8fd416615311de0446f1e062a73b0610d064e13',
        '7f97355b8db81c09abfb7f3c5b2515888b679a3e50dd6bd6cef7c73111f4cc0c'
      ],
      [
        '174a53b9c9a285872d39e56e6913cab15d59b1fa512508c022f382de8319497c',
        'ccc9dc37abfc9c1657b4155f2c47f9e6646b3a1d8cb9854383da13ac079afa73'
      ],
      [
        '959396981943785c3d3e57edf5018cdbe039e730e4918b3d884fdff09475b7ba',
        '2e7e552888c331dd8ba0386a4b9cd6849c653f64c8709385e9b8abf87524f2fd'
      ],
      [
        'd2a63a50ae401e56d645a1153b109a8fcca0a43d561fba2dbb51340c9d82b151',
        'e82d86fb6443fcb7565aee58b2948220a70f750af484ca52d4142174dcf89405'
      ],
      [
        '64587e2335471eb890ee7896d7cfdc866bacbdbd3839317b3436f9b45617e073',
        'd99fcdd5bf6902e2ae96dd6447c299a185b90a39133aeab358299e5e9faf6589'
      ],
      [
        '8481bde0e4e4d885b3a546d3e549de042f0aa6cea250e7fd358d6c86dd45e458',
        '38ee7b8cba5404dd84a25bf39cecb2ca900a79c42b262e556d64b1b59779057e'
      ],
      [
        '13464a57a78102aa62b6979ae817f4637ffcfed3c4b1ce30bcd6303f6caf666b',
        '69be159004614580ef7e433453ccb0ca48f300a81d0942e13f495a907f6ecc27'
      ],
      [
        'bc4a9df5b713fe2e9aef430bcc1dc97a0cd9ccede2f28588cada3a0d2d83f366',
        'd3a81ca6e785c06383937adf4b798caa6e8a9fbfa547b16d758d666581f33c1'
      ],
      [
        '8c28a97bf8298bc0d23d8c749452a32e694b65e30a9472a3954ab30fe5324caa',
        '40a30463a3305193378fedf31f7cc0eb7ae784f0451cb9459e71dc73cbef9482'
      ],
      [
        '8ea9666139527a8c1dd94ce4f071fd23c8b350c5a4bb33748c4ba111faccae0',
        '620efabbc8ee2782e24e7c0cfb95c5d735b783be9cf0f8e955af34a30e62b945'
      ],
      [
        'dd3625faef5ba06074669716bbd3788d89bdde815959968092f76cc4eb9a9787',
        '7a188fa3520e30d461da2501045731ca941461982883395937f68d00c644a573'
      ],
      [
        'f710d79d9eb962297e4f6232b40e8f7feb2bc63814614d692c12de752408221e',
        'ea98e67232d3b3295d3b535532115ccac8612c721851617526ae47a9c77bfc82'
      ]
    ]
  },
  naf: {
    wnd: 7,
    points: [
      [
        'f9308a019258c31049344f85f89d5229b531c845836f99b08601f113bce036f9',
        '388f7b0f632de8140fe337e62a37f3566500a99934c2231b6cb9fd7584b8e672'
      ],
      [
        '2f8bde4d1a07209355b4a7250a5c5128e88b84bddc619ab7cba8d569b240efe4',
        'd8ac222636e5e3d6d4dba9dda6c9c426f788271bab0d6840dca87d3aa6ac62d6'
      ],
      [
        '5cbdf0646e5db4eaa398f365f2ea7a0e3d419b7e0330e39ce92bddedcac4f9bc',
        '6aebca40ba255960a3178d6d861a54dba813d0b813fde7b5a5082628087264da'
      ],
      [
        'acd484e2f0c7f65309ad178a9f559abde09796974c57e714c35f110dfc27ccbe',
        'cc338921b0a7d9fd64380971763b61e9add888a4375f8e0f05cc262ac64f9c37'
      ],
      [
        '774ae7f858a9411e5ef4246b70c65aac5649980be5c17891bbec17895da008cb',
        'd984a032eb6b5e190243dd56d7b7b365372db1e2dff9d6a8301d74c9c953c61b'
      ],
      [
        'f28773c2d975288bc7d1d205c3748651b075fbc6610e58cddeeddf8f19405aa8',
        'ab0902e8d880a89758212eb65cdaf473a1a06da521fa91f29b5cb52db03ed81'
      ],
      [
        'd7924d4f7d43ea965a465ae3095ff41131e5946f3c85f79e44adbcf8e27e080e',
        '581e2872a86c72a683842ec228cc6defea40af2bd896d3a5c504dc9ff6a26b58'
      ],
      [
        'defdea4cdb677750a420fee807eacf21eb9898ae79b9768766e4faa04a2d4a34',
        '4211ab0694635168e997b0ead2a93daeced1f4a04a95c0f6cfb199f69e56eb77'
      ],
      [
        '2b4ea0a797a443d293ef5cff444f4979f06acfebd7e86d277475656138385b6c',
        '85e89bc037945d93b343083b5a1c86131a01f60c50269763b570c854e5c09b7a'
      ],
      [
        '352bbf4a4cdd12564f93fa332ce333301d9ad40271f8107181340aef25be59d5',
        '321eb4075348f534d59c18259dda3e1f4a1b3b2e71b1039c67bd3d8bcf81998c'
      ],
      [
        '2fa2104d6b38d11b0230010559879124e42ab8dfeff5ff29dc9cdadd4ecacc3f',
        '2de1068295dd865b64569335bd5dd80181d70ecfc882648423ba76b532b7d67'
      ],
      [
        '9248279b09b4d68dab21a9b066edda83263c3d84e09572e269ca0cd7f5453714',
        '73016f7bf234aade5d1aa71bdea2b1ff3fc0de2a887912ffe54a32ce97cb3402'
      ],
      [
        'daed4f2be3a8bf278e70132fb0beb7522f570e144bf615c07e996d443dee8729',
        'a69dce4a7d6c98e8d4a1aca87ef8d7003f83c230f3afa726ab40e52290be1c55'
      ],
      [
        'c44d12c7065d812e8acf28d7cbb19f9011ecd9e9fdf281b0e6a3b5e87d22e7db',
        '2119a460ce326cdc76c45926c982fdac0e106e861edf61c5a039063f0e0e6482'
      ],
      [
        '6a245bf6dc698504c89a20cfded60853152b695336c28063b61c65cbd269e6b4',
        'e022cf42c2bd4a708b3f5126f16a24ad8b33ba48d0423b6efd5e6348100d8a82'
      ],
      [
        '1697ffa6fd9de627c077e3d2fe541084ce13300b0bec1146f95ae57f0d0bd6a5',
        'b9c398f186806f5d27561506e4557433a2cf15009e498ae7adee9d63d01b2396'
      ],
      [
        '605bdb019981718b986d0f07e834cb0d9deb8360ffb7f61df982345ef27a7479',
        '2972d2de4f8d20681a78d93ec96fe23c26bfae84fb14db43b01e1e9056b8c49'
      ],
      [
        '62d14dab4150bf497402fdc45a215e10dcb01c354959b10cfe31c7e9d87ff33d',
        '80fc06bd8cc5b01098088a1950eed0db01aa132967ab472235f5642483b25eaf'
      ],
      [
        '80c60ad0040f27dade5b4b06c408e56b2c50e9f56b9b8b425e555c2f86308b6f',
        '1c38303f1cc5c30f26e66bad7fe72f70a65eed4cbe7024eb1aa01f56430bd57a'
      ],
      [
        '7a9375ad6167ad54aa74c6348cc54d344cc5dc9487d847049d5eabb0fa03c8fb',
        'd0e3fa9eca8726909559e0d79269046bdc59ea10c70ce2b02d499ec224dc7f7'
      ],
      [
        'd528ecd9b696b54c907a9ed045447a79bb408ec39b68df504bb51f459bc3ffc9',
        'eecf41253136e5f99966f21881fd656ebc4345405c520dbc063465b521409933'
      ],
      [
        '49370a4b5f43412ea25f514e8ecdad05266115e4a7ecb1387231808f8b45963',
        '758f3f41afd6ed428b3081b0512fd62a54c3f3afbb5b6764b653052a12949c9a'
      ],
      [
        '77f230936ee88cbbd73df930d64702ef881d811e0e1498e2f1c13eb1fc345d74',
        '958ef42a7886b6400a08266e9ba1b37896c95330d97077cbbe8eb3c7671c60d6'
      ],
      [
        'f2dac991cc4ce4b9ea44887e5c7c0bce58c80074ab9d4dbaeb28531b7739f530',
        'e0dedc9b3b2f8dad4da1f32dec2531df9eb5fbeb0598e4fd1a117dba703a3c37'
      ],
      [
        '463b3d9f662621fb1b4be8fbbe2520125a216cdfc9dae3debcba4850c690d45b',
        '5ed430d78c296c3543114306dd8622d7c622e27c970a1de31cb377b01af7307e'
      ],
      [
        'f16f804244e46e2a09232d4aff3b59976b98fac14328a2d1a32496b49998f247',
        'cedabd9b82203f7e13d206fcdf4e33d92a6c53c26e5cce26d6579962c4e31df6'
      ],
      [
        'caf754272dc84563b0352b7a14311af55d245315ace27c65369e15f7151d41d1',
        'cb474660ef35f5f2a41b643fa5e460575f4fa9b7962232a5c32f908318a04476'
      ],
      [
        '2600ca4b282cb986f85d0f1709979d8b44a09c07cb86d7c124497bc86f082120',
        '4119b88753c15bd6a693b03fcddbb45d5ac6be74ab5f0ef44b0be9475a7e4b40'
      ],
      [
        '7635ca72d7e8432c338ec53cd12220bc01c48685e24f7dc8c602a7746998e435',
        '91b649609489d613d1d5e590f78e6d74ecfc061d57048bad9e76f302c5b9c61'
      ],
      [
        '754e3239f325570cdbbf4a87deee8a66b7f2b33479d468fbc1a50743bf56cc18',
        '673fb86e5bda30fb3cd0ed304ea49a023ee33d0197a695d0c5d98093c536683'
      ],
      [
        'e3e6bd1071a1e96aff57859c82d570f0330800661d1c952f9fe2694691d9b9e8',
        '59c9e0bba394e76f40c0aa58379a3cb6a5a2283993e90c4167002af4920e37f5'
      ],
      [
        '186b483d056a033826ae73d88f732985c4ccb1f32ba35f4b4cc47fdcf04aa6eb',
        '3b952d32c67cf77e2e17446e204180ab21fb8090895138b4a4a797f86e80888b'
      ],
      [
        'df9d70a6b9876ce544c98561f4be4f725442e6d2b737d9c91a8321724ce0963f',
        '55eb2dafd84d6ccd5f862b785dc39d4ab157222720ef9da217b8c45cf2ba2417'
      ],
      [
        '5edd5cc23c51e87a497ca815d5dce0f8ab52554f849ed8995de64c5f34ce7143',
        'efae9c8dbc14130661e8cec030c89ad0c13c66c0d17a2905cdc706ab7399a868'
      ],
      [
        '290798c2b6476830da12fe02287e9e777aa3fba1c355b17a722d362f84614fba',
        'e38da76dcd440621988d00bcf79af25d5b29c094db2a23146d003afd41943e7a'
      ],
      [
        'af3c423a95d9f5b3054754efa150ac39cd29552fe360257362dfdecef4053b45',
        'f98a3fd831eb2b749a93b0e6f35cfb40c8cd5aa667a15581bc2feded498fd9c6'
      ],
      [
        '766dbb24d134e745cccaa28c99bf274906bb66b26dcf98df8d2fed50d884249a',
        '744b1152eacbe5e38dcc887980da38b897584a65fa06cedd2c924f97cbac5996'
      ],
      [
        '59dbf46f8c94759ba21277c33784f41645f7b44f6c596a58ce92e666191abe3e',
        'c534ad44175fbc300f4ea6ce648309a042ce739a7919798cd85e216c4a307f6e'
      ],
      [
        'f13ada95103c4537305e691e74e9a4a8dd647e711a95e73cb62dc6018cfd87b8',
        'e13817b44ee14de663bf4bc808341f326949e21a6a75c2570778419bdaf5733d'
      ],
      [
        '7754b4fa0e8aced06d4167a2c59cca4cda1869c06ebadfb6488550015a88522c',
        '30e93e864e669d82224b967c3020b8fa8d1e4e350b6cbcc537a48b57841163a2'
      ],
      [
        '948dcadf5990e048aa3874d46abef9d701858f95de8041d2a6828c99e2262519',
        'e491a42537f6e597d5d28a3224b1bc25df9154efbd2ef1d2cbba2cae5347d57e'
      ],
      [
        '7962414450c76c1689c7b48f8202ec37fb224cf5ac0bfa1570328a8a3d7c77ab',
        '100b610ec4ffb4760d5c1fc133ef6f6b12507a051f04ac5760afa5b29db83437'
      ],
      [
        '3514087834964b54b15b160644d915485a16977225b8847bb0dd085137ec47ca',
        'ef0afbb2056205448e1652c48e8127fc6039e77c15c2378b7e7d15a0de293311'
      ],
      [
        'd3cc30ad6b483e4bc79ce2c9dd8bc54993e947eb8df787b442943d3f7b527eaf',
        '8b378a22d827278d89c5e9be8f9508ae3c2ad46290358630afb34db04eede0a4'
      ],
      [
        '1624d84780732860ce1c78fcbfefe08b2b29823db913f6493975ba0ff4847610',
        '68651cf9b6da903e0914448c6cd9d4ca896878f5282be4c8cc06e2a404078575'
      ],
      [
        '733ce80da955a8a26902c95633e62a985192474b5af207da6df7b4fd5fc61cd4',
        'f5435a2bd2badf7d485a4d8b8db9fcce3e1ef8e0201e4578c54673bc1dc5ea1d'
      ],
      [
        '15d9441254945064cf1a1c33bbd3b49f8966c5092171e699ef258dfab81c045c',
        'd56eb30b69463e7234f5137b73b84177434800bacebfc685fc37bbe9efe4070d'
      ],
      [
        'a1d0fcf2ec9de675b612136e5ce70d271c21417c9d2b8aaaac138599d0717940',
        'edd77f50bcb5a3cab2e90737309667f2641462a54070f3d519212d39c197a629'
      ],
      [
        'e22fbe15c0af8ccc5780c0735f84dbe9a790badee8245c06c7ca37331cb36980',
        'a855babad5cd60c88b430a69f53a1a7a38289154964799be43d06d77d31da06'
      ],
      [
        '311091dd9860e8e20ee13473c1155f5f69635e394704eaa74009452246cfa9b3',
        '66db656f87d1f04fffd1f04788c06830871ec5a64feee685bd80f0b1286d8374'
      ],
      [
        '34c1fd04d301be89b31c0442d3e6ac24883928b45a9340781867d4232ec2dbdf',
        '9414685e97b1b5954bd46f730174136d57f1ceeb487443dc5321857ba73abee'
      ],
      [
        'f219ea5d6b54701c1c14de5b557eb42a8d13f3abbcd08affcc2a5e6b049b8d63',
        '4cb95957e83d40b0f73af4544cccf6b1f4b08d3c07b27fb8d8c2962a400766d1'
      ],
      [
        'd7b8740f74a8fbaab1f683db8f45de26543a5490bca627087236912469a0b448',
        'fa77968128d9c92ee1010f337ad4717eff15db5ed3c049b3411e0315eaa4593b'
      ],
      [
        '32d31c222f8f6f0ef86f7c98d3a3335ead5bcd32abdd94289fe4d3091aa824bf',
        '5f3032f5892156e39ccd3d7915b9e1da2e6dac9e6f26e961118d14b8462e1661'
      ],
      [
        '7461f371914ab32671045a155d9831ea8793d77cd59592c4340f86cbc18347b5',
        '8ec0ba238b96bec0cbdddcae0aa442542eee1ff50c986ea6b39847b3cc092ff6'
      ],
      [
        'ee079adb1df1860074356a25aa38206a6d716b2c3e67453d287698bad7b2b2d6',
        '8dc2412aafe3be5c4c5f37e0ecc5f9f6a446989af04c4e25ebaac479ec1c8c1e'
      ],
      [
        '16ec93e447ec83f0467b18302ee620f7e65de331874c9dc72bfd8616ba9da6b5',
        '5e4631150e62fb40d0e8c2a7ca5804a39d58186a50e497139626778e25b0674d'
      ],
      [
        'eaa5f980c245f6f038978290afa70b6bd8855897f98b6aa485b96065d537bd99',
        'f65f5d3e292c2e0819a528391c994624d784869d7e6ea67fb18041024edc07dc'
      ],
      [
        '78c9407544ac132692ee1910a02439958ae04877151342ea96c4b6b35a49f51',
        'f3e0319169eb9b85d5404795539a5e68fa1fbd583c064d2462b675f194a3ddb4'
      ],
      [
        '494f4be219a1a77016dcd838431aea0001cdc8ae7a6fc688726578d9702857a5',
        '42242a969283a5f339ba7f075e36ba2af925ce30d767ed6e55f4b031880d562c'
      ],
      [
        'a598a8030da6d86c6bc7f2f5144ea549d28211ea58faa70ebf4c1e665c1fe9b5',
        '204b5d6f84822c307e4b4a7140737aec23fc63b65b35f86a10026dbd2d864e6b'
      ],
      [
        'c41916365abb2b5d09192f5f2dbeafec208f020f12570a184dbadc3e58595997',
        '4f14351d0087efa49d245b328984989d5caf9450f34bfc0ed16e96b58fa9913'
      ],
      [
        '841d6063a586fa475a724604da03bc5b92a2e0d2e0a36acfe4c73a5514742881',
        '73867f59c0659e81904f9a1c7543698e62562d6744c169ce7a36de01a8d6154'
      ],
      [
        '5e95bb399a6971d376026947f89bde2f282b33810928be4ded112ac4d70e20d5',
        '39f23f366809085beebfc71181313775a99c9aed7d8ba38b161384c746012865'
      ],
      [
        '36e4641a53948fd476c39f8a99fd974e5ec07564b5315d8bf99471bca0ef2f66',
        'd2424b1b1abe4eb8164227b085c9aa9456ea13493fd563e06fd51cf5694c78fc'
      ],
      [
        '336581ea7bfbbb290c191a2f507a41cf5643842170e914faeab27c2c579f726',
        'ead12168595fe1be99252129b6e56b3391f7ab1410cd1e0ef3dcdcabd2fda224'
      ],
      [
        '8ab89816dadfd6b6a1f2634fcf00ec8403781025ed6890c4849742706bd43ede',
        '6fdcef09f2f6d0a044e654aef624136f503d459c3e89845858a47a9129cdd24e'
      ],
      [
        '1e33f1a746c9c5778133344d9299fcaa20b0938e8acff2544bb40284b8c5fb94',
        '60660257dd11b3aa9c8ed618d24edff2306d320f1d03010e33a7d2057f3b3b6'
      ],
      [
        '85b7c1dcb3cec1b7ee7f30ded79dd20a0ed1f4cc18cbcfcfa410361fd8f08f31',
        '3d98a9cdd026dd43f39048f25a8847f4fcafad1895d7a633c6fed3c35e999511'
      ],
      [
        '29df9fbd8d9e46509275f4b125d6d45d7fbe9a3b878a7af872a2800661ac5f51',
        'b4c4fe99c775a606e2d8862179139ffda61dc861c019e55cd2876eb2a27d84b'
      ],
      [
        'a0b1cae06b0a847a3fea6e671aaf8adfdfe58ca2f768105c8082b2e449fce252',
        'ae434102edde0958ec4b19d917a6a28e6b72da1834aff0e650f049503a296cf2'
      ],
      [
        '4e8ceafb9b3e9a136dc7ff67e840295b499dfb3b2133e4ba113f2e4c0e121e5',
        'cf2174118c8b6d7a4b48f6d534ce5c79422c086a63460502b827ce62a326683c'
      ],
      [
        'd24a44e047e19b6f5afb81c7ca2f69080a5076689a010919f42725c2b789a33b',
        '6fb8d5591b466f8fc63db50f1c0f1c69013f996887b8244d2cdec417afea8fa3'
      ],
      [
        'ea01606a7a6c9cdd249fdfcfacb99584001edd28abbab77b5104e98e8e3b35d4',
        '322af4908c7312b0cfbfe369f7a7b3cdb7d4494bc2823700cfd652188a3ea98d'
      ],
      [
        'af8addbf2b661c8a6c6328655eb96651252007d8c5ea31be4ad196de8ce2131f',
        '6749e67c029b85f52a034eafd096836b2520818680e26ac8f3dfbcdb71749700'
      ],
      [
        'e3ae1974566ca06cc516d47e0fb165a674a3dabcfca15e722f0e3450f45889',
        '2aeabe7e4531510116217f07bf4d07300de97e4874f81f533420a72eeb0bd6a4'
      ],
      [
        '591ee355313d99721cf6993ffed1e3e301993ff3ed258802075ea8ced397e246',
        'b0ea558a113c30bea60fc4775460c7901ff0b053d25ca2bdeee98f1a4be5d196'
      ],
      [
        '11396d55fda54c49f19aa97318d8da61fa8584e47b084945077cf03255b52984',
        '998c74a8cd45ac01289d5833a7beb4744ff536b01b257be4c5767bea93ea57a4'
      ],
      [
        '3c5d2a1ba39c5a1790000738c9e0c40b8dcdfd5468754b6405540157e017aa7a',
        'b2284279995a34e2f9d4de7396fc18b80f9b8b9fdd270f6661f79ca4c81bd257'
      ],
      [
        'cc8704b8a60a0defa3a99a7299f2e9c3fbc395afb04ac078425ef8a1793cc030',
        'bdd46039feed17881d1e0862db347f8cf395b74fc4bcdc4e940b74e3ac1f1b13'
      ],
      [
        'c533e4f7ea8555aacd9777ac5cad29b97dd4defccc53ee7ea204119b2889b197',
        '6f0a256bc5efdf429a2fb6242f1a43a2d9b925bb4a4b3a26bb8e0f45eb596096'
      ],
      [
        'c14f8f2ccb27d6f109f6d08d03cc96a69ba8c34eec07bbcf566d48e33da6593',
        'c359d6923bb398f7fd4473e16fe1c28475b740dd098075e6c0e8649113dc3a38'
      ],
      [
        'a6cbc3046bc6a450bac24789fa17115a4c9739ed75f8f21ce441f72e0b90e6ef',
        '21ae7f4680e889bb130619e2c0f95a360ceb573c70603139862afd617fa9b9f'
      ],
      [
        '347d6d9a02c48927ebfb86c1359b1caf130a3c0267d11ce6344b39f99d43cc38',
        '60ea7f61a353524d1c987f6ecec92f086d565ab687870cb12689ff1e31c74448'
      ],
      [
        'da6545d2181db8d983f7dcb375ef5866d47c67b1bf31c8cf855ef7437b72656a',
        '49b96715ab6878a79e78f07ce5680c5d6673051b4935bd897fea824b77dc208a'
      ],
      [
        'c40747cc9d012cb1a13b8148309c6de7ec25d6945d657146b9d5994b8feb1111',
        '5ca560753be2a12fc6de6caf2cb489565db936156b9514e1bb5e83037e0fa2d4'
      ],
      [
        '4e42c8ec82c99798ccf3a610be870e78338c7f713348bd34c8203ef4037f3502',
        '7571d74ee5e0fb92a7a8b33a07783341a5492144cc54bcc40a94473693606437'
      ],
      [
        '3775ab7089bc6af823aba2e1af70b236d251cadb0c86743287522a1b3b0dedea',
        'be52d107bcfa09d8bcb9736a828cfa7fac8db17bf7a76a2c42ad961409018cf7'
      ],
      [
        'cee31cbf7e34ec379d94fb814d3d775ad954595d1314ba8846959e3e82f74e26',
        '8fd64a14c06b589c26b947ae2bcf6bfa0149ef0be14ed4d80f448a01c43b1c6d'
      ],
      [
        'b4f9eaea09b6917619f6ea6a4eb5464efddb58fd45b1ebefcdc1a01d08b47986',
        '39e5c9925b5a54b07433a4f18c61726f8bb131c012ca542eb24a8ac07200682a'
      ],
      [
        'd4263dfc3d2df923a0179a48966d30ce84e2515afc3dccc1b77907792ebcc60e',
        '62dfaf07a0f78feb30e30d6295853ce189e127760ad6cf7fae164e122a208d54'
      ],
      [
        '48457524820fa65a4f8d35eb6930857c0032acc0a4a2de422233eeda897612c4',
        '25a748ab367979d98733c38a1fa1c2e7dc6cc07db2d60a9ae7a76aaa49bd0f77'
      ],
      [
        'dfeeef1881101f2cb11644f3a2afdfc2045e19919152923f367a1767c11cceda',
        'ecfb7056cf1de042f9420bab396793c0c390bde74b4bbdff16a83ae09a9a7517'
      ],
      [
        '6d7ef6b17543f8373c573f44e1f389835d89bcbc6062ced36c82df83b8fae859',
        'cd450ec335438986dfefa10c57fea9bcc521a0959b2d80bbf74b190dca712d10'
      ],
      [
        'e75605d59102a5a2684500d3b991f2e3f3c88b93225547035af25af66e04541f',
        'f5c54754a8f71ee540b9b48728473e314f729ac5308b06938360990e2bfad125'
      ],
      [
        'eb98660f4c4dfaa06a2be453d5020bc99a0c2e60abe388457dd43fefb1ed620c',
        '6cb9a8876d9cb8520609af3add26cd20a0a7cd8a9411131ce85f44100099223e'
      ],
      [
        '13e87b027d8514d35939f2e6892b19922154596941888336dc3563e3b8dba942',
        'fef5a3c68059a6dec5d624114bf1e91aac2b9da568d6abeb2570d55646b8adf1'
      ],
      [
        'ee163026e9fd6fe017c38f06a5be6fc125424b371ce2708e7bf4491691e5764a',
        '1acb250f255dd61c43d94ccc670d0f58f49ae3fa15b96623e5430da0ad6c62b2'
      ],
      [
        'b268f5ef9ad51e4d78de3a750c2dc89b1e626d43505867999932e5db33af3d80',
        '5f310d4b3c99b9ebb19f77d41c1dee018cf0d34fd4191614003e945a1216e423'
      ],
      [
        'ff07f3118a9df035e9fad85eb6c7bfe42b02f01ca99ceea3bf7ffdba93c4750d',
        '438136d603e858a3a5c440c38eccbaddc1d2942114e2eddd4740d098ced1f0d8'
      ],
      [
        '8d8b9855c7c052a34146fd20ffb658bea4b9f69e0d825ebec16e8c3ce2b526a1',
        'cdb559eedc2d79f926baf44fb84ea4d44bcf50fee51d7ceb30e2e7f463036758'
      ],
      [
        '52db0b5384dfbf05bfa9d472d7ae26dfe4b851ceca91b1eba54263180da32b63',
        'c3b997d050ee5d423ebaf66a6db9f57b3180c902875679de924b69d84a7b375'
      ],
      [
        'e62f9490d3d51da6395efd24e80919cc7d0f29c3f3fa48c6fff543becbd43352',
        '6d89ad7ba4876b0b22c2ca280c682862f342c8591f1daf5170e07bfd9ccafa7d'
      ],
      [
        '7f30ea2476b399b4957509c88f77d0191afa2ff5cb7b14fd6d8e7d65aaab1193',
        'ca5ef7d4b231c94c3b15389a5f6311e9daff7bb67b103e9880ef4bff637acaec'
      ],
      [
        '5098ff1e1d9f14fb46a210fada6c903fef0fb7b4a1dd1d9ac60a0361800b7a00',
        '9731141d81fc8f8084d37c6e7542006b3ee1b40d60dfe5362a5b132fd17ddc0'
      ],
      [
        '32b78c7de9ee512a72895be6b9cbefa6e2f3c4ccce445c96b9f2c81e2778ad58',
        'ee1849f513df71e32efc3896ee28260c73bb80547ae2275ba497237794c8753c'
      ],
      [
        'e2cb74fddc8e9fbcd076eef2a7c72b0ce37d50f08269dfc074b581550547a4f7',
        'd3aa2ed71c9dd2247a62df062736eb0baddea9e36122d2be8641abcb005cc4a4'
      ],
      [
        '8438447566d4d7bedadc299496ab357426009a35f235cb141be0d99cd10ae3a8',
        'c4e1020916980a4da5d01ac5e6ad330734ef0d7906631c4f2390426b2edd791f'
      ],
      [
        '4162d488b89402039b584c6fc6c308870587d9c46f660b878ab65c82c711d67e',
        '67163e903236289f776f22c25fb8a3afc1732f2b84b4e95dbda47ae5a0852649'
      ],
      [
        '3fad3fa84caf0f34f0f89bfd2dcf54fc175d767aec3e50684f3ba4a4bf5f683d',
        'cd1bc7cb6cc407bb2f0ca647c718a730cf71872e7d0d2a53fa20efcdfe61826'
      ],
      [
        '674f2600a3007a00568c1a7ce05d0816c1fb84bf1370798f1c69532faeb1a86b',
        '299d21f9413f33b3edf43b257004580b70db57da0b182259e09eecc69e0d38a5'
      ],
      [
        'd32f4da54ade74abb81b815ad1fb3b263d82d6c692714bcff87d29bd5ee9f08f',
        'f9429e738b8e53b968e99016c059707782e14f4535359d582fc416910b3eea87'
      ],
      [
        '30e4e670435385556e593657135845d36fbb6931f72b08cb1ed954f1e3ce3ff6',
        '462f9bce619898638499350113bbc9b10a878d35da70740dc695a559eb88db7b'
      ],
      [
        'be2062003c51cc3004682904330e4dee7f3dcd10b01e580bf1971b04d4cad297',
        '62188bc49d61e5428573d48a74e1c655b1c61090905682a0d5558ed72dccb9bc'
      ],
      [
        '93144423ace3451ed29e0fb9ac2af211cb6e84a601df5993c419859fff5df04a',
        '7c10dfb164c3425f5c71a3f9d7992038f1065224f72bb9d1d902a6d13037b47c'
      ],
      [
        'b015f8044f5fcbdcf21ca26d6c34fb8197829205c7b7d2a7cb66418c157b112c',
        'ab8c1e086d04e813744a655b2df8d5f83b3cdc6faa3088c1d3aea1454e3a1d5f'
      ],
      [
        'd5e9e1da649d97d89e4868117a465a3a4f8a18de57a140d36b3f2af341a21b52',
        '4cb04437f391ed73111a13cc1d4dd0db1693465c2240480d8955e8592f27447a'
      ],
      [
        'd3ae41047dd7ca065dbf8ed77b992439983005cd72e16d6f996a5316d36966bb',
        'bd1aeb21ad22ebb22a10f0303417c6d964f8cdd7df0aca614b10dc14d125ac46'
      ],
      [
        '463e2763d885f958fc66cdd22800f0a487197d0a82e377b49f80af87c897b065',
        'bfefacdb0e5d0fd7df3a311a94de062b26b80c61fbc97508b79992671ef7ca7f'
      ],
      [
        '7985fdfd127c0567c6f53ec1bb63ec3158e597c40bfe747c83cddfc910641917',
        '603c12daf3d9862ef2b25fe1de289aed24ed291e0ec6708703a5bd567f32ed03'
      ],
      [
        '74a1ad6b5f76e39db2dd249410eac7f99e74c59cb83d2d0ed5ff1543da7703e9',
        'cc6157ef18c9c63cd6193d83631bbea0093e0968942e8c33d5737fd790e0db08'
      ],
      [
        '30682a50703375f602d416664ba19b7fc9bab42c72747463a71d0896b22f6da3',
        '553e04f6b018b4fa6c8f39e7f311d3176290d0e0f19ca73f17714d9977a22ff8'
      ],
      [
        '9e2158f0d7c0d5f26c3791efefa79597654e7a2b2464f52b1ee6c1347769ef57',
        '712fcdd1b9053f09003a3481fa7762e9ffd7c8ef35a38509e2fbf2629008373'
      ],
      [
        '176e26989a43c9cfeba4029c202538c28172e566e3c4fce7322857f3be327d66',
        'ed8cc9d04b29eb877d270b4878dc43c19aefd31f4eee09ee7b47834c1fa4b1c3'
      ],
      [
        '75d46efea3771e6e68abb89a13ad747ecf1892393dfc4f1b7004788c50374da8',
        '9852390a99507679fd0b86fd2b39a868d7efc22151346e1a3ca4726586a6bed8'
      ],
      [
        '809a20c67d64900ffb698c4c825f6d5f2310fb0451c869345b7319f645605721',
        '9e994980d9917e22b76b061927fa04143d096ccc54963e6a5ebfa5f3f8e286c1'
      ],
      [
        '1b38903a43f7f114ed4500b4eac7083fdefece1cf29c63528d563446f972c180',
        '4036edc931a60ae889353f77fd53de4a2708b26b6f5da72ad3394119daf408f9'
      ]
    ]
  }
};


/***/ }),
/* 280 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var BN = __webpack_require__(13);
var HmacDRBG = __webpack_require__(281);
var elliptic = __webpack_require__(17);
var utils = elliptic.utils;
var assert = utils.assert;

var KeyPair = __webpack_require__(282);
var Signature = __webpack_require__(283);

function EC(options) {
  if (!(this instanceof EC))
    return new EC(options);

  // Shortcut `elliptic.ec(curve-name)`
  if (typeof options === 'string') {
    assert(elliptic.curves.hasOwnProperty(options), 'Unknown curve ' + options);

    options = elliptic.curves[options];
  }

  // Shortcut for `elliptic.ec(elliptic.curves.curveName)`
  if (options instanceof elliptic.curves.PresetCurve)
    options = { curve: options };

  this.curve = options.curve.curve;
  this.n = this.curve.n;
  this.nh = this.n.ushrn(1);
  this.g = this.curve.g;

  // Point on curve
  this.g = options.curve.g;
  this.g.precompute(options.curve.n.bitLength() + 1);

  // Hash for function for DRBG
  this.hash = options.hash || options.curve.hash;
}
module.exports = EC;

EC.prototype.keyPair = function keyPair(options) {
  return new KeyPair(this, options);
};

EC.prototype.keyFromPrivate = function keyFromPrivate(priv, enc) {
  return KeyPair.fromPrivate(this, priv, enc);
};

EC.prototype.keyFromPublic = function keyFromPublic(pub, enc) {
  return KeyPair.fromPublic(this, pub, enc);
};

EC.prototype.genKeyPair = function genKeyPair(options) {
  if (!options)
    options = {};

  // Instantiate Hmac_DRBG
  var drbg = new HmacDRBG({
    hash: this.hash,
    pers: options.pers,
    persEnc: options.persEnc || 'utf8',
    entropy: options.entropy || elliptic.rand(this.hash.hmacStrength),
    entropyEnc: options.entropy && options.entropyEnc || 'utf8',
    nonce: this.n.toArray()
  });

  var bytes = this.n.byteLength();
  var ns2 = this.n.sub(new BN(2));
  do {
    var priv = new BN(drbg.generate(bytes));
    if (priv.cmp(ns2) > 0)
      continue;

    priv.iaddn(1);
    return this.keyFromPrivate(priv);
  } while (true);
};

EC.prototype._truncateToN = function truncateToN(msg, truncOnly) {
  var delta = msg.byteLength() * 8 - this.n.bitLength();
  if (delta > 0)
    msg = msg.ushrn(delta);
  if (!truncOnly && msg.cmp(this.n) >= 0)
    return msg.sub(this.n);
  else
    return msg;
};

EC.prototype.sign = function sign(msg, key, enc, options) {
  if (typeof enc === 'object') {
    options = enc;
    enc = null;
  }
  if (!options)
    options = {};

  key = this.keyFromPrivate(key, enc);
  msg = this._truncateToN(new BN(msg, 16));

  // Zero-extend key to provide enough entropy
  var bytes = this.n.byteLength();
  var bkey = key.getPrivate().toArray('be', bytes);

  // Zero-extend nonce to have the same byte size as N
  var nonce = msg.toArray('be', bytes);

  // Instantiate Hmac_DRBG
  var drbg = new HmacDRBG({
    hash: this.hash,
    entropy: bkey,
    nonce: nonce,
    pers: options.pers,
    persEnc: options.persEnc || 'utf8'
  });

  // Number of bytes to generate
  var ns1 = this.n.sub(new BN(1));

  for (var iter = 0; true; iter++) {
    var k = options.k ?
        options.k(iter) :
        new BN(drbg.generate(this.n.byteLength()));
    k = this._truncateToN(k, true);
    if (k.cmpn(1) <= 0 || k.cmp(ns1) >= 0)
      continue;

    var kp = this.g.mul(k);
    if (kp.isInfinity())
      continue;

    var kpX = kp.getX();
    var r = kpX.umod(this.n);
    if (r.cmpn(0) === 0)
      continue;

    var s = k.invm(this.n).mul(r.mul(key.getPrivate()).iadd(msg));
    s = s.umod(this.n);
    if (s.cmpn(0) === 0)
      continue;

    var recoveryParam = (kp.getY().isOdd() ? 1 : 0) |
                        (kpX.cmp(r) !== 0 ? 2 : 0);

    // Use complement of `s`, if it is > `n / 2`
    if (options.canonical && s.cmp(this.nh) > 0) {
      s = this.n.sub(s);
      recoveryParam ^= 1;
    }

    return new Signature({ r: r, s: s, recoveryParam: recoveryParam });
  }
};

EC.prototype.verify = function verify(msg, signature, key, enc) {
  msg = this._truncateToN(new BN(msg, 16));
  key = this.keyFromPublic(key, enc);
  signature = new Signature(signature, 'hex');

  // Perform primitive values validation
  var r = signature.r;
  var s = signature.s;
  if (r.cmpn(1) < 0 || r.cmp(this.n) >= 0)
    return false;
  if (s.cmpn(1) < 0 || s.cmp(this.n) >= 0)
    return false;

  // Validate signature
  var sinv = s.invm(this.n);
  var u1 = sinv.mul(msg).umod(this.n);
  var u2 = sinv.mul(r).umod(this.n);

  if (!this.curve._maxwellTrick) {
    var p = this.g.mulAdd(u1, key.getPublic(), u2);
    if (p.isInfinity())
      return false;

    return p.getX().umod(this.n).cmp(r) === 0;
  }

  // NOTE: Greg Maxwell's trick, inspired by:
  // https://git.io/vad3K

  var p = this.g.jmulAdd(u1, key.getPublic(), u2);
  if (p.isInfinity())
    return false;

  // Compare `p.x` of Jacobian point with `r`,
  // this will do `p.x == r * p.z^2` instead of multiplying `p.x` by the
  // inverse of `p.z^2`
  return p.eqXToP(r);
};

EC.prototype.recoverPubKey = function(msg, signature, j, enc) {
  assert((3 & j) === j, 'The recovery param is more than two bits');
  signature = new Signature(signature, enc);

  var n = this.n;
  var e = new BN(msg);
  var r = signature.r;
  var s = signature.s;

  // A set LSB signifies that the y-coordinate is odd
  var isYOdd = j & 1;
  var isSecondKey = j >> 1;
  if (r.cmp(this.curve.p.umod(this.curve.n)) >= 0 && isSecondKey)
    throw new Error('Unable to find sencond key candinate');

  // 1.1. Let x = r + jn.
  if (isSecondKey)
    r = this.curve.pointFromX(r.add(this.curve.n), isYOdd);
  else
    r = this.curve.pointFromX(r, isYOdd);

  var rInv = signature.r.invm(n);
  var s1 = n.sub(e).mul(rInv).umod(n);
  var s2 = s.mul(rInv).umod(n);

  // 1.6.1 Compute Q = r^-1 (sR -  eG)
  //               Q = r^-1 (sR + -eG)
  return this.g.mulAdd(s1, r, s2);
};

EC.prototype.getKeyRecoveryParam = function(e, signature, Q, enc) {
  signature = new Signature(signature, enc);
  if (signature.recoveryParam !== null)
    return signature.recoveryParam;

  for (var i = 0; i < 4; i++) {
    var Qprime;
    try {
      Qprime = this.recoverPubKey(e, signature, i);
    } catch (e) {
      continue;
    }

    if (Qprime.eq(Q))
      return i;
  }
  throw new Error('Unable to find valid recovery factor');
};


/***/ }),
/* 281 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var hash = __webpack_require__(112);
var utils = __webpack_require__(167);
var assert = __webpack_require__(22);

function HmacDRBG(options) {
  if (!(this instanceof HmacDRBG))
    return new HmacDRBG(options);
  this.hash = options.hash;
  this.predResist = !!options.predResist;

  this.outLen = this.hash.outSize;
  this.minEntropy = options.minEntropy || this.hash.hmacStrength;

  this._reseed = null;
  this.reseedInterval = null;
  this.K = null;
  this.V = null;

  var entropy = utils.toArray(options.entropy, options.entropyEnc || 'hex');
  var nonce = utils.toArray(options.nonce, options.nonceEnc || 'hex');
  var pers = utils.toArray(options.pers, options.persEnc || 'hex');
  assert(entropy.length >= (this.minEntropy / 8),
         'Not enough entropy. Minimum is: ' + this.minEntropy + ' bits');
  this._init(entropy, nonce, pers);
}
module.exports = HmacDRBG;

HmacDRBG.prototype._init = function init(entropy, nonce, pers) {
  var seed = entropy.concat(nonce).concat(pers);

  this.K = new Array(this.outLen / 8);
  this.V = new Array(this.outLen / 8);
  for (var i = 0; i < this.V.length; i++) {
    this.K[i] = 0x00;
    this.V[i] = 0x01;
  }

  this._update(seed);
  this._reseed = 1;
  this.reseedInterval = 0x1000000000000;  // 2^48
};

HmacDRBG.prototype._hmac = function hmac() {
  return new hash.hmac(this.hash, this.K);
};

HmacDRBG.prototype._update = function update(seed) {
  var kmac = this._hmac()
                 .update(this.V)
                 .update([ 0x00 ]);
  if (seed)
    kmac = kmac.update(seed);
  this.K = kmac.digest();
  this.V = this._hmac().update(this.V).digest();
  if (!seed)
    return;

  this.K = this._hmac()
               .update(this.V)
               .update([ 0x01 ])
               .update(seed)
               .digest();
  this.V = this._hmac().update(this.V).digest();
};

HmacDRBG.prototype.reseed = function reseed(entropy, entropyEnc, add, addEnc) {
  // Optional entropy enc
  if (typeof entropyEnc !== 'string') {
    addEnc = add;
    add = entropyEnc;
    entropyEnc = null;
  }

  entropy = utils.toArray(entropy, entropyEnc);
  add = utils.toArray(add, addEnc);

  assert(entropy.length >= (this.minEntropy / 8),
         'Not enough entropy. Minimum is: ' + this.minEntropy + ' bits');

  this._update(entropy.concat(add || []));
  this._reseed = 1;
};

HmacDRBG.prototype.generate = function generate(len, enc, add, addEnc) {
  if (this._reseed > this.reseedInterval)
    throw new Error('Reseed is required');

  // Optional encoding
  if (typeof enc !== 'string') {
    addEnc = add;
    add = enc;
    enc = null;
  }

  // Optional additional data
  if (add) {
    add = utils.toArray(add, addEnc || 'hex');
    this._update(add);
  }

  var temp = [];
  while (temp.length < len) {
    this.V = this._hmac().update(this.V).digest();
    temp = temp.concat(this.V);
  }

  var res = temp.slice(0, len);
  this._update(add);
  this._reseed++;
  return utils.encode(res, enc);
};


/***/ }),
/* 282 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var BN = __webpack_require__(13);
var elliptic = __webpack_require__(17);
var utils = elliptic.utils;
var assert = utils.assert;

function KeyPair(ec, options) {
  this.ec = ec;
  this.priv = null;
  this.pub = null;

  // KeyPair(ec, { priv: ..., pub: ... })
  if (options.priv)
    this._importPrivate(options.priv, options.privEnc);
  if (options.pub)
    this._importPublic(options.pub, options.pubEnc);
}
module.exports = KeyPair;

KeyPair.fromPublic = function fromPublic(ec, pub, enc) {
  if (pub instanceof KeyPair)
    return pub;

  return new KeyPair(ec, {
    pub: pub,
    pubEnc: enc
  });
};

KeyPair.fromPrivate = function fromPrivate(ec, priv, enc) {
  if (priv instanceof KeyPair)
    return priv;

  return new KeyPair(ec, {
    priv: priv,
    privEnc: enc
  });
};

KeyPair.prototype.validate = function validate() {
  var pub = this.getPublic();

  if (pub.isInfinity())
    return { result: false, reason: 'Invalid public key' };
  if (!pub.validate())
    return { result: false, reason: 'Public key is not a point' };
  if (!pub.mul(this.ec.curve.n).isInfinity())
    return { result: false, reason: 'Public key * N != O' };

  return { result: true, reason: null };
};

KeyPair.prototype.getPublic = function getPublic(compact, enc) {
  // compact is optional argument
  if (typeof compact === 'string') {
    enc = compact;
    compact = null;
  }

  if (!this.pub)
    this.pub = this.ec.g.mul(this.priv);

  if (!enc)
    return this.pub;

  return this.pub.encode(enc, compact);
};

KeyPair.prototype.getPrivate = function getPrivate(enc) {
  if (enc === 'hex')
    return this.priv.toString(16, 2);
  else
    return this.priv;
};

KeyPair.prototype._importPrivate = function _importPrivate(key, enc) {
  this.priv = new BN(key, enc || 16);

  // Ensure that the priv won't be bigger than n, otherwise we may fail
  // in fixed multiplication method
  this.priv = this.priv.umod(this.ec.curve.n);
};

KeyPair.prototype._importPublic = function _importPublic(key, enc) {
  if (key.x || key.y) {
    // Montgomery points only have an `x` coordinate.
    // Weierstrass/Edwards points on the other hand have both `x` and
    // `y` coordinates.
    if (this.ec.curve.type === 'mont') {
      assert(key.x, 'Need x coordinate');
    } else if (this.ec.curve.type === 'short' ||
               this.ec.curve.type === 'edwards') {
      assert(key.x && key.y, 'Need both x and y coordinate');
    }
    this.pub = this.ec.curve.point(key.x, key.y);
    return;
  }
  this.pub = this.ec.curve.decodePoint(key, enc);
};

// ECDH
KeyPair.prototype.derive = function derive(pub) {
  return pub.mul(this.priv).getX();
};

// ECDSA
KeyPair.prototype.sign = function sign(msg, enc, options) {
  return this.ec.sign(msg, this, enc, options);
};

KeyPair.prototype.verify = function verify(msg, signature) {
  return this.ec.verify(msg, signature, this);
};

KeyPair.prototype.inspect = function inspect() {
  return '<Key priv: ' + (this.priv && this.priv.toString(16, 2)) +
         ' pub: ' + (this.pub && this.pub.inspect()) + ' >';
};


/***/ }),
/* 283 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var BN = __webpack_require__(13);

var elliptic = __webpack_require__(17);
var utils = elliptic.utils;
var assert = utils.assert;

function Signature(options, enc) {
  if (options instanceof Signature)
    return options;

  if (this._importDER(options, enc))
    return;

  assert(options.r && options.s, 'Signature without r or s');
  this.r = new BN(options.r, 16);
  this.s = new BN(options.s, 16);
  if (options.recoveryParam === undefined)
    this.recoveryParam = null;
  else
    this.recoveryParam = options.recoveryParam;
}
module.exports = Signature;

function Position() {
  this.place = 0;
}

function getLength(buf, p) {
  var initial = buf[p.place++];
  if (!(initial & 0x80)) {
    return initial;
  }
  var octetLen = initial & 0xf;
  var val = 0;
  for (var i = 0, off = p.place; i < octetLen; i++, off++) {
    val <<= 8;
    val |= buf[off];
  }
  p.place = off;
  return val;
}

function rmPadding(buf) {
  var i = 0;
  var len = buf.length - 1;
  while (!buf[i] && !(buf[i + 1] & 0x80) && i < len) {
    i++;
  }
  if (i === 0) {
    return buf;
  }
  return buf.slice(i);
}

Signature.prototype._importDER = function _importDER(data, enc) {
  data = utils.toArray(data, enc);
  var p = new Position();
  if (data[p.place++] !== 0x30) {
    return false;
  }
  var len = getLength(data, p);
  if ((len + p.place) !== data.length) {
    return false;
  }
  if (data[p.place++] !== 0x02) {
    return false;
  }
  var rlen = getLength(data, p);
  var r = data.slice(p.place, rlen + p.place);
  p.place += rlen;
  if (data[p.place++] !== 0x02) {
    return false;
  }
  var slen = getLength(data, p);
  if (data.length !== slen + p.place) {
    return false;
  }
  var s = data.slice(p.place, slen + p.place);
  if (r[0] === 0 && (r[1] & 0x80)) {
    r = r.slice(1);
  }
  if (s[0] === 0 && (s[1] & 0x80)) {
    s = s.slice(1);
  }

  this.r = new BN(r);
  this.s = new BN(s);
  this.recoveryParam = null;

  return true;
};

function constructLength(arr, len) {
  if (len < 0x80) {
    arr.push(len);
    return;
  }
  var octets = 1 + (Math.log(len) / Math.LN2 >>> 3);
  arr.push(octets | 0x80);
  while (--octets) {
    arr.push((len >>> (octets << 3)) & 0xff);
  }
  arr.push(len);
}

Signature.prototype.toDER = function toDER(enc) {
  var r = this.r.toArray();
  var s = this.s.toArray();

  // Pad values
  if (r[0] & 0x80)
    r = [ 0 ].concat(r);
  // Pad values
  if (s[0] & 0x80)
    s = [ 0 ].concat(s);

  r = rmPadding(r);
  s = rmPadding(s);

  while (!s[0] && !(s[1] & 0x80)) {
    s = s.slice(1);
  }
  var arr = [ 0x02 ];
  constructLength(arr, r.length);
  arr = arr.concat(r);
  arr.push(0x02);
  constructLength(arr, s.length);
  var backHalf = arr.concat(s);
  var res = [ 0x30 ];
  constructLength(res, backHalf.length);
  res = res.concat(backHalf);
  return utils.encode(res, enc);
};


/***/ }),
/* 284 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var hash = __webpack_require__(112);
var elliptic = __webpack_require__(17);
var utils = elliptic.utils;
var assert = utils.assert;
var parseBytes = utils.parseBytes;
var KeyPair = __webpack_require__(285);
var Signature = __webpack_require__(286);

function EDDSA(curve) {
  assert(curve === 'ed25519', 'only tested with ed25519 so far');

  if (!(this instanceof EDDSA))
    return new EDDSA(curve);

  var curve = elliptic.curves[curve].curve;
  this.curve = curve;
  this.g = curve.g;
  this.g.precompute(curve.n.bitLength() + 1);

  this.pointClass = curve.point().constructor;
  this.encodingLength = Math.ceil(curve.n.bitLength() / 8);
  this.hash = hash.sha512;
}

module.exports = EDDSA;

/**
* @param {Array|String} message - message bytes
* @param {Array|String|KeyPair} secret - secret bytes or a keypair
* @returns {Signature} - signature
*/
EDDSA.prototype.sign = function sign(message, secret) {
  message = parseBytes(message);
  var key = this.keyFromSecret(secret);
  var r = this.hashInt(key.messagePrefix(), message);
  var R = this.g.mul(r);
  var Rencoded = this.encodePoint(R);
  var s_ = this.hashInt(Rencoded, key.pubBytes(), message)
               .mul(key.priv());
  var S = r.add(s_).umod(this.curve.n);
  return this.makeSignature({ R: R, S: S, Rencoded: Rencoded });
};

/**
* @param {Array} message - message bytes
* @param {Array|String|Signature} sig - sig bytes
* @param {Array|String|Point|KeyPair} pub - public key
* @returns {Boolean} - true if public key matches sig of message
*/
EDDSA.prototype.verify = function verify(message, sig, pub) {
  message = parseBytes(message);
  sig = this.makeSignature(sig);
  var key = this.keyFromPublic(pub);
  var h = this.hashInt(sig.Rencoded(), key.pubBytes(), message);
  var SG = this.g.mul(sig.S());
  var RplusAh = sig.R().add(key.pub().mul(h));
  return RplusAh.eq(SG);
};

EDDSA.prototype.hashInt = function hashInt() {
  var hash = this.hash();
  for (var i = 0; i < arguments.length; i++)
    hash.update(arguments[i]);
  return utils.intFromLE(hash.digest()).umod(this.curve.n);
};

EDDSA.prototype.keyFromPublic = function keyFromPublic(pub) {
  return KeyPair.fromPublic(this, pub);
};

EDDSA.prototype.keyFromSecret = function keyFromSecret(secret) {
  return KeyPair.fromSecret(this, secret);
};

EDDSA.prototype.makeSignature = function makeSignature(sig) {
  if (sig instanceof Signature)
    return sig;
  return new Signature(this, sig);
};

/**
* * https://tools.ietf.org/html/draft-josefsson-eddsa-ed25519-03#section-5.2
*
* EDDSA defines methods for encoding and decoding points and integers. These are
* helper convenience methods, that pass along to utility functions implied
* parameters.
*
*/
EDDSA.prototype.encodePoint = function encodePoint(point) {
  var enc = point.getY().toArray('le', this.encodingLength);
  enc[this.encodingLength - 1] |= point.getX().isOdd() ? 0x80 : 0;
  return enc;
};

EDDSA.prototype.decodePoint = function decodePoint(bytes) {
  bytes = utils.parseBytes(bytes);

  var lastIx = bytes.length - 1;
  var normed = bytes.slice(0, lastIx).concat(bytes[lastIx] & ~0x80);
  var xIsOdd = (bytes[lastIx] & 0x80) !== 0;

  var y = utils.intFromLE(normed);
  return this.curve.pointFromY(y, xIsOdd);
};

EDDSA.prototype.encodeInt = function encodeInt(num) {
  return num.toArray('le', this.encodingLength);
};

EDDSA.prototype.decodeInt = function decodeInt(bytes) {
  return utils.intFromLE(bytes);
};

EDDSA.prototype.isPoint = function isPoint(val) {
  return val instanceof this.pointClass;
};


/***/ }),
/* 285 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var elliptic = __webpack_require__(17);
var utils = elliptic.utils;
var assert = utils.assert;
var parseBytes = utils.parseBytes;
var cachedProperty = utils.cachedProperty;

/**
* @param {EDDSA} eddsa - instance
* @param {Object} params - public/private key parameters
*
* @param {Array<Byte>} [params.secret] - secret seed bytes
* @param {Point} [params.pub] - public key point (aka `A` in eddsa terms)
* @param {Array<Byte>} [params.pub] - public key point encoded as bytes
*
*/
function KeyPair(eddsa, params) {
  this.eddsa = eddsa;
  this._secret = parseBytes(params.secret);
  if (eddsa.isPoint(params.pub))
    this._pub = params.pub;
  else
    this._pubBytes = parseBytes(params.pub);
}

KeyPair.fromPublic = function fromPublic(eddsa, pub) {
  if (pub instanceof KeyPair)
    return pub;
  return new KeyPair(eddsa, { pub: pub });
};

KeyPair.fromSecret = function fromSecret(eddsa, secret) {
  if (secret instanceof KeyPair)
    return secret;
  return new KeyPair(eddsa, { secret: secret });
};

KeyPair.prototype.secret = function secret() {
  return this._secret;
};

cachedProperty(KeyPair, 'pubBytes', function pubBytes() {
  return this.eddsa.encodePoint(this.pub());
});

cachedProperty(KeyPair, 'pub', function pub() {
  if (this._pubBytes)
    return this.eddsa.decodePoint(this._pubBytes);
  return this.eddsa.g.mul(this.priv());
});

cachedProperty(KeyPair, 'privBytes', function privBytes() {
  var eddsa = this.eddsa;
  var hash = this.hash();
  var lastIx = eddsa.encodingLength - 1;

  var a = hash.slice(0, eddsa.encodingLength);
  a[0] &= 248;
  a[lastIx] &= 127;
  a[lastIx] |= 64;

  return a;
});

cachedProperty(KeyPair, 'priv', function priv() {
  return this.eddsa.decodeInt(this.privBytes());
});

cachedProperty(KeyPair, 'hash', function hash() {
  return this.eddsa.hash().update(this.secret()).digest();
});

cachedProperty(KeyPair, 'messagePrefix', function messagePrefix() {
  return this.hash().slice(this.eddsa.encodingLength);
});

KeyPair.prototype.sign = function sign(message) {
  assert(this._secret, 'KeyPair can only verify');
  return this.eddsa.sign(message, this);
};

KeyPair.prototype.verify = function verify(message, sig) {
  return this.eddsa.verify(message, sig, this);
};

KeyPair.prototype.getSecret = function getSecret(enc) {
  assert(this._secret, 'KeyPair is public only');
  return utils.encode(this.secret(), enc);
};

KeyPair.prototype.getPublic = function getPublic(enc) {
  return utils.encode(this.pubBytes(), enc);
};

module.exports = KeyPair;


/***/ }),
/* 286 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var BN = __webpack_require__(13);
var elliptic = __webpack_require__(17);
var utils = elliptic.utils;
var assert = utils.assert;
var cachedProperty = utils.cachedProperty;
var parseBytes = utils.parseBytes;

/**
* @param {EDDSA} eddsa - eddsa instance
* @param {Array<Bytes>|Object} sig -
* @param {Array<Bytes>|Point} [sig.R] - R point as Point or bytes
* @param {Array<Bytes>|bn} [sig.S] - S scalar as bn or bytes
* @param {Array<Bytes>} [sig.Rencoded] - R point encoded
* @param {Array<Bytes>} [sig.Sencoded] - S scalar encoded
*/
function Signature(eddsa, sig) {
  this.eddsa = eddsa;

  if (typeof sig !== 'object')
    sig = parseBytes(sig);

  if (Array.isArray(sig)) {
    sig = {
      R: sig.slice(0, eddsa.encodingLength),
      S: sig.slice(eddsa.encodingLength)
    };
  }

  assert(sig.R && sig.S, 'Signature without R or S');

  if (eddsa.isPoint(sig.R))
    this._R = sig.R;
  if (sig.S instanceof BN)
    this._S = sig.S;

  this._Rencoded = Array.isArray(sig.R) ? sig.R : sig.Rencoded;
  this._Sencoded = Array.isArray(sig.S) ? sig.S : sig.Sencoded;
}

cachedProperty(Signature, 'S', function S() {
  return this.eddsa.decodeInt(this.Sencoded());
});

cachedProperty(Signature, 'R', function R() {
  return this.eddsa.decodePoint(this.Rencoded());
});

cachedProperty(Signature, 'Rencoded', function Rencoded() {
  return this.eddsa.encodePoint(this.R());
});

cachedProperty(Signature, 'Sencoded', function Sencoded() {
  return this.eddsa.encodeInt(this.S());
});

Signature.prototype.toBytes = function toBytes() {
  return this.Rencoded().concat(this.Sencoded());
};

Signature.prototype.toHex = function toHex() {
  return utils.encode(this.toBytes(), 'hex').toUpperCase();
};

module.exports = Signature;


/***/ }),
/* 287 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";
// from https://github.com/indutny/self-signed/blob/gh-pages/lib/asn1.js
// Fedor, you are amazing.


var asn1 = __webpack_require__(71)

exports.certificate = __webpack_require__(298)

var RSAPrivateKey = asn1.define('RSAPrivateKey', function () {
  this.seq().obj(
    this.key('version').int(),
    this.key('modulus').int(),
    this.key('publicExponent').int(),
    this.key('privateExponent').int(),
    this.key('prime1').int(),
    this.key('prime2').int(),
    this.key('exponent1').int(),
    this.key('exponent2').int(),
    this.key('coefficient').int()
  )
})
exports.RSAPrivateKey = RSAPrivateKey

var RSAPublicKey = asn1.define('RSAPublicKey', function () {
  this.seq().obj(
    this.key('modulus').int(),
    this.key('publicExponent').int()
  )
})
exports.RSAPublicKey = RSAPublicKey

var PublicKey = asn1.define('SubjectPublicKeyInfo', function () {
  this.seq().obj(
    this.key('algorithm').use(AlgorithmIdentifier),
    this.key('subjectPublicKey').bitstr()
  )
})
exports.PublicKey = PublicKey

var AlgorithmIdentifier = asn1.define('AlgorithmIdentifier', function () {
  this.seq().obj(
    this.key('algorithm').objid(),
    this.key('none').null_().optional(),
    this.key('curve').objid().optional(),
    this.key('params').seq().obj(
      this.key('p').int(),
      this.key('q').int(),
      this.key('g').int()
    ).optional()
  )
})

var PrivateKeyInfo = asn1.define('PrivateKeyInfo', function () {
  this.seq().obj(
    this.key('version').int(),
    this.key('algorithm').use(AlgorithmIdentifier),
    this.key('subjectPrivateKey').octstr()
  )
})
exports.PrivateKey = PrivateKeyInfo
var EncryptedPrivateKeyInfo = asn1.define('EncryptedPrivateKeyInfo', function () {
  this.seq().obj(
    this.key('algorithm').seq().obj(
      this.key('id').objid(),
      this.key('decrypt').seq().obj(
        this.key('kde').seq().obj(
          this.key('id').objid(),
          this.key('kdeparams').seq().obj(
            this.key('salt').octstr(),
            this.key('iters').int()
          )
        ),
        this.key('cipher').seq().obj(
          this.key('algo').objid(),
          this.key('iv').octstr()
        )
      )
    ),
    this.key('subjectPrivateKey').octstr()
  )
})

exports.EncryptedPrivateKey = EncryptedPrivateKeyInfo

var DSAPrivateKey = asn1.define('DSAPrivateKey', function () {
  this.seq().obj(
    this.key('version').int(),
    this.key('p').int(),
    this.key('q').int(),
    this.key('g').int(),
    this.key('pub_key').int(),
    this.key('priv_key').int()
  )
})
exports.DSAPrivateKey = DSAPrivateKey

exports.DSAparam = asn1.define('DSAparam', function () {
  this.int()
})

var ECPrivateKey = asn1.define('ECPrivateKey', function () {
  this.seq().obj(
    this.key('version').int(),
    this.key('privateKey').octstr(),
    this.key('parameters').optional().explicit(0).use(ECParameters),
    this.key('publicKey').optional().explicit(1).bitstr()
  )
})
exports.ECPrivateKey = ECPrivateKey

var ECParameters = asn1.define('ECParameters', function () {
  this.choice({
    namedCurve: this.objid()
  })
})

exports.signature = asn1.define('signature', function () {
  this.seq().obj(
    this.key('r').int(),
    this.key('s').int()
  )
})


/***/ }),
/* 288 */
/***/ (function(module, exports, __webpack_require__) {

var asn1 = __webpack_require__(71);
var inherits = __webpack_require__(1);

var api = exports;

api.define = function define(name, body) {
  return new Entity(name, body);
};

function Entity(name, body) {
  this.name = name;
  this.body = body;

  this.decoders = {};
  this.encoders = {};
};

Entity.prototype._createNamed = function createNamed(base) {
  var named;
  try {
    named = __webpack_require__(289).runInThisContext(
      '(function ' + this.name + '(entity) {\n' +
      '  this._initNamed(entity);\n' +
      '})'
    );
  } catch (e) {
    named = function (entity) {
      this._initNamed(entity);
    };
  }
  inherits(named, base);
  named.prototype._initNamed = function initnamed(entity) {
    base.call(this, entity);
  };

  return new named(this);
};

Entity.prototype._getDecoder = function _getDecoder(enc) {
  enc = enc || 'der';
  // Lazily create decoder
  if (!this.decoders.hasOwnProperty(enc))
    this.decoders[enc] = this._createNamed(asn1.decoders[enc]);
  return this.decoders[enc];
};

Entity.prototype.decode = function decode(data, enc, options) {
  return this._getDecoder(enc).decode(data, options);
};

Entity.prototype._getEncoder = function _getEncoder(enc) {
  enc = enc || 'der';
  // Lazily create encoder
  if (!this.encoders.hasOwnProperty(enc))
    this.encoders[enc] = this._createNamed(asn1.encoders[enc]);
  return this.encoders[enc];
};

Entity.prototype.encode = function encode(data, enc, /* internal */ reporter) {
  return this._getEncoder(enc).encode(data, reporter);
};


/***/ }),
/* 289 */
/***/ (function(module, exports, __webpack_require__) {

var indexOf = __webpack_require__(290);

var Object_keys = function (obj) {
    if (Object.keys) return Object.keys(obj)
    else {
        var res = [];
        for (var key in obj) res.push(key)
        return res;
    }
};

var forEach = function (xs, fn) {
    if (xs.forEach) return xs.forEach(fn)
    else for (var i = 0; i < xs.length; i++) {
        fn(xs[i], i, xs);
    }
};

var defineProp = (function() {
    try {
        Object.defineProperty({}, '_', {});
        return function(obj, name, value) {
            Object.defineProperty(obj, name, {
                writable: true,
                enumerable: false,
                configurable: true,
                value: value
            })
        };
    } catch(e) {
        return function(obj, name, value) {
            obj[name] = value;
        };
    }
}());

var globals = ['Array', 'Boolean', 'Date', 'Error', 'EvalError', 'Function',
'Infinity', 'JSON', 'Math', 'NaN', 'Number', 'Object', 'RangeError',
'ReferenceError', 'RegExp', 'String', 'SyntaxError', 'TypeError', 'URIError',
'decodeURI', 'decodeURIComponent', 'encodeURI', 'encodeURIComponent', 'escape',
'eval', 'isFinite', 'isNaN', 'parseFloat', 'parseInt', 'undefined', 'unescape'];

function Context() {}
Context.prototype = {};

var Script = exports.Script = function NodeScript (code) {
    if (!(this instanceof Script)) return new Script(code);
    this.code = code;
};

Script.prototype.runInContext = function (context) {
    if (!(context instanceof Context)) {
        throw new TypeError("needs a 'context' argument.");
    }
    
    var iframe = document.createElement('iframe');
    if (!iframe.style) iframe.style = {};
    iframe.style.display = 'none';
    
    document.body.appendChild(iframe);
    
    var win = iframe.contentWindow;
    var wEval = win.eval, wExecScript = win.execScript;

    if (!wEval && wExecScript) {
        // win.eval() magically appears when this is called in IE:
        wExecScript.call(win, 'null');
        wEval = win.eval;
    }
    
    forEach(Object_keys(context), function (key) {
        win[key] = context[key];
    });
    forEach(globals, function (key) {
        if (context[key]) {
            win[key] = context[key];
        }
    });
    
    var winKeys = Object_keys(win);

    var res = wEval.call(win, this.code);
    
    forEach(Object_keys(win), function (key) {
        // Avoid copying circular objects like `top` and `window` by only
        // updating existing context properties or new properties in the `win`
        // that was only introduced after the eval.
        if (key in context || indexOf(winKeys, key) === -1) {
            context[key] = win[key];
        }
    });

    forEach(globals, function (key) {
        if (!(key in context)) {
            defineProp(context, key, win[key]);
        }
    });
    
    document.body.removeChild(iframe);
    
    return res;
};

Script.prototype.runInThisContext = function () {
    return eval(this.code); // maybe...
};

Script.prototype.runInNewContext = function (context) {
    var ctx = Script.createContext(context);
    var res = this.runInContext(ctx);

    forEach(Object_keys(ctx), function (key) {
        context[key] = ctx[key];
    });

    return res;
};

forEach(Object_keys(Script.prototype), function (name) {
    exports[name] = Script[name] = function (code) {
        var s = Script(code);
        return s[name].apply(s, [].slice.call(arguments, 1));
    };
});

exports.createScript = function (code) {
    return exports.Script(code);
};

exports.createContext = Script.createContext = function (context) {
    var copy = new Context();
    if(typeof context === 'object') {
        forEach(Object_keys(context), function (key) {
            copy[key] = context[key];
        });
    }
    return copy;
};


/***/ }),
/* 290 */
/***/ (function(module, exports) {


var indexOf = [].indexOf;

module.exports = function(arr, obj){
  if (indexOf) return arr.indexOf(obj);
  for (var i = 0; i < arr.length; ++i) {
    if (arr[i] === obj) return i;
  }
  return -1;
};

/***/ }),
/* 291 */
/***/ (function(module, exports, __webpack_require__) {

var inherits = __webpack_require__(1);

function Reporter(options) {
  this._reporterState = {
    obj: null,
    path: [],
    options: options || {},
    errors: []
  };
}
exports.Reporter = Reporter;

Reporter.prototype.isError = function isError(obj) {
  return obj instanceof ReporterError;
};

Reporter.prototype.save = function save() {
  var state = this._reporterState;

  return { obj: state.obj, pathLen: state.path.length };
};

Reporter.prototype.restore = function restore(data) {
  var state = this._reporterState;

  state.obj = data.obj;
  state.path = state.path.slice(0, data.pathLen);
};

Reporter.prototype.enterKey = function enterKey(key) {
  return this._reporterState.path.push(key);
};

Reporter.prototype.exitKey = function exitKey(index) {
  var state = this._reporterState;

  state.path = state.path.slice(0, index - 1);
};

Reporter.prototype.leaveKey = function leaveKey(index, key, value) {
  var state = this._reporterState;

  this.exitKey(index);
  if (state.obj !== null)
    state.obj[key] = value;
};

Reporter.prototype.path = function path() {
  return this._reporterState.path.join('/');
};

Reporter.prototype.enterObject = function enterObject() {
  var state = this._reporterState;

  var prev = state.obj;
  state.obj = {};
  return prev;
};

Reporter.prototype.leaveObject = function leaveObject(prev) {
  var state = this._reporterState;

  var now = state.obj;
  state.obj = prev;
  return now;
};

Reporter.prototype.error = function error(msg) {
  var err;
  var state = this._reporterState;

  var inherited = msg instanceof ReporterError;
  if (inherited) {
    err = msg;
  } else {
    err = new ReporterError(state.path.map(function(elem) {
      return '[' + JSON.stringify(elem) + ']';
    }).join(''), msg.message || msg, msg.stack);
  }

  if (!state.options.partial)
    throw err;

  if (!inherited)
    state.errors.push(err);

  return err;
};

Reporter.prototype.wrapResult = function wrapResult(result) {
  var state = this._reporterState;
  if (!state.options.partial)
    return result;

  return {
    result: this.isError(result) ? null : result,
    errors: state.errors
  };
};

function ReporterError(path, msg) {
  this.path = path;
  this.rethrow(msg);
};
inherits(ReporterError, Error);

ReporterError.prototype.rethrow = function rethrow(msg) {
  this.message = msg + ' at: ' + (this.path || '(shallow)');
  if (Error.captureStackTrace)
    Error.captureStackTrace(this, ReporterError);

  if (!this.stack) {
    try {
      // IE only adds stack when thrown
      throw new Error(this.message);
    } catch (e) {
      this.stack = e.stack;
    }
  }
  return this;
};


/***/ }),
/* 292 */
/***/ (function(module, exports, __webpack_require__) {

var Reporter = __webpack_require__(72).Reporter;
var EncoderBuffer = __webpack_require__(72).EncoderBuffer;
var DecoderBuffer = __webpack_require__(72).DecoderBuffer;
var assert = __webpack_require__(22);

// Supported tags
var tags = [
  'seq', 'seqof', 'set', 'setof', 'objid', 'bool',
  'gentime', 'utctime', 'null_', 'enum', 'int', 'objDesc',
  'bitstr', 'bmpstr', 'charstr', 'genstr', 'graphstr', 'ia5str', 'iso646str',
  'numstr', 'octstr', 'printstr', 't61str', 'unistr', 'utf8str', 'videostr'
];

// Public methods list
var methods = [
  'key', 'obj', 'use', 'optional', 'explicit', 'implicit', 'def', 'choice',
  'any', 'contains'
].concat(tags);

// Overrided methods list
var overrided = [
  '_peekTag', '_decodeTag', '_use',
  '_decodeStr', '_decodeObjid', '_decodeTime',
  '_decodeNull', '_decodeInt', '_decodeBool', '_decodeList',

  '_encodeComposite', '_encodeStr', '_encodeObjid', '_encodeTime',
  '_encodeNull', '_encodeInt', '_encodeBool'
];

function Node(enc, parent) {
  var state = {};
  this._baseState = state;

  state.enc = enc;

  state.parent = parent || null;
  state.children = null;

  // State
  state.tag = null;
  state.args = null;
  state.reverseArgs = null;
  state.choice = null;
  state.optional = false;
  state.any = false;
  state.obj = false;
  state.use = null;
  state.useDecoder = null;
  state.key = null;
  state['default'] = null;
  state.explicit = null;
  state.implicit = null;
  state.contains = null;

  // Should create new instance on each method
  if (!state.parent) {
    state.children = [];
    this._wrap();
  }
}
module.exports = Node;

var stateProps = [
  'enc', 'parent', 'children', 'tag', 'args', 'reverseArgs', 'choice',
  'optional', 'any', 'obj', 'use', 'alteredUse', 'key', 'default', 'explicit',
  'implicit', 'contains'
];

Node.prototype.clone = function clone() {
  var state = this._baseState;
  var cstate = {};
  stateProps.forEach(function(prop) {
    cstate[prop] = state[prop];
  });
  var res = new this.constructor(cstate.parent);
  res._baseState = cstate;
  return res;
};

Node.prototype._wrap = function wrap() {
  var state = this._baseState;
  methods.forEach(function(method) {
    this[method] = function _wrappedMethod() {
      var clone = new this.constructor(this);
      state.children.push(clone);
      return clone[method].apply(clone, arguments);
    };
  }, this);
};

Node.prototype._init = function init(body) {
  var state = this._baseState;

  assert(state.parent === null);
  body.call(this);

  // Filter children
  state.children = state.children.filter(function(child) {
    return child._baseState.parent === this;
  }, this);
  assert.equal(state.children.length, 1, 'Root node can have only one child');
};

Node.prototype._useArgs = function useArgs(args) {
  var state = this._baseState;

  // Filter children and args
  var children = args.filter(function(arg) {
    return arg instanceof this.constructor;
  }, this);
  args = args.filter(function(arg) {
    return !(arg instanceof this.constructor);
  }, this);

  if (children.length !== 0) {
    assert(state.children === null);
    state.children = children;

    // Replace parent to maintain backward link
    children.forEach(function(child) {
      child._baseState.parent = this;
    }, this);
  }
  if (args.length !== 0) {
    assert(state.args === null);
    state.args = args;
    state.reverseArgs = args.map(function(arg) {
      if (typeof arg !== 'object' || arg.constructor !== Object)
        return arg;

      var res = {};
      Object.keys(arg).forEach(function(key) {
        if (key == (key | 0))
          key |= 0;
        var value = arg[key];
        res[value] = key;
      });
      return res;
    });
  }
};

//
// Overrided methods
//

overrided.forEach(function(method) {
  Node.prototype[method] = function _overrided() {
    var state = this._baseState;
    throw new Error(method + ' not implemented for encoding: ' + state.enc);
  };
});

//
// Public methods
//

tags.forEach(function(tag) {
  Node.prototype[tag] = function _tagMethod() {
    var state = this._baseState;
    var args = Array.prototype.slice.call(arguments);

    assert(state.tag === null);
    state.tag = tag;

    this._useArgs(args);

    return this;
  };
});

Node.prototype.use = function use(item) {
  assert(item);
  var state = this._baseState;

  assert(state.use === null);
  state.use = item;

  return this;
};

Node.prototype.optional = function optional() {
  var state = this._baseState;

  state.optional = true;

  return this;
};

Node.prototype.def = function def(val) {
  var state = this._baseState;

  assert(state['default'] === null);
  state['default'] = val;
  state.optional = true;

  return this;
};

Node.prototype.explicit = function explicit(num) {
  var state = this._baseState;

  assert(state.explicit === null && state.implicit === null);
  state.explicit = num;

  return this;
};

Node.prototype.implicit = function implicit(num) {
  var state = this._baseState;

  assert(state.explicit === null && state.implicit === null);
  state.implicit = num;

  return this;
};

Node.prototype.obj = function obj() {
  var state = this._baseState;
  var args = Array.prototype.slice.call(arguments);

  state.obj = true;

  if (args.length !== 0)
    this._useArgs(args);

  return this;
};

Node.prototype.key = function key(newKey) {
  var state = this._baseState;

  assert(state.key === null);
  state.key = newKey;

  return this;
};

Node.prototype.any = function any() {
  var state = this._baseState;

  state.any = true;

  return this;
};

Node.prototype.choice = function choice(obj) {
  var state = this._baseState;

  assert(state.choice === null);
  state.choice = obj;
  this._useArgs(Object.keys(obj).map(function(key) {
    return obj[key];
  }));

  return this;
};

Node.prototype.contains = function contains(item) {
  var state = this._baseState;

  assert(state.use === null);
  state.contains = item;

  return this;
};

//
// Decoding
//

Node.prototype._decode = function decode(input, options) {
  var state = this._baseState;

  // Decode root node
  if (state.parent === null)
    return input.wrapResult(state.children[0]._decode(input, options));

  var result = state['default'];
  var present = true;

  var prevKey = null;
  if (state.key !== null)
    prevKey = input.enterKey(state.key);

  // Check if tag is there
  if (state.optional) {
    var tag = null;
    if (state.explicit !== null)
      tag = state.explicit;
    else if (state.implicit !== null)
      tag = state.implicit;
    else if (state.tag !== null)
      tag = state.tag;

    if (tag === null && !state.any) {
      // Trial and Error
      var save = input.save();
      try {
        if (state.choice === null)
          this._decodeGeneric(state.tag, input, options);
        else
          this._decodeChoice(input, options);
        present = true;
      } catch (e) {
        present = false;
      }
      input.restore(save);
    } else {
      present = this._peekTag(input, tag, state.any);

      if (input.isError(present))
        return present;
    }
  }

  // Push object on stack
  var prevObj;
  if (state.obj && present)
    prevObj = input.enterObject();

  if (present) {
    // Unwrap explicit values
    if (state.explicit !== null) {
      var explicit = this._decodeTag(input, state.explicit);
      if (input.isError(explicit))
        return explicit;
      input = explicit;
    }

    var start = input.offset;

    // Unwrap implicit and normal values
    if (state.use === null && state.choice === null) {
      if (state.any)
        var save = input.save();
      var body = this._decodeTag(
        input,
        state.implicit !== null ? state.implicit : state.tag,
        state.any
      );
      if (input.isError(body))
        return body;

      if (state.any)
        result = input.raw(save);
      else
        input = body;
    }

    if (options && options.track && state.tag !== null)
      options.track(input.path(), start, input.length, 'tagged');

    if (options && options.track && state.tag !== null)
      options.track(input.path(), input.offset, input.length, 'content');

    // Select proper method for tag
    if (state.any)
      result = result;
    else if (state.choice === null)
      result = this._decodeGeneric(state.tag, input, options);
    else
      result = this._decodeChoice(input, options);

    if (input.isError(result))
      return result;

    // Decode children
    if (!state.any && state.choice === null && state.children !== null) {
      state.children.forEach(function decodeChildren(child) {
        // NOTE: We are ignoring errors here, to let parser continue with other
        // parts of encoded data
        child._decode(input, options);
      });
    }

    // Decode contained/encoded by schema, only in bit or octet strings
    if (state.contains && (state.tag === 'octstr' || state.tag === 'bitstr')) {
      var data = new DecoderBuffer(result);
      result = this._getUse(state.contains, input._reporterState.obj)
          ._decode(data, options);
    }
  }

  // Pop object
  if (state.obj && present)
    result = input.leaveObject(prevObj);

  // Set key
  if (state.key !== null && (result !== null || present === true))
    input.leaveKey(prevKey, state.key, result);
  else if (prevKey !== null)
    input.exitKey(prevKey);

  return result;
};

Node.prototype._decodeGeneric = function decodeGeneric(tag, input, options) {
  var state = this._baseState;

  if (tag === 'seq' || tag === 'set')
    return null;
  if (tag === 'seqof' || tag === 'setof')
    return this._decodeList(input, tag, state.args[0], options);
  else if (/str$/.test(tag))
    return this._decodeStr(input, tag, options);
  else if (tag === 'objid' && state.args)
    return this._decodeObjid(input, state.args[0], state.args[1], options);
  else if (tag === 'objid')
    return this._decodeObjid(input, null, null, options);
  else if (tag === 'gentime' || tag === 'utctime')
    return this._decodeTime(input, tag, options);
  else if (tag === 'null_')
    return this._decodeNull(input, options);
  else if (tag === 'bool')
    return this._decodeBool(input, options);
  else if (tag === 'objDesc')
    return this._decodeStr(input, tag, options);
  else if (tag === 'int' || tag === 'enum')
    return this._decodeInt(input, state.args && state.args[0], options);

  if (state.use !== null) {
    return this._getUse(state.use, input._reporterState.obj)
        ._decode(input, options);
  } else {
    return input.error('unknown tag: ' + tag);
  }
};

Node.prototype._getUse = function _getUse(entity, obj) {

  var state = this._baseState;
  // Create altered use decoder if implicit is set
  state.useDecoder = this._use(entity, obj);
  assert(state.useDecoder._baseState.parent === null);
  state.useDecoder = state.useDecoder._baseState.children[0];
  if (state.implicit !== state.useDecoder._baseState.implicit) {
    state.useDecoder = state.useDecoder.clone();
    state.useDecoder._baseState.implicit = state.implicit;
  }
  return state.useDecoder;
};

Node.prototype._decodeChoice = function decodeChoice(input, options) {
  var state = this._baseState;
  var result = null;
  var match = false;

  Object.keys(state.choice).some(function(key) {
    var save = input.save();
    var node = state.choice[key];
    try {
      var value = node._decode(input, options);
      if (input.isError(value))
        return false;

      result = { type: key, value: value };
      match = true;
    } catch (e) {
      input.restore(save);
      return false;
    }
    return true;
  }, this);

  if (!match)
    return input.error('Choice not matched');

  return result;
};

//
// Encoding
//

Node.prototype._createEncoderBuffer = function createEncoderBuffer(data) {
  return new EncoderBuffer(data, this.reporter);
};

Node.prototype._encode = function encode(data, reporter, parent) {
  var state = this._baseState;
  if (state['default'] !== null && state['default'] === data)
    return;

  var result = this._encodeValue(data, reporter, parent);
  if (result === undefined)
    return;

  if (this._skipDefault(result, reporter, parent))
    return;

  return result;
};

Node.prototype._encodeValue = function encode(data, reporter, parent) {
  var state = this._baseState;

  // Decode root node
  if (state.parent === null)
    return state.children[0]._encode(data, reporter || new Reporter());

  var result = null;

  // Set reporter to share it with a child class
  this.reporter = reporter;

  // Check if data is there
  if (state.optional && data === undefined) {
    if (state['default'] !== null)
      data = state['default']
    else
      return;
  }

  // Encode children first
  var content = null;
  var primitive = false;
  if (state.any) {
    // Anything that was given is translated to buffer
    result = this._createEncoderBuffer(data);
  } else if (state.choice) {
    result = this._encodeChoice(data, reporter);
  } else if (state.contains) {
    content = this._getUse(state.contains, parent)._encode(data, reporter);
    primitive = true;
  } else if (state.children) {
    content = state.children.map(function(child) {
      if (child._baseState.tag === 'null_')
        return child._encode(null, reporter, data);

      if (child._baseState.key === null)
        return reporter.error('Child should have a key');
      var prevKey = reporter.enterKey(child._baseState.key);

      if (typeof data !== 'object')
        return reporter.error('Child expected, but input is not object');

      var res = child._encode(data[child._baseState.key], reporter, data);
      reporter.leaveKey(prevKey);

      return res;
    }, this).filter(function(child) {
      return child;
    });
    content = this._createEncoderBuffer(content);
  } else {
    if (state.tag === 'seqof' || state.tag === 'setof') {
      // TODO(indutny): this should be thrown on DSL level
      if (!(state.args && state.args.length === 1))
        return reporter.error('Too many args for : ' + state.tag);

      if (!Array.isArray(data))
        return reporter.error('seqof/setof, but data is not Array');

      var child = this.clone();
      child._baseState.implicit = null;
      content = this._createEncoderBuffer(data.map(function(item) {
        var state = this._baseState;

        return this._getUse(state.args[0], data)._encode(item, reporter);
      }, child));
    } else if (state.use !== null) {
      result = this._getUse(state.use, parent)._encode(data, reporter);
    } else {
      content = this._encodePrimitive(state.tag, data);
      primitive = true;
    }
  }

  // Encode data itself
  var result;
  if (!state.any && state.choice === null) {
    var tag = state.implicit !== null ? state.implicit : state.tag;
    var cls = state.implicit === null ? 'universal' : 'context';

    if (tag === null) {
      if (state.use === null)
        reporter.error('Tag could be ommited only for .use()');
    } else {
      if (state.use === null)
        result = this._encodeComposite(tag, primitive, cls, content);
    }
  }

  // Wrap in explicit
  if (state.explicit !== null)
    result = this._encodeComposite(state.explicit, false, 'context', result);

  return result;
};

Node.prototype._encodeChoice = function encodeChoice(data, reporter) {
  var state = this._baseState;

  var node = state.choice[data.type];
  if (!node) {
    assert(
        false,
        data.type + ' not found in ' +
            JSON.stringify(Object.keys(state.choice)));
  }
  return node._encode(data.value, reporter);
};

Node.prototype._encodePrimitive = function encodePrimitive(tag, data) {
  var state = this._baseState;

  if (/str$/.test(tag))
    return this._encodeStr(data, tag);
  else if (tag === 'objid' && state.args)
    return this._encodeObjid(data, state.reverseArgs[0], state.args[1]);
  else if (tag === 'objid')
    return this._encodeObjid(data, null, null);
  else if (tag === 'gentime' || tag === 'utctime')
    return this._encodeTime(data, tag);
  else if (tag === 'null_')
    return this._encodeNull();
  else if (tag === 'int' || tag === 'enum')
    return this._encodeInt(data, state.args && state.reverseArgs[0]);
  else if (tag === 'bool')
    return this._encodeBool(data);
  else if (tag === 'objDesc')
    return this._encodeStr(data, tag);
  else
    throw new Error('Unsupported tag: ' + tag);
};

Node.prototype._isNumstr = function isNumstr(str) {
  return /^[0-9 ]*$/.test(str);
};

Node.prototype._isPrintstr = function isPrintstr(str) {
  return /^[A-Za-z0-9 '\(\)\+,\-\.\/:=\?]*$/.test(str);
};


/***/ }),
/* 293 */
/***/ (function(module, exports, __webpack_require__) {

var constants = __webpack_require__(172);

exports.tagClass = {
  0: 'universal',
  1: 'application',
  2: 'context',
  3: 'private'
};
exports.tagClassByName = constants._reverse(exports.tagClass);

exports.tag = {
  0x00: 'end',
  0x01: 'bool',
  0x02: 'int',
  0x03: 'bitstr',
  0x04: 'octstr',
  0x05: 'null_',
  0x06: 'objid',
  0x07: 'objDesc',
  0x08: 'external',
  0x09: 'real',
  0x0a: 'enum',
  0x0b: 'embed',
  0x0c: 'utf8str',
  0x0d: 'relativeOid',
  0x10: 'seq',
  0x11: 'set',
  0x12: 'numstr',
  0x13: 'printstr',
  0x14: 't61str',
  0x15: 'videostr',
  0x16: 'ia5str',
  0x17: 'utctime',
  0x18: 'gentime',
  0x19: 'graphstr',
  0x1a: 'iso646str',
  0x1b: 'genstr',
  0x1c: 'unistr',
  0x1d: 'charstr',
  0x1e: 'bmpstr'
};
exports.tagByName = constants._reverse(exports.tag);


/***/ }),
/* 294 */
/***/ (function(module, exports, __webpack_require__) {

var decoders = exports;

decoders.der = __webpack_require__(173);
decoders.pem = __webpack_require__(295);


/***/ }),
/* 295 */
/***/ (function(module, exports, __webpack_require__) {

var inherits = __webpack_require__(1);
var Buffer = __webpack_require__(6).Buffer;

var DERDecoder = __webpack_require__(173);

function PEMDecoder(entity) {
  DERDecoder.call(this, entity);
  this.enc = 'pem';
};
inherits(PEMDecoder, DERDecoder);
module.exports = PEMDecoder;

PEMDecoder.prototype.decode = function decode(data, options) {
  var lines = data.toString().split(/[\r\n]+/g);

  var label = options.label.toUpperCase();

  var re = /^-----(BEGIN|END) ([^-]+)-----$/;
  var start = -1;
  var end = -1;
  for (var i = 0; i < lines.length; i++) {
    var match = lines[i].match(re);
    if (match === null)
      continue;

    if (match[2] !== label)
      continue;

    if (start === -1) {
      if (match[1] !== 'BEGIN')
        break;
      start = i;
    } else {
      if (match[1] !== 'END')
        break;
      end = i;
      break;
    }
  }
  if (start === -1 || end === -1)
    throw new Error('PEM section not found for: ' + label);

  var base64 = lines.slice(start + 1, end).join('');
  // Remove excessive symbols
  base64.replace(/[^a-z0-9\+\/=]+/gi, '');

  var input = new Buffer(base64, 'base64');
  return DERDecoder.prototype.decode.call(this, input, options);
};


/***/ }),
/* 296 */
/***/ (function(module, exports, __webpack_require__) {

var encoders = exports;

encoders.der = __webpack_require__(174);
encoders.pem = __webpack_require__(297);


/***/ }),
/* 297 */
/***/ (function(module, exports, __webpack_require__) {

var inherits = __webpack_require__(1);

var DEREncoder = __webpack_require__(174);

function PEMEncoder(entity) {
  DEREncoder.call(this, entity);
  this.enc = 'pem';
};
inherits(PEMEncoder, DEREncoder);
module.exports = PEMEncoder;

PEMEncoder.prototype.encode = function encode(data, options) {
  var buf = DEREncoder.prototype.encode.call(this, data);

  var p = buf.toString('base64');
  var out = [ '-----BEGIN ' + options.label + '-----' ];
  for (var i = 0; i < p.length; i += 64)
    out.push(p.slice(i, i + 64));
  out.push('-----END ' + options.label + '-----');
  return out.join('\n');
};


/***/ }),
/* 298 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";
// from https://github.com/Rantanen/node-dtls/blob/25a7dc861bda38cfeac93a723500eea4f0ac2e86/Certificate.js
// thanks to @Rantanen



var asn = __webpack_require__(71)

var Time = asn.define('Time', function () {
  this.choice({
    utcTime: this.utctime(),
    generalTime: this.gentime()
  })
})

var AttributeTypeValue = asn.define('AttributeTypeValue', function () {
  this.seq().obj(
    this.key('type').objid(),
    this.key('value').any()
  )
})

var AlgorithmIdentifier = asn.define('AlgorithmIdentifier', function () {
  this.seq().obj(
    this.key('algorithm').objid(),
    this.key('parameters').optional()
  )
})

var SubjectPublicKeyInfo = asn.define('SubjectPublicKeyInfo', function () {
  this.seq().obj(
    this.key('algorithm').use(AlgorithmIdentifier),
    this.key('subjectPublicKey').bitstr()
  )
})

var RelativeDistinguishedName = asn.define('RelativeDistinguishedName', function () {
  this.setof(AttributeTypeValue)
})

var RDNSequence = asn.define('RDNSequence', function () {
  this.seqof(RelativeDistinguishedName)
})

var Name = asn.define('Name', function () {
  this.choice({
    rdnSequence: this.use(RDNSequence)
  })
})

var Validity = asn.define('Validity', function () {
  this.seq().obj(
    this.key('notBefore').use(Time),
    this.key('notAfter').use(Time)
  )
})

var Extension = asn.define('Extension', function () {
  this.seq().obj(
    this.key('extnID').objid(),
    this.key('critical').bool().def(false),
    this.key('extnValue').octstr()
  )
})

var TBSCertificate = asn.define('TBSCertificate', function () {
  this.seq().obj(
    this.key('version').explicit(0).int(),
    this.key('serialNumber').int(),
    this.key('signature').use(AlgorithmIdentifier),
    this.key('issuer').use(Name),
    this.key('validity').use(Validity),
    this.key('subject').use(Name),
    this.key('subjectPublicKeyInfo').use(SubjectPublicKeyInfo),
    this.key('issuerUniqueID').implicit(1).bitstr().optional(),
    this.key('subjectUniqueID').implicit(2).bitstr().optional(),
    this.key('extensions').explicit(3).seqof(Extension).optional()
  )
})

var X509Certificate = asn.define('X509Certificate', function () {
  this.seq().obj(
    this.key('tbsCertificate').use(TBSCertificate),
    this.key('signatureAlgorithm').use(AlgorithmIdentifier),
    this.key('signatureValue').bitstr()
  )
})

module.exports = X509Certificate


/***/ }),
/* 299 */
/***/ (function(module, exports) {

module.exports = {"2.16.840.1.101.3.4.1.1":"aes-128-ecb","2.16.840.1.101.3.4.1.2":"aes-128-cbc","2.16.840.1.101.3.4.1.3":"aes-128-ofb","2.16.840.1.101.3.4.1.4":"aes-128-cfb","2.16.840.1.101.3.4.1.21":"aes-192-ecb","2.16.840.1.101.3.4.1.22":"aes-192-cbc","2.16.840.1.101.3.4.1.23":"aes-192-ofb","2.16.840.1.101.3.4.1.24":"aes-192-cfb","2.16.840.1.101.3.4.1.41":"aes-256-ecb","2.16.840.1.101.3.4.1.42":"aes-256-cbc","2.16.840.1.101.3.4.1.43":"aes-256-ofb","2.16.840.1.101.3.4.1.44":"aes-256-cfb"}

/***/ }),
/* 300 */
/***/ (function(module, exports, __webpack_require__) {

/* WEBPACK VAR INJECTION */(function(Buffer) {// adapted from https://github.com/apatil/pemstrip
var findProc = /Proc-Type: 4,ENCRYPTED\n\r?DEK-Info: AES-((?:128)|(?:192)|(?:256))-CBC,([0-9A-H]+)\n\r?\n\r?([0-9A-z\n\r\+\/\=]+)\n\r?/m
var startRegex = /^-----BEGIN ((?:.* KEY)|CERTIFICATE)-----\n/m
var fullRegex = /^-----BEGIN ((?:.* KEY)|CERTIFICATE)-----\n\r?([0-9A-z\n\r\+\/\=]+)\n\r?-----END \1-----$/m
var evp = __webpack_require__(78)
var ciphers = __webpack_require__(108)
module.exports = function (okey, password) {
  var key = okey.toString()
  var match = key.match(findProc)
  var decrypted
  if (!match) {
    var match2 = key.match(fullRegex)
    decrypted = new Buffer(match2[2].replace(/\r?\n/g, ''), 'base64')
  } else {
    var suite = 'aes' + match[1]
    var iv = new Buffer(match[2], 'hex')
    var cipherText = new Buffer(match[3].replace(/\r?\n/g, ''), 'base64')
    var cipherKey = evp(password, iv.slice(0, 8), parseInt(match[1], 10)).key
    var out = []
    var cipher = ciphers.createDecipheriv(suite, cipherKey, iv)
    out.push(cipher.update(cipherText))
    out.push(cipher.final())
    decrypted = Buffer.concat(out)
  }
  var tag = key.match(startRegex)[1]
  return {
    tag: tag,
    data: decrypted
  }
}

/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(6).Buffer))

/***/ }),
/* 301 */
/***/ (function(module, exports, __webpack_require__) {

/* WEBPACK VAR INJECTION */(function(Buffer) {// much of this based on https://github.com/indutny/self-signed/blob/gh-pages/lib/rsa.js
var BN = __webpack_require__(13)
var EC = __webpack_require__(17).ec
var parseKeys = __webpack_require__(81)
var curves = __webpack_require__(175)

function verify (sig, hash, key, signType, tag) {
  var pub = parseKeys(key)
  if (pub.type === 'ec') {
    // rsa keys can be interpreted as ecdsa ones in openssl
    if (signType !== 'ecdsa' && signType !== 'ecdsa/rsa') throw new Error('wrong public key type')
    return ecVerify(sig, hash, pub)
  } else if (pub.type === 'dsa') {
    if (signType !== 'dsa') throw new Error('wrong public key type')
    return dsaVerify(sig, hash, pub)
  } else {
    if (signType !== 'rsa' && signType !== 'ecdsa/rsa') throw new Error('wrong public key type')
  }
  hash = Buffer.concat([tag, hash])
  var len = pub.modulus.byteLength()
  var pad = [ 1 ]
  var padNum = 0
  while (hash.length + pad.length + 2 < len) {
    pad.push(0xff)
    padNum++
  }
  pad.push(0x00)
  var i = -1
  while (++i < hash.length) {
    pad.push(hash[i])
  }
  pad = new Buffer(pad)
  var red = BN.mont(pub.modulus)
  sig = new BN(sig).toRed(red)

  sig = sig.redPow(new BN(pub.publicExponent))
  sig = new Buffer(sig.fromRed().toArray())
  var out = padNum < 8 ? 1 : 0
  len = Math.min(sig.length, pad.length)
  if (sig.length !== pad.length) out = 1

  i = -1
  while (++i < len) out |= sig[i] ^ pad[i]
  return out === 0
}

function ecVerify (sig, hash, pub) {
  var curveId = curves[pub.data.algorithm.curve.join('.')]
  if (!curveId) throw new Error('unknown curve ' + pub.data.algorithm.curve.join('.'))

  var curve = new EC(curveId)
  var pubkey = pub.data.subjectPrivateKey.data

  return curve.verify(hash, sig, pubkey)
}

function dsaVerify (sig, hash, pub) {
  var p = pub.data.p
  var q = pub.data.q
  var g = pub.data.g
  var y = pub.data.pub_key
  var unpacked = parseKeys.signature.decode(sig, 'der')
  var s = unpacked.s
  var r = unpacked.r
  checkValue(s, q)
  checkValue(r, q)
  var montp = BN.mont(p)
  var w = s.invm(q)
  var v = g.toRed(montp)
    .redPow(new BN(hash).mul(w).mod(q))
    .fromRed()
    .mul(y.toRed(montp).redPow(r.mul(w).mod(q)).fromRed())
    .mod(p)
    .mod(q)
  return v.cmp(r) === 0
}

function checkValue (b, q) {
  if (b.cmpn(0) <= 0) throw new Error('invalid sig')
  if (b.cmp(q) >= q) throw new Error('invalid sig')
}

module.exports = verify

/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(6).Buffer))

/***/ }),
/* 302 */
/***/ (function(module, exports, __webpack_require__) {

/* WEBPACK VAR INJECTION */(function(Buffer) {var elliptic = __webpack_require__(17);
var BN = __webpack_require__(13);

module.exports = function createECDH(curve) {
	return new ECDH(curve);
};

var aliases = {
	secp256k1: {
		name: 'secp256k1',
		byteLength: 32
	},
	secp224r1: {
		name: 'p224',
		byteLength: 28
	},
	prime256v1: {
		name: 'p256',
		byteLength: 32
	},
	prime192v1: {
		name: 'p192',
		byteLength: 24
	},
	ed25519: {
		name: 'ed25519',
		byteLength: 32
	},
	secp384r1: {
		name: 'p384',
		byteLength: 48
	},
	secp521r1: {
		name: 'p521',
		byteLength: 66
	}
};

aliases.p224 = aliases.secp224r1;
aliases.p256 = aliases.secp256r1 = aliases.prime256v1;
aliases.p192 = aliases.secp192r1 = aliases.prime192v1;
aliases.p384 = aliases.secp384r1;
aliases.p521 = aliases.secp521r1;

function ECDH(curve) {
	this.curveType = aliases[curve];
	if (!this.curveType ) {
		this.curveType = {
			name: curve
		};
	}
	this.curve = new elliptic.ec(this.curveType.name);
	this.keys = void 0;
}

ECDH.prototype.generateKeys = function (enc, format) {
	this.keys = this.curve.genKeyPair();
	return this.getPublicKey(enc, format);
};

ECDH.prototype.computeSecret = function (other, inenc, enc) {
	inenc = inenc || 'utf8';
	if (!Buffer.isBuffer(other)) {
		other = new Buffer(other, inenc);
	}
	var otherPub = this.curve.keyFromPublic(other).getPublic();
	var out = otherPub.mul(this.keys.getPrivate()).getX();
	return formatReturnValue(out, enc, this.curveType.byteLength);
};

ECDH.prototype.getPublicKey = function (enc, format) {
	var key = this.keys.getPublic(format === 'compressed', true);
	if (format === 'hybrid') {
		if (key[key.length - 1] % 2) {
			key[0] = 7;
		} else {
			key [0] = 6;
		}
	}
	return formatReturnValue(key, enc);
};

ECDH.prototype.getPrivateKey = function (enc) {
	return formatReturnValue(this.keys.getPrivate(), enc);
};

ECDH.prototype.setPublicKey = function (pub, enc) {
	enc = enc || 'utf8';
	if (!Buffer.isBuffer(pub)) {
		pub = new Buffer(pub, enc);
	}
	this.keys._importPublic(pub);
	return this;
};

ECDH.prototype.setPrivateKey = function (priv, enc) {
	enc = enc || 'utf8';
	if (!Buffer.isBuffer(priv)) {
		priv = new Buffer(priv, enc);
	}
	var _priv = new BN(priv);
	_priv = _priv.toString(16);
	this.keys._importPrivate(_priv);
	return this;
};

function formatReturnValue(bn, enc, len) {
	if (!Array.isArray(bn)) {
		bn = bn.toArray();
	}
	var buf = new Buffer(bn);
	if (len && buf.length < len) {
		var zeros = new Buffer(len - buf.length);
		zeros.fill(0);
		buf = Buffer.concat([zeros, buf]);
	}
	if (!enc) {
		return buf;
	} else {
		return buf.toString(enc);
	}
}

/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(6).Buffer))

/***/ }),
/* 303 */
/***/ (function(module, exports, __webpack_require__) {

exports.publicEncrypt = __webpack_require__(304);
exports.privateDecrypt = __webpack_require__(305);

exports.privateEncrypt = function privateEncrypt(key, buf) {
  return exports.publicEncrypt(key, buf, true);
};

exports.publicDecrypt = function publicDecrypt(key, buf) {
  return exports.privateDecrypt(key, buf, true);
};

/***/ }),
/* 304 */
/***/ (function(module, exports, __webpack_require__) {

/* WEBPACK VAR INJECTION */(function(Buffer) {var parseKeys = __webpack_require__(81);
var randomBytes = __webpack_require__(66);
var createHash = __webpack_require__(67);
var mgf = __webpack_require__(176);
var xor = __webpack_require__(177);
var bn = __webpack_require__(13);
var withPublic = __webpack_require__(178);
var crt = __webpack_require__(111);

var constants = {
  RSA_PKCS1_OAEP_PADDING: 4,
  RSA_PKCS1_PADDIN: 1,
  RSA_NO_PADDING: 3
};

module.exports = function publicEncrypt(public_key, msg, reverse) {
  var padding;
  if (public_key.padding) {
    padding = public_key.padding;
  } else if (reverse) {
    padding = 1;
  } else {
    padding = 4;
  }
  var key = parseKeys(public_key);
  var paddedMsg;
  if (padding === 4) {
    paddedMsg = oaep(key, msg);
  } else if (padding === 1) {
    paddedMsg = pkcs1(key, msg, reverse);
  } else if (padding === 3) {
    paddedMsg = new bn(msg);
    if (paddedMsg.cmp(key.modulus) >= 0) {
      throw new Error('data too long for modulus');
    }
  } else {
    throw new Error('unknown padding');
  }
  if (reverse) {
    return crt(paddedMsg, key);
  } else {
    return withPublic(paddedMsg, key);
  }
};

function oaep(key, msg){
  var k = key.modulus.byteLength();
  var mLen = msg.length;
  var iHash = createHash('sha1').update(new Buffer('')).digest();
  var hLen = iHash.length;
  var hLen2 = 2 * hLen;
  if (mLen > k - hLen2 - 2) {
    throw new Error('message too long');
  }
  var ps = new Buffer(k - mLen - hLen2 - 2);
  ps.fill(0);
  var dblen = k - hLen - 1;
  var seed = randomBytes(hLen);
  var maskedDb = xor(Buffer.concat([iHash, ps, new Buffer([1]), msg], dblen), mgf(seed, dblen));
  var maskedSeed = xor(seed, mgf(maskedDb, hLen));
  return new bn(Buffer.concat([new Buffer([0]), maskedSeed, maskedDb], k));
}
function pkcs1(key, msg, reverse){
  var mLen = msg.length;
  var k = key.modulus.byteLength();
  if (mLen > k - 11) {
    throw new Error('message too long');
  }
  var ps;
  if (reverse) {
    ps = new Buffer(k - mLen - 3);
    ps.fill(0xff);
  } else {
    ps = nonZero(k - mLen - 3);
  }
  return new bn(Buffer.concat([new Buffer([0, reverse?1:2]), ps, new Buffer([0]), msg], k));
}
function nonZero(len, crypto) {
  var out = new Buffer(len);
  var i = 0;
  var cache = randomBytes(len*2);
  var cur = 0;
  var num;
  while (i < len) {
    if (cur === cache.length) {
      cache = randomBytes(len*2);
      cur = 0;
    }
    num = cache[cur++];
    if (num) {
      out[i++] = num;
    }
  }
  return out;
}
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(6).Buffer))

/***/ }),
/* 305 */
/***/ (function(module, exports, __webpack_require__) {

/* WEBPACK VAR INJECTION */(function(Buffer) {var parseKeys = __webpack_require__(81);
var mgf = __webpack_require__(176);
var xor = __webpack_require__(177);
var bn = __webpack_require__(13);
var crt = __webpack_require__(111);
var createHash = __webpack_require__(67);
var withPublic = __webpack_require__(178);
module.exports = function privateDecrypt(private_key, enc, reverse) {
  var padding;
  if (private_key.padding) {
    padding = private_key.padding;
  } else if (reverse) {
    padding = 1;
  } else {
    padding = 4;
  }
  
  var key = parseKeys(private_key);
  var k = key.modulus.byteLength();
  if (enc.length > k || new bn(enc).cmp(key.modulus) >= 0) {
    throw new Error('decryption error');
  }
  var msg;
  if (reverse) {
    msg = withPublic(new bn(enc), key);
  } else {
    msg = crt(enc, key);
  }
  var zBuffer = new Buffer(k - msg.length);
  zBuffer.fill(0);
  msg = Buffer.concat([zBuffer, msg], k);
  if (padding === 4) {
    return oaep(key, msg);
  } else if (padding === 1) {
    return pkcs1(key, msg, reverse);
  } else if (padding === 3) {
    return msg;
  } else {
    throw new Error('unknown padding');
  }
};

function oaep(key, msg){
  var n = key.modulus;
  var k = key.modulus.byteLength();
  var mLen = msg.length;
  var iHash = createHash('sha1').update(new Buffer('')).digest();
  var hLen = iHash.length;
  var hLen2 = 2 * hLen;
  if (msg[0] !== 0) {
    throw new Error('decryption error');
  }
  var maskedSeed = msg.slice(1, hLen + 1);
  var maskedDb =  msg.slice(hLen + 1);
  var seed = xor(maskedSeed, mgf(maskedDb, hLen));
  var db = xor(maskedDb, mgf(seed, k - hLen - 1));
  if (compare(iHash, db.slice(0, hLen))) {
    throw new Error('decryption error');
  }
  var i = hLen;
  while (db[i] === 0) {
    i++;
  }
  if (db[i++] !== 1) {
    throw new Error('decryption error');
  }
  return db.slice(i);
}

function pkcs1(key, msg, reverse){
  var p1 = msg.slice(0, 2);
  var i = 2;
  var status = 0;
  while (msg[i++] !== 0) {
    if (i >= msg.length) {
      status++;
      break;
    }
  }
  var ps = msg.slice(2, i - 1);
  var p2 = msg.slice(i - 1, i);

  if ((p1.toString('hex') !== '0002' && !reverse) || (p1.toString('hex') !== '0001' && reverse)){
    status++;
  }
  if (ps.length < 8) {
    status++;
  }
  if (status) {
    throw new Error('decryption error');
  }
  return  msg.slice(i);
}
function compare(a, b){
  a = new Buffer(a);
  b = new Buffer(b);
  var dif = 0;
  var len = a.length;
  if (a.length !== b.length) {
    dif++;
    len = Math.min(a.length, b.length);
  }
  var i = -1;
  while (++i < len) {
    dif += (a[i] ^ b[i]);
  }
  return dif;
}
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(6).Buffer))

/***/ }),
/* 306 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


function _asyncToGenerator(fn) { return function () { var gen = fn.apply(this, arguments); return new Promise(function (resolve, reject) { function step(key, arg) { try { var info = gen[key](arg); var value = info.value; } catch (error) { reject(error); return; } if (info.done) { resolve(value); } else { return Promise.resolve(value).then(function (value) { step("next", value); }, function (err) { step("throw", err); }); } } return step("next"); }); }; }

/// Deps
__webpack_require__(307);
var crypto = __webpack_require__(145);
var Crypto = __webpack_require__(213);
var Encryption = __webpack_require__(538);
var pify = __webpack_require__(539);
// Setup Provider
var iota = {};
var Mam = {};

/**
 * Initialisation function which returns a state object
 * @param  {object} externalIOTA
 * @param  {string} seed
 * @param  {integer} security
 */
var init = function init() {
  var externalIOTA = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
  var seed = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : keyGen(81);
  var security = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : 2;

  // Set IOTA object
  iota = externalIOTA;
  // Setup Personal Channel
  var channel = {
    side_key: null,
    mode: 'public',
    next_root: null,
    security: security,
    start: 0,
    count: 1,
    next_count: 1,
    index: 0
    // Setup Subs
  };var subscribed = [];
  return {
    subscribed: subscribed,
    channel: channel,
    seed: seed
  };
};
/**
 * Add a subscription to your state object
 * @param  {object} state
 * @param  {string} channelRoot
 * @param  {string} channelKey
 */
var subscribe = function subscribe(state, channelRoot) {
  var channelKey = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : null;

  state.subscribed[channelRoot] = {
    channelKey: channelKey,
    timeout: 5000,
    root: channelRoot,
    next_root: null,
    active: true
  };
  return state;
};

var changeMode = function changeMode(state, mode, sidekey) {
  if (mode !== 'public' && mode !== 'private' && mode !== 'restricted') return console.log('Did not recognise mode!');
  if (mode === 'restricted' && !sidekey) return console.log('You must specify a side key for a restricted channel');
  if (sidekey) state.channel.side_key = sidekey;
  state.channel.mode = mode;
  return state;
};

/**
 * create 
 * @param  {object} state
 * @param  {sting} message // Tryte encoded string
 */
var create = function create(state, message) {
  var channel = state.channel;
  // Interact with MAM Lib
  var mam = Mam.createMessage(state.seed, message, channel.side_key, channel);
  // If the tree is exhausted.
  if (channel.index == channel.count - 1) {
    // change start to begining of next tree.
    channel.start = channel.next_count + channel.start;
    // Reset index.
    channel.index = 0;
  } else {
    //Else step the tree.
    channel.index++;
  }

  // Advance Channel
  channel.next_root = mam.next_root;
  state.channel = channel;

  // Generate attachement address
  var address = void 0;
  if (channel.mode !== 'public') {
    address = Crypto.converter.trytes(Encryption.hash(81, Crypto.converter.trits(mam.root.slice())));
  } else {
    address = mam.root;
  }
  return {
    state,
    payload: mam.payload,
    root: mam.root,
    address: address
  };
};

// Current root
var getRoot = function getRoot(state) {
  return Mam.getMamRoot(state.seed, state.channel);
};
var decode = function decode(payload, side_key, root) {
  var mam = Mam.decodeMessage(payload, side_key, root);
  return mam;
};

var fetch = function () {
  var _ref = _asyncToGenerator( /*#__PURE__*/regeneratorRuntime.mark(function _callee(address, mode, sidekey, callback) {
    var rounds = arguments.length > 4 && arguments[4] !== undefined ? arguments[4] : 81;

    var consumedAll, messages, nextRoot, transactionCount, messageCount, hashes, messagesGen, _iteratorNormalCompletion, _didIteratorError, _iteratorError, _iterator, _step, message, unmasked, resp;

    return regeneratorRuntime.wrap(function _callee$(_context) {
      while (1) {
        switch (_context.prev = _context.next) {
          case 0:
            consumedAll = false;

            if (!callback) messages = [];
            nextRoot = address;
            transactionCount = 0;
            messageCount = 0;

          case 5:
            if (consumedAll) {
              _context.next = 54;
              break;
            }

            // Apply channel mode
            address = nextRoot;
            if (mode === 'private' || mode === 'restricted') address = hash(nextRoot, rounds);
            // Fetching
            _context.next = 10;
            return pify(iota.api.findTransactions.bind(iota.api))({
              addresses: [address]
            });

          case 10:
            hashes = _context.sent;

            if (!(hashes.length == 0)) {
              _context.next = 14;
              break;
            }

            consumedAll = true;
            return _context.abrupt('break', 54);

          case 14:

            transactionCount += hashes.length;
            messageCount++;

            _context.next = 18;
            return txHashesToMessages(hashes);

          case 18:
            messagesGen = _context.sent;
            _iteratorNormalCompletion = true;
            _didIteratorError = false;
            _iteratorError = undefined;
            _context.prev = 22;
            _iterator = messagesGen[Symbol.iterator]();

          case 24:
            if (_iteratorNormalCompletion = (_step = _iterator.next()).done) {
              _context.next = 38;
              break;
            }

            message = _step.value;
            _context.prev = 26;

            // Unmask the message
            unmasked = decode(message, sidekey, nextRoot);
            // Push payload into the messages array

            if (!callback) {
              messages.push(unmasked.payload);
            } else {
              callback(unmasked.payload);
            }
            nextRoot = unmasked.next_root;
            _context.next = 35;
            break;

          case 32:
            _context.prev = 32;
            _context.t0 = _context['catch'](26);
            return _context.abrupt('return', console.error('failed to parse: ', _context.t0));

          case 35:
            _iteratorNormalCompletion = true;
            _context.next = 24;
            break;

          case 38:
            _context.next = 44;
            break;

          case 40:
            _context.prev = 40;
            _context.t1 = _context['catch'](22);
            _didIteratorError = true;
            _iteratorError = _context.t1;

          case 44:
            _context.prev = 44;
            _context.prev = 45;

            if (!_iteratorNormalCompletion && _iterator.return) {
              _iterator.return();
            }

          case 47:
            _context.prev = 47;

            if (!_didIteratorError) {
              _context.next = 50;
              break;
            }

            throw _iteratorError;

          case 50:
            return _context.finish(47);

          case 51:
            return _context.finish(44);

          case 52:
            _context.next = 5;
            break;

          case 54:
            resp = {};

            resp.nextRoot = nextRoot;
            if (!callback) resp.messages = messages;
            return _context.abrupt('return', resp);

          case 58:
          case 'end':
            return _context.stop();
        }
      }
    }, _callee, undefined, [[22, 40, 44, 52], [26, 32], [45,, 47, 51]]);
  }));

  return function fetch(_x6, _x7, _x8, _x9) {
    return _ref.apply(this, arguments);
  };
}();

var fetchSingle = function () {
  var _ref2 = _asyncToGenerator( /*#__PURE__*/regeneratorRuntime.mark(function _callee2(root, mode, sidekey) {
    var rounds = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : 81;

    var address, hashes, messagesGen, _iteratorNormalCompletion2, _didIteratorError2, _iteratorError2, _iterator2, _step2, message, unmasked;

    return regeneratorRuntime.wrap(function _callee2$(_context2) {
      while (1) {
        switch (_context2.prev = _context2.next) {
          case 0:
            address = root;

            if (mode === 'private' || mode === 'restricted') address = hash(root, rounds);
            _context2.next = 4;
            return pify(iota.api.findTransactions.bind(iota.api))({
              addresses: [address]
            });

          case 4:
            hashes = _context2.sent;
            _context2.next = 7;
            return txHashesToMessages(hashes);

          case 7:
            messagesGen = _context2.sent;
            _iteratorNormalCompletion2 = true;
            _didIteratorError2 = false;
            _iteratorError2 = undefined;
            _context2.prev = 11;
            _iterator2 = messagesGen[Symbol.iterator]();

          case 13:
            if (_iteratorNormalCompletion2 = (_step2 = _iterator2.next()).done) {
              _context2.next = 26;
              break;
            }

            message = _step2.value;
            _context2.prev = 15;

            // Unmask the message
            unmasked = decode(message, sidekey, root);
            // Return payload

            return _context2.abrupt('return', { payload: unmasked.payload, nextRoot: unmasked.next_root });

          case 20:
            _context2.prev = 20;
            _context2.t0 = _context2['catch'](15);

            console.error('failed to parse: ', _context2.t0);

          case 23:
            _iteratorNormalCompletion2 = true;
            _context2.next = 13;
            break;

          case 26:
            _context2.next = 32;
            break;

          case 28:
            _context2.prev = 28;
            _context2.t1 = _context2['catch'](11);
            _didIteratorError2 = true;
            _iteratorError2 = _context2.t1;

          case 32:
            _context2.prev = 32;
            _context2.prev = 33;

            if (!_iteratorNormalCompletion2 && _iterator2.return) {
              _iterator2.return();
            }

          case 35:
            _context2.prev = 35;

            if (!_didIteratorError2) {
              _context2.next = 38;
              break;
            }

            throw _iteratorError2;

          case 38:
            return _context2.finish(35);

          case 39:
            return _context2.finish(32);

          case 40:
          case 'end':
            return _context2.stop();
        }
      }
    }, _callee2, undefined, [[11, 28, 32, 40], [15, 20], [33,, 35, 39]]);
  }));

  return function fetchSingle(_x11, _x12, _x13) {
    return _ref2.apply(this, arguments);
  };
}();

var listen = function listen(channel, callback) {
  var root = channel.root;
  return setTimeout(_asyncToGenerator( /*#__PURE__*/regeneratorRuntime.mark(function _callee3() {
    var resp;
    return regeneratorRuntime.wrap(function _callee3$(_context3) {
      while (1) {
        switch (_context3.prev = _context3.next) {
          case 0:
            _context3.next = 2;
            return fetch(root);

          case 2:
            resp = _context3.sent;

            root = resp.nextRoot;
            callback(resp.messages);

          case 5:
          case 'end':
            return _context3.stop();
        }
      }
    }, _callee3, undefined);
  })), channel.timeout);
};

// Parse bundles and
var txHashesToMessages = function () {
  var _ref4 = _asyncToGenerator( /*#__PURE__*/regeneratorRuntime.mark(function _callee4(hashes) {
    var bundles, processTx, objs;
    return regeneratorRuntime.wrap(function _callee4$(_context4) {
      while (1) {
        switch (_context4.prev = _context4.next) {
          case 0:
            bundles = {};

            processTx = function processTx(txo) {
              var bundle = txo.bundle;
              var msg = txo.signatureMessageFragment;
              var idx = txo.currentIndex;
              var maxIdx = txo.lastIndex;

              if (bundle in bundles) {
                bundles[bundle].push([idx, msg]);
              } else {
                bundles[bundle] = [[idx, msg]];
              }

              if (bundles[bundle].length == maxIdx + 1) {
                var l = bundles[bundle];
                delete bundles[bundle];
                return l.sort(function (a, b) {
                  return b[0] < a[0];
                }).reduce(function (acc, n) {
                  return acc + n[1];
                }, '');
              }
            };

            _context4.next = 4;
            return pify(iota.api.getTransactionsObjects.bind(iota.api))(hashes);

          case 4:
            objs = _context4.sent;
            return _context4.abrupt('return', objs.map(function (result) {
              return processTx(result);
            }).filter(function (item) {
              return item !== undefined;
            }));

          case 6:
          case 'end':
            return _context4.stop();
        }
      }
    }, _callee4, undefined);
  }));

  return function txHashesToMessages(_x14) {
    return _ref4.apply(this, arguments);
  };
}();

var attach = function () {
  var _ref5 = _asyncToGenerator( /*#__PURE__*/regeneratorRuntime.mark(function _callee5(trytes, root) {
    var depth = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : 6;
    var mwm = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : 14;
    var transfers, objs;
    return regeneratorRuntime.wrap(function _callee5$(_context5) {
      while (1) {
        switch (_context5.prev = _context5.next) {
          case 0:
            transfers = [{
              address: root,
              value: 0,
              message: trytes
            }];
            // if (isClient) curl.overrideAttachToTangle(iota)

            _context5.prev = 1;
            _context5.next = 4;
            return pify(iota.api.sendTransfer.bind(iota.api))(keyGen(81), depth, mwm, transfers);

          case 4:
            objs = _context5.sent;
            return _context5.abrupt('return', objs);

          case 8:
            _context5.prev = 8;
            _context5.t0 = _context5['catch'](1);
            return _context5.abrupt('return', console.error('failed to attach message:', '\n', _context5.t0));

          case 11:
          case 'end':
            return _context5.stop();
        }
      }
    }, _callee5, undefined, [[1, 8]]);
  }));

  return function attach(_x17, _x18) {
    return _ref5.apply(this, arguments);
  };
}();

// Helpers
var hash = function hash(data, rounds) {
  return Crypto.converter.trytes(Encryption.hash(rounds || 81, Crypto.converter.trits(data.slice())).slice());
};
var isClient = typeof window !== 'undefined' && window.document && window.document.createElement;

var keyGen = function keyGen(length) {
  var charset = 'ABCDEFGHIJKLMNOPQRSTUVWXYZ9';
  var values = crypto.randomBytes(length);
  var result = new Array(length);
  for (var i = 0; i < length; i++) {
    result[i] = charset[values[i] % charset.length];
  }
  return result.join('');
};

var setupEnv = function setupEnv(IOTA) {
  return Mam = IOTA;
};

module.exports = {
  init: init,
  subscribe: subscribe,
  changeMode: changeMode,
  create: create,
  decode: decode,
  fetch: fetch,
  fetchSingle: fetchSingle,
  attach: attach,
  listen: listen,
  getRoot: getRoot,
  setupEnv: setupEnv
};

/***/ }),
/* 307 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";
/* WEBPACK VAR INJECTION */(function(global) {

__webpack_require__(308);

__webpack_require__(505);

__webpack_require__(506);

if (global._babelPolyfill) {
  throw new Error("only one instance of babel-polyfill is allowed");
}
global._babelPolyfill = true;

var DEFINE_PROPERTY = "defineProperty";
function define(O, key, value) {
  O[key] || Object[DEFINE_PROPERTY](O, key, {
    writable: true,
    configurable: true,
    value: value
  });
}

define(String.prototype, "padLeft", "".padStart);
define(String.prototype, "padRight", "".padEnd);

"pop,reverse,shift,keys,values,entries,indexOf,every,some,forEach,map,filter,find,findIndex,includes,join,slice,concat,push,splice,unshift,sort,lastIndexOf,reduce,reduceRight,copyWithin,fill".split(",").forEach(function (key) {
  [][key] && define(Array, key, Function.call.bind([][key]));
});
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(37)))

/***/ }),
/* 308 */
/***/ (function(module, exports, __webpack_require__) {

__webpack_require__(309);
__webpack_require__(311);
__webpack_require__(312);
__webpack_require__(313);
__webpack_require__(314);
__webpack_require__(315);
__webpack_require__(316);
__webpack_require__(317);
__webpack_require__(318);
__webpack_require__(319);
__webpack_require__(320);
__webpack_require__(321);
__webpack_require__(322);
__webpack_require__(323);
__webpack_require__(324);
__webpack_require__(325);
__webpack_require__(327);
__webpack_require__(328);
__webpack_require__(329);
__webpack_require__(330);
__webpack_require__(331);
__webpack_require__(332);
__webpack_require__(333);
__webpack_require__(334);
__webpack_require__(335);
__webpack_require__(336);
__webpack_require__(337);
__webpack_require__(338);
__webpack_require__(339);
__webpack_require__(340);
__webpack_require__(341);
__webpack_require__(342);
__webpack_require__(343);
__webpack_require__(344);
__webpack_require__(345);
__webpack_require__(346);
__webpack_require__(347);
__webpack_require__(348);
__webpack_require__(349);
__webpack_require__(350);
__webpack_require__(351);
__webpack_require__(352);
__webpack_require__(353);
__webpack_require__(354);
__webpack_require__(355);
__webpack_require__(356);
__webpack_require__(357);
__webpack_require__(358);
__webpack_require__(359);
__webpack_require__(360);
__webpack_require__(361);
__webpack_require__(362);
__webpack_require__(363);
__webpack_require__(364);
__webpack_require__(365);
__webpack_require__(366);
__webpack_require__(367);
__webpack_require__(368);
__webpack_require__(369);
__webpack_require__(370);
__webpack_require__(371);
__webpack_require__(372);
__webpack_require__(373);
__webpack_require__(374);
__webpack_require__(375);
__webpack_require__(376);
__webpack_require__(377);
__webpack_require__(378);
__webpack_require__(379);
__webpack_require__(380);
__webpack_require__(381);
__webpack_require__(382);
__webpack_require__(383);
__webpack_require__(384);
__webpack_require__(385);
__webpack_require__(386);
__webpack_require__(387);
__webpack_require__(389);
__webpack_require__(390);
__webpack_require__(392);
__webpack_require__(393);
__webpack_require__(394);
__webpack_require__(395);
__webpack_require__(396);
__webpack_require__(397);
__webpack_require__(398);
__webpack_require__(400);
__webpack_require__(401);
__webpack_require__(402);
__webpack_require__(403);
__webpack_require__(404);
__webpack_require__(405);
__webpack_require__(406);
__webpack_require__(407);
__webpack_require__(408);
__webpack_require__(409);
__webpack_require__(410);
__webpack_require__(411);
__webpack_require__(412);
__webpack_require__(134);
__webpack_require__(413);
__webpack_require__(414);
__webpack_require__(197);
__webpack_require__(415);
__webpack_require__(416);
__webpack_require__(417);
__webpack_require__(418);
__webpack_require__(419);
__webpack_require__(200);
__webpack_require__(202);
__webpack_require__(203);
__webpack_require__(420);
__webpack_require__(421);
__webpack_require__(422);
__webpack_require__(423);
__webpack_require__(424);
__webpack_require__(425);
__webpack_require__(426);
__webpack_require__(427);
__webpack_require__(428);
__webpack_require__(429);
__webpack_require__(430);
__webpack_require__(431);
__webpack_require__(432);
__webpack_require__(433);
__webpack_require__(434);
__webpack_require__(435);
__webpack_require__(436);
__webpack_require__(437);
__webpack_require__(438);
__webpack_require__(439);
__webpack_require__(440);
__webpack_require__(441);
__webpack_require__(442);
__webpack_require__(443);
__webpack_require__(444);
__webpack_require__(445);
__webpack_require__(446);
__webpack_require__(447);
__webpack_require__(448);
__webpack_require__(449);
__webpack_require__(450);
__webpack_require__(451);
__webpack_require__(452);
__webpack_require__(453);
__webpack_require__(454);
__webpack_require__(455);
__webpack_require__(456);
__webpack_require__(457);
__webpack_require__(458);
__webpack_require__(459);
__webpack_require__(460);
__webpack_require__(461);
__webpack_require__(462);
__webpack_require__(463);
__webpack_require__(464);
__webpack_require__(465);
__webpack_require__(466);
__webpack_require__(467);
__webpack_require__(468);
__webpack_require__(469);
__webpack_require__(470);
__webpack_require__(471);
__webpack_require__(472);
__webpack_require__(473);
__webpack_require__(474);
__webpack_require__(475);
__webpack_require__(476);
__webpack_require__(477);
__webpack_require__(478);
__webpack_require__(479);
__webpack_require__(480);
__webpack_require__(481);
__webpack_require__(482);
__webpack_require__(483);
__webpack_require__(484);
__webpack_require__(485);
__webpack_require__(486);
__webpack_require__(487);
__webpack_require__(488);
__webpack_require__(489);
__webpack_require__(490);
__webpack_require__(491);
__webpack_require__(492);
__webpack_require__(493);
__webpack_require__(494);
__webpack_require__(495);
__webpack_require__(496);
__webpack_require__(497);
__webpack_require__(498);
__webpack_require__(499);
__webpack_require__(500);
__webpack_require__(501);
__webpack_require__(502);
__webpack_require__(503);
__webpack_require__(504);
module.exports = __webpack_require__(30);


/***/ }),
/* 309 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// ECMAScript 6 symbols shim
var global = __webpack_require__(3);
var has = __webpack_require__(18);
var DESCRIPTORS = __webpack_require__(10);
var $export = __webpack_require__(0);
var redefine = __webpack_require__(20);
var META = __webpack_require__(43).KEY;
var $fails = __webpack_require__(5);
var shared = __webpack_require__(82);
var setToStringTag = __webpack_require__(59);
var uid = __webpack_require__(47);
var wks = __webpack_require__(9);
var wksExt = __webpack_require__(180);
var wksDefine = __webpack_require__(114);
var enumKeys = __webpack_require__(310);
var isArray = __webpack_require__(85);
var anObject = __webpack_require__(2);
var toIObject = __webpack_require__(23);
var toPrimitive = __webpack_require__(31);
var createDesc = __webpack_require__(46);
var _create = __webpack_require__(51);
var gOPNExt = __webpack_require__(183);
var $GOPD = __webpack_require__(24);
var $DP = __webpack_require__(11);
var $keys = __webpack_require__(49);
var gOPD = $GOPD.f;
var dP = $DP.f;
var gOPN = gOPNExt.f;
var $Symbol = global.Symbol;
var $JSON = global.JSON;
var _stringify = $JSON && $JSON.stringify;
var PROTOTYPE = 'prototype';
var HIDDEN = wks('_hidden');
var TO_PRIMITIVE = wks('toPrimitive');
var isEnum = {}.propertyIsEnumerable;
var SymbolRegistry = shared('symbol-registry');
var AllSymbols = shared('symbols');
var OPSymbols = shared('op-symbols');
var ObjectProto = Object[PROTOTYPE];
var USE_NATIVE = typeof $Symbol == 'function';
var QObject = global.QObject;
// Don't use setters in Qt Script, https://github.com/zloirock/core-js/issues/173
var setter = !QObject || !QObject[PROTOTYPE] || !QObject[PROTOTYPE].findChild;

// fallback for old Android, https://code.google.com/p/v8/issues/detail?id=687
var setSymbolDesc = DESCRIPTORS && $fails(function () {
  return _create(dP({}, 'a', {
    get: function () { return dP(this, 'a', { value: 7 }).a; }
  })).a != 7;
}) ? function (it, key, D) {
  var protoDesc = gOPD(ObjectProto, key);
  if (protoDesc) delete ObjectProto[key];
  dP(it, key, D);
  if (protoDesc && it !== ObjectProto) dP(ObjectProto, key, protoDesc);
} : dP;

var wrap = function (tag) {
  var sym = AllSymbols[tag] = _create($Symbol[PROTOTYPE]);
  sym._k = tag;
  return sym;
};

var isSymbol = USE_NATIVE && typeof $Symbol.iterator == 'symbol' ? function (it) {
  return typeof it == 'symbol';
} : function (it) {
  return it instanceof $Symbol;
};

var $defineProperty = function defineProperty(it, key, D) {
  if (it === ObjectProto) $defineProperty(OPSymbols, key, D);
  anObject(it);
  key = toPrimitive(key, true);
  anObject(D);
  if (has(AllSymbols, key)) {
    if (!D.enumerable) {
      if (!has(it, HIDDEN)) dP(it, HIDDEN, createDesc(1, {}));
      it[HIDDEN][key] = true;
    } else {
      if (has(it, HIDDEN) && it[HIDDEN][key]) it[HIDDEN][key] = false;
      D = _create(D, { enumerable: createDesc(0, false) });
    } return setSymbolDesc(it, key, D);
  } return dP(it, key, D);
};
var $defineProperties = function defineProperties(it, P) {
  anObject(it);
  var keys = enumKeys(P = toIObject(P));
  var i = 0;
  var l = keys.length;
  var key;
  while (l > i) $defineProperty(it, key = keys[i++], P[key]);
  return it;
};
var $create = function create(it, P) {
  return P === undefined ? _create(it) : $defineProperties(_create(it), P);
};
var $propertyIsEnumerable = function propertyIsEnumerable(key) {
  var E = isEnum.call(this, key = toPrimitive(key, true));
  if (this === ObjectProto && has(AllSymbols, key) && !has(OPSymbols, key)) return false;
  return E || !has(this, key) || !has(AllSymbols, key) || has(this, HIDDEN) && this[HIDDEN][key] ? E : true;
};
var $getOwnPropertyDescriptor = function getOwnPropertyDescriptor(it, key) {
  it = toIObject(it);
  key = toPrimitive(key, true);
  if (it === ObjectProto && has(AllSymbols, key) && !has(OPSymbols, key)) return;
  var D = gOPD(it, key);
  if (D && has(AllSymbols, key) && !(has(it, HIDDEN) && it[HIDDEN][key])) D.enumerable = true;
  return D;
};
var $getOwnPropertyNames = function getOwnPropertyNames(it) {
  var names = gOPN(toIObject(it));
  var result = [];
  var i = 0;
  var key;
  while (names.length > i) {
    if (!has(AllSymbols, key = names[i++]) && key != HIDDEN && key != META) result.push(key);
  } return result;
};
var $getOwnPropertySymbols = function getOwnPropertySymbols(it) {
  var IS_OP = it === ObjectProto;
  var names = gOPN(IS_OP ? OPSymbols : toIObject(it));
  var result = [];
  var i = 0;
  var key;
  while (names.length > i) {
    if (has(AllSymbols, key = names[i++]) && (IS_OP ? has(ObjectProto, key) : true)) result.push(AllSymbols[key]);
  } return result;
};

// 19.4.1.1 Symbol([description])
if (!USE_NATIVE) {
  $Symbol = function Symbol() {
    if (this instanceof $Symbol) throw TypeError('Symbol is not a constructor!');
    var tag = uid(arguments.length > 0 ? arguments[0] : undefined);
    var $set = function (value) {
      if (this === ObjectProto) $set.call(OPSymbols, value);
      if (has(this, HIDDEN) && has(this[HIDDEN], tag)) this[HIDDEN][tag] = false;
      setSymbolDesc(this, tag, createDesc(1, value));
    };
    if (DESCRIPTORS && setter) setSymbolDesc(ObjectProto, tag, { configurable: true, set: $set });
    return wrap(tag);
  };
  redefine($Symbol[PROTOTYPE], 'toString', function toString() {
    return this._k;
  });

  $GOPD.f = $getOwnPropertyDescriptor;
  $DP.f = $defineProperty;
  __webpack_require__(52).f = gOPNExt.f = $getOwnPropertyNames;
  __webpack_require__(74).f = $propertyIsEnumerable;
  __webpack_require__(84).f = $getOwnPropertySymbols;

  if (DESCRIPTORS && !__webpack_require__(48)) {
    redefine(ObjectProto, 'propertyIsEnumerable', $propertyIsEnumerable, true);
  }

  wksExt.f = function (name) {
    return wrap(wks(name));
  };
}

$export($export.G + $export.W + $export.F * !USE_NATIVE, { Symbol: $Symbol });

for (var es6Symbols = (
  // 19.4.2.2, 19.4.2.3, 19.4.2.4, 19.4.2.6, 19.4.2.8, 19.4.2.9, 19.4.2.10, 19.4.2.11, 19.4.2.12, 19.4.2.13, 19.4.2.14
  'hasInstance,isConcatSpreadable,iterator,match,replace,search,species,split,toPrimitive,toStringTag,unscopables'
).split(','), j = 0; es6Symbols.length > j;)wks(es6Symbols[j++]);

for (var wellKnownSymbols = $keys(wks.store), k = 0; wellKnownSymbols.length > k;) wksDefine(wellKnownSymbols[k++]);

$export($export.S + $export.F * !USE_NATIVE, 'Symbol', {
  // 19.4.2.1 Symbol.for(key)
  'for': function (key) {
    return has(SymbolRegistry, key += '')
      ? SymbolRegistry[key]
      : SymbolRegistry[key] = $Symbol(key);
  },
  // 19.4.2.5 Symbol.keyFor(sym)
  keyFor: function keyFor(sym) {
    if (!isSymbol(sym)) throw TypeError(sym + ' is not a symbol!');
    for (var key in SymbolRegistry) if (SymbolRegistry[key] === sym) return key;
  },
  useSetter: function () { setter = true; },
  useSimple: function () { setter = false; }
});

$export($export.S + $export.F * !USE_NATIVE, 'Object', {
  // 19.1.2.2 Object.create(O [, Properties])
  create: $create,
  // 19.1.2.4 Object.defineProperty(O, P, Attributes)
  defineProperty: $defineProperty,
  // 19.1.2.3 Object.defineProperties(O, Properties)
  defineProperties: $defineProperties,
  // 19.1.2.6 Object.getOwnPropertyDescriptor(O, P)
  getOwnPropertyDescriptor: $getOwnPropertyDescriptor,
  // 19.1.2.7 Object.getOwnPropertyNames(O)
  getOwnPropertyNames: $getOwnPropertyNames,
  // 19.1.2.8 Object.getOwnPropertySymbols(O)
  getOwnPropertySymbols: $getOwnPropertySymbols
});

// 24.3.2 JSON.stringify(value [, replacer [, space]])
$JSON && $export($export.S + $export.F * (!USE_NATIVE || $fails(function () {
  var S = $Symbol();
  // MS Edge converts symbol values to JSON as {}
  // WebKit converts symbol values to JSON as null
  // V8 throws on boxed symbols
  return _stringify([S]) != '[null]' || _stringify({ a: S }) != '{}' || _stringify(Object(S)) != '{}';
})), 'JSON', {
  stringify: function stringify(it) {
    if (it === undefined || isSymbol(it)) return; // IE8 returns string on undefined
    var args = [it];
    var i = 1;
    var replacer, $replacer;
    while (arguments.length > i) args.push(arguments[i++]);
    replacer = args[1];
    if (typeof replacer == 'function') $replacer = replacer;
    if ($replacer || !isArray(replacer)) replacer = function (key, value) {
      if ($replacer) value = $replacer.call(this, key, value);
      if (!isSymbol(value)) return value;
    };
    args[1] = replacer;
    return _stringify.apply($JSON, args);
  }
});

// 19.4.3.4 Symbol.prototype[@@toPrimitive](hint)
$Symbol[PROTOTYPE][TO_PRIMITIVE] || __webpack_require__(19)($Symbol[PROTOTYPE], TO_PRIMITIVE, $Symbol[PROTOTYPE].valueOf);
// 19.4.3.5 Symbol.prototype[@@toStringTag]
setToStringTag($Symbol, 'Symbol');
// 20.2.1.9 Math[@@toStringTag]
setToStringTag(Math, 'Math', true);
// 24.3.3 JSON[@@toStringTag]
setToStringTag(global.JSON, 'JSON', true);


/***/ }),
/* 310 */
/***/ (function(module, exports, __webpack_require__) {

// all enumerable object keys, includes symbols
var getKeys = __webpack_require__(49);
var gOPS = __webpack_require__(84);
var pIE = __webpack_require__(74);
module.exports = function (it) {
  var result = getKeys(it);
  var getSymbols = gOPS.f;
  if (getSymbols) {
    var symbols = getSymbols(it);
    var isEnum = pIE.f;
    var i = 0;
    var key;
    while (symbols.length > i) if (isEnum.call(it, key = symbols[i++])) result.push(key);
  } return result;
};


/***/ }),
/* 311 */
/***/ (function(module, exports, __webpack_require__) {

var $export = __webpack_require__(0);
// 19.1.2.2 / 15.2.3.5 Object.create(O [, Properties])
$export($export.S, 'Object', { create: __webpack_require__(51) });


/***/ }),
/* 312 */
/***/ (function(module, exports, __webpack_require__) {

var $export = __webpack_require__(0);
// 19.1.2.4 / 15.2.3.6 Object.defineProperty(O, P, Attributes)
$export($export.S + $export.F * !__webpack_require__(10), 'Object', { defineProperty: __webpack_require__(11).f });


/***/ }),
/* 313 */
/***/ (function(module, exports, __webpack_require__) {

var $export = __webpack_require__(0);
// 19.1.2.3 / 15.2.3.7 Object.defineProperties(O, Properties)
$export($export.S + $export.F * !__webpack_require__(10), 'Object', { defineProperties: __webpack_require__(182) });


/***/ }),
/* 314 */
/***/ (function(module, exports, __webpack_require__) {

// 19.1.2.6 Object.getOwnPropertyDescriptor(O, P)
var toIObject = __webpack_require__(23);
var $getOwnPropertyDescriptor = __webpack_require__(24).f;

__webpack_require__(34)('getOwnPropertyDescriptor', function () {
  return function getOwnPropertyDescriptor(it, key) {
    return $getOwnPropertyDescriptor(toIObject(it), key);
  };
});


/***/ }),
/* 315 */
/***/ (function(module, exports, __webpack_require__) {

// 19.1.2.9 Object.getPrototypeOf(O)
var toObject = __webpack_require__(14);
var $getPrototypeOf = __webpack_require__(25);

__webpack_require__(34)('getPrototypeOf', function () {
  return function getPrototypeOf(it) {
    return $getPrototypeOf(toObject(it));
  };
});


/***/ }),
/* 316 */
/***/ (function(module, exports, __webpack_require__) {

// 19.1.2.14 Object.keys(O)
var toObject = __webpack_require__(14);
var $keys = __webpack_require__(49);

__webpack_require__(34)('keys', function () {
  return function keys(it) {
    return $keys(toObject(it));
  };
});


/***/ }),
/* 317 */
/***/ (function(module, exports, __webpack_require__) {

// 19.1.2.7 Object.getOwnPropertyNames(O)
__webpack_require__(34)('getOwnPropertyNames', function () {
  return __webpack_require__(183).f;
});


/***/ }),
/* 318 */
/***/ (function(module, exports, __webpack_require__) {

// 19.1.2.5 Object.freeze(O)
var isObject = __webpack_require__(7);
var meta = __webpack_require__(43).onFreeze;

__webpack_require__(34)('freeze', function ($freeze) {
  return function freeze(it) {
    return $freeze && isObject(it) ? $freeze(meta(it)) : it;
  };
});


/***/ }),
/* 319 */
/***/ (function(module, exports, __webpack_require__) {

// 19.1.2.17 Object.seal(O)
var isObject = __webpack_require__(7);
var meta = __webpack_require__(43).onFreeze;

__webpack_require__(34)('seal', function ($seal) {
  return function seal(it) {
    return $seal && isObject(it) ? $seal(meta(it)) : it;
  };
});


/***/ }),
/* 320 */
/***/ (function(module, exports, __webpack_require__) {

// 19.1.2.15 Object.preventExtensions(O)
var isObject = __webpack_require__(7);
var meta = __webpack_require__(43).onFreeze;

__webpack_require__(34)('preventExtensions', function ($preventExtensions) {
  return function preventExtensions(it) {
    return $preventExtensions && isObject(it) ? $preventExtensions(meta(it)) : it;
  };
});


/***/ }),
/* 321 */
/***/ (function(module, exports, __webpack_require__) {

// 19.1.2.12 Object.isFrozen(O)
var isObject = __webpack_require__(7);

__webpack_require__(34)('isFrozen', function ($isFrozen) {
  return function isFrozen(it) {
    return isObject(it) ? $isFrozen ? $isFrozen(it) : false : true;
  };
});


/***/ }),
/* 322 */
/***/ (function(module, exports, __webpack_require__) {

// 19.1.2.13 Object.isSealed(O)
var isObject = __webpack_require__(7);

__webpack_require__(34)('isSealed', function ($isSealed) {
  return function isSealed(it) {
    return isObject(it) ? $isSealed ? $isSealed(it) : false : true;
  };
});


/***/ }),
/* 323 */
/***/ (function(module, exports, __webpack_require__) {

// 19.1.2.11 Object.isExtensible(O)
var isObject = __webpack_require__(7);

__webpack_require__(34)('isExtensible', function ($isExtensible) {
  return function isExtensible(it) {
    return isObject(it) ? $isExtensible ? $isExtensible(it) : true : false;
  };
});


/***/ }),
/* 324 */
/***/ (function(module, exports, __webpack_require__) {

// 19.1.3.1 Object.assign(target, source)
var $export = __webpack_require__(0);

$export($export.S + $export.F, 'Object', { assign: __webpack_require__(184) });


/***/ }),
/* 325 */
/***/ (function(module, exports, __webpack_require__) {

// 19.1.3.10 Object.is(value1, value2)
var $export = __webpack_require__(0);
$export($export.S, 'Object', { is: __webpack_require__(326) });


/***/ }),
/* 326 */
/***/ (function(module, exports) {

// 7.2.9 SameValue(x, y)
module.exports = Object.is || function is(x, y) {
  // eslint-disable-next-line no-self-compare
  return x === y ? x !== 0 || 1 / x === 1 / y : x != x && y != y;
};


/***/ }),
/* 327 */
/***/ (function(module, exports, __webpack_require__) {

// 19.1.3.19 Object.setPrototypeOf(O, proto)
var $export = __webpack_require__(0);
$export($export.S, 'Object', { setPrototypeOf: __webpack_require__(118).set });


/***/ }),
/* 328 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// 19.1.3.6 Object.prototype.toString()
var classof = __webpack_require__(75);
var test = {};
test[__webpack_require__(9)('toStringTag')] = 'z';
if (test + '' != '[object z]') {
  __webpack_require__(20)(Object.prototype, 'toString', function toString() {
    return '[object ' + classof(this) + ']';
  }, true);
}


/***/ }),
/* 329 */
/***/ (function(module, exports, __webpack_require__) {

// 19.2.3.2 / 15.3.4.5 Function.prototype.bind(thisArg, args...)
var $export = __webpack_require__(0);

$export($export.P, 'Function', { bind: __webpack_require__(185) });


/***/ }),
/* 330 */
/***/ (function(module, exports, __webpack_require__) {

var dP = __webpack_require__(11).f;
var FProto = Function.prototype;
var nameRE = /^\s*function ([^ (]*)/;
var NAME = 'name';

// 19.2.4.2 name
NAME in FProto || __webpack_require__(10) && dP(FProto, NAME, {
  configurable: true,
  get: function () {
    try {
      return ('' + this).match(nameRE)[1];
    } catch (e) {
      return '';
    }
  }
});


/***/ }),
/* 331 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var isObject = __webpack_require__(7);
var getPrototypeOf = __webpack_require__(25);
var HAS_INSTANCE = __webpack_require__(9)('hasInstance');
var FunctionProto = Function.prototype;
// 19.2.3.6 Function.prototype[@@hasInstance](V)
if (!(HAS_INSTANCE in FunctionProto)) __webpack_require__(11).f(FunctionProto, HAS_INSTANCE, { value: function (O) {
  if (typeof this != 'function' || !isObject(O)) return false;
  if (!isObject(this.prototype)) return O instanceof this;
  // for environment w/o native `@@hasInstance` logic enough `instanceof`, but add this:
  while (O = getPrototypeOf(O)) if (this.prototype === O) return true;
  return false;
} });


/***/ }),
/* 332 */
/***/ (function(module, exports, __webpack_require__) {

var $export = __webpack_require__(0);
var $parseInt = __webpack_require__(187);
// 18.2.5 parseInt(string, radix)
$export($export.G + $export.F * (parseInt != $parseInt), { parseInt: $parseInt });


/***/ }),
/* 333 */
/***/ (function(module, exports, __webpack_require__) {

var $export = __webpack_require__(0);
var $parseFloat = __webpack_require__(188);
// 18.2.4 parseFloat(string)
$export($export.G + $export.F * (parseFloat != $parseFloat), { parseFloat: $parseFloat });


/***/ }),
/* 334 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var global = __webpack_require__(3);
var has = __webpack_require__(18);
var cof = __webpack_require__(27);
var inheritIfRequired = __webpack_require__(120);
var toPrimitive = __webpack_require__(31);
var fails = __webpack_require__(5);
var gOPN = __webpack_require__(52).f;
var gOPD = __webpack_require__(24).f;
var dP = __webpack_require__(11).f;
var $trim = __webpack_require__(60).trim;
var NUMBER = 'Number';
var $Number = global[NUMBER];
var Base = $Number;
var proto = $Number.prototype;
// Opera ~12 has broken Object#toString
var BROKEN_COF = cof(__webpack_require__(51)(proto)) == NUMBER;
var TRIM = 'trim' in String.prototype;

// 7.1.3 ToNumber(argument)
var toNumber = function (argument) {
  var it = toPrimitive(argument, false);
  if (typeof it == 'string' && it.length > 2) {
    it = TRIM ? it.trim() : $trim(it, 3);
    var first = it.charCodeAt(0);
    var third, radix, maxCode;
    if (first === 43 || first === 45) {
      third = it.charCodeAt(2);
      if (third === 88 || third === 120) return NaN; // Number('+0x1') should be NaN, old V8 fix
    } else if (first === 48) {
      switch (it.charCodeAt(1)) {
        case 66: case 98: radix = 2; maxCode = 49; break; // fast equal /^0b[01]+$/i
        case 79: case 111: radix = 8; maxCode = 55; break; // fast equal /^0o[0-7]+$/i
        default: return +it;
      }
      for (var digits = it.slice(2), i = 0, l = digits.length, code; i < l; i++) {
        code = digits.charCodeAt(i);
        // parseInt parses a string to a first unavailable symbol
        // but ToNumber should return NaN if a string contains unavailable symbols
        if (code < 48 || code > maxCode) return NaN;
      } return parseInt(digits, radix);
    }
  } return +it;
};

if (!$Number(' 0o1') || !$Number('0b1') || $Number('+0x1')) {
  $Number = function Number(value) {
    var it = arguments.length < 1 ? 0 : value;
    var that = this;
    return that instanceof $Number
      // check on 1..constructor(foo) case
      && (BROKEN_COF ? fails(function () { proto.valueOf.call(that); }) : cof(that) != NUMBER)
        ? inheritIfRequired(new Base(toNumber(it)), that, $Number) : toNumber(it);
  };
  for (var keys = __webpack_require__(10) ? gOPN(Base) : (
    // ES3:
    'MAX_VALUE,MIN_VALUE,NaN,NEGATIVE_INFINITY,POSITIVE_INFINITY,' +
    // ES6 (in case, if modules with ES6 Number statics required before):
    'EPSILON,isFinite,isInteger,isNaN,isSafeInteger,MAX_SAFE_INTEGER,' +
    'MIN_SAFE_INTEGER,parseFloat,parseInt,isInteger'
  ).split(','), j = 0, key; keys.length > j; j++) {
    if (has(Base, key = keys[j]) && !has($Number, key)) {
      dP($Number, key, gOPD(Base, key));
    }
  }
  $Number.prototype = proto;
  proto.constructor = $Number;
  __webpack_require__(20)(global, NUMBER, $Number);
}


/***/ }),
/* 335 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var $export = __webpack_require__(0);
var toInteger = __webpack_require__(33);
var aNumberValue = __webpack_require__(189);
var repeat = __webpack_require__(121);
var $toFixed = 1.0.toFixed;
var floor = Math.floor;
var data = [0, 0, 0, 0, 0, 0];
var ERROR = 'Number.toFixed: incorrect invocation!';
var ZERO = '0';

var multiply = function (n, c) {
  var i = -1;
  var c2 = c;
  while (++i < 6) {
    c2 += n * data[i];
    data[i] = c2 % 1e7;
    c2 = floor(c2 / 1e7);
  }
};
var divide = function (n) {
  var i = 6;
  var c = 0;
  while (--i >= 0) {
    c += data[i];
    data[i] = floor(c / n);
    c = (c % n) * 1e7;
  }
};
var numToString = function () {
  var i = 6;
  var s = '';
  while (--i >= 0) {
    if (s !== '' || i === 0 || data[i] !== 0) {
      var t = String(data[i]);
      s = s === '' ? t : s + repeat.call(ZERO, 7 - t.length) + t;
    }
  } return s;
};
var pow = function (x, n, acc) {
  return n === 0 ? acc : n % 2 === 1 ? pow(x, n - 1, acc * x) : pow(x * x, n / 2, acc);
};
var log = function (x) {
  var n = 0;
  var x2 = x;
  while (x2 >= 4096) {
    n += 12;
    x2 /= 4096;
  }
  while (x2 >= 2) {
    n += 1;
    x2 /= 2;
  } return n;
};

$export($export.P + $export.F * (!!$toFixed && (
  0.00008.toFixed(3) !== '0.000' ||
  0.9.toFixed(0) !== '1' ||
  1.255.toFixed(2) !== '1.25' ||
  1000000000000000128.0.toFixed(0) !== '1000000000000000128'
) || !__webpack_require__(5)(function () {
  // V8 ~ Android 4.3-
  $toFixed.call({});
})), 'Number', {
  toFixed: function toFixed(fractionDigits) {
    var x = aNumberValue(this, ERROR);
    var f = toInteger(fractionDigits);
    var s = '';
    var m = ZERO;
    var e, z, j, k;
    if (f < 0 || f > 20) throw RangeError(ERROR);
    // eslint-disable-next-line no-self-compare
    if (x != x) return 'NaN';
    if (x <= -1e21 || x >= 1e21) return String(x);
    if (x < 0) {
      s = '-';
      x = -x;
    }
    if (x > 1e-21) {
      e = log(x * pow(2, 69, 1)) - 69;
      z = e < 0 ? x * pow(2, -e, 1) : x / pow(2, e, 1);
      z *= 0x10000000000000;
      e = 52 - e;
      if (e > 0) {
        multiply(0, z);
        j = f;
        while (j >= 7) {
          multiply(1e7, 0);
          j -= 7;
        }
        multiply(pow(10, j, 1), 0);
        j = e - 1;
        while (j >= 23) {
          divide(1 << 23);
          j -= 23;
        }
        divide(1 << j);
        multiply(1, 1);
        divide(2);
        m = numToString();
      } else {
        multiply(0, z);
        multiply(1 << -e, 0);
        m = numToString() + repeat.call(ZERO, f);
      }
    }
    if (f > 0) {
      k = m.length;
      m = s + (k <= f ? '0.' + repeat.call(ZERO, f - k) + m : m.slice(0, k - f) + '.' + m.slice(k - f));
    } else {
      m = s + m;
    } return m;
  }
});


/***/ }),
/* 336 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var $export = __webpack_require__(0);
var $fails = __webpack_require__(5);
var aNumberValue = __webpack_require__(189);
var $toPrecision = 1.0.toPrecision;

$export($export.P + $export.F * ($fails(function () {
  // IE7-
  return $toPrecision.call(1, undefined) !== '1';
}) || !$fails(function () {
  // V8 ~ Android 4.3-
  $toPrecision.call({});
})), 'Number', {
  toPrecision: function toPrecision(precision) {
    var that = aNumberValue(this, 'Number#toPrecision: incorrect invocation!');
    return precision === undefined ? $toPrecision.call(that) : $toPrecision.call(that, precision);
  }
});


/***/ }),
/* 337 */
/***/ (function(module, exports, __webpack_require__) {

// 20.1.2.1 Number.EPSILON
var $export = __webpack_require__(0);

$export($export.S, 'Number', { EPSILON: Math.pow(2, -52) });


/***/ }),
/* 338 */
/***/ (function(module, exports, __webpack_require__) {

// 20.1.2.2 Number.isFinite(number)
var $export = __webpack_require__(0);
var _isFinite = __webpack_require__(3).isFinite;

$export($export.S, 'Number', {
  isFinite: function isFinite(it) {
    return typeof it == 'number' && _isFinite(it);
  }
});


/***/ }),
/* 339 */
/***/ (function(module, exports, __webpack_require__) {

// 20.1.2.3 Number.isInteger(number)
var $export = __webpack_require__(0);

$export($export.S, 'Number', { isInteger: __webpack_require__(190) });


/***/ }),
/* 340 */
/***/ (function(module, exports, __webpack_require__) {

// 20.1.2.4 Number.isNaN(number)
var $export = __webpack_require__(0);

$export($export.S, 'Number', {
  isNaN: function isNaN(number) {
    // eslint-disable-next-line no-self-compare
    return number != number;
  }
});


/***/ }),
/* 341 */
/***/ (function(module, exports, __webpack_require__) {

// 20.1.2.5 Number.isSafeInteger(number)
var $export = __webpack_require__(0);
var isInteger = __webpack_require__(190);
var abs = Math.abs;

$export($export.S, 'Number', {
  isSafeInteger: function isSafeInteger(number) {
    return isInteger(number) && abs(number) <= 0x1fffffffffffff;
  }
});


/***/ }),
/* 342 */
/***/ (function(module, exports, __webpack_require__) {

// 20.1.2.6 Number.MAX_SAFE_INTEGER
var $export = __webpack_require__(0);

$export($export.S, 'Number', { MAX_SAFE_INTEGER: 0x1fffffffffffff });


/***/ }),
/* 343 */
/***/ (function(module, exports, __webpack_require__) {

// 20.1.2.10 Number.MIN_SAFE_INTEGER
var $export = __webpack_require__(0);

$export($export.S, 'Number', { MIN_SAFE_INTEGER: -0x1fffffffffffff });


/***/ }),
/* 344 */
/***/ (function(module, exports, __webpack_require__) {

var $export = __webpack_require__(0);
var $parseFloat = __webpack_require__(188);
// 20.1.2.12 Number.parseFloat(string)
$export($export.S + $export.F * (Number.parseFloat != $parseFloat), 'Number', { parseFloat: $parseFloat });


/***/ }),
/* 345 */
/***/ (function(module, exports, __webpack_require__) {

var $export = __webpack_require__(0);
var $parseInt = __webpack_require__(187);
// 20.1.2.13 Number.parseInt(string, radix)
$export($export.S + $export.F * (Number.parseInt != $parseInt), 'Number', { parseInt: $parseInt });


/***/ }),
/* 346 */
/***/ (function(module, exports, __webpack_require__) {

// 20.2.2.3 Math.acosh(x)
var $export = __webpack_require__(0);
var log1p = __webpack_require__(191);
var sqrt = Math.sqrt;
var $acosh = Math.acosh;

$export($export.S + $export.F * !($acosh
  // V8 bug: https://code.google.com/p/v8/issues/detail?id=3509
  && Math.floor($acosh(Number.MAX_VALUE)) == 710
  // Tor Browser bug: Math.acosh(Infinity) -> NaN
  && $acosh(Infinity) == Infinity
), 'Math', {
  acosh: function acosh(x) {
    return (x = +x) < 1 ? NaN : x > 94906265.62425156
      ? Math.log(x) + Math.LN2
      : log1p(x - 1 + sqrt(x - 1) * sqrt(x + 1));
  }
});


/***/ }),
/* 347 */
/***/ (function(module, exports, __webpack_require__) {

// 20.2.2.5 Math.asinh(x)
var $export = __webpack_require__(0);
var $asinh = Math.asinh;

function asinh(x) {
  return !isFinite(x = +x) || x == 0 ? x : x < 0 ? -asinh(-x) : Math.log(x + Math.sqrt(x * x + 1));
}

// Tor Browser bug: Math.asinh(0) -> -0
$export($export.S + $export.F * !($asinh && 1 / $asinh(0) > 0), 'Math', { asinh: asinh });


/***/ }),
/* 348 */
/***/ (function(module, exports, __webpack_require__) {

// 20.2.2.7 Math.atanh(x)
var $export = __webpack_require__(0);
var $atanh = Math.atanh;

// Tor Browser bug: Math.atanh(-0) -> 0
$export($export.S + $export.F * !($atanh && 1 / $atanh(-0) < 0), 'Math', {
  atanh: function atanh(x) {
    return (x = +x) == 0 ? x : Math.log((1 + x) / (1 - x)) / 2;
  }
});


/***/ }),
/* 349 */
/***/ (function(module, exports, __webpack_require__) {

// 20.2.2.9 Math.cbrt(x)
var $export = __webpack_require__(0);
var sign = __webpack_require__(122);

$export($export.S, 'Math', {
  cbrt: function cbrt(x) {
    return sign(x = +x) * Math.pow(Math.abs(x), 1 / 3);
  }
});


/***/ }),
/* 350 */
/***/ (function(module, exports, __webpack_require__) {

// 20.2.2.11 Math.clz32(x)
var $export = __webpack_require__(0);

$export($export.S, 'Math', {
  clz32: function clz32(x) {
    return (x >>>= 0) ? 31 - Math.floor(Math.log(x + 0.5) * Math.LOG2E) : 32;
  }
});


/***/ }),
/* 351 */
/***/ (function(module, exports, __webpack_require__) {

// 20.2.2.12 Math.cosh(x)
var $export = __webpack_require__(0);
var exp = Math.exp;

$export($export.S, 'Math', {
  cosh: function cosh(x) {
    return (exp(x = +x) + exp(-x)) / 2;
  }
});


/***/ }),
/* 352 */
/***/ (function(module, exports, __webpack_require__) {

// 20.2.2.14 Math.expm1(x)
var $export = __webpack_require__(0);
var $expm1 = __webpack_require__(123);

$export($export.S + $export.F * ($expm1 != Math.expm1), 'Math', { expm1: $expm1 });


/***/ }),
/* 353 */
/***/ (function(module, exports, __webpack_require__) {

// 20.2.2.16 Math.fround(x)
var $export = __webpack_require__(0);

$export($export.S, 'Math', { fround: __webpack_require__(192) });


/***/ }),
/* 354 */
/***/ (function(module, exports, __webpack_require__) {

// 20.2.2.17 Math.hypot([value1[, value2[, … ]]])
var $export = __webpack_require__(0);
var abs = Math.abs;

$export($export.S, 'Math', {
  hypot: function hypot(value1, value2) { // eslint-disable-line no-unused-vars
    var sum = 0;
    var i = 0;
    var aLen = arguments.length;
    var larg = 0;
    var arg, div;
    while (i < aLen) {
      arg = abs(arguments[i++]);
      if (larg < arg) {
        div = larg / arg;
        sum = sum * div * div + 1;
        larg = arg;
      } else if (arg > 0) {
        div = arg / larg;
        sum += div * div;
      } else sum += arg;
    }
    return larg === Infinity ? Infinity : larg * Math.sqrt(sum);
  }
});


/***/ }),
/* 355 */
/***/ (function(module, exports, __webpack_require__) {

// 20.2.2.18 Math.imul(x, y)
var $export = __webpack_require__(0);
var $imul = Math.imul;

// some WebKit versions fails with big numbers, some has wrong arity
$export($export.S + $export.F * __webpack_require__(5)(function () {
  return $imul(0xffffffff, 5) != -5 || $imul.length != 2;
}), 'Math', {
  imul: function imul(x, y) {
    var UINT16 = 0xffff;
    var xn = +x;
    var yn = +y;
    var xl = UINT16 & xn;
    var yl = UINT16 & yn;
    return 0 | xl * yl + ((UINT16 & xn >>> 16) * yl + xl * (UINT16 & yn >>> 16) << 16 >>> 0);
  }
});


/***/ }),
/* 356 */
/***/ (function(module, exports, __webpack_require__) {

// 20.2.2.21 Math.log10(x)
var $export = __webpack_require__(0);

$export($export.S, 'Math', {
  log10: function log10(x) {
    return Math.log(x) * Math.LOG10E;
  }
});


/***/ }),
/* 357 */
/***/ (function(module, exports, __webpack_require__) {

// 20.2.2.20 Math.log1p(x)
var $export = __webpack_require__(0);

$export($export.S, 'Math', { log1p: __webpack_require__(191) });


/***/ }),
/* 358 */
/***/ (function(module, exports, __webpack_require__) {

// 20.2.2.22 Math.log2(x)
var $export = __webpack_require__(0);

$export($export.S, 'Math', {
  log2: function log2(x) {
    return Math.log(x) / Math.LN2;
  }
});


/***/ }),
/* 359 */
/***/ (function(module, exports, __webpack_require__) {

// 20.2.2.28 Math.sign(x)
var $export = __webpack_require__(0);

$export($export.S, 'Math', { sign: __webpack_require__(122) });


/***/ }),
/* 360 */
/***/ (function(module, exports, __webpack_require__) {

// 20.2.2.30 Math.sinh(x)
var $export = __webpack_require__(0);
var expm1 = __webpack_require__(123);
var exp = Math.exp;

// V8 near Chromium 38 has a problem with very small numbers
$export($export.S + $export.F * __webpack_require__(5)(function () {
  return !Math.sinh(-2e-17) != -2e-17;
}), 'Math', {
  sinh: function sinh(x) {
    return Math.abs(x = +x) < 1
      ? (expm1(x) - expm1(-x)) / 2
      : (exp(x - 1) - exp(-x - 1)) * (Math.E / 2);
  }
});


/***/ }),
/* 361 */
/***/ (function(module, exports, __webpack_require__) {

// 20.2.2.33 Math.tanh(x)
var $export = __webpack_require__(0);
var expm1 = __webpack_require__(123);
var exp = Math.exp;

$export($export.S, 'Math', {
  tanh: function tanh(x) {
    var a = expm1(x = +x);
    var b = expm1(-x);
    return a == Infinity ? 1 : b == Infinity ? -1 : (a - b) / (exp(x) + exp(-x));
  }
});


/***/ }),
/* 362 */
/***/ (function(module, exports, __webpack_require__) {

// 20.2.2.34 Math.trunc(x)
var $export = __webpack_require__(0);

$export($export.S, 'Math', {
  trunc: function trunc(it) {
    return (it > 0 ? Math.floor : Math.ceil)(it);
  }
});


/***/ }),
/* 363 */
/***/ (function(module, exports, __webpack_require__) {

var $export = __webpack_require__(0);
var toAbsoluteIndex = __webpack_require__(50);
var fromCharCode = String.fromCharCode;
var $fromCodePoint = String.fromCodePoint;

// length should be 1, old FF problem
$export($export.S + $export.F * (!!$fromCodePoint && $fromCodePoint.length != 1), 'String', {
  // 21.1.2.2 String.fromCodePoint(...codePoints)
  fromCodePoint: function fromCodePoint(x) { // eslint-disable-line no-unused-vars
    var res = [];
    var aLen = arguments.length;
    var i = 0;
    var code;
    while (aLen > i) {
      code = +arguments[i++];
      if (toAbsoluteIndex(code, 0x10ffff) !== code) throw RangeError(code + ' is not a valid code point');
      res.push(code < 0x10000
        ? fromCharCode(code)
        : fromCharCode(((code -= 0x10000) >> 10) + 0xd800, code % 0x400 + 0xdc00)
      );
    } return res.join('');
  }
});


/***/ }),
/* 364 */
/***/ (function(module, exports, __webpack_require__) {

var $export = __webpack_require__(0);
var toIObject = __webpack_require__(23);
var toLength = __webpack_require__(12);

$export($export.S, 'String', {
  // 21.1.2.4 String.raw(callSite, ...substitutions)
  raw: function raw(callSite) {
    var tpl = toIObject(callSite.raw);
    var len = toLength(tpl.length);
    var aLen = arguments.length;
    var res = [];
    var i = 0;
    while (len > i) {
      res.push(String(tpl[i++]));
      if (i < aLen) res.push(String(arguments[i]));
    } return res.join('');
  }
});


/***/ }),
/* 365 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// 21.1.3.25 String.prototype.trim()
__webpack_require__(60)('trim', function ($trim) {
  return function trim() {
    return $trim(this, 3);
  };
});


/***/ }),
/* 366 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var $at = __webpack_require__(124)(true);

// 21.1.3.27 String.prototype[@@iterator]()
__webpack_require__(125)(String, 'String', function (iterated) {
  this._t = String(iterated); // target
  this._i = 0;                // next index
// 21.1.5.2.1 %StringIteratorPrototype%.next()
}, function () {
  var O = this._t;
  var index = this._i;
  var point;
  if (index >= O.length) return { value: undefined, done: true };
  point = $at(O, index);
  this._i += point.length;
  return { value: point, done: false };
});


/***/ }),
/* 367 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var $export = __webpack_require__(0);
var $at = __webpack_require__(124)(false);
$export($export.P, 'String', {
  // 21.1.3.3 String.prototype.codePointAt(pos)
  codePointAt: function codePointAt(pos) {
    return $at(this, pos);
  }
});


/***/ }),
/* 368 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";
// 21.1.3.6 String.prototype.endsWith(searchString [, endPosition])

var $export = __webpack_require__(0);
var toLength = __webpack_require__(12);
var context = __webpack_require__(127);
var ENDS_WITH = 'endsWith';
var $endsWith = ''[ENDS_WITH];

$export($export.P + $export.F * __webpack_require__(128)(ENDS_WITH), 'String', {
  endsWith: function endsWith(searchString /* , endPosition = @length */) {
    var that = context(this, searchString, ENDS_WITH);
    var endPosition = arguments.length > 1 ? arguments[1] : undefined;
    var len = toLength(that.length);
    var end = endPosition === undefined ? len : Math.min(toLength(endPosition), len);
    var search = String(searchString);
    return $endsWith
      ? $endsWith.call(that, search, end)
      : that.slice(end - search.length, end) === search;
  }
});


/***/ }),
/* 369 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";
// 21.1.3.7 String.prototype.includes(searchString, position = 0)

var $export = __webpack_require__(0);
var context = __webpack_require__(127);
var INCLUDES = 'includes';

$export($export.P + $export.F * __webpack_require__(128)(INCLUDES), 'String', {
  includes: function includes(searchString /* , position = 0 */) {
    return !!~context(this, searchString, INCLUDES)
      .indexOf(searchString, arguments.length > 1 ? arguments[1] : undefined);
  }
});


/***/ }),
/* 370 */
/***/ (function(module, exports, __webpack_require__) {

var $export = __webpack_require__(0);

$export($export.P, 'String', {
  // 21.1.3.13 String.prototype.repeat(count)
  repeat: __webpack_require__(121)
});


/***/ }),
/* 371 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";
// 21.1.3.18 String.prototype.startsWith(searchString [, position ])

var $export = __webpack_require__(0);
var toLength = __webpack_require__(12);
var context = __webpack_require__(127);
var STARTS_WITH = 'startsWith';
var $startsWith = ''[STARTS_WITH];

$export($export.P + $export.F * __webpack_require__(128)(STARTS_WITH), 'String', {
  startsWith: function startsWith(searchString /* , position = 0 */) {
    var that = context(this, searchString, STARTS_WITH);
    var index = toLength(Math.min(arguments.length > 1 ? arguments[1] : undefined, that.length));
    var search = String(searchString);
    return $startsWith
      ? $startsWith.call(that, search, index)
      : that.slice(index, index + search.length) === search;
  }
});


/***/ }),
/* 372 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// B.2.3.2 String.prototype.anchor(name)
__webpack_require__(21)('anchor', function (createHTML) {
  return function anchor(name) {
    return createHTML(this, 'a', 'name', name);
  };
});


/***/ }),
/* 373 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// B.2.3.3 String.prototype.big()
__webpack_require__(21)('big', function (createHTML) {
  return function big() {
    return createHTML(this, 'big', '', '');
  };
});


/***/ }),
/* 374 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// B.2.3.4 String.prototype.blink()
__webpack_require__(21)('blink', function (createHTML) {
  return function blink() {
    return createHTML(this, 'blink', '', '');
  };
});


/***/ }),
/* 375 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// B.2.3.5 String.prototype.bold()
__webpack_require__(21)('bold', function (createHTML) {
  return function bold() {
    return createHTML(this, 'b', '', '');
  };
});


/***/ }),
/* 376 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// B.2.3.6 String.prototype.fixed()
__webpack_require__(21)('fixed', function (createHTML) {
  return function fixed() {
    return createHTML(this, 'tt', '', '');
  };
});


/***/ }),
/* 377 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// B.2.3.7 String.prototype.fontcolor(color)
__webpack_require__(21)('fontcolor', function (createHTML) {
  return function fontcolor(color) {
    return createHTML(this, 'font', 'color', color);
  };
});


/***/ }),
/* 378 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// B.2.3.8 String.prototype.fontsize(size)
__webpack_require__(21)('fontsize', function (createHTML) {
  return function fontsize(size) {
    return createHTML(this, 'font', 'size', size);
  };
});


/***/ }),
/* 379 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// B.2.3.9 String.prototype.italics()
__webpack_require__(21)('italics', function (createHTML) {
  return function italics() {
    return createHTML(this, 'i', '', '');
  };
});


/***/ }),
/* 380 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// B.2.3.10 String.prototype.link(url)
__webpack_require__(21)('link', function (createHTML) {
  return function link(url) {
    return createHTML(this, 'a', 'href', url);
  };
});


/***/ }),
/* 381 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// B.2.3.11 String.prototype.small()
__webpack_require__(21)('small', function (createHTML) {
  return function small() {
    return createHTML(this, 'small', '', '');
  };
});


/***/ }),
/* 382 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// B.2.3.12 String.prototype.strike()
__webpack_require__(21)('strike', function (createHTML) {
  return function strike() {
    return createHTML(this, 'strike', '', '');
  };
});


/***/ }),
/* 383 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// B.2.3.13 String.prototype.sub()
__webpack_require__(21)('sub', function (createHTML) {
  return function sub() {
    return createHTML(this, 'sub', '', '');
  };
});


/***/ }),
/* 384 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// B.2.3.14 String.prototype.sup()
__webpack_require__(21)('sup', function (createHTML) {
  return function sup() {
    return createHTML(this, 'sup', '', '');
  };
});


/***/ }),
/* 385 */
/***/ (function(module, exports, __webpack_require__) {

// 20.3.3.1 / 15.9.4.4 Date.now()
var $export = __webpack_require__(0);

$export($export.S, 'Date', { now: function () { return new Date().getTime(); } });


/***/ }),
/* 386 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var $export = __webpack_require__(0);
var toObject = __webpack_require__(14);
var toPrimitive = __webpack_require__(31);

$export($export.P + $export.F * __webpack_require__(5)(function () {
  return new Date(NaN).toJSON() !== null
    || Date.prototype.toJSON.call({ toISOString: function () { return 1; } }) !== 1;
}), 'Date', {
  // eslint-disable-next-line no-unused-vars
  toJSON: function toJSON(key) {
    var O = toObject(this);
    var pv = toPrimitive(O);
    return typeof pv == 'number' && !isFinite(pv) ? null : O.toISOString();
  }
});


/***/ }),
/* 387 */
/***/ (function(module, exports, __webpack_require__) {

// 20.3.4.36 / 15.9.5.43 Date.prototype.toISOString()
var $export = __webpack_require__(0);
var toISOString = __webpack_require__(388);

// PhantomJS / old WebKit has a broken implementations
$export($export.P + $export.F * (Date.prototype.toISOString !== toISOString), 'Date', {
  toISOString: toISOString
});


/***/ }),
/* 388 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// 20.3.4.36 / 15.9.5.43 Date.prototype.toISOString()
var fails = __webpack_require__(5);
var getTime = Date.prototype.getTime;
var $toISOString = Date.prototype.toISOString;

var lz = function (num) {
  return num > 9 ? num : '0' + num;
};

// PhantomJS / old WebKit has a broken implementations
module.exports = (fails(function () {
  return $toISOString.call(new Date(-5e13 - 1)) != '0385-07-25T07:06:39.999Z';
}) || !fails(function () {
  $toISOString.call(new Date(NaN));
})) ? function toISOString() {
  if (!isFinite(getTime.call(this))) throw RangeError('Invalid time value');
  var d = this;
  var y = d.getUTCFullYear();
  var m = d.getUTCMilliseconds();
  var s = y < 0 ? '-' : y > 9999 ? '+' : '';
  return s + ('00000' + Math.abs(y)).slice(s ? -6 : -4) +
    '-' + lz(d.getUTCMonth() + 1) + '-' + lz(d.getUTCDate()) +
    'T' + lz(d.getUTCHours()) + ':' + lz(d.getUTCMinutes()) +
    ':' + lz(d.getUTCSeconds()) + '.' + (m > 99 ? m : '0' + lz(m)) + 'Z';
} : $toISOString;


/***/ }),
/* 389 */
/***/ (function(module, exports, __webpack_require__) {

var DateProto = Date.prototype;
var INVALID_DATE = 'Invalid Date';
var TO_STRING = 'toString';
var $toString = DateProto[TO_STRING];
var getTime = DateProto.getTime;
if (new Date(NaN) + '' != INVALID_DATE) {
  __webpack_require__(20)(DateProto, TO_STRING, function toString() {
    var value = getTime.call(this);
    // eslint-disable-next-line no-self-compare
    return value === value ? $toString.call(this) : INVALID_DATE;
  });
}


/***/ }),
/* 390 */
/***/ (function(module, exports, __webpack_require__) {

var TO_PRIMITIVE = __webpack_require__(9)('toPrimitive');
var proto = Date.prototype;

if (!(TO_PRIMITIVE in proto)) __webpack_require__(19)(proto, TO_PRIMITIVE, __webpack_require__(391));


/***/ }),
/* 391 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var anObject = __webpack_require__(2);
var toPrimitive = __webpack_require__(31);
var NUMBER = 'number';

module.exports = function (hint) {
  if (hint !== 'string' && hint !== NUMBER && hint !== 'default') throw TypeError('Incorrect hint');
  return toPrimitive(anObject(this), hint != NUMBER);
};


/***/ }),
/* 392 */
/***/ (function(module, exports, __webpack_require__) {

// 22.1.2.2 / 15.4.3.2 Array.isArray(arg)
var $export = __webpack_require__(0);

$export($export.S, 'Array', { isArray: __webpack_require__(85) });


/***/ }),
/* 393 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var ctx = __webpack_require__(26);
var $export = __webpack_require__(0);
var toObject = __webpack_require__(14);
var call = __webpack_require__(193);
var isArrayIter = __webpack_require__(129);
var toLength = __webpack_require__(12);
var createProperty = __webpack_require__(130);
var getIterFn = __webpack_require__(131);

$export($export.S + $export.F * !__webpack_require__(87)(function (iter) { Array.from(iter); }), 'Array', {
  // 22.1.2.1 Array.from(arrayLike, mapfn = undefined, thisArg = undefined)
  from: function from(arrayLike /* , mapfn = undefined, thisArg = undefined */) {
    var O = toObject(arrayLike);
    var C = typeof this == 'function' ? this : Array;
    var aLen = arguments.length;
    var mapfn = aLen > 1 ? arguments[1] : undefined;
    var mapping = mapfn !== undefined;
    var index = 0;
    var iterFn = getIterFn(O);
    var length, result, step, iterator;
    if (mapping) mapfn = ctx(mapfn, aLen > 2 ? arguments[2] : undefined, 2);
    // if object isn't iterable or it's array with default iterator - use simple case
    if (iterFn != undefined && !(C == Array && isArrayIter(iterFn))) {
      for (iterator = iterFn.call(O), result = new C(); !(step = iterator.next()).done; index++) {
        createProperty(result, index, mapping ? call(iterator, mapfn, [step.value, index], true) : step.value);
      }
    } else {
      length = toLength(O.length);
      for (result = new C(length); length > index; index++) {
        createProperty(result, index, mapping ? mapfn(O[index], index) : O[index]);
      }
    }
    result.length = index;
    return result;
  }
});


/***/ }),
/* 394 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var $export = __webpack_require__(0);
var createProperty = __webpack_require__(130);

// WebKit Array.of isn't generic
$export($export.S + $export.F * __webpack_require__(5)(function () {
  function F() { /* empty */ }
  return !(Array.of.call(F) instanceof F);
}), 'Array', {
  // 22.1.2.3 Array.of( ...items)
  of: function of(/* ...args */) {
    var index = 0;
    var aLen = arguments.length;
    var result = new (typeof this == 'function' ? this : Array)(aLen);
    while (aLen > index) createProperty(result, index, arguments[index++]);
    result.length = aLen;
    return result;
  }
});


/***/ }),
/* 395 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// 22.1.3.13 Array.prototype.join(separator)
var $export = __webpack_require__(0);
var toIObject = __webpack_require__(23);
var arrayJoin = [].join;

// fallback for not array-like strings
$export($export.P + $export.F * (__webpack_require__(73) != Object || !__webpack_require__(28)(arrayJoin)), 'Array', {
  join: function join(separator) {
    return arrayJoin.call(toIObject(this), separator === undefined ? ',' : separator);
  }
});


/***/ }),
/* 396 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var $export = __webpack_require__(0);
var html = __webpack_require__(117);
var cof = __webpack_require__(27);
var toAbsoluteIndex = __webpack_require__(50);
var toLength = __webpack_require__(12);
var arraySlice = [].slice;

// fallback for not array-like ES3 strings and DOM objects
$export($export.P + $export.F * __webpack_require__(5)(function () {
  if (html) arraySlice.call(html);
}), 'Array', {
  slice: function slice(begin, end) {
    var len = toLength(this.length);
    var klass = cof(this);
    end = end === undefined ? len : end;
    if (klass == 'Array') return arraySlice.call(this, begin, end);
    var start = toAbsoluteIndex(begin, len);
    var upTo = toAbsoluteIndex(end, len);
    var size = toLength(upTo - start);
    var cloned = Array(size);
    var i = 0;
    for (; i < size; i++) cloned[i] = klass == 'String'
      ? this.charAt(start + i)
      : this[start + i];
    return cloned;
  }
});


/***/ }),
/* 397 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var $export = __webpack_require__(0);
var aFunction = __webpack_require__(16);
var toObject = __webpack_require__(14);
var fails = __webpack_require__(5);
var $sort = [].sort;
var test = [1, 2, 3];

$export($export.P + $export.F * (fails(function () {
  // IE8-
  test.sort(undefined);
}) || !fails(function () {
  // V8 bug
  test.sort(null);
  // Old WebKit
}) || !__webpack_require__(28)($sort)), 'Array', {
  // 22.1.3.25 Array.prototype.sort(comparefn)
  sort: function sort(comparefn) {
    return comparefn === undefined
      ? $sort.call(toObject(this))
      : $sort.call(toObject(this), aFunction(comparefn));
  }
});


/***/ }),
/* 398 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var $export = __webpack_require__(0);
var $forEach = __webpack_require__(35)(0);
var STRICT = __webpack_require__(28)([].forEach, true);

$export($export.P + $export.F * !STRICT, 'Array', {
  // 22.1.3.10 / 15.4.4.18 Array.prototype.forEach(callbackfn [, thisArg])
  forEach: function forEach(callbackfn /* , thisArg */) {
    return $forEach(this, callbackfn, arguments[1]);
  }
});


/***/ }),
/* 399 */
/***/ (function(module, exports, __webpack_require__) {

var isObject = __webpack_require__(7);
var isArray = __webpack_require__(85);
var SPECIES = __webpack_require__(9)('species');

module.exports = function (original) {
  var C;
  if (isArray(original)) {
    C = original.constructor;
    // cross-realm fallback
    if (typeof C == 'function' && (C === Array || isArray(C.prototype))) C = undefined;
    if (isObject(C)) {
      C = C[SPECIES];
      if (C === null) C = undefined;
    }
  } return C === undefined ? Array : C;
};


/***/ }),
/* 400 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var $export = __webpack_require__(0);
var $map = __webpack_require__(35)(1);

$export($export.P + $export.F * !__webpack_require__(28)([].map, true), 'Array', {
  // 22.1.3.15 / 15.4.4.19 Array.prototype.map(callbackfn [, thisArg])
  map: function map(callbackfn /* , thisArg */) {
    return $map(this, callbackfn, arguments[1]);
  }
});


/***/ }),
/* 401 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var $export = __webpack_require__(0);
var $filter = __webpack_require__(35)(2);

$export($export.P + $export.F * !__webpack_require__(28)([].filter, true), 'Array', {
  // 22.1.3.7 / 15.4.4.20 Array.prototype.filter(callbackfn [, thisArg])
  filter: function filter(callbackfn /* , thisArg */) {
    return $filter(this, callbackfn, arguments[1]);
  }
});


/***/ }),
/* 402 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var $export = __webpack_require__(0);
var $some = __webpack_require__(35)(3);

$export($export.P + $export.F * !__webpack_require__(28)([].some, true), 'Array', {
  // 22.1.3.23 / 15.4.4.17 Array.prototype.some(callbackfn [, thisArg])
  some: function some(callbackfn /* , thisArg */) {
    return $some(this, callbackfn, arguments[1]);
  }
});


/***/ }),
/* 403 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var $export = __webpack_require__(0);
var $every = __webpack_require__(35)(4);

$export($export.P + $export.F * !__webpack_require__(28)([].every, true), 'Array', {
  // 22.1.3.5 / 15.4.4.16 Array.prototype.every(callbackfn [, thisArg])
  every: function every(callbackfn /* , thisArg */) {
    return $every(this, callbackfn, arguments[1]);
  }
});


/***/ }),
/* 404 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var $export = __webpack_require__(0);
var $reduce = __webpack_require__(194);

$export($export.P + $export.F * !__webpack_require__(28)([].reduce, true), 'Array', {
  // 22.1.3.18 / 15.4.4.21 Array.prototype.reduce(callbackfn [, initialValue])
  reduce: function reduce(callbackfn /* , initialValue */) {
    return $reduce(this, callbackfn, arguments.length, arguments[1], false);
  }
});


/***/ }),
/* 405 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var $export = __webpack_require__(0);
var $reduce = __webpack_require__(194);

$export($export.P + $export.F * !__webpack_require__(28)([].reduceRight, true), 'Array', {
  // 22.1.3.19 / 15.4.4.22 Array.prototype.reduceRight(callbackfn [, initialValue])
  reduceRight: function reduceRight(callbackfn /* , initialValue */) {
    return $reduce(this, callbackfn, arguments.length, arguments[1], true);
  }
});


/***/ }),
/* 406 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var $export = __webpack_require__(0);
var $indexOf = __webpack_require__(83)(false);
var $native = [].indexOf;
var NEGATIVE_ZERO = !!$native && 1 / [1].indexOf(1, -0) < 0;

$export($export.P + $export.F * (NEGATIVE_ZERO || !__webpack_require__(28)($native)), 'Array', {
  // 22.1.3.11 / 15.4.4.14 Array.prototype.indexOf(searchElement [, fromIndex])
  indexOf: function indexOf(searchElement /* , fromIndex = 0 */) {
    return NEGATIVE_ZERO
      // convert -0 to +0
      ? $native.apply(this, arguments) || 0
      : $indexOf(this, searchElement, arguments[1]);
  }
});


/***/ }),
/* 407 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var $export = __webpack_require__(0);
var toIObject = __webpack_require__(23);
var toInteger = __webpack_require__(33);
var toLength = __webpack_require__(12);
var $native = [].lastIndexOf;
var NEGATIVE_ZERO = !!$native && 1 / [1].lastIndexOf(1, -0) < 0;

$export($export.P + $export.F * (NEGATIVE_ZERO || !__webpack_require__(28)($native)), 'Array', {
  // 22.1.3.14 / 15.4.4.15 Array.prototype.lastIndexOf(searchElement [, fromIndex])
  lastIndexOf: function lastIndexOf(searchElement /* , fromIndex = @[*-1] */) {
    // convert -0 to +0
    if (NEGATIVE_ZERO) return $native.apply(this, arguments) || 0;
    var O = toIObject(this);
    var length = toLength(O.length);
    var index = length - 1;
    if (arguments.length > 1) index = Math.min(index, toInteger(arguments[1]));
    if (index < 0) index = length + index;
    for (;index >= 0; index--) if (index in O) if (O[index] === searchElement) return index || 0;
    return -1;
  }
});


/***/ }),
/* 408 */
/***/ (function(module, exports, __webpack_require__) {

// 22.1.3.3 Array.prototype.copyWithin(target, start, end = this.length)
var $export = __webpack_require__(0);

$export($export.P, 'Array', { copyWithin: __webpack_require__(195) });

__webpack_require__(44)('copyWithin');


/***/ }),
/* 409 */
/***/ (function(module, exports, __webpack_require__) {

// 22.1.3.6 Array.prototype.fill(value, start = 0, end = this.length)
var $export = __webpack_require__(0);

$export($export.P, 'Array', { fill: __webpack_require__(133) });

__webpack_require__(44)('fill');


/***/ }),
/* 410 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// 22.1.3.8 Array.prototype.find(predicate, thisArg = undefined)
var $export = __webpack_require__(0);
var $find = __webpack_require__(35)(5);
var KEY = 'find';
var forced = true;
// Shouldn't skip holes
if (KEY in []) Array(1)[KEY](function () { forced = false; });
$export($export.P + $export.F * forced, 'Array', {
  find: function find(callbackfn /* , that = undefined */) {
    return $find(this, callbackfn, arguments.length > 1 ? arguments[1] : undefined);
  }
});
__webpack_require__(44)(KEY);


/***/ }),
/* 411 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// 22.1.3.9 Array.prototype.findIndex(predicate, thisArg = undefined)
var $export = __webpack_require__(0);
var $find = __webpack_require__(35)(6);
var KEY = 'findIndex';
var forced = true;
// Shouldn't skip holes
if (KEY in []) Array(1)[KEY](function () { forced = false; });
$export($export.P + $export.F * forced, 'Array', {
  findIndex: function findIndex(callbackfn /* , that = undefined */) {
    return $find(this, callbackfn, arguments.length > 1 ? arguments[1] : undefined);
  }
});
__webpack_require__(44)(KEY);


/***/ }),
/* 412 */
/***/ (function(module, exports, __webpack_require__) {

__webpack_require__(53)('Array');


/***/ }),
/* 413 */
/***/ (function(module, exports, __webpack_require__) {

var global = __webpack_require__(3);
var inheritIfRequired = __webpack_require__(120);
var dP = __webpack_require__(11).f;
var gOPN = __webpack_require__(52).f;
var isRegExp = __webpack_require__(86);
var $flags = __webpack_require__(88);
var $RegExp = global.RegExp;
var Base = $RegExp;
var proto = $RegExp.prototype;
var re1 = /a/g;
var re2 = /a/g;
// "new" creates a new object, old webkit buggy here
var CORRECT_NEW = new $RegExp(re1) !== re1;

if (__webpack_require__(10) && (!CORRECT_NEW || __webpack_require__(5)(function () {
  re2[__webpack_require__(9)('match')] = false;
  // RegExp constructor can alter flags and IsRegExp works correct with @@match
  return $RegExp(re1) != re1 || $RegExp(re2) == re2 || $RegExp(re1, 'i') != '/a/i';
}))) {
  $RegExp = function RegExp(p, f) {
    var tiRE = this instanceof $RegExp;
    var piRE = isRegExp(p);
    var fiU = f === undefined;
    return !tiRE && piRE && p.constructor === $RegExp && fiU ? p
      : inheritIfRequired(CORRECT_NEW
        ? new Base(piRE && !fiU ? p.source : p, f)
        : Base((piRE = p instanceof $RegExp) ? p.source : p, piRE && fiU ? $flags.call(p) : f)
      , tiRE ? this : proto, $RegExp);
  };
  var proxy = function (key) {
    key in $RegExp || dP($RegExp, key, {
      configurable: true,
      get: function () { return Base[key]; },
      set: function (it) { Base[key] = it; }
    });
  };
  for (var keys = gOPN(Base), i = 0; keys.length > i;) proxy(keys[i++]);
  proto.constructor = $RegExp;
  $RegExp.prototype = proto;
  __webpack_require__(20)(global, 'RegExp', $RegExp);
}

__webpack_require__(53)('RegExp');


/***/ }),
/* 414 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

__webpack_require__(197);
var anObject = __webpack_require__(2);
var $flags = __webpack_require__(88);
var DESCRIPTORS = __webpack_require__(10);
var TO_STRING = 'toString';
var $toString = /./[TO_STRING];

var define = function (fn) {
  __webpack_require__(20)(RegExp.prototype, TO_STRING, fn, true);
};

// 21.2.5.14 RegExp.prototype.toString()
if (__webpack_require__(5)(function () { return $toString.call({ source: 'a', flags: 'b' }) != '/a/b'; })) {
  define(function toString() {
    var R = anObject(this);
    return '/'.concat(R.source, '/',
      'flags' in R ? R.flags : !DESCRIPTORS && R instanceof RegExp ? $flags.call(R) : undefined);
  });
// FF44- RegExp#toString has a wrong name
} else if ($toString.name != TO_STRING) {
  define(function toString() {
    return $toString.call(this);
  });
}


/***/ }),
/* 415 */
/***/ (function(module, exports, __webpack_require__) {

// @@match logic
__webpack_require__(89)('match', 1, function (defined, MATCH, $match) {
  // 21.1.3.11 String.prototype.match(regexp)
  return [function match(regexp) {
    'use strict';
    var O = defined(this);
    var fn = regexp == undefined ? undefined : regexp[MATCH];
    return fn !== undefined ? fn.call(regexp, O) : new RegExp(regexp)[MATCH](String(O));
  }, $match];
});


/***/ }),
/* 416 */
/***/ (function(module, exports, __webpack_require__) {

// @@replace logic
__webpack_require__(89)('replace', 2, function (defined, REPLACE, $replace) {
  // 21.1.3.14 String.prototype.replace(searchValue, replaceValue)
  return [function replace(searchValue, replaceValue) {
    'use strict';
    var O = defined(this);
    var fn = searchValue == undefined ? undefined : searchValue[REPLACE];
    return fn !== undefined
      ? fn.call(searchValue, O, replaceValue)
      : $replace.call(String(O), searchValue, replaceValue);
  }, $replace];
});


/***/ }),
/* 417 */
/***/ (function(module, exports, __webpack_require__) {

// @@search logic
__webpack_require__(89)('search', 1, function (defined, SEARCH, $search) {
  // 21.1.3.15 String.prototype.search(regexp)
  return [function search(regexp) {
    'use strict';
    var O = defined(this);
    var fn = regexp == undefined ? undefined : regexp[SEARCH];
    return fn !== undefined ? fn.call(regexp, O) : new RegExp(regexp)[SEARCH](String(O));
  }, $search];
});


/***/ }),
/* 418 */
/***/ (function(module, exports, __webpack_require__) {

// @@split logic
__webpack_require__(89)('split', 2, function (defined, SPLIT, $split) {
  'use strict';
  var isRegExp = __webpack_require__(86);
  var _split = $split;
  var $push = [].push;
  var $SPLIT = 'split';
  var LENGTH = 'length';
  var LAST_INDEX = 'lastIndex';
  if (
    'abbc'[$SPLIT](/(b)*/)[1] == 'c' ||
    'test'[$SPLIT](/(?:)/, -1)[LENGTH] != 4 ||
    'ab'[$SPLIT](/(?:ab)*/)[LENGTH] != 2 ||
    '.'[$SPLIT](/(.?)(.?)/)[LENGTH] != 4 ||
    '.'[$SPLIT](/()()/)[LENGTH] > 1 ||
    ''[$SPLIT](/.?/)[LENGTH]
  ) {
    var NPCG = /()??/.exec('')[1] === undefined; // nonparticipating capturing group
    // based on es5-shim implementation, need to rework it
    $split = function (separator, limit) {
      var string = String(this);
      if (separator === undefined && limit === 0) return [];
      // If `separator` is not a regex, use native split
      if (!isRegExp(separator)) return _split.call(string, separator, limit);
      var output = [];
      var flags = (separator.ignoreCase ? 'i' : '') +
                  (separator.multiline ? 'm' : '') +
                  (separator.unicode ? 'u' : '') +
                  (separator.sticky ? 'y' : '');
      var lastLastIndex = 0;
      var splitLimit = limit === undefined ? 4294967295 : limit >>> 0;
      // Make `global` and avoid `lastIndex` issues by working with a copy
      var separatorCopy = new RegExp(separator.source, flags + 'g');
      var separator2, match, lastIndex, lastLength, i;
      // Doesn't need flags gy, but they don't hurt
      if (!NPCG) separator2 = new RegExp('^' + separatorCopy.source + '$(?!\\s)', flags);
      while (match = separatorCopy.exec(string)) {
        // `separatorCopy.lastIndex` is not reliable cross-browser
        lastIndex = match.index + match[0][LENGTH];
        if (lastIndex > lastLastIndex) {
          output.push(string.slice(lastLastIndex, match.index));
          // Fix browsers whose `exec` methods don't consistently return `undefined` for NPCG
          // eslint-disable-next-line no-loop-func
          if (!NPCG && match[LENGTH] > 1) match[0].replace(separator2, function () {
            for (i = 1; i < arguments[LENGTH] - 2; i++) if (arguments[i] === undefined) match[i] = undefined;
          });
          if (match[LENGTH] > 1 && match.index < string[LENGTH]) $push.apply(output, match.slice(1));
          lastLength = match[0][LENGTH];
          lastLastIndex = lastIndex;
          if (output[LENGTH] >= splitLimit) break;
        }
        if (separatorCopy[LAST_INDEX] === match.index) separatorCopy[LAST_INDEX]++; // Avoid an infinite loop
      }
      if (lastLastIndex === string[LENGTH]) {
        if (lastLength || !separatorCopy.test('')) output.push('');
      } else output.push(string.slice(lastLastIndex));
      return output[LENGTH] > splitLimit ? output.slice(0, splitLimit) : output;
    };
  // Chakra, V8
  } else if ('0'[$SPLIT](undefined, 0)[LENGTH]) {
    $split = function (separator, limit) {
      return separator === undefined && limit === 0 ? [] : _split.call(this, separator, limit);
    };
  }
  // 21.1.3.17 String.prototype.split(separator, limit)
  return [function split(separator, limit) {
    var O = defined(this);
    var fn = separator == undefined ? undefined : separator[SPLIT];
    return fn !== undefined ? fn.call(separator, O, limit) : $split.call(String(O), separator, limit);
  }, $split];
});


/***/ }),
/* 419 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var LIBRARY = __webpack_require__(48);
var global = __webpack_require__(3);
var ctx = __webpack_require__(26);
var classof = __webpack_require__(75);
var $export = __webpack_require__(0);
var isObject = __webpack_require__(7);
var aFunction = __webpack_require__(16);
var anInstance = __webpack_require__(54);
var forOf = __webpack_require__(55);
var speciesConstructor = __webpack_require__(90);
var task = __webpack_require__(135).set;
var microtask = __webpack_require__(136)();
var newPromiseCapabilityModule = __webpack_require__(137);
var perform = __webpack_require__(198);
var promiseResolve = __webpack_require__(199);
var PROMISE = 'Promise';
var TypeError = global.TypeError;
var process = global.process;
var $Promise = global[PROMISE];
var isNode = classof(process) == 'process';
var empty = function () { /* empty */ };
var Internal, newGenericPromiseCapability, OwnPromiseCapability, Wrapper;
var newPromiseCapability = newGenericPromiseCapability = newPromiseCapabilityModule.f;

var USE_NATIVE = !!function () {
  try {
    // correct subclassing with @@species support
    var promise = $Promise.resolve(1);
    var FakePromise = (promise.constructor = {})[__webpack_require__(9)('species')] = function (exec) {
      exec(empty, empty);
    };
    // unhandled rejections tracking support, NodeJS Promise without it fails @@species test
    return (isNode || typeof PromiseRejectionEvent == 'function') && promise.then(empty) instanceof FakePromise;
  } catch (e) { /* empty */ }
}();

// helpers
var isThenable = function (it) {
  var then;
  return isObject(it) && typeof (then = it.then) == 'function' ? then : false;
};
var notify = function (promise, isReject) {
  if (promise._n) return;
  promise._n = true;
  var chain = promise._c;
  microtask(function () {
    var value = promise._v;
    var ok = promise._s == 1;
    var i = 0;
    var run = function (reaction) {
      var handler = ok ? reaction.ok : reaction.fail;
      var resolve = reaction.resolve;
      var reject = reaction.reject;
      var domain = reaction.domain;
      var result, then;
      try {
        if (handler) {
          if (!ok) {
            if (promise._h == 2) onHandleUnhandled(promise);
            promise._h = 1;
          }
          if (handler === true) result = value;
          else {
            if (domain) domain.enter();
            result = handler(value);
            if (domain) domain.exit();
          }
          if (result === reaction.promise) {
            reject(TypeError('Promise-chain cycle'));
          } else if (then = isThenable(result)) {
            then.call(result, resolve, reject);
          } else resolve(result);
        } else reject(value);
      } catch (e) {
        reject(e);
      }
    };
    while (chain.length > i) run(chain[i++]); // variable length - can't use forEach
    promise._c = [];
    promise._n = false;
    if (isReject && !promise._h) onUnhandled(promise);
  });
};
var onUnhandled = function (promise) {
  task.call(global, function () {
    var value = promise._v;
    var unhandled = isUnhandled(promise);
    var result, handler, console;
    if (unhandled) {
      result = perform(function () {
        if (isNode) {
          process.emit('unhandledRejection', value, promise);
        } else if (handler = global.onunhandledrejection) {
          handler({ promise: promise, reason: value });
        } else if ((console = global.console) && console.error) {
          console.error('Unhandled promise rejection', value);
        }
      });
      // Browsers should not trigger `rejectionHandled` event if it was handled here, NodeJS - should
      promise._h = isNode || isUnhandled(promise) ? 2 : 1;
    } promise._a = undefined;
    if (unhandled && result.e) throw result.v;
  });
};
var isUnhandled = function (promise) {
  if (promise._h == 1) return false;
  var chain = promise._a || promise._c;
  var i = 0;
  var reaction;
  while (chain.length > i) {
    reaction = chain[i++];
    if (reaction.fail || !isUnhandled(reaction.promise)) return false;
  } return true;
};
var onHandleUnhandled = function (promise) {
  task.call(global, function () {
    var handler;
    if (isNode) {
      process.emit('rejectionHandled', promise);
    } else if (handler = global.onrejectionhandled) {
      handler({ promise: promise, reason: promise._v });
    }
  });
};
var $reject = function (value) {
  var promise = this;
  if (promise._d) return;
  promise._d = true;
  promise = promise._w || promise; // unwrap
  promise._v = value;
  promise._s = 2;
  if (!promise._a) promise._a = promise._c.slice();
  notify(promise, true);
};
var $resolve = function (value) {
  var promise = this;
  var then;
  if (promise._d) return;
  promise._d = true;
  promise = promise._w || promise; // unwrap
  try {
    if (promise === value) throw TypeError("Promise can't be resolved itself");
    if (then = isThenable(value)) {
      microtask(function () {
        var wrapper = { _w: promise, _d: false }; // wrap
        try {
          then.call(value, ctx($resolve, wrapper, 1), ctx($reject, wrapper, 1));
        } catch (e) {
          $reject.call(wrapper, e);
        }
      });
    } else {
      promise._v = value;
      promise._s = 1;
      notify(promise, false);
    }
  } catch (e) {
    $reject.call({ _w: promise, _d: false }, e); // wrap
  }
};

// constructor polyfill
if (!USE_NATIVE) {
  // 25.4.3.1 Promise(executor)
  $Promise = function Promise(executor) {
    anInstance(this, $Promise, PROMISE, '_h');
    aFunction(executor);
    Internal.call(this);
    try {
      executor(ctx($resolve, this, 1), ctx($reject, this, 1));
    } catch (err) {
      $reject.call(this, err);
    }
  };
  // eslint-disable-next-line no-unused-vars
  Internal = function Promise(executor) {
    this._c = [];             // <- awaiting reactions
    this._a = undefined;      // <- checked in isUnhandled reactions
    this._s = 0;              // <- state
    this._d = false;          // <- done
    this._v = undefined;      // <- value
    this._h = 0;              // <- rejection state, 0 - default, 1 - handled, 2 - unhandled
    this._n = false;          // <- notify
  };
  Internal.prototype = __webpack_require__(56)($Promise.prototype, {
    // 25.4.5.3 Promise.prototype.then(onFulfilled, onRejected)
    then: function then(onFulfilled, onRejected) {
      var reaction = newPromiseCapability(speciesConstructor(this, $Promise));
      reaction.ok = typeof onFulfilled == 'function' ? onFulfilled : true;
      reaction.fail = typeof onRejected == 'function' && onRejected;
      reaction.domain = isNode ? process.domain : undefined;
      this._c.push(reaction);
      if (this._a) this._a.push(reaction);
      if (this._s) notify(this, false);
      return reaction.promise;
    },
    // 25.4.5.1 Promise.prototype.catch(onRejected)
    'catch': function (onRejected) {
      return this.then(undefined, onRejected);
    }
  });
  OwnPromiseCapability = function () {
    var promise = new Internal();
    this.promise = promise;
    this.resolve = ctx($resolve, promise, 1);
    this.reject = ctx($reject, promise, 1);
  };
  newPromiseCapabilityModule.f = newPromiseCapability = function (C) {
    return C === $Promise || C === Wrapper
      ? new OwnPromiseCapability(C)
      : newGenericPromiseCapability(C);
  };
}

$export($export.G + $export.W + $export.F * !USE_NATIVE, { Promise: $Promise });
__webpack_require__(59)($Promise, PROMISE);
__webpack_require__(53)(PROMISE);
Wrapper = __webpack_require__(30)[PROMISE];

// statics
$export($export.S + $export.F * !USE_NATIVE, PROMISE, {
  // 25.4.4.5 Promise.reject(r)
  reject: function reject(r) {
    var capability = newPromiseCapability(this);
    var $$reject = capability.reject;
    $$reject(r);
    return capability.promise;
  }
});
$export($export.S + $export.F * (LIBRARY || !USE_NATIVE), PROMISE, {
  // 25.4.4.6 Promise.resolve(x)
  resolve: function resolve(x) {
    return promiseResolve(LIBRARY && this === Wrapper ? $Promise : this, x);
  }
});
$export($export.S + $export.F * !(USE_NATIVE && __webpack_require__(87)(function (iter) {
  $Promise.all(iter)['catch'](empty);
})), PROMISE, {
  // 25.4.4.1 Promise.all(iterable)
  all: function all(iterable) {
    var C = this;
    var capability = newPromiseCapability(C);
    var resolve = capability.resolve;
    var reject = capability.reject;
    var result = perform(function () {
      var values = [];
      var index = 0;
      var remaining = 1;
      forOf(iterable, false, function (promise) {
        var $index = index++;
        var alreadyCalled = false;
        values.push(undefined);
        remaining++;
        C.resolve(promise).then(function (value) {
          if (alreadyCalled) return;
          alreadyCalled = true;
          values[$index] = value;
          --remaining || resolve(values);
        }, reject);
      });
      --remaining || resolve(values);
    });
    if (result.e) reject(result.v);
    return capability.promise;
  },
  // 25.4.4.4 Promise.race(iterable)
  race: function race(iterable) {
    var C = this;
    var capability = newPromiseCapability(C);
    var reject = capability.reject;
    var result = perform(function () {
      forOf(iterable, false, function (promise) {
        C.resolve(promise).then(capability.resolve, reject);
      });
    });
    if (result.e) reject(result.v);
    return capability.promise;
  }
});


/***/ }),
/* 420 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var weak = __webpack_require__(204);
var validate = __webpack_require__(62);
var WEAK_SET = 'WeakSet';

// 23.4 WeakSet Objects
__webpack_require__(91)(WEAK_SET, function (get) {
  return function WeakSet() { return get(this, arguments.length > 0 ? arguments[0] : undefined); };
}, {
  // 23.4.3.1 WeakSet.prototype.add(value)
  add: function add(value) {
    return weak.def(validate(this, WEAK_SET), value, true);
  }
}, weak, false, true);


/***/ }),
/* 421 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var $export = __webpack_require__(0);
var $typed = __webpack_require__(92);
var buffer = __webpack_require__(138);
var anObject = __webpack_require__(2);
var toAbsoluteIndex = __webpack_require__(50);
var toLength = __webpack_require__(12);
var isObject = __webpack_require__(7);
var ArrayBuffer = __webpack_require__(3).ArrayBuffer;
var speciesConstructor = __webpack_require__(90);
var $ArrayBuffer = buffer.ArrayBuffer;
var $DataView = buffer.DataView;
var $isView = $typed.ABV && ArrayBuffer.isView;
var $slice = $ArrayBuffer.prototype.slice;
var VIEW = $typed.VIEW;
var ARRAY_BUFFER = 'ArrayBuffer';

$export($export.G + $export.W + $export.F * (ArrayBuffer !== $ArrayBuffer), { ArrayBuffer: $ArrayBuffer });

$export($export.S + $export.F * !$typed.CONSTR, ARRAY_BUFFER, {
  // 24.1.3.1 ArrayBuffer.isView(arg)
  isView: function isView(it) {
    return $isView && $isView(it) || isObject(it) && VIEW in it;
  }
});

$export($export.P + $export.U + $export.F * __webpack_require__(5)(function () {
  return !new $ArrayBuffer(2).slice(1, undefined).byteLength;
}), ARRAY_BUFFER, {
  // 24.1.4.3 ArrayBuffer.prototype.slice(start, end)
  slice: function slice(start, end) {
    if ($slice !== undefined && end === undefined) return $slice.call(anObject(this), start); // FF fix
    var len = anObject(this).byteLength;
    var first = toAbsoluteIndex(start, len);
    var final = toAbsoluteIndex(end === undefined ? len : end, len);
    var result = new (speciesConstructor(this, $ArrayBuffer))(toLength(final - first));
    var viewS = new $DataView(this);
    var viewT = new $DataView(result);
    var index = 0;
    while (first < final) {
      viewT.setUint8(index++, viewS.getUint8(first++));
    } return result;
  }
});

__webpack_require__(53)(ARRAY_BUFFER);


/***/ }),
/* 422 */
/***/ (function(module, exports, __webpack_require__) {

var $export = __webpack_require__(0);
$export($export.G + $export.W + $export.F * !__webpack_require__(92).ABV, {
  DataView: __webpack_require__(138).DataView
});


/***/ }),
/* 423 */
/***/ (function(module, exports, __webpack_require__) {

__webpack_require__(38)('Int8', 1, function (init) {
  return function Int8Array(data, byteOffset, length) {
    return init(this, data, byteOffset, length);
  };
});


/***/ }),
/* 424 */
/***/ (function(module, exports, __webpack_require__) {

__webpack_require__(38)('Uint8', 1, function (init) {
  return function Uint8Array(data, byteOffset, length) {
    return init(this, data, byteOffset, length);
  };
});


/***/ }),
/* 425 */
/***/ (function(module, exports, __webpack_require__) {

__webpack_require__(38)('Uint8', 1, function (init) {
  return function Uint8ClampedArray(data, byteOffset, length) {
    return init(this, data, byteOffset, length);
  };
}, true);


/***/ }),
/* 426 */
/***/ (function(module, exports, __webpack_require__) {

__webpack_require__(38)('Int16', 2, function (init) {
  return function Int16Array(data, byteOffset, length) {
    return init(this, data, byteOffset, length);
  };
});


/***/ }),
/* 427 */
/***/ (function(module, exports, __webpack_require__) {

__webpack_require__(38)('Uint16', 2, function (init) {
  return function Uint16Array(data, byteOffset, length) {
    return init(this, data, byteOffset, length);
  };
});


/***/ }),
/* 428 */
/***/ (function(module, exports, __webpack_require__) {

__webpack_require__(38)('Int32', 4, function (init) {
  return function Int32Array(data, byteOffset, length) {
    return init(this, data, byteOffset, length);
  };
});


/***/ }),
/* 429 */
/***/ (function(module, exports, __webpack_require__) {

__webpack_require__(38)('Uint32', 4, function (init) {
  return function Uint32Array(data, byteOffset, length) {
    return init(this, data, byteOffset, length);
  };
});


/***/ }),
/* 430 */
/***/ (function(module, exports, __webpack_require__) {

__webpack_require__(38)('Float32', 4, function (init) {
  return function Float32Array(data, byteOffset, length) {
    return init(this, data, byteOffset, length);
  };
});


/***/ }),
/* 431 */
/***/ (function(module, exports, __webpack_require__) {

__webpack_require__(38)('Float64', 8, function (init) {
  return function Float64Array(data, byteOffset, length) {
    return init(this, data, byteOffset, length);
  };
});


/***/ }),
/* 432 */
/***/ (function(module, exports, __webpack_require__) {

// 26.1.1 Reflect.apply(target, thisArgument, argumentsList)
var $export = __webpack_require__(0);
var aFunction = __webpack_require__(16);
var anObject = __webpack_require__(2);
var rApply = (__webpack_require__(3).Reflect || {}).apply;
var fApply = Function.apply;
// MS Edge argumentsList argument is optional
$export($export.S + $export.F * !__webpack_require__(5)(function () {
  rApply(function () { /* empty */ });
}), 'Reflect', {
  apply: function apply(target, thisArgument, argumentsList) {
    var T = aFunction(target);
    var L = anObject(argumentsList);
    return rApply ? rApply(T, thisArgument, L) : fApply.call(T, thisArgument, L);
  }
});


/***/ }),
/* 433 */
/***/ (function(module, exports, __webpack_require__) {

// 26.1.2 Reflect.construct(target, argumentsList [, newTarget])
var $export = __webpack_require__(0);
var create = __webpack_require__(51);
var aFunction = __webpack_require__(16);
var anObject = __webpack_require__(2);
var isObject = __webpack_require__(7);
var fails = __webpack_require__(5);
var bind = __webpack_require__(185);
var rConstruct = (__webpack_require__(3).Reflect || {}).construct;

// MS Edge supports only 2 arguments and argumentsList argument is optional
// FF Nightly sets third argument as `new.target`, but does not create `this` from it
var NEW_TARGET_BUG = fails(function () {
  function F() { /* empty */ }
  return !(rConstruct(function () { /* empty */ }, [], F) instanceof F);
});
var ARGS_BUG = !fails(function () {
  rConstruct(function () { /* empty */ });
});

$export($export.S + $export.F * (NEW_TARGET_BUG || ARGS_BUG), 'Reflect', {
  construct: function construct(Target, args /* , newTarget */) {
    aFunction(Target);
    anObject(args);
    var newTarget = arguments.length < 3 ? Target : aFunction(arguments[2]);
    if (ARGS_BUG && !NEW_TARGET_BUG) return rConstruct(Target, args, newTarget);
    if (Target == newTarget) {
      // w/o altered newTarget, optimization for 0-4 arguments
      switch (args.length) {
        case 0: return new Target();
        case 1: return new Target(args[0]);
        case 2: return new Target(args[0], args[1]);
        case 3: return new Target(args[0], args[1], args[2]);
        case 4: return new Target(args[0], args[1], args[2], args[3]);
      }
      // w/o altered newTarget, lot of arguments case
      var $args = [null];
      $args.push.apply($args, args);
      return new (bind.apply(Target, $args))();
    }
    // with altered newTarget, not support built-in constructors
    var proto = newTarget.prototype;
    var instance = create(isObject(proto) ? proto : Object.prototype);
    var result = Function.apply.call(Target, instance, args);
    return isObject(result) ? result : instance;
  }
});


/***/ }),
/* 434 */
/***/ (function(module, exports, __webpack_require__) {

// 26.1.3 Reflect.defineProperty(target, propertyKey, attributes)
var dP = __webpack_require__(11);
var $export = __webpack_require__(0);
var anObject = __webpack_require__(2);
var toPrimitive = __webpack_require__(31);

// MS Edge has broken Reflect.defineProperty - throwing instead of returning false
$export($export.S + $export.F * __webpack_require__(5)(function () {
  // eslint-disable-next-line no-undef
  Reflect.defineProperty(dP.f({}, 1, { value: 1 }), 1, { value: 2 });
}), 'Reflect', {
  defineProperty: function defineProperty(target, propertyKey, attributes) {
    anObject(target);
    propertyKey = toPrimitive(propertyKey, true);
    anObject(attributes);
    try {
      dP.f(target, propertyKey, attributes);
      return true;
    } catch (e) {
      return false;
    }
  }
});


/***/ }),
/* 435 */
/***/ (function(module, exports, __webpack_require__) {

// 26.1.4 Reflect.deleteProperty(target, propertyKey)
var $export = __webpack_require__(0);
var gOPD = __webpack_require__(24).f;
var anObject = __webpack_require__(2);

$export($export.S, 'Reflect', {
  deleteProperty: function deleteProperty(target, propertyKey) {
    var desc = gOPD(anObject(target), propertyKey);
    return desc && !desc.configurable ? false : delete target[propertyKey];
  }
});


/***/ }),
/* 436 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// 26.1.5 Reflect.enumerate(target)
var $export = __webpack_require__(0);
var anObject = __webpack_require__(2);
var Enumerate = function (iterated) {
  this._t = anObject(iterated); // target
  this._i = 0;                  // next index
  var keys = this._k = [];      // keys
  var key;
  for (key in iterated) keys.push(key);
};
__webpack_require__(126)(Enumerate, 'Object', function () {
  var that = this;
  var keys = that._k;
  var key;
  do {
    if (that._i >= keys.length) return { value: undefined, done: true };
  } while (!((key = keys[that._i++]) in that._t));
  return { value: key, done: false };
});

$export($export.S, 'Reflect', {
  enumerate: function enumerate(target) {
    return new Enumerate(target);
  }
});


/***/ }),
/* 437 */
/***/ (function(module, exports, __webpack_require__) {

// 26.1.6 Reflect.get(target, propertyKey [, receiver])
var gOPD = __webpack_require__(24);
var getPrototypeOf = __webpack_require__(25);
var has = __webpack_require__(18);
var $export = __webpack_require__(0);
var isObject = __webpack_require__(7);
var anObject = __webpack_require__(2);

function get(target, propertyKey /* , receiver */) {
  var receiver = arguments.length < 3 ? target : arguments[2];
  var desc, proto;
  if (anObject(target) === receiver) return target[propertyKey];
  if (desc = gOPD.f(target, propertyKey)) return has(desc, 'value')
    ? desc.value
    : desc.get !== undefined
      ? desc.get.call(receiver)
      : undefined;
  if (isObject(proto = getPrototypeOf(target))) return get(proto, propertyKey, receiver);
}

$export($export.S, 'Reflect', { get: get });


/***/ }),
/* 438 */
/***/ (function(module, exports, __webpack_require__) {

// 26.1.7 Reflect.getOwnPropertyDescriptor(target, propertyKey)
var gOPD = __webpack_require__(24);
var $export = __webpack_require__(0);
var anObject = __webpack_require__(2);

$export($export.S, 'Reflect', {
  getOwnPropertyDescriptor: function getOwnPropertyDescriptor(target, propertyKey) {
    return gOPD.f(anObject(target), propertyKey);
  }
});


/***/ }),
/* 439 */
/***/ (function(module, exports, __webpack_require__) {

// 26.1.8 Reflect.getPrototypeOf(target)
var $export = __webpack_require__(0);
var getProto = __webpack_require__(25);
var anObject = __webpack_require__(2);

$export($export.S, 'Reflect', {
  getPrototypeOf: function getPrototypeOf(target) {
    return getProto(anObject(target));
  }
});


/***/ }),
/* 440 */
/***/ (function(module, exports, __webpack_require__) {

// 26.1.9 Reflect.has(target, propertyKey)
var $export = __webpack_require__(0);

$export($export.S, 'Reflect', {
  has: function has(target, propertyKey) {
    return propertyKey in target;
  }
});


/***/ }),
/* 441 */
/***/ (function(module, exports, __webpack_require__) {

// 26.1.10 Reflect.isExtensible(target)
var $export = __webpack_require__(0);
var anObject = __webpack_require__(2);
var $isExtensible = Object.isExtensible;

$export($export.S, 'Reflect', {
  isExtensible: function isExtensible(target) {
    anObject(target);
    return $isExtensible ? $isExtensible(target) : true;
  }
});


/***/ }),
/* 442 */
/***/ (function(module, exports, __webpack_require__) {

// 26.1.11 Reflect.ownKeys(target)
var $export = __webpack_require__(0);

$export($export.S, 'Reflect', { ownKeys: __webpack_require__(206) });


/***/ }),
/* 443 */
/***/ (function(module, exports, __webpack_require__) {

// 26.1.12 Reflect.preventExtensions(target)
var $export = __webpack_require__(0);
var anObject = __webpack_require__(2);
var $preventExtensions = Object.preventExtensions;

$export($export.S, 'Reflect', {
  preventExtensions: function preventExtensions(target) {
    anObject(target);
    try {
      if ($preventExtensions) $preventExtensions(target);
      return true;
    } catch (e) {
      return false;
    }
  }
});


/***/ }),
/* 444 */
/***/ (function(module, exports, __webpack_require__) {

// 26.1.13 Reflect.set(target, propertyKey, V [, receiver])
var dP = __webpack_require__(11);
var gOPD = __webpack_require__(24);
var getPrototypeOf = __webpack_require__(25);
var has = __webpack_require__(18);
var $export = __webpack_require__(0);
var createDesc = __webpack_require__(46);
var anObject = __webpack_require__(2);
var isObject = __webpack_require__(7);

function set(target, propertyKey, V /* , receiver */) {
  var receiver = arguments.length < 4 ? target : arguments[3];
  var ownDesc = gOPD.f(anObject(target), propertyKey);
  var existingDescriptor, proto;
  if (!ownDesc) {
    if (isObject(proto = getPrototypeOf(target))) {
      return set(proto, propertyKey, V, receiver);
    }
    ownDesc = createDesc(0);
  }
  if (has(ownDesc, 'value')) {
    if (ownDesc.writable === false || !isObject(receiver)) return false;
    existingDescriptor = gOPD.f(receiver, propertyKey) || createDesc(0);
    existingDescriptor.value = V;
    dP.f(receiver, propertyKey, existingDescriptor);
    return true;
  }
  return ownDesc.set === undefined ? false : (ownDesc.set.call(receiver, V), true);
}

$export($export.S, 'Reflect', { set: set });


/***/ }),
/* 445 */
/***/ (function(module, exports, __webpack_require__) {

// 26.1.14 Reflect.setPrototypeOf(target, proto)
var $export = __webpack_require__(0);
var setProto = __webpack_require__(118);

if (setProto) $export($export.S, 'Reflect', {
  setPrototypeOf: function setPrototypeOf(target, proto) {
    setProto.check(target, proto);
    try {
      setProto.set(target, proto);
      return true;
    } catch (e) {
      return false;
    }
  }
});


/***/ }),
/* 446 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// https://github.com/tc39/Array.prototype.includes
var $export = __webpack_require__(0);
var $includes = __webpack_require__(83)(true);

$export($export.P, 'Array', {
  includes: function includes(el /* , fromIndex = 0 */) {
    return $includes(this, el, arguments.length > 1 ? arguments[1] : undefined);
  }
});

__webpack_require__(44)('includes');


/***/ }),
/* 447 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// https://tc39.github.io/proposal-flatMap/#sec-Array.prototype.flatMap
var $export = __webpack_require__(0);
var flattenIntoArray = __webpack_require__(207);
var toObject = __webpack_require__(14);
var toLength = __webpack_require__(12);
var aFunction = __webpack_require__(16);
var arraySpeciesCreate = __webpack_require__(132);

$export($export.P, 'Array', {
  flatMap: function flatMap(callbackfn /* , thisArg */) {
    var O = toObject(this);
    var sourceLen, A;
    aFunction(callbackfn);
    sourceLen = toLength(O.length);
    A = arraySpeciesCreate(O, 0);
    flattenIntoArray(A, O, O, sourceLen, 0, 1, callbackfn, arguments[1]);
    return A;
  }
});

__webpack_require__(44)('flatMap');


/***/ }),
/* 448 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// https://tc39.github.io/proposal-flatMap/#sec-Array.prototype.flatten
var $export = __webpack_require__(0);
var flattenIntoArray = __webpack_require__(207);
var toObject = __webpack_require__(14);
var toLength = __webpack_require__(12);
var toInteger = __webpack_require__(33);
var arraySpeciesCreate = __webpack_require__(132);

$export($export.P, 'Array', {
  flatten: function flatten(/* depthArg = 1 */) {
    var depthArg = arguments[0];
    var O = toObject(this);
    var sourceLen = toLength(O.length);
    var A = arraySpeciesCreate(O, 0);
    flattenIntoArray(A, O, O, sourceLen, 0, depthArg === undefined ? 1 : toInteger(depthArg));
    return A;
  }
});

__webpack_require__(44)('flatten');


/***/ }),
/* 449 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// https://github.com/mathiasbynens/String.prototype.at
var $export = __webpack_require__(0);
var $at = __webpack_require__(124)(true);

$export($export.P, 'String', {
  at: function at(pos) {
    return $at(this, pos);
  }
});


/***/ }),
/* 450 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// https://github.com/tc39/proposal-string-pad-start-end
var $export = __webpack_require__(0);
var $pad = __webpack_require__(208);

$export($export.P, 'String', {
  padStart: function padStart(maxLength /* , fillString = ' ' */) {
    return $pad(this, maxLength, arguments.length > 1 ? arguments[1] : undefined, true);
  }
});


/***/ }),
/* 451 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// https://github.com/tc39/proposal-string-pad-start-end
var $export = __webpack_require__(0);
var $pad = __webpack_require__(208);

$export($export.P, 'String', {
  padEnd: function padEnd(maxLength /* , fillString = ' ' */) {
    return $pad(this, maxLength, arguments.length > 1 ? arguments[1] : undefined, false);
  }
});


/***/ }),
/* 452 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// https://github.com/sebmarkbage/ecmascript-string-left-right-trim
__webpack_require__(60)('trimLeft', function ($trim) {
  return function trimLeft() {
    return $trim(this, 1);
  };
}, 'trimStart');


/***/ }),
/* 453 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// https://github.com/sebmarkbage/ecmascript-string-left-right-trim
__webpack_require__(60)('trimRight', function ($trim) {
  return function trimRight() {
    return $trim(this, 2);
  };
}, 'trimEnd');


/***/ }),
/* 454 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// https://tc39.github.io/String.prototype.matchAll/
var $export = __webpack_require__(0);
var defined = __webpack_require__(32);
var toLength = __webpack_require__(12);
var isRegExp = __webpack_require__(86);
var getFlags = __webpack_require__(88);
var RegExpProto = RegExp.prototype;

var $RegExpStringIterator = function (regexp, string) {
  this._r = regexp;
  this._s = string;
};

__webpack_require__(126)($RegExpStringIterator, 'RegExp String', function next() {
  var match = this._r.exec(this._s);
  return { value: match, done: match === null };
});

$export($export.P, 'String', {
  matchAll: function matchAll(regexp) {
    defined(this);
    if (!isRegExp(regexp)) throw TypeError(regexp + ' is not a regexp!');
    var S = String(this);
    var flags = 'flags' in RegExpProto ? String(regexp.flags) : getFlags.call(regexp);
    var rx = new RegExp(regexp.source, ~flags.indexOf('g') ? flags : 'g' + flags);
    rx.lastIndex = toLength(regexp.lastIndex);
    return new $RegExpStringIterator(rx, S);
  }
});


/***/ }),
/* 455 */
/***/ (function(module, exports, __webpack_require__) {

__webpack_require__(114)('asyncIterator');


/***/ }),
/* 456 */
/***/ (function(module, exports, __webpack_require__) {

__webpack_require__(114)('observable');


/***/ }),
/* 457 */
/***/ (function(module, exports, __webpack_require__) {

// https://github.com/tc39/proposal-object-getownpropertydescriptors
var $export = __webpack_require__(0);
var ownKeys = __webpack_require__(206);
var toIObject = __webpack_require__(23);
var gOPD = __webpack_require__(24);
var createProperty = __webpack_require__(130);

$export($export.S, 'Object', {
  getOwnPropertyDescriptors: function getOwnPropertyDescriptors(object) {
    var O = toIObject(object);
    var getDesc = gOPD.f;
    var keys = ownKeys(O);
    var result = {};
    var i = 0;
    var key, desc;
    while (keys.length > i) {
      desc = getDesc(O, key = keys[i++]);
      if (desc !== undefined) createProperty(result, key, desc);
    }
    return result;
  }
});


/***/ }),
/* 458 */
/***/ (function(module, exports, __webpack_require__) {

// https://github.com/tc39/proposal-object-values-entries
var $export = __webpack_require__(0);
var $values = __webpack_require__(209)(false);

$export($export.S, 'Object', {
  values: function values(it) {
    return $values(it);
  }
});


/***/ }),
/* 459 */
/***/ (function(module, exports, __webpack_require__) {

// https://github.com/tc39/proposal-object-values-entries
var $export = __webpack_require__(0);
var $entries = __webpack_require__(209)(true);

$export($export.S, 'Object', {
  entries: function entries(it) {
    return $entries(it);
  }
});


/***/ }),
/* 460 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var $export = __webpack_require__(0);
var toObject = __webpack_require__(14);
var aFunction = __webpack_require__(16);
var $defineProperty = __webpack_require__(11);

// B.2.2.2 Object.prototype.__defineGetter__(P, getter)
__webpack_require__(10) && $export($export.P + __webpack_require__(93), 'Object', {
  __defineGetter__: function __defineGetter__(P, getter) {
    $defineProperty.f(toObject(this), P, { get: aFunction(getter), enumerable: true, configurable: true });
  }
});


/***/ }),
/* 461 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var $export = __webpack_require__(0);
var toObject = __webpack_require__(14);
var aFunction = __webpack_require__(16);
var $defineProperty = __webpack_require__(11);

// B.2.2.3 Object.prototype.__defineSetter__(P, setter)
__webpack_require__(10) && $export($export.P + __webpack_require__(93), 'Object', {
  __defineSetter__: function __defineSetter__(P, setter) {
    $defineProperty.f(toObject(this), P, { set: aFunction(setter), enumerable: true, configurable: true });
  }
});


/***/ }),
/* 462 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var $export = __webpack_require__(0);
var toObject = __webpack_require__(14);
var toPrimitive = __webpack_require__(31);
var getPrototypeOf = __webpack_require__(25);
var getOwnPropertyDescriptor = __webpack_require__(24).f;

// B.2.2.4 Object.prototype.__lookupGetter__(P)
__webpack_require__(10) && $export($export.P + __webpack_require__(93), 'Object', {
  __lookupGetter__: function __lookupGetter__(P) {
    var O = toObject(this);
    var K = toPrimitive(P, true);
    var D;
    do {
      if (D = getOwnPropertyDescriptor(O, K)) return D.get;
    } while (O = getPrototypeOf(O));
  }
});


/***/ }),
/* 463 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

var $export = __webpack_require__(0);
var toObject = __webpack_require__(14);
var toPrimitive = __webpack_require__(31);
var getPrototypeOf = __webpack_require__(25);
var getOwnPropertyDescriptor = __webpack_require__(24).f;

// B.2.2.5 Object.prototype.__lookupSetter__(P)
__webpack_require__(10) && $export($export.P + __webpack_require__(93), 'Object', {
  __lookupSetter__: function __lookupSetter__(P) {
    var O = toObject(this);
    var K = toPrimitive(P, true);
    var D;
    do {
      if (D = getOwnPropertyDescriptor(O, K)) return D.set;
    } while (O = getPrototypeOf(O));
  }
});


/***/ }),
/* 464 */
/***/ (function(module, exports, __webpack_require__) {

// https://github.com/DavidBruant/Map-Set.prototype.toJSON
var $export = __webpack_require__(0);

$export($export.P + $export.R, 'Map', { toJSON: __webpack_require__(210)('Map') });


/***/ }),
/* 465 */
/***/ (function(module, exports, __webpack_require__) {

// https://github.com/DavidBruant/Map-Set.prototype.toJSON
var $export = __webpack_require__(0);

$export($export.P + $export.R, 'Set', { toJSON: __webpack_require__(210)('Set') });


/***/ }),
/* 466 */
/***/ (function(module, exports, __webpack_require__) {

// https://tc39.github.io/proposal-setmap-offrom/#sec-map.of
__webpack_require__(94)('Map');


/***/ }),
/* 467 */
/***/ (function(module, exports, __webpack_require__) {

// https://tc39.github.io/proposal-setmap-offrom/#sec-set.of
__webpack_require__(94)('Set');


/***/ }),
/* 468 */
/***/ (function(module, exports, __webpack_require__) {

// https://tc39.github.io/proposal-setmap-offrom/#sec-weakmap.of
__webpack_require__(94)('WeakMap');


/***/ }),
/* 469 */
/***/ (function(module, exports, __webpack_require__) {

// https://tc39.github.io/proposal-setmap-offrom/#sec-weakset.of
__webpack_require__(94)('WeakSet');


/***/ }),
/* 470 */
/***/ (function(module, exports, __webpack_require__) {

// https://tc39.github.io/proposal-setmap-offrom/#sec-map.from
__webpack_require__(95)('Map');


/***/ }),
/* 471 */
/***/ (function(module, exports, __webpack_require__) {

// https://tc39.github.io/proposal-setmap-offrom/#sec-set.from
__webpack_require__(95)('Set');


/***/ }),
/* 472 */
/***/ (function(module, exports, __webpack_require__) {

// https://tc39.github.io/proposal-setmap-offrom/#sec-weakmap.from
__webpack_require__(95)('WeakMap');


/***/ }),
/* 473 */
/***/ (function(module, exports, __webpack_require__) {

// https://tc39.github.io/proposal-setmap-offrom/#sec-weakset.from
__webpack_require__(95)('WeakSet');


/***/ }),
/* 474 */
/***/ (function(module, exports, __webpack_require__) {

// https://github.com/tc39/proposal-global
var $export = __webpack_require__(0);

$export($export.G, { global: __webpack_require__(3) });


/***/ }),
/* 475 */
/***/ (function(module, exports, __webpack_require__) {

// https://github.com/tc39/proposal-global
var $export = __webpack_require__(0);

$export($export.S, 'System', { global: __webpack_require__(3) });


/***/ }),
/* 476 */
/***/ (function(module, exports, __webpack_require__) {

// https://github.com/ljharb/proposal-is-error
var $export = __webpack_require__(0);
var cof = __webpack_require__(27);

$export($export.S, 'Error', {
  isError: function isError(it) {
    return cof(it) === 'Error';
  }
});


/***/ }),
/* 477 */
/***/ (function(module, exports, __webpack_require__) {

// https://rwaldron.github.io/proposal-math-extensions/
var $export = __webpack_require__(0);

$export($export.S, 'Math', {
  clamp: function clamp(x, lower, upper) {
    return Math.min(upper, Math.max(lower, x));
  }
});


/***/ }),
/* 478 */
/***/ (function(module, exports, __webpack_require__) {

// https://rwaldron.github.io/proposal-math-extensions/
var $export = __webpack_require__(0);

$export($export.S, 'Math', { DEG_PER_RAD: Math.PI / 180 });


/***/ }),
/* 479 */
/***/ (function(module, exports, __webpack_require__) {

// https://rwaldron.github.io/proposal-math-extensions/
var $export = __webpack_require__(0);
var RAD_PER_DEG = 180 / Math.PI;

$export($export.S, 'Math', {
  degrees: function degrees(radians) {
    return radians * RAD_PER_DEG;
  }
});


/***/ }),
/* 480 */
/***/ (function(module, exports, __webpack_require__) {

// https://rwaldron.github.io/proposal-math-extensions/
var $export = __webpack_require__(0);
var scale = __webpack_require__(212);
var fround = __webpack_require__(192);

$export($export.S, 'Math', {
  fscale: function fscale(x, inLow, inHigh, outLow, outHigh) {
    return fround(scale(x, inLow, inHigh, outLow, outHigh));
  }
});


/***/ }),
/* 481 */
/***/ (function(module, exports, __webpack_require__) {

// https://gist.github.com/BrendanEich/4294d5c212a6d2254703
var $export = __webpack_require__(0);

$export($export.S, 'Math', {
  iaddh: function iaddh(x0, x1, y0, y1) {
    var $x0 = x0 >>> 0;
    var $x1 = x1 >>> 0;
    var $y0 = y0 >>> 0;
    return $x1 + (y1 >>> 0) + (($x0 & $y0 | ($x0 | $y0) & ~($x0 + $y0 >>> 0)) >>> 31) | 0;
  }
});


/***/ }),
/* 482 */
/***/ (function(module, exports, __webpack_require__) {

// https://gist.github.com/BrendanEich/4294d5c212a6d2254703
var $export = __webpack_require__(0);

$export($export.S, 'Math', {
  isubh: function isubh(x0, x1, y0, y1) {
    var $x0 = x0 >>> 0;
    var $x1 = x1 >>> 0;
    var $y0 = y0 >>> 0;
    return $x1 - (y1 >>> 0) - ((~$x0 & $y0 | ~($x0 ^ $y0) & $x0 - $y0 >>> 0) >>> 31) | 0;
  }
});


/***/ }),
/* 483 */
/***/ (function(module, exports, __webpack_require__) {

// https://gist.github.com/BrendanEich/4294d5c212a6d2254703
var $export = __webpack_require__(0);

$export($export.S, 'Math', {
  imulh: function imulh(u, v) {
    var UINT16 = 0xffff;
    var $u = +u;
    var $v = +v;
    var u0 = $u & UINT16;
    var v0 = $v & UINT16;
    var u1 = $u >> 16;
    var v1 = $v >> 16;
    var t = (u1 * v0 >>> 0) + (u0 * v0 >>> 16);
    return u1 * v1 + (t >> 16) + ((u0 * v1 >>> 0) + (t & UINT16) >> 16);
  }
});


/***/ }),
/* 484 */
/***/ (function(module, exports, __webpack_require__) {

// https://rwaldron.github.io/proposal-math-extensions/
var $export = __webpack_require__(0);

$export($export.S, 'Math', { RAD_PER_DEG: 180 / Math.PI });


/***/ }),
/* 485 */
/***/ (function(module, exports, __webpack_require__) {

// https://rwaldron.github.io/proposal-math-extensions/
var $export = __webpack_require__(0);
var DEG_PER_RAD = Math.PI / 180;

$export($export.S, 'Math', {
  radians: function radians(degrees) {
    return degrees * DEG_PER_RAD;
  }
});


/***/ }),
/* 486 */
/***/ (function(module, exports, __webpack_require__) {

// https://rwaldron.github.io/proposal-math-extensions/
var $export = __webpack_require__(0);

$export($export.S, 'Math', { scale: __webpack_require__(212) });


/***/ }),
/* 487 */
/***/ (function(module, exports, __webpack_require__) {

// https://gist.github.com/BrendanEich/4294d5c212a6d2254703
var $export = __webpack_require__(0);

$export($export.S, 'Math', {
  umulh: function umulh(u, v) {
    var UINT16 = 0xffff;
    var $u = +u;
    var $v = +v;
    var u0 = $u & UINT16;
    var v0 = $v & UINT16;
    var u1 = $u >>> 16;
    var v1 = $v >>> 16;
    var t = (u1 * v0 >>> 0) + (u0 * v0 >>> 16);
    return u1 * v1 + (t >>> 16) + ((u0 * v1 >>> 0) + (t & UINT16) >>> 16);
  }
});


/***/ }),
/* 488 */
/***/ (function(module, exports, __webpack_require__) {

// http://jfbastien.github.io/papers/Math.signbit.html
var $export = __webpack_require__(0);

$export($export.S, 'Math', { signbit: function signbit(x) {
  // eslint-disable-next-line no-self-compare
  return (x = +x) != x ? x : x == 0 ? 1 / x == Infinity : x > 0;
} });


/***/ }),
/* 489 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";
// https://github.com/tc39/proposal-promise-finally

var $export = __webpack_require__(0);
var core = __webpack_require__(30);
var global = __webpack_require__(3);
var speciesConstructor = __webpack_require__(90);
var promiseResolve = __webpack_require__(199);

$export($export.P + $export.R, 'Promise', { 'finally': function (onFinally) {
  var C = speciesConstructor(this, core.Promise || global.Promise);
  var isFunction = typeof onFinally == 'function';
  return this.then(
    isFunction ? function (x) {
      return promiseResolve(C, onFinally()).then(function () { return x; });
    } : onFinally,
    isFunction ? function (e) {
      return promiseResolve(C, onFinally()).then(function () { throw e; });
    } : onFinally
  );
} });


/***/ }),
/* 490 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// https://github.com/tc39/proposal-promise-try
var $export = __webpack_require__(0);
var newPromiseCapability = __webpack_require__(137);
var perform = __webpack_require__(198);

$export($export.S, 'Promise', { 'try': function (callbackfn) {
  var promiseCapability = newPromiseCapability.f(this);
  var result = perform(callbackfn);
  (result.e ? promiseCapability.reject : promiseCapability.resolve)(result.v);
  return promiseCapability.promise;
} });


/***/ }),
/* 491 */
/***/ (function(module, exports, __webpack_require__) {

var metadata = __webpack_require__(39);
var anObject = __webpack_require__(2);
var toMetaKey = metadata.key;
var ordinaryDefineOwnMetadata = metadata.set;

metadata.exp({ defineMetadata: function defineMetadata(metadataKey, metadataValue, target, targetKey) {
  ordinaryDefineOwnMetadata(metadataKey, metadataValue, anObject(target), toMetaKey(targetKey));
} });


/***/ }),
/* 492 */
/***/ (function(module, exports, __webpack_require__) {

var metadata = __webpack_require__(39);
var anObject = __webpack_require__(2);
var toMetaKey = metadata.key;
var getOrCreateMetadataMap = metadata.map;
var store = metadata.store;

metadata.exp({ deleteMetadata: function deleteMetadata(metadataKey, target /* , targetKey */) {
  var targetKey = arguments.length < 3 ? undefined : toMetaKey(arguments[2]);
  var metadataMap = getOrCreateMetadataMap(anObject(target), targetKey, false);
  if (metadataMap === undefined || !metadataMap['delete'](metadataKey)) return false;
  if (metadataMap.size) return true;
  var targetMetadata = store.get(target);
  targetMetadata['delete'](targetKey);
  return !!targetMetadata.size || store['delete'](target);
} });


/***/ }),
/* 493 */
/***/ (function(module, exports, __webpack_require__) {

var metadata = __webpack_require__(39);
var anObject = __webpack_require__(2);
var getPrototypeOf = __webpack_require__(25);
var ordinaryHasOwnMetadata = metadata.has;
var ordinaryGetOwnMetadata = metadata.get;
var toMetaKey = metadata.key;

var ordinaryGetMetadata = function (MetadataKey, O, P) {
  var hasOwn = ordinaryHasOwnMetadata(MetadataKey, O, P);
  if (hasOwn) return ordinaryGetOwnMetadata(MetadataKey, O, P);
  var parent = getPrototypeOf(O);
  return parent !== null ? ordinaryGetMetadata(MetadataKey, parent, P) : undefined;
};

metadata.exp({ getMetadata: function getMetadata(metadataKey, target /* , targetKey */) {
  return ordinaryGetMetadata(metadataKey, anObject(target), arguments.length < 3 ? undefined : toMetaKey(arguments[2]));
} });


/***/ }),
/* 494 */
/***/ (function(module, exports, __webpack_require__) {

var Set = __webpack_require__(202);
var from = __webpack_require__(211);
var metadata = __webpack_require__(39);
var anObject = __webpack_require__(2);
var getPrototypeOf = __webpack_require__(25);
var ordinaryOwnMetadataKeys = metadata.keys;
var toMetaKey = metadata.key;

var ordinaryMetadataKeys = function (O, P) {
  var oKeys = ordinaryOwnMetadataKeys(O, P);
  var parent = getPrototypeOf(O);
  if (parent === null) return oKeys;
  var pKeys = ordinaryMetadataKeys(parent, P);
  return pKeys.length ? oKeys.length ? from(new Set(oKeys.concat(pKeys))) : pKeys : oKeys;
};

metadata.exp({ getMetadataKeys: function getMetadataKeys(target /* , targetKey */) {
  return ordinaryMetadataKeys(anObject(target), arguments.length < 2 ? undefined : toMetaKey(arguments[1]));
} });


/***/ }),
/* 495 */
/***/ (function(module, exports, __webpack_require__) {

var metadata = __webpack_require__(39);
var anObject = __webpack_require__(2);
var ordinaryGetOwnMetadata = metadata.get;
var toMetaKey = metadata.key;

metadata.exp({ getOwnMetadata: function getOwnMetadata(metadataKey, target /* , targetKey */) {
  return ordinaryGetOwnMetadata(metadataKey, anObject(target)
    , arguments.length < 3 ? undefined : toMetaKey(arguments[2]));
} });


/***/ }),
/* 496 */
/***/ (function(module, exports, __webpack_require__) {

var metadata = __webpack_require__(39);
var anObject = __webpack_require__(2);
var ordinaryOwnMetadataKeys = metadata.keys;
var toMetaKey = metadata.key;

metadata.exp({ getOwnMetadataKeys: function getOwnMetadataKeys(target /* , targetKey */) {
  return ordinaryOwnMetadataKeys(anObject(target), arguments.length < 2 ? undefined : toMetaKey(arguments[1]));
} });


/***/ }),
/* 497 */
/***/ (function(module, exports, __webpack_require__) {

var metadata = __webpack_require__(39);
var anObject = __webpack_require__(2);
var getPrototypeOf = __webpack_require__(25);
var ordinaryHasOwnMetadata = metadata.has;
var toMetaKey = metadata.key;

var ordinaryHasMetadata = function (MetadataKey, O, P) {
  var hasOwn = ordinaryHasOwnMetadata(MetadataKey, O, P);
  if (hasOwn) return true;
  var parent = getPrototypeOf(O);
  return parent !== null ? ordinaryHasMetadata(MetadataKey, parent, P) : false;
};

metadata.exp({ hasMetadata: function hasMetadata(metadataKey, target /* , targetKey */) {
  return ordinaryHasMetadata(metadataKey, anObject(target), arguments.length < 3 ? undefined : toMetaKey(arguments[2]));
} });


/***/ }),
/* 498 */
/***/ (function(module, exports, __webpack_require__) {

var metadata = __webpack_require__(39);
var anObject = __webpack_require__(2);
var ordinaryHasOwnMetadata = metadata.has;
var toMetaKey = metadata.key;

metadata.exp({ hasOwnMetadata: function hasOwnMetadata(metadataKey, target /* , targetKey */) {
  return ordinaryHasOwnMetadata(metadataKey, anObject(target)
    , arguments.length < 3 ? undefined : toMetaKey(arguments[2]));
} });


/***/ }),
/* 499 */
/***/ (function(module, exports, __webpack_require__) {

var $metadata = __webpack_require__(39);
var anObject = __webpack_require__(2);
var aFunction = __webpack_require__(16);
var toMetaKey = $metadata.key;
var ordinaryDefineOwnMetadata = $metadata.set;

$metadata.exp({ metadata: function metadata(metadataKey, metadataValue) {
  return function decorator(target, targetKey) {
    ordinaryDefineOwnMetadata(
      metadataKey, metadataValue,
      (targetKey !== undefined ? anObject : aFunction)(target),
      toMetaKey(targetKey)
    );
  };
} });


/***/ }),
/* 500 */
/***/ (function(module, exports, __webpack_require__) {

// https://github.com/rwaldron/tc39-notes/blob/master/es6/2014-09/sept-25.md#510-globalasap-for-enqueuing-a-microtask
var $export = __webpack_require__(0);
var microtask = __webpack_require__(136)();
var process = __webpack_require__(3).process;
var isNode = __webpack_require__(27)(process) == 'process';

$export($export.G, {
  asap: function asap(fn) {
    var domain = isNode && process.domain;
    microtask(domain ? domain.bind(fn) : fn);
  }
});


/***/ }),
/* 501 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

// https://github.com/zenparsing/es-observable
var $export = __webpack_require__(0);
var global = __webpack_require__(3);
var core = __webpack_require__(30);
var microtask = __webpack_require__(136)();
var OBSERVABLE = __webpack_require__(9)('observable');
var aFunction = __webpack_require__(16);
var anObject = __webpack_require__(2);
var anInstance = __webpack_require__(54);
var redefineAll = __webpack_require__(56);
var hide = __webpack_require__(19);
var forOf = __webpack_require__(55);
var RETURN = forOf.RETURN;

var getMethod = function (fn) {
  return fn == null ? undefined : aFunction(fn);
};

var cleanupSubscription = function (subscription) {
  var cleanup = subscription._c;
  if (cleanup) {
    subscription._c = undefined;
    cleanup();
  }
};

var subscriptionClosed = function (subscription) {
  return subscription._o === undefined;
};

var closeSubscription = function (subscription) {
  if (!subscriptionClosed(subscription)) {
    subscription._o = undefined;
    cleanupSubscription(subscription);
  }
};

var Subscription = function (observer, subscriber) {
  anObject(observer);
  this._c = undefined;
  this._o = observer;
  observer = new SubscriptionObserver(this);
  try {
    var cleanup = subscriber(observer);
    var subscription = cleanup;
    if (cleanup != null) {
      if (typeof cleanup.unsubscribe === 'function') cleanup = function () { subscription.unsubscribe(); };
      else aFunction(cleanup);
      this._c = cleanup;
    }
  } catch (e) {
    observer.error(e);
    return;
  } if (subscriptionClosed(this)) cleanupSubscription(this);
};

Subscription.prototype = redefineAll({}, {
  unsubscribe: function unsubscribe() { closeSubscription(this); }
});

var SubscriptionObserver = function (subscription) {
  this._s = subscription;
};

SubscriptionObserver.prototype = redefineAll({}, {
  next: function next(value) {
    var subscription = this._s;
    if (!subscriptionClosed(subscription)) {
      var observer = subscription._o;
      try {
        var m = getMethod(observer.next);
        if (m) return m.call(observer, value);
      } catch (e) {
        try {
          closeSubscription(subscription);
        } finally {
          throw e;
        }
      }
    }
  },
  error: function error(value) {
    var subscription = this._s;
    if (subscriptionClosed(subscription)) throw value;
    var observer = subscription._o;
    subscription._o = undefined;
    try {
      var m = getMethod(observer.error);
      if (!m) throw value;
      value = m.call(observer, value);
    } catch (e) {
      try {
        cleanupSubscription(subscription);
      } finally {
        throw e;
      }
    } cleanupSubscription(subscription);
    return value;
  },
  complete: function complete(value) {
    var subscription = this._s;
    if (!subscriptionClosed(subscription)) {
      var observer = subscription._o;
      subscription._o = undefined;
      try {
        var m = getMethod(observer.complete);
        value = m ? m.call(observer, value) : undefined;
      } catch (e) {
        try {
          cleanupSubscription(subscription);
        } finally {
          throw e;
        }
      } cleanupSubscription(subscription);
      return value;
    }
  }
});

var $Observable = function Observable(subscriber) {
  anInstance(this, $Observable, 'Observable', '_f')._f = aFunction(subscriber);
};

redefineAll($Observable.prototype, {
  subscribe: function subscribe(observer) {
    return new Subscription(observer, this._f);
  },
  forEach: function forEach(fn) {
    var that = this;
    return new (core.Promise || global.Promise)(function (resolve, reject) {
      aFunction(fn);
      var subscription = that.subscribe({
        next: function (value) {
          try {
            return fn(value);
          } catch (e) {
            reject(e);
            subscription.unsubscribe();
          }
        },
        error: reject,
        complete: resolve
      });
    });
  }
});

redefineAll($Observable, {
  from: function from(x) {
    var C = typeof this === 'function' ? this : $Observable;
    var method = getMethod(anObject(x)[OBSERVABLE]);
    if (method) {
      var observable = anObject(method.call(x));
      return observable.constructor === C ? observable : new C(function (observer) {
        return observable.subscribe(observer);
      });
    }
    return new C(function (observer) {
      var done = false;
      microtask(function () {
        if (!done) {
          try {
            if (forOf(x, false, function (it) {
              observer.next(it);
              if (done) return RETURN;
            }) === RETURN) return;
          } catch (e) {
            if (done) throw e;
            observer.error(e);
            return;
          } observer.complete();
        }
      });
      return function () { done = true; };
    });
  },
  of: function of() {
    for (var i = 0, l = arguments.length, items = Array(l); i < l;) items[i] = arguments[i++];
    return new (typeof this === 'function' ? this : $Observable)(function (observer) {
      var done = false;
      microtask(function () {
        if (!done) {
          for (var j = 0; j < items.length; ++j) {
            observer.next(items[j]);
            if (done) return;
          } observer.complete();
        }
      });
      return function () { done = true; };
    });
  }
});

hide($Observable.prototype, OBSERVABLE, function () { return this; });

$export($export.G, { Observable: $Observable });

__webpack_require__(53)('Observable');


/***/ }),
/* 502 */
/***/ (function(module, exports, __webpack_require__) {

// ie9- setTimeout & setInterval additional parameters fix
var global = __webpack_require__(3);
var $export = __webpack_require__(0);
var navigator = global.navigator;
var slice = [].slice;
var MSIE = !!navigator && /MSIE .\./.test(navigator.userAgent); // <- dirty ie9- check
var wrap = function (set) {
  return function (fn, time /* , ...args */) {
    var boundArgs = arguments.length > 2;
    var args = boundArgs ? slice.call(arguments, 2) : false;
    return set(boundArgs ? function () {
      // eslint-disable-next-line no-new-func
      (typeof fn == 'function' ? fn : Function(fn)).apply(this, args);
    } : fn, time);
  };
};
$export($export.G + $export.B + $export.F * MSIE, {
  setTimeout: wrap(global.setTimeout),
  setInterval: wrap(global.setInterval)
});


/***/ }),
/* 503 */
/***/ (function(module, exports, __webpack_require__) {

var $export = __webpack_require__(0);
var $task = __webpack_require__(135);
$export($export.G + $export.B, {
  setImmediate: $task.set,
  clearImmediate: $task.clear
});


/***/ }),
/* 504 */
/***/ (function(module, exports, __webpack_require__) {

var $iterators = __webpack_require__(134);
var getKeys = __webpack_require__(49);
var redefine = __webpack_require__(20);
var global = __webpack_require__(3);
var hide = __webpack_require__(19);
var Iterators = __webpack_require__(61);
var wks = __webpack_require__(9);
var ITERATOR = wks('iterator');
var TO_STRING_TAG = wks('toStringTag');
var ArrayValues = Iterators.Array;

var DOMIterables = {
  CSSRuleList: true, // TODO: Not spec compliant, should be false.
  CSSStyleDeclaration: false,
  CSSValueList: false,
  ClientRectList: false,
  DOMRectList: false,
  DOMStringList: false,
  DOMTokenList: true,
  DataTransferItemList: false,
  FileList: false,
  HTMLAllCollection: false,
  HTMLCollection: false,
  HTMLFormElement: false,
  HTMLSelectElement: false,
  MediaList: true, // TODO: Not spec compliant, should be false.
  MimeTypeArray: false,
  NamedNodeMap: false,
  NodeList: true,
  PaintRequestList: false,
  Plugin: false,
  PluginArray: false,
  SVGLengthList: false,
  SVGNumberList: false,
  SVGPathSegList: false,
  SVGPointList: false,
  SVGStringList: false,
  SVGTransformList: false,
  SourceBufferList: false,
  StyleSheetList: true, // TODO: Not spec compliant, should be false.
  TextTrackCueList: false,
  TextTrackList: false,
  TouchList: false
};

for (var collections = getKeys(DOMIterables), i = 0; i < collections.length; i++) {
  var NAME = collections[i];
  var explicit = DOMIterables[NAME];
  var Collection = global[NAME];
  var proto = Collection && Collection.prototype;
  var key;
  if (proto) {
    if (!proto[ITERATOR]) hide(proto, ITERATOR, ArrayValues);
    if (!proto[TO_STRING_TAG]) hide(proto, TO_STRING_TAG, NAME);
    Iterators[NAME] = ArrayValues;
    if (explicit) for (key in $iterators) if (!proto[key]) redefine(proto, key, $iterators[key], true);
  }
}


/***/ }),
/* 505 */
/***/ (function(module, exports, __webpack_require__) {

/* WEBPACK VAR INJECTION */(function(global) {/**
 * Copyright (c) 2014, Facebook, Inc.
 * All rights reserved.
 *
 * This source code is licensed under the BSD-style license found in the
 * https://raw.github.com/facebook/regenerator/master/LICENSE file. An
 * additional grant of patent rights can be found in the PATENTS file in
 * the same directory.
 */

!(function(global) {
  "use strict";

  var Op = Object.prototype;
  var hasOwn = Op.hasOwnProperty;
  var undefined; // More compressible than void 0.
  var $Symbol = typeof Symbol === "function" ? Symbol : {};
  var iteratorSymbol = $Symbol.iterator || "@@iterator";
  var asyncIteratorSymbol = $Symbol.asyncIterator || "@@asyncIterator";
  var toStringTagSymbol = $Symbol.toStringTag || "@@toStringTag";

  var inModule = typeof module === "object";
  var runtime = global.regeneratorRuntime;
  if (runtime) {
    if (inModule) {
      // If regeneratorRuntime is defined globally and we're in a module,
      // make the exports object identical to regeneratorRuntime.
      module.exports = runtime;
    }
    // Don't bother evaluating the rest of this file if the runtime was
    // already defined globally.
    return;
  }

  // Define the runtime globally (as expected by generated code) as either
  // module.exports (if we're in a module) or a new, empty object.
  runtime = global.regeneratorRuntime = inModule ? module.exports : {};

  function wrap(innerFn, outerFn, self, tryLocsList) {
    // If outerFn provided and outerFn.prototype is a Generator, then outerFn.prototype instanceof Generator.
    var protoGenerator = outerFn && outerFn.prototype instanceof Generator ? outerFn : Generator;
    var generator = Object.create(protoGenerator.prototype);
    var context = new Context(tryLocsList || []);

    // The ._invoke method unifies the implementations of the .next,
    // .throw, and .return methods.
    generator._invoke = makeInvokeMethod(innerFn, self, context);

    return generator;
  }
  runtime.wrap = wrap;

  // Try/catch helper to minimize deoptimizations. Returns a completion
  // record like context.tryEntries[i].completion. This interface could
  // have been (and was previously) designed to take a closure to be
  // invoked without arguments, but in all the cases we care about we
  // already have an existing method we want to call, so there's no need
  // to create a new function object. We can even get away with assuming
  // the method takes exactly one argument, since that happens to be true
  // in every case, so we don't have to touch the arguments object. The
  // only additional allocation required is the completion record, which
  // has a stable shape and so hopefully should be cheap to allocate.
  function tryCatch(fn, obj, arg) {
    try {
      return { type: "normal", arg: fn.call(obj, arg) };
    } catch (err) {
      return { type: "throw", arg: err };
    }
  }

  var GenStateSuspendedStart = "suspendedStart";
  var GenStateSuspendedYield = "suspendedYield";
  var GenStateExecuting = "executing";
  var GenStateCompleted = "completed";

  // Returning this object from the innerFn has the same effect as
  // breaking out of the dispatch switch statement.
  var ContinueSentinel = {};

  // Dummy constructor functions that we use as the .constructor and
  // .constructor.prototype properties for functions that return Generator
  // objects. For full spec compliance, you may wish to configure your
  // minifier not to mangle the names of these two functions.
  function Generator() {}
  function GeneratorFunction() {}
  function GeneratorFunctionPrototype() {}

  // This is a polyfill for %IteratorPrototype% for environments that
  // don't natively support it.
  var IteratorPrototype = {};
  IteratorPrototype[iteratorSymbol] = function () {
    return this;
  };

  var getProto = Object.getPrototypeOf;
  var NativeIteratorPrototype = getProto && getProto(getProto(values([])));
  if (NativeIteratorPrototype &&
      NativeIteratorPrototype !== Op &&
      hasOwn.call(NativeIteratorPrototype, iteratorSymbol)) {
    // This environment has a native %IteratorPrototype%; use it instead
    // of the polyfill.
    IteratorPrototype = NativeIteratorPrototype;
  }

  var Gp = GeneratorFunctionPrototype.prototype =
    Generator.prototype = Object.create(IteratorPrototype);
  GeneratorFunction.prototype = Gp.constructor = GeneratorFunctionPrototype;
  GeneratorFunctionPrototype.constructor = GeneratorFunction;
  GeneratorFunctionPrototype[toStringTagSymbol] =
    GeneratorFunction.displayName = "GeneratorFunction";

  // Helper for defining the .next, .throw, and .return methods of the
  // Iterator interface in terms of a single ._invoke method.
  function defineIteratorMethods(prototype) {
    ["next", "throw", "return"].forEach(function(method) {
      prototype[method] = function(arg) {
        return this._invoke(method, arg);
      };
    });
  }

  runtime.isGeneratorFunction = function(genFun) {
    var ctor = typeof genFun === "function" && genFun.constructor;
    return ctor
      ? ctor === GeneratorFunction ||
        // For the native GeneratorFunction constructor, the best we can
        // do is to check its .name property.
        (ctor.displayName || ctor.name) === "GeneratorFunction"
      : false;
  };

  runtime.mark = function(genFun) {
    if (Object.setPrototypeOf) {
      Object.setPrototypeOf(genFun, GeneratorFunctionPrototype);
    } else {
      genFun.__proto__ = GeneratorFunctionPrototype;
      if (!(toStringTagSymbol in genFun)) {
        genFun[toStringTagSymbol] = "GeneratorFunction";
      }
    }
    genFun.prototype = Object.create(Gp);
    return genFun;
  };

  // Within the body of any async function, `await x` is transformed to
  // `yield regeneratorRuntime.awrap(x)`, so that the runtime can test
  // `hasOwn.call(value, "__await")` to determine if the yielded value is
  // meant to be awaited.
  runtime.awrap = function(arg) {
    return { __await: arg };
  };

  function AsyncIterator(generator) {
    function invoke(method, arg, resolve, reject) {
      var record = tryCatch(generator[method], generator, arg);
      if (record.type === "throw") {
        reject(record.arg);
      } else {
        var result = record.arg;
        var value = result.value;
        if (value &&
            typeof value === "object" &&
            hasOwn.call(value, "__await")) {
          return Promise.resolve(value.__await).then(function(value) {
            invoke("next", value, resolve, reject);
          }, function(err) {
            invoke("throw", err, resolve, reject);
          });
        }

        return Promise.resolve(value).then(function(unwrapped) {
          // When a yielded Promise is resolved, its final value becomes
          // the .value of the Promise<{value,done}> result for the
          // current iteration. If the Promise is rejected, however, the
          // result for this iteration will be rejected with the same
          // reason. Note that rejections of yielded Promises are not
          // thrown back into the generator function, as is the case
          // when an awaited Promise is rejected. This difference in
          // behavior between yield and await is important, because it
          // allows the consumer to decide what to do with the yielded
          // rejection (swallow it and continue, manually .throw it back
          // into the generator, abandon iteration, whatever). With
          // await, by contrast, there is no opportunity to examine the
          // rejection reason outside the generator function, so the
          // only option is to throw it from the await expression, and
          // let the generator function handle the exception.
          result.value = unwrapped;
          resolve(result);
        }, reject);
      }
    }

    if (typeof global.process === "object" && global.process.domain) {
      invoke = global.process.domain.bind(invoke);
    }

    var previousPromise;

    function enqueue(method, arg) {
      function callInvokeWithMethodAndArg() {
        return new Promise(function(resolve, reject) {
          invoke(method, arg, resolve, reject);
        });
      }

      return previousPromise =
        // If enqueue has been called before, then we want to wait until
        // all previous Promises have been resolved before calling invoke,
        // so that results are always delivered in the correct order. If
        // enqueue has not been called before, then it is important to
        // call invoke immediately, without waiting on a callback to fire,
        // so that the async generator function has the opportunity to do
        // any necessary setup in a predictable way. This predictability
        // is why the Promise constructor synchronously invokes its
        // executor callback, and why async functions synchronously
        // execute code before the first await. Since we implement simple
        // async functions in terms of async generators, it is especially
        // important to get this right, even though it requires care.
        previousPromise ? previousPromise.then(
          callInvokeWithMethodAndArg,
          // Avoid propagating failures to Promises returned by later
          // invocations of the iterator.
          callInvokeWithMethodAndArg
        ) : callInvokeWithMethodAndArg();
    }

    // Define the unified helper method that is used to implement .next,
    // .throw, and .return (see defineIteratorMethods).
    this._invoke = enqueue;
  }

  defineIteratorMethods(AsyncIterator.prototype);
  AsyncIterator.prototype[asyncIteratorSymbol] = function () {
    return this;
  };
  runtime.AsyncIterator = AsyncIterator;

  // Note that simple async functions are implemented on top of
  // AsyncIterator objects; they just return a Promise for the value of
  // the final result produced by the iterator.
  runtime.async = function(innerFn, outerFn, self, tryLocsList) {
    var iter = new AsyncIterator(
      wrap(innerFn, outerFn, self, tryLocsList)
    );

    return runtime.isGeneratorFunction(outerFn)
      ? iter // If outerFn is a generator, return the full iterator.
      : iter.next().then(function(result) {
          return result.done ? result.value : iter.next();
        });
  };

  function makeInvokeMethod(innerFn, self, context) {
    var state = GenStateSuspendedStart;

    return function invoke(method, arg) {
      if (state === GenStateExecuting) {
        throw new Error("Generator is already running");
      }

      if (state === GenStateCompleted) {
        if (method === "throw") {
          throw arg;
        }

        // Be forgiving, per 25.3.3.3.3 of the spec:
        // https://people.mozilla.org/~jorendorff/es6-draft.html#sec-generatorresume
        return doneResult();
      }

      context.method = method;
      context.arg = arg;

      while (true) {
        var delegate = context.delegate;
        if (delegate) {
          var delegateResult = maybeInvokeDelegate(delegate, context);
          if (delegateResult) {
            if (delegateResult === ContinueSentinel) continue;
            return delegateResult;
          }
        }

        if (context.method === "next") {
          // Setting context._sent for legacy support of Babel's
          // function.sent implementation.
          context.sent = context._sent = context.arg;

        } else if (context.method === "throw") {
          if (state === GenStateSuspendedStart) {
            state = GenStateCompleted;
            throw context.arg;
          }

          context.dispatchException(context.arg);

        } else if (context.method === "return") {
          context.abrupt("return", context.arg);
        }

        state = GenStateExecuting;

        var record = tryCatch(innerFn, self, context);
        if (record.type === "normal") {
          // If an exception is thrown from innerFn, we leave state ===
          // GenStateExecuting and loop back for another invocation.
          state = context.done
            ? GenStateCompleted
            : GenStateSuspendedYield;

          if (record.arg === ContinueSentinel) {
            continue;
          }

          return {
            value: record.arg,
            done: context.done
          };

        } else if (record.type === "throw") {
          state = GenStateCompleted;
          // Dispatch the exception by looping back around to the
          // context.dispatchException(context.arg) call above.
          context.method = "throw";
          context.arg = record.arg;
        }
      }
    };
  }

  // Call delegate.iterator[context.method](context.arg) and handle the
  // result, either by returning a { value, done } result from the
  // delegate iterator, or by modifying context.method and context.arg,
  // setting context.delegate to null, and returning the ContinueSentinel.
  function maybeInvokeDelegate(delegate, context) {
    var method = delegate.iterator[context.method];
    if (method === undefined) {
      // A .throw or .return when the delegate iterator has no .throw
      // method always terminates the yield* loop.
      context.delegate = null;

      if (context.method === "throw") {
        if (delegate.iterator.return) {
          // If the delegate iterator has a return method, give it a
          // chance to clean up.
          context.method = "return";
          context.arg = undefined;
          maybeInvokeDelegate(delegate, context);

          if (context.method === "throw") {
            // If maybeInvokeDelegate(context) changed context.method from
            // "return" to "throw", let that override the TypeError below.
            return ContinueSentinel;
          }
        }

        context.method = "throw";
        context.arg = new TypeError(
          "The iterator does not provide a 'throw' method");
      }

      return ContinueSentinel;
    }

    var record = tryCatch(method, delegate.iterator, context.arg);

    if (record.type === "throw") {
      context.method = "throw";
      context.arg = record.arg;
      context.delegate = null;
      return ContinueSentinel;
    }

    var info = record.arg;

    if (! info) {
      context.method = "throw";
      context.arg = new TypeError("iterator result is not an object");
      context.delegate = null;
      return ContinueSentinel;
    }

    if (info.done) {
      // Assign the result of the finished delegate to the temporary
      // variable specified by delegate.resultName (see delegateYield).
      context[delegate.resultName] = info.value;

      // Resume execution at the desired location (see delegateYield).
      context.next = delegate.nextLoc;

      // If context.method was "throw" but the delegate handled the
      // exception, let the outer generator proceed normally. If
      // context.method was "next", forget context.arg since it has been
      // "consumed" by the delegate iterator. If context.method was
      // "return", allow the original .return call to continue in the
      // outer generator.
      if (context.method !== "return") {
        context.method = "next";
        context.arg = undefined;
      }

    } else {
      // Re-yield the result returned by the delegate method.
      return info;
    }

    // The delegate iterator is finished, so forget it and continue with
    // the outer generator.
    context.delegate = null;
    return ContinueSentinel;
  }

  // Define Generator.prototype.{next,throw,return} in terms of the
  // unified ._invoke helper method.
  defineIteratorMethods(Gp);

  Gp[toStringTagSymbol] = "Generator";

  // A Generator should always return itself as the iterator object when the
  // @@iterator function is called on it. Some browsers' implementations of the
  // iterator prototype chain incorrectly implement this, causing the Generator
  // object to not be returned from this call. This ensures that doesn't happen.
  // See https://github.com/facebook/regenerator/issues/274 for more details.
  Gp[iteratorSymbol] = function() {
    return this;
  };

  Gp.toString = function() {
    return "[object Generator]";
  };

  function pushTryEntry(locs) {
    var entry = { tryLoc: locs[0] };

    if (1 in locs) {
      entry.catchLoc = locs[1];
    }

    if (2 in locs) {
      entry.finallyLoc = locs[2];
      entry.afterLoc = locs[3];
    }

    this.tryEntries.push(entry);
  }

  function resetTryEntry(entry) {
    var record = entry.completion || {};
    record.type = "normal";
    delete record.arg;
    entry.completion = record;
  }

  function Context(tryLocsList) {
    // The root entry object (effectively a try statement without a catch
    // or a finally block) gives us a place to store values thrown from
    // locations where there is no enclosing try statement.
    this.tryEntries = [{ tryLoc: "root" }];
    tryLocsList.forEach(pushTryEntry, this);
    this.reset(true);
  }

  runtime.keys = function(object) {
    var keys = [];
    for (var key in object) {
      keys.push(key);
    }
    keys.reverse();

    // Rather than returning an object with a next method, we keep
    // things simple and return the next function itself.
    return function next() {
      while (keys.length) {
        var key = keys.pop();
        if (key in object) {
          next.value = key;
          next.done = false;
          return next;
        }
      }

      // To avoid creating an additional object, we just hang the .value
      // and .done properties off the next function object itself. This
      // also ensures that the minifier will not anonymize the function.
      next.done = true;
      return next;
    };
  };

  function values(iterable) {
    if (iterable) {
      var iteratorMethod = iterable[iteratorSymbol];
      if (iteratorMethod) {
        return iteratorMethod.call(iterable);
      }

      if (typeof iterable.next === "function") {
        return iterable;
      }

      if (!isNaN(iterable.length)) {
        var i = -1, next = function next() {
          while (++i < iterable.length) {
            if (hasOwn.call(iterable, i)) {
              next.value = iterable[i];
              next.done = false;
              return next;
            }
          }

          next.value = undefined;
          next.done = true;

          return next;
        };

        return next.next = next;
      }
    }

    // Return an iterator with no values.
    return { next: doneResult };
  }
  runtime.values = values;

  function doneResult() {
    return { value: undefined, done: true };
  }

  Context.prototype = {
    constructor: Context,

    reset: function(skipTempReset) {
      this.prev = 0;
      this.next = 0;
      // Resetting context._sent for legacy support of Babel's
      // function.sent implementation.
      this.sent = this._sent = undefined;
      this.done = false;
      this.delegate = null;

      this.method = "next";
      this.arg = undefined;

      this.tryEntries.forEach(resetTryEntry);

      if (!skipTempReset) {
        for (var name in this) {
          // Not sure about the optimal order of these conditions:
          if (name.charAt(0) === "t" &&
              hasOwn.call(this, name) &&
              !isNaN(+name.slice(1))) {
            this[name] = undefined;
          }
        }
      }
    },

    stop: function() {
      this.done = true;

      var rootEntry = this.tryEntries[0];
      var rootRecord = rootEntry.completion;
      if (rootRecord.type === "throw") {
        throw rootRecord.arg;
      }

      return this.rval;
    },

    dispatchException: function(exception) {
      if (this.done) {
        throw exception;
      }

      var context = this;
      function handle(loc, caught) {
        record.type = "throw";
        record.arg = exception;
        context.next = loc;

        if (caught) {
          // If the dispatched exception was caught by a catch block,
          // then let that catch block handle the exception normally.
          context.method = "next";
          context.arg = undefined;
        }

        return !! caught;
      }

      for (var i = this.tryEntries.length - 1; i >= 0; --i) {
        var entry = this.tryEntries[i];
        var record = entry.completion;

        if (entry.tryLoc === "root") {
          // Exception thrown outside of any try block that could handle
          // it, so set the completion value of the entire function to
          // throw the exception.
          return handle("end");
        }

        if (entry.tryLoc <= this.prev) {
          var hasCatch = hasOwn.call(entry, "catchLoc");
          var hasFinally = hasOwn.call(entry, "finallyLoc");

          if (hasCatch && hasFinally) {
            if (this.prev < entry.catchLoc) {
              return handle(entry.catchLoc, true);
            } else if (this.prev < entry.finallyLoc) {
              return handle(entry.finallyLoc);
            }

          } else if (hasCatch) {
            if (this.prev < entry.catchLoc) {
              return handle(entry.catchLoc, true);
            }

          } else if (hasFinally) {
            if (this.prev < entry.finallyLoc) {
              return handle(entry.finallyLoc);
            }

          } else {
            throw new Error("try statement without catch or finally");
          }
        }
      }
    },

    abrupt: function(type, arg) {
      for (var i = this.tryEntries.length - 1; i >= 0; --i) {
        var entry = this.tryEntries[i];
        if (entry.tryLoc <= this.prev &&
            hasOwn.call(entry, "finallyLoc") &&
            this.prev < entry.finallyLoc) {
          var finallyEntry = entry;
          break;
        }
      }

      if (finallyEntry &&
          (type === "break" ||
           type === "continue") &&
          finallyEntry.tryLoc <= arg &&
          arg <= finallyEntry.finallyLoc) {
        // Ignore the finally entry if control is not jumping to a
        // location outside the try/catch block.
        finallyEntry = null;
      }

      var record = finallyEntry ? finallyEntry.completion : {};
      record.type = type;
      record.arg = arg;

      if (finallyEntry) {
        this.method = "next";
        this.next = finallyEntry.finallyLoc;
        return ContinueSentinel;
      }

      return this.complete(record);
    },

    complete: function(record, afterLoc) {
      if (record.type === "throw") {
        throw record.arg;
      }

      if (record.type === "break" ||
          record.type === "continue") {
        this.next = record.arg;
      } else if (record.type === "return") {
        this.rval = this.arg = record.arg;
        this.method = "return";
        this.next = "end";
      } else if (record.type === "normal" && afterLoc) {
        this.next = afterLoc;
      }

      return ContinueSentinel;
    },

    finish: function(finallyLoc) {
      for (var i = this.tryEntries.length - 1; i >= 0; --i) {
        var entry = this.tryEntries[i];
        if (entry.finallyLoc === finallyLoc) {
          this.complete(entry.completion, entry.afterLoc);
          resetTryEntry(entry);
          return ContinueSentinel;
        }
      }
    },

    "catch": function(tryLoc) {
      for (var i = this.tryEntries.length - 1; i >= 0; --i) {
        var entry = this.tryEntries[i];
        if (entry.tryLoc === tryLoc) {
          var record = entry.completion;
          if (record.type === "throw") {
            var thrown = record.arg;
            resetTryEntry(entry);
          }
          return thrown;
        }
      }

      // The context.catch method must only be called with a location
      // argument that corresponds to a known catch block.
      throw new Error("illegal catch attempt");
    },

    delegateYield: function(iterable, resultName, nextLoc) {
      this.delegate = {
        iterator: values(iterable),
        resultName: resultName,
        nextLoc: nextLoc
      };

      if (this.method === "next") {
        // Deliberately forget the last sent value so that we don't
        // accidentally pass it on to the delegate.
        this.arg = undefined;
      }

      return ContinueSentinel;
    }
  };
})(
  // Among the various tricks for obtaining a reference to the global
  // object, this seems to be the most reliable technique that does not
  // use indirect eval (which violates Content Security Policy).
  typeof global === "object" ? global :
  typeof window === "object" ? window :
  typeof self === "object" ? self : this
);

/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(37)))

/***/ }),
/* 506 */
/***/ (function(module, exports, __webpack_require__) {

__webpack_require__(507);
module.exports = __webpack_require__(30).RegExp.escape;


/***/ }),
/* 507 */
/***/ (function(module, exports, __webpack_require__) {

// https://github.com/benjamingr/RexExp.escape
var $export = __webpack_require__(0);
var $re = __webpack_require__(508)(/[\\^$*+?.()|[\]{}]/g, '\\$&');

$export($export.S, 'RegExp', { escape: function escape(it) { return $re(it); } });


/***/ }),
/* 508 */
/***/ (function(module, exports) {

module.exports = function (regExp, replace) {
  var replacer = replace === Object(replace) ? function (part) {
    return replace[part];
  } : replace;
  return function (it) {
    return String(it).replace(regExp, replacer);
  };
};


/***/ }),
/* 509 */
/***/ (function(module, exports, __webpack_require__) {

;(function (root, factory) {
	if (true) {
		// CommonJS
		module.exports = exports = factory(__webpack_require__(4));
	}
	else if (typeof define === "function" && define.amd) {
		// AMD
		define(["./core"], factory);
	}
	else {
		// Global (browser)
		factory(root.CryptoJS);
	}
}(this, function (CryptoJS) {

	(function () {
	    // Check if typed arrays are supported
	    if (typeof ArrayBuffer != 'function') {
	        return;
	    }

	    // Shortcuts
	    var C = CryptoJS;
	    var C_lib = C.lib;
	    var WordArray = C_lib.WordArray;

	    // Reference original init
	    var superInit = WordArray.init;

	    // Augment WordArray.init to handle typed arrays
	    var subInit = WordArray.init = function (typedArray) {
	        // Convert buffers to uint8
	        if (typedArray instanceof ArrayBuffer) {
	            typedArray = new Uint8Array(typedArray);
	        }

	        // Convert other array views to uint8
	        if (
	            typedArray instanceof Int8Array ||
	            (typeof Uint8ClampedArray !== "undefined" && typedArray instanceof Uint8ClampedArray) ||
	            typedArray instanceof Int16Array ||
	            typedArray instanceof Uint16Array ||
	            typedArray instanceof Int32Array ||
	            typedArray instanceof Uint32Array ||
	            typedArray instanceof Float32Array ||
	            typedArray instanceof Float64Array
	        ) {
	            typedArray = new Uint8Array(typedArray.buffer, typedArray.byteOffset, typedArray.byteLength);
	        }

	        // Handle Uint8Array
	        if (typedArray instanceof Uint8Array) {
	            // Shortcut
	            var typedArrayByteLength = typedArray.byteLength;

	            // Extract bytes
	            var words = [];
	            for (var i = 0; i < typedArrayByteLength; i++) {
	                words[i >>> 2] |= typedArray[i] << (24 - (i % 4) * 8);
	            }

	            // Initialize this word array
	            superInit.call(this, words, typedArrayByteLength);
	        } else {
	            // Else call normal init
	            superInit.apply(this, arguments);
	        }
	    };

	    subInit.prototype = WordArray;
	}());


	return CryptoJS.lib.WordArray;

}));

/***/ }),
/* 510 */
/***/ (function(module, exports, __webpack_require__) {

;(function (root, factory) {
	if (true) {
		// CommonJS
		module.exports = exports = factory(__webpack_require__(4));
	}
	else if (typeof define === "function" && define.amd) {
		// AMD
		define(["./core"], factory);
	}
	else {
		// Global (browser)
		factory(root.CryptoJS);
	}
}(this, function (CryptoJS) {

	(function () {
	    // Shortcuts
	    var C = CryptoJS;
	    var C_lib = C.lib;
	    var WordArray = C_lib.WordArray;
	    var C_enc = C.enc;

	    /**
	     * UTF-16 BE encoding strategy.
	     */
	    var Utf16BE = C_enc.Utf16 = C_enc.Utf16BE = {
	        /**
	         * Converts a word array to a UTF-16 BE string.
	         *
	         * @param {WordArray} wordArray The word array.
	         *
	         * @return {string} The UTF-16 BE string.
	         *
	         * @static
	         *
	         * @example
	         *
	         *     var utf16String = CryptoJS.enc.Utf16.stringify(wordArray);
	         */
	        stringify: function (wordArray) {
	            // Shortcuts
	            var words = wordArray.words;
	            var sigBytes = wordArray.sigBytes;

	            // Convert
	            var utf16Chars = [];
	            for (var i = 0; i < sigBytes; i += 2) {
	                var codePoint = (words[i >>> 2] >>> (16 - (i % 4) * 8)) & 0xffff;
	                utf16Chars.push(String.fromCharCode(codePoint));
	            }

	            return utf16Chars.join('');
	        },

	        /**
	         * Converts a UTF-16 BE string to a word array.
	         *
	         * @param {string} utf16Str The UTF-16 BE string.
	         *
	         * @return {WordArray} The word array.
	         *
	         * @static
	         *
	         * @example
	         *
	         *     var wordArray = CryptoJS.enc.Utf16.parse(utf16String);
	         */
	        parse: function (utf16Str) {
	            // Shortcut
	            var utf16StrLength = utf16Str.length;

	            // Convert
	            var words = [];
	            for (var i = 0; i < utf16StrLength; i++) {
	                words[i >>> 1] |= utf16Str.charCodeAt(i) << (16 - (i % 2) * 16);
	            }

	            return WordArray.create(words, utf16StrLength * 2);
	        }
	    };

	    /**
	     * UTF-16 LE encoding strategy.
	     */
	    C_enc.Utf16LE = {
	        /**
	         * Converts a word array to a UTF-16 LE string.
	         *
	         * @param {WordArray} wordArray The word array.
	         *
	         * @return {string} The UTF-16 LE string.
	         *
	         * @static
	         *
	         * @example
	         *
	         *     var utf16Str = CryptoJS.enc.Utf16LE.stringify(wordArray);
	         */
	        stringify: function (wordArray) {
	            // Shortcuts
	            var words = wordArray.words;
	            var sigBytes = wordArray.sigBytes;

	            // Convert
	            var utf16Chars = [];
	            for (var i = 0; i < sigBytes; i += 2) {
	                var codePoint = swapEndian((words[i >>> 2] >>> (16 - (i % 4) * 8)) & 0xffff);
	                utf16Chars.push(String.fromCharCode(codePoint));
	            }

	            return utf16Chars.join('');
	        },

	        /**
	         * Converts a UTF-16 LE string to a word array.
	         *
	         * @param {string} utf16Str The UTF-16 LE string.
	         *
	         * @return {WordArray} The word array.
	         *
	         * @static
	         *
	         * @example
	         *
	         *     var wordArray = CryptoJS.enc.Utf16LE.parse(utf16Str);
	         */
	        parse: function (utf16Str) {
	            // Shortcut
	            var utf16StrLength = utf16Str.length;

	            // Convert
	            var words = [];
	            for (var i = 0; i < utf16StrLength; i++) {
	                words[i >>> 1] |= swapEndian(utf16Str.charCodeAt(i) << (16 - (i % 2) * 16));
	            }

	            return WordArray.create(words, utf16StrLength * 2);
	        }
	    };

	    function swapEndian(word) {
	        return ((word << 8) & 0xff00ff00) | ((word >>> 8) & 0x00ff00ff);
	    }
	}());


	return CryptoJS.enc.Utf16;

}));

/***/ }),
/* 511 */
/***/ (function(module, exports, __webpack_require__) {

;(function (root, factory, undef) {
	if (true) {
		// CommonJS
		module.exports = exports = factory(__webpack_require__(4), __webpack_require__(215));
	}
	else if (typeof define === "function" && define.amd) {
		// AMD
		define(["./core", "./sha256"], factory);
	}
	else {
		// Global (browser)
		factory(root.CryptoJS);
	}
}(this, function (CryptoJS) {

	(function () {
	    // Shortcuts
	    var C = CryptoJS;
	    var C_lib = C.lib;
	    var WordArray = C_lib.WordArray;
	    var C_algo = C.algo;
	    var SHA256 = C_algo.SHA256;

	    /**
	     * SHA-224 hash algorithm.
	     */
	    var SHA224 = C_algo.SHA224 = SHA256.extend({
	        _doReset: function () {
	            this._hash = new WordArray.init([
	                0xc1059ed8, 0x367cd507, 0x3070dd17, 0xf70e5939,
	                0xffc00b31, 0x68581511, 0x64f98fa7, 0xbefa4fa4
	            ]);
	        },

	        _doFinalize: function () {
	            var hash = SHA256._doFinalize.call(this);

	            hash.sigBytes -= 4;

	            return hash;
	        }
	    });

	    /**
	     * Shortcut function to the hasher's object interface.
	     *
	     * @param {WordArray|string} message The message to hash.
	     *
	     * @return {WordArray} The hash.
	     *
	     * @static
	     *
	     * @example
	     *
	     *     var hash = CryptoJS.SHA224('message');
	     *     var hash = CryptoJS.SHA224(wordArray);
	     */
	    C.SHA224 = SHA256._createHelper(SHA224);

	    /**
	     * Shortcut function to the HMAC's object interface.
	     *
	     * @param {WordArray|string} message The message to hash.
	     * @param {WordArray|string} key The secret key.
	     *
	     * @return {WordArray} The HMAC.
	     *
	     * @static
	     *
	     * @example
	     *
	     *     var hmac = CryptoJS.HmacSHA224(message, key);
	     */
	    C.HmacSHA224 = SHA256._createHmacHelper(SHA224);
	}());


	return CryptoJS.SHA224;

}));

/***/ }),
/* 512 */
/***/ (function(module, exports, __webpack_require__) {

;(function (root, factory, undef) {
	if (true) {
		// CommonJS
		module.exports = exports = factory(__webpack_require__(4), __webpack_require__(96), __webpack_require__(216));
	}
	else if (typeof define === "function" && define.amd) {
		// AMD
		define(["./core", "./x64-core", "./sha512"], factory);
	}
	else {
		// Global (browser)
		factory(root.CryptoJS);
	}
}(this, function (CryptoJS) {

	(function () {
	    // Shortcuts
	    var C = CryptoJS;
	    var C_x64 = C.x64;
	    var X64Word = C_x64.Word;
	    var X64WordArray = C_x64.WordArray;
	    var C_algo = C.algo;
	    var SHA512 = C_algo.SHA512;

	    /**
	     * SHA-384 hash algorithm.
	     */
	    var SHA384 = C_algo.SHA384 = SHA512.extend({
	        _doReset: function () {
	            this._hash = new X64WordArray.init([
	                new X64Word.init(0xcbbb9d5d, 0xc1059ed8), new X64Word.init(0x629a292a, 0x367cd507),
	                new X64Word.init(0x9159015a, 0x3070dd17), new X64Word.init(0x152fecd8, 0xf70e5939),
	                new X64Word.init(0x67332667, 0xffc00b31), new X64Word.init(0x8eb44a87, 0x68581511),
	                new X64Word.init(0xdb0c2e0d, 0x64f98fa7), new X64Word.init(0x47b5481d, 0xbefa4fa4)
	            ]);
	        },

	        _doFinalize: function () {
	            var hash = SHA512._doFinalize.call(this);

	            hash.sigBytes -= 16;

	            return hash;
	        }
	    });

	    /**
	     * Shortcut function to the hasher's object interface.
	     *
	     * @param {WordArray|string} message The message to hash.
	     *
	     * @return {WordArray} The hash.
	     *
	     * @static
	     *
	     * @example
	     *
	     *     var hash = CryptoJS.SHA384('message');
	     *     var hash = CryptoJS.SHA384(wordArray);
	     */
	    C.SHA384 = SHA512._createHelper(SHA384);

	    /**
	     * Shortcut function to the HMAC's object interface.
	     *
	     * @param {WordArray|string} message The message to hash.
	     * @param {WordArray|string} key The secret key.
	     *
	     * @return {WordArray} The HMAC.
	     *
	     * @static
	     *
	     * @example
	     *
	     *     var hmac = CryptoJS.HmacSHA384(message, key);
	     */
	    C.HmacSHA384 = SHA512._createHmacHelper(SHA384);
	}());


	return CryptoJS.SHA384;

}));

/***/ }),
/* 513 */
/***/ (function(module, exports, __webpack_require__) {

;(function (root, factory, undef) {
	if (true) {
		// CommonJS
		module.exports = exports = factory(__webpack_require__(4), __webpack_require__(96));
	}
	else if (typeof define === "function" && define.amd) {
		// AMD
		define(["./core", "./x64-core"], factory);
	}
	else {
		// Global (browser)
		factory(root.CryptoJS);
	}
}(this, function (CryptoJS) {

	(function (Math) {
	    // Shortcuts
	    var C = CryptoJS;
	    var C_lib = C.lib;
	    var WordArray = C_lib.WordArray;
	    var Hasher = C_lib.Hasher;
	    var C_x64 = C.x64;
	    var X64Word = C_x64.Word;
	    var C_algo = C.algo;

	    // Constants tables
	    var RHO_OFFSETS = [];
	    var PI_INDEXES  = [];
	    var ROUND_CONSTANTS = [];

	    // Compute Constants
	    (function () {
	        // Compute rho offset constants
	        var x = 1, y = 0;
	        for (var t = 0; t < 24; t++) {
	            RHO_OFFSETS[x + 5 * y] = ((t + 1) * (t + 2) / 2) % 64;

	            var newX = y % 5;
	            var newY = (2 * x + 3 * y) % 5;
	            x = newX;
	            y = newY;
	        }

	        // Compute pi index constants
	        for (var x = 0; x < 5; x++) {
	            for (var y = 0; y < 5; y++) {
	                PI_INDEXES[x + 5 * y] = y + ((2 * x + 3 * y) % 5) * 5;
	            }
	        }

	        // Compute round constants
	        var LFSR = 0x01;
	        for (var i = 0; i < 24; i++) {
	            var roundConstantMsw = 0;
	            var roundConstantLsw = 0;

	            for (var j = 0; j < 7; j++) {
	                if (LFSR & 0x01) {
	                    var bitPosition = (1 << j) - 1;
	                    if (bitPosition < 32) {
	                        roundConstantLsw ^= 1 << bitPosition;
	                    } else /* if (bitPosition >= 32) */ {
	                        roundConstantMsw ^= 1 << (bitPosition - 32);
	                    }
	                }

	                // Compute next LFSR
	                if (LFSR & 0x80) {
	                    // Primitive polynomial over GF(2): x^8 + x^6 + x^5 + x^4 + 1
	                    LFSR = (LFSR << 1) ^ 0x71;
	                } else {
	                    LFSR <<= 1;
	                }
	            }

	            ROUND_CONSTANTS[i] = X64Word.create(roundConstantMsw, roundConstantLsw);
	        }
	    }());

	    // Reusable objects for temporary values
	    var T = [];
	    (function () {
	        for (var i = 0; i < 25; i++) {
	            T[i] = X64Word.create();
	        }
	    }());

	    /**
	     * SHA-3 hash algorithm.
	     */
	    var SHA3 = C_algo.SHA3 = Hasher.extend({
	        /**
	         * Configuration options.
	         *
	         * @property {number} outputLength
	         *   The desired number of bits in the output hash.
	         *   Only values permitted are: 224, 256, 384, 512.
	         *   Default: 512
	         */
	        cfg: Hasher.cfg.extend({
	            outputLength: 512
	        }),

	        _doReset: function () {
	            var state = this._state = []
	            for (var i = 0; i < 25; i++) {
	                state[i] = new X64Word.init();
	            }

	            this.blockSize = (1600 - 2 * this.cfg.outputLength) / 32;
	        },

	        _doProcessBlock: function (M, offset) {
	            // Shortcuts
	            var state = this._state;
	            var nBlockSizeLanes = this.blockSize / 2;

	            // Absorb
	            for (var i = 0; i < nBlockSizeLanes; i++) {
	                // Shortcuts
	                var M2i  = M[offset + 2 * i];
	                var M2i1 = M[offset + 2 * i + 1];

	                // Swap endian
	                M2i = (
	                    (((M2i << 8)  | (M2i >>> 24)) & 0x00ff00ff) |
	                    (((M2i << 24) | (M2i >>> 8))  & 0xff00ff00)
	                );
	                M2i1 = (
	                    (((M2i1 << 8)  | (M2i1 >>> 24)) & 0x00ff00ff) |
	                    (((M2i1 << 24) | (M2i1 >>> 8))  & 0xff00ff00)
	                );

	                // Absorb message into state
	                var lane = state[i];
	                lane.high ^= M2i1;
	                lane.low  ^= M2i;
	            }

	            // Rounds
	            for (var round = 0; round < 24; round++) {
	                // Theta
	                for (var x = 0; x < 5; x++) {
	                    // Mix column lanes
	                    var tMsw = 0, tLsw = 0;
	                    for (var y = 0; y < 5; y++) {
	                        var lane = state[x + 5 * y];
	                        tMsw ^= lane.high;
	                        tLsw ^= lane.low;
	                    }

	                    // Temporary values
	                    var Tx = T[x];
	                    Tx.high = tMsw;
	                    Tx.low  = tLsw;
	                }
	                for (var x = 0; x < 5; x++) {
	                    // Shortcuts
	                    var Tx4 = T[(x + 4) % 5];
	                    var Tx1 = T[(x + 1) % 5];
	                    var Tx1Msw = Tx1.high;
	                    var Tx1Lsw = Tx1.low;

	                    // Mix surrounding columns
	                    var tMsw = Tx4.high ^ ((Tx1Msw << 1) | (Tx1Lsw >>> 31));
	                    var tLsw = Tx4.low  ^ ((Tx1Lsw << 1) | (Tx1Msw >>> 31));
	                    for (var y = 0; y < 5; y++) {
	                        var lane = state[x + 5 * y];
	                        lane.high ^= tMsw;
	                        lane.low  ^= tLsw;
	                    }
	                }

	                // Rho Pi
	                for (var laneIndex = 1; laneIndex < 25; laneIndex++) {
	                    // Shortcuts
	                    var lane = state[laneIndex];
	                    var laneMsw = lane.high;
	                    var laneLsw = lane.low;
	                    var rhoOffset = RHO_OFFSETS[laneIndex];

	                    // Rotate lanes
	                    if (rhoOffset < 32) {
	                        var tMsw = (laneMsw << rhoOffset) | (laneLsw >>> (32 - rhoOffset));
	                        var tLsw = (laneLsw << rhoOffset) | (laneMsw >>> (32 - rhoOffset));
	                    } else /* if (rhoOffset >= 32) */ {
	                        var tMsw = (laneLsw << (rhoOffset - 32)) | (laneMsw >>> (64 - rhoOffset));
	                        var tLsw = (laneMsw << (rhoOffset - 32)) | (laneLsw >>> (64 - rhoOffset));
	                    }

	                    // Transpose lanes
	                    var TPiLane = T[PI_INDEXES[laneIndex]];
	                    TPiLane.high = tMsw;
	                    TPiLane.low  = tLsw;
	                }

	                // Rho pi at x = y = 0
	                var T0 = T[0];
	                var state0 = state[0];
	                T0.high = state0.high;
	                T0.low  = state0.low;

	                // Chi
	                for (var x = 0; x < 5; x++) {
	                    for (var y = 0; y < 5; y++) {
	                        // Shortcuts
	                        var laneIndex = x + 5 * y;
	                        var lane = state[laneIndex];
	                        var TLane = T[laneIndex];
	                        var Tx1Lane = T[((x + 1) % 5) + 5 * y];
	                        var Tx2Lane = T[((x + 2) % 5) + 5 * y];

	                        // Mix rows
	                        lane.high = TLane.high ^ (~Tx1Lane.high & Tx2Lane.high);
	                        lane.low  = TLane.low  ^ (~Tx1Lane.low  & Tx2Lane.low);
	                    }
	                }

	                // Iota
	                var lane = state[0];
	                var roundConstant = ROUND_CONSTANTS[round];
	                lane.high ^= roundConstant.high;
	                lane.low  ^= roundConstant.low;;
	            }
	        },

	        _doFinalize: function () {
	            // Shortcuts
	            var data = this._data;
	            var dataWords = data.words;
	            var nBitsTotal = this._nDataBytes * 8;
	            var nBitsLeft = data.sigBytes * 8;
	            var blockSizeBits = this.blockSize * 32;

	            // Add padding
	            dataWords[nBitsLeft >>> 5] |= 0x1 << (24 - nBitsLeft % 32);
	            dataWords[((Math.ceil((nBitsLeft + 1) / blockSizeBits) * blockSizeBits) >>> 5) - 1] |= 0x80;
	            data.sigBytes = dataWords.length * 4;

	            // Hash final blocks
	            this._process();

	            // Shortcuts
	            var state = this._state;
	            var outputLengthBytes = this.cfg.outputLength / 8;
	            var outputLengthLanes = outputLengthBytes / 8;

	            // Squeeze
	            var hashWords = [];
	            for (var i = 0; i < outputLengthLanes; i++) {
	                // Shortcuts
	                var lane = state[i];
	                var laneMsw = lane.high;
	                var laneLsw = lane.low;

	                // Swap endian
	                laneMsw = (
	                    (((laneMsw << 8)  | (laneMsw >>> 24)) & 0x00ff00ff) |
	                    (((laneMsw << 24) | (laneMsw >>> 8))  & 0xff00ff00)
	                );
	                laneLsw = (
	                    (((laneLsw << 8)  | (laneLsw >>> 24)) & 0x00ff00ff) |
	                    (((laneLsw << 24) | (laneLsw >>> 8))  & 0xff00ff00)
	                );

	                // Squeeze state to retrieve hash
	                hashWords.push(laneLsw);
	                hashWords.push(laneMsw);
	            }

	            // Return final computed hash
	            return new WordArray.init(hashWords, outputLengthBytes);
	        },

	        clone: function () {
	            var clone = Hasher.clone.call(this);

	            var state = clone._state = this._state.slice(0);
	            for (var i = 0; i < 25; i++) {
	                state[i] = state[i].clone();
	            }

	            return clone;
	        }
	    });

	    /**
	     * Shortcut function to the hasher's object interface.
	     *
	     * @param {WordArray|string} message The message to hash.
	     *
	     * @return {WordArray} The hash.
	     *
	     * @static
	     *
	     * @example
	     *
	     *     var hash = CryptoJS.SHA3('message');
	     *     var hash = CryptoJS.SHA3(wordArray);
	     */
	    C.SHA3 = Hasher._createHelper(SHA3);

	    /**
	     * Shortcut function to the HMAC's object interface.
	     *
	     * @param {WordArray|string} message The message to hash.
	     * @param {WordArray|string} key The secret key.
	     *
	     * @return {WordArray} The HMAC.
	     *
	     * @static
	     *
	     * @example
	     *
	     *     var hmac = CryptoJS.HmacSHA3(message, key);
	     */
	    C.HmacSHA3 = Hasher._createHmacHelper(SHA3);
	}(Math));


	return CryptoJS.SHA3;

}));

/***/ }),
/* 514 */
/***/ (function(module, exports, __webpack_require__) {

;(function (root, factory) {
	if (true) {
		// CommonJS
		module.exports = exports = factory(__webpack_require__(4));
	}
	else if (typeof define === "function" && define.amd) {
		// AMD
		define(["./core"], factory);
	}
	else {
		// Global (browser)
		factory(root.CryptoJS);
	}
}(this, function (CryptoJS) {

	/** @preserve
	(c) 2012 by Cédric Mesnil. All rights reserved.

	Redistribution and use in source and binary forms, with or without modification, are permitted provided that the following conditions are met:

	    - Redistributions of source code must retain the above copyright notice, this list of conditions and the following disclaimer.
	    - Redistributions in binary form must reproduce the above copyright notice, this list of conditions and the following disclaimer in the documentation and/or other materials provided with the distribution.

	THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
	*/

	(function (Math) {
	    // Shortcuts
	    var C = CryptoJS;
	    var C_lib = C.lib;
	    var WordArray = C_lib.WordArray;
	    var Hasher = C_lib.Hasher;
	    var C_algo = C.algo;

	    // Constants table
	    var _zl = WordArray.create([
	        0,  1,  2,  3,  4,  5,  6,  7,  8,  9, 10, 11, 12, 13, 14, 15,
	        7,  4, 13,  1, 10,  6, 15,  3, 12,  0,  9,  5,  2, 14, 11,  8,
	        3, 10, 14,  4,  9, 15,  8,  1,  2,  7,  0,  6, 13, 11,  5, 12,
	        1,  9, 11, 10,  0,  8, 12,  4, 13,  3,  7, 15, 14,  5,  6,  2,
	        4,  0,  5,  9,  7, 12,  2, 10, 14,  1,  3,  8, 11,  6, 15, 13]);
	    var _zr = WordArray.create([
	        5, 14,  7,  0,  9,  2, 11,  4, 13,  6, 15,  8,  1, 10,  3, 12,
	        6, 11,  3,  7,  0, 13,  5, 10, 14, 15,  8, 12,  4,  9,  1,  2,
	        15,  5,  1,  3,  7, 14,  6,  9, 11,  8, 12,  2, 10,  0,  4, 13,
	        8,  6,  4,  1,  3, 11, 15,  0,  5, 12,  2, 13,  9,  7, 10, 14,
	        12, 15, 10,  4,  1,  5,  8,  7,  6,  2, 13, 14,  0,  3,  9, 11]);
	    var _sl = WordArray.create([
	         11, 14, 15, 12,  5,  8,  7,  9, 11, 13, 14, 15,  6,  7,  9,  8,
	        7, 6,   8, 13, 11,  9,  7, 15,  7, 12, 15,  9, 11,  7, 13, 12,
	        11, 13,  6,  7, 14,  9, 13, 15, 14,  8, 13,  6,  5, 12,  7,  5,
	          11, 12, 14, 15, 14, 15,  9,  8,  9, 14,  5,  6,  8,  6,  5, 12,
	        9, 15,  5, 11,  6,  8, 13, 12,  5, 12, 13, 14, 11,  8,  5,  6 ]);
	    var _sr = WordArray.create([
	        8,  9,  9, 11, 13, 15, 15,  5,  7,  7,  8, 11, 14, 14, 12,  6,
	        9, 13, 15,  7, 12,  8,  9, 11,  7,  7, 12,  7,  6, 15, 13, 11,
	        9,  7, 15, 11,  8,  6,  6, 14, 12, 13,  5, 14, 13, 13,  7,  5,
	        15,  5,  8, 11, 14, 14,  6, 14,  6,  9, 12,  9, 12,  5, 15,  8,
	        8,  5, 12,  9, 12,  5, 14,  6,  8, 13,  6,  5, 15, 13, 11, 11 ]);

	    var _hl =  WordArray.create([ 0x00000000, 0x5A827999, 0x6ED9EBA1, 0x8F1BBCDC, 0xA953FD4E]);
	    var _hr =  WordArray.create([ 0x50A28BE6, 0x5C4DD124, 0x6D703EF3, 0x7A6D76E9, 0x00000000]);

	    /**
	     * RIPEMD160 hash algorithm.
	     */
	    var RIPEMD160 = C_algo.RIPEMD160 = Hasher.extend({
	        _doReset: function () {
	            this._hash  = WordArray.create([0x67452301, 0xEFCDAB89, 0x98BADCFE, 0x10325476, 0xC3D2E1F0]);
	        },

	        _doProcessBlock: function (M, offset) {

	            // Swap endian
	            for (var i = 0; i < 16; i++) {
	                // Shortcuts
	                var offset_i = offset + i;
	                var M_offset_i = M[offset_i];

	                // Swap
	                M[offset_i] = (
	                    (((M_offset_i << 8)  | (M_offset_i >>> 24)) & 0x00ff00ff) |
	                    (((M_offset_i << 24) | (M_offset_i >>> 8))  & 0xff00ff00)
	                );
	            }
	            // Shortcut
	            var H  = this._hash.words;
	            var hl = _hl.words;
	            var hr = _hr.words;
	            var zl = _zl.words;
	            var zr = _zr.words;
	            var sl = _sl.words;
	            var sr = _sr.words;

	            // Working variables
	            var al, bl, cl, dl, el;
	            var ar, br, cr, dr, er;

	            ar = al = H[0];
	            br = bl = H[1];
	            cr = cl = H[2];
	            dr = dl = H[3];
	            er = el = H[4];
	            // Computation
	            var t;
	            for (var i = 0; i < 80; i += 1) {
	                t = (al +  M[offset+zl[i]])|0;
	                if (i<16){
		            t +=  f1(bl,cl,dl) + hl[0];
	                } else if (i<32) {
		            t +=  f2(bl,cl,dl) + hl[1];
	                } else if (i<48) {
		            t +=  f3(bl,cl,dl) + hl[2];
	                } else if (i<64) {
		            t +=  f4(bl,cl,dl) + hl[3];
	                } else {// if (i<80) {
		            t +=  f5(bl,cl,dl) + hl[4];
	                }
	                t = t|0;
	                t =  rotl(t,sl[i]);
	                t = (t+el)|0;
	                al = el;
	                el = dl;
	                dl = rotl(cl, 10);
	                cl = bl;
	                bl = t;

	                t = (ar + M[offset+zr[i]])|0;
	                if (i<16){
		            t +=  f5(br,cr,dr) + hr[0];
	                } else if (i<32) {
		            t +=  f4(br,cr,dr) + hr[1];
	                } else if (i<48) {
		            t +=  f3(br,cr,dr) + hr[2];
	                } else if (i<64) {
		            t +=  f2(br,cr,dr) + hr[3];
	                } else {// if (i<80) {
		            t +=  f1(br,cr,dr) + hr[4];
	                }
	                t = t|0;
	                t =  rotl(t,sr[i]) ;
	                t = (t+er)|0;
	                ar = er;
	                er = dr;
	                dr = rotl(cr, 10);
	                cr = br;
	                br = t;
	            }
	            // Intermediate hash value
	            t    = (H[1] + cl + dr)|0;
	            H[1] = (H[2] + dl + er)|0;
	            H[2] = (H[3] + el + ar)|0;
	            H[3] = (H[4] + al + br)|0;
	            H[4] = (H[0] + bl + cr)|0;
	            H[0] =  t;
	        },

	        _doFinalize: function () {
	            // Shortcuts
	            var data = this._data;
	            var dataWords = data.words;

	            var nBitsTotal = this._nDataBytes * 8;
	            var nBitsLeft = data.sigBytes * 8;

	            // Add padding
	            dataWords[nBitsLeft >>> 5] |= 0x80 << (24 - nBitsLeft % 32);
	            dataWords[(((nBitsLeft + 64) >>> 9) << 4) + 14] = (
	                (((nBitsTotal << 8)  | (nBitsTotal >>> 24)) & 0x00ff00ff) |
	                (((nBitsTotal << 24) | (nBitsTotal >>> 8))  & 0xff00ff00)
	            );
	            data.sigBytes = (dataWords.length + 1) * 4;

	            // Hash final blocks
	            this._process();

	            // Shortcuts
	            var hash = this._hash;
	            var H = hash.words;

	            // Swap endian
	            for (var i = 0; i < 5; i++) {
	                // Shortcut
	                var H_i = H[i];

	                // Swap
	                H[i] = (((H_i << 8)  | (H_i >>> 24)) & 0x00ff00ff) |
	                       (((H_i << 24) | (H_i >>> 8))  & 0xff00ff00);
	            }

	            // Return final computed hash
	            return hash;
	        },

	        clone: function () {
	            var clone = Hasher.clone.call(this);
	            clone._hash = this._hash.clone();

	            return clone;
	        }
	    });


	    function f1(x, y, z) {
	        return ((x) ^ (y) ^ (z));

	    }

	    function f2(x, y, z) {
	        return (((x)&(y)) | ((~x)&(z)));
	    }

	    function f3(x, y, z) {
	        return (((x) | (~(y))) ^ (z));
	    }

	    function f4(x, y, z) {
	        return (((x) & (z)) | ((y)&(~(z))));
	    }

	    function f5(x, y, z) {
	        return ((x) ^ ((y) |(~(z))));

	    }

	    function rotl(x,n) {
	        return (x<<n) | (x>>>(32-n));
	    }


	    /**
	     * Shortcut function to the hasher's object interface.
	     *
	     * @param {WordArray|string} message The message to hash.
	     *
	     * @return {WordArray} The hash.
	     *
	     * @static
	     *
	     * @example
	     *
	     *     var hash = CryptoJS.RIPEMD160('message');
	     *     var hash = CryptoJS.RIPEMD160(wordArray);
	     */
	    C.RIPEMD160 = Hasher._createHelper(RIPEMD160);

	    /**
	     * Shortcut function to the HMAC's object interface.
	     *
	     * @param {WordArray|string} message The message to hash.
	     * @param {WordArray|string} key The secret key.
	     *
	     * @return {WordArray} The HMAC.
	     *
	     * @static
	     *
	     * @example
	     *
	     *     var hmac = CryptoJS.HmacRIPEMD160(message, key);
	     */
	    C.HmacRIPEMD160 = Hasher._createHmacHelper(RIPEMD160);
	}(Math));


	return CryptoJS.RIPEMD160;

}));

/***/ }),
/* 515 */
/***/ (function(module, exports, __webpack_require__) {

;(function (root, factory, undef) {
	if (true) {
		// CommonJS
		module.exports = exports = factory(__webpack_require__(4), __webpack_require__(139), __webpack_require__(140));
	}
	else if (typeof define === "function" && define.amd) {
		// AMD
		define(["./core", "./sha1", "./hmac"], factory);
	}
	else {
		// Global (browser)
		factory(root.CryptoJS);
	}
}(this, function (CryptoJS) {

	(function () {
	    // Shortcuts
	    var C = CryptoJS;
	    var C_lib = C.lib;
	    var Base = C_lib.Base;
	    var WordArray = C_lib.WordArray;
	    var C_algo = C.algo;
	    var SHA1 = C_algo.SHA1;
	    var HMAC = C_algo.HMAC;

	    /**
	     * Password-Based Key Derivation Function 2 algorithm.
	     */
	    var PBKDF2 = C_algo.PBKDF2 = Base.extend({
	        /**
	         * Configuration options.
	         *
	         * @property {number} keySize The key size in words to generate. Default: 4 (128 bits)
	         * @property {Hasher} hasher The hasher to use. Default: SHA1
	         * @property {number} iterations The number of iterations to perform. Default: 1
	         */
	        cfg: Base.extend({
	            keySize: 128/32,
	            hasher: SHA1,
	            iterations: 1
	        }),

	        /**
	         * Initializes a newly created key derivation function.
	         *
	         * @param {Object} cfg (Optional) The configuration options to use for the derivation.
	         *
	         * @example
	         *
	         *     var kdf = CryptoJS.algo.PBKDF2.create();
	         *     var kdf = CryptoJS.algo.PBKDF2.create({ keySize: 8 });
	         *     var kdf = CryptoJS.algo.PBKDF2.create({ keySize: 8, iterations: 1000 });
	         */
	        init: function (cfg) {
	            this.cfg = this.cfg.extend(cfg);
	        },

	        /**
	         * Computes the Password-Based Key Derivation Function 2.
	         *
	         * @param {WordArray|string} password The password.
	         * @param {WordArray|string} salt A salt.
	         *
	         * @return {WordArray} The derived key.
	         *
	         * @example
	         *
	         *     var key = kdf.compute(password, salt);
	         */
	        compute: function (password, salt) {
	            // Shortcut
	            var cfg = this.cfg;

	            // Init HMAC
	            var hmac = HMAC.create(cfg.hasher, password);

	            // Initial values
	            var derivedKey = WordArray.create();
	            var blockIndex = WordArray.create([0x00000001]);

	            // Shortcuts
	            var derivedKeyWords = derivedKey.words;
	            var blockIndexWords = blockIndex.words;
	            var keySize = cfg.keySize;
	            var iterations = cfg.iterations;

	            // Generate key
	            while (derivedKeyWords.length < keySize) {
	                var block = hmac.update(salt).finalize(blockIndex);
	                hmac.reset();

	                // Shortcuts
	                var blockWords = block.words;
	                var blockWordsLength = blockWords.length;

	                // Iterations
	                var intermediate = block;
	                for (var i = 1; i < iterations; i++) {
	                    intermediate = hmac.finalize(intermediate);
	                    hmac.reset();

	                    // Shortcut
	                    var intermediateWords = intermediate.words;

	                    // XOR intermediate with block
	                    for (var j = 0; j < blockWordsLength; j++) {
	                        blockWords[j] ^= intermediateWords[j];
	                    }
	                }

	                derivedKey.concat(block);
	                blockIndexWords[0]++;
	            }
	            derivedKey.sigBytes = keySize * 4;

	            return derivedKey;
	        }
	    });

	    /**
	     * Computes the Password-Based Key Derivation Function 2.
	     *
	     * @param {WordArray|string} password The password.
	     * @param {WordArray|string} salt A salt.
	     * @param {Object} cfg (Optional) The configuration options to use for this computation.
	     *
	     * @return {WordArray} The derived key.
	     *
	     * @static
	     *
	     * @example
	     *
	     *     var key = CryptoJS.PBKDF2(password, salt);
	     *     var key = CryptoJS.PBKDF2(password, salt, { keySize: 8 });
	     *     var key = CryptoJS.PBKDF2(password, salt, { keySize: 8, iterations: 1000 });
	     */
	    C.PBKDF2 = function (password, salt, cfg) {
	        return PBKDF2.create(cfg).compute(password, salt);
	    };
	}());


	return CryptoJS.PBKDF2;

}));

/***/ }),
/* 516 */
/***/ (function(module, exports, __webpack_require__) {

;(function (root, factory, undef) {
	if (true) {
		// CommonJS
		module.exports = exports = factory(__webpack_require__(4), __webpack_require__(15));
	}
	else if (typeof define === "function" && define.amd) {
		// AMD
		define(["./core", "./cipher-core"], factory);
	}
	else {
		// Global (browser)
		factory(root.CryptoJS);
	}
}(this, function (CryptoJS) {

	/**
	 * Cipher Feedback block mode.
	 */
	CryptoJS.mode.CFB = (function () {
	    var CFB = CryptoJS.lib.BlockCipherMode.extend();

	    CFB.Encryptor = CFB.extend({
	        processBlock: function (words, offset) {
	            // Shortcuts
	            var cipher = this._cipher;
	            var blockSize = cipher.blockSize;

	            generateKeystreamAndEncrypt.call(this, words, offset, blockSize, cipher);

	            // Remember this block to use with next block
	            this._prevBlock = words.slice(offset, offset + blockSize);
	        }
	    });

	    CFB.Decryptor = CFB.extend({
	        processBlock: function (words, offset) {
	            // Shortcuts
	            var cipher = this._cipher;
	            var blockSize = cipher.blockSize;

	            // Remember this block to use with next block
	            var thisBlock = words.slice(offset, offset + blockSize);

	            generateKeystreamAndEncrypt.call(this, words, offset, blockSize, cipher);

	            // This block becomes the previous block
	            this._prevBlock = thisBlock;
	        }
	    });

	    function generateKeystreamAndEncrypt(words, offset, blockSize, cipher) {
	        // Shortcut
	        var iv = this._iv;

	        // Generate keystream
	        if (iv) {
	            var keystream = iv.slice(0);

	            // Remove IV for subsequent blocks
	            this._iv = undefined;
	        } else {
	            var keystream = this._prevBlock;
	        }
	        cipher.encryptBlock(keystream, 0);

	        // Encrypt
	        for (var i = 0; i < blockSize; i++) {
	            words[offset + i] ^= keystream[i];
	        }
	    }

	    return CFB;
	}());


	return CryptoJS.mode.CFB;

}));

/***/ }),
/* 517 */
/***/ (function(module, exports, __webpack_require__) {

;(function (root, factory, undef) {
	if (true) {
		// CommonJS
		module.exports = exports = factory(__webpack_require__(4), __webpack_require__(15));
	}
	else if (typeof define === "function" && define.amd) {
		// AMD
		define(["./core", "./cipher-core"], factory);
	}
	else {
		// Global (browser)
		factory(root.CryptoJS);
	}
}(this, function (CryptoJS) {

	/**
	 * Counter block mode.
	 */
	CryptoJS.mode.CTR = (function () {
	    var CTR = CryptoJS.lib.BlockCipherMode.extend();

	    var Encryptor = CTR.Encryptor = CTR.extend({
	        processBlock: function (words, offset) {
	            // Shortcuts
	            var cipher = this._cipher
	            var blockSize = cipher.blockSize;
	            var iv = this._iv;
	            var counter = this._counter;

	            // Generate keystream
	            if (iv) {
	                counter = this._counter = iv.slice(0);

	                // Remove IV for subsequent blocks
	                this._iv = undefined;
	            }
	            var keystream = counter.slice(0);
	            cipher.encryptBlock(keystream, 0);

	            // Increment counter
	            counter[blockSize - 1] = (counter[blockSize - 1] + 1) | 0

	            // Encrypt
	            for (var i = 0; i < blockSize; i++) {
	                words[offset + i] ^= keystream[i];
	            }
	        }
	    });

	    CTR.Decryptor = Encryptor;

	    return CTR;
	}());


	return CryptoJS.mode.CTR;

}));

/***/ }),
/* 518 */
/***/ (function(module, exports, __webpack_require__) {

;(function (root, factory, undef) {
	if (true) {
		// CommonJS
		module.exports = exports = factory(__webpack_require__(4), __webpack_require__(15));
	}
	else if (typeof define === "function" && define.amd) {
		// AMD
		define(["./core", "./cipher-core"], factory);
	}
	else {
		// Global (browser)
		factory(root.CryptoJS);
	}
}(this, function (CryptoJS) {

	/** @preserve
	 * Counter block mode compatible with  Dr Brian Gladman fileenc.c
	 * derived from CryptoJS.mode.CTR
	 * Jan Hruby jhruby.web@gmail.com
	 */
	CryptoJS.mode.CTRGladman = (function () {
	    var CTRGladman = CryptoJS.lib.BlockCipherMode.extend();

		function incWord(word)
		{
			if (((word >> 24) & 0xff) === 0xff) { //overflow
			var b1 = (word >> 16)&0xff;
			var b2 = (word >> 8)&0xff;
			var b3 = word & 0xff;

			if (b1 === 0xff) // overflow b1
			{
			b1 = 0;
			if (b2 === 0xff)
			{
				b2 = 0;
				if (b3 === 0xff)
				{
					b3 = 0;
				}
				else
				{
					++b3;
				}
			}
			else
			{
				++b2;
			}
			}
			else
			{
			++b1;
			}

			word = 0;
			word += (b1 << 16);
			word += (b2 << 8);
			word += b3;
			}
			else
			{
			word += (0x01 << 24);
			}
			return word;
		}

		function incCounter(counter)
		{
			if ((counter[0] = incWord(counter[0])) === 0)
			{
				// encr_data in fileenc.c from  Dr Brian Gladman's counts only with DWORD j < 8
				counter[1] = incWord(counter[1]);
			}
			return counter;
		}

	    var Encryptor = CTRGladman.Encryptor = CTRGladman.extend({
	        processBlock: function (words, offset) {
	            // Shortcuts
	            var cipher = this._cipher
	            var blockSize = cipher.blockSize;
	            var iv = this._iv;
	            var counter = this._counter;

	            // Generate keystream
	            if (iv) {
	                counter = this._counter = iv.slice(0);

	                // Remove IV for subsequent blocks
	                this._iv = undefined;
	            }

				incCounter(counter);

				var keystream = counter.slice(0);
	            cipher.encryptBlock(keystream, 0);

	            // Encrypt
	            for (var i = 0; i < blockSize; i++) {
	                words[offset + i] ^= keystream[i];
	            }
	        }
	    });

	    CTRGladman.Decryptor = Encryptor;

	    return CTRGladman;
	}());




	return CryptoJS.mode.CTRGladman;

}));

/***/ }),
/* 519 */
/***/ (function(module, exports, __webpack_require__) {

;(function (root, factory, undef) {
	if (true) {
		// CommonJS
		module.exports = exports = factory(__webpack_require__(4), __webpack_require__(15));
	}
	else if (typeof define === "function" && define.amd) {
		// AMD
		define(["./core", "./cipher-core"], factory);
	}
	else {
		// Global (browser)
		factory(root.CryptoJS);
	}
}(this, function (CryptoJS) {

	/**
	 * Output Feedback block mode.
	 */
	CryptoJS.mode.OFB = (function () {
	    var OFB = CryptoJS.lib.BlockCipherMode.extend();

	    var Encryptor = OFB.Encryptor = OFB.extend({
	        processBlock: function (words, offset) {
	            // Shortcuts
	            var cipher = this._cipher
	            var blockSize = cipher.blockSize;
	            var iv = this._iv;
	            var keystream = this._keystream;

	            // Generate keystream
	            if (iv) {
	                keystream = this._keystream = iv.slice(0);

	                // Remove IV for subsequent blocks
	                this._iv = undefined;
	            }
	            cipher.encryptBlock(keystream, 0);

	            // Encrypt
	            for (var i = 0; i < blockSize; i++) {
	                words[offset + i] ^= keystream[i];
	            }
	        }
	    });

	    OFB.Decryptor = Encryptor;

	    return OFB;
	}());


	return CryptoJS.mode.OFB;

}));

/***/ }),
/* 520 */
/***/ (function(module, exports, __webpack_require__) {

;(function (root, factory, undef) {
	if (true) {
		// CommonJS
		module.exports = exports = factory(__webpack_require__(4), __webpack_require__(15));
	}
	else if (typeof define === "function" && define.amd) {
		// AMD
		define(["./core", "./cipher-core"], factory);
	}
	else {
		// Global (browser)
		factory(root.CryptoJS);
	}
}(this, function (CryptoJS) {

	/**
	 * Electronic Codebook block mode.
	 */
	CryptoJS.mode.ECB = (function () {
	    var ECB = CryptoJS.lib.BlockCipherMode.extend();

	    ECB.Encryptor = ECB.extend({
	        processBlock: function (words, offset) {
	            this._cipher.encryptBlock(words, offset);
	        }
	    });

	    ECB.Decryptor = ECB.extend({
	        processBlock: function (words, offset) {
	            this._cipher.decryptBlock(words, offset);
	        }
	    });

	    return ECB;
	}());


	return CryptoJS.mode.ECB;

}));

/***/ }),
/* 521 */
/***/ (function(module, exports, __webpack_require__) {

;(function (root, factory, undef) {
	if (true) {
		// CommonJS
		module.exports = exports = factory(__webpack_require__(4), __webpack_require__(15));
	}
	else if (typeof define === "function" && define.amd) {
		// AMD
		define(["./core", "./cipher-core"], factory);
	}
	else {
		// Global (browser)
		factory(root.CryptoJS);
	}
}(this, function (CryptoJS) {

	/**
	 * ANSI X.923 padding strategy.
	 */
	CryptoJS.pad.AnsiX923 = {
	    pad: function (data, blockSize) {
	        // Shortcuts
	        var dataSigBytes = data.sigBytes;
	        var blockSizeBytes = blockSize * 4;

	        // Count padding bytes
	        var nPaddingBytes = blockSizeBytes - dataSigBytes % blockSizeBytes;

	        // Compute last byte position
	        var lastBytePos = dataSigBytes + nPaddingBytes - 1;

	        // Pad
	        data.clamp();
	        data.words[lastBytePos >>> 2] |= nPaddingBytes << (24 - (lastBytePos % 4) * 8);
	        data.sigBytes += nPaddingBytes;
	    },

	    unpad: function (data) {
	        // Get number of padding bytes from last byte
	        var nPaddingBytes = data.words[(data.sigBytes - 1) >>> 2] & 0xff;

	        // Remove padding
	        data.sigBytes -= nPaddingBytes;
	    }
	};


	return CryptoJS.pad.Ansix923;

}));

/***/ }),
/* 522 */
/***/ (function(module, exports, __webpack_require__) {

;(function (root, factory, undef) {
	if (true) {
		// CommonJS
		module.exports = exports = factory(__webpack_require__(4), __webpack_require__(15));
	}
	else if (typeof define === "function" && define.amd) {
		// AMD
		define(["./core", "./cipher-core"], factory);
	}
	else {
		// Global (browser)
		factory(root.CryptoJS);
	}
}(this, function (CryptoJS) {

	/**
	 * ISO 10126 padding strategy.
	 */
	CryptoJS.pad.Iso10126 = {
	    pad: function (data, blockSize) {
	        // Shortcut
	        var blockSizeBytes = blockSize * 4;

	        // Count padding bytes
	        var nPaddingBytes = blockSizeBytes - data.sigBytes % blockSizeBytes;

	        // Pad
	        data.concat(CryptoJS.lib.WordArray.random(nPaddingBytes - 1)).
	             concat(CryptoJS.lib.WordArray.create([nPaddingBytes << 24], 1));
	    },

	    unpad: function (data) {
	        // Get number of padding bytes from last byte
	        var nPaddingBytes = data.words[(data.sigBytes - 1) >>> 2] & 0xff;

	        // Remove padding
	        data.sigBytes -= nPaddingBytes;
	    }
	};


	return CryptoJS.pad.Iso10126;

}));

/***/ }),
/* 523 */
/***/ (function(module, exports, __webpack_require__) {

;(function (root, factory, undef) {
	if (true) {
		// CommonJS
		module.exports = exports = factory(__webpack_require__(4), __webpack_require__(15));
	}
	else if (typeof define === "function" && define.amd) {
		// AMD
		define(["./core", "./cipher-core"], factory);
	}
	else {
		// Global (browser)
		factory(root.CryptoJS);
	}
}(this, function (CryptoJS) {

	/**
	 * ISO/IEC 9797-1 Padding Method 2.
	 */
	CryptoJS.pad.Iso97971 = {
	    pad: function (data, blockSize) {
	        // Add 0x80 byte
	        data.concat(CryptoJS.lib.WordArray.create([0x80000000], 1));

	        // Zero pad the rest
	        CryptoJS.pad.ZeroPadding.pad(data, blockSize);
	    },

	    unpad: function (data) {
	        // Remove zero padding
	        CryptoJS.pad.ZeroPadding.unpad(data);

	        // Remove one more byte -- the 0x80 byte
	        data.sigBytes--;
	    }
	};


	return CryptoJS.pad.Iso97971;

}));

/***/ }),
/* 524 */
/***/ (function(module, exports, __webpack_require__) {

;(function (root, factory, undef) {
	if (true) {
		// CommonJS
		module.exports = exports = factory(__webpack_require__(4), __webpack_require__(15));
	}
	else if (typeof define === "function" && define.amd) {
		// AMD
		define(["./core", "./cipher-core"], factory);
	}
	else {
		// Global (browser)
		factory(root.CryptoJS);
	}
}(this, function (CryptoJS) {

	/**
	 * Zero padding strategy.
	 */
	CryptoJS.pad.ZeroPadding = {
	    pad: function (data, blockSize) {
	        // Shortcut
	        var blockSizeBytes = blockSize * 4;

	        // Pad
	        data.clamp();
	        data.sigBytes += blockSizeBytes - ((data.sigBytes % blockSizeBytes) || blockSizeBytes);
	    },

	    unpad: function (data) {
	        // Shortcut
	        var dataWords = data.words;

	        // Unpad
	        var i = data.sigBytes - 1;
	        while (!((dataWords[i >>> 2] >>> (24 - (i % 4) * 8)) & 0xff)) {
	            i--;
	        }
	        data.sigBytes = i + 1;
	    }
	};


	return CryptoJS.pad.ZeroPadding;

}));

/***/ }),
/* 525 */
/***/ (function(module, exports, __webpack_require__) {

;(function (root, factory, undef) {
	if (true) {
		// CommonJS
		module.exports = exports = factory(__webpack_require__(4), __webpack_require__(15));
	}
	else if (typeof define === "function" && define.amd) {
		// AMD
		define(["./core", "./cipher-core"], factory);
	}
	else {
		// Global (browser)
		factory(root.CryptoJS);
	}
}(this, function (CryptoJS) {

	/**
	 * A noop padding strategy.
	 */
	CryptoJS.pad.NoPadding = {
	    pad: function () {
	    },

	    unpad: function () {
	    }
	};


	return CryptoJS.pad.NoPadding;

}));

/***/ }),
/* 526 */
/***/ (function(module, exports, __webpack_require__) {

;(function (root, factory, undef) {
	if (true) {
		// CommonJS
		module.exports = exports = factory(__webpack_require__(4), __webpack_require__(15));
	}
	else if (typeof define === "function" && define.amd) {
		// AMD
		define(["./core", "./cipher-core"], factory);
	}
	else {
		// Global (browser)
		factory(root.CryptoJS);
	}
}(this, function (CryptoJS) {

	(function (undefined) {
	    // Shortcuts
	    var C = CryptoJS;
	    var C_lib = C.lib;
	    var CipherParams = C_lib.CipherParams;
	    var C_enc = C.enc;
	    var Hex = C_enc.Hex;
	    var C_format = C.format;

	    var HexFormatter = C_format.Hex = {
	        /**
	         * Converts the ciphertext of a cipher params object to a hexadecimally encoded string.
	         *
	         * @param {CipherParams} cipherParams The cipher params object.
	         *
	         * @return {string} The hexadecimally encoded string.
	         *
	         * @static
	         *
	         * @example
	         *
	         *     var hexString = CryptoJS.format.Hex.stringify(cipherParams);
	         */
	        stringify: function (cipherParams) {
	            return cipherParams.ciphertext.toString(Hex);
	        },

	        /**
	         * Converts a hexadecimally encoded ciphertext string to a cipher params object.
	         *
	         * @param {string} input The hexadecimally encoded string.
	         *
	         * @return {CipherParams} The cipher params object.
	         *
	         * @static
	         *
	         * @example
	         *
	         *     var cipherParams = CryptoJS.format.Hex.parse(hexString);
	         */
	        parse: function (input) {
	            var ciphertext = Hex.parse(input);
	            return CipherParams.create({ ciphertext: ciphertext });
	        }
	    };
	}());


	return CryptoJS.format.Hex;

}));

/***/ }),
/* 527 */
/***/ (function(module, exports, __webpack_require__) {

;(function (root, factory, undef) {
	if (true) {
		// CommonJS
		module.exports = exports = factory(__webpack_require__(4), __webpack_require__(64), __webpack_require__(65), __webpack_require__(57), __webpack_require__(15));
	}
	else if (typeof define === "function" && define.amd) {
		// AMD
		define(["./core", "./enc-base64", "./md5", "./evpkdf", "./cipher-core"], factory);
	}
	else {
		// Global (browser)
		factory(root.CryptoJS);
	}
}(this, function (CryptoJS) {

	(function () {
	    // Shortcuts
	    var C = CryptoJS;
	    var C_lib = C.lib;
	    var BlockCipher = C_lib.BlockCipher;
	    var C_algo = C.algo;

	    // Lookup tables
	    var SBOX = [];
	    var INV_SBOX = [];
	    var SUB_MIX_0 = [];
	    var SUB_MIX_1 = [];
	    var SUB_MIX_2 = [];
	    var SUB_MIX_3 = [];
	    var INV_SUB_MIX_0 = [];
	    var INV_SUB_MIX_1 = [];
	    var INV_SUB_MIX_2 = [];
	    var INV_SUB_MIX_3 = [];

	    // Compute lookup tables
	    (function () {
	        // Compute double table
	        var d = [];
	        for (var i = 0; i < 256; i++) {
	            if (i < 128) {
	                d[i] = i << 1;
	            } else {
	                d[i] = (i << 1) ^ 0x11b;
	            }
	        }

	        // Walk GF(2^8)
	        var x = 0;
	        var xi = 0;
	        for (var i = 0; i < 256; i++) {
	            // Compute sbox
	            var sx = xi ^ (xi << 1) ^ (xi << 2) ^ (xi << 3) ^ (xi << 4);
	            sx = (sx >>> 8) ^ (sx & 0xff) ^ 0x63;
	            SBOX[x] = sx;
	            INV_SBOX[sx] = x;

	            // Compute multiplication
	            var x2 = d[x];
	            var x4 = d[x2];
	            var x8 = d[x4];

	            // Compute sub bytes, mix columns tables
	            var t = (d[sx] * 0x101) ^ (sx * 0x1010100);
	            SUB_MIX_0[x] = (t << 24) | (t >>> 8);
	            SUB_MIX_1[x] = (t << 16) | (t >>> 16);
	            SUB_MIX_2[x] = (t << 8)  | (t >>> 24);
	            SUB_MIX_3[x] = t;

	            // Compute inv sub bytes, inv mix columns tables
	            var t = (x8 * 0x1010101) ^ (x4 * 0x10001) ^ (x2 * 0x101) ^ (x * 0x1010100);
	            INV_SUB_MIX_0[sx] = (t << 24) | (t >>> 8);
	            INV_SUB_MIX_1[sx] = (t << 16) | (t >>> 16);
	            INV_SUB_MIX_2[sx] = (t << 8)  | (t >>> 24);
	            INV_SUB_MIX_3[sx] = t;

	            // Compute next counter
	            if (!x) {
	                x = xi = 1;
	            } else {
	                x = x2 ^ d[d[d[x8 ^ x2]]];
	                xi ^= d[d[xi]];
	            }
	        }
	    }());

	    // Precomputed Rcon lookup
	    var RCON = [0x00, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20, 0x40, 0x80, 0x1b, 0x36];

	    /**
	     * AES block cipher algorithm.
	     */
	    var AES = C_algo.AES = BlockCipher.extend({
	        _doReset: function () {
	            // Skip reset of nRounds has been set before and key did not change
	            if (this._nRounds && this._keyPriorReset === this._key) {
	                return;
	            }

	            // Shortcuts
	            var key = this._keyPriorReset = this._key;
	            var keyWords = key.words;
	            var keySize = key.sigBytes / 4;

	            // Compute number of rounds
	            var nRounds = this._nRounds = keySize + 6;

	            // Compute number of key schedule rows
	            var ksRows = (nRounds + 1) * 4;

	            // Compute key schedule
	            var keySchedule = this._keySchedule = [];
	            for (var ksRow = 0; ksRow < ksRows; ksRow++) {
	                if (ksRow < keySize) {
	                    keySchedule[ksRow] = keyWords[ksRow];
	                } else {
	                    var t = keySchedule[ksRow - 1];

	                    if (!(ksRow % keySize)) {
	                        // Rot word
	                        t = (t << 8) | (t >>> 24);

	                        // Sub word
	                        t = (SBOX[t >>> 24] << 24) | (SBOX[(t >>> 16) & 0xff] << 16) | (SBOX[(t >>> 8) & 0xff] << 8) | SBOX[t & 0xff];

	                        // Mix Rcon
	                        t ^= RCON[(ksRow / keySize) | 0] << 24;
	                    } else if (keySize > 6 && ksRow % keySize == 4) {
	                        // Sub word
	                        t = (SBOX[t >>> 24] << 24) | (SBOX[(t >>> 16) & 0xff] << 16) | (SBOX[(t >>> 8) & 0xff] << 8) | SBOX[t & 0xff];
	                    }

	                    keySchedule[ksRow] = keySchedule[ksRow - keySize] ^ t;
	                }
	            }

	            // Compute inv key schedule
	            var invKeySchedule = this._invKeySchedule = [];
	            for (var invKsRow = 0; invKsRow < ksRows; invKsRow++) {
	                var ksRow = ksRows - invKsRow;

	                if (invKsRow % 4) {
	                    var t = keySchedule[ksRow];
	                } else {
	                    var t = keySchedule[ksRow - 4];
	                }

	                if (invKsRow < 4 || ksRow <= 4) {
	                    invKeySchedule[invKsRow] = t;
	                } else {
	                    invKeySchedule[invKsRow] = INV_SUB_MIX_0[SBOX[t >>> 24]] ^ INV_SUB_MIX_1[SBOX[(t >>> 16) & 0xff]] ^
	                                               INV_SUB_MIX_2[SBOX[(t >>> 8) & 0xff]] ^ INV_SUB_MIX_3[SBOX[t & 0xff]];
	                }
	            }
	        },

	        encryptBlock: function (M, offset) {
	            this._doCryptBlock(M, offset, this._keySchedule, SUB_MIX_0, SUB_MIX_1, SUB_MIX_2, SUB_MIX_3, SBOX);
	        },

	        decryptBlock: function (M, offset) {
	            // Swap 2nd and 4th rows
	            var t = M[offset + 1];
	            M[offset + 1] = M[offset + 3];
	            M[offset + 3] = t;

	            this._doCryptBlock(M, offset, this._invKeySchedule, INV_SUB_MIX_0, INV_SUB_MIX_1, INV_SUB_MIX_2, INV_SUB_MIX_3, INV_SBOX);

	            // Inv swap 2nd and 4th rows
	            var t = M[offset + 1];
	            M[offset + 1] = M[offset + 3];
	            M[offset + 3] = t;
	        },

	        _doCryptBlock: function (M, offset, keySchedule, SUB_MIX_0, SUB_MIX_1, SUB_MIX_2, SUB_MIX_3, SBOX) {
	            // Shortcut
	            var nRounds = this._nRounds;

	            // Get input, add round key
	            var s0 = M[offset]     ^ keySchedule[0];
	            var s1 = M[offset + 1] ^ keySchedule[1];
	            var s2 = M[offset + 2] ^ keySchedule[2];
	            var s3 = M[offset + 3] ^ keySchedule[3];

	            // Key schedule row counter
	            var ksRow = 4;

	            // Rounds
	            for (var round = 1; round < nRounds; round++) {
	                // Shift rows, sub bytes, mix columns, add round key
	                var t0 = SUB_MIX_0[s0 >>> 24] ^ SUB_MIX_1[(s1 >>> 16) & 0xff] ^ SUB_MIX_2[(s2 >>> 8) & 0xff] ^ SUB_MIX_3[s3 & 0xff] ^ keySchedule[ksRow++];
	                var t1 = SUB_MIX_0[s1 >>> 24] ^ SUB_MIX_1[(s2 >>> 16) & 0xff] ^ SUB_MIX_2[(s3 >>> 8) & 0xff] ^ SUB_MIX_3[s0 & 0xff] ^ keySchedule[ksRow++];
	                var t2 = SUB_MIX_0[s2 >>> 24] ^ SUB_MIX_1[(s3 >>> 16) & 0xff] ^ SUB_MIX_2[(s0 >>> 8) & 0xff] ^ SUB_MIX_3[s1 & 0xff] ^ keySchedule[ksRow++];
	                var t3 = SUB_MIX_0[s3 >>> 24] ^ SUB_MIX_1[(s0 >>> 16) & 0xff] ^ SUB_MIX_2[(s1 >>> 8) & 0xff] ^ SUB_MIX_3[s2 & 0xff] ^ keySchedule[ksRow++];

	                // Update state
	                s0 = t0;
	                s1 = t1;
	                s2 = t2;
	                s3 = t3;
	            }

	            // Shift rows, sub bytes, add round key
	            var t0 = ((SBOX[s0 >>> 24] << 24) | (SBOX[(s1 >>> 16) & 0xff] << 16) | (SBOX[(s2 >>> 8) & 0xff] << 8) | SBOX[s3 & 0xff]) ^ keySchedule[ksRow++];
	            var t1 = ((SBOX[s1 >>> 24] << 24) | (SBOX[(s2 >>> 16) & 0xff] << 16) | (SBOX[(s3 >>> 8) & 0xff] << 8) | SBOX[s0 & 0xff]) ^ keySchedule[ksRow++];
	            var t2 = ((SBOX[s2 >>> 24] << 24) | (SBOX[(s3 >>> 16) & 0xff] << 16) | (SBOX[(s0 >>> 8) & 0xff] << 8) | SBOX[s1 & 0xff]) ^ keySchedule[ksRow++];
	            var t3 = ((SBOX[s3 >>> 24] << 24) | (SBOX[(s0 >>> 16) & 0xff] << 16) | (SBOX[(s1 >>> 8) & 0xff] << 8) | SBOX[s2 & 0xff]) ^ keySchedule[ksRow++];

	            // Set output
	            M[offset]     = t0;
	            M[offset + 1] = t1;
	            M[offset + 2] = t2;
	            M[offset + 3] = t3;
	        },

	        keySize: 256/32
	    });

	    /**
	     * Shortcut functions to the cipher's object interface.
	     *
	     * @example
	     *
	     *     var ciphertext = CryptoJS.AES.encrypt(message, key, cfg);
	     *     var plaintext  = CryptoJS.AES.decrypt(ciphertext, key, cfg);
	     */
	    C.AES = BlockCipher._createHelper(AES);
	}());


	return CryptoJS.AES;

}));

/***/ }),
/* 528 */
/***/ (function(module, exports, __webpack_require__) {

;(function (root, factory, undef) {
	if (true) {
		// CommonJS
		module.exports = exports = factory(__webpack_require__(4), __webpack_require__(64), __webpack_require__(65), __webpack_require__(57), __webpack_require__(15));
	}
	else if (typeof define === "function" && define.amd) {
		// AMD
		define(["./core", "./enc-base64", "./md5", "./evpkdf", "./cipher-core"], factory);
	}
	else {
		// Global (browser)
		factory(root.CryptoJS);
	}
}(this, function (CryptoJS) {

	(function () {
	    // Shortcuts
	    var C = CryptoJS;
	    var C_lib = C.lib;
	    var WordArray = C_lib.WordArray;
	    var BlockCipher = C_lib.BlockCipher;
	    var C_algo = C.algo;

	    // Permuted Choice 1 constants
	    var PC1 = [
	        57, 49, 41, 33, 25, 17, 9,  1,
	        58, 50, 42, 34, 26, 18, 10, 2,
	        59, 51, 43, 35, 27, 19, 11, 3,
	        60, 52, 44, 36, 63, 55, 47, 39,
	        31, 23, 15, 7,  62, 54, 46, 38,
	        30, 22, 14, 6,  61, 53, 45, 37,
	        29, 21, 13, 5,  28, 20, 12, 4
	    ];

	    // Permuted Choice 2 constants
	    var PC2 = [
	        14, 17, 11, 24, 1,  5,
	        3,  28, 15, 6,  21, 10,
	        23, 19, 12, 4,  26, 8,
	        16, 7,  27, 20, 13, 2,
	        41, 52, 31, 37, 47, 55,
	        30, 40, 51, 45, 33, 48,
	        44, 49, 39, 56, 34, 53,
	        46, 42, 50, 36, 29, 32
	    ];

	    // Cumulative bit shift constants
	    var BIT_SHIFTS = [1,  2,  4,  6,  8,  10, 12, 14, 15, 17, 19, 21, 23, 25, 27, 28];

	    // SBOXes and round permutation constants
	    var SBOX_P = [
	        {
	            0x0: 0x808200,
	            0x10000000: 0x8000,
	            0x20000000: 0x808002,
	            0x30000000: 0x2,
	            0x40000000: 0x200,
	            0x50000000: 0x808202,
	            0x60000000: 0x800202,
	            0x70000000: 0x800000,
	            0x80000000: 0x202,
	            0x90000000: 0x800200,
	            0xa0000000: 0x8200,
	            0xb0000000: 0x808000,
	            0xc0000000: 0x8002,
	            0xd0000000: 0x800002,
	            0xe0000000: 0x0,
	            0xf0000000: 0x8202,
	            0x8000000: 0x0,
	            0x18000000: 0x808202,
	            0x28000000: 0x8202,
	            0x38000000: 0x8000,
	            0x48000000: 0x808200,
	            0x58000000: 0x200,
	            0x68000000: 0x808002,
	            0x78000000: 0x2,
	            0x88000000: 0x800200,
	            0x98000000: 0x8200,
	            0xa8000000: 0x808000,
	            0xb8000000: 0x800202,
	            0xc8000000: 0x800002,
	            0xd8000000: 0x8002,
	            0xe8000000: 0x202,
	            0xf8000000: 0x800000,
	            0x1: 0x8000,
	            0x10000001: 0x2,
	            0x20000001: 0x808200,
	            0x30000001: 0x800000,
	            0x40000001: 0x808002,
	            0x50000001: 0x8200,
	            0x60000001: 0x200,
	            0x70000001: 0x800202,
	            0x80000001: 0x808202,
	            0x90000001: 0x808000,
	            0xa0000001: 0x800002,
	            0xb0000001: 0x8202,
	            0xc0000001: 0x202,
	            0xd0000001: 0x800200,
	            0xe0000001: 0x8002,
	            0xf0000001: 0x0,
	            0x8000001: 0x808202,
	            0x18000001: 0x808000,
	            0x28000001: 0x800000,
	            0x38000001: 0x200,
	            0x48000001: 0x8000,
	            0x58000001: 0x800002,
	            0x68000001: 0x2,
	            0x78000001: 0x8202,
	            0x88000001: 0x8002,
	            0x98000001: 0x800202,
	            0xa8000001: 0x202,
	            0xb8000001: 0x808200,
	            0xc8000001: 0x800200,
	            0xd8000001: 0x0,
	            0xe8000001: 0x8200,
	            0xf8000001: 0x808002
	        },
	        {
	            0x0: 0x40084010,
	            0x1000000: 0x4000,
	            0x2000000: 0x80000,
	            0x3000000: 0x40080010,
	            0x4000000: 0x40000010,
	            0x5000000: 0x40084000,
	            0x6000000: 0x40004000,
	            0x7000000: 0x10,
	            0x8000000: 0x84000,
	            0x9000000: 0x40004010,
	            0xa000000: 0x40000000,
	            0xb000000: 0x84010,
	            0xc000000: 0x80010,
	            0xd000000: 0x0,
	            0xe000000: 0x4010,
	            0xf000000: 0x40080000,
	            0x800000: 0x40004000,
	            0x1800000: 0x84010,
	            0x2800000: 0x10,
	            0x3800000: 0x40004010,
	            0x4800000: 0x40084010,
	            0x5800000: 0x40000000,
	            0x6800000: 0x80000,
	            0x7800000: 0x40080010,
	            0x8800000: 0x80010,
	            0x9800000: 0x0,
	            0xa800000: 0x4000,
	            0xb800000: 0x40080000,
	            0xc800000: 0x40000010,
	            0xd800000: 0x84000,
	            0xe800000: 0x40084000,
	            0xf800000: 0x4010,
	            0x10000000: 0x0,
	            0x11000000: 0x40080010,
	            0x12000000: 0x40004010,
	            0x13000000: 0x40084000,
	            0x14000000: 0x40080000,
	            0x15000000: 0x10,
	            0x16000000: 0x84010,
	            0x17000000: 0x4000,
	            0x18000000: 0x4010,
	            0x19000000: 0x80000,
	            0x1a000000: 0x80010,
	            0x1b000000: 0x40000010,
	            0x1c000000: 0x84000,
	            0x1d000000: 0x40004000,
	            0x1e000000: 0x40000000,
	            0x1f000000: 0x40084010,
	            0x10800000: 0x84010,
	            0x11800000: 0x80000,
	            0x12800000: 0x40080000,
	            0x13800000: 0x4000,
	            0x14800000: 0x40004000,
	            0x15800000: 0x40084010,
	            0x16800000: 0x10,
	            0x17800000: 0x40000000,
	            0x18800000: 0x40084000,
	            0x19800000: 0x40000010,
	            0x1a800000: 0x40004010,
	            0x1b800000: 0x80010,
	            0x1c800000: 0x0,
	            0x1d800000: 0x4010,
	            0x1e800000: 0x40080010,
	            0x1f800000: 0x84000
	        },
	        {
	            0x0: 0x104,
	            0x100000: 0x0,
	            0x200000: 0x4000100,
	            0x300000: 0x10104,
	            0x400000: 0x10004,
	            0x500000: 0x4000004,
	            0x600000: 0x4010104,
	            0x700000: 0x4010000,
	            0x800000: 0x4000000,
	            0x900000: 0x4010100,
	            0xa00000: 0x10100,
	            0xb00000: 0x4010004,
	            0xc00000: 0x4000104,
	            0xd00000: 0x10000,
	            0xe00000: 0x4,
	            0xf00000: 0x100,
	            0x80000: 0x4010100,
	            0x180000: 0x4010004,
	            0x280000: 0x0,
	            0x380000: 0x4000100,
	            0x480000: 0x4000004,
	            0x580000: 0x10000,
	            0x680000: 0x10004,
	            0x780000: 0x104,
	            0x880000: 0x4,
	            0x980000: 0x100,
	            0xa80000: 0x4010000,
	            0xb80000: 0x10104,
	            0xc80000: 0x10100,
	            0xd80000: 0x4000104,
	            0xe80000: 0x4010104,
	            0xf80000: 0x4000000,
	            0x1000000: 0x4010100,
	            0x1100000: 0x10004,
	            0x1200000: 0x10000,
	            0x1300000: 0x4000100,
	            0x1400000: 0x100,
	            0x1500000: 0x4010104,
	            0x1600000: 0x4000004,
	            0x1700000: 0x0,
	            0x1800000: 0x4000104,
	            0x1900000: 0x4000000,
	            0x1a00000: 0x4,
	            0x1b00000: 0x10100,
	            0x1c00000: 0x4010000,
	            0x1d00000: 0x104,
	            0x1e00000: 0x10104,
	            0x1f00000: 0x4010004,
	            0x1080000: 0x4000000,
	            0x1180000: 0x104,
	            0x1280000: 0x4010100,
	            0x1380000: 0x0,
	            0x1480000: 0x10004,
	            0x1580000: 0x4000100,
	            0x1680000: 0x100,
	            0x1780000: 0x4010004,
	            0x1880000: 0x10000,
	            0x1980000: 0x4010104,
	            0x1a80000: 0x10104,
	            0x1b80000: 0x4000004,
	            0x1c80000: 0x4000104,
	            0x1d80000: 0x4010000,
	            0x1e80000: 0x4,
	            0x1f80000: 0x10100
	        },
	        {
	            0x0: 0x80401000,
	            0x10000: 0x80001040,
	            0x20000: 0x401040,
	            0x30000: 0x80400000,
	            0x40000: 0x0,
	            0x50000: 0x401000,
	            0x60000: 0x80000040,
	            0x70000: 0x400040,
	            0x80000: 0x80000000,
	            0x90000: 0x400000,
	            0xa0000: 0x40,
	            0xb0000: 0x80001000,
	            0xc0000: 0x80400040,
	            0xd0000: 0x1040,
	            0xe0000: 0x1000,
	            0xf0000: 0x80401040,
	            0x8000: 0x80001040,
	            0x18000: 0x40,
	            0x28000: 0x80400040,
	            0x38000: 0x80001000,
	            0x48000: 0x401000,
	            0x58000: 0x80401040,
	            0x68000: 0x0,
	            0x78000: 0x80400000,
	            0x88000: 0x1000,
	            0x98000: 0x80401000,
	            0xa8000: 0x400000,
	            0xb8000: 0x1040,
	            0xc8000: 0x80000000,
	            0xd8000: 0x400040,
	            0xe8000: 0x401040,
	            0xf8000: 0x80000040,
	            0x100000: 0x400040,
	            0x110000: 0x401000,
	            0x120000: 0x80000040,
	            0x130000: 0x0,
	            0x140000: 0x1040,
	            0x150000: 0x80400040,
	            0x160000: 0x80401000,
	            0x170000: 0x80001040,
	            0x180000: 0x80401040,
	            0x190000: 0x80000000,
	            0x1a0000: 0x80400000,
	            0x1b0000: 0x401040,
	            0x1c0000: 0x80001000,
	            0x1d0000: 0x400000,
	            0x1e0000: 0x40,
	            0x1f0000: 0x1000,
	            0x108000: 0x80400000,
	            0x118000: 0x80401040,
	            0x128000: 0x0,
	            0x138000: 0x401000,
	            0x148000: 0x400040,
	            0x158000: 0x80000000,
	            0x168000: 0x80001040,
	            0x178000: 0x40,
	            0x188000: 0x80000040,
	            0x198000: 0x1000,
	            0x1a8000: 0x80001000,
	            0x1b8000: 0x80400040,
	            0x1c8000: 0x1040,
	            0x1d8000: 0x80401000,
	            0x1e8000: 0x400000,
	            0x1f8000: 0x401040
	        },
	        {
	            0x0: 0x80,
	            0x1000: 0x1040000,
	            0x2000: 0x40000,
	            0x3000: 0x20000000,
	            0x4000: 0x20040080,
	            0x5000: 0x1000080,
	            0x6000: 0x21000080,
	            0x7000: 0x40080,
	            0x8000: 0x1000000,
	            0x9000: 0x20040000,
	            0xa000: 0x20000080,
	            0xb000: 0x21040080,
	            0xc000: 0x21040000,
	            0xd000: 0x0,
	            0xe000: 0x1040080,
	            0xf000: 0x21000000,
	            0x800: 0x1040080,
	            0x1800: 0x21000080,
	            0x2800: 0x80,
	            0x3800: 0x1040000,
	            0x4800: 0x40000,
	            0x5800: 0x20040080,
	            0x6800: 0x21040000,
	            0x7800: 0x20000000,
	            0x8800: 0x20040000,
	            0x9800: 0x0,
	            0xa800: 0x21040080,
	            0xb800: 0x1000080,
	            0xc800: 0x20000080,
	            0xd800: 0x21000000,
	            0xe800: 0x1000000,
	            0xf800: 0x40080,
	            0x10000: 0x40000,
	            0x11000: 0x80,
	            0x12000: 0x20000000,
	            0x13000: 0x21000080,
	            0x14000: 0x1000080,
	            0x15000: 0x21040000,
	            0x16000: 0x20040080,
	            0x17000: 0x1000000,
	            0x18000: 0x21040080,
	            0x19000: 0x21000000,
	            0x1a000: 0x1040000,
	            0x1b000: 0x20040000,
	            0x1c000: 0x40080,
	            0x1d000: 0x20000080,
	            0x1e000: 0x0,
	            0x1f000: 0x1040080,
	            0x10800: 0x21000080,
	            0x11800: 0x1000000,
	            0x12800: 0x1040000,
	            0x13800: 0x20040080,
	            0x14800: 0x20000000,
	            0x15800: 0x1040080,
	            0x16800: 0x80,
	            0x17800: 0x21040000,
	            0x18800: 0x40080,
	            0x19800: 0x21040080,
	            0x1a800: 0x0,
	            0x1b800: 0x21000000,
	            0x1c800: 0x1000080,
	            0x1d800: 0x40000,
	            0x1e800: 0x20040000,
	            0x1f800: 0x20000080
	        },
	        {
	            0x0: 0x10000008,
	            0x100: 0x2000,
	            0x200: 0x10200000,
	            0x300: 0x10202008,
	            0x400: 0x10002000,
	            0x500: 0x200000,
	            0x600: 0x200008,
	            0x700: 0x10000000,
	            0x800: 0x0,
	            0x900: 0x10002008,
	            0xa00: 0x202000,
	            0xb00: 0x8,
	            0xc00: 0x10200008,
	            0xd00: 0x202008,
	            0xe00: 0x2008,
	            0xf00: 0x10202000,
	            0x80: 0x10200000,
	            0x180: 0x10202008,
	            0x280: 0x8,
	            0x380: 0x200000,
	            0x480: 0x202008,
	            0x580: 0x10000008,
	            0x680: 0x10002000,
	            0x780: 0x2008,
	            0x880: 0x200008,
	            0x980: 0x2000,
	            0xa80: 0x10002008,
	            0xb80: 0x10200008,
	            0xc80: 0x0,
	            0xd80: 0x10202000,
	            0xe80: 0x202000,
	            0xf80: 0x10000000,
	            0x1000: 0x10002000,
	            0x1100: 0x10200008,
	            0x1200: 0x10202008,
	            0x1300: 0x2008,
	            0x1400: 0x200000,
	            0x1500: 0x10000000,
	            0x1600: 0x10000008,
	            0x1700: 0x202000,
	            0x1800: 0x202008,
	            0x1900: 0x0,
	            0x1a00: 0x8,
	            0x1b00: 0x10200000,
	            0x1c00: 0x2000,
	            0x1d00: 0x10002008,
	            0x1e00: 0x10202000,
	            0x1f00: 0x200008,
	            0x1080: 0x8,
	            0x1180: 0x202000,
	            0x1280: 0x200000,
	            0x1380: 0x10000008,
	            0x1480: 0x10002000,
	            0x1580: 0x2008,
	            0x1680: 0x10202008,
	            0x1780: 0x10200000,
	            0x1880: 0x10202000,
	            0x1980: 0x10200008,
	            0x1a80: 0x2000,
	            0x1b80: 0x202008,
	            0x1c80: 0x200008,
	            0x1d80: 0x0,
	            0x1e80: 0x10000000,
	            0x1f80: 0x10002008
	        },
	        {
	            0x0: 0x100000,
	            0x10: 0x2000401,
	            0x20: 0x400,
	            0x30: 0x100401,
	            0x40: 0x2100401,
	            0x50: 0x0,
	            0x60: 0x1,
	            0x70: 0x2100001,
	            0x80: 0x2000400,
	            0x90: 0x100001,
	            0xa0: 0x2000001,
	            0xb0: 0x2100400,
	            0xc0: 0x2100000,
	            0xd0: 0x401,
	            0xe0: 0x100400,
	            0xf0: 0x2000000,
	            0x8: 0x2100001,
	            0x18: 0x0,
	            0x28: 0x2000401,
	            0x38: 0x2100400,
	            0x48: 0x100000,
	            0x58: 0x2000001,
	            0x68: 0x2000000,
	            0x78: 0x401,
	            0x88: 0x100401,
	            0x98: 0x2000400,
	            0xa8: 0x2100000,
	            0xb8: 0x100001,
	            0xc8: 0x400,
	            0xd8: 0x2100401,
	            0xe8: 0x1,
	            0xf8: 0x100400,
	            0x100: 0x2000000,
	            0x110: 0x100000,
	            0x120: 0x2000401,
	            0x130: 0x2100001,
	            0x140: 0x100001,
	            0x150: 0x2000400,
	            0x160: 0x2100400,
	            0x170: 0x100401,
	            0x180: 0x401,
	            0x190: 0x2100401,
	            0x1a0: 0x100400,
	            0x1b0: 0x1,
	            0x1c0: 0x0,
	            0x1d0: 0x2100000,
	            0x1e0: 0x2000001,
	            0x1f0: 0x400,
	            0x108: 0x100400,
	            0x118: 0x2000401,
	            0x128: 0x2100001,
	            0x138: 0x1,
	            0x148: 0x2000000,
	            0x158: 0x100000,
	            0x168: 0x401,
	            0x178: 0x2100400,
	            0x188: 0x2000001,
	            0x198: 0x2100000,
	            0x1a8: 0x0,
	            0x1b8: 0x2100401,
	            0x1c8: 0x100401,
	            0x1d8: 0x400,
	            0x1e8: 0x2000400,
	            0x1f8: 0x100001
	        },
	        {
	            0x0: 0x8000820,
	            0x1: 0x20000,
	            0x2: 0x8000000,
	            0x3: 0x20,
	            0x4: 0x20020,
	            0x5: 0x8020820,
	            0x6: 0x8020800,
	            0x7: 0x800,
	            0x8: 0x8020000,
	            0x9: 0x8000800,
	            0xa: 0x20800,
	            0xb: 0x8020020,
	            0xc: 0x820,
	            0xd: 0x0,
	            0xe: 0x8000020,
	            0xf: 0x20820,
	            0x80000000: 0x800,
	            0x80000001: 0x8020820,
	            0x80000002: 0x8000820,
	            0x80000003: 0x8000000,
	            0x80000004: 0x8020000,
	            0x80000005: 0x20800,
	            0x80000006: 0x20820,
	            0x80000007: 0x20,
	            0x80000008: 0x8000020,
	            0x80000009: 0x820,
	            0x8000000a: 0x20020,
	            0x8000000b: 0x8020800,
	            0x8000000c: 0x0,
	            0x8000000d: 0x8020020,
	            0x8000000e: 0x8000800,
	            0x8000000f: 0x20000,
	            0x10: 0x20820,
	            0x11: 0x8020800,
	            0x12: 0x20,
	            0x13: 0x800,
	            0x14: 0x8000800,
	            0x15: 0x8000020,
	            0x16: 0x8020020,
	            0x17: 0x20000,
	            0x18: 0x0,
	            0x19: 0x20020,
	            0x1a: 0x8020000,
	            0x1b: 0x8000820,
	            0x1c: 0x8020820,
	            0x1d: 0x20800,
	            0x1e: 0x820,
	            0x1f: 0x8000000,
	            0x80000010: 0x20000,
	            0x80000011: 0x800,
	            0x80000012: 0x8020020,
	            0x80000013: 0x20820,
	            0x80000014: 0x20,
	            0x80000015: 0x8020000,
	            0x80000016: 0x8000000,
	            0x80000017: 0x8000820,
	            0x80000018: 0x8020820,
	            0x80000019: 0x8000020,
	            0x8000001a: 0x8000800,
	            0x8000001b: 0x0,
	            0x8000001c: 0x20800,
	            0x8000001d: 0x820,
	            0x8000001e: 0x20020,
	            0x8000001f: 0x8020800
	        }
	    ];

	    // Masks that select the SBOX input
	    var SBOX_MASK = [
	        0xf8000001, 0x1f800000, 0x01f80000, 0x001f8000,
	        0x0001f800, 0x00001f80, 0x000001f8, 0x8000001f
	    ];

	    /**
	     * DES block cipher algorithm.
	     */
	    var DES = C_algo.DES = BlockCipher.extend({
	        _doReset: function () {
	            // Shortcuts
	            var key = this._key;
	            var keyWords = key.words;

	            // Select 56 bits according to PC1
	            var keyBits = [];
	            for (var i = 0; i < 56; i++) {
	                var keyBitPos = PC1[i] - 1;
	                keyBits[i] = (keyWords[keyBitPos >>> 5] >>> (31 - keyBitPos % 32)) & 1;
	            }

	            // Assemble 16 subkeys
	            var subKeys = this._subKeys = [];
	            for (var nSubKey = 0; nSubKey < 16; nSubKey++) {
	                // Create subkey
	                var subKey = subKeys[nSubKey] = [];

	                // Shortcut
	                var bitShift = BIT_SHIFTS[nSubKey];

	                // Select 48 bits according to PC2
	                for (var i = 0; i < 24; i++) {
	                    // Select from the left 28 key bits
	                    subKey[(i / 6) | 0] |= keyBits[((PC2[i] - 1) + bitShift) % 28] << (31 - i % 6);

	                    // Select from the right 28 key bits
	                    subKey[4 + ((i / 6) | 0)] |= keyBits[28 + (((PC2[i + 24] - 1) + bitShift) % 28)] << (31 - i % 6);
	                }

	                // Since each subkey is applied to an expanded 32-bit input,
	                // the subkey can be broken into 8 values scaled to 32-bits,
	                // which allows the key to be used without expansion
	                subKey[0] = (subKey[0] << 1) | (subKey[0] >>> 31);
	                for (var i = 1; i < 7; i++) {
	                    subKey[i] = subKey[i] >>> ((i - 1) * 4 + 3);
	                }
	                subKey[7] = (subKey[7] << 5) | (subKey[7] >>> 27);
	            }

	            // Compute inverse subkeys
	            var invSubKeys = this._invSubKeys = [];
	            for (var i = 0; i < 16; i++) {
	                invSubKeys[i] = subKeys[15 - i];
	            }
	        },

	        encryptBlock: function (M, offset) {
	            this._doCryptBlock(M, offset, this._subKeys);
	        },

	        decryptBlock: function (M, offset) {
	            this._doCryptBlock(M, offset, this._invSubKeys);
	        },

	        _doCryptBlock: function (M, offset, subKeys) {
	            // Get input
	            this._lBlock = M[offset];
	            this._rBlock = M[offset + 1];

	            // Initial permutation
	            exchangeLR.call(this, 4,  0x0f0f0f0f);
	            exchangeLR.call(this, 16, 0x0000ffff);
	            exchangeRL.call(this, 2,  0x33333333);
	            exchangeRL.call(this, 8,  0x00ff00ff);
	            exchangeLR.call(this, 1,  0x55555555);

	            // Rounds
	            for (var round = 0; round < 16; round++) {
	                // Shortcuts
	                var subKey = subKeys[round];
	                var lBlock = this._lBlock;
	                var rBlock = this._rBlock;

	                // Feistel function
	                var f = 0;
	                for (var i = 0; i < 8; i++) {
	                    f |= SBOX_P[i][((rBlock ^ subKey[i]) & SBOX_MASK[i]) >>> 0];
	                }
	                this._lBlock = rBlock;
	                this._rBlock = lBlock ^ f;
	            }

	            // Undo swap from last round
	            var t = this._lBlock;
	            this._lBlock = this._rBlock;
	            this._rBlock = t;

	            // Final permutation
	            exchangeLR.call(this, 1,  0x55555555);
	            exchangeRL.call(this, 8,  0x00ff00ff);
	            exchangeRL.call(this, 2,  0x33333333);
	            exchangeLR.call(this, 16, 0x0000ffff);
	            exchangeLR.call(this, 4,  0x0f0f0f0f);

	            // Set output
	            M[offset] = this._lBlock;
	            M[offset + 1] = this._rBlock;
	        },

	        keySize: 64/32,

	        ivSize: 64/32,

	        blockSize: 64/32
	    });

	    // Swap bits across the left and right words
	    function exchangeLR(offset, mask) {
	        var t = ((this._lBlock >>> offset) ^ this._rBlock) & mask;
	        this._rBlock ^= t;
	        this._lBlock ^= t << offset;
	    }

	    function exchangeRL(offset, mask) {
	        var t = ((this._rBlock >>> offset) ^ this._lBlock) & mask;
	        this._lBlock ^= t;
	        this._rBlock ^= t << offset;
	    }

	    /**
	     * Shortcut functions to the cipher's object interface.
	     *
	     * @example
	     *
	     *     var ciphertext = CryptoJS.DES.encrypt(message, key, cfg);
	     *     var plaintext  = CryptoJS.DES.decrypt(ciphertext, key, cfg);
	     */
	    C.DES = BlockCipher._createHelper(DES);

	    /**
	     * Triple-DES block cipher algorithm.
	     */
	    var TripleDES = C_algo.TripleDES = BlockCipher.extend({
	        _doReset: function () {
	            // Shortcuts
	            var key = this._key;
	            var keyWords = key.words;

	            // Create DES instances
	            this._des1 = DES.createEncryptor(WordArray.create(keyWords.slice(0, 2)));
	            this._des2 = DES.createEncryptor(WordArray.create(keyWords.slice(2, 4)));
	            this._des3 = DES.createEncryptor(WordArray.create(keyWords.slice(4, 6)));
	        },

	        encryptBlock: function (M, offset) {
	            this._des1.encryptBlock(M, offset);
	            this._des2.decryptBlock(M, offset);
	            this._des3.encryptBlock(M, offset);
	        },

	        decryptBlock: function (M, offset) {
	            this._des3.decryptBlock(M, offset);
	            this._des2.encryptBlock(M, offset);
	            this._des1.decryptBlock(M, offset);
	        },

	        keySize: 192/32,

	        ivSize: 64/32,

	        blockSize: 64/32
	    });

	    /**
	     * Shortcut functions to the cipher's object interface.
	     *
	     * @example
	     *
	     *     var ciphertext = CryptoJS.TripleDES.encrypt(message, key, cfg);
	     *     var plaintext  = CryptoJS.TripleDES.decrypt(ciphertext, key, cfg);
	     */
	    C.TripleDES = BlockCipher._createHelper(TripleDES);
	}());


	return CryptoJS.TripleDES;

}));

/***/ }),
/* 529 */
/***/ (function(module, exports, __webpack_require__) {

;(function (root, factory, undef) {
	if (true) {
		// CommonJS
		module.exports = exports = factory(__webpack_require__(4), __webpack_require__(64), __webpack_require__(65), __webpack_require__(57), __webpack_require__(15));
	}
	else if (typeof define === "function" && define.amd) {
		// AMD
		define(["./core", "./enc-base64", "./md5", "./evpkdf", "./cipher-core"], factory);
	}
	else {
		// Global (browser)
		factory(root.CryptoJS);
	}
}(this, function (CryptoJS) {

	(function () {
	    // Shortcuts
	    var C = CryptoJS;
	    var C_lib = C.lib;
	    var StreamCipher = C_lib.StreamCipher;
	    var C_algo = C.algo;

	    /**
	     * RC4 stream cipher algorithm.
	     */
	    var RC4 = C_algo.RC4 = StreamCipher.extend({
	        _doReset: function () {
	            // Shortcuts
	            var key = this._key;
	            var keyWords = key.words;
	            var keySigBytes = key.sigBytes;

	            // Init sbox
	            var S = this._S = [];
	            for (var i = 0; i < 256; i++) {
	                S[i] = i;
	            }

	            // Key setup
	            for (var i = 0, j = 0; i < 256; i++) {
	                var keyByteIndex = i % keySigBytes;
	                var keyByte = (keyWords[keyByteIndex >>> 2] >>> (24 - (keyByteIndex % 4) * 8)) & 0xff;

	                j = (j + S[i] + keyByte) % 256;

	                // Swap
	                var t = S[i];
	                S[i] = S[j];
	                S[j] = t;
	            }

	            // Counters
	            this._i = this._j = 0;
	        },

	        _doProcessBlock: function (M, offset) {
	            M[offset] ^= generateKeystreamWord.call(this);
	        },

	        keySize: 256/32,

	        ivSize: 0
	    });

	    function generateKeystreamWord() {
	        // Shortcuts
	        var S = this._S;
	        var i = this._i;
	        var j = this._j;

	        // Generate keystream word
	        var keystreamWord = 0;
	        for (var n = 0; n < 4; n++) {
	            i = (i + 1) % 256;
	            j = (j + S[i]) % 256;

	            // Swap
	            var t = S[i];
	            S[i] = S[j];
	            S[j] = t;

	            keystreamWord |= S[(S[i] + S[j]) % 256] << (24 - n * 8);
	        }

	        // Update counters
	        this._i = i;
	        this._j = j;

	        return keystreamWord;
	    }

	    /**
	     * Shortcut functions to the cipher's object interface.
	     *
	     * @example
	     *
	     *     var ciphertext = CryptoJS.RC4.encrypt(message, key, cfg);
	     *     var plaintext  = CryptoJS.RC4.decrypt(ciphertext, key, cfg);
	     */
	    C.RC4 = StreamCipher._createHelper(RC4);

	    /**
	     * Modified RC4 stream cipher algorithm.
	     */
	    var RC4Drop = C_algo.RC4Drop = RC4.extend({
	        /**
	         * Configuration options.
	         *
	         * @property {number} drop The number of keystream words to drop. Default 192
	         */
	        cfg: RC4.cfg.extend({
	            drop: 192
	        }),

	        _doReset: function () {
	            RC4._doReset.call(this);

	            // Drop
	            for (var i = this.cfg.drop; i > 0; i--) {
	                generateKeystreamWord.call(this);
	            }
	        }
	    });

	    /**
	     * Shortcut functions to the cipher's object interface.
	     *
	     * @example
	     *
	     *     var ciphertext = CryptoJS.RC4Drop.encrypt(message, key, cfg);
	     *     var plaintext  = CryptoJS.RC4Drop.decrypt(ciphertext, key, cfg);
	     */
	    C.RC4Drop = StreamCipher._createHelper(RC4Drop);
	}());


	return CryptoJS.RC4;

}));

/***/ }),
/* 530 */
/***/ (function(module, exports, __webpack_require__) {

;(function (root, factory, undef) {
	if (true) {
		// CommonJS
		module.exports = exports = factory(__webpack_require__(4), __webpack_require__(64), __webpack_require__(65), __webpack_require__(57), __webpack_require__(15));
	}
	else if (typeof define === "function" && define.amd) {
		// AMD
		define(["./core", "./enc-base64", "./md5", "./evpkdf", "./cipher-core"], factory);
	}
	else {
		// Global (browser)
		factory(root.CryptoJS);
	}
}(this, function (CryptoJS) {

	(function () {
	    // Shortcuts
	    var C = CryptoJS;
	    var C_lib = C.lib;
	    var StreamCipher = C_lib.StreamCipher;
	    var C_algo = C.algo;

	    // Reusable objects
	    var S  = [];
	    var C_ = [];
	    var G  = [];

	    /**
	     * Rabbit stream cipher algorithm
	     */
	    var Rabbit = C_algo.Rabbit = StreamCipher.extend({
	        _doReset: function () {
	            // Shortcuts
	            var K = this._key.words;
	            var iv = this.cfg.iv;

	            // Swap endian
	            for (var i = 0; i < 4; i++) {
	                K[i] = (((K[i] << 8)  | (K[i] >>> 24)) & 0x00ff00ff) |
	                       (((K[i] << 24) | (K[i] >>> 8))  & 0xff00ff00);
	            }

	            // Generate initial state values
	            var X = this._X = [
	                K[0], (K[3] << 16) | (K[2] >>> 16),
	                K[1], (K[0] << 16) | (K[3] >>> 16),
	                K[2], (K[1] << 16) | (K[0] >>> 16),
	                K[3], (K[2] << 16) | (K[1] >>> 16)
	            ];

	            // Generate initial counter values
	            var C = this._C = [
	                (K[2] << 16) | (K[2] >>> 16), (K[0] & 0xffff0000) | (K[1] & 0x0000ffff),
	                (K[3] << 16) | (K[3] >>> 16), (K[1] & 0xffff0000) | (K[2] & 0x0000ffff),
	                (K[0] << 16) | (K[0] >>> 16), (K[2] & 0xffff0000) | (K[3] & 0x0000ffff),
	                (K[1] << 16) | (K[1] >>> 16), (K[3] & 0xffff0000) | (K[0] & 0x0000ffff)
	            ];

	            // Carry bit
	            this._b = 0;

	            // Iterate the system four times
	            for (var i = 0; i < 4; i++) {
	                nextState.call(this);
	            }

	            // Modify the counters
	            for (var i = 0; i < 8; i++) {
	                C[i] ^= X[(i + 4) & 7];
	            }

	            // IV setup
	            if (iv) {
	                // Shortcuts
	                var IV = iv.words;
	                var IV_0 = IV[0];
	                var IV_1 = IV[1];

	                // Generate four subvectors
	                var i0 = (((IV_0 << 8) | (IV_0 >>> 24)) & 0x00ff00ff) | (((IV_0 << 24) | (IV_0 >>> 8)) & 0xff00ff00);
	                var i2 = (((IV_1 << 8) | (IV_1 >>> 24)) & 0x00ff00ff) | (((IV_1 << 24) | (IV_1 >>> 8)) & 0xff00ff00);
	                var i1 = (i0 >>> 16) | (i2 & 0xffff0000);
	                var i3 = (i2 << 16)  | (i0 & 0x0000ffff);

	                // Modify counter values
	                C[0] ^= i0;
	                C[1] ^= i1;
	                C[2] ^= i2;
	                C[3] ^= i3;
	                C[4] ^= i0;
	                C[5] ^= i1;
	                C[6] ^= i2;
	                C[7] ^= i3;

	                // Iterate the system four times
	                for (var i = 0; i < 4; i++) {
	                    nextState.call(this);
	                }
	            }
	        },

	        _doProcessBlock: function (M, offset) {
	            // Shortcut
	            var X = this._X;

	            // Iterate the system
	            nextState.call(this);

	            // Generate four keystream words
	            S[0] = X[0] ^ (X[5] >>> 16) ^ (X[3] << 16);
	            S[1] = X[2] ^ (X[7] >>> 16) ^ (X[5] << 16);
	            S[2] = X[4] ^ (X[1] >>> 16) ^ (X[7] << 16);
	            S[3] = X[6] ^ (X[3] >>> 16) ^ (X[1] << 16);

	            for (var i = 0; i < 4; i++) {
	                // Swap endian
	                S[i] = (((S[i] << 8)  | (S[i] >>> 24)) & 0x00ff00ff) |
	                       (((S[i] << 24) | (S[i] >>> 8))  & 0xff00ff00);

	                // Encrypt
	                M[offset + i] ^= S[i];
	            }
	        },

	        blockSize: 128/32,

	        ivSize: 64/32
	    });

	    function nextState() {
	        // Shortcuts
	        var X = this._X;
	        var C = this._C;

	        // Save old counter values
	        for (var i = 0; i < 8; i++) {
	            C_[i] = C[i];
	        }

	        // Calculate new counter values
	        C[0] = (C[0] + 0x4d34d34d + this._b) | 0;
	        C[1] = (C[1] + 0xd34d34d3 + ((C[0] >>> 0) < (C_[0] >>> 0) ? 1 : 0)) | 0;
	        C[2] = (C[2] + 0x34d34d34 + ((C[1] >>> 0) < (C_[1] >>> 0) ? 1 : 0)) | 0;
	        C[3] = (C[3] + 0x4d34d34d + ((C[2] >>> 0) < (C_[2] >>> 0) ? 1 : 0)) | 0;
	        C[4] = (C[4] + 0xd34d34d3 + ((C[3] >>> 0) < (C_[3] >>> 0) ? 1 : 0)) | 0;
	        C[5] = (C[5] + 0x34d34d34 + ((C[4] >>> 0) < (C_[4] >>> 0) ? 1 : 0)) | 0;
	        C[6] = (C[6] + 0x4d34d34d + ((C[5] >>> 0) < (C_[5] >>> 0) ? 1 : 0)) | 0;
	        C[7] = (C[7] + 0xd34d34d3 + ((C[6] >>> 0) < (C_[6] >>> 0) ? 1 : 0)) | 0;
	        this._b = (C[7] >>> 0) < (C_[7] >>> 0) ? 1 : 0;

	        // Calculate the g-values
	        for (var i = 0; i < 8; i++) {
	            var gx = X[i] + C[i];

	            // Construct high and low argument for squaring
	            var ga = gx & 0xffff;
	            var gb = gx >>> 16;

	            // Calculate high and low result of squaring
	            var gh = ((((ga * ga) >>> 17) + ga * gb) >>> 15) + gb * gb;
	            var gl = (((gx & 0xffff0000) * gx) | 0) + (((gx & 0x0000ffff) * gx) | 0);

	            // High XOR low
	            G[i] = gh ^ gl;
	        }

	        // Calculate new state values
	        X[0] = (G[0] + ((G[7] << 16) | (G[7] >>> 16)) + ((G[6] << 16) | (G[6] >>> 16))) | 0;
	        X[1] = (G[1] + ((G[0] << 8)  | (G[0] >>> 24)) + G[7]) | 0;
	        X[2] = (G[2] + ((G[1] << 16) | (G[1] >>> 16)) + ((G[0] << 16) | (G[0] >>> 16))) | 0;
	        X[3] = (G[3] + ((G[2] << 8)  | (G[2] >>> 24)) + G[1]) | 0;
	        X[4] = (G[4] + ((G[3] << 16) | (G[3] >>> 16)) + ((G[2] << 16) | (G[2] >>> 16))) | 0;
	        X[5] = (G[5] + ((G[4] << 8)  | (G[4] >>> 24)) + G[3]) | 0;
	        X[6] = (G[6] + ((G[5] << 16) | (G[5] >>> 16)) + ((G[4] << 16) | (G[4] >>> 16))) | 0;
	        X[7] = (G[7] + ((G[6] << 8)  | (G[6] >>> 24)) + G[5]) | 0;
	    }

	    /**
	     * Shortcut functions to the cipher's object interface.
	     *
	     * @example
	     *
	     *     var ciphertext = CryptoJS.Rabbit.encrypt(message, key, cfg);
	     *     var plaintext  = CryptoJS.Rabbit.decrypt(ciphertext, key, cfg);
	     */
	    C.Rabbit = StreamCipher._createHelper(Rabbit);
	}());


	return CryptoJS.Rabbit;

}));

/***/ }),
/* 531 */
/***/ (function(module, exports, __webpack_require__) {

;(function (root, factory, undef) {
	if (true) {
		// CommonJS
		module.exports = exports = factory(__webpack_require__(4), __webpack_require__(64), __webpack_require__(65), __webpack_require__(57), __webpack_require__(15));
	}
	else if (typeof define === "function" && define.amd) {
		// AMD
		define(["./core", "./enc-base64", "./md5", "./evpkdf", "./cipher-core"], factory);
	}
	else {
		// Global (browser)
		factory(root.CryptoJS);
	}
}(this, function (CryptoJS) {

	(function () {
	    // Shortcuts
	    var C = CryptoJS;
	    var C_lib = C.lib;
	    var StreamCipher = C_lib.StreamCipher;
	    var C_algo = C.algo;

	    // Reusable objects
	    var S  = [];
	    var C_ = [];
	    var G  = [];

	    /**
	     * Rabbit stream cipher algorithm.
	     *
	     * This is a legacy version that neglected to convert the key to little-endian.
	     * This error doesn't affect the cipher's security,
	     * but it does affect its compatibility with other implementations.
	     */
	    var RabbitLegacy = C_algo.RabbitLegacy = StreamCipher.extend({
	        _doReset: function () {
	            // Shortcuts
	            var K = this._key.words;
	            var iv = this.cfg.iv;

	            // Generate initial state values
	            var X = this._X = [
	                K[0], (K[3] << 16) | (K[2] >>> 16),
	                K[1], (K[0] << 16) | (K[3] >>> 16),
	                K[2], (K[1] << 16) | (K[0] >>> 16),
	                K[3], (K[2] << 16) | (K[1] >>> 16)
	            ];

	            // Generate initial counter values
	            var C = this._C = [
	                (K[2] << 16) | (K[2] >>> 16), (K[0] & 0xffff0000) | (K[1] & 0x0000ffff),
	                (K[3] << 16) | (K[3] >>> 16), (K[1] & 0xffff0000) | (K[2] & 0x0000ffff),
	                (K[0] << 16) | (K[0] >>> 16), (K[2] & 0xffff0000) | (K[3] & 0x0000ffff),
	                (K[1] << 16) | (K[1] >>> 16), (K[3] & 0xffff0000) | (K[0] & 0x0000ffff)
	            ];

	            // Carry bit
	            this._b = 0;

	            // Iterate the system four times
	            for (var i = 0; i < 4; i++) {
	                nextState.call(this);
	            }

	            // Modify the counters
	            for (var i = 0; i < 8; i++) {
	                C[i] ^= X[(i + 4) & 7];
	            }

	            // IV setup
	            if (iv) {
	                // Shortcuts
	                var IV = iv.words;
	                var IV_0 = IV[0];
	                var IV_1 = IV[1];

	                // Generate four subvectors
	                var i0 = (((IV_0 << 8) | (IV_0 >>> 24)) & 0x00ff00ff) | (((IV_0 << 24) | (IV_0 >>> 8)) & 0xff00ff00);
	                var i2 = (((IV_1 << 8) | (IV_1 >>> 24)) & 0x00ff00ff) | (((IV_1 << 24) | (IV_1 >>> 8)) & 0xff00ff00);
	                var i1 = (i0 >>> 16) | (i2 & 0xffff0000);
	                var i3 = (i2 << 16)  | (i0 & 0x0000ffff);

	                // Modify counter values
	                C[0] ^= i0;
	                C[1] ^= i1;
	                C[2] ^= i2;
	                C[3] ^= i3;
	                C[4] ^= i0;
	                C[5] ^= i1;
	                C[6] ^= i2;
	                C[7] ^= i3;

	                // Iterate the system four times
	                for (var i = 0; i < 4; i++) {
	                    nextState.call(this);
	                }
	            }
	        },

	        _doProcessBlock: function (M, offset) {
	            // Shortcut
	            var X = this._X;

	            // Iterate the system
	            nextState.call(this);

	            // Generate four keystream words
	            S[0] = X[0] ^ (X[5] >>> 16) ^ (X[3] << 16);
	            S[1] = X[2] ^ (X[7] >>> 16) ^ (X[5] << 16);
	            S[2] = X[4] ^ (X[1] >>> 16) ^ (X[7] << 16);
	            S[3] = X[6] ^ (X[3] >>> 16) ^ (X[1] << 16);

	            for (var i = 0; i < 4; i++) {
	                // Swap endian
	                S[i] = (((S[i] << 8)  | (S[i] >>> 24)) & 0x00ff00ff) |
	                       (((S[i] << 24) | (S[i] >>> 8))  & 0xff00ff00);

	                // Encrypt
	                M[offset + i] ^= S[i];
	            }
	        },

	        blockSize: 128/32,

	        ivSize: 64/32
	    });

	    function nextState() {
	        // Shortcuts
	        var X = this._X;
	        var C = this._C;

	        // Save old counter values
	        for (var i = 0; i < 8; i++) {
	            C_[i] = C[i];
	        }

	        // Calculate new counter values
	        C[0] = (C[0] + 0x4d34d34d + this._b) | 0;
	        C[1] = (C[1] + 0xd34d34d3 + ((C[0] >>> 0) < (C_[0] >>> 0) ? 1 : 0)) | 0;
	        C[2] = (C[2] + 0x34d34d34 + ((C[1] >>> 0) < (C_[1] >>> 0) ? 1 : 0)) | 0;
	        C[3] = (C[3] + 0x4d34d34d + ((C[2] >>> 0) < (C_[2] >>> 0) ? 1 : 0)) | 0;
	        C[4] = (C[4] + 0xd34d34d3 + ((C[3] >>> 0) < (C_[3] >>> 0) ? 1 : 0)) | 0;
	        C[5] = (C[5] + 0x34d34d34 + ((C[4] >>> 0) < (C_[4] >>> 0) ? 1 : 0)) | 0;
	        C[6] = (C[6] + 0x4d34d34d + ((C[5] >>> 0) < (C_[5] >>> 0) ? 1 : 0)) | 0;
	        C[7] = (C[7] + 0xd34d34d3 + ((C[6] >>> 0) < (C_[6] >>> 0) ? 1 : 0)) | 0;
	        this._b = (C[7] >>> 0) < (C_[7] >>> 0) ? 1 : 0;

	        // Calculate the g-values
	        for (var i = 0; i < 8; i++) {
	            var gx = X[i] + C[i];

	            // Construct high and low argument for squaring
	            var ga = gx & 0xffff;
	            var gb = gx >>> 16;

	            // Calculate high and low result of squaring
	            var gh = ((((ga * ga) >>> 17) + ga * gb) >>> 15) + gb * gb;
	            var gl = (((gx & 0xffff0000) * gx) | 0) + (((gx & 0x0000ffff) * gx) | 0);

	            // High XOR low
	            G[i] = gh ^ gl;
	        }

	        // Calculate new state values
	        X[0] = (G[0] + ((G[7] << 16) | (G[7] >>> 16)) + ((G[6] << 16) | (G[6] >>> 16))) | 0;
	        X[1] = (G[1] + ((G[0] << 8)  | (G[0] >>> 24)) + G[7]) | 0;
	        X[2] = (G[2] + ((G[1] << 16) | (G[1] >>> 16)) + ((G[0] << 16) | (G[0] >>> 16))) | 0;
	        X[3] = (G[3] + ((G[2] << 8)  | (G[2] >>> 24)) + G[1]) | 0;
	        X[4] = (G[4] + ((G[3] << 16) | (G[3] >>> 16)) + ((G[2] << 16) | (G[2] >>> 16))) | 0;
	        X[5] = (G[5] + ((G[4] << 8)  | (G[4] >>> 24)) + G[3]) | 0;
	        X[6] = (G[6] + ((G[5] << 16) | (G[5] >>> 16)) + ((G[4] << 16) | (G[4] >>> 16))) | 0;
	        X[7] = (G[7] + ((G[6] << 8)  | (G[6] >>> 24)) + G[5]) | 0;
	    }

	    /**
	     * Shortcut functions to the cipher's object interface.
	     *
	     * @example
	     *
	     *     var ciphertext = CryptoJS.RabbitLegacy.encrypt(message, key, cfg);
	     *     var plaintext  = CryptoJS.RabbitLegacy.decrypt(ciphertext, key, cfg);
	     */
	    C.RabbitLegacy = StreamCipher._createHelper(RabbitLegacy);
	}());


	return CryptoJS.RabbitLegacy;

}));

/***/ }),
/* 532 */
/***/ (function(module, exports) {

var INT_LENGTH = 12;
var BYTE_LENGTH = 48;
var RADIX = 3;
/// hex representation of (3^242)/2
var HALF_3 = new Uint32Array([
    0xa5ce8964,
    0x9f007669,
    0x1484504f,
    0x3ade00d9,
    0x0c24486e,
    0x50979d57,
    0x79a4c702,
    0x48bbae36,
    0xa9f6808b,
    0xaa06a805,
    0xa87fabdf,
    0x5e69ebef
]);

var ta_reverse = function(array) {
    if (array.reverse !== undefined) {
        array.reverse();
        return;
    }

    var i = 0,
        n = array.length,
        middle = Math.floor(n / 2),
        temp = null;

    for (; i < middle; i += 1) {
        temp = array[i];
        array[i] = array[n - 1 - i];
        array[n - 1 - i] = temp;
    }
};

/// negates the (unsigned) input array
var bigint_not = function(arr) {
    for (var i = 0; i < arr.length; i++) {
        arr[i] = (~arr[i]) >>> 0;
    }
};

/// rshift that works with up to 53
/// JS's shift operators only work on 32 bit integers
/// ours is up to 33 or 34 bits though, so
/// we need to implement shifting manually
var rshift = function(number, shift) {
    return (number / Math.pow(2, shift)) >>> 0;
};

/// swaps endianness
var swap32 = function(val) {
    return ((val & 0xFF) << 24) |
        ((val & 0xFF00) << 8) |
        ((val >> 8) & 0xFF00) |
        ((val >> 24) & 0xFF);
}

/// add with carry
var full_add = function(lh, rh, carry) {
    var v = lh + rh;
    var l = (rshift(v, 32)) & 0xFFFFFFFF;
    var r = (v & 0xFFFFFFFF) >>> 0;
    var carry1 = l != 0;

    if (carry) {
        v = r + 1;
    }
    l = (rshift(v, 32)) & 0xFFFFFFFF;
    r = (v & 0xFFFFFFFF) >>> 0;
    var carry2 = l != 0;

    return [r, carry1 || carry2];
};

/// subtracts rh from base
var bigint_sub = function(base, rh) {
    var noborrow = true;

    for (var i = 0; i < base.length; i++) {
        var vc = full_add(base[i], (~rh[i] >>> 0), noborrow);
        base[i] = vc[0];
        noborrow = vc[1];
    }

    if (!noborrow) {
        throw "noborrow";
    }
};

/// compares two (unsigned) big integers
var bigint_cmp = function(lh, rh) {
    for (var i = lh.length; i-- > 0;) {
        var a = lh[i] >>> 0;
        var b = rh[i] >>> 0;
        if (a < b) {
            return -1;
        } else if (a > b) {
            return 1;
        }
    }
    return 0;
};

/// adds rh to base in place
var bigint_add = function(base, rh) {
    var carry = false;
    for (var i = 0; i < base.length; i++) {
        var vc = full_add(base[i], rh[i], carry);
        base[i] = vc[0];
        carry = vc[1];
    }
};

/// adds a small (i.e. <32bit) number to base
var bigint_add_small = function(base, other) {
    var vc = full_add(base[0], other, false);
    base[0] = vc[0];
    var carry = vc[1];

    var i = 1;
    while (carry && i < base.length) {
        var vc = full_add(base[i], 0, carry);
        base[i] = vc[0];
        carry = vc[1];
        i += 1;
    }

    return i;
};

/// converts the given byte array to trits
var words_to_trits = function(words) {
    if (words.length != INT_LENGTH) {
        throw "Invalid words length";
    }

    var trits = new Int8Array(243);
    var base = new Uint32Array(words);

    ta_reverse(base);

    var flip_trits = false;
    if (base[INT_LENGTH - 1] >> 31 == 0) {
        // positive two's complement number.
        // add HALF_3 to move it to the right place.
        bigint_add(base, HALF_3);
    } else {
        // negative number.
        bigint_not(base);
        if (bigint_cmp(base, HALF_3) > 0) {
            bigint_sub(base, HALF_3);
            flip_trits = true;
        } else {
            /// bigint is between (unsigned) HALF_3 and (2**384 - 3**242/2).
            bigint_add_small(base, 1);
            var tmp = HALF_3.slice(0);
            bigint_sub(tmp, base);
            base = tmp;
        }
    }


    var rem = 0;

    for (var i = 0; i < 242; i++) {
        rem = 0;
        for (var j = INT_LENGTH - 1; j >= 0; j--) {
            var lhs = (rem != 0 ? rem * 0xFFFFFFFF + rem : 0) + base[j];
            var rhs = RADIX;

            var q = (lhs / rhs) >>> 0;
            var r = (lhs % rhs) >>> 0;

            base[j] = q;
            rem = r;
        }

        trits[i] = rem - 1;
    }

    if (flip_trits) {
        for (var i = 0; i < trits.length; i++) {
            trits[i] = -trits[i];
        }
    }

    return trits;
}

var is_null = function(arr) {
    for (var i = 0; i < arr.length; i++) {
        if (arr[i] != 0) {
            return false;
            break;
        }
    }
    return true;
}

var trits_to_words = function(trits) {
    if (trits.length != 243) {
        throw "Invalid trits length";
    }

    var base = new Uint32Array(INT_LENGTH);

    if (trits.slice(0, 242).every(function(a) {
            a == -1
        })) {
        base = HALF_3.slice(0);
        bigint_not(base);
        bigint_add_small(base, 1);
    } else {
        var size = 1;
        for (var i = trits.length - 1; i-- > 0;) {
            var trit = trits[i] + 1;

            //multiply by radix
            {
                var sz = size;
                var carry = 0;

                for (var j = 0; j < sz; j++) {
                    var v = base[j] * RADIX + carry;
                    carry = rshift(v, 32);
                    base[j] = (v & 0xFFFFFFFF) >>> 0;
                }

                if (carry > 0) {
                    base[sz] = carry;
                    size += 1;
                }
            }

            //addition
            {
                var sz = bigint_add_small(base, trit);
                if (sz > size) {
                    size = sz;
                }
            }
        }

        if (!is_null(base)) {
            if (bigint_cmp(HALF_3, base) <= 0) {
                // base >= HALF_3
                // just do base - HALF_3
                bigint_sub(base, HALF_3);
            } else {
                // base < HALF_3
                // so we need to transform it to a two's complement representation
                // of (base - HALF_3).
                // as we don't have a wrapping (-), we need to use some bit magic
                var tmp = HALF_3.slice(0);
                bigint_sub(tmp, base);
                bigint_not(tmp);
                bigint_add_small(tmp, 1);
                base = tmp;
            }
        }
    }

    ta_reverse(base);

    for (var i = 0; i < base.length; i++) {
        base[i] = swap32(base[i]);
    }

    return base;
};

module.exports = {
    trits_to_words: trits_to_words,
    words_to_trits: words_to_trits
};


/***/ }),
/* 533 */
/***/ (function(module, exports, __webpack_require__) {

var Curl = __webpack_require__(40);
var Converter = __webpack_require__(36);
var Bundle = __webpack_require__(97);
var add = __webpack_require__(141);

/**
*           Signing related functions
*
**/
var key = function(seed, index, length) {

    while ((seed.length % 243) !== 0) {
      seed.push(0);
    }

    var indexTrits = Converter.fromValue( index );
    var subseed = add( seed.slice( ), indexTrits );

    var curl = new Curl( );

    curl.initialize( );
    curl.absorb(subseed, 0, subseed.length);
    curl.squeeze(subseed, 0, subseed.length);

    curl.reset( );
    curl.absorb(subseed, 0, subseed.length);

    var key = [], offset = 0, buffer = [];

    while (length-- > 0) {

        for (var i = 0; i < 27; i++) {

            curl.squeeze(buffer, 0, subseed.length);
            for (var j = 0; j < 243; j++) {

                key[offset++] = buffer[j];
            }
        }
    }
    return key;
}

/**
*
*
**/
var digests = function(key) {

    var digests = [], buffer = [];

    for (var i = 0; i < Math.floor(key.length / 6561); i++) {

        var keyFragment = key.slice(i * 6561, (i + 1) * 6561);

        for (var j = 0; j < 27; j++) {

            buffer = keyFragment.slice(j * 243, (j + 1) * 243);

            for (var k = 0; k < 26; k++) {

                var kCurl = new Curl();
                kCurl.initialize();
                kCurl.absorb(buffer, 0, buffer.length);
                kCurl.squeeze(buffer, 0, Curl.HASH_LENGTH);
            }

            for (var k = 0; k < 243; k++) {

                keyFragment[j * 243 + k] = buffer[k];
            }
        }

        var curl = new Curl()

        curl.initialize();
        curl.absorb(keyFragment, 0, keyFragment.length);
        curl.squeeze(buffer, 0, Curl.HASH_LENGTH);

        for (var j = 0; j < 243; j++) {

            digests[i * 243 + j] = buffer[j];
        }
    }
    return digests;
}

/**
*
*
**/
var address = function(digests) {

    var addressTrits = [];

    var curl = new Curl();

    curl.initialize();
    curl.absorb(digests, 0, digests.length);
    curl.squeeze(addressTrits, 0, Curl.HASH_LENGTH);

    return addressTrits;
}

/**
*
*
**/
var digest = function(normalizedBundleFragment, signatureFragment) {

    var buffer = []

    var curl = new Curl();

    curl.initialize();

    for (var i = 0; i< 27; i++) {
        buffer = signatureFragment.slice(i * 243, (i + 1) * 243);

        for (var j = normalizedBundleFragment[i] + 13; j-- > 0; ) {

            var jCurl = new Curl();

            jCurl.initialize();
            jCurl.absorb(buffer, 0, buffer.length);
            jCurl.squeeze(buffer, 0, Curl.HASH_LENGTH);
        }

        curl.absorb(buffer, 0, buffer.length);
    }

    curl.squeeze(buffer, 0, Curl.HASH_LENGTH);
    return buffer;
}

/**
*
*
**/
var signatureFragment = function(normalizedBundleFragment, keyFragment) {

    var signatureFragment = keyFragment.slice(), hash = [];

    var curl = new Curl();

    for (var i = 0; i < 27; i++) {

        hash = signatureFragment.slice(i * 243, (i + 1) * 243);

        for (var j = 0; j < 13 - normalizedBundleFragment[i]; j++) {

            curl.initialize();
            curl.reset();
            curl.absorb(hash, 0, hash.length);
            curl.squeeze(hash, 0, Curl.HASH_LENGTH);
        }

        for (var j = 0; j < 243; j++) {

            signatureFragment[i * 243 + j] = hash[j];
        }
    }

    return signatureFragment;
}

/**
*
*
**/
var validateSignatures = function(expectedAddress, signatureFragments, bundleHash) {

    var self = this;
    var bundle = new Bundle();

    var normalizedBundleFragments = [];
    var normalizedBundleHash = bundle.normalizedBundle(bundleHash);

    // Split hash into 3 fragments
    for (var i = 0; i < 3; i++) {
        normalizedBundleFragments[i] = normalizedBundleHash.slice(i * 27, (i + 1) * 27);
    }

    // Get digests
    var digests = [];

    for (var i = 0; i < signatureFragments.length; i++) {

        var digestBuffer = digest(normalizedBundleFragments[i % 3], Converter.trits(signatureFragments[i]));

        for (var j = 0; j < 243; j++) {

            digests[i * 243 + j] = digestBuffer[j]
        }
    }

    var address = Converter.trytes(self.address(digests));

    return (expectedAddress === address);
}


module.exports = {
    key                 : key,
    digests             : digests,
    address             : address,
    digest              : digest,
    signatureFragment   : signatureFragment,
    validateSignatures  : validateSignatures
}


/***/ }),
/* 534 */
/***/ (function(module, exports, __webpack_require__) {

var Curl = __webpack_require__(40);
var Converter = __webpack_require__(36);
var HMAC_ROUNDS = 27;

function hmac(key) {
    this._key = Converter.trits(key);
}

hmac.prototype.addHMAC = function(bundle) {
    var curl = new Curl(HMAC_ROUNDS);
    var key = this._key;
    for(var i = 0; i < bundle.bundle.length; i++) {
        if (bundle.bundle[i].value > 0) {
            var bundleHashTrits = Converter.trits(bundle.bundle[i].bundle);
            var hmac = new Int8Array(243);
            curl.initialize();
            curl.absorb(key);
            curl.absorb(bundleHashTrits);
            curl.squeeze(hmac);
            var hmacTrytes = Converter.trytes(hmac);
            bundle.bundle[i].signatureMessageFragment = hmacTrytes + bundle.bundle[i].signatureMessageFragment.substring(81, 2187);
        }
    }
}

module.exports = hmac;


/***/ }),
/* 535 */
/***/ (function(module, exports, __webpack_require__) {

var Signing         =  __webpack_require__(98);
var Converter       =  __webpack_require__(36);
var Kerl            =  __webpack_require__(63);
var Curl            =  __webpack_require__(40);
var Bundle          =  __webpack_require__(97);
var Utils           =  __webpack_require__(143);
var inputValidator  =  __webpack_require__(99);
var errors          =  __webpack_require__(142);
var Address         =  __webpack_require__(537);

function Multisig(provider) {

    this._makeRequest = provider;
}


/**
*   Gets the key value of a seed
*
*   @method getKey
*   @param {string} seed
*   @param {int} index
*   @param {int} security Security level to be used for the private key / address. Can be 1, 2 or 3
*   @returns {string} digest trytes
**/
Multisig.getKey = function(seed, index, security) {

    return Converter.trytes(Signing.key(Converter.trits(seed), index, security));
}

/**
*   Gets the digest value of a seed
*
*   @method getDigest
*   @param {string} seed
*   @param {int} index
*   @param {int} security Security level to be used for the private key / address. Can be 1, 2 or 3
*   @returns {string} digest trytes
**/
Multisig.getDigest = function(seed, index, security) {

    var key = Signing.key(Converter.trits(seed), index, security);
    return Converter.trytes(Signing.digests(key));
}

/**
*   Multisig address constructor
*/
Multisig.address = Address;

/**
*   Validates  a generated multisig address
*
*   @method validateAddress
*   @param {string} multisigAddress
*   @param {array} digests
*   @returns {bool}
**/
Multisig.validateAddress = function(multisigAddress, digests) {

    var kerl = new Kerl();

    // initialize Kerl with the provided state
    kerl.initialize();

    // Absorb all key digests
    digests.forEach(function(keyDigest) {
        var trits = Converter.trits(keyDigest);
        kerl.absorb(Converter.trits(keyDigest), 0, trits.length);
    })

    // Squeeze address trits
    var addressTrits = [];
    kerl.squeeze(addressTrits, 0, Curl.HASH_LENGTH);

    // Convert trits into trytes and return the address
    return Converter.trytes(addressTrits) === multisigAddress;
}


/**
*   Prepares transfer by generating the bundle with the corresponding cosigner transactions
*   Does not contain signatures
*
*   @method initiateTransfer
*   @param {object} input the input addresses as well as the securitySum, and balance
*                   where `address` is the input multisig address
*                   and `securitySum` is the sum of security levels used by all co-signers
*                   and `balance` is the expected balance, if you wish to override getBalances
*   @param {string} remainderAddress Has to be generated by the cosigners before initiating the transfer, can be null if fully spent
*   @param {object} transfers
*   @param {function} callback
*   @returns {array} Array of transaction objects
**/
Multisig.initiateTransfer = function(input, remainderAddress, transfers, callback) {

    var self = this;

    // If message or tag is not supplied, provide it
    // Also remove the checksum of the address if it's there
    transfers.forEach(function(thisTransfer) {
        thisTransfer.message = thisTransfer.message ? thisTransfer.message : '';
        thisTransfer.tag = thisTransfer.tag ? thisTransfer.tag : '';
        thisTransfer.address = Utils.noChecksum(thisTransfer.address);
    })

    // Input validation of transfers object
    if (!inputValidator.isTransfersArray(transfers)) {
        return callback(errors.invalidTransfers());
    }

    // check if int
    if (!inputValidator.isValue(input.securitySum)) {
        return callback(errors.invalidInputs());
    }

    // validate input address
    if (!inputValidator.isAddress(input.address)) {
        return callback(errors.invalidTrytes());
    }

    // validate remainder address
    if (remainderAddress && !inputValidator.isAddress(remainderAddress)) {
        return callback(errors.invalidTrytes());
    }

    // Create a new bundle
    var bundle = new Bundle();

    var totalValue = 0;
    var signatureFragments = [];
    var tag;

    //
    //  Iterate over all transfers, get totalValue
    //  and prepare the signatureFragments, message and tag
    //
    for (var i = 0; i < transfers.length; i++) {

        var signatureMessageLength = 1;

        // If message longer than 2187 trytes, increase signatureMessageLength (add multiple transactions)
        if (transfers[i].message.length > 2187) {

            // Get total length, message / maxLength (2187 trytes)
            signatureMessageLength += Math.floor(transfers[i].message.length / 2187);

            var msgCopy = transfers[i].message;

            // While there is still a message, copy it
            while (msgCopy) {

                var fragment = msgCopy.slice(0, 2187);
                msgCopy = msgCopy.slice(2187, msgCopy.length);

                // Pad remainder of fragment
                for (var j = 0; fragment.length < 2187; j++) {
                    fragment += '9';
                }

                signatureFragments.push(fragment);
            }

        } else {
            // Else, get single fragment with 2187 of 9's trytes
            var fragment = '';

            if (transfers[i].message) {
                fragment = transfers[i].message.slice(0, 2187)
            }

            for (var j = 0; fragment.length < 2187; j++) {
                fragment += '9';
            }

            signatureFragments.push(fragment);
        }

        // get current timestamp in seconds
        var timestamp = Math.floor(Date.now() / 1000);

        // If no tag defined, get 27 tryte tag.
        tag = transfers[i].tag ? transfers[i].tag : '999999999999999999999999999';

        // Pad for required 27 tryte length
        for (var j = 0; tag.length < 27; j++) {
            tag += '9';
        }

        // Add first entries to the bundle
        // Slice the address in case the user provided a checksummed one
        bundle.addEntry(signatureMessageLength, transfers[i].address.slice(0, 81), transfers[i].value, tag, timestamp);

        // Sum up total value
        totalValue += parseInt(transfers[i].value);
    }

    // Get inputs if we are sending tokens
    if (totalValue) {

        function createBundle(totalBalance, callback) {
            if (totalBalance > 0) {

                var toSubtract = 0 - totalBalance;
                var timestamp = Math.floor(Date.now() / 1000);

                // Add input as bundle entry
                // Only a single entry, signatures will be added later
                bundle.addEntry(input.securitySum, input.address, toSubtract, tag, timestamp);
            }

            if (totalValue > totalBalance) {
                return callback(new Error("Not enough balance."));
            }


            // If there is a remainder value
            // Add extra output to send remaining funds to
            if (totalBalance > totalValue) {

                var remainder = totalBalance - totalValue;

                // Remainder bundle entry if necessary
                if (!remainderAddress) {
                    return callback(new Error("No remainder address defined"));
                }

                bundle.addEntry(1, remainderAddress, remainder, tag, timestamp);
            }

            bundle.finalize();
            bundle.addTrytes(signatureFragments);

            return callback(null, bundle.bundle);
        };

        if (input.balance) {
          createBundle(input.balance, callback);
        } else {
          var command = {
              'command': 'getBalances',
              'addresses': new Array(input.address),
              'threshold': 100
          }
          self._makeRequest.send(command, function(e, balances) {
              if (e) return callback(e);
              createBundle(parseInt(balances.balances[0]), callback);
          });
        }

    } else {

        return callback(new Error("Invalid value transfer: the transfer does not require a signature."));
    }

}


/**
*   Adds the cosigner signatures to the corresponding bundle transaction
*
*   @method addSignature
*   @param {array} bundleToSign
*   @param {int} cosignerIndex
*   @param {string} inputAddress
*   @param {string} key
*   @param {function} callback
*   @returns {array} trytes Returns bundle trytes
**/
Multisig.addSignature = function(bundleToSign, inputAddress, key, callback) {

    var bundle = new Bundle();
    bundle.bundle = bundleToSign;

    // Get the security used for the private key
    // 1 security level = 2187 trytes
    var security = (key.length / 2187);

    // convert private key trytes into trits
    var key = Converter.trits(key);


    // First get the total number of already signed transactions
    // use that for the bundle hash calculation as well as knowing
    // where to add the signature
    var numSignedTxs = 0;

    for (var i = 0; i < bundle.bundle.length; i++) {

        if (bundle.bundle[i].address === inputAddress) {

            // If transaction is already signed, increase counter
            if (!inputValidator.isNinesTrytes(bundle.bundle[i].signatureMessageFragment)) {

                numSignedTxs++;
            }
            // Else sign the transactionse
            else {

                var bundleHash = bundle.bundle[i].bundle;

                //  First 6561 trits for the firstFragment
                var firstFragment = key.slice(0, 6561);

                //  Get the normalized bundle hash
                var normalizedBundleHash = bundle.normalizedBundle(bundleHash);
                var normalizedBundleFragments = [];

                // Split hash into 3 fragments
                for (var k = 0; k < 3; k++) {
                    normalizedBundleFragments[k] = normalizedBundleHash.slice(k * 27, (k + 1) * 27);
                }

                //  First bundle fragment uses 27 trytes
                var firstBundleFragment = normalizedBundleFragments[numSignedTxs % 3];

                //  Calculate the new signatureFragment with the first bundle fragment
                var firstSignedFragment = Signing.signatureFragment(firstBundleFragment, firstFragment);

                //  Convert signature to trytes and assign the new signatureFragment
                bundle.bundle[i].signatureMessageFragment = Converter.trytes(firstSignedFragment);

                for (var j = 1; j < security; j++) {

                    //  Next 6561 trits for the firstFragment
                    var nextFragment = key.slice(6561 * j, (j + 1) * 6561);

                    //  Use the next 27 trytes
                    var nextBundleFragment = normalizedBundleFragments[(numSignedTxs + j) % 3];

                    //  Calculate the new signatureFragment with the first bundle fragment
                    var nextSignedFragment = Signing.signatureFragment(nextBundleFragment, nextFragment);

                    //  Convert signature to trytes and add new bundle entry at i + j position
                    // Assign the signature fragment
                    bundle.bundle[i + j].signatureMessageFragment = Converter.trytes(nextSignedFragment);
                }

                break;
            }
        }
    }

    return callback(null, bundle.bundle);
}

module.exports = Multisig;


/***/ }),
/* 536 */
/***/ (function(module, exports, __webpack_require__) {

var ascii = __webpack_require__(217);
var inputValidator = __webpack_require__(99);

/**
*   extractJson takes a bundle as input and from the signatureMessageFragments extracts the correct JSON
*   data which was encoded and sent with the transaction.
*
*   @method extractJson
*   @param {array} bundle
*   @returns {Object}
**/
function extractJson(bundle) {

    // if wrong input return null
    if ( !inputValidator.isArray(bundle) || bundle[0] === undefined ) return null;


    // Sanity check: if the first tryte pair is not opening bracket, it's not a message
    var firstTrytePair = bundle[0].signatureMessageFragment[0] + bundle[0].signatureMessageFragment[1];

    if (firstTrytePair !== "OD") return null;

    var index = 0;
    var notEnded = true;
    var trytesChunk = '';
    var trytesChecked = 0;
    var preliminaryStop = false;
    var finalJson = '';

    while (index < bundle.length && notEnded) {

        var messageChunk = bundle[index].signatureMessageFragment;

        // We iterate over the message chunk, reading 9 trytes at a time
        for (var i = 0; i < messageChunk.length; i += 9) {

            // get 9 trytes
            var trytes = messageChunk.slice(i, i + 9);
            trytesChunk += trytes;

            // Get the upper limit of the tytes that need to be checked
            // because we only check 2 trytes at a time, there is sometimes a leftover
            var upperLimit = trytesChunk.length - trytesChunk.length % 2;

            var trytesToCheck = trytesChunk.slice(trytesChecked, upperLimit);

            // We read 2 trytes at a time and check if it equals the closing bracket character
            for (var j = 0; j < trytesToCheck.length; j += 2) {

                var trytePair = trytesToCheck[j] + trytesToCheck[j + 1];

                // If closing bracket char was found, and there are only trailing 9's
                // we quit and remove the 9's from the trytesChunk.
                if ( preliminaryStop && trytePair === '99' ) {

                    notEnded = false;
                    // TODO: Remove the trailing 9's from trytesChunk
                    //var closingBracket = trytesToCheck.indexOf('QD') + 1;

                    //trytesChunk = trytesChunk.slice( 0, ( trytesChunk.length - trytesToCheck.length ) + ( closingBracket % 2 === 0 ? closingBracket : closingBracket + 1 ) );

                    break;
                }

                finalJson += ascii.fromTrytes(trytePair);

                // If tryte pair equals closing bracket char, we set a preliminary stop
                // the preliminaryStop is useful when we have a nested JSON object
                if (trytePair === "QD") {
                    preliminaryStop = true;
                }
            }

            if (!notEnded)
                break;

            trytesChecked += trytesToCheck.length;
        }

        // If we have not reached the end of the message yet, we continue with the next
        // transaction in the bundle
        index += 1;

    }

    // If we did not find any JSON, return null
    if (notEnded) {

        return null;

    } else {

        return finalJson;

    }
}

module.exports = extractJson;


/***/ }),
/* 537 */
/***/ (function(module, exports, __webpack_require__) {

var Converter      =  __webpack_require__(36);
var Curl           =  __webpack_require__(40);
var Kerl           =  __webpack_require__(63);
var Signing        =  __webpack_require__(98);
var Utils          =  __webpack_require__(143);
var inputValidator =  __webpack_require__(99);


/**
*   Initializes a new multisig address
*
*   @method addDigest
*   @param {string|array} digest digest trytes
*   @return {object} address instance
*
**/
function Address(digests) {

  if (!(this instanceof Address)) {
    return new Address(digests);
  }

  // Initialize kerl instance
  this._kerl = new Kerl();
  this._kerl.initialize();


  // Add digests if any
  if (digests) {

    this.absorb(digests);
  }
}

/**
*   Absorbs key digests
*
*   @method absorb
*   @param {string|array} digest digest trytes
*   @return {object} address instance
*
**/
Address.prototype.absorb = function (digest) {

  // Construct array
  var digests = Array.isArray(digest) ? digest : [digest];

  // Add digests
  for (var i = 0; i < digests.length; i++) {

    // Get trits of digest
    var digestTrits = Converter.trits(digests[i]);

    // Absorb digest
    this._kerl.absorb(digestTrits, 0, digestTrits.length);
  }

  return this;
}

/**
*   Finalizes and returns the multisig address in trytes
*
*   @method finalize
*   @param {string} digest digest trytes, optional
*   @return {string} address trytes
*
**/
Address.prototype.finalize = function (digest) {

    // Absorb last digest if provided
    if (digest) {
      this.absorb(digest);
    }

    // Squeeze the address trits
    var addressTrits = [];
    this._kerl.squeeze(addressTrits, 0, Curl.HASH_LENGTH);

    // Convert trits into trytes and return the address
    return Converter.trytes(addressTrits);
}


module.exports = Address;


/***/ }),
/* 538 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var Crypto = __webpack_require__(213);

function trinarySum(a, b) {
  var result = a + b;
  return result == 2 ? -1 : result == -2 ? 1 : result;
}

function increment(subseed, count) {
  var index = count == null || count < 1 ? 1 : count;
  while (index-- > 0) {
    for (var j = 0; j < 243; j++) {
      if (++subseed[j] > 1) {
        subseed[j] = -1;
      } else {
        break;
      }
    }
  }
  return subseed;
}

function hash(rounds) {
  var curl = new Crypto.curl(rounds);
  var key = new Int32Array(243);
  curl.initialize();

  for (var _len = arguments.length, keys = Array(_len > 1 ? _len - 1 : 0), _key = 1; _key < _len; _key++) {
    keys[_key - 1] = arguments[_key];
  }

  keys.map(function (k) {
    return curl.absorb(k, 0, k.length);
  });
  curl.squeeze(key, 0, 243);
  return key;
}

function encrypt(message, key, salt) {
  var curl = new Crypto.curl();
  curl.initialize();
  curl.absorb(Crypto.converter.trits(key), 0, key.length);
  if (salt != null) {
    curl.absorb(Crypto.converter.trits(salt), 0, salt.length);
  }
  var length = message.length * 3;
  var outTrits = new Int32Array(length);
  var intermedaiteKey = new Int32Array(curl.HASH_LENGTH);
  return message.match(/.{1,81}/g).map(function (m) {
    curl.squeeze(intermedaiteKey, 0, curl.HASH_LENGTH);
    var out = Crypto.converter.trytes(Crypto.converter.trits(m).map(function (t, i) {
      return trinarySum(t, intermedaiteKey[i]);
    }));
    return out;
  }).join("");
}

function decrypt(message, key, salt) {
  var curl = new Crypto.curl();
  curl.initialize();
  curl.absorb(Crypto.converter.trits(key), 0, key.length);
  if (salt != null) {
    curl.absorb(Crypto.converter.trits(salt), 0, salt.length);
  }
  var messageTrits = Crypto.converter.trits(message);
  var length = messageTrits.length;
  var plainTrits = new Int32Array(length);
  var intermedaiteKey = new Int32Array(curl.HASH_LENGTH);
  return message.match(/.{1,81}/g).map(function (m) {
    curl.squeeze(intermedaiteKey, 0, curl.HASH_LENGTH);
    var out = Crypto.converter.trytes(Crypto.converter.trits(m).map(function (t, i) {
      return trinarySum(t, -intermedaiteKey[i]);
    }));
    return out;
  }).join("");
}

module.exports = {
  encrypt,
  decrypt,
  increment,
  hash
};

/***/ }),
/* 539 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


const processFn = (fn, opts) => function () {
	const P = opts.promiseModule;
	const args = new Array(arguments.length);

	for (let i = 0; i < arguments.length; i++) {
		args[i] = arguments[i];
	}

	return new P((resolve, reject) => {
		if (opts.errorFirst) {
			args.push(function (err, result) {
				if (opts.multiArgs) {
					const results = new Array(arguments.length - 1);

					for (let i = 1; i < arguments.length; i++) {
						results[i - 1] = arguments[i];
					}

					if (err) {
						results.unshift(err);
						reject(results);
					} else {
						resolve(results);
					}
				} else if (err) {
					reject(err);
				} else {
					resolve(result);
				}
			});
		} else {
			args.push(function (result) {
				if (opts.multiArgs) {
					const results = new Array(arguments.length - 1);

					for (let i = 0; i < arguments.length; i++) {
						results[i] = arguments[i];
					}

					resolve(results);
				} else {
					resolve(result);
				}
			});
		}

		fn.apply(this, args);
	});
};

module.exports = (obj, opts) => {
	opts = Object.assign({
		exclude: [/.+(Sync|Stream)$/],
		errorFirst: true,
		promiseModule: Promise
	}, opts);

	const filter = key => {
		const match = pattern => typeof pattern === 'string' ? key === pattern : pattern.test(key);
		return opts.include ? opts.include.some(match) : !opts.exclude.some(match);
	};

	let ret;
	if (typeof obj === 'function') {
		ret = function () {
			if (opts.excludeMain) {
				return obj.apply(this, arguments);
			}

			return processFn(obj, opts).apply(this, arguments);
		};
	} else {
		ret = Object.create(Object.getPrototypeOf(obj));
	}

	for (const key in obj) { // eslint-disable-line guard-for-in
		const x = obj[key];
		ret[key] = typeof x === 'function' && filter(key) ? processFn(x, opts) : x;
	}

	return ret;
};


/***/ })
/******/ ]);
});